NO127300B - - Google Patents
Download PDFInfo
- Publication number
- NO127300B NO127300B NO2451/70A NO245170A NO127300B NO 127300 B NO127300 B NO 127300B NO 2451/70 A NO2451/70 A NO 2451/70A NO 245170 A NO245170 A NO 245170A NO 127300 B NO127300 B NO 127300B
- Authority
- NO
- Norway
- Prior art keywords
- chloroform
- solution
- added
- mixture
- potassium hydroxide
- Prior art date
Links
- -1 1,2-disubstituted-4-pyrazolidinols Chemical class 0.000 claims description 19
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 72
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 70
- 239000000243 solution Substances 0.000 description 25
- 239000000203 mixture Substances 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 15
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 7
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- UXILCSZJNQSVKU-UHFFFAOYSA-N 1,2-diethylpyrazolidin-4-ol Chemical compound CCN1CC(O)CN1CC UXILCSZJNQSVKU-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 150000002429 hydrazines Chemical class 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- HELODTZNVFWOIK-UHFFFAOYSA-N 1-hydroxypyrazolidine Chemical group ON1CCCN1 HELODTZNVFWOIK-UHFFFAOYSA-N 0.000 description 4
- 239000003637 basic solution Substances 0.000 description 4
- 239000002026 chloroform extract Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- GRRIYLZJLGTQJX-UHFFFAOYSA-N 1,2-dibenzoylhydrazine Chemical compound C=1C=CC=CC=1C(=O)NNC(=O)C1=CC=CC=C1 GRRIYLZJLGTQJX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229940008406 diethyl sulfate Drugs 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 description 2
- HDCUSMZVZWLDRZ-UHFFFAOYSA-N 1-benzyl-2-methylhydrazine Chemical compound CNNCC1=CC=CC=C1 HDCUSMZVZWLDRZ-UHFFFAOYSA-N 0.000 description 2
- ANLRYZKIYUPHRY-UHFFFAOYSA-N 1-methyl-2-propan-2-ylhydrazine Chemical compound CNNC(C)C ANLRYZKIYUPHRY-UHFFFAOYSA-N 0.000 description 2
- DQIWHUCPKPPCPK-UHFFFAOYSA-N N'-acetyl-N,N'-diethylacetohydrazide Chemical compound C(C)(=O)N(N(CC)C(C)=O)CC DQIWHUCPKPPCPK-UHFFFAOYSA-N 0.000 description 2
- IMNWEUTXDBEAGY-UHFFFAOYSA-N N'-acetyl-N-methyl-N'-propan-2-ylacetohydrazide Chemical compound C(C)(=O)N(N(C)C(C)=O)C(C)C IMNWEUTXDBEAGY-UHFFFAOYSA-N 0.000 description 2
- ZLHNYIHIHQEHJQ-UHFFFAOYSA-N N,N'-Diacetylhydrazine Chemical compound CC(=O)NNC(C)=O ZLHNYIHIHQEHJQ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000008050 dialkyl sulfates Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- YCBOYOYVDOUXLH-UHFFFAOYSA-N 1,2-Diethylhydrazine Chemical compound CCNNCC YCBOYOYVDOUXLH-UHFFFAOYSA-N 0.000 description 1
- 229940051269 1,3-dichloro-2-propanol Drugs 0.000 description 1
- XEFCZINKJMACOI-UHFFFAOYSA-N 1-benzyl-2-methylpyrazolidin-4-ol Chemical compound CN1CC(O)CN1CC1=CC=CC=C1 XEFCZINKJMACOI-UHFFFAOYSA-N 0.000 description 1
- IAYQMOHXOMVPHT-UHFFFAOYSA-N 1-cyclopentyl-2-methylhydrazine Chemical compound CNNC1CCCC1 IAYQMOHXOMVPHT-UHFFFAOYSA-N 0.000 description 1
- XRFLFPRBIWPVSR-UHFFFAOYSA-N 1-ethyl-2-methylpyrazolidin-4-ol Chemical compound C(C)N1N(CC(C1)O)C XRFLFPRBIWPVSR-UHFFFAOYSA-N 0.000 description 1
- RQCZSXLNQYJSSU-UHFFFAOYSA-N 1-methyl-2-propan-2-ylpyrazolidin-4-ol Chemical compound C(C)(C)N1N(CC(C1)O)C RQCZSXLNQYJSSU-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- PTCQEPPJNFTFFC-UHFFFAOYSA-N N'-acetyl-N'-cyclopentyl-N-methylacetohydrazide Chemical compound C(C)(=O)N(N(C)C(C)=O)C1CCCC1 PTCQEPPJNFTFFC-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WHRIKZCFRVTHJH-UHFFFAOYSA-N ethylhydrazine Chemical compound CCNN WHRIKZCFRVTHJH-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- VGVYRHYDNGFIGF-UHFFFAOYSA-N fumarin Chemical class OC=1OC2=CC=CC=C2C(=O)C=1C(CC(=O)C)C1=CC=CO1 VGVYRHYDNGFIGF-UHFFFAOYSA-N 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- HSPCCASGCDMMSH-UHFFFAOYSA-N n'-benzoyl-n'-ethylbenzohydrazide Chemical compound C=1C=CC=CC=1C(=O)N(CC)NC(=O)C1=CC=CC=C1 HSPCCASGCDMMSH-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000013014 purified material Substances 0.000 description 1
- RPHNCVUQQDZKLE-UHFFFAOYSA-N pyrazolidin-4-ol Chemical class OC1CNNC1 RPHNCVUQQDZKLE-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/04—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83661769A | 1969-06-25 | 1969-06-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO127300B true NO127300B (cs) | 1973-06-04 |
Family
ID=25272340
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO2451/70A NO127300B (cs) | 1969-06-25 | 1970-06-24 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3660426A (cs) |
| AT (2) | AT297696B (cs) |
| BE (1) | BE751562A (cs) |
| CH (1) | CH511854A (cs) |
| DE (1) | DE2031489C2 (cs) |
| DK (1) | DK126504B (cs) |
| ES (1) | ES380355A1 (cs) |
| FR (1) | FR2053022B1 (cs) |
| GB (1) | GB1309018A (cs) |
| NL (1) | NL168222C (cs) |
| NO (1) | NO127300B (cs) |
| OA (1) | OA03440A (cs) |
| SE (2) | SE396599B (cs) |
| ZA (1) | ZA704377B (cs) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4309552A (en) * | 1980-08-07 | 1982-01-05 | A. H. Robins Company, Inc. | Synthesis of 4-nitro-1,2-hydrocarbyl pyrazolidines and process for preparation thereof |
| DE3031385A1 (de) * | 1980-08-20 | 1982-04-08 | Basf Ag, 6700 Ludwigshafen | 1-hydroxypyrazol und verfahren zu seiner herstellung |
| US5117057A (en) * | 1985-10-21 | 1992-05-26 | Rohm And Haas Company | Insecticidal N' substituted-N-N'-disubstituted-hydrazines |
| US5225443A (en) * | 1986-05-01 | 1993-07-06 | Rohm And Haas Company | Insecticidal N'-substituted-N'-substituted N,N'-diacylhydrazines |
| JP2735840B2 (ja) * | 1988-09-02 | 1998-04-02 | 日本レダリー株式会社 | ピラゾリジン誘導体およびピラゾリジノン誘導体 |
-
1969
- 1969-06-25 US US836617A patent/US3660426A/en not_active Expired - Lifetime
-
1970
- 1970-06-03 ES ES380355A patent/ES380355A1/es not_active Expired
- 1970-06-05 BE BE751562D patent/BE751562A/xx unknown
- 1970-06-23 SE SE7304439A patent/SE396599B/xx unknown
- 1970-06-23 GB GB3041770A patent/GB1309018A/en not_active Expired
- 1970-06-23 SE SE08673/70A patent/SE367627B/xx unknown
- 1970-06-24 NO NO2451/70A patent/NO127300B/no unknown
- 1970-06-24 AT AT571070A patent/AT297696B/de not_active IP Right Cessation
- 1970-06-24 AT AT729571A patent/AT319908B/de not_active IP Right Cessation
- 1970-06-24 NL NLAANVRAGE7009283,A patent/NL168222C/xx not_active IP Right Cessation
- 1970-06-24 CH CH958270A patent/CH511854A/fr not_active IP Right Cessation
- 1970-06-24 FR FR707023413A patent/FR2053022B1/fr not_active Expired
- 1970-06-24 DK DK328870AA patent/DK126504B/da unknown
- 1970-06-25 DE DE2031489A patent/DE2031489C2/de not_active Expired
- 1970-06-25 ZA ZA704377A patent/ZA704377B/xx unknown
- 1970-06-25 OA OA53962A patent/OA03440A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA704377B (en) | 1971-03-31 |
| NL168222B (nl) | 1981-10-16 |
| SE396599B (sv) | 1977-09-26 |
| SE367627B (cs) | 1974-06-04 |
| GB1309018A (en) | 1973-03-07 |
| US3660426A (en) | 1972-05-02 |
| FR2053022B1 (cs) | 1973-06-08 |
| FR2053022A1 (cs) | 1971-04-16 |
| DE2031489A1 (de) | 1971-01-07 |
| AT297696B (de) | 1972-04-10 |
| BE751562A (fr) | 1970-11-16 |
| AT319908B (de) | 1975-01-10 |
| OA03440A (fr) | 1971-03-30 |
| CH511854A (fr) | 1971-08-31 |
| NL7009283A (cs) | 1970-12-29 |
| NL168222C (nl) | 1982-03-16 |
| ES380355A1 (es) | 1973-04-16 |
| DK126504B (da) | 1973-07-23 |
| DE2031489C2 (de) | 1982-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU867298A3 (ru) | Способ получени производных пиперидина или их солей | |
| DE69619809T2 (de) | Verfahren zur herstellung von (s)-3-(aminoethyl)-5-metylhexansäure | |
| SU552025A3 (ru) | Способ получени производных фенил-имидазолил-алканов | |
| DK152726B (da) | Fremgangsmaade til fremstilling af monoacetaler af aromatiske 1,2-diketoner | |
| EP1254883A1 (en) | Process for producing sobstituted 1,1,1-trifluoro-3-butene-2-ones | |
| DK154563B (da) | Fremgangsmaade til fremstilling af en racemisk eller optisk aktiv (+)-thiolacton eller (+)-bioton | |
| NO120506B (cs) | ||
| NO127300B (cs) | ||
| SU683623A3 (ru) | Способ получени производных пурина или их солей | |
| SU563120A3 (ru) | Способ получени производных 1-фенокси-3-аминопропан2-ола или их солей | |
| NO120075B (cs) | ||
| US4308206A (en) | Process for preparing derivatives of 5,11-dihydro-6h-pyrido[2,3-b][1,4]-benzodiazepin-6-one, and the final derivatives and synthesis intermediates obtained thereby | |
| US3952010A (en) | Catalytic dehydrogenation process for the preparation of 3,5-disubstituted pyrazoles | |
| NO312027B1 (no) | Fremgangsmåte for fremstilling av O-(3-amino-2- hydroksypropyl)-hydroksiminsyrehalogenider | |
| SU582768A3 (ru) | Способ получени производных биспиперазиноандростана | |
| US4275216A (en) | Process for preparing 4(5)-hydroxymethyl 5(4)-lower alkyl imidazoles | |
| FI80685B (fi) | Foerfarande foer framstaellning av dihydroaryloxialkylamino-1,2,4-triazolderivat. | |
| US2916495A (en) | Beta-thianaphthenylalkyl hydrazines and intermediates | |
| SU1490121A1 (ru) | Способ получени 5-гидрокси-5-метил-4-оксо-3-арилпирролидино[1,2- @ ]пиразолов | |
| NO134767B (cs) | ||
| CN116041156B (zh) | 5-(2,4,6-三甲苯基)-2-丙酰基-3-羟基-2-环己烯-1-酮的合成方法 | |
| US4113742A (en) | Process for the preparation of alpha-pyrones | |
| DK158038B (da) | Fremgangsmaade til fremstilling af di-n-propylacetonitril | |
| US3122556A (en) | -phenoxyalkyl | |
| CA1129865A (en) | Process for preparing 3-(4-pyridinyl)-2-cyclohexen-1- one oxime |