NO305951B1 - Kjemiske forbindelser, farmasoeytisk preparat med blodplateaggregeringshemmende egenskaper, samt anvendelse av forbindelsene til fremstilling av henholdsvis en blodplateaggregeringsinhibitor og et farmasoeytisk preparat for behandling eller foreby - Google Patents
Kjemiske forbindelser, farmasoeytisk preparat med blodplateaggregeringshemmende egenskaper, samt anvendelse av forbindelsene til fremstilling av henholdsvis en blodplateaggregeringsinhibitor og et farmasoeytisk preparat for behandling eller foreby Download PDFInfo
- Publication number
- NO305951B1 NO305951B1 NO960919A NO960919A NO305951B1 NO 305951 B1 NO305951 B1 NO 305951B1 NO 960919 A NO960919 A NO 960919A NO 960919 A NO960919 A NO 960919A NO 305951 B1 NO305951 B1 NO 305951B1
- Authority
- NO
- Norway
- Prior art keywords
- acetyl
- piperidin
- compound
- dioxopiperazin
- formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 130
- 239000000825 pharmaceutical preparation Substances 0.000 title claims description 16
- 238000011282 treatment Methods 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 229940127218 antiplatelet drug Drugs 0.000 title claims description 4
- 239000000106 platelet aggregation inhibitor Substances 0.000 title claims description 4
- 101000783577 Dendroaspis angusticeps Thrombostatin Proteins 0.000 title claims 3
- 101000783578 Dendroaspis jamesoni kaimosae Dendroaspin Proteins 0.000 title claims 3
- 208000010110 spontaneous platelet aggregation Diseases 0.000 title description 4
- 230000002401 inhibitory effect Effects 0.000 title description 3
- 238000011321 prophylaxis Methods 0.000 title description 2
- -1 diethyl[[4-[[4-(piperidin-4-yl)-2-oxopiperazin-1-yl]-acetyl]-o-phenylene]dioxy]diacetate n-butyl-4-[[4-(piperidin-4 -yl)-2,6-dioxopiperazin-1-yl]-acetyl]phenoxyacetate Chemical compound 0.000 claims description 29
- 150000003839 salts Chemical class 0.000 claims description 14
- 208000007536 Thrombosis Diseases 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000012453 solvate Substances 0.000 claims description 7
- 230000002265 prevention Effects 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- CVCRUEYFKBREBT-UHFFFAOYSA-N ethyl 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OCC)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1 CVCRUEYFKBREBT-UHFFFAOYSA-N 0.000 claims description 3
- 230000004962 physiological condition Effects 0.000 claims description 3
- MPINZWLPXWPVFQ-UHFFFAOYSA-N 2-[2-(carboxymethoxy)-4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid Chemical group C1=C(OCC(O)=O)C(OCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1 MPINZWLPXWPVFQ-UHFFFAOYSA-N 0.000 claims description 2
- GXSGKCBLUMLOGZ-UHFFFAOYSA-N 2-[2-(carboxymethoxy)-4-[2-(4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid Chemical compound C1=C(OCC(O)=O)C(OCC(=O)O)=CC=C1C(=O)CN1CCN(C2CCNCC2)CC1 GXSGKCBLUMLOGZ-UHFFFAOYSA-N 0.000 claims description 2
- AMOSKVOUQUTUFY-UHFFFAOYSA-N 2-[4-[2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1C(=O)CN1C(=O)C(=O)N(C2CCNCC2)CC1 AMOSKVOUQUTUFY-UHFFFAOYSA-N 0.000 claims description 2
- AICXVQJAEGSARR-UHFFFAOYSA-N 2-[4-[2-(2,5-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)C(=O)C1 AICXVQJAEGSARR-UHFFFAOYSA-N 0.000 claims description 2
- NJALRHTVNCJLLI-UHFFFAOYSA-N 2-[4-[2-(2,6-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1=O NJALRHTVNCJLLI-UHFFFAOYSA-N 0.000 claims description 2
- MUAXNFFODHNENM-UHFFFAOYSA-N 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1 MUAXNFFODHNENM-UHFFFAOYSA-N 0.000 claims description 2
- 206010002383 Angina Pectoris Diseases 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- SWOHTCFUYQGSDB-UHFFFAOYSA-N butyl 2-[4-[2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)C(=O)N(C2CCNCC2)CC1 SWOHTCFUYQGSDB-UHFFFAOYSA-N 0.000 claims description 2
- NIXGKDQXMJLYFH-UHFFFAOYSA-N butyl 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1 NIXGKDQXMJLYFH-UHFFFAOYSA-N 0.000 claims description 2
- 206010008118 cerebral infarction Diseases 0.000 claims description 2
- 208000026106 cerebrovascular disease Diseases 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 208000010125 myocardial infarction Diseases 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 230000002093 peripheral effect Effects 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 59
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- 239000000243 solution Substances 0.000 description 49
- 238000000034 method Methods 0.000 description 40
- 238000005160 1H NMR spectroscopy Methods 0.000 description 35
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 31
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 26
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- 238000001816 cooling Methods 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- 235000002639 sodium chloride Nutrition 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 125000006239 protecting group Chemical group 0.000 description 14
- 238000010898 silica gel chromatography Methods 0.000 description 13
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 239000012044 organic layer Substances 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 210000001772 blood platelet Anatomy 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 102100025306 Integrin alpha-IIb Human genes 0.000 description 5
- 101710149643 Integrin alpha-IIb Proteins 0.000 description 5
- 230000002776 aggregation Effects 0.000 description 5
- 238000004220 aggregation Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 210000004623 platelet-rich plasma Anatomy 0.000 description 4
- 239000012266 salt solution Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- CYJAWBVQRMVFEO-UHFFFAOYSA-N piperazine-2,6-dione Chemical compound O=C1CNCC(=O)N1 CYJAWBVQRMVFEO-UHFFFAOYSA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000005932 reductive alkylation reaction Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000015424 sodium Nutrition 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- JKSHATVZXFFKMT-UHFFFAOYSA-N 2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-2-oxopiperazin-1-yl]acetic acid;hydrochloride Chemical compound Cl.C1CN(C(=O)OC(C)(C)C)CCC1N1CC(=O)N(CC(O)=O)CC1 JKSHATVZXFFKMT-UHFFFAOYSA-N 0.000 description 2
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 2
- 241000790917 Dioxys <bee> Species 0.000 description 2
- 102000008946 Fibrinogen Human genes 0.000 description 2
- 108010049003 Fibrinogen Proteins 0.000 description 2
- 102000003886 Glycoproteins Human genes 0.000 description 2
- 108090000288 Glycoproteins Proteins 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 2
- 230000000702 anti-platelet effect Effects 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- KWZWNVAHEQHCTQ-UHFFFAOYSA-N diacetyloxyboranyl acetate Chemical compound CC(=O)OB(OC(C)=O)OC(C)=O KWZWNVAHEQHCTQ-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 2
- 229940012952 fibrinogen Drugs 0.000 description 2
- 238000000434 field desorption mass spectrometry Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000010255 intramuscular injection Methods 0.000 description 2
- 239000007927 intramuscular injection Substances 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 2
- 210000002381 plasma Anatomy 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- RUFUOXBXVPRTQH-UHFFFAOYSA-N tert-butyl 4-(3,5-dioxopiperazin-1-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1CC(=O)NC(=O)C1 RUFUOXBXVPRTQH-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- QMLKQXIAPAAIEJ-UHFFFAOYSA-N 2-(phenylmethoxycarbonylamino)ethylazanium;chloride Chemical group Cl.NCCNC(=O)OCC1=CC=CC=C1 QMLKQXIAPAAIEJ-UHFFFAOYSA-N 0.000 description 1
- XCYKBGPXNXNABN-UHFFFAOYSA-N 2-[2-(carboxymethoxy)-4-(2-chloroacetyl)phenoxy]-2-ethylbutanoic acid Chemical compound CCC(CC)(C(O)=O)OC1=CC=C(C(=O)CCl)C=C1OCC(O)=O XCYKBGPXNXNABN-UHFFFAOYSA-N 0.000 description 1
- NQNJHISEBDIEMP-UHFFFAOYSA-N 2-[2-(carboxymethoxy)-4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=C(OCC(O)=O)C(OCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1 NQNJHISEBDIEMP-UHFFFAOYSA-N 0.000 description 1
- MZIABNWDWGCMAS-UHFFFAOYSA-N 2-[4-[2-(2,3-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)O)=CC=C1C(=O)CN1C(=O)C(=O)N(C2CCNCC2)CC1 MZIABNWDWGCMAS-UHFFFAOYSA-N 0.000 description 1
- JYRQJCZACFVJNS-UHFFFAOYSA-N 2-[4-[2-(2,5-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)C(=O)C1 JYRQJCZACFVJNS-UHFFFAOYSA-N 0.000 description 1
- MEVLFCFNEJBWTD-UHFFFAOYSA-N 2-[4-[2-(2,6-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetic acid;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1=O MEVLFCFNEJBWTD-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- KCVHRLZUYURVSY-UHFFFAOYSA-N 3-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenyl]propanoic acid;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC(CCC(=O)O)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1 KCVHRLZUYURVSY-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 239000005528 B01AC05 - Ticlopidine Substances 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical class CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical class OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 1
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 108060000200 adenylate cyclase Proteins 0.000 description 1
- 102000030621 adenylate cyclase Human genes 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- AWXFBUDOYXNHHK-UHFFFAOYSA-N benzyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1CCN(C(=O)OCC=2C=CC=CC=2)CC1 AWXFBUDOYXNHHK-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- IBLLRBTZFQZTDB-UHFFFAOYSA-N butyl 2-[4-[2-(2,5-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)C(=O)C1 IBLLRBTZFQZTDB-UHFFFAOYSA-N 0.000 description 1
- BXBCFDGYVFJKSH-UHFFFAOYSA-N butyl 2-[4-[2-(2,6-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1=O BXBCFDGYVFJKSH-UHFFFAOYSA-N 0.000 description 1
- MADMNQHYSPDNSG-UHFFFAOYSA-N butyl 2-[4-[2-(2,6-dioxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1=O MADMNQHYSPDNSG-UHFFFAOYSA-N 0.000 description 1
- DRGUNRWLIBNOBO-UHFFFAOYSA-N butyl 2-[4-[2-(2-oxo-4-piperidin-4-ylpiperazin-1-yl)acetyl]phenoxy]acetate;dihydrochloride Chemical compound Cl.Cl.C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)CN(C2CCNCC2)CC1 DRGUNRWLIBNOBO-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- YKGMKSIHIVVYKY-UHFFFAOYSA-N dabrafenib mesylate Chemical compound CS(O)(=O)=O.S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 YKGMKSIHIVVYKY-UHFFFAOYSA-N 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 235000006694 eating habits Nutrition 0.000 description 1
- 150000002148 esters Chemical group 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 1
- OWZFULPEVHKEKS-UHFFFAOYSA-N ethyl 2-chloro-2-oxoacetate Chemical compound CCOC(=O)C(Cl)=O OWZFULPEVHKEKS-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 150000002306 glutamic acid derivatives Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 230000016507 interphase Effects 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000957 no side effect Toxicity 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- DYUMLJSJISTVPV-UHFFFAOYSA-N phenyl propanoate Chemical compound CCC(=O)OC1=CC=CC=C1 DYUMLJSJISTVPV-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- KYUHWCNPQANFCF-UHFFFAOYSA-N tert-butyl 2-[4-(2-bromoacetyl)phenoxy]acetate Chemical compound CC(C)(C)OC(=O)COC1=CC=C(C(=O)CBr)C=C1 KYUHWCNPQANFCF-UHFFFAOYSA-N 0.000 description 1
- PCOKVBQRZCEGTJ-UHFFFAOYSA-N tert-butyl 2-piperidin-4-yloxyacetate Chemical compound CC(C)(C)OC(=O)COC1CCNCC1 PCOKVBQRZCEGTJ-UHFFFAOYSA-N 0.000 description 1
- TYCCTYJRBMDZDJ-UHFFFAOYSA-N tert-butyl 4-(2,3-dioxopiperazin-1-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1C(=O)C(=O)NCC1 TYCCTYJRBMDZDJ-UHFFFAOYSA-N 0.000 description 1
- XPZCEWZMMCPCFL-UHFFFAOYSA-N tert-butyl 4-(2,5-dioxopiperazin-1-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1C(=O)CNC(=O)C1 XPZCEWZMMCPCFL-UHFFFAOYSA-N 0.000 description 1
- GLDPBRPHRFPQGG-UHFFFAOYSA-N tert-butyl 4-(3-oxopiperazin-1-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1CC(=O)NCC1 GLDPBRPHRFPQGG-UHFFFAOYSA-N 0.000 description 1
- RDSCDOZKNVEYOX-UHFFFAOYSA-N tert-butyl 4-(4-benzylpiperazin-1-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1CCN(CC=2C=CC=CC=2)CC1 RDSCDOZKNVEYOX-UHFFFAOYSA-N 0.000 description 1
- RBZARBAHNMADHE-UHFFFAOYSA-N tert-butyl 4-[(2-ethoxy-2-oxoacetyl)-[2-(phenylmethoxycarbonylamino)ethyl]amino]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N(C(=O)C(=O)OCC)CCNC(=O)OCC1=CC=CC=C1 RBZARBAHNMADHE-UHFFFAOYSA-N 0.000 description 1
- OPCNKUSJXBVJGW-UHFFFAOYSA-N tert-butyl 4-[(2-ethoxy-2-oxoethyl)-[2-(phenylmethoxycarbonylamino)acetyl]amino]piperidine-1-carboxylate Chemical compound C=1C=CC=CC=1COC(=O)NCC(=O)N(CC(=O)OCC)C1CCN(C(=O)OC(C)(C)C)CC1 OPCNKUSJXBVJGW-UHFFFAOYSA-N 0.000 description 1
- BWSVCIPDXWEGMQ-UHFFFAOYSA-N tert-butyl 4-[(2-ethoxy-2-oxoethyl)amino]piperidine-1-carboxylate Chemical compound CCOC(=O)CNC1CCN(C(=O)OC(C)(C)C)CC1 BWSVCIPDXWEGMQ-UHFFFAOYSA-N 0.000 description 1
- GZIDKTJFNDTMGX-UHFFFAOYSA-N tert-butyl 4-[4-[2-[3,4-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-2-oxoethyl]-3-oxopiperazin-1-yl]piperidine-1-carboxylate Chemical compound C1=C(OCC(=O)OC(C)(C)C)C(OCC(=O)OC(C)(C)C)=CC=C1C(=O)CN1C(=O)CN(C2CCN(CC2)C(=O)OC(C)(C)C)CC1 GZIDKTJFNDTMGX-UHFFFAOYSA-N 0.000 description 1
- HSOFBVVLBAZDTI-UHFFFAOYSA-N tert-butyl 4-[4-[2-[4-(2-butoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-2,3-dioxopiperazin-1-yl]piperidine-1-carboxylate Chemical compound C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)C(=O)N(C2CCN(CC2)C(=O)OC(C)(C)C)CC1 HSOFBVVLBAZDTI-UHFFFAOYSA-N 0.000 description 1
- RTUGZXPEHSMBJY-UHFFFAOYSA-N tert-butyl 4-[4-[2-[4-(2-butoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-2,5-dioxopiperazin-1-yl]piperidine-1-carboxylate Chemical compound C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)CN(C2CCN(CC2)C(=O)OC(C)(C)C)C(=O)C1 RTUGZXPEHSMBJY-UHFFFAOYSA-N 0.000 description 1
- FJHNFGXRUIAMRZ-UHFFFAOYSA-N tert-butyl 4-[4-[2-[4-(2-butoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-3,5-dioxopiperazin-1-yl]piperidine-1-carboxylate Chemical compound C1=CC(OCC(=O)OCCCC)=CC=C1C(=O)CN1C(=O)CN(C2CCN(CC2)C(=O)OC(C)(C)C)CC1=O FJHNFGXRUIAMRZ-UHFFFAOYSA-N 0.000 description 1
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- PHWBOXQYWZNQIN-UHFFFAOYSA-N ticlopidine Chemical compound ClC1=CC=CC=C1CN1CC(C=CS2)=C2CC1 PHWBOXQYWZNQIN-UHFFFAOYSA-N 0.000 description 1
- 229960005001 ticlopidine Drugs 0.000 description 1
- DTQVDTLACAAQTR-DYCDLGHISA-N trifluoroacetic acid-d1 Chemical compound [2H]OC(=O)C(F)(F)F DTQVDTLACAAQTR-DYCDLGHISA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000003667 tyrosine derivatives Chemical class 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP16350694 | 1994-07-15 | ||
| JP13551495 | 1995-06-02 | ||
| PCT/JP1995/001419 WO1996002503A1 (fr) | 1994-07-15 | 1995-07-17 | Nouveaux composes ayant un effet inhibant l'agregation plaquettaire |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO960919D0 NO960919D0 (no) | 1996-03-07 |
| NO960919L NO960919L (no) | 1996-05-10 |
| NO305951B1 true NO305951B1 (no) | 1999-08-23 |
Family
ID=26469352
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO960919A NO305951B1 (no) | 1994-07-15 | 1996-03-07 | Kjemiske forbindelser, farmasoeytisk preparat med blodplateaggregeringshemmende egenskaper, samt anvendelse av forbindelsene til fremstilling av henholdsvis en blodplateaggregeringsinhibitor og et farmasoeytisk preparat for behandling eller foreby |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US5814636A (ko) |
| EP (1) | EP0721941A4 (ko) |
| KR (1) | KR100254666B1 (ko) |
| CN (1) | CN1134695A (ko) |
| AU (1) | AU709070B2 (ko) |
| CA (1) | CA2171850A1 (ko) |
| NO (1) | NO305951B1 (ko) |
| NZ (1) | NZ289498A (ko) |
| RU (1) | RU2156763C2 (ko) |
| TW (1) | TW397831B (ko) |
| WO (1) | WO1996002503A1 (ko) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2206053A1 (en) * | 1994-12-01 | 1996-06-06 | Toyama Chemical Co., Ltd. | Novel 2,3-diketopiperazine derivatives or their salts |
| US6069143A (en) * | 1994-12-20 | 2000-05-30 | Smithkline Beecham Corporation | Fibrinogen receptor antagonists |
| EP0796098A4 (en) * | 1994-12-22 | 1998-04-29 | Smithkline Beecham Corp | FIBRINOGEN RECEPTOR ANTAGONISTS |
| MX9704745A (es) * | 1994-12-23 | 1997-10-31 | Thomae Gmbh Dr K | Derivados de piperazina, medicamentos que contienen estos compuestos, su empleo y procedimientos para su preparacion. |
| US5889006A (en) * | 1995-02-23 | 1999-03-30 | Schering Corporation | Muscarinic antagonists |
| NZ321575A (en) * | 1995-10-30 | 1999-05-28 | Janssen Pharmaceutica Nv | 1-(1,2-disubstituted piperidinyl)-4- substituted piperazine derivatives |
| TW429256B (en) * | 1995-12-27 | 2001-04-11 | Janssen Pharmaceutica Nv | 1-(1,2-disubstituted piperidinyl)-4-(benzimidazolyl- and imidazopyridinyl)-piperidine derivatives |
| TW382017B (en) | 1995-12-27 | 2000-02-11 | Janssen Pharmaceutica Nv | 1-(1,2-disubstituted piperidinyl)-4-(fused imidazole)-piperidine derivatives |
| TW531537B (en) | 1995-12-27 | 2003-05-11 | Janssen Pharmaceutica Nv | 1-(1,2-disubstituted piperidinyl)-4-substituted piperidine derivatives |
| AU2044297A (en) * | 1996-03-29 | 1997-10-22 | Meiji Seika Kaisha Ltd. | Novel heterocyclic compounds having platelet aggregation inhibitory effects |
| US5990107A (en) * | 1996-06-28 | 1999-11-23 | Merck & Co., Inc. | Fibrinogen receptor antagonist prodrugs |
| UA62985C2 (en) * | 1997-11-10 | 2004-01-15 | Lunnbeck As H | A method for the preparation of citalopram |
| EP1070712A4 (en) * | 1998-04-09 | 2005-01-05 | Meiji Seika Kaisha | NITROGEN-CONTAINING HETEROCYCLES WITH ANTI-BLOOD INFLAMMATION AND THEIR MEDICAL USE |
| GB0025354D0 (en) | 2000-10-17 | 2000-11-29 | Glaxo Group Ltd | Chemical compounds |
| GB0203022D0 (en) | 2002-02-08 | 2002-03-27 | Glaxo Group Ltd | Chemical compounds |
| GB0203020D0 (en) * | 2002-02-08 | 2002-03-27 | Glaxo Group Ltd | Chemical compounds |
| US7482365B2 (en) | 2002-02-08 | 2009-01-27 | Glaxo Group Limited | Piperidylcarboxamide derivatives and their use in the treatment of tachykinin-mediated diseases |
| NZ556628A (en) * | 2005-03-08 | 2009-09-25 | Janssen Pharmaceutica Nv | Diaza-spiro-[4.4]-nonane derivatives as neurokinin (NK1) antagonists |
| EP2670722B1 (en) | 2011-01-31 | 2016-10-12 | Council of Scientific & Industrial Research | Chiral 1-(4-methylphenylmethyl)-5-oxo-{n-[(3-t-butoxycarbonyl-aminomethyl)]-piperidin-1-yl}-pyrrolidine-2-carboxamides as inhibitors of collagen induced platelet activation and adhesion |
| CN114920722B (zh) * | 2021-06-02 | 2024-03-08 | 何黎琴 | 一种7-羟基-3-乙酰基香豆素肟类化合物、其制备方法及医药用途 |
| WO2023122481A2 (en) * | 2021-12-20 | 2023-06-29 | Sigma-Aldrich Co. Llc | Chemical linkers |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1278166A (en) * | 1970-04-14 | 1972-06-14 | Yoshitomo Pharmaceutical Ind L | Novel pyrrolidine and piperidine derivarives and pharmaceutical compositions containing them |
| US5225402A (en) * | 1989-02-10 | 1993-07-06 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives |
| ES2056259T3 (es) * | 1989-02-10 | 1994-10-01 | Otsuka Pharma Co Ltd | Derivados de carboestirilo. |
| US5442004A (en) * | 1989-10-05 | 1995-08-15 | Raychem Limited | Gels |
| US5273982A (en) * | 1990-03-09 | 1993-12-28 | Hoffmann-La Roche Inc. | Acetic acid derivatives |
| DE4107857A1 (de) * | 1991-03-12 | 1992-09-17 | Thomae Gmbh Dr K | Cyclische harnstoffderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| DE4127404A1 (de) * | 1991-08-19 | 1993-02-25 | Thomae Gmbh Dr K | Cyclische iminoderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| AU2915892A (en) * | 1991-11-14 | 1993-06-15 | Glaxo Group Limited | Piperidine acetic acid derivatives as inhibitors of fibrinogen-dependent blood platelet aggregation |
| DE4241632A1 (de) * | 1992-12-10 | 1994-06-16 | Thomae Gmbh Dr K | Carbonsäurederivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| DE4326344A1 (de) * | 1993-08-05 | 1995-02-09 | Thomae Gmbh Dr K | Carbonamide, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| US5700801A (en) * | 1994-12-23 | 1997-12-23 | Karl Thomae, Gmbh | Piperazine derivatives, pharmaceutical compositions containing these compounds, their use and processes for preparing them |
-
1995
- 1995-07-17 AU AU29367/95A patent/AU709070B2/en not_active Ceased
- 1995-07-17 US US08/615,227 patent/US5814636A/en not_active Expired - Fee Related
- 1995-07-17 EP EP95925137A patent/EP0721941A4/en not_active Ceased
- 1995-07-17 RU RU96109467/04A patent/RU2156763C2/ru active
- 1995-07-17 CN CN95190807A patent/CN1134695A/zh active Pending
- 1995-07-17 TW TW084107435A patent/TW397831B/zh not_active IP Right Cessation
- 1995-07-17 WO PCT/JP1995/001419 patent/WO1996002503A1/ja not_active Application Discontinuation
- 1995-07-17 KR KR1019960701317A patent/KR100254666B1/ko not_active IP Right Cessation
- 1995-07-17 CA CA002171850A patent/CA2171850A1/en not_active Abandoned
- 1995-07-17 NZ NZ289498A patent/NZ289498A/en unknown
-
1996
- 1996-03-07 NO NO960919A patent/NO305951B1/no not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CA2171850A1 (en) | 1996-02-01 |
| NO960919D0 (no) | 1996-03-07 |
| EP0721941A1 (en) | 1996-07-17 |
| US5814636A (en) | 1998-09-29 |
| TW397831B (en) | 2000-07-11 |
| NO960919L (no) | 1996-05-10 |
| AU2936795A (en) | 1996-02-16 |
| EP0721941A4 (en) | 1996-09-25 |
| KR960704876A (ko) | 1996-10-09 |
| AU709070B2 (en) | 1999-08-19 |
| RU2156763C2 (ru) | 2000-09-27 |
| NZ289498A (en) | 1998-02-26 |
| CN1134695A (zh) | 1996-10-30 |
| KR100254666B1 (ko) | 2000-05-01 |
| WO1996002503A1 (fr) | 1996-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO305951B1 (no) | Kjemiske forbindelser, farmasoeytisk preparat med blodplateaggregeringshemmende egenskaper, samt anvendelse av forbindelsene til fremstilling av henholdsvis en blodplateaggregeringsinhibitor og et farmasoeytisk preparat for behandling eller foreby | |
| EP0383579B1 (en) | N-Phenyl-N-(4-piperidinyl)amides useful as analgesics | |
| RU2396257C2 (ru) | Производные 4-аминопиперидина | |
| JP4366079B2 (ja) | ビピペリジニル誘導体およびケモカインレセプターインヒビターとしてのそれらの使用 | |
| CA2867114C (en) | Piperidine derivatives for gpr119 agonist | |
| TW200922602A (en) | Phosphonic acid derivatives | |
| IL115572A (en) | -4 (Azaneptuelamino) Piperidines, salts of these, pharmaceutical preparations containing them, and process for their preparation | |
| KR20010043032A (ko) | 1-[(1-치환-4-피페리디닐)메틸]-4-피페리딘 유도체, 그의제조방법, 그것을 함유하는의약조성물 및 이 화합물의중간체 | |
| TW201326143A (zh) | Ｇ蛋白偶合ｍａｓ受體之調節劑及與其相關病症之治療 | |
| IL172529A (en) | Substituted diketopiperazines, process for their preparation and their use in the preparation of medicaments for antagonizing the effects of oxytocin on the oxytocin receptor | |
| CN102325754A (zh) | 含杂原子的环状化合物 | |
| NO329899B1 (no) | Propionsyrederivater som hemmer binding av integriner til deres reseptorer, farmasoytiske preparater som omfatter forbindelsene, samt anvendelse av forbindelsene til fremstilling av medikamenter | |
| CA3160508A1 (en) | Substituted ((((6-benzylamino-5-fluoropyrimidin-4-yl)amino)methyl)-piperidin-1-yl)acetamide compounds active towards nuclear receptors | |
| JP2021513530A (ja) | テトラヒドロイソキノリン化合物、その調製方法、そのような化合物を含む医薬組成物およびその使用 | |
| KR100735781B1 (ko) | 이소퀴놀린 화합물 및 그의 의약 용도 | |
| EP0228246A2 (en) | Isoquinoline compounds | |
| JP2004277319A (ja) | １−（４−ピペリジニルメチル）ピペリジニルアミド誘導体およびそれを含有する医薬組成物 | |
| EP1193259A1 (en) | Dihydropyrimidine derivatives | |
| RU2175970C2 (ru) | Производные пиперидинилметилоксазолидин-2-она, способ их получения и фармацевтическая композиция на их основе | |
| EP1785415B1 (en) | Piperidine derivative or pharmaceutically acceptable salt thereof | |
| IL93814A (en) | History of benzothiophyranilamines, their preparation and pharmaceutical preparations containing them | |
| DE19636623A1 (de) | Abgewandelte Aminosäuren, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| KR100848490B1 (ko) | 베타아미노기를 갖는 1,2,5-트리아제판 유도체, 이의약학적으로 허용 가능한 염 및 이의 제조 방법 | |
| CZ340697A3 (cs) | Fenylamidinové deriváty, způsob jejich výroby a farmaceutický prostředek s jejich obsahem | |
| JPWO2004080965A1 (ja) | ニューロペプチドｆｆ受容体拮抗剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM1K | Lapsed by not paying the annual fees |
Free format text: LAPSED IN JANUARY 2003 |