NO750819L - - Google Patents
Info
- Publication number
- NO750819L NO750819L NO750819A NO750819A NO750819L NO 750819 L NO750819 L NO 750819L NO 750819 A NO750819 A NO 750819A NO 750819 A NO750819 A NO 750819A NO 750819 L NO750819 L NO 750819L
- Authority
- NO
- Norway
- Prior art keywords
- compound
- formula
- stated
- hydrogen
- alkyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 60
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 22
- 239000002904 solvent Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- 125000003158 alcohol group Chemical group 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 5
- 239000007868 Raney catalyst Substances 0.000 claims description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 5
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 229910052705 radium Inorganic materials 0.000 claims description 4
- 229940117975 chromium trioxide Drugs 0.000 claims description 3
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims description 3
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 claims description 3
- 239000007800 oxidant agent Substances 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- 125000000777 acyl halide group Chemical group 0.000 claims description 2
- 150000001266 acyl halides Chemical class 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 239000012024 dehydrating agents Substances 0.000 claims description 2
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 72
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 61
- 239000003921 oil Substances 0.000 description 33
- 235000019198 oils Nutrition 0.000 description 33
- 239000000243 solution Substances 0.000 description 31
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 15
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 230000009102 absorption Effects 0.000 description 11
- 238000010521 absorption reaction Methods 0.000 description 11
- -1 benzyl ester Chemical class 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 239000012259 ether extract Substances 0.000 description 6
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- WDAXFOBOLVPGLV-UHFFFAOYSA-N ethyl isobutyrate Chemical compound CCOC(=O)C(C)C WDAXFOBOLVPGLV-UHFFFAOYSA-N 0.000 description 4
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 4
- ARQVRCKIVSELCG-UHFFFAOYSA-N methyl 2-(4-methoxyphenyl)propanoate Chemical compound COC(=O)C(C)C1=CC=C(OC)C=C1 ARQVRCKIVSELCG-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- AUWDOZOUJWEPBA-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethanol Chemical compound COC1=CC=C(CCO)C=C1 AUWDOZOUJWEPBA-UHFFFAOYSA-N 0.000 description 3
- IMEPSBLHFMECET-UHFFFAOYSA-N 2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C2OC(C(C)C)CC(=O)C2=C1 IMEPSBLHFMECET-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 239000003810 Jones reagent Substances 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminum chloride Substances Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- 229940121363 anti-inflammatory agent Drugs 0.000 description 3
- 239000002260 anti-inflammatory agent Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 3
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- KBUWNOZVAFZDJS-UHFFFAOYSA-N 1-[2-hydroxy-5-(1-hydroxypropan-2-yl)phenyl]ethanone Chemical compound OCC(C)C1=CC=C(O)C(C(C)=O)=C1 KBUWNOZVAFZDJS-UHFFFAOYSA-N 0.000 description 2
- QONBZVGEMCBTOC-UHFFFAOYSA-N 2-ethyl-6-(1-hydroxypropan-2-yl)chromen-4-one Chemical compound OCC(C)C1=CC=C2OC(CC)=CC(=O)C2=C1 QONBZVGEMCBTOC-UHFFFAOYSA-N 0.000 description 2
- XQXPVVBIMDBYFF-UHFFFAOYSA-N 4-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=C(O)C=C1 XQXPVVBIMDBYFF-UHFFFAOYSA-N 0.000 description 2
- MFNQRGFWJRNKPO-UHFFFAOYSA-N 6-(1-hydroxypropan-2-yl)chromen-4-one Chemical compound O1C=CC(=O)C2=CC(C(CO)C)=CC=C21 MFNQRGFWJRNKPO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 241000786363 Rhampholeon spectrum Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001562 benzopyrans Chemical class 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- MNNMTFSPSVOWSF-UHFFFAOYSA-N dicyclohexylazanium;chloride Chemical compound Cl.C1CCCCC1NC1CCCCC1 MNNMTFSPSVOWSF-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- HLSADYVXHNXEJS-UHFFFAOYSA-N methyl 2-(3-acetyl-4-hydroxyphenyl)propanoate Chemical compound COC(=O)C(C)C1=CC=C(O)C(C(C)=O)=C1 HLSADYVXHNXEJS-UHFFFAOYSA-N 0.000 description 2
- XHEJLYJUMDXJAJ-UHFFFAOYSA-N methyl 2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoate Chemical compound O1C(C(C)C)CC(=O)C2=CC(C(C)C(=O)OC)=CC=C21 XHEJLYJUMDXJAJ-UHFFFAOYSA-N 0.000 description 2
- FHTKVDOIWNFCEF-UHFFFAOYSA-N methyl 2-(4-oxo-2-propan-2-ylchromen-6-yl)propanoate Chemical compound O1C(C(C)C)=CC(=O)C2=CC(C(C)C(=O)OC)=CC=C21 FHTKVDOIWNFCEF-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 201000003068 rheumatic fever Diseases 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229940066769 systemic antihistamines substituted alkylamines Drugs 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- OTTYFDRFBJPGRW-ONEGZZNKSA-N (e)-pent-2-enoyl chloride Chemical compound CC\C=C\C(Cl)=O OTTYFDRFBJPGRW-ONEGZZNKSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- HNAGHMKIPMKKBB-UHFFFAOYSA-N 1-benzylpyrrolidine-3-carboxamide Chemical compound C1C(C(=O)N)CCN1CC1=CC=CC=C1 HNAGHMKIPMKKBB-UHFFFAOYSA-N 0.000 description 1
- KQUKYOKTQKKISB-UHFFFAOYSA-N 2-(2-ethyl-4-oxo-2,3-dihydrochromen-6-yl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C2OC(CC)CC(=O)C2=C1 KQUKYOKTQKKISB-UHFFFAOYSA-N 0.000 description 1
- AKMFIYTVLXQTRR-UHFFFAOYSA-N 2-(2-ethyl-4-oxochromen-6-yl)acetic acid Chemical compound OC(=O)CC1=CC=C2OC(CC)=CC(=O)C2=C1 AKMFIYTVLXQTRR-UHFFFAOYSA-N 0.000 description 1
- GDQLZWULLTVQTC-UHFFFAOYSA-N 2-(2-ethyl-4-oxochromen-6-yl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C2OC(CC)=CC(=O)C2=C1 GDQLZWULLTVQTC-UHFFFAOYSA-N 0.000 description 1
- DCGRLMABSSGAPH-UHFFFAOYSA-N 2-(3-acetyl-4-hydroxyphenyl)ethyl acetate Chemical compound CC(=O)OCCC1=CC=C(O)C(C(C)=O)=C1 DCGRLMABSSGAPH-UHFFFAOYSA-N 0.000 description 1
- PUAJHDSUMKNKAW-UHFFFAOYSA-N 2-(3-acetyl-4-hydroxyphenyl)propyl acetate Chemical compound CC(=O)OCC(C)C1=CC=C(O)C(C(C)=O)=C1 PUAJHDSUMKNKAW-UHFFFAOYSA-N 0.000 description 1
- YCCILVSKPBXVIP-UHFFFAOYSA-N 2-(4-Hydroxyphenyl)ethanol Natural products OCCC1=CC=C(O)C=C1 YCCILVSKPBXVIP-UHFFFAOYSA-N 0.000 description 1
- VIPNDDUFWVYIPH-UHFFFAOYSA-N 2-(4-methoxyphenyl)propan-1-ol Chemical compound COC1=CC=C(C(C)CO)C=C1 VIPNDDUFWVYIPH-UHFFFAOYSA-N 0.000 description 1
- TZSHEUDIKQHNKP-UHFFFAOYSA-N 2-(4-oxo-2,3-dihydrochromen-6-yl)propanoic acid Chemical compound O1CCC(=O)C2=CC(C(C(O)=O)C)=CC=C21 TZSHEUDIKQHNKP-UHFFFAOYSA-N 0.000 description 1
- QGPZDAHWXRLWPO-UHFFFAOYSA-N 2-ethoxy-1-[2-hydroxy-5-(1-hydroxypropan-2-yl)phenyl]ethanone Chemical compound CCOCC(=O)C1=CC(C(C)CO)=CC=C1O QGPZDAHWXRLWPO-UHFFFAOYSA-N 0.000 description 1
- AHCLIZWRCWDGFE-UHFFFAOYSA-N 2-ethyl-6-(1-hydroxypropan-2-yl)-2,3-dihydrochromen-4-one Chemical compound OCC(C)C1=CC=C2OC(CC)CC(=O)C2=C1 AHCLIZWRCWDGFE-UHFFFAOYSA-N 0.000 description 1
- GKDARSLDNVPFFY-UHFFFAOYSA-N 2-ethyl-6-(2-hydroxyethyl)chromen-4-one Chemical compound OCCC1=CC=C2OC(CC)=CC(=O)C2=C1 GKDARSLDNVPFFY-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- MSTDXOZUKAQDRL-UHFFFAOYSA-N 4-Chromanone Chemical class C1=CC=C2C(=O)CCOC2=C1 MSTDXOZUKAQDRL-UHFFFAOYSA-N 0.000 description 1
- LLBJZTQSYYQQNE-UHFFFAOYSA-N 6-(1-hydroxypropan-2-yl)-2-propylchromen-4-one Chemical compound OCC(C)C1=CC=C2OC(CCC)=CC(=O)C2=C1 LLBJZTQSYYQQNE-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- TWMHMMNCOUZOCM-UHFFFAOYSA-N N-cyclohexylcyclohexanamine 2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid Chemical compound C1CCCCC1NC1CCCCC1.OC(=O)C(C)C1=CC=C2OC(C(C)C)CC(=O)C2=C1 TWMHMMNCOUZOCM-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- UCTLHLZWKJIXJI-LXIBVNSESA-N [(3s,8r,9s,10r,13s,14s)-17-chloro-16-formyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1h-cyclopenta[a]phenanthren-3-yl] acetate Chemical compound C([C@@H]12)C[C@]3(C)C(Cl)=C(C=O)C[C@H]3[C@@H]1CC=C1[C@]2(C)CC[C@H](OC(=O)C)C1 UCTLHLZWKJIXJI-LXIBVNSESA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N butanoic acid ethyl ester Natural products CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical compound C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 description 1
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000027950 fever generation Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000005067 joint tissue Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- MCPJAILZXPQXGM-UHFFFAOYSA-N methyl 2-(4-hydroxy-3-pent-2-enoylphenyl)propanoate Chemical compound CCC=CC(=O)C1=CC(C(C)C(=O)OC)=CC=C1O MCPJAILZXPQXGM-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 210000001087 myotubule Anatomy 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB12784/74A GB1499323A (en) | 1974-03-22 | 1974-03-22 | 6-substituted chromones and chromanones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO750819L true NO750819L (xx) | 1975-09-23 |
Family
ID=10011064
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO750819A NO750819L (xx) | 1974-03-22 | 1975-03-11 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4057641A (xx) |
| JP (1) | JPS50154264A (xx) |
| BE (1) | BE826765A (xx) |
| CH (1) | CH608798A5 (xx) |
| DE (1) | DE2511647A1 (xx) |
| DK (1) | DK120475A (xx) |
| ES (1) | ES435855A1 (xx) |
| FI (1) | FI750841A (xx) |
| FR (1) | FR2264528B1 (xx) |
| GB (1) | GB1499323A (xx) |
| IE (1) | IE42116B1 (xx) |
| IL (1) | IL46893A (xx) |
| NL (1) | NL7503397A (xx) |
| NO (1) | NO750819L (xx) |
| SE (1) | SE7503291L (xx) |
| ZA (1) | ZA751546B (xx) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2549745A1 (de) * | 1974-11-20 | 1976-05-26 | Lipha | Durch einen chromonylrest substituierte propionsaeuren sowie deren derivate und verwendungen |
| US4151179A (en) * | 1975-03-12 | 1979-04-24 | Fisons Limited | 2-(4H-1-Benzopyran-6-yl)propionic acids |
| JPS58135877A (ja) * | 1982-02-05 | 1983-08-12 | Nippon Zoki Pharmaceut Co Ltd | 新規クロマノン誘導体及び該化合物を含有する医薬組成物 |
| ATE50771T1 (de) * | 1985-12-24 | 1990-03-15 | Mallinckrodt Inc | Herstellung von 6-substituierten 4-chromanonen. |
| JPH0753725B2 (ja) * | 1987-10-08 | 1995-06-07 | 富山化学工業株式会社 | ４ｈ―１―ベンゾピラン―４―オン誘導体およびその塩、それらの製造法並びにそれらを含有する抗炎症剤 |
| US6469031B1 (en) | 1998-12-18 | 2002-10-22 | Bayer Corporation | Carboxyl substituted chroman derivatives useful as beta 3 adrenoreceptor agonists |
| US6051586A (en) * | 1997-12-19 | 2000-04-18 | Bayer Corporation | Sulfonamide substituted chroman derivatives useful as beta 3 adrenoreceptor agonists |
| EP1218002A4 (en) | 2000-01-24 | 2004-09-22 | Jozef S Mruk | USE OF FLAVON-8 ACETIC ACID IN VASCULAR AND CARDIOVASCULAR INTERVENTIONS AND ACUTE CORONARY SYNDROME |
| AR035605A1 (es) | 2000-12-11 | 2004-06-16 | Bayer Corp | Derivados de aminometil cromano di-sustituidos, un metodo para su preparacion, composiciones farmaceuticas y el uso de dichos derivados para la manufactura de medicamentos utiles como agonistas beta-3-adreno-receptores |
| AR035858A1 (es) | 2001-04-23 | 2004-07-21 | Bayer Corp | Derivados de cromano 2,6-sustituidos,composiciones farmaceuticas,uso de dichos derivados para la manufactura de medicamentos utiles como agonistas adrenorreceptores beta-3 |
| WO2014130608A1 (en) * | 2013-02-22 | 2014-08-28 | Merck Sharp & Dohme Corp. | Antidiabetic bicyclic compounds |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2897211A (en) * | 1955-11-02 | 1959-07-28 | Recordati Lab Farmacologico S | Hydroxychromone derivatives and method of preparing the same |
| FR95487E (fr) * | 1967-07-26 | 1971-01-15 | Rech S Ind Sori Soc D | Nouveaux dérives flavoniques. |
| BE757821A (fr) * | 1970-08-01 | 1971-04-01 | Recordati Chem Pharm | Procede de preparation de l'acide 3-propionyl-salicylique et dederives de cet acide |
| US3775435A (en) * | 1971-08-26 | 1973-11-27 | American Home Prod | 5,6,7,8-tetrahydro-2,5(and 4,5)-dioxo-1-benzopyrans |
| GB1403487A (en) * | 1972-07-21 | 1975-08-28 | Yoshitomi Pharmaceutical | Heterocyclic substituted alkanoic acids and derivatives |
| US3862143A (en) * | 1972-12-04 | 1975-01-21 | Warner Lambert Co | Substituted chromone-3-carbonitriles, carboxamides and carboxylic acids |
| US3825574A (en) * | 1972-12-04 | 1974-07-23 | Warner Lambert Co | Process for preparing substituted chromone-3-carbonitriles,carboxamides and carboxylic acids |
| US3912760A (en) * | 1973-04-18 | 1975-10-14 | Warner Lambert Co | Process for the production of chromone derivatives and intermediates produced thereby |
-
1974
- 1974-03-22 GB GB12784/74A patent/GB1499323A/en not_active Expired
-
1975
- 1975-03-11 NO NO750819A patent/NO750819L/no unknown
- 1975-03-12 ZA ZA00751546A patent/ZA751546B/xx unknown
- 1975-03-12 US US05/557,897 patent/US4057641A/en not_active Expired - Lifetime
- 1975-03-17 DE DE19752511647 patent/DE2511647A1/de not_active Ceased
- 1975-03-17 BE BE154400A patent/BE826765A/xx unknown
- 1975-03-20 JP JP50033072A patent/JPS50154264A/ja active Pending
- 1975-03-21 FI FI750841A patent/FI750841A/fi not_active Application Discontinuation
- 1975-03-21 SE SE7503291A patent/SE7503291L/xx unknown
- 1975-03-21 ES ES435855A patent/ES435855A1/es not_active Expired
- 1975-03-21 IL IL46893A patent/IL46893A/xx unknown
- 1975-03-21 NL NL7503397A patent/NL7503397A/xx not_active Application Discontinuation
- 1975-03-21 DK DK120475A patent/DK120475A/da not_active Application Discontinuation
- 1975-03-21 FR FR7508851A patent/FR2264528B1/fr not_active Expired
- 1975-03-21 CH CH753678A patent/CH608798A5/xx not_active IP Right Cessation
- 1975-03-24 IE IE648/75A patent/IE42116B1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2511647A1 (de) | 1975-09-25 |
| JPS50154264A (xx) | 1975-12-12 |
| FR2264528B1 (xx) | 1978-11-10 |
| FI750841A (xx) | 1975-09-23 |
| GB1499323A (en) | 1978-02-01 |
| US4057641A (en) | 1977-11-08 |
| AU7929675A (en) | 1976-09-23 |
| IL46893A0 (en) | 1975-05-22 |
| BE826765A (fr) | 1975-09-17 |
| IE42116L (en) | 1975-09-22 |
| IL46893A (en) | 1978-08-31 |
| SE7503291L (xx) | 1975-09-23 |
| ES435855A1 (es) | 1976-11-16 |
| ZA751546B (en) | 1976-05-26 |
| DK120475A (xx) | 1975-09-23 |
| CH608798A5 (xx) | 1979-01-31 |
| FR2264528A1 (xx) | 1975-10-17 |
| NL7503397A (nl) | 1975-09-24 |
| IE42116B1 (en) | 1980-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2556821B2 (ja) | 三環式芳香族化合物 | |
| NO154346B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive ftalazin-4-yl-eddiksyrederivater. | |
| JPS6237037B2 (xx) | ||
| CA1179368A (en) | Enkephalinase enzyme inhibiting compounds | |
| NO750819L (xx) | ||
| JPS5811850B2 (ja) | １− オキソ −２，２− ジチカン −５− インダニロキシ （ マタハチオ ＃ アルカノイツクアシド | |
| NO142865B (no) | Analogifremgangsmaate ved fremstilling av nye terapeutisk aktive karbazoler | |
| NO812557L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive 9-amino-1-hydroksyoktahydrobenzo(c)kinolinderivater | |
| JPH0217170A (ja) | 酸の製造方法 | |
| US5332857A (en) | 3,5-dihydroxy-6,8-nonadienoic acids and derivatives as hypocholesterolemic agents | |
| EP0094102B1 (fr) | Nouveaux dérivés de 1-(1-cyclohexénylméthyl) pyrrolidine et leur procédé de préparation | |
| US3969397A (en) | Process for the preparation of l-dopa | |
| US4151179A (en) | 2-(4H-1-Benzopyran-6-yl)propionic acids | |
| JPS6125012B2 (xx) | ||
| DK160760B (da) | Analogifremgangsmaade til fremstilling af n-naphthoylglycinderivater | |
| GB2162179A (en) | Naphthyl analogs of mevalonolactone and derivatives thereof, processes for their production and their use | |
| NO158673B (no) | Analogifremgangsm te ved fremstilling av terapeutisk aktive azurenderivater. | |
| US3506658A (en) | 2-(10-methyl-2-phenoxazinyl)propionic acid | |
| US4740518A (en) | 4H-benzo(4,5)cyclohepta(1,2-B)thiophene derivatives | |
| US4473583A (en) | Compositions containing certain derivatives of 4-phenyl-4-oxobuten-2-oic acid and methods of treatment using them | |
| US2906757A (en) | Their preparation | |
| CN114213260A (zh) | 一种普罗碘铵的制备方法 | |
| NO147028B (no) | Analogifremgangsmaate for fremstilling av farmasoeytisk aktive 1-hydroksyoktahydrobenzo(c)kinoliner | |
| NO743135L (xx) | ||
| SU554810A3 (ru) | Способ получени производных бифенила или их солей, или рацематов, или оптически активных антиподов |