NO125724B - - Google Patents
Download PDFInfo
- Publication number
- NO125724B NO125724B NO5013/68A NO501368A NO125724B NO 125724 B NO125724 B NO 125724B NO 5013/68 A NO5013/68 A NO 5013/68A NO 501368 A NO501368 A NO 501368A NO 125724 B NO125724 B NO 125724B
- Authority
- NO
- Norway
- Prior art keywords
- formula
- acid
- phenyl
- substituted
- salt
- Prior art date
Links
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 19
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical class C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- 150000001768 cations Chemical class 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 150000007529 inorganic bases Chemical class 0.000 claims description 6
- 150000007530 organic bases Chemical class 0.000 claims description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 claims description 6
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 5
- XFBFAOFHQQXDCX-UHFFFAOYSA-N 2-(2-anilinophenyl)-2-oxoacetic acid Chemical compound N(C1=CC=CC=C1)C1=C(C=CC=C1)C(C(=O)O)=O XFBFAOFHQQXDCX-UHFFFAOYSA-N 0.000 claims description 4
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical class C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 4
- 238000006798 ring closing metathesis reaction Methods 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 74
- 239000000243 solution Substances 0.000 description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000003208 petroleum Substances 0.000 description 15
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- -1 methoxy, ethoxy, n-propoxy, isopropoxy, n-butoxy Chemical group 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
- QKHCOLJVUBQEMB-UHFFFAOYSA-N 1-(2,6-dimethylphenyl)indole-2,3-dione Chemical compound CC1=C(C(=CC=C1)C)N1C(C(C2=CC=CC=C12)=O)=O QKHCOLJVUBQEMB-UHFFFAOYSA-N 0.000 description 4
- SQIUEWNROMQRQY-UHFFFAOYSA-N 2,6-dimethyl-n-phenylaniline Chemical group CC1=CC=CC(C)=C1NC1=CC=CC=C1 SQIUEWNROMQRQY-UHFFFAOYSA-N 0.000 description 4
- ICJTVRXTYOYEOT-UHFFFAOYSA-N 2-[2-(2,6-dimethylanilino)phenyl]acetic acid Chemical compound CC1=CC=CC(C)=C1NC1=CC=CC=C1CC(O)=O ICJTVRXTYOYEOT-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 4
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 4
- 150000001447 alkali salts Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 229960003424 phenylacetic acid Drugs 0.000 description 4
- 239000003279 phenylacetic acid Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZKYWDEUSHBRHBI-UHFFFAOYSA-N 2-(2,6-dimethylanilino)benzoic acid Chemical compound CC1=CC=CC(C)=C1NC1=CC=CC=C1C(O)=O ZKYWDEUSHBRHBI-UHFFFAOYSA-N 0.000 description 3
- XIUHOHOPFVHIEV-UHFFFAOYSA-N 2-[2-(2,6-dimethylanilino)phenyl]-2-oxoacetic acid Chemical compound CC1=C(NC2=C(C=CC=C2)C(C(=O)O)=O)C(=CC=C1)C XIUHOHOPFVHIEV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- MGEGDVKBXGZTRM-UHFFFAOYSA-N 1-(2,6-dichlorophenyl)indole-2,3-dione Chemical compound ClC1=CC=CC(Cl)=C1N1C2=CC=CC=C2C(=O)C1=O MGEGDVKBXGZTRM-UHFFFAOYSA-N 0.000 description 2
- MBGSBDUEVSDONF-UHFFFAOYSA-N 1-(4-methoxy-3-methylphenyl)indole-2,3-dione Chemical compound COC1=CC=C(C=C1C)N1C(C(C2=CC=CC=C12)=O)=O MBGSBDUEVSDONF-UHFFFAOYSA-N 0.000 description 2
- SLPAPGNFCSVQKP-UHFFFAOYSA-N 2,6-dichloro-3-methyl-n-phenylaniline Chemical compound CC1=CC=C(Cl)C(NC=2C=CC=CC=2)=C1Cl SLPAPGNFCSVQKP-UHFFFAOYSA-N 0.000 description 2
- HDUUZPLYVVQTKN-UHFFFAOYSA-N 2,6-dichloro-n-phenylaniline Chemical compound ClC1=CC=CC(Cl)=C1NC1=CC=CC=C1 HDUUZPLYVVQTKN-UHFFFAOYSA-N 0.000 description 2
- TXARYTJORYGQKX-UHFFFAOYSA-N 2,6-dimethyl-n-(4-methylphenyl)aniline Chemical group C1=CC(C)=CC=C1NC1=C(C)C=CC=C1C TXARYTJORYGQKX-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical group CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- FAFKIFYBYASEDL-UHFFFAOYSA-N 2-(2,6-dichloroanilino)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl FAFKIFYBYASEDL-UHFFFAOYSA-N 0.000 description 2
- JOXPQVQKTURDSS-UHFFFAOYSA-N 2-(2,6-dimethylanilino)-5-methylbenzoic acid Chemical compound OC(=O)C1=CC(C)=CC=C1NC1=C(C)C=CC=C1C JOXPQVQKTURDSS-UHFFFAOYSA-N 0.000 description 2
- HOVGGLRIZGQIJM-UHFFFAOYSA-N 2-(4-methoxy-3-methylanilino)benzoic acid Chemical compound C1=C(C)C(OC)=CC=C1NC1=CC=CC=C1C(O)=O HOVGGLRIZGQIJM-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- NXHYVXRWKQWGCL-UHFFFAOYSA-N 2-chloro-6-methyl-n-phenylaniline Chemical compound CC1=CC=CC(Cl)=C1NC1=CC=CC=C1 NXHYVXRWKQWGCL-UHFFFAOYSA-N 0.000 description 2
- PAGQEMVOSGYMNU-UHFFFAOYSA-N 2-methoxy-5-methyl-N-phenylaniline Chemical compound C1(=CC=CC=C1)NC1=C(C=CC(=C1)C)OC PAGQEMVOSGYMNU-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- SBDNJUWAMKYJOX-UHFFFAOYSA-N Meclofenamic Acid Chemical compound CC1=CC=C(Cl)C(NC=2C(=CC=CC=2)C(O)=O)=C1Cl SBDNJUWAMKYJOX-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- DQYPHQHFXVXYRN-UHFFFAOYSA-N N(C=1C(=CC=CC=1C)C)C1=C(C=CC=C1CC(=O)O)C Chemical compound N(C=1C(=CC=CC=1C)C)C1=C(C=CC=C1CC(=O)O)C DQYPHQHFXVXYRN-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical class OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- DWVWVSLAIJHBBG-UHFFFAOYSA-N n-(2,6-dichlorophenyl)acetamide Chemical compound CC(=O)NC1=C(Cl)C=CC=C1Cl DWVWVSLAIJHBBG-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YEZNLOUZAIOMLT-UHFFFAOYSA-N tolfenamic acid Chemical compound CC1=C(Cl)C=CC=C1NC1=CC=CC=C1C(O)=O YEZNLOUZAIOMLT-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VIHACNGXYPWCPM-UHFFFAOYSA-N 1-(2,4-dichloro-3-methylphenyl)indole-2,3-dione Chemical compound ClC1=C(C(=CC=C1N1C(C(C2=CC=CC=C12)=O)=O)Cl)C VIHACNGXYPWCPM-UHFFFAOYSA-N 0.000 description 1
- NMZDCIXVKOQWIW-UHFFFAOYSA-N 1-(3-chloro-2-methylphenyl)indole-2,3-dione Chemical compound CC1=C(Cl)C=CC=C1N1C2=CC=CC=C2C(=O)C1=O NMZDCIXVKOQWIW-UHFFFAOYSA-N 0.000 description 1
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 1
- NHDODQWIKUYWMW-UHFFFAOYSA-N 1-bromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1 NHDODQWIKUYWMW-UHFFFAOYSA-N 0.000 description 1
- OWPNVXATCSXTBK-UHFFFAOYSA-N 1-phenyl-3h-indol-2-one Chemical compound O=C1CC2=CC=CC=C2N1C1=CC=CC=C1 OWPNVXATCSXTBK-UHFFFAOYSA-N 0.000 description 1
- YPBLNCRVEYJNER-UHFFFAOYSA-N 1h-indole-2,3-dione Chemical class C1=CC=C2C(=O)C(=O)NC2=C1.C1=CC=C2C(=O)C(=O)NC2=C1 YPBLNCRVEYJNER-UHFFFAOYSA-N 0.000 description 1
- NJFCAWNKWPIBAG-UHFFFAOYSA-N 2-(2-anilinophenyl)acetic acid Chemical class OC(=O)CC1=CC=CC=C1NC1=CC=CC=C1 NJFCAWNKWPIBAG-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- CNQCAFDKWBMIJV-UHFFFAOYSA-N 2-[2-(2,4-dichloro-3-methylanilino)phenyl]acetic acid Chemical compound CC1=C(Cl)C=CC(NC=2C(=CC=CC=2)CC(O)=O)=C1Cl CNQCAFDKWBMIJV-UHFFFAOYSA-N 0.000 description 1
- AHXBTNJVGFKVSX-UHFFFAOYSA-N 2-[2-(3-chloro-2-methylanilino)phenyl]-2-oxoacetic acid Chemical compound CC1=C(Cl)C=CC=C1NC1=CC=CC=C1C(=O)C(O)=O AHXBTNJVGFKVSX-UHFFFAOYSA-N 0.000 description 1
- MWPZLYLEVLUDNL-UHFFFAOYSA-N 2-[2-(3-chloro-2-methylanilino)phenyl]acetic acid Chemical compound CC1=C(Cl)C=CC=C1NC1=CC=CC=C1CC(O)=O MWPZLYLEVLUDNL-UHFFFAOYSA-N 0.000 description 1
- GRIXINIGTYIHSN-UHFFFAOYSA-N 2-chloro-n,n-diphenylacetamide Chemical class C=1C=CC=CC=1N(C(=O)CCl)C1=CC=CC=C1 GRIXINIGTYIHSN-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- SZDXAZJCYIFJIE-UHFFFAOYSA-N 2-oxo-2-(n-phenylanilino)acetyl chloride Chemical class C=1C=CC=CC=1N(C(=O)C(=O)Cl)C1=CC=CC=C1 SZDXAZJCYIFJIE-UHFFFAOYSA-N 0.000 description 1
- BCLQROPHEBEQCM-UHFFFAOYSA-N 3,5-dichloro-4-methoxy-N-[(4-methoxyphenyl)methyl]aniline Chemical compound C(C1=CC=C(C=C1)OC)NC1=CC(=C(OC)C(=C1)Cl)Cl BCLQROPHEBEQCM-UHFFFAOYSA-N 0.000 description 1
- YRLCJTLJODVGRC-UHFFFAOYSA-N COC1=CC=C(C=C1C)NC1=C(C=CC=C1)CC(=O)O Chemical compound COC1=CC=C(C=C1C)NC1=C(C=CC=C1)CC(=O)O YRLCJTLJODVGRC-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- YBLKGQZXIHCUPL-UHFFFAOYSA-N ClC1=C(C(=CC=C1)Cl)C1=C(C=C(C=C1)Cl)CC(=O)O Chemical compound ClC1=C(C(=CC=C1)Cl)C1=C(C=C(C=C1)Cl)CC(=O)O YBLKGQZXIHCUPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AANQJFNLSBDFMJ-UHFFFAOYSA-N N-(3,5-dichloro-4-methoxyphenyl)acetamide Chemical compound COC1=C(Cl)C=C(NC(C)=O)C=C1Cl AANQJFNLSBDFMJ-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- SEAJGEJITBMQGI-UHFFFAOYSA-M [K+].ClC=1C=CC=C(C=1C)NC1=C(C=CC=C1)CC(=O)[O-] Chemical compound [K+].ClC=1C=CC=C(C=1C)NC1=C(C=CC=C1)CC(=O)[O-] SEAJGEJITBMQGI-UHFFFAOYSA-M 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- NBZANZVJRKXVBH-GYDPHNCVSA-N alpha-Cryptoxanthin Natural products O[C@H]1CC(C)(C)C(/C=C/C(=C\C=C\C(=C/C=C/C=C(\C=C\C=C(/C=C/[C@H]2C(C)=CCCC2(C)C)\C)/C)\C)/C)=C(C)C1 NBZANZVJRKXVBH-GYDPHNCVSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- PPLKNQLEJDDAHV-UHFFFAOYSA-N chloroform;1,1,1,2-tetrachloroethane Chemical compound ClC(Cl)Cl.ClCC(Cl)(Cl)Cl PPLKNQLEJDDAHV-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- DCOPUUMXTXDBNB-UHFFFAOYSA-N diclofenac Chemical compound OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl DCOPUUMXTXDBNB-UHFFFAOYSA-N 0.000 description 1
- KPHWPUGNDIVLNH-UHFFFAOYSA-M diclofenac sodium Chemical compound [Na+].[O-]C(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl KPHWPUGNDIVLNH-UHFFFAOYSA-M 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XRYSCSFJNUNNAU-UHFFFAOYSA-N n-chloro-n-phenylaniline Chemical compound C=1C=CC=CC=1N(Cl)C1=CC=CC=C1 XRYSCSFJNUNNAU-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003349 semicarbazides Chemical class 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000000475 sunscreen effect Effects 0.000 description 1
- 239000000516 sunscreening agent Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/38—Oxygen atoms in positions 2 and 3, e.g. isatin
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1789367A CH485667A (de) | 1967-12-20 | 1967-12-20 | Verfahren zur Herstellung von substituierten Phenylessigsäuren |
| CH1789267A CH487840A (de) | 1967-12-20 | 1967-12-20 | Verfahren zur Herstellung von substituierten Phenylessigsäuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125724B true NO125724B (show.php) | 1972-10-23 |
Family
ID=25720227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO5013/68A NO125724B (show.php) | 1967-12-20 | 1968-12-13 |
Country Status (16)
| Country | Link |
|---|---|
| JP (4) | JPS5220469B1 (show.php) |
| AT (1) | AT284823B (show.php) |
| BE (1) | BE725793A (show.php) |
| CS (2) | CS151496B2 (show.php) |
| DE (1) | DE1815802A1 (show.php) |
| DK (1) | DK125461B (show.php) |
| ES (1) | ES361666A1 (show.php) |
| FI (1) | FI49600C (show.php) |
| FR (1) | FR1595382A (show.php) |
| GB (1) | GB1257190A (show.php) |
| IE (1) | IE32591B1 (show.php) |
| IL (1) | IL31296A (show.php) |
| NL (1) | NL6817965A (show.php) |
| NO (1) | NO125724B (show.php) |
| SE (1) | SE366296B (show.php) |
| YU (1) | YU32986B (show.php) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS549240A (en) * | 1977-06-23 | 1979-01-24 | Asahi Chem Ind Co Ltd | New derivative of phenylglycolic acid, its preparation and analgesic and antiinflammatory agent contining it as effective component |
| IT1112024B (it) * | 1979-02-23 | 1986-01-13 | Alcar Srl | Processo per la preparazione dell'acido o.(2,6-dicloroanilino)-fenilacetico |
| AT370721B (de) * | 1981-02-24 | 1983-04-25 | Ciba Geigy Ag | Verfahren zur herstellung von neuen salzen der 2- (2,6-dichloranilino)-phenylessigsaeure, der |
| LU83138A1 (de) * | 1981-02-16 | 1981-09-11 | T Eckert | Topische pharmazeutische praeparate,enthaltend salze von alkancarbonsaeuren sowie neue carbonsaeuresalze und verfahren zu ihrer herstellung |
| CH655507B (show.php) * | 1983-01-12 | 1986-04-30 | ||
| JPS6341143U (show.php) * | 1986-09-02 | 1988-03-17 | ||
| US5160487A (en) * | 1990-09-04 | 1992-11-03 | Hitachi Chemical Company, Ltd. | Electrophotographic member |
| US6355680B1 (en) | 1996-02-20 | 2002-03-12 | Exocell, Inc. | Albumin-binding compounds that prevent nonenzymatic glycation and that may be used for treatment of glycation-related pathologies |
| FR2878522B1 (fr) | 2004-12-01 | 2008-04-18 | Merck Sante Soc Par Actions Si | Nouveaux inhibiteurs specifiques de la caspas-10 |
| AR061623A1 (es) | 2006-06-26 | 2008-09-10 | Novartis Ag | Derivados de acido fenilacetico |
| JP5542436B2 (ja) | 2006-07-25 | 2014-07-09 | テックフィールズ バイオケム カンパニー リミテッド | 非常に速い皮膚透過率を有するジクロフェナクの正荷電水溶性プロドラッグ |
| CN114516813B (zh) | 2022-02-25 | 2024-05-28 | 复旦大学 | 一种双氯芬酸钠的连续流制备方法 |
| CN114539086B (zh) | 2022-02-25 | 2023-10-03 | 复旦大学 | 一种双氯芬酸钠的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5220469A (en) * | 1975-08-08 | 1977-02-16 | Mitsui Toatsu Chem Inc | Method for grading granule |
| JPS5851859B2 (ja) * | 1978-08-11 | 1983-11-18 | 株式会社日立製作所 | 帳票送り出し装置 |
-
1968
- 1968-12-13 NO NO5013/68A patent/NO125724B/no unknown
- 1968-12-13 SE SE17151/68A patent/SE366296B/xx unknown
- 1968-12-13 NL NL6817965A patent/NL6817965A/xx unknown
- 1968-12-13 DK DK612768AA patent/DK125461B/da not_active IP Right Cessation
- 1968-12-13 FI FI683591A patent/FI49600C/fi active
- 1968-12-17 YU YU2983/68A patent/YU32986B/xx unknown
- 1968-12-19 DE DE19681815802 patent/DE1815802A1/de active Pending
- 1968-12-19 ES ES361666A patent/ES361666A1/es not_active Expired
- 1968-12-19 CS CS5436*[A patent/CS151496B2/cs unknown
- 1968-12-19 FR FR1595382D patent/FR1595382A/fr not_active Expired
- 1968-12-19 IE IE1536/68A patent/IE32591B1/xx unknown
- 1968-12-19 JP JP43092731A patent/JPS5220469B1/ja active Pending
- 1968-12-19 GB GB1257190D patent/GB1257190A/en not_active Expired
- 1968-12-19 AT AT1236868A patent/AT284823B/de not_active IP Right Cessation
- 1968-12-19 CS CS8634A patent/CS151495B2/cs unknown
- 1968-12-19 IL IL31296A patent/IL31296A/en unknown
- 1968-12-20 BE BE725793D patent/BE725793A/xx not_active IP Right Cessation
-
1978
- 1978-06-07 JP JP6871878A patent/JPS5526131B1/ja active Pending
- 1978-10-31 JP JP13440778A patent/JPS5635664B1/ja active Pending
-
1979
- 1979-05-02 JP JP5465379A patent/JPS5526132B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL31296A (en) | 1972-06-28 |
| FI49600B (show.php) | 1975-04-30 |
| IE32591L (en) | 1969-06-20 |
| CS151495B2 (show.php) | 1973-10-19 |
| FR1595382A (show.php) | 1970-06-08 |
| GB1257190A (show.php) | 1971-12-15 |
| JPS5526131B1 (show.php) | 1980-07-11 |
| FI49600C (fi) | 1975-08-11 |
| BE725793A (show.php) | 1969-06-20 |
| AT284823B (de) | 1970-09-25 |
| IL31296A0 (en) | 1969-02-27 |
| NL6817965A (show.php) | 1969-06-24 |
| DK125461B (da) | 1973-02-26 |
| JPS5635664B1 (show.php) | 1981-08-19 |
| SE366296B (show.php) | 1974-04-22 |
| ES361666A1 (es) | 1970-11-16 |
| JPS5220469B1 (show.php) | 1977-06-03 |
| YU32986B (en) | 1975-12-31 |
| YU298368A (en) | 1975-06-30 |
| CS151496B2 (show.php) | 1973-10-19 |
| DE1815802A1 (de) | 1969-07-10 |
| JPS5526132B1 (show.php) | 1980-07-11 |
| IE32591B1 (en) | 1973-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO125724B (show.php) | ||
| IE59252B1 (en) | Trisubstituted benzoic acid intermediates | |
| DK149586B (da) | Fremgangsmaade til fremstilling af 1-amino-cyclopropan-carboxylsyre og derivater deraf | |
| SU805946A3 (ru) | Способ получени производных имидазола | |
| US3975432A (en) | Process for preparing 2-(6-methoxy-2-naphthyl)propionic acid | |
| US3016403A (en) | 1-aryl-3-hydroxypropyl sulfones and processes | |
| NO118798B (show.php) | ||
| US3895063A (en) | Substituted Anilino Benzyl Alcohols | |
| Tamelen et al. | The Malonic Ester Reaction with 3, 4-Dihydronaphthalene-1, 2-oxide | |
| US3960967A (en) | Process for producing a sulfone derivative of vitamin A alcohol | |
| SU799647A3 (ru) | Способ получени производныхиНдАНА | |
| US3651149A (en) | Beta-(6-methoxy-2-naphthyl)-9-borabicyclo-(3 3 1)-nonane | |
| Hansch et al. | SYNTHESIS OF 6-SUBSTITUTED THIANAPHTHENES1 | |
| NO124687B (show.php) | ||
| SU474143A3 (ru) | Способ получени производных дибензофурана или карбазола | |
| Mulholland et al. | A synthesis of tetronic acid [furan-2 (3 H), 4 (5 H)-dione] and three analogues | |
| SU502607A3 (ru) | Способ получени лактамов | |
| US3062834A (en) | Process for preparing thiophencarboxylic acids and their esters | |
| US2773091A (en) | Fluorantheneoxocarboxylic acids and the production thereof | |
| JPH04247052A (ja) | ビシクロ〔4,1,0〕ヘプタン−2,4−ジオン誘導体、その製造法 | |
| US3103519A (en) | I-benzoxacycloalkanecarboxyoc acids | |
| US4465843A (en) | Process for the preparation of derivatives of 2-pyrrole acetic acid with anti-inflammatory activity | |
| NO144667B (no) | Fremgangsmaate ved fremstilling av 0-(2,6-diklor-anilino)-fenyleddiksyre og dens salter | |
| NO115414B (show.php) | ||
| US4977274A (en) | 4-hydroxyindole derivatives, the process for preparation thereof and their use |