NO119478B - - Google Patents
Download PDFInfo
- Publication number
- NO119478B NO119478B NO165145A NO16514566A NO119478B NO 119478 B NO119478 B NO 119478B NO 165145 A NO165145 A NO 165145A NO 16514566 A NO16514566 A NO 16514566A NO 119478 B NO119478 B NO 119478B
- Authority
- NO
- Norway
- Prior art keywords
- thiadiazole
- sulfanilamido
- chloro
- compounds
- water
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- 239000000203 mixture Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 12
- -1 alkaline earth metal salts Chemical class 0.000 description 11
- 229940124530 sulfonamide Drugs 0.000 description 11
- 241000287828 Gallus gallus Species 0.000 description 10
- 235000013330 chicken meat Nutrition 0.000 description 10
- 208000003495 Coccidiosis Diseases 0.000 description 9
- 206010023076 Isosporiasis Diseases 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 244000144977 poultry Species 0.000 description 8
- 235000013594 poultry meat Nutrition 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 210000003250 oocyst Anatomy 0.000 description 7
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 7
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- 241000271566 Aves Species 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000003302 alkenyloxy group Chemical group 0.000 description 6
- 230000001165 anti-coccidial effect Effects 0.000 description 6
- 239000003224 coccidiostatic agent Substances 0.000 description 6
- 239000003651 drinking water Substances 0.000 description 6
- 235000020188 drinking water Nutrition 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 241000499566 Eimeria brunetti Species 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- BHBZGQBBRQJXCY-UHFFFAOYSA-N 4-chloro-1,2,5-thiadiazol-3-one Chemical compound OC1=NSN=C1Cl BHBZGQBBRQJXCY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 235000005911 diet Nutrition 0.000 description 3
- 230000037213 diet Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- UDGKZGLPXCRRAM-UHFFFAOYSA-N 1,2,5-thiadiazole Chemical compound C=1C=NSN=1 UDGKZGLPXCRRAM-UHFFFAOYSA-N 0.000 description 2
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 2
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 2
- WWCLVQQGRCZLLD-UHFFFAOYSA-N 4-amino-3-but-2-ynoxy-N-(1,2,5-thiadiazol-3-yl)benzenesulfonamide Chemical compound C(C#CC)OC=1C=C(S(=O)(=O)NC2=NSN=C2)C=CC1N WWCLVQQGRCZLLD-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 241000227425 Pieris rapae crucivora Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- OCKPCBLVNKHBMX-UHFFFAOYSA-N butylbenzene Chemical compound CCCCC1=CC=CC=C1 OCKPCBLVNKHBMX-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- YDVJBLJCSLVMSY-UHFFFAOYSA-N carbamoyl cyanide Chemical compound NC(=O)C#N YDVJBLJCSLVMSY-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- SKIVFJLNDNKQPD-UHFFFAOYSA-N sulfacetamide Chemical compound CC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 SKIVFJLNDNKQPD-UHFFFAOYSA-N 0.000 description 2
- JNMRHUJNCSQMMB-UHFFFAOYSA-N sulfathiazole Chemical class C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CS1 JNMRHUJNCSQMMB-UHFFFAOYSA-N 0.000 description 2
- WMMOILQGTMDETN-UHFFFAOYSA-N sulfuric acid;thiadiazole Chemical compound C1=CSN=N1.OS(O)(=O)=O WMMOILQGTMDETN-UHFFFAOYSA-N 0.000 description 2
- AVMHMVJVHYGDOO-NSCUHMNNSA-N (e)-1-bromobut-2-ene Chemical group C\C=C\CBr AVMHMVJVHYGDOO-NSCUHMNNSA-N 0.000 description 1
- 150000004868 1,2,5-thiadiazoles Chemical class 0.000 description 1
- LNNXOEHOXSYWLD-UHFFFAOYSA-N 1-bromobut-2-yne Chemical compound CC#CCBr LNNXOEHOXSYWLD-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- USEGQJLHQSTGHW-UHFFFAOYSA-N 3-bromo-2-methylprop-1-ene Chemical compound CC(=C)CBr USEGQJLHQSTGHW-UHFFFAOYSA-N 0.000 description 1
- LWJPYRFOSYZGKP-UHFFFAOYSA-N 3-chloro-4-prop-2-ynoxy-1,2,5-thiadiazole Chemical compound ClC1=NSN=C1OCC#C LWJPYRFOSYZGKP-UHFFFAOYSA-N 0.000 description 1
- XLYOGWXIKVUXCL-UHFFFAOYSA-N 4-bromobut-1-yne Chemical compound BrCCC#C XLYOGWXIKVUXCL-UHFFFAOYSA-N 0.000 description 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 1
- 241000223924 Eimeria Species 0.000 description 1
- 241000223931 Eimeria acervulina Species 0.000 description 1
- 241000499563 Eimeria necatrix Species 0.000 description 1
- 241000223932 Eimeria tenella Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 208000027954 Poultry disease Diseases 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000607683 Salmonella enterica subsp. enterica serovar Pullorum Species 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 206010047897 Weight gain poor Diseases 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 238000005905 alkynylation reaction Methods 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 210000004534 cecum Anatomy 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000002192 coccidiostatic effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000021055 solid food Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229960002673 sulfacetamide Drugs 0.000 description 1
- VMSFDSVIZYGJDO-UHFFFAOYSA-N sulfuric acid;1,3-thiazole Chemical class C1=CSC=N1.OS(O)(=O)=O VMSFDSVIZYGJDO-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000004867 thiadiazoles Chemical class 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/10—1,2,5-Thiadiazoles; Hydrogenated 1,2,5-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Lubricants (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US49670065A | 1965-10-15 | 1965-10-15 | |
| US56901466A | 1966-08-01 | 1966-08-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119478B true NO119478B (enExample) | 1970-05-25 |
Family
ID=27052236
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO165145A NO119478B (enExample) | 1965-10-15 | 1966-10-14 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3467653A (enExample) |
| AT (1) | AT279607B (enExample) |
| BE (1) | BE688251A (enExample) |
| BR (1) | BR6683448D0 (enExample) |
| CH (1) | CH518965A (enExample) |
| DE (1) | DE1620041A1 (enExample) |
| DK (1) | DK115918B (enExample) |
| ES (1) | ES332669A1 (enExample) |
| FR (2) | FR1503797A (enExample) |
| GB (1) | GB1161094A (enExample) |
| IL (1) | IL26626A (enExample) |
| NL (1) | NL145856B (enExample) |
| NO (1) | NO119478B (enExample) |
| SE (1) | SE332826B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2701632C2 (de) * | 1977-01-17 | 1982-04-22 | Lentia GmbH Chem. u. pharm. Erzeugnisse - Industriebedarf, 8000 München | Verfahren zur Herstellung von reinem 3-Methoxy-4-(4-aminobenzolsulfonamido)-1,2,5-thiadiazol |
| JP2005535325A (ja) * | 2002-08-13 | 2005-11-24 | ヒドベーギ,マーテー | 飼料及び獣医業務における発酵小麦胚芽の使用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB533495A (en) * | 1938-01-31 | 1941-02-14 | Chem Ind Basel | Manufacture of new benzenesulphonamido-derivatives |
-
1966
- 1966-08-01 US US569014A patent/US3467653A/en not_active Expired - Lifetime
- 1966-10-03 IL IL26626A patent/IL26626A/xx unknown
- 1966-10-06 BR BR183448/66A patent/BR6683448D0/pt unknown
- 1966-10-13 NL NL666614425A patent/NL145856B/xx unknown
- 1966-10-13 GB GB45818/66A patent/GB1161094A/en not_active Expired
- 1966-10-13 FR FR79846A patent/FR1503797A/fr not_active Expired
- 1966-10-14 SE SE13980/66A patent/SE332826B/xx unknown
- 1966-10-14 BE BE688251D patent/BE688251A/xx unknown
- 1966-10-14 NO NO165145A patent/NO119478B/no unknown
- 1966-10-14 DE DE19661620041 patent/DE1620041A1/de active Pending
- 1966-10-14 ES ES0332669A patent/ES332669A1/es not_active Expired
- 1966-10-14 DK DK532266AA patent/DK115918B/da unknown
- 1966-10-14 CH CH1485566A patent/CH518965A/de not_active IP Right Cessation
-
1967
- 1967-01-12 FR FR90911A patent/FR6150M/fr not_active Expired
- 1967-07-28 AT AT707267A patent/AT279607B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US3467653A (en) | 1969-09-16 |
| ES332669A1 (es) | 1967-08-01 |
| DK115918B (da) | 1969-11-24 |
| AT279607B (de) | 1970-03-10 |
| BR6683448D0 (pt) | 1973-12-04 |
| IL26626A (en) | 1970-04-20 |
| FR1503797A (fr) | 1967-12-01 |
| CH518965A (de) | 1972-02-15 |
| NL6614425A (enExample) | 1967-04-17 |
| GB1161094A (en) | 1969-08-13 |
| SE332826B (enExample) | 1971-02-22 |
| NL145856B (nl) | 1975-05-15 |
| FR6150M (enExample) | 1968-07-01 |
| DE1620041A1 (de) | 1970-03-19 |
| BE688251A (enExample) | 1967-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO165145B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 1h-imidazo-(4,5-c)-kinolin-4-aminderivater. | |
| US4140789A (en) | Etherified hydroxy-benzodiheterocyclic compounds | |
| EP0148725B1 (en) | Sulfonamido-benzamide derivatives | |
| US20040142981A1 (en) | Antibacterial benzoic acid derivatives | |
| SU993817A3 (ru) | Способ получени производных индолизина | |
| IE49069B1 (en) | Parasiticidal heterocyclic ether derivatives,processes for the manufacture thereof and compositions thereof | |
| GB2057439A (en) | Quinazolinones | |
| GB2128188A (en) | Propynylaminoisoxazole derivatives | |
| US11897858B2 (en) | Salt and solid state forms of escatalopram | |
| FR2459235A1 (fr) | Nouveaux derives de sulfonyl-aniline, leur procede de preparation et leur application therapeutique | |
| CN111943906B (zh) | 脒类衍生物、及其制法和药物组合物与用途 | |
| NO119478B (enExample) | ||
| HU203548B (en) | Process for producing benzoxazine derivatives and pharmaceutical compositions containing them | |
| JPH05222012A (ja) | 新規置換尿素及びその製法 | |
| US4632926A (en) | Quinazolinone derivatives which are active against coccidiosis | |
| CN110612288A (zh) | 取代咪唑盐类化合物、其制备方法、药用组合物及其应用 | |
| US2920074A (en) | 1-(5-nitrofurfurylideneamino)-2-imidazolidinethione | |
| US3026332A (en) | Nitrofurfurylidene hydroxy acid hydrazides | |
| DK144822B (da) | Analogifremgangsmaade til fremstilling af hoejredrejende 7-brom-6-chlor-3-(3-(3-hydroxy-2-peperidyl)-acetonyl)-4-3h-quinazolinon eller dets additionssalte med syrer | |
| US11242338B2 (en) | EBNA1 inhibitor crystalline forms, and methods of preparing and using same | |
| US3110713A (en) | 3-methoxymethyl-1-(5-nitrofurfurylideneamino) hydantoin | |
| US2877154A (en) | Anthelmintic compositions containing chlorine substituted amides and methods for using same | |
| US3931244A (en) | Thioureas | |
| US4053602A (en) | Compositions for treating coccidiosis containing 5-deazariboflavin and its derivatives | |
| JPH03261783A (ja) | 1,2,4―トリアジンジオン化合物及びそれを有効成分とする抗コクシジウム剤 |