NO773853L - Nye fosforsyreestre avledet fra 1,2,4-triazol med insekticid, nematocid og acaricid virkning, og fremstilling av disse - Google Patents
Nye fosforsyreestre avledet fra 1,2,4-triazol med insekticid, nematocid og acaricid virkning, og fremstilling av disseInfo
- Publication number
- NO773853L NO773853L NO773853A NO773853A NO773853L NO 773853 L NO773853 L NO 773853L NO 773853 A NO773853 A NO 773853A NO 773853 A NO773853 A NO 773853A NO 773853 L NO773853 L NO 773853L
- Authority
- NO
- Norway
- Prior art keywords
- triazol
- alkyl
- phenyl
- triazole
- thione
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 11
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 title claims description 4
- 230000000694 effects Effects 0.000 title description 8
- 150000003014 phosphoric acid esters Chemical class 0.000 title 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 241001061127 Thione Species 0.000 claims description 15
- 229960000583 acetic acid Drugs 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 239000002689 soil Substances 0.000 claims description 12
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 12
- 229920002554 vinyl polymer Polymers 0.000 claims description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 11
- 229910052794 bromium Inorganic materials 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 10
- 241000255925 Diptera Species 0.000 claims description 8
- 238000010992 reflux Methods 0.000 claims description 8
- -1 C^H^ Chemical group 0.000 claims description 7
- 241000255777 Lepidoptera Species 0.000 claims description 7
- 239000012362 glacial acetic acid Substances 0.000 claims description 7
- 238000007363 ring formation reaction Methods 0.000 claims description 7
- 241000238876 Acari Species 0.000 claims description 6
- 241000254173 Coleoptera Species 0.000 claims description 6
- 241000238814 Orthoptera Species 0.000 claims description 6
- 150000003852 triazoles Chemical class 0.000 claims description 6
- 241001124076 Aphididae Species 0.000 claims description 5
- 241000244206 Nematoda Species 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- YYJNOYZRYGDPNH-MFKUBSTISA-N fenpyroximate Chemical compound C=1C=C(C(=O)OC(C)(C)C)C=CC=1CO/N=C/C=1C(C)=NN(C)C=1OC1=CC=CC=C1 YYJNOYZRYGDPNH-MFKUBSTISA-N 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 208000015181 infectious disease Diseases 0.000 claims description 4
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229940067157 phenylhydrazine Drugs 0.000 claims description 4
- 150000007659 semicarbazones Chemical class 0.000 claims description 4
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 239000002798 polar solvent Substances 0.000 claims description 3
- LAJLZSPXJPKRML-UHFFFAOYSA-N 5-acetyl-2-phenyl-1h-1,2,4-triazol-3-one Chemical group N1C(C(=O)C)=NC(=O)N1C1=CC=CC=C1 LAJLZSPXJPKRML-UHFFFAOYSA-N 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 244000045947 parasite Species 0.000 claims description 2
- SGAUPIBMJQWCEK-UHFFFAOYSA-N thionitrosourea Chemical compound NC(=O)NN=S SGAUPIBMJQWCEK-UHFFFAOYSA-N 0.000 claims description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims 2
- 239000003513 alkali Substances 0.000 claims 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl chloride Substances ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims 2
- SIHDPKAXUCHRDH-UHFFFAOYSA-N (sulfanylamino)urea Chemical compound NC(=O)NNS SIHDPKAXUCHRDH-UHFFFAOYSA-N 0.000 claims 1
- LRGRRXLFTKMPFS-UHFFFAOYSA-N 5-ethenyl-2-phenyl-1h-1,2,4-triazol-3-one Chemical compound N1C(C=C)=NC(=O)N1C1=CC=CC=C1 LRGRRXLFTKMPFS-UHFFFAOYSA-N 0.000 claims 1
- NYGIBHYVYFICCQ-UHFFFAOYSA-N C(=O)=C1CC=C(C=C1)NN Chemical compound C(=O)=C1CC=C(C=C1)NN NYGIBHYVYFICCQ-UHFFFAOYSA-N 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 claims 1
- 235000021317 phosphate Nutrition 0.000 claims 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 16
- 239000002904 solvent Substances 0.000 description 12
- 230000004071 biological effect Effects 0.000 description 11
- 239000006185 dispersion Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- AWEPUHGBSHAEKZ-UHFFFAOYSA-N 2-methyl-5-(1,2,2-tribromoethenyl)-1h-1,2,4-triazol-3-one Chemical compound CN1N=C(C(Br)=C(Br)Br)N=C1O AWEPUHGBSHAEKZ-UHFFFAOYSA-N 0.000 description 5
- 239000002917 insecticide Substances 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 230000000749 insecticidal effect Effects 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- DLHGUSPWVYHOPK-UHFFFAOYSA-N 5-(2-chlorocyclohexen-1-yl)-2-methyl-1h-1,2,4-triazol-3-one Chemical compound O=C1N(C)NC(C=2CCCCC=2Cl)=N1 DLHGUSPWVYHOPK-UHFFFAOYSA-N 0.000 description 3
- 241000238421 Arthropoda Species 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 235000013601 eggs Nutrition 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 230000001069 nematicidal effect Effects 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- AMFGTOFWMRQMEM-UHFFFAOYSA-N triazophos Chemical compound N1=C(OP(=S)(OCC)OCC)N=CN1C1=CC=CC=C1 AMFGTOFWMRQMEM-UHFFFAOYSA-N 0.000 description 3
- MDTUWBLTRPRXBX-UHFFFAOYSA-N 1,2,4-triazol-3-one Chemical class O=C1N=CN=N1 MDTUWBLTRPRXBX-UHFFFAOYSA-N 0.000 description 2
- LZTSCEYDCZBRCJ-UHFFFAOYSA-N 1,2-dihydro-1,2,4-triazol-3-one Chemical compound OC=1N=CNN=1 LZTSCEYDCZBRCJ-UHFFFAOYSA-N 0.000 description 2
- XRHGWAGWAHHFLF-UHFFFAOYSA-N Isazofos Chemical compound CCOP(=S)(OCC)OC=1N=C(Cl)N(C(C)C)N=1 XRHGWAGWAHHFLF-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical class OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- FFSJPOPLSWBGQY-UHFFFAOYSA-N triazol-4-one Chemical compound O=C1C=NN=N1 FFSJPOPLSWBGQY-UHFFFAOYSA-N 0.000 description 2
- CALXRFQHLYYMDO-UHFFFAOYSA-N (diethoxy-lambda4-sulfanylidene)-trihydroxy-lambda5-phosphane Chemical compound CCOS(=P(O)(O)O)OCC CALXRFQHLYYMDO-UHFFFAOYSA-N 0.000 description 1
- DOORGKNGFZOACY-UHFFFAOYSA-N 1-amino-1-methylurea Chemical compound CN(N)C(N)=O DOORGKNGFZOACY-UHFFFAOYSA-N 0.000 description 1
- SEPQTYODOKLVSB-UHFFFAOYSA-N 3-methylbut-2-enal Chemical compound CC(C)=CC=O SEPQTYODOKLVSB-UHFFFAOYSA-N 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 235000011299 Brassica oleracea var botrytis Nutrition 0.000 description 1
- 240000003259 Brassica oleracea var. botrytis Species 0.000 description 1
- 241000256059 Culex pipiens Species 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 1
- 241000721714 Macrosiphum euphorbiae Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000243786 Meloidogyne incognita Species 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 241000255969 Pieris brassicae Species 0.000 description 1
- 240000001970 Raphanus sativus var. sativus Species 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 241000256250 Spodoptera littoralis Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- QQDGWFFERFLTLR-UHFFFAOYSA-N dichlorophosphoryl thiohypochlorite Chemical compound ClSP(Cl)(Cl)=O QQDGWFFERFLTLR-UHFFFAOYSA-N 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 101150009274 nhr-1 gene Proteins 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT29420/76A IT1068010B (it) | 1976-11-17 | 1976-11-17 | Nuovi esteri fosforici derivati dall' 1-2-4 triazolo ad azione insetticida,nematocida e acaricida e loro preparazione |
| IT2085577A IT1113760B (it) | 1977-03-03 | 1977-03-03 | Nuovi esteri fosforici derivati dall'1, 2, 4-triazolo ad azione insetticida,nematocida e acaricida,e loro preparazione |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO773853L true NO773853L (no) | 1978-05-19 |
Family
ID=26327687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO773853A NO773853L (no) | 1976-11-17 | 1977-11-11 | Nye fosforsyreestre avledet fra 1,2,4-triazol med insekticid, nematocid og acaricid virkning, og fremstilling av disse |
Country Status (25)
| Country | Link |
|---|---|
| US (2) | US4220789A (OSRAM) |
| JP (1) | JPS5363380A (OSRAM) |
| AR (1) | AR224612A1 (OSRAM) |
| AU (1) | AU516865B2 (OSRAM) |
| BR (1) | BR7707633A (OSRAM) |
| CA (1) | CA1095058A (OSRAM) |
| CH (1) | CH640541A5 (OSRAM) |
| DD (2) | DD135030A5 (OSRAM) |
| DE (1) | DE2750813A1 (OSRAM) |
| DK (1) | DK501077A (OSRAM) |
| EG (1) | EG12811A (OSRAM) |
| ES (1) | ES464206A1 (OSRAM) |
| FR (2) | FR2379543A1 (OSRAM) |
| GB (1) | GB1576964A (OSRAM) |
| GR (1) | GR71997B (OSRAM) |
| IL (1) | IL53390A (OSRAM) |
| IN (1) | IN148991B (OSRAM) |
| KE (1) | KE3138A (OSRAM) |
| LU (1) | LU78528A1 (OSRAM) |
| NL (1) | NL7712430A (OSRAM) |
| NO (1) | NO773853L (OSRAM) |
| OA (1) | OA05803A (OSRAM) |
| PT (1) | PT67279B (OSRAM) |
| RO (1) | RO75961A (OSRAM) |
| SU (1) | SU795485A3 (OSRAM) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NO773853L (no) * | 1976-11-17 | 1978-05-19 | Montedison Spa | Nye fosforsyreestre avledet fra 1,2,4-triazol med insekticid, nematocid og acaricid virkning, og fremstilling av disse |
| DE3931303A1 (de) * | 1989-09-20 | 1991-03-28 | Desowag Materialschutz Gmbh | Verfahren zum vorbeugenden materialschutz gegenueber staendig und/oder temporaer im boden lebenden schaedlingen, insbesondere termiten |
| JPH06279421A (ja) * | 1993-03-24 | 1994-10-04 | Nippon Paint Co Ltd | 新規なトリアゾール化合物、その中間体およびその合成法 |
| US5728834A (en) * | 1996-11-14 | 1998-03-17 | Wyckoff Chemical Company, Inc. | Process for preparation of 4-aryl-1,2,4-triazol-3-ones |
| DE19823131A1 (de) * | 1998-05-23 | 1999-11-25 | Bayer Ag | Sulfonylamino(thio)carbonyltriazolin(thi)one mit Alkenyl-Substituenten |
| US6492527B1 (en) | 1999-10-13 | 2002-12-10 | Fmc Corporation | Process to prepare aryltriazolinones and novel intermediates thereto |
| PL375889A1 (en) | 2002-10-11 | 2005-12-12 | Cytokinetics, Inc. | Compounds for treating cellular proliferative diseases, compositions containing them and their application |
| CN101643451B (zh) * | 2008-08-07 | 2013-03-06 | 浙江海正药业股份有限公司 | 过氧化物酶增殖物激活受体亚型δ类激动剂化合物及其制备方法 |
| CA2742317A1 (en) * | 2008-11-06 | 2010-05-14 | Schering Corporation | Gamma secretase modulators |
| CN106543139B (zh) * | 2015-09-17 | 2020-03-17 | 沈阳中化农药化工研发有限公司 | 一种三唑酮类化合物及其用途 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE805763C (de) * | 1949-02-10 | 1951-05-28 | Dr Heinz Gehlen | Verfahren zur Darstellung von am C-Atom substituierten 1,2,4-Triazolonen-(3) |
| BE637016A (OSRAM) * | 1951-04-20 | 1900-01-01 | ||
| DE1235930B (de) * | 1963-10-15 | 1967-03-09 | Acraf | Verfahren zur Herstellung von als Heilmittel geeignetem 1-Phenyl-3-butyl-4-methyl-triazolon-(5) |
| CH523017A (de) * | 1969-11-21 | 1972-05-31 | Agripat Sa | Schädlingsbekämpfungsmittel |
| DE2150169A1 (de) * | 1970-10-22 | 1972-04-27 | Agripat Sa | Neue Ester |
| BE792452A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Esters triazolyliques d'acides du phosphore et produits pesticides qui en renferment |
| BE792450A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Composes organophosphores et produits pesticides qui en contiennent |
| IT998314B (it) | 1973-08-02 | 1976-01-20 | Montedison Spa | Alfa alchil mercapto alfa sostitui te formilidene fenil idrazine attive per via interna contro le malattie fungine delle piante |
| NO773853L (no) * | 1976-11-17 | 1978-05-19 | Montedison Spa | Nye fosforsyreestre avledet fra 1,2,4-triazol med insekticid, nematocid og acaricid virkning, og fremstilling av disse |
-
1977
- 1977-11-11 NO NO773853A patent/NO773853L/no unknown
- 1977-11-11 NL NL7712430A patent/NL7712430A/xx not_active Application Discontinuation
- 1977-11-11 DK DK501077A patent/DK501077A/da unknown
- 1977-11-14 US US05/851,202 patent/US4220789A/en not_active Expired - Lifetime
- 1977-11-14 RO RO7792111A patent/RO75961A/ro unknown
- 1977-11-14 DE DE19772750813 patent/DE2750813A1/de not_active Ceased
- 1977-11-14 GR GR54788A patent/GR71997B/el unknown
- 1977-11-14 EG EG638/77A patent/EG12811A/xx active
- 1977-11-14 AR AR269963A patent/AR224612A1/es active
- 1977-11-15 IL IL53390A patent/IL53390A/xx unknown
- 1977-11-15 PT PT67279A patent/PT67279B/pt unknown
- 1977-11-15 AU AU30664/77A patent/AU516865B2/en not_active Expired
- 1977-11-15 DD DD77204435A patent/DD135030A5/xx unknown
- 1977-11-15 DD DD7700202092A patent/DD132664A5/xx unknown
- 1977-11-16 FR FR7734447A patent/FR2379543A1/fr active Granted
- 1977-11-16 LU LU78528A patent/LU78528A1/xx unknown
- 1977-11-16 ES ES464206A patent/ES464206A1/es not_active Expired
- 1977-11-16 BR BR7707633A patent/BR7707633A/pt unknown
- 1977-11-16 SU SU772541750A patent/SU795485A3/ru active
- 1977-11-16 CA CA291,003A patent/CA1095058A/en not_active Expired
- 1977-11-16 JP JP13677977A patent/JPS5363380A/ja active Granted
- 1977-11-17 CH CH1408677A patent/CH640541A5/de not_active IP Right Cessation
- 1977-11-17 OA OA56317A patent/OA05803A/xx unknown
- 1977-11-17 GB GB47948/77A patent/GB1576964A/en not_active Expired
-
1978
- 1978-04-14 FR FR7811029A patent/FR2379527A1/fr active Granted
-
1979
- 1979-01-03 IN IN07/CAL/79A patent/IN148991B/en unknown
-
1980
- 1980-01-29 US US06/116,547 patent/US4400517A/en not_active Expired - Lifetime
-
1981
- 1981-06-29 KE KE3138A patent/KE3138A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL53390A0 (en) | 1978-01-31 |
| US4220789A (en) | 1980-09-02 |
| ES464206A1 (es) | 1978-07-16 |
| LU78528A1 (OSRAM) | 1978-07-14 |
| FR2379527A1 (fr) | 1978-09-01 |
| EG12811A (en) | 1979-12-31 |
| DD135030A5 (de) | 1979-04-11 |
| GB1576964A (en) | 1980-10-15 |
| FR2379543A1 (fr) | 1978-09-01 |
| DD132664A5 (de) | 1978-10-18 |
| AU516865B2 (en) | 1981-06-25 |
| BR7707633A (pt) | 1978-06-13 |
| SU795485A3 (ru) | 1981-01-07 |
| FR2379527B1 (OSRAM) | 1982-07-30 |
| AU3066477A (en) | 1979-05-24 |
| NL7712430A (nl) | 1978-05-19 |
| JPS5363380A (en) | 1978-06-06 |
| AR224612A1 (es) | 1981-12-30 |
| KE3138A (en) | 1981-07-24 |
| US4400517A (en) | 1983-08-23 |
| IN148991B (OSRAM) | 1981-08-08 |
| DK501077A (da) | 1978-05-18 |
| RO75961A (ro) | 1981-03-30 |
| GR71997B (OSRAM) | 1983-08-26 |
| FR2379543B1 (OSRAM) | 1982-03-05 |
| IL53390A (en) | 1982-03-31 |
| PT67279B (en) | 1979-04-19 |
| JPH0134996B2 (OSRAM) | 1989-07-21 |
| PT67279A (en) | 1977-12-01 |
| CH640541A5 (de) | 1984-01-13 |
| DE2750813A1 (de) | 1978-05-18 |
| CA1095058A (en) | 1981-02-03 |
| OA05803A (fr) | 1981-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2037488C1 (ru) | Производные 3-циано-5-алкокси-1-арилпиразолов и композиция на их основе | |
| HU186742B (en) | Herbicide composition and process for preparing the active substance of the composition | |
| US4220789A (en) | Phosphoric esters derived from 1,2,4-triazole having an insecticidal, nematocidal and acaricidal action, and their preparation | |
| US4256902A (en) | Process for the preparation of 3-chloro-5-hydroxypyrazoles | |
| CA1076585A (en) | Phosphoric acid derivatives | |
| US4075003A (en) | Novel herbicidal method utilizing 1,4-diphenyl-3-pyrazolin-5-ones | |
| KR800001183B1 (ko) | 1,2,4-트리아졸 인산에스테르의 제조법 | |
| CA1106387A (en) | 1,2,4-triazole intermediate derivatives | |
| US3948935A (en) | Pyrazoline derivatives | |
| US3856948A (en) | Insecticidal phosphoric acid esters | |
| US4209512A (en) | Mono- and di-thiophosphate esters containing an isoxazolinone ring and compositions and methods containing the same | |
| US3161651A (en) | Polyfunctional aliphatic-bis-(upsilon-triazole) compounds | |
| JPS6169767A (ja) | 1,2,4−トリアゾ−ル誘導体及びその製造法 | |
| US3743728A (en) | Insecticidal active composition and process for manufacturing the same | |
| IL24261A (en) | Pesticides containing phenazine compounds and new phenazine compounds | |
| US3847936A (en) | O,o-dialkyl-o-(1,2-diazolidin-ones-5-yl-3)-thionophosphates | |
| US2944080A (en) | Pentachlorobenzenesulfenyl halides | |
| US3220922A (en) | Amino-triazol derivatives | |
| WO1994022853A1 (en) | Herbicidal 1-heteroaryl pyrazolidin-3,5-diones | |
| CA1225650A (en) | Insecticidal carbamates | |
| US3471436A (en) | S,s-dialkyl-n-(p-(substituted)-phenylsulfonyl)-sulfilimines | |
| US3964894A (en) | Method of controlling plant growth | |
| US4359431A (en) | Preparation of arylphosphinic acids | |
| US3719686A (en) | Thiophosphate derivatives of triazoline thiones | |
| KR820000939B1 (ko) | 살충제 5(3)-하이드록시피라졸의 인산 및 티오인산에스테르, 그 중간체 5(3)-하이드록시피라졸 및 그 제조방법. |