NO136711B - - Google Patents
Download PDFInfo
- Publication number
- NO136711B NO136711B NO1301/72A NO130172A NO136711B NO 136711 B NO136711 B NO 136711B NO 1301/72 A NO1301/72 A NO 1301/72A NO 130172 A NO130172 A NO 130172A NO 136711 B NO136711 B NO 136711B
- Authority
- NO
- Norway
- Prior art keywords
- formula
- compound
- picolinic acid
- lower alkyl
- alkyl group
- Prior art date
Links
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 claims description 7
- 150000004659 dithiocarbamates Chemical class 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- -1 amine salt Chemical class 0.000 claims description 4
- 125000004185 ester group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229940081066 picolinic acid Drugs 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 150000003943 catecholamines Chemical class 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- RVQXLTFKCWKQOJ-UHFFFAOYSA-N ethyl 5-(chloromethyl)pyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(CCl)C=N1 RVQXLTFKCWKQOJ-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 208000020925 Bipolar disease Diseases 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 208000018737 Parkinson disease Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 3
- 208000007848 Alcoholism Diseases 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 210000004100 adrenal gland Anatomy 0.000 description 2
- 201000007930 alcohol dependence Diseases 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000000043 antiallergic agent Substances 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 210000002216 heart Anatomy 0.000 description 2
- 201000000980 schizophrenia Diseases 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 description 1
- 108010015720 Dopamine beta-Hydroxylase Proteins 0.000 description 1
- 102100033156 Dopamine beta-hydroxylase Human genes 0.000 description 1
- 206010013883 Dwarfism Diseases 0.000 description 1
- 102000018997 Growth Hormone Human genes 0.000 description 1
- 108010051696 Growth Hormone Proteins 0.000 description 1
- 206010062767 Hypophysitis Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229960000258 corticotropin Drugs 0.000 description 1
- IDLFZVILOHSSID-OVLDLUHVSA-N corticotropin Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@@H](N)CO)C1=CC=C(O)C=C1 IDLFZVILOHSSID-OVLDLUHVSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- IFEFSAVXWIHYIT-UHFFFAOYSA-N ethyl 5-(hydroxymethyl)pyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(CO)C=N1 IFEFSAVXWIHYIT-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000122 growth hormone Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000009399 inbreeding Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 210000003635 pituitary gland Anatomy 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 210000000697 sensory organ Anatomy 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- VMSRVIHUFHQIAL-UHFFFAOYSA-M sodium;n,n-dimethylcarbamodithioate Chemical compound [Na+].CN(C)C([S-])=S VMSRVIHUFHQIAL-UHFFFAOYSA-M 0.000 description 1
- XWIDAPBPUKQFRJ-UHFFFAOYSA-M sodium;n-propan-2-ylcarbamodithioate Chemical compound [Na+].CC(C)NC([S-])=S XWIDAPBPUKQFRJ-UHFFFAOYSA-M 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2389271A JPS5429503B1 (ru) | 1971-04-16 | 1971-04-16 | |
| JP9528271A JPS5429506B2 (ru) | 1971-11-29 | 1971-11-29 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO136711B true NO136711B (ru) | 1977-07-18 |
| NO136711C NO136711C (no) | 1977-10-26 |
Family
ID=26361331
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1301/72A NO136711C (no) | 1971-04-16 | 1972-04-14 | Analogifremgangsm}te for fremstilling av terapeutisk aktive pikolinsyrederivater |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3776913A (ru) |
| AR (1) | AR206674A1 (ru) |
| BE (1) | BE781989A (ru) |
| CH (1) | CH569714A5 (ru) |
| DK (1) | DK143272C (ru) |
| ES (1) | ES401829A1 (ru) |
| FI (1) | FI55190C (ru) |
| FR (1) | FR2133822B1 (ru) |
| GB (1) | GB1369718A (ru) |
| IL (1) | IL39179A (ru) |
| NL (1) | NL173955C (ru) |
| NO (1) | NO136711C (ru) |
| SE (1) | SE391522B (ru) |
| SU (1) | SU436492A3 (ru) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2544869B2 (es) * | 2014-03-04 | 2016-01-18 | Universidade De Vigo | Derivados de piridazin-3(2H)-ona inhibidores selectivos de la isoforma B de la monoaminooxidasa |
-
1972
- 1972-01-01 AR AR241465A patent/AR206674A1/es active
- 1972-04-10 DK DK173572A patent/DK143272C/da not_active IP Right Cessation
- 1972-04-10 IL IL39179A patent/IL39179A/en unknown
- 1972-04-12 BE BE781989A patent/BE781989A/xx not_active IP Right Cessation
- 1972-04-13 FI FI1045/72A patent/FI55190C/fi active
- 1972-04-14 GB GB1742472A patent/GB1369718A/en not_active Expired
- 1972-04-14 SE SE7204907A patent/SE391522B/xx unknown
- 1972-04-14 NO NO1301/72A patent/NO136711C/no unknown
- 1972-04-14 CH CH560772A patent/CH569714A5/xx not_active IP Right Cessation
- 1972-04-14 NL NLAANVRAGE7205035,A patent/NL173955C/xx not_active IP Right Cessation
- 1972-04-14 SU SU1773636A patent/SU436492A3/ru active
- 1972-04-17 FR FR7213458A patent/FR2133822B1/fr not_active Expired
- 1972-04-17 US US00244904A patent/US3776913A/en not_active Expired - Lifetime
- 1972-04-17 ES ES72401829A patent/ES401829A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL39179A0 (en) | 1972-06-28 |
| DE2218248A1 (de) | 1972-10-26 |
| FR2133822B1 (ru) | 1976-04-16 |
| DE2218248B2 (de) | 1977-03-17 |
| NL7205035A (ru) | 1972-10-18 |
| US3776913A (en) | 1973-12-04 |
| FI55190B (fi) | 1979-02-28 |
| NL173955B (nl) | 1983-11-01 |
| AR206674A1 (es) | 1976-08-13 |
| BE781989A (fr) | 1972-10-12 |
| NO136711C (no) | 1977-10-26 |
| IL39179A (en) | 1976-03-31 |
| GB1369718A (en) | 1974-10-09 |
| FR2133822A1 (ru) | 1972-12-01 |
| NL173955C (nl) | 1984-04-02 |
| CH569714A5 (ru) | 1975-11-28 |
| DK143272B (da) | 1981-08-03 |
| FI55190C (fi) | 1979-06-11 |
| DK143272C (da) | 1981-12-07 |
| ES401829A1 (es) | 1975-11-01 |
| SU436492A3 (ru) | 1974-07-15 |
| SE391522B (sv) | 1977-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2583920C (en) | Non-peptide bradykinin antagonists and pharmaceutical compositions therefrom | |
| US4727150A (en) | Pyridyl methylsulfinyl benzimidazole derivatives | |
| NO164476B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk virksomme 1,2,3,5-tetrahydroimidazo-(2,1-b)-kinazoliner. | |
| NO154089B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazolderivater. | |
| NO151137B (no) | Rengjoeringsredskap for stoevsuging | |
| NO137825B (no) | Analogifremgangsm}te for fremstilling av terapeutisk aktive tetrazolsubstituerte kromonderivater | |
| CS226021B2 (en) | Method of presparing piperidine propylderivatives | |
| DE1595920A1 (de) | 4-(omega-Piperazinoalkyl)-pyrazole,ihre Salze und Verfahren zu ihrer Herstellung | |
| NO770161L (no) | Tiazolidinderivater og fremgangsm}te til deres fremstilling. | |
| DE68924221T2 (de) | Imidazolderivate. | |
| NO136711B (ru) | ||
| US3743646A (en) | Amides of 3-(2-halophenyl-5-tetrazolyl)propionic acids | |
| NO761926L (ru) | ||
| CH622777A5 (ru) | ||
| SU1433411A3 (ru) | Способ получени производных 2-(1Н)-хинолона или их фармацевтически приемлемых солей | |
| US2377395A (en) | Pyrimidine derivatives and peocesb | |
| US4460775A (en) | 2-(3-Mercapto-1-oxopropyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid derivatives | |
| US3974169A (en) | α-[2-(2-Pyridyl)ethylamino]phenylacetic acid dihydrochloride Hemihydrate | |
| DE1801205A1 (de) | Aminoalkylierte Thioaether von 2-Mercaptoindolen und Verfahren zu ihrer Herstellung | |
| US3468889A (en) | O-and/or s-nicotinoyl diacylthiamines and acylation process for preparing the same | |
| US5719293A (en) | Intermediate for preparing a pharmaceutically active compound | |
| US4092322A (en) | 1-Benzoxepino[4,3-c]pyridines | |
| DK168377B1 (da) | N-(1H-indol-4-yl)-benzamidderivater og deres salte, fremgangsmåde til deres fremstilling samt farmaceutiske præparater indeholdende dem | |
| HU182782B (en) | Process for producing alkylthio-benzimidazoles | |
| US3812135A (en) | Pyrroloindole and pyridoindole derivatives |