NO773377L - Fremgangsmaate ved fremstilling av 1-(n-acyl-carbamoyl)-2-cyanaziridiner - Google Patents
Fremgangsmaate ved fremstilling av 1-(n-acyl-carbamoyl)-2-cyanaziridinerInfo
- Publication number
- NO773377L NO773377L NO773377A NO773377A NO773377L NO 773377 L NO773377 L NO 773377L NO 773377 A NO773377 A NO 773377A NO 773377 A NO773377 A NO 773377A NO 773377 L NO773377 L NO 773377L
- Authority
- NO
- Norway
- Prior art keywords
- group
- cyanaziridine
- carbamoyl
- phenyl
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 9
- PGZUFTROELAOMP-UHFFFAOYSA-N aziridine-2-carbonitrile Chemical compound N#CC1CN1 PGZUFTROELAOMP-UHFFFAOYSA-N 0.000 claims description 51
- -1 nitro, phenyl Chemical group 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 27
- 125000003545 alkoxy group Chemical group 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 19
- 150000002367 halogens Chemical class 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 125000004423 acyloxy group Chemical group 0.000 claims description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 12
- 125000004414 alkyl thio group Chemical group 0.000 claims description 12
- 239000012948 isocyanate Substances 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 12
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 11
- 150000002825 nitriles Chemical class 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 229920006395 saturated elastomer Polymers 0.000 claims description 10
- 150000002513 isocyanates Chemical class 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000005442 diisocyanate group Chemical group 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000004417 unsaturated alkyl group Chemical group 0.000 claims description 5
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 230000003213 activating effect Effects 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000001540 azides Chemical class 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000002540 isothiocyanates Chemical class 0.000 claims description 3
- RMSRKYVNQYEPHO-UHFFFAOYSA-N 2-cyanoaziridine-1-carboxamide Chemical compound NC(=O)N1CC1C#N RMSRKYVNQYEPHO-UHFFFAOYSA-N 0.000 claims description 2
- 150000007945 N-acyl ureas Chemical class 0.000 claims description 2
- 239000005864 Sulphur Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 276
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 168
- 239000000243 solution Substances 0.000 description 79
- 238000003756 stirring Methods 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 36
- 239000013078 crystal Substances 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 25
- 239000000126 substance Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 238000010992 reflux Methods 0.000 description 19
- 238000001704 evaporation Methods 0.000 description 18
- 230000008020 evaporation Effects 0.000 description 18
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 235000011121 sodium hydroxide Nutrition 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 239000000463 material Substances 0.000 description 9
- 238000001035 drying Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- DOQQTKLDEQSKIE-UHFFFAOYSA-N silver;isocyanate Chemical compound [Ag+].[N-]=C=O DOQQTKLDEQSKIE-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000001665 trituration Methods 0.000 description 4
- MOVMEFHWBOWMFU-UHFFFAOYSA-N 2-chloroacetyl isocyanate Chemical compound ClCC(=O)N=C=O MOVMEFHWBOWMFU-UHFFFAOYSA-N 0.000 description 3
- QCYHQUHXTLQUIR-UHFFFAOYSA-N 2-cyclohexylacetyl isocyanate Chemical compound O=C=NC(=O)CC1CCCCC1 QCYHQUHXTLQUIR-UHFFFAOYSA-N 0.000 description 3
- GMYKYCKUEYTTFJ-UHFFFAOYSA-N 3-methylaziridine-2-carbonitrile Chemical compound CC1NC1C#N GMYKYCKUEYTTFJ-UHFFFAOYSA-N 0.000 description 3
- PBNPTRKEHUFRPP-UHFFFAOYSA-N 3-phenylaziridine-2-carbonitrile Chemical compound N#CC1NC1C1=CC=CC=C1 PBNPTRKEHUFRPP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 230000003327 cancerostatic effect Effects 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- ZTOWOZMLBGSQIC-UHFFFAOYSA-N ethyl 3-isocyanato-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)N=C=O ZTOWOZMLBGSQIC-UHFFFAOYSA-N 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000003308 immunostimulating effect Effects 0.000 description 3
- XGOOMNFRIHJVFD-UHFFFAOYSA-N naphthalene-2-carbonyl isocyanate Chemical compound C1=CC=CC2=CC(C(=O)N=C=O)=CC=C21 XGOOMNFRIHJVFD-UHFFFAOYSA-N 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 229910052717 sulfur Chemical group 0.000 description 3
- AGXGGAVHNIUTIJ-UHFFFAOYSA-N thiophene-2-carbonyl isocyanate Chemical compound O=C=NC(=O)C1=CC=CS1 AGXGGAVHNIUTIJ-UHFFFAOYSA-N 0.000 description 3
- LPMQRYZFOLOHKQ-UHFFFAOYSA-N 1,3-benzodioxole-5-carbonyl isocyanate Chemical compound O=C=NC(=O)C1=CC=C2OCOC2=C1 LPMQRYZFOLOHKQ-UHFFFAOYSA-N 0.000 description 2
- HUSYTLMIRXITQS-UHFFFAOYSA-N 1,3-benzodioxole-5-carboxamide Chemical compound NC(=O)C1=CC=C2OCOC2=C1 HUSYTLMIRXITQS-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DHEMGZOEQNZYAG-UHFFFAOYSA-N 1-benzofuran-2-carbonyl isocyanate Chemical compound C1=CC=C2OC(C(=O)N=C=O)=CC2=C1 DHEMGZOEQNZYAG-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- VMZUEXQQVAOMAG-UHFFFAOYSA-N 2-(4-chlorophenoxy)acetyl isocyanate Chemical compound ClC1=CC=C(OCC(=O)N=C=O)C=C1 VMZUEXQQVAOMAG-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- MJYZITPAOSTIQH-UHFFFAOYSA-N 2-cyano-n-(2,2,2-trichloroacetyl)aziridine-1-carboxamide Chemical compound ClC(Cl)(Cl)C(=O)NC(=O)N1CC1C#N MJYZITPAOSTIQH-UHFFFAOYSA-N 0.000 description 2
- PMWSCDAWUNWAJP-UHFFFAOYSA-N 2-cyano-n-(2,2-dimethylpropanoyl)aziridine-1-carboxamide Chemical compound CC(C)(C)C(=O)NC(=O)N1CC1C#N PMWSCDAWUNWAJP-UHFFFAOYSA-N 0.000 description 2
- FZRXBDHZYZWNBS-UHFFFAOYSA-N 2-cyano-n-(3-nitrobenzoyl)aziridine-1-carboxamide Chemical compound [O-][N+](=O)C1=CC=CC(C(=O)NC(=O)N2C(C2)C#N)=C1 FZRXBDHZYZWNBS-UHFFFAOYSA-N 0.000 description 2
- OVKBHAGVUDGKKU-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalene-2-carbonyl isocyanate Chemical compound C1CCCC2=CC(C(=O)N=C=O)=CC=C21 OVKBHAGVUDGKKU-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 208000036142 Viral infection Diseases 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- IQGASUKCXDUJJS-UHFFFAOYSA-N ethyl 2-[(2-cyanoaziridine-1-carbonyl)amino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC(=O)N1CC1C#N IQGASUKCXDUJJS-UHFFFAOYSA-N 0.000 description 2
- HOXLPLIHJQEFQK-UHFFFAOYSA-N ethyl 4-carbonisocyanatidoylbenzoate Chemical compound CCOC(=O)C1=CC=C(C(=O)N=C=O)C=C1 HOXLPLIHJQEFQK-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- OYSWHVQIPJTJJV-UHFFFAOYSA-N hexanoyl isocyanate Chemical compound CCCCCC(=O)N=C=O OYSWHVQIPJTJJV-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- POKQMBNRTSOEMR-UHFFFAOYSA-N n-benzoyl-2-cyanoaziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)C1=CC=CC=C1 POKQMBNRTSOEMR-UHFFFAOYSA-N 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- DENPQNAWGQXKCU-UHFFFAOYSA-N thiophene-2-carboxamide Chemical compound NC(=O)C1=CC=CS1 DENPQNAWGQXKCU-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- FPNXJWMDPZGLHE-UHFFFAOYSA-N (2-isocyanato-2-oxoethyl) acetate Chemical compound CC(=O)OCC(=O)N=C=O FPNXJWMDPZGLHE-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- VFKOCHDKHMXUOE-UHFFFAOYSA-N (4-carbonisocyanatidoylphenyl) acetate Chemical compound CC(=O)OC1=CC=C(C(=O)N=C=O)C=C1 VFKOCHDKHMXUOE-UHFFFAOYSA-N 0.000 description 1
- QHKJIJXBJCOABP-UHFFFAOYSA-N 1-benzofuran-2-carboxamide Chemical compound C1=CC=C2OC(C(=O)N)=CC2=C1 QHKJIJXBJCOABP-UHFFFAOYSA-N 0.000 description 1
- KLAQNTBUXCCZHC-UHFFFAOYSA-N 1-methyl-3-nitropyrazole Chemical compound CN1C=CC([N+]([O-])=O)=N1 KLAQNTBUXCCZHC-UHFFFAOYSA-N 0.000 description 1
- QJZRMSWDJMEIQO-UHFFFAOYSA-N 1-methyl-3-nitropyrazole-4-carbonyl isocyanate Chemical compound CN1C=C(C(=O)N=C=O)C([N+]([O-])=O)=N1 QJZRMSWDJMEIQO-UHFFFAOYSA-N 0.000 description 1
- ZIDNELAAGGUUFP-UHFFFAOYSA-N 1-methyl-3-nitropyrazole-4-carboxamide Chemical compound CN1C=C(C(N)=O)C([N+]([O-])=O)=N1 ZIDNELAAGGUUFP-UHFFFAOYSA-N 0.000 description 1
- GRNOZCCBOFGDCL-UHFFFAOYSA-N 2,2,2-trichloroacetyl isocyanate Chemical compound ClC(Cl)(Cl)C(=O)N=C=O GRNOZCCBOFGDCL-UHFFFAOYSA-N 0.000 description 1
- TVPVPCIFAVVLAU-UHFFFAOYSA-N 2,2-dichloroacetyl isocyanate Chemical compound ClC(Cl)C(=O)N=C=O TVPVPCIFAVVLAU-UHFFFAOYSA-N 0.000 description 1
- NTTLMKNUXSSXOM-UHFFFAOYSA-N 2,2-diphenylacetyl isocyanate Chemical compound C=1C=CC=CC=1C(C(=O)N=C=O)C1=CC=CC=C1 NTTLMKNUXSSXOM-UHFFFAOYSA-N 0.000 description 1
- LBRFOFQHSRWMEB-UHFFFAOYSA-N 2,3-dibromo-3-phenylpropanenitrile Chemical compound N#CC(Br)C(Br)C1=CC=CC=C1 LBRFOFQHSRWMEB-UHFFFAOYSA-N 0.000 description 1
- ARRIEYYNOLTVTE-UHFFFAOYSA-N 2,3-dibromopropanenitrile Chemical compound BrCC(Br)C#N ARRIEYYNOLTVTE-UHFFFAOYSA-N 0.000 description 1
- LVNVLQIXMBTMPH-UHFFFAOYSA-N 2,3-dichlorothiophene Chemical compound ClC=1C=CSC=1Cl LVNVLQIXMBTMPH-UHFFFAOYSA-N 0.000 description 1
- RHLHDNNWVXMDAF-UHFFFAOYSA-N 2-(4-chlorophenoxy)acetamide Chemical compound NC(=O)COC1=CC=C(Cl)C=C1 RHLHDNNWVXMDAF-UHFFFAOYSA-N 0.000 description 1
- OKDGRDCXVWSXDC-UHFFFAOYSA-N 2-chloropyridine Chemical compound ClC1=CC=CC=N1 OKDGRDCXVWSXDC-UHFFFAOYSA-N 0.000 description 1
- WYRVGLXBUYQKNY-UHFFFAOYSA-N 2-cyano-1-dimethoxyphosphorylaziridine-2-carboxamide Chemical compound COP(=O)(OC)N1CC1(C#N)C(N)=O WYRVGLXBUYQKNY-UHFFFAOYSA-N 0.000 description 1
- XYPAMQNDNCMEAY-UHFFFAOYSA-N 2-cyano-n-(2,2,2-trifluoroacetyl)aziridine-1-carboxamide Chemical compound FC(F)(F)C(=O)NC(=O)N1CC1C#N XYPAMQNDNCMEAY-UHFFFAOYSA-N 0.000 description 1
- OQWRGZAEYVLUAX-UHFFFAOYSA-N 2-cyano-n-(2,2-dichloroacetyl)aziridine-1-carboxamide Chemical compound ClC(Cl)C(=O)NC(=O)N1CC1C#N OQWRGZAEYVLUAX-UHFFFAOYSA-N 0.000 description 1
- SUEGYGBKRVDFLN-UHFFFAOYSA-N 2-cyano-n-(2,2-diphenylacetyl)aziridine-1-carboxamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)C(=O)NC(=O)N1CC1C#N SUEGYGBKRVDFLN-UHFFFAOYSA-N 0.000 description 1
- JKJFMTSGGHKAEG-UHFFFAOYSA-N 2-cyano-n-(2-cyclohexylacetyl)aziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)CC1CCCCC1 JKJFMTSGGHKAEG-UHFFFAOYSA-N 0.000 description 1
- CPDYLBXWGMJKNG-UHFFFAOYSA-N 2-cyano-n-(2-methylbenzenecarbothioyl)aziridine-1-carboxamide Chemical compound CC1=CC=CC=C1C(=S)NC(=O)N1C(C#N)C1 CPDYLBXWGMJKNG-UHFFFAOYSA-N 0.000 description 1
- HWDFZHKWUBYXMM-UHFFFAOYSA-N 2-cyano-n-(2-methylphenyl)sulfonylaziridine-1-carboxamide Chemical compound CC1=CC=CC=C1S(=O)(=O)NC(=O)N1C(C#N)C1 HWDFZHKWUBYXMM-UHFFFAOYSA-N 0.000 description 1
- OQVNBUCORCREJG-UHFFFAOYSA-N 2-cyano-n-(2-phenoxyacetyl)aziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)COC1=CC=CC=C1 OQVNBUCORCREJG-UHFFFAOYSA-N 0.000 description 1
- PUGLBHSJSPHGLM-UHFFFAOYSA-N 2-cyano-n-(2-phenylacetyl)aziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)CC1=CC=CC=C1 PUGLBHSJSPHGLM-UHFFFAOYSA-N 0.000 description 1
- AROHLLPOCFNLCX-UHFFFAOYSA-N 2-cyano-n-(2-thiophen-2-ylacetyl)aziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)CC1=CC=CS1 AROHLLPOCFNLCX-UHFFFAOYSA-N 0.000 description 1
- CGUUPBDBLVJNAI-UHFFFAOYSA-N 2-cyano-n-(4-fluorobenzoyl)aziridine-1-carboxamide Chemical compound C1=CC(F)=CC=C1C(=O)NC(=O)N1C(C#N)C1 CGUUPBDBLVJNAI-UHFFFAOYSA-N 0.000 description 1
- RGHFMIVDZNMCFY-UHFFFAOYSA-N 2-cyano-n-(4-methylbenzoyl)aziridine-1-carboxamide Chemical compound C1=CC(C)=CC=C1C(=O)NC(=O)N1C(C#N)C1 RGHFMIVDZNMCFY-UHFFFAOYSA-N 0.000 description 1
- TTZCGORZBPFAHL-UHFFFAOYSA-N 2-cyano-n-(4-methylphenyl)sulfonylaziridine-1-carboxamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)N1C(C#N)C1 TTZCGORZBPFAHL-UHFFFAOYSA-N 0.000 description 1
- YXNLPASXAJMFTL-UHFFFAOYSA-N 2-cyano-n-(4-nitrothiophen-2-yl)sulfonylaziridine-1-carboxamide Chemical compound [O-][N+](=O)C1=CSC(S(=O)(=O)NC(=O)N2C(C2)C#N)=C1 YXNLPASXAJMFTL-UHFFFAOYSA-N 0.000 description 1
- RADPSGKUXCEIAN-UHFFFAOYSA-N 2-cyano-n-(cyclohexanecarbonyl)aziridine-1-carboxamide Chemical compound C1CCCCC1C(=O)NC(=O)N1CC1C#N RADPSGKUXCEIAN-UHFFFAOYSA-N 0.000 description 1
- JGQKLWBOKCYNPF-UHFFFAOYSA-N 2-cyano-n-(cyclopropanecarbonyl)aziridine-1-carboxamide Chemical compound C1CC1C(=O)NC(=O)N1CC1C#N JGQKLWBOKCYNPF-UHFFFAOYSA-N 0.000 description 1
- LZXDLMDMLOQZNA-UHFFFAOYSA-N 2-cyano-n-(thiophene-2-carbonyl)aziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)C1=CC=CS1 LZXDLMDMLOQZNA-UHFFFAOYSA-N 0.000 description 1
- DGQUSKKKFWZBFP-UHFFFAOYSA-N 2-cyano-n-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]aziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)CN1C(=O)CCC1=O DGQUSKKKFWZBFP-UHFFFAOYSA-N 0.000 description 1
- XVPVRIQCIQJYFE-UHFFFAOYSA-N 2-cyano-n-[methyl(phenyl)carbamoyl]aziridine-1-carboxamide Chemical compound C=1C=CC=CC=1N(C)C(=O)NC(=O)N1CC1C#N XVPVRIQCIQJYFE-UHFFFAOYSA-N 0.000 description 1
- NTPXPDNMBGWODE-UHFFFAOYSA-N 2-cyano-n-dodecanoylaziridine-1-carboxamide Chemical compound CCCCCCCCCCCC(=O)NC(=O)N1CC1C#N NTPXPDNMBGWODE-UHFFFAOYSA-N 0.000 description 1
- JNZCYBBWLAKSOU-UHFFFAOYSA-N 2-cyano-n-ethylsulfonylaziridine-1-carboxamide Chemical compound CCS(=O)(=O)NC(=O)N1CC1C#N JNZCYBBWLAKSOU-UHFFFAOYSA-N 0.000 description 1
- AUYPFRZUVAROCM-UHFFFAOYSA-N 2-cyano-n-formylaziridine-1-carboxamide Chemical compound O=CNC(=O)N1CC1C#N AUYPFRZUVAROCM-UHFFFAOYSA-N 0.000 description 1
- NQZSIYQSGRVFSY-UHFFFAOYSA-N 2-cyano-n-methylsulfonylaziridine-1-carboxamide Chemical compound CS(=O)(=O)NC(=O)N1CC1C#N NQZSIYQSGRVFSY-UHFFFAOYSA-N 0.000 description 1
- FDTXRXQFEMLBIK-UHFFFAOYSA-N 2-cyano-n-prop-2-enoylaziridine-1-carboxamide Chemical compound C=CC(=O)NC(=O)N1CC1C#N FDTXRXQFEMLBIK-UHFFFAOYSA-N 0.000 description 1
- DKLQJNUJPSHYQG-UHFFFAOYSA-N 2-cyclohexylacetamide Chemical compound NC(=O)CC1CCCCC1 DKLQJNUJPSHYQG-UHFFFAOYSA-N 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- BXEUCJURXLKEOH-UHFFFAOYSA-N 2-methoxyacetyl isocyanate Chemical compound COCC(=O)N=C=O BXEUCJURXLKEOH-UHFFFAOYSA-N 0.000 description 1
- VZWOXDYRBDIHMA-UHFFFAOYSA-N 2-methyl-1,3-thiazole Chemical compound CC1=NC=CS1 VZWOXDYRBDIHMA-UHFFFAOYSA-N 0.000 description 1
- DTIIRMWDYPYNGD-UHFFFAOYSA-N 2-methylbenzenecarbothioyl isocyanate Chemical compound CC1=CC=CC=C1C(=S)N=C=O DTIIRMWDYPYNGD-UHFFFAOYSA-N 0.000 description 1
- IHRLIAGXUDMAGX-UHFFFAOYSA-N 2-methylsulfonylbenzoyl isocyanate Chemical compound CS(=O)(=O)C1=CC=CC=C1C(=O)N=C=O IHRLIAGXUDMAGX-UHFFFAOYSA-N 0.000 description 1
- QGRTYKCENIQLFG-UHFFFAOYSA-N 2-methylsulfonylfuran Chemical compound CS(=O)(=O)C1=CC=CO1 QGRTYKCENIQLFG-UHFFFAOYSA-N 0.000 description 1
- FUBFWTUFPGFHOJ-UHFFFAOYSA-N 2-nitrofuran Chemical compound [O-][N+](=O)C1=CC=CO1 FUBFWTUFPGFHOJ-UHFFFAOYSA-N 0.000 description 1
- SUPAAWQDMBKXGN-UHFFFAOYSA-N 2-phenoxyacetyl isocyanate Chemical compound O=C=NC(=O)COC1=CC=CC=C1 SUPAAWQDMBKXGN-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- SMTUNIMBRXGDKX-UHFFFAOYSA-N 2-phenylacetyl isocyanate Chemical compound O=C=NC(=O)CC1=CC=CC=C1 SMTUNIMBRXGDKX-UHFFFAOYSA-N 0.000 description 1
- ZRJPWJRRRNJDHF-UHFFFAOYSA-N 3-(trifluoromethyl)benzoyl isocyanate Chemical compound FC(F)(F)C1=CC=CC(C(=O)N=C=O)=C1 ZRJPWJRRRNJDHF-UHFFFAOYSA-N 0.000 description 1
- MXMJHNGIWGMNIG-UHFFFAOYSA-N 3-methylsulfanylpyridazine Chemical compound CSC1=CC=CN=N1 MXMJHNGIWGMNIG-UHFFFAOYSA-N 0.000 description 1
- SIPCFXFCVTUAID-UHFFFAOYSA-N 3-nitrothiophene Chemical compound [O-][N+](=O)C=1C=CSC=1 SIPCFXFCVTUAID-UHFFFAOYSA-N 0.000 description 1
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 1
- JGHDVROWMPBQSR-UHFFFAOYSA-N 4-chloro-n-(oxomethylidene)benzenesulfonamide Chemical compound ClC1=CC=C(S(=O)(=O)N=C=O)C=C1 JGHDVROWMPBQSR-UHFFFAOYSA-N 0.000 description 1
- ADFVYWCDAKWKPH-UHFFFAOYSA-N 4-ethoxycarbonylbenzoic acid Chemical compound CCOC(=O)C1=CC=C(C(O)=O)C=C1 ADFVYWCDAKWKPH-UHFFFAOYSA-N 0.000 description 1
- DBCORYGNTYHQBR-UHFFFAOYSA-N 4-fluorobenzoyl isocyanate Chemical compound FC1=CC=C(C(=O)N=C=O)C=C1 DBCORYGNTYHQBR-UHFFFAOYSA-N 0.000 description 1
- RGVBEISMHCYSNF-UHFFFAOYSA-N 4-methoxy-n-(oxomethylidene)benzenesulfonamide Chemical compound COC1=CC=C(S(=O)(=O)N=C=O)C=C1 RGVBEISMHCYSNF-UHFFFAOYSA-N 0.000 description 1
- RSWXAGBBPCRION-UHFFFAOYSA-N 5,6,7,8-tetrahydro-2-naphthoic acid Chemical compound C1CCCC2=CC(C(=O)O)=CC=C21 RSWXAGBBPCRION-UHFFFAOYSA-N 0.000 description 1
- QMYMOARPAJVXDF-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalene-2-carboxamide Chemical compound C1CCCC2=CC(C(=O)N)=CC=C21 QMYMOARPAJVXDF-UHFFFAOYSA-N 0.000 description 1
- JRKCFBWRBYRACV-UHFFFAOYSA-N 5-cyano-n-(2-cyanoaziridine-1-carbonyl)pyridine-3-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)C1=CN=CC(C#N)=C1 JRKCFBWRBYRACV-UHFFFAOYSA-N 0.000 description 1
- 206010000060 Abdominal distension Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- QENGPZGAWFQWCZ-UHFFFAOYSA-N Methylthiophene Natural products CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- SETHSKIRVBKZTB-UHFFFAOYSA-N NC([O])=O Chemical compound NC([O])=O SETHSKIRVBKZTB-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 208000010362 Protozoan Infections Diseases 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- LUJPTEXNONBQCZ-UHFFFAOYSA-N [2-[(2-cyanoaziridine-1-carbonyl)amino]-2-oxoethyl] acetate Chemical compound CC(=O)OCC(=O)NC(=O)N1CC1C#N LUJPTEXNONBQCZ-UHFFFAOYSA-N 0.000 description 1
- SYGAXMKJEFLEPY-UHFFFAOYSA-N [2-[(2-cyanoaziridine-1-carbonyl)amino]-2-oxoethyl] n,n-diethylcarbamate Chemical compound CCN(CC)C(=O)OCC(=O)NC(=O)N1CC1C#N SYGAXMKJEFLEPY-UHFFFAOYSA-N 0.000 description 1
- SEZWJRWTCIPRSV-UHFFFAOYSA-N [N]C(N)=O Chemical group [N]C(N)=O SEZWJRWTCIPRSV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- OCKPROYBCPQWJO-UHFFFAOYSA-N acetyl isocyanate Chemical compound CC(=O)N=C=O OCKPROYBCPQWJO-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 208000024330 bloating Diseases 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- ZISMXCUJCSPKPF-UHFFFAOYSA-N butyl n-(oxomethylidene)carbamate Chemical compound CCCCOC(=O)N=C=O ZISMXCUJCSPKPF-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- STJYMUBZVMSMBP-UHFFFAOYSA-N chlorocyclobutane Chemical compound ClC1CCC1 STJYMUBZVMSMBP-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- NKKMVIVFRUYPLQ-NSCUHMNNSA-N crotononitrile Chemical compound C\C=C\C#N NKKMVIVFRUYPLQ-NSCUHMNNSA-N 0.000 description 1
- HIQFVZPTTCQMQQ-UHFFFAOYSA-N cyclobutanecarbonyl isocyanate Chemical compound O=C=NC(=O)C1CCC1 HIQFVZPTTCQMQQ-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- OBDABCRPZWESIL-UHFFFAOYSA-N cyclohexanecarbonyl isocyanate Chemical compound O=C=NC(=O)C1CCCCC1 OBDABCRPZWESIL-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- FVBRMNFEXWSLNI-UHFFFAOYSA-N cyclopropanecarbonyl isocyanate Chemical compound O=C=NC(=O)C1CC1 FVBRMNFEXWSLNI-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- RPNPLURUJVCOAA-UHFFFAOYSA-N dimethoxyphosphorylimino(oxo)methane Chemical compound COP(=O)(OC)N=C=O RPNPLURUJVCOAA-UHFFFAOYSA-N 0.000 description 1
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- 230000000913 erythropoietic effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- XVJRQAJDEMSBGG-UHFFFAOYSA-N ethyl 2-isocyanato-2-oxoacetate Chemical compound CCOC(=O)C(=O)N=C=O XVJRQAJDEMSBGG-UHFFFAOYSA-N 0.000 description 1
- RIUPNMPMHAEEDK-UHFFFAOYSA-N ethyl 3-[(2-cyanoaziridine-1-carbonyl)amino]-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)NC(=O)N1CC1C#N RIUPNMPMHAEEDK-UHFFFAOYSA-N 0.000 description 1
- UVSPVEYCSVXYBB-UHFFFAOYSA-N ethyl 3-amino-3-oxopropanoate Chemical compound CCOC(=O)CC(N)=O UVSPVEYCSVXYBB-UHFFFAOYSA-N 0.000 description 1
- VLKGYFSQZMKYOT-UHFFFAOYSA-N ethyl 4-carbamoylbenzoate Chemical compound CCOC(=O)C1=CC=C(C(N)=O)C=C1 VLKGYFSQZMKYOT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HKCGFKNXCPDIMW-UHFFFAOYSA-N ethyl n-(2-cyanoaziridine-1-carbothioyl)carbamate Chemical compound CCOC(=O)NC(=S)N1CC1C#N HKCGFKNXCPDIMW-UHFFFAOYSA-N 0.000 description 1
- VMVZGGPZNHFGKS-UHFFFAOYSA-N ethyl n-(oxomethylidene)carbamate Chemical compound CCOC(=O)N=C=O VMVZGGPZNHFGKS-UHFFFAOYSA-N 0.000 description 1
- BDTDECDAHYOJRO-UHFFFAOYSA-N ethyl n-(sulfanylidenemethylidene)carbamate Chemical compound CCOC(=O)N=C=S BDTDECDAHYOJRO-UHFFFAOYSA-N 0.000 description 1
- MCRPKBUFXAKDKI-UHFFFAOYSA-N ethyl pyridine-4-carboxylate Chemical compound CCOC(=O)C1=CC=NC=C1 MCRPKBUFXAKDKI-UHFFFAOYSA-N 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 244000000010 microbial pathogen Species 0.000 description 1
- RDFOYDSYDKCSPI-UHFFFAOYSA-N n-(2-acetamidoacetyl)-2-cyanoaziridine-1-carboxamide Chemical compound CC(=O)NCC(=O)NC(=O)N1CC1C#N RDFOYDSYDKCSPI-UHFFFAOYSA-N 0.000 description 1
- VGLFOLHOAOJYLJ-UHFFFAOYSA-N n-(2-chloroacetyl)-2-cyano-3-phenylaziridine-1-carboxamide Chemical compound ClCC(=O)NC(=O)N1C(C#N)C1C1=CC=CC=C1 VGLFOLHOAOJYLJ-UHFFFAOYSA-N 0.000 description 1
- CSYIGWCATQSVMB-UHFFFAOYSA-N n-(2-chloroacetyl)-2-cyanoaziridine-1-carboxamide Chemical compound ClCC(=O)NC(=O)N1CC1C#N CSYIGWCATQSVMB-UHFFFAOYSA-N 0.000 description 1
- QCBMQERJLMOEBP-UHFFFAOYSA-N n-(2-cyanoaziridine-1-carbonyl)-1-methyl-3-nitropyrazole-4-carboxamide Chemical compound [O-][N+](=O)C1=NN(C)C=C1C(=O)NC(=O)N1C(C#N)C1 QCBMQERJLMOEBP-UHFFFAOYSA-N 0.000 description 1
- AHDBNXYWWWWCIR-UHFFFAOYSA-N n-(2-cyanoaziridine-1-carbonyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide Chemical compound CC=1ON=C(C=2C=CC=CC=2)C=1C(=O)NC(=O)N1CC1C#N AHDBNXYWWWWCIR-UHFFFAOYSA-N 0.000 description 1
- SNJUVNKBINJSGO-UHFFFAOYSA-N n-(2-cyanoaziridine-1-carbonyl)-6-methylsulfanylpyridazine-3-carboxamide Chemical compound N1=NC(SC)=CC=C1C(=O)NC(=O)N1C(C#N)C1 SNJUVNKBINJSGO-UHFFFAOYSA-N 0.000 description 1
- BFSAPBFWHFONDQ-UHFFFAOYSA-N n-(2-cyanoaziridine-1-carbothioyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(=S)N1CC1C#N BFSAPBFWHFONDQ-UHFFFAOYSA-N 0.000 description 1
- LMCIGOIQCQGIDD-UHFFFAOYSA-N n-(4-acetylbenzoyl)-2-cyanoaziridine-1-carboxamide Chemical compound C1=CC(C(=O)C)=CC=C1C(=O)NC(=O)N1C(C#N)C1 LMCIGOIQCQGIDD-UHFFFAOYSA-N 0.000 description 1
- BXIIDFFOSGJHQU-UHFFFAOYSA-N n-(4-benzoylbenzoyl)-2-cyanoaziridine-1-carboxamide Chemical compound C1C(C#N)N1C(=O)NC(=O)C(C=C1)=CC=C1C(=O)C1=CC=CC=C1 BXIIDFFOSGJHQU-UHFFFAOYSA-N 0.000 description 1
- WJJDNVUMGIAWBJ-UHFFFAOYSA-N n-(4-chlorobenzoyl)-2-cyanoaziridine-1-carboxamide Chemical compound C1=CC(Cl)=CC=C1C(=O)NC(=O)N1C(C#N)C1 WJJDNVUMGIAWBJ-UHFFFAOYSA-N 0.000 description 1
- DJJWKFFHTLWSRE-UHFFFAOYSA-N n-(4-chlorophenyl)sulfonyl-2-cyanoaziridine-1-carboxamide Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)NC(=O)N1C(C#N)C1 DJJWKFFHTLWSRE-UHFFFAOYSA-N 0.000 description 1
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 description 1
- SFWQPYSIXMKRKF-UHFFFAOYSA-N n-(oxomethylidene)ethanesulfonamide Chemical compound CCS(=O)(=O)N=C=O SFWQPYSIXMKRKF-UHFFFAOYSA-N 0.000 description 1
- OUPLTJDZPQZRBW-UHFFFAOYSA-N n-(oxomethylidene)methanesulfonamide Chemical compound CS(=O)(=O)N=C=O OUPLTJDZPQZRBW-UHFFFAOYSA-N 0.000 description 1
- YYSUMRRMUJKBFF-UHFFFAOYSA-N n-[2-(4-chlorophenoxy)acetyl]-2-cyanoaziridine-1-carboxamide Chemical compound C1=CC(Cl)=CC=C1OCC(=O)NC(=O)N1C(C#N)C1 YYSUMRRMUJKBFF-UHFFFAOYSA-N 0.000 description 1
- CKOMYBIIDNQZOB-UHFFFAOYSA-N n-acetyl-2-cyanoaziridine-1-carboxamide Chemical compound CC(=O)NC(=O)N1CC1C#N CKOMYBIIDNQZOB-UHFFFAOYSA-N 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- MZBBNKPSOPQJSA-UHFFFAOYSA-N n-carbonocyanidoyl-2-cyanoaziridine-1-carboxamide Chemical compound N#CC(=O)NC(=O)N1CC1C#N MZBBNKPSOPQJSA-UHFFFAOYSA-N 0.000 description 1
- JVXXKQIRGQDWOJ-UHFFFAOYSA-N naphthalene-2-carboxamide Chemical compound C1=CC=CC2=CC(C(=O)N)=CC=C21 JVXXKQIRGQDWOJ-UHFFFAOYSA-N 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- FSZKLYCUEQGCKW-UHFFFAOYSA-N phenyl n-(oxomethylidene)carbamate Chemical compound O=C=NC(=O)OC1=CC=CC=C1 FSZKLYCUEQGCKW-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- YOSXAXYCARLZTR-UHFFFAOYSA-N prop-2-enoyl isocyanate Chemical compound C=CC(=O)N=C=O YOSXAXYCARLZTR-UHFFFAOYSA-N 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 210000004989 spleen cell Anatomy 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 150000003450 sulfenic acids Chemical class 0.000 description 1
- 150000003455 sulfinic acids Chemical class 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical group C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- OZEFVOPTJSERLH-UHFFFAOYSA-N trifluoro(isocyanatosulfanyl)methane Chemical compound FC(F)(F)SN=C=O OZEFVOPTJSERLH-UHFFFAOYSA-N 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C265/00—Derivatives of isocyanic acid
- C07C265/16—Derivatives of isocyanic acid having isocyanate groups acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/16—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with acylated ring nitrogen atoms
- C07D203/20—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with acylated ring nitrogen atoms by carbonic acid, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/22—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
- C07D203/24—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/564—Three-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762644820 DE2644820A1 (de) | 1976-10-05 | 1976-10-05 | Cancerostatisch und immunstimulierend wirkende 1-(n-acyl-carbamoyl)-2-cyanaziridine sowie verfahren zur herstellung derselben |
| DE19772727550 DE2727550A1 (de) | 1977-06-18 | 1977-06-18 | Cancerostatisch und immunstimulierend wirkende 1-(n-acyl-carbamoyl)- 2-cyanaziridine sowie verfahren zur herstellung derselben |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO773377L true NO773377L (no) | 1978-04-06 |
Family
ID=25770972
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO773377A NO773377L (no) | 1976-10-05 | 1977-10-04 | Fremgangsmaate ved fremstilling av 1-(n-acyl-carbamoyl)-2-cyanaziridiner |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4282212A (pl) |
| JP (1) | JPS5350153A (pl) |
| AR (1) | AR217085A1 (pl) |
| AT (1) | AT356129B (pl) |
| AU (1) | AU2931477A (pl) |
| CA (1) | CA1092606A (pl) |
| CS (1) | CS199711B2 (pl) |
| DD (1) | DD131927A5 (pl) |
| DK (1) | DK438177A (pl) |
| ES (1) | ES462890A1 (pl) |
| FI (1) | FI772924A7 (pl) |
| FR (1) | FR2367062A1 (pl) |
| GB (1) | GB1547513A (pl) |
| IE (1) | IE45782B1 (pl) |
| IT (1) | IT1087759B (pl) |
| NL (1) | NL7710790A (pl) |
| NO (1) | NO773377L (pl) |
| NZ (1) | NZ185319A (pl) |
| OA (1) | OA05778A (pl) |
| PL (1) | PL110162B1 (pl) |
| PT (1) | PT67108B (pl) |
| SE (1) | SE7711093L (pl) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2833986A1 (de) * | 1978-08-03 | 1980-02-21 | Boehringer Mannheim Gmbh | Immunstimulierende n-substituierte aziridin-2-carbonsaeurederivate, verfahren zu ihrer herstellung sowie arzneimittel, die diese substanzen enthalten |
| FR2692577B1 (fr) * | 1992-05-26 | 1996-02-02 | Bouchara Sa | Nouvelles quinolones fluorees, leur procede de preparation et les compositions pharmaceutiques en renfermant. |
| CA2294243C (en) * | 1997-06-27 | 2008-12-30 | Arizona Board Of Regents, University Of Arizona | Novel cyanoaziridines for treating cancer |
| US6982263B2 (en) * | 2001-06-08 | 2006-01-03 | Boehringer Ingelheim Pharmaceuticals, Inc. | Nitriles useful as reversible inhibitors of cysteine proteases |
| AR037097A1 (es) * | 2001-10-05 | 2004-10-20 | Novartis Ag | Compuestos acilsulfonamidas, composiciones farmaceuticas y el uso de dichos compuestos para la preparacion de un medicamento |
| US6476236B1 (en) * | 2001-11-26 | 2002-11-05 | The Arizona Board Of Regents | Synthesis of 2-cyanoaziridine-1-carboxamide |
| WO2004106535A2 (en) * | 2003-05-27 | 2004-12-09 | Pointcare Technologies, Inc. | Enhanced cellular assay method for use in flow cytometry or similar instruments using optically resonant particles |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3406192A (en) * | 1962-09-04 | 1968-10-15 | Monsanto Co | N-(aroyl) carbamates and thio carbamates |
| DD110492A1 (pl) * | 1974-03-21 | 1974-12-20 |
-
1977
- 1977-09-27 CA CA287,572A patent/CA1092606A/en not_active Expired
- 1977-09-28 CS CS776290A patent/CS199711B2/cs unknown
- 1977-09-30 US US05/838,426 patent/US4282212A/en not_active Expired - Lifetime
- 1977-10-03 NL NL7710790A patent/NL7710790A/xx not_active Application Discontinuation
- 1977-10-03 PT PT67108A patent/PT67108B/pt unknown
- 1977-10-03 DD DD7700201316A patent/DD131927A5/xx unknown
- 1977-10-03 NZ NZ185319A patent/NZ185319A/xx unknown
- 1977-10-03 GB GB40926/77A patent/GB1547513A/en not_active Expired
- 1977-10-03 IT IT28225/77A patent/IT1087759B/it active
- 1977-10-04 IE IE2023/77A patent/IE45782B1/en unknown
- 1977-10-04 FI FI772924A patent/FI772924A7/fi not_active Application Discontinuation
- 1977-10-04 AT AT706577A patent/AT356129B/de not_active IP Right Cessation
- 1977-10-04 PL PL1977201285A patent/PL110162B1/pl unknown
- 1977-10-04 AU AU29314/77A patent/AU2931477A/en active Pending
- 1977-10-04 ES ES462890A patent/ES462890A1/es not_active Expired
- 1977-10-04 SE SE7711093A patent/SE7711093L/xx unknown
- 1977-10-04 DK DK438177A patent/DK438177A/da unknown
- 1977-10-04 NO NO773377A patent/NO773377L/no unknown
- 1977-10-05 AR AR269465A patent/AR217085A1/es active
- 1977-10-05 JP JP11989577A patent/JPS5350153A/ja active Pending
- 1977-10-05 OA OA56292A patent/OA05778A/xx unknown
- 1977-10-05 FR FR7729924A patent/FR2367062A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ATA706577A (de) | 1979-09-15 |
| PT67108A (de) | 1977-11-01 |
| CA1092606A (en) | 1980-12-30 |
| FR2367062B1 (pl) | 1981-11-13 |
| FR2367062A1 (fr) | 1978-05-05 |
| PT67108B (de) | 1979-03-14 |
| SE7711093L (sv) | 1978-04-06 |
| NL7710790A (nl) | 1978-04-07 |
| DK438177A (da) | 1978-04-06 |
| AT356129B (de) | 1980-04-10 |
| PL201285A1 (pl) | 1979-03-12 |
| IE45782L (en) | 1978-04-05 |
| IT1087759B (it) | 1985-06-04 |
| AR217085A1 (es) | 1980-02-29 |
| PL110162B1 (en) | 1980-07-31 |
| GB1547513A (en) | 1979-06-20 |
| FI772924A7 (fi) | 1978-04-06 |
| DD131927A5 (de) | 1978-08-09 |
| ES462890A1 (es) | 1978-09-01 |
| OA05778A (fr) | 1981-05-31 |
| CS199711B2 (en) | 1980-07-31 |
| US4282212A (en) | 1981-08-04 |
| NZ185319A (en) | 1979-03-16 |
| IE45782B1 (en) | 1982-12-01 |
| JPS5350153A (en) | 1978-05-08 |
| AU2931477A (en) | 1979-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4182766A (en) | Naphth[2,3-d]imidazoles | |
| EP0557171B1 (fr) | Azaindoles, procédés de préparation et médicaments les contenant | |
| KR880001942B1 (ko) | 1,4-디히드로피리딘-3,5-디카르복실산 에스테르 유도체의 제법 | |
| US4267174A (en) | Immune-stimulating and cancerostatic 1-acyl-2-cyanoaziridines | |
| AU2021394226B2 (en) | Benzylamine or benzyl alcohol derivative and use thereof | |
| FI66180B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 6-acylaminotetrahydro-1,3,5-triazin-2,4-dioner | |
| NO152091B (no) | Analogifremgangsmaate ved fremstilling av antiinflammatorisk virksomme 5-substituerte 2,3-difenylthiofener | |
| US5258397A (en) | 3-Isoxazoyl derivatives endowed with anticonvulsant activity, procedure for their preparation and their pharmaceutical compositions | |
| HU198479B (en) | Process for producing 1-substituted imidazole derivatives and pharmaceutical compositions comprising same as active ingredient | |
| NO852133L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyrrolidinon-derivater. | |
| NO156087B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive alkylurinstoff-derivater. | |
| NO773377L (no) | Fremgangsmaate ved fremstilling av 1-(n-acyl-carbamoyl)-2-cyanaziridiner | |
| JP3140494B2 (ja) | 置換されたフエニルアセチレン、これを含有する薬剤、この化合物及び薬剤を製造する方法 | |
| US5326879A (en) | Indole derivatives | |
| EP0114572A1 (de) | Substituierte Imidazo(1,5-a)pyridine | |
| DK158944B (da) | Analogifremgangsmaade til fremstilling af substituerede methylimidazolforbindelser | |
| EP0310109A2 (en) | Novel aminoalkyl-substituted heterocyclic sulfur compounds | |
| US4252811A (en) | Hexahydro-trans-pyridoindole neuroleptic agents | |
| NO784423L (no) | Fremgangsmaate for fremstilling av nye arylaminoimidazolinderivater | |
| FI65428C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla 2-fenylamino-imidazolin(2) derivat | |
| JP2967231B2 (ja) | 1,4―チアジン誘導体 | |
| KR20000069544A (ko) | 신규 4-(1-피페라진일)벤조산 유도체, 이의 제조방법 및 이를이용한 치료 | |
| CA2008247A1 (en) | Substituted benzo(b)pyrans, processes for their preparation, their use and pharmaceutical preparations based on these compounds | |
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| US4224317A (en) | Substituted 1-oxa-4-aza-2,6-disilacyclohexanes and use thereof |