NO123429B - - Google Patents
Download PDFInfo
- Publication number
- NO123429B NO123429B NO169387A NO16938767A NO123429B NO 123429 B NO123429 B NO 123429B NO 169387 A NO169387 A NO 169387A NO 16938767 A NO16938767 A NO 16938767A NO 123429 B NO123429 B NO 123429B
- Authority
- NO
- Norway
- Prior art keywords
- amino
- optionally
- general formula
- arylsulfonyl
- halogen
- Prior art date
Links
- -1 arylsulfonyl semicarbazides Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 230000003178 anti-diabetic effect Effects 0.000 claims description 2
- 239000003472 antidiabetic agent Substances 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000008280 blood Substances 0.000 description 7
- 210000004369 blood Anatomy 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- OUDSBRTVNLOZBN-UHFFFAOYSA-N tolazamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1CCCCCC1 OUDSBRTVNLOZBN-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229960002277 tolazamide Drugs 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 229960005371 tolbutamide Drugs 0.000 description 2
- JGHDVROWMPBQSR-UHFFFAOYSA-N 4-chloro-n-(oxomethylidene)benzenesulfonamide Chemical compound ClC1=CC=C(S(=O)(=O)N=C=O)C=C1 JGHDVROWMPBQSR-UHFFFAOYSA-N 0.000 description 1
- FHMRJRSOWRCSKA-UHFFFAOYSA-N 4-fluoro-n-(oxomethylidene)benzenesulfonamide Chemical compound FC1=CC=C(S(=O)(=O)N=C=O)C=C1 FHMRJRSOWRCSKA-UHFFFAOYSA-N 0.000 description 1
- VLJQDHDVZJXNQL-UHFFFAOYSA-N 4-methyl-n-(oxomethylidene)benzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N=C=O)C=C1 VLJQDHDVZJXNQL-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- PKGNFJLDVFEWKR-UHFFFAOYSA-N ethyl n-ethyl-n-(4-methylphenyl)sulfonylcarbamate Chemical compound CCOC(=O)N(CC)S(=O)(=O)C1=CC=C(C)C=C1 PKGNFJLDVFEWKR-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229940127017 oral antidiabetic Drugs 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/06—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing isoquinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0050003 | 1966-08-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO123429B true NO123429B (enExample) | 1971-11-15 |
Family
ID=7103453
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO169387A NO123429B (enExample) | 1966-08-22 | 1967-08-16 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3764605A (enExample) |
| AT (1) | AT275542B (enExample) |
| BE (1) | BE702903A (enExample) |
| CH (1) | CH487860A (enExample) |
| DE (1) | DE1670736A1 (enExample) |
| DK (1) | DK119830B (enExample) |
| ES (2) | ES344342A1 (enExample) |
| FI (1) | FI45659C (enExample) |
| FR (1) | FR7050M (enExample) |
| GB (1) | GB1199758A (enExample) |
| IL (1) | IL28504A (enExample) |
| NL (1) | NL6711508A (enExample) |
| NO (1) | NO123429B (enExample) |
| SE (1) | SE330698B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4443243A (en) * | 1981-07-16 | 1984-04-17 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N-triazinylureas |
| JP2000169474A (ja) * | 1998-12-07 | 2000-06-20 | Kotobuki Seiyaku Kk | イソキヌクリジン誘導体及びその製造方法並びにこれを含有する高コレステロール血症治療剤 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2075359A (en) * | 1930-10-16 | 1937-03-30 | Du Pont | Insecticide |
| US1915334A (en) * | 1930-10-16 | 1933-06-27 | Du Pont | Fluosilicate of organic heterocyclic bases and process of making it |
| DE1191826B (de) * | 1963-09-03 | 1965-04-29 | Boehringer & Soehne Gmbh | Verfahren zur Herstellung neuer Benzolsulfonylsemicarbazide und ihrer Salze |
-
1966
- 1966-08-22 DE DE19661670736 patent/DE1670736A1/de active Pending
-
1967
- 1967-08-07 CH CH1108567A patent/CH487860A/de not_active IP Right Cessation
- 1967-08-15 IL IL28504A patent/IL28504A/en unknown
- 1967-08-16 NO NO169387A patent/NO123429B/no unknown
- 1967-08-16 DK DK416467AA patent/DK119830B/da unknown
- 1967-08-17 US US00661198A patent/US3764605A/en not_active Expired - Lifetime
- 1967-08-18 FI FI672219A patent/FI45659C/fi active
- 1967-08-21 NL NL6711508A patent/NL6711508A/xx unknown
- 1967-08-21 GB GB38460/67A patent/GB1199758A/en not_active Expired
- 1967-08-21 BE BE702903D patent/BE702903A/xx unknown
- 1967-08-22 ES ES344342A patent/ES344342A1/es not_active Expired
- 1967-08-22 SE SE11749/67A patent/SE330698B/xx unknown
- 1967-08-22 AT AT772767A patent/AT275542B/de active
- 1967-09-29 ES ES345565A patent/ES345565A1/es not_active Expired
- 1967-11-21 FR FR129107A patent/FR7050M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES344342A1 (es) | 1969-04-16 |
| GB1199758A (en) | 1970-07-22 |
| SE330698B (enExample) | 1970-11-30 |
| DE1670736A1 (de) | 1970-12-23 |
| AT275542B (de) | 1969-10-27 |
| BE702903A (enExample) | 1968-02-21 |
| ES345565A1 (es) | 1969-04-16 |
| IL28504A (en) | 1971-10-20 |
| NL6711508A (enExample) | 1968-02-23 |
| US3764605A (en) | 1973-10-09 |
| FR7050M (enExample) | 1969-06-16 |
| CH487860A (de) | 1970-03-31 |
| FI45659B (enExample) | 1972-05-02 |
| DK119830B (da) | 1971-03-01 |
| FI45659C (fi) | 1972-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR870000354B1 (ko) | 피리딘-2-에테르 또는 피리딘-2-티오에테르의 제조방법 | |
| NO159166B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive benzoazepinderivater. | |
| NO780558L (no) | Benzoesyre og dens derivater samt fremgangsmaate til deres fremstilling | |
| NO158419B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive 1,2-diaminocyklobuten-3,4-dioner. | |
| WO1986003203A1 (fr) | Derives de thienylthiazole | |
| NO154882B (no) | Fremgangsmaate for fremstilling av 2-(2-(1,4-benzodioksanyl)) -2-imidazolin. | |
| KR930002488B1 (ko) | 이미다졸리디논 화합물 및 그의 제조 방법 | |
| NO153530B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive substituerte heterocykliske benzamider. | |
| NO163432B (no) | Fremgangsmaate for fremstilling av frisk ost. | |
| NO151837B (no) | Anordning ved fagverk for bruk under bygging av bygninger og andre konstruksjoner | |
| US4061647A (en) | Thiazolidine derivatives | |
| NO136360B (enExample) | ||
| NO142107B (no) | Anordning for ekstrudering. | |
| NO764039L (enExample) | ||
| US3873558A (en) | Process for preparing 1,5-substituted or 1,6-substituted benzimidazoles | |
| NO123429B (enExample) | ||
| NO144773B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive aminer | |
| NO762735L (enExample) | ||
| NO124430B (enExample) | ||
| US2858309A (en) | New aminobenzene sulfonamide | |
| Webb et al. | Some 3, 4-Disubstituted Pyridines1 | |
| NO814468L (no) | Tiazolinderivater, fremgangsmaate til deres fremstilling, deres anvendelse samt farmasoeytiske preparater paa basis av disse forbindelser | |
| US3933836A (en) | Pyridinylidene guanidines | |
| US4018775A (en) | 5-Phenyl-thiazolidin-4-one derivatives | |
| US3960881A (en) | Method for preparing 4-carboxythiazolidine-2-thione |