MXPA06002018A - Bencimidazolilo n-sustituidos inhibidores de c-kit. - Google Patents
Bencimidazolilo n-sustituidos inhibidores de c-kit.Info
- Publication number
- MXPA06002018A MXPA06002018A MXPA06002018A MXPA06002018A MXPA06002018A MX PA06002018 A MXPA06002018 A MX PA06002018A MX PA06002018 A MXPA06002018 A MX PA06002018A MX PA06002018 A MXPA06002018 A MX PA06002018A MX PA06002018 A MXPA06002018 A MX PA06002018A
- Authority
- MX
- Mexico
- Prior art keywords
- carboxamide
- benzimidazole
- phenyl
- pyridin
- ylmethyl
- Prior art date
Links
- -1 N-substituted benzimidazolyl Chemical group 0.000 title claims description 264
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 title description 17
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 title description 17
- 239000003112 inhibitor Substances 0.000 title description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 57
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 44
- 238000011282 treatment Methods 0.000 claims abstract description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 200
- 150000001875 compounds Chemical class 0.000 claims description 105
- 125000004432 carbon atom Chemical group C* 0.000 claims description 84
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 84
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 79
- 239000000203 mixture Substances 0.000 claims description 74
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 61
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 48
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 48
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 47
- 125000000217 alkyl group Chemical group 0.000 claims description 44
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 35
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 35
- 210000004027 cell Anatomy 0.000 claims description 30
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 claims description 27
- 125000004122 cyclic group Chemical group 0.000 claims description 25
- 125000000623 heterocyclic group Chemical group 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 23
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 20
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 19
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 16
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 15
- 239000002246 antineoplastic agent Substances 0.000 claims description 14
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 229910052760 oxygen Inorganic materials 0.000 claims description 12
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 11
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 claims description 11
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 claims description 11
- 208000035475 disorder Diseases 0.000 claims description 11
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 10
- 208000000587 small cell lung carcinoma Diseases 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- KSSQEOXBWAKNHQ-UHFFFAOYSA-N 1-[4-(2-pyridin-2-yloxyethoxy)phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)N)=CC=C2N1C(C=C1)=CC=C1OCCOC1=CC=CC=N1 KSSQEOXBWAKNHQ-UHFFFAOYSA-N 0.000 claims description 8
- 208000031261 Acute myeloid leukaemia Diseases 0.000 claims description 8
- 206010006187 Breast cancer Diseases 0.000 claims description 8
- 208000026310 Breast neoplasm Diseases 0.000 claims description 8
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 239000003937 drug carrier Substances 0.000 claims description 8
- 230000003463 hyperproliferative effect Effects 0.000 claims description 8
- 125000004043 oxo group Chemical group O=* 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 208000032839 leukemia Diseases 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 229940127089 cytotoxic agent Drugs 0.000 claims description 6
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims description 6
- CPRRHERYRRXBRZ-SRVKXCTJSA-N methyl n-[(2s)-1-[[(2s)-1-hydroxy-3-[(3s)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate Chemical compound COC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CO)C[C@@H]1CCNC1=O CPRRHERYRRXBRZ-SRVKXCTJSA-N 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 6
- 125000004434 sulfur atom Chemical group 0.000 claims description 6
- NZCMJCJDUGKYCW-UHFFFAOYSA-N 1-[4-(2-pyridin-2-yloxypropoxy)phenyl]benzimidazole-5-carboxamide Chemical compound C=1C=C(N2C3=CC=C(C=C3N=C2)C(N)=O)C=CC=1OCC(C)OC1=CC=CC=N1 NZCMJCJDUGKYCW-UHFFFAOYSA-N 0.000 claims description 5
- FNLQDVXHDNFXIY-UHFFFAOYSA-N 3h-benzimidazole-5-carboxamide Chemical compound NC(=O)C1=CC=C2NC=NC2=C1 FNLQDVXHDNFXIY-UHFFFAOYSA-N 0.000 claims description 5
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims description 5
- 206010009944 Colon cancer Diseases 0.000 claims description 5
- 210000001744 T-lymphocyte Anatomy 0.000 claims description 5
- 150000003857 carboxamides Chemical class 0.000 claims description 5
- 208000029742 colonic neoplasm Diseases 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 5
- 206010033128 Ovarian cancer Diseases 0.000 claims description 4
- 230000033115 angiogenesis Effects 0.000 claims description 4
- 201000008275 breast carcinoma Diseases 0.000 claims description 4
- SHZIWNPUGXLXDT-UHFFFAOYSA-N caproic acid ethyl ester Natural products CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 4
- 208000020816 lung neoplasm Diseases 0.000 claims description 4
- 201000001441 melanoma Diseases 0.000 claims description 4
- PGMYKACGEOXYJE-UHFFFAOYSA-N pentyl acetate Chemical compound CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 claims description 4
- 229910052701 rubidium Inorganic materials 0.000 claims description 4
- 229940124597 therapeutic agent Drugs 0.000 claims description 4
- JVLPMYWSBPYNFE-UHFFFAOYSA-N 1-[4-(3-pyridin-2-yloxybutan-2-yloxy)phenyl]benzimidazole-5-carboxamide Chemical compound C=1C=C(N2C3=CC=C(C=C3N=C2)C(N)=O)C=CC=1OC(C)C(C)OC1=CC=CC=N1 JVLPMYWSBPYNFE-UHFFFAOYSA-N 0.000 claims description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 3
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 claims description 3
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 claims description 3
- 206010073478 Anaplastic large-cell lymphoma Diseases 0.000 claims description 3
- 201000003076 Angiosarcoma Diseases 0.000 claims description 3
- 206010014733 Endometrial cancer Diseases 0.000 claims description 3
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 claims description 3
- 208000001258 Hemangiosarcoma Diseases 0.000 claims description 3
- 208000032004 Large-Cell Anaplastic Lymphoma Diseases 0.000 claims description 3
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 3
- 206010025323 Lymphomas Diseases 0.000 claims description 3
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 claims description 3
- 201000010208 Seminoma Diseases 0.000 claims description 3
- 206010041067 Small cell lung cancer Diseases 0.000 claims description 3
- 208000024313 Testicular Neoplasms Diseases 0.000 claims description 3
- 206010057644 Testis cancer Diseases 0.000 claims description 3
- 208000033781 Thyroid carcinoma Diseases 0.000 claims description 3
- 208000024770 Thyroid neoplasm Diseases 0.000 claims description 3
- 208000002517 adenoid cystic carcinoma Diseases 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000004037 angiogenesis inhibitor Substances 0.000 claims description 3
- 230000001772 anti-angiogenic effect Effects 0.000 claims description 3
- 230000000118 anti-neoplastic effect Effects 0.000 claims description 3
- 230000000259 anti-tumor effect Effects 0.000 claims description 3
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 230000001461 cytolytic effect Effects 0.000 claims description 3
- 201000005202 lung cancer Diseases 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 3
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 201000001514 prostate carcinoma Diseases 0.000 claims description 3
- 201000007416 salivary gland adenoid cystic carcinoma Diseases 0.000 claims description 3
- 201000003120 testicular cancer Diseases 0.000 claims description 3
- 201000002510 thyroid cancer Diseases 0.000 claims description 3
- 208000013077 thyroid gland carcinoma Diseases 0.000 claims description 3
- 125000001401 1,2,4-triazol-4-yl group Chemical group N=1N=C([H])N([*])C=1[H] 0.000 claims description 2
- HDFBXXNQENNXAN-UHFFFAOYSA-N 1-[3-(naphthalen-2-ylmethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCC=4C=C5C=CC=CC5=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 HDFBXXNQENNXAN-UHFFFAOYSA-N 0.000 claims description 2
- BLFQUBXFZKAAPE-UHFFFAOYSA-N 1-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(Cl)=CC=C1OCCCOC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 BLFQUBXFZKAAPE-UHFFFAOYSA-N 0.000 claims description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims description 2
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 claims description 2
- 206010014759 Endometrial neoplasm Diseases 0.000 claims description 2
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 claims description 2
- 108010081348 HRT1 protein Hairy Proteins 0.000 claims description 2
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims description 2
- 206010060862 Prostate cancer Diseases 0.000 claims description 2
- 201000003914 endometrial carcinoma Diseases 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 claims description 2
- 210000004072 lung Anatomy 0.000 claims description 2
- 230000002611 ovarian Effects 0.000 claims description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- IQLGMKHPGNYTGA-UHFFFAOYSA-N 1-[3-(2-ethoxyethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound CCOCCOC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 IQLGMKHPGNYTGA-UHFFFAOYSA-N 0.000 claims 1
- ACMAFILGHQASAP-UHFFFAOYSA-N 1-[3-(2-methoxyethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound COCCOC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 ACMAFILGHQASAP-UHFFFAOYSA-N 0.000 claims 1
- CHERBHFNOOKZDB-UHFFFAOYSA-N 1-[3-(2-morpholin-4-ylethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCCN4CCOCC4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 CHERBHFNOOKZDB-UHFFFAOYSA-N 0.000 claims 1
- IUXXKMPXMFDIKF-UHFFFAOYSA-N 1-[3-(2-phenoxyethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCCOC=4C=CC=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 IUXXKMPXMFDIKF-UHFFFAOYSA-N 0.000 claims 1
- YIHVZTRDKGZLDQ-UHFFFAOYSA-N 1-[3-(2-phenylethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCCC=4C=CC=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 YIHVZTRDKGZLDQ-UHFFFAOYSA-N 0.000 claims 1
- SNGZARYVVCXVAH-UHFFFAOYSA-N 1-[3-(2-phenylsulfanylethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCCSC=4C=CC=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 SNGZARYVVCXVAH-UHFFFAOYSA-N 0.000 claims 1
- ANSWURICULGDCO-UHFFFAOYSA-N 1-[3-(2-thiophen-3-ylethylamino)phenyl]benzimidazole-5-carboxamide Chemical compound S1C=C(C=C1)CCNC=1C=C(C=CC1)N1C=NC2=C1C=CC(=C2)C(=O)N ANSWURICULGDCO-UHFFFAOYSA-N 0.000 claims 1
- NEDXGMUDNMZAJQ-UHFFFAOYSA-N 1-[3-(3-phenoxypropoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCCCOC=4C=CC=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 NEDXGMUDNMZAJQ-UHFFFAOYSA-N 0.000 claims 1
- NCTMLJGPAUDVJW-UHFFFAOYSA-N 1-[3-(3-phenylbutan-2-yloxy)phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1(=CC=CC=C1)C(C)C(C)OC=1C=C(C=CC=1)N1C=NC2=C1C=CC(=C2)C(=O)NCC=1C=NC=CC=1 NCTMLJGPAUDVJW-UHFFFAOYSA-N 0.000 claims 1
- IQLAVJONSFPEAW-UHFFFAOYSA-N 1-[3-(pyridin-4-ylmethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCC=4C=CN=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 IQLAVJONSFPEAW-UHFFFAOYSA-N 0.000 claims 1
- KGQDAYXMCACTOL-UHFFFAOYSA-N 1-[3-[(2-phenylphenyl)methoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCC=4C(=CC=CC=4)C=4C=CC=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 KGQDAYXMCACTOL-UHFFFAOYSA-N 0.000 claims 1
- KJMZZSWTEIYXJW-UHFFFAOYSA-N 1-[3-[(4-cyanophenyl)methoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCC=4C=CC(=CC=4)C#N)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 KJMZZSWTEIYXJW-UHFFFAOYSA-N 0.000 claims 1
- AAGKUZYTYRLBBB-UHFFFAOYSA-N 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1COC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 AAGKUZYTYRLBBB-UHFFFAOYSA-N 0.000 claims 1
- QDYKBBYZWNGRCV-UHFFFAOYSA-N 1-[3-[(4-methylphenyl)methoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(C)=CC=C1COC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 QDYKBBYZWNGRCV-UHFFFAOYSA-N 0.000 claims 1
- BQFODSCTFSDMJO-UHFFFAOYSA-N 1-[3-[(4-nitrophenyl)methoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 BQFODSCTFSDMJO-UHFFFAOYSA-N 0.000 claims 1
- JBPGZRVPFLUOEX-UHFFFAOYSA-N 1-[3-[2-(3-chlorophenoxy)ethoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound ClC1=CC=CC(OCCOC=2C=C(C=CC=2)N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 JBPGZRVPFLUOEX-UHFFFAOYSA-N 0.000 claims 1
- RYFILEKQJMPTHC-UHFFFAOYSA-N 1-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]-n-(2-methoxyethyl)benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCOC)=CC=C2N1C(C=1)=CC=CC=1OCCOC1=CC=C(F)C=C1 RYFILEKQJMPTHC-UHFFFAOYSA-N 0.000 claims 1
- PYWRIBMCKUCNMM-UHFFFAOYSA-N 1-[3-[2-(4-fluorophenoxy)ethoxy]phenyl]-n-(oxan-4-yl)benzimidazole-5-carboxamide Chemical compound C1=CC(F)=CC=C1OCCOC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NC2CCOCC2)=C1 PYWRIBMCKUCNMM-UHFFFAOYSA-N 0.000 claims 1
- CDIUBXDIBBTVBD-UHFFFAOYSA-N 1-[3-[3-(4-bromophenoxy)propoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(Br)=CC=C1OCCCOC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 CDIUBXDIBBTVBD-UHFFFAOYSA-N 0.000 claims 1
- RPPGVSAYRGDRHX-UHFFFAOYSA-N 1-[3-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(F)=CC=C1C1CCN(C=2C=C(C=CC=2)N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)CC1 RPPGVSAYRGDRHX-UHFFFAOYSA-N 0.000 claims 1
- HSFUEPHKKSRZDI-UHFFFAOYSA-N 1-[3-[benzyl(methyl)amino]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=CC=1N(C)CC1=CC=CC=C1 HSFUEPHKKSRZDI-UHFFFAOYSA-N 0.000 claims 1
- GEULDJLZKHPRDZ-UHFFFAOYSA-N 1-[4-(2-ethoxyethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(OCCOCC)=CC=C1N1C2=CC=C(C(=O)NCC=3C=NC=CC=3)C=C2N=C1 GEULDJLZKHPRDZ-UHFFFAOYSA-N 0.000 claims 1
- OCHFAXGZTGWVJB-UHFFFAOYSA-N 1-[4-(2-morpholin-4-ylethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCCN4CCOCC4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 OCHFAXGZTGWVJB-UHFFFAOYSA-N 0.000 claims 1
- ZWFXWHBENNJQOZ-UHFFFAOYSA-N 1-[4-(2-phenoxyethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCCOC=4C=CC=CC=4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 ZWFXWHBENNJQOZ-UHFFFAOYSA-N 0.000 claims 1
- UNKVLDRGUIXKOC-UHFFFAOYSA-N 1-[4-(2-phenylethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCCC=4C=CC=CC=4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 UNKVLDRGUIXKOC-UHFFFAOYSA-N 0.000 claims 1
- NKHOLNVCVYQPTJ-UHFFFAOYSA-N 1-[4-(3-phenylbutan-2-yloxy)phenyl]-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1(=CC=CC=C1)C(C)C(C)OC1=CC=C(C=C1)N1C=NC2=C1C=CC(=C2)C(=O)NCC=2C=NC=CC2 NKHOLNVCVYQPTJ-UHFFFAOYSA-N 0.000 claims 1
- IRDUHSBVOVKRKK-UHFFFAOYSA-N 1-[4-(cyclohexylmethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCC4CCCCC4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 IRDUHSBVOVKRKK-UHFFFAOYSA-N 0.000 claims 1
- CYTAYVDNWOSCJF-UHFFFAOYSA-N 1-[4-(naphthalen-2-ylmethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCC=4C=C5C=CC=CC5=CC=4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 CYTAYVDNWOSCJF-UHFFFAOYSA-N 0.000 claims 1
- UGWCGIBNFLYLMJ-UHFFFAOYSA-N 1-[4-(pyridin-3-ylmethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCC=4C=NC=CC=4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 UGWCGIBNFLYLMJ-UHFFFAOYSA-N 0.000 claims 1
- RFGNHXNFMCQRMA-UHFFFAOYSA-N 1-[4-[(4-fluorophenyl)methoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(F)=CC=C1COC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)C=C1 RFGNHXNFMCQRMA-UHFFFAOYSA-N 0.000 claims 1
- RJZZFGXTKXFWBD-UHFFFAOYSA-N 1-[4-[(4-methylphenyl)methoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(C)=CC=C1COC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)C=C1 RJZZFGXTKXFWBD-UHFFFAOYSA-N 0.000 claims 1
- XJYOFMGPKWDCLU-UHFFFAOYSA-N 1-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(OCCOCCOC)=CC=C1N1C2=CC=C(C(=O)NCC=3C=NC=CC=3)C=C2N=C1 XJYOFMGPKWDCLU-UHFFFAOYSA-N 0.000 claims 1
- XUUNZZLXHWHEKP-UHFFFAOYSA-N 1-[4-[2-(3-bromophenoxy)ethoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound BrC1=CC=CC(OCCOC=2C=CC(=CC=2)N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 XUUNZZLXHWHEKP-UHFFFAOYSA-N 0.000 claims 1
- SEHYHSVAKYGEHF-UHFFFAOYSA-N 1-[4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound COC1=CC=CC(OCCOC=2C=CC(=CC=2)N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 SEHYHSVAKYGEHF-UHFFFAOYSA-N 0.000 claims 1
- OFRSIBRHYBWFAJ-UHFFFAOYSA-N 1-[4-[2-(4-cyanophenoxy)ethoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCCOC=4C=CC(=CC=4)C#N)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 OFRSIBRHYBWFAJ-UHFFFAOYSA-N 0.000 claims 1
- VWAMGDIIZOFDIO-UHFFFAOYSA-N 1-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]-n-(3-methoxypropyl)benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCCOC)=CC=C2N1C(C=C1)=CC=C1OCCOC1=CC=C(F)C=C1 VWAMGDIIZOFDIO-UHFFFAOYSA-N 0.000 claims 1
- PFLDQSGXHVUKHZ-UHFFFAOYSA-N 1-[4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1OCCOC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)C=C1 PFLDQSGXHVUKHZ-UHFFFAOYSA-N 0.000 claims 1
- RZXYXRYVHFWBJZ-UHFFFAOYSA-N 1-[4-[3-(4-fluorophenoxy)propoxy]phenyl]-n-(2-methoxyethyl)benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCOC)=CC=C2N1C(C=C1)=CC=C1OCCCOC1=CC=C(F)C=C1 RZXYXRYVHFWBJZ-UHFFFAOYSA-N 0.000 claims 1
- FFRFRGDGFPEYLR-UHFFFAOYSA-N 1-[4-[3-(4-fluorophenoxy)propoxy]phenyl]-n-(3-morpholin-4-ylpropyl)benzimidazole-5-carboxamide Chemical compound C1=CC(F)=CC=C1OCCCOC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCCCN2CCOCC2)C=C1 FFRFRGDGFPEYLR-UHFFFAOYSA-N 0.000 claims 1
- PTTOXOJFDLGOKN-UHFFFAOYSA-N 1-[4-[[4-(difluoromethoxy)phenyl]methoxy]phenyl]-n-(oxan-4-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(OC(F)F)=CC=C1COC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCC2CCOCC2)C=C1 PTTOXOJFDLGOKN-UHFFFAOYSA-N 0.000 claims 1
- PYFUVHXOLXWHFJ-UHFFFAOYSA-N 1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)N)=CC=C2N1C(C=C1)=CC=C1OCC1=CC=C(C(F)(F)F)C=C1 PYFUVHXOLXWHFJ-UHFFFAOYSA-N 0.000 claims 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 claims 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 claims 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 claims 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims 1
- 125000005977 3-phenylpropyloxy group Chemical group 0.000 claims 1
- PCHASXFZGQWKJT-UHFFFAOYSA-N 4-[3-(4-fluorophenoxy)propoxy]phenol Chemical compound C1=CC(O)=CC=C1OCCCOC1=CC=C(F)C=C1 PCHASXFZGQWKJT-UHFFFAOYSA-N 0.000 claims 1
- NHXSTXWKZVAVOQ-UHFFFAOYSA-N Ethyl furoate Chemical compound CCOC(=O)C1=CC=CO1 NHXSTXWKZVAVOQ-UHFFFAOYSA-N 0.000 claims 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims 1
- MFEQPHZZMQEJTB-UHFFFAOYSA-N [1-[2-[2-(4-fluorophenoxy)ethoxy]phenyl]benzimidazol-5-yl]-[4-(1-hydroxyethyl)piperazin-1-yl]methanone Chemical compound C1CN(C(O)C)CCN1C(=O)C1=CC=C(N(C=N2)C=3C(=CC=CC=3)OCCOC=3C=CC(F)=CC=3)C2=C1 MFEQPHZZMQEJTB-UHFFFAOYSA-N 0.000 claims 1
- VNEUJYMWOQKZPV-UHFFFAOYSA-N [4-(1-hydroxyethyl)piperazin-1-yl]-[1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazol-5-yl]methanone Chemical compound C1CN(C(O)C)CCN1C(=O)C1=CC=C(N(C=N2)C=3C=C(OCC=4C=CC(OC(F)(F)F)=CC=4)C=CC=3)C2=C1 VNEUJYMWOQKZPV-UHFFFAOYSA-N 0.000 claims 1
- RXRDWDMRVPMVFB-UHFFFAOYSA-N [4-(1-hydroxyethyl)piperidin-1-yl]-[1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazol-5-yl]methanone Chemical compound C1CC(C(O)C)CCN1C(=O)C1=CC=C(N(C=N2)C=3C=C(OCC=4C=CC(OC(F)(F)F)=CC=4)C=CC=3)C2=C1 RXRDWDMRVPMVFB-UHFFFAOYSA-N 0.000 claims 1
- ZRKWNHMECZKQSM-UHFFFAOYSA-N [4-(2-methoxyethyl)piperazin-1-yl]-[1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazol-5-yl]methanone Chemical compound C1CN(CCOC)CCN1C(=O)C1=CC=C(N(C=N2)C=3C=C(OCC=4C=CC(OC(F)(F)F)=CC=4)C=CC=3)C2=C1 ZRKWNHMECZKQSM-UHFFFAOYSA-N 0.000 claims 1
- 231100000433 cytotoxic Toxicity 0.000 claims 1
- 230000001472 cytotoxic effect Effects 0.000 claims 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims 1
- 208000026037 malignant tumor of neck Diseases 0.000 claims 1
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 claims 1
- BJBRVNBMAVPWIV-UHFFFAOYSA-N n-(2-hydroxyethyl)-1-[4-(2-pyridin-2-yloxyethoxy)phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCO)=CC=C2N1C(C=C1)=CC=C1OCCOC1=CC=CC=N1 BJBRVNBMAVPWIV-UHFFFAOYSA-N 0.000 claims 1
- OHJGKWCMWINDIS-UHFFFAOYSA-N n-(2-morpholin-4-ylethyl)-1-[4-[[4-(trifluoromethoxy)phenyl]methylamino]phenyl]benzimidazole-5-carboxamide Chemical compound C1=CC(OC(F)(F)F)=CC=C1CNC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCCN2CCOCC2)C=C1 OHJGKWCMWINDIS-UHFFFAOYSA-N 0.000 claims 1
- NJEIKUWTGDEECN-UHFFFAOYSA-N n-(2-morpholin-4-ylethyl)-3h-benzimidazole-5-carboxamide Chemical compound C=1C=C2N=CNC2=CC=1C(=O)NCCN1CCOCC1 NJEIKUWTGDEECN-UHFFFAOYSA-N 0.000 claims 1
- IAPFITXGRCCFKS-UHFFFAOYSA-N n-(3-methoxypropyl)-1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCCOC)=CC=C2N1C(C=1)=CC=CC=1OCC1=CC=C(OC(F)(F)F)C=C1 IAPFITXGRCCFKS-UHFFFAOYSA-N 0.000 claims 1
- RWKKOVIGWQDWTH-UHFFFAOYSA-N n-(3-methylsulfanylpropyl)-1-[4-(1-pyridin-2-yloxypropan-2-yloxy)phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCCSC)=CC=C2N1C(C=C1)=CC=C1OC(C)COC1=CC=CC=N1 RWKKOVIGWQDWTH-UHFFFAOYSA-N 0.000 claims 1
- YIUMQNYKBKIRKU-UHFFFAOYSA-N n-(3-methylsulfanylpropyl)-1-[4-(3-pyridin-2-yloxybutan-2-yloxy)phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCCSC)=CC=C2N1C(C=C1)=CC=C1OC(C)C(C)OC1=CC=CC=N1 YIUMQNYKBKIRKU-UHFFFAOYSA-N 0.000 claims 1
- SBHPIVZNACXOGI-UHFFFAOYSA-N n-(3-morpholin-4-ylpropyl)-1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=CC(OC(F)(F)F)=CC=C1COC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCCCN2CCOCC2)=C1 SBHPIVZNACXOGI-UHFFFAOYSA-N 0.000 claims 1
- ROSSNFLGYMBAJY-UHFFFAOYSA-N n-(3-morpholin-4-ylpropyl)-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=CC(OC(F)(F)F)=CC=C1COC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCCCN2CCOCC2)C=C1 ROSSNFLGYMBAJY-UHFFFAOYSA-N 0.000 claims 1
- UEDSDQOTMUHZDU-UHFFFAOYSA-N n-(oxan-4-yl)-1-[4-[[4-(trifluoromethoxy)phenyl]methylamino]phenyl]benzimidazole-5-carboxamide Chemical compound C1=CC(OC(F)(F)F)=CC=C1CNC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NC2CCOCC2)C=C1 UEDSDQOTMUHZDU-UHFFFAOYSA-N 0.000 claims 1
- RGYZHGHIFBMHBO-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=CC(C(F)(F)F)=CC=C1COC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCC2CCOCC2)C=C1 RGYZHGHIFBMHBO-UHFFFAOYSA-N 0.000 claims 1
- TVMDOUTVUGPION-UHFFFAOYSA-N n-(pyridin-3-ylmethyl)-1-[3-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(C=CC=3)N3CCN(CC3)C=3N=CC=CN=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 TVMDOUTVUGPION-UHFFFAOYSA-N 0.000 claims 1
- OSSLLUXAEYOIPA-UHFFFAOYSA-N n-(pyridin-3-ylmethyl)-1-[3-(quinolin-2-ylmethoxy)phenyl]benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=C(OCC=4N=C5C=CC=CC5=CC=4)C=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 OSSLLUXAEYOIPA-UHFFFAOYSA-N 0.000 claims 1
- SMESQSGEYANAQH-UHFFFAOYSA-N n-(pyridin-3-ylmethyl)-1-[4-(3-pyridin-4-ylpropoxy)phenyl]benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCCCC=4C=CN=CC=4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 SMESQSGEYANAQH-UHFFFAOYSA-N 0.000 claims 1
- CRDCDIGLMVZQLL-UHFFFAOYSA-N n-(pyridin-3-ylmethyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCC=4N=C5C=CC=CC5=CC=4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 CRDCDIGLMVZQLL-UHFFFAOYSA-N 0.000 claims 1
- VRKKYXQBYPCMSE-UHFFFAOYSA-N n-ethyl-1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCC)=CC=C2N1C(C=1)=CC=CC=1OCC1=CC=C(OC(F)(F)F)C=C1 VRKKYXQBYPCMSE-UHFFFAOYSA-N 0.000 claims 1
- MCFNYKBWQXXACU-UHFFFAOYSA-N n-methyl-1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NC)=CC=C2N1C(C=1)=CC=CC=1OCC1=CC=C(OC(F)(F)F)C=C1 MCFNYKBWQXXACU-UHFFFAOYSA-N 0.000 claims 1
- MJZDGZJRVRIQRE-UHFFFAOYSA-N n-methyl-1-[4-(2-pyridin-2-yloxyethoxy)phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NC)=CC=C2N1C(C=C1)=CC=C1OCCOC1=CC=CC=N1 MJZDGZJRVRIQRE-UHFFFAOYSA-N 0.000 claims 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 201000002528 pancreatic cancer Diseases 0.000 claims 1
- 208000008443 pancreatic carcinoma Diseases 0.000 claims 1
- RFIOZSIHFNEKFF-UHFFFAOYSA-N piperazine-1-carboxylic acid Chemical compound OC(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-N 0.000 claims 1
- 206010028980 Neoplasm Diseases 0.000 abstract description 15
- 201000011510 cancer Diseases 0.000 abstract description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 69
- ZMXDDKWLCZADIW-UHFFFAOYSA-N Vilsmeier-Haack reagent Natural products CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 44
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 40
- 238000000034 method Methods 0.000 description 40
- 239000011541 reaction mixture Substances 0.000 description 37
- 239000007787 solid Substances 0.000 description 33
- 238000006243 chemical reaction Methods 0.000 description 31
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 25
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 21
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 238000005160 1H NMR spectroscopy Methods 0.000 description 18
- 108091000080 Phosphotransferase Proteins 0.000 description 16
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 16
- 102000020233 phosphotransferase Human genes 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 239000008194 pharmaceutical composition Substances 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 13
- 239000004480 active ingredient Substances 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 12
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 11
- 235000019439 ethyl acetate Nutrition 0.000 description 11
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 11
- 239000007788 liquid Substances 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 238000004587 chromatography analysis Methods 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 102000005962 receptors Human genes 0.000 description 10
- 108020003175 receptors Proteins 0.000 description 10
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 10
- 239000003643 water by type Substances 0.000 description 10
- BOJWTAQWPVBIPG-UHFFFAOYSA-N 4-fluoro-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 BOJWTAQWPVBIPG-UHFFFAOYSA-N 0.000 description 9
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 8
- 102100020880 Kit ligand Human genes 0.000 description 8
- 108010039445 Stem Cell Factor Proteins 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 239000000969 carrier Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 7
- 206010051066 Gastrointestinal stromal tumour Diseases 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 201000011243 gastrointestinal stromal tumor Diseases 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 231100000252 nontoxic Toxicity 0.000 description 7
- 230000003000 nontoxic effect Effects 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 238000002953 preparative HPLC Methods 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 230000002829 reductive effect Effects 0.000 description 7
- 239000011347 resin Substances 0.000 description 7
- 229920005989 resin Polymers 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 6
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 6
- 230000001404 mediated effect Effects 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- 239000012298 atmosphere Substances 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 230000012010 growth Effects 0.000 description 5
- 125000001072 heteroaryl group Chemical group 0.000 description 5
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 239000003446 ligand Substances 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 230000026731 phosphorylation Effects 0.000 description 5
- 238000006366 phosphorylation reaction Methods 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 5
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 4
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 4
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000002965 ELISA Methods 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 239000012911 assay medium Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 239000013058 crude material Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000011534 incubation Methods 0.000 description 4
- 239000000314 lubricant Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 208000000516 mast-cell leukemia Diseases 0.000 description 4
- 208000008585 mastocytosis Diseases 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- LHWIIDAAHNZWQY-UHFFFAOYSA-N 1-(3-hydroxyphenyl)-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound OC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 LHWIIDAAHNZWQY-UHFFFAOYSA-N 0.000 description 3
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 3
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 3
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 3
- FMEORZSHJKEHOJ-UHFFFAOYSA-N C(C)(=O)NC=1C=C(C=CC=1)NC1=C(C(=O)O)C=CC=C1[N+](=O)[O-] Chemical compound C(C)(=O)NC=1C=C(C=CC=1)NC1=C(C(=O)O)C=CC=C1[N+](=O)[O-] FMEORZSHJKEHOJ-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- 108010002386 Interleukin-3 Proteins 0.000 description 3
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 102000004278 Receptor Protein-Tyrosine Kinases Human genes 0.000 description 3
- 108090000873 Receptor Protein-Tyrosine Kinases Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000002837 carbocyclic group Chemical group 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000013592 cell lysate Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 239000002254 cytotoxic agent Substances 0.000 description 3
- 231100000599 cytotoxic agent Toxicity 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 229940080856 gleevec Drugs 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 229940043355 kinase inhibitor Drugs 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000035772 mutation Effects 0.000 description 3
- 239000013642 negative control Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- 210000004881 tumor cell Anatomy 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- OIMYTJKLMHSPNR-UHFFFAOYSA-N 1-(3-acetamidophenyl)benzimidazole-5-carboxylic acid Chemical compound CC(=O)NC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(O)=O)=C1 OIMYTJKLMHSPNR-UHFFFAOYSA-N 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- GCDGCOQSXIVIMI-UHFFFAOYSA-N 1-methylbenzimidazole-5-carboxamide Chemical compound NC(=O)C1=CC=C2N(C)C=NC2=C1 GCDGCOQSXIVIMI-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- FPZWZCWUIYYYBU-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl acetate Chemical group CCOCCOCCOC(C)=O FPZWZCWUIYYYBU-UHFFFAOYSA-N 0.000 description 2
- PHPYXVIHDRDPDI-UHFFFAOYSA-N 2-bromo-1h-benzimidazole Chemical compound C1=CC=C2NC(Br)=NC2=C1 PHPYXVIHDRDPDI-UHFFFAOYSA-N 0.000 description 2
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- RKBOVIXFWKGJLG-UHFFFAOYSA-N 2-pyridin-2-yloxyethanol Chemical compound OCCOC1=CC=CC=N1 RKBOVIXFWKGJLG-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- SOSRJZNYVRVFOH-UHFFFAOYSA-N 3-amino-4-anilinobenzoic acid Chemical compound NC1=CC(C(O)=O)=CC=C1NC1=CC=CC=C1 SOSRJZNYVRVFOH-UHFFFAOYSA-N 0.000 description 2
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 2
- UGUUCNPLYAGMNG-UHFFFAOYSA-N 3-nitro-4-(phenylazaniumyl)benzoate Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC=C1NC1=CC=CC=C1 UGUUCNPLYAGMNG-UHFFFAOYSA-N 0.000 description 2
- GRFNBEZIAWKNCO-UHFFFAOYSA-N 3-pyridinol Chemical compound OC1=CC=CN=C1 GRFNBEZIAWKNCO-UHFFFAOYSA-N 0.000 description 2
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 230000006820 DNA synthesis Effects 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 238000012286 ELISA Assay Methods 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 239000007821 HATU Substances 0.000 description 2
- 229910004373 HOAc Inorganic materials 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- 108700020796 Oncogene Proteins 0.000 description 2
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 2
- 235000019483 Peanut oil Nutrition 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 108091005682 Receptor kinases Proteins 0.000 description 2
- 208000015634 Rectal Neoplasms Diseases 0.000 description 2
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 208000005718 Stomach Neoplasms Diseases 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000012317 TBTU Substances 0.000 description 2
- 229940123237 Taxane Drugs 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 description 2
- 239000006096 absorbing agent Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 230000001093 anti-cancer Effects 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000008004 cell lysis buffer Substances 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229960004316 cisplatin Drugs 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- 210000001072 colon Anatomy 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 206010017758 gastric cancer Diseases 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 201000010536 head and neck cancer Diseases 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- UWSZCZQOKCCULF-UHFFFAOYSA-N methyl 1-(4-hydroxyphenyl)benzimidazole-5-carboxylate Chemical compound C1=NC2=CC(C(=O)OC)=CC=C2N1C1=CC=C(O)C=C1 UWSZCZQOKCCULF-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- YNBADRVTZLEFNH-UHFFFAOYSA-N methyl nicotinate Chemical compound COC(=O)C1=CC=CN=C1 YNBADRVTZLEFNH-UHFFFAOYSA-N 0.000 description 2
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- DCWXELXMIBXGTH-UHFFFAOYSA-N phosphotyrosine Chemical compound OC(=O)C(N)CC1=CC=C(OP(O)(O)=O)C=C1 DCWXELXMIBXGTH-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 206010038038 rectal cancer Diseases 0.000 description 2
- 201000001275 rectum cancer Diseases 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 210000000130 stem cell Anatomy 0.000 description 2
- 201000011549 stomach cancer Diseases 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 229940120982 tarceva Drugs 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 2
- VNNLHYZDXIBHKZ-UHFFFAOYSA-N thiophene-2-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CS1 VNNLHYZDXIBHKZ-UHFFFAOYSA-N 0.000 description 2
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 238000011269 treatment regimen Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- IHIXIJGXTJIKRB-UHFFFAOYSA-N trisodium vanadate Chemical compound [Na+].[Na+].[Na+].[O-][V]([O-])([O-])=O IHIXIJGXTJIKRB-UHFFFAOYSA-N 0.000 description 2
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 2
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 2
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 2
- 230000003612 virological effect Effects 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- PFTAWBLQPZVEMU-DZGCQCFKSA-N (+)-catechin Chemical compound C1([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC=C(O)C(O)=C1 PFTAWBLQPZVEMU-DZGCQCFKSA-N 0.000 description 1
- GYYDPBCUIJTIBM-DYOGSRDZSA-N (2r,3s,4s,5r)-2-(hydroxymethyl)-6-[[(4r,5s)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol Chemical compound O[C@@H]1[C@@H](OC)[C@@H](O)[C@@H](CO)OC1OC1[C@H]2OCC1OC(C)[C@H]2O GYYDPBCUIJTIBM-DYOGSRDZSA-N 0.000 description 1
- PDVFSPNIEOYOQL-UHFFFAOYSA-N (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(C)C=C1 PDVFSPNIEOYOQL-UHFFFAOYSA-N 0.000 description 1
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 description 1
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- CIISBYKBBMFLEZ-UHFFFAOYSA-N 1,2-oxazolidine Chemical compound C1CNOC1 CIISBYKBBMFLEZ-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- CZSRXHJVZUBEGW-UHFFFAOYSA-N 1,2-thiazolidine Chemical compound C1CNSC1 CZSRXHJVZUBEGW-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- UGRMITBWUVWUEB-UHFFFAOYSA-N 1-$l^{1}-oxidanyl-3-methylbenzene Chemical group CC1=CC=CC([O])=C1 UGRMITBWUVWUEB-UHFFFAOYSA-N 0.000 description 1
- OJJXGUWATBNSBX-UHFFFAOYSA-N 1-(3-hydroxyphenyl)benzimidazole-5-carboxylic acid Chemical compound C1=NC2=CC(C(=O)O)=CC=C2N1C1=CC=CC(O)=C1 OJJXGUWATBNSBX-UHFFFAOYSA-N 0.000 description 1
- DEMHOXWUUFXDLE-UHFFFAOYSA-N 1-(3-morpholin-4-ylpropyl)benzimidazole-5-carboxamide Chemical compound N1(CCOCC1)CCCN1C=NC2=C1C=CC(=C2)C(=O)N DEMHOXWUUFXDLE-UHFFFAOYSA-N 0.000 description 1
- JDNPUJCKXLOHOW-UHFFFAOYSA-N 1-(bromomethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CBr)C=C1 JDNPUJCKXLOHOW-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical group C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- WOVWEIQUSSUOLI-UHFFFAOYSA-N 1-[3-(2-chloroethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound ClCCOC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)=C1 WOVWEIQUSSUOLI-UHFFFAOYSA-N 0.000 description 1
- NBNPVRFWJNSLEM-UHFFFAOYSA-N 1-[4-(1h-indol-3-ylmethoxy)phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C=1C=C2N(C=3C=CC(OCC=4C5=CC=CC=C5NC=4)=CC=3)C=NC2=CC=1C(=O)NCC1=CC=CN=C1 NBNPVRFWJNSLEM-UHFFFAOYSA-N 0.000 description 1
- UVLGBIQIXSTVPL-UHFFFAOYSA-N 1-[4-[2-(4-bromophenoxy)ethoxy]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(Br)=CC=C1OCCOC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)C=C1 UVLGBIQIXSTVPL-UHFFFAOYSA-N 0.000 description 1
- UOPLDFBCLQHPJP-UHFFFAOYSA-N 1-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]-n-(2-morpholin-4-ylethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(F)=CC=C1OCCOC1=CC=C(N2C3=CC=C(C=C3N=C2)C(=O)NCCN2CCOCC2)C=C1 UOPLDFBCLQHPJP-UHFFFAOYSA-N 0.000 description 1
- XPOHUEQBCAVXMY-UHFFFAOYSA-N 1-[4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]-n-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide Chemical compound C1=CC(F)=CC=C1C1CCN(C=2C=CC(=CC=2)N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C=NC=CC=2)CC1 XPOHUEQBCAVXMY-UHFFFAOYSA-N 0.000 description 1
- FUBDRGWGYBHZFD-UHFFFAOYSA-N 1-[4-[[4-(difluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)N)=CC=C2N1C(C=C1)=CC=C1OCC1=CC=C(OC(F)F)C=C1 FUBDRGWGYBHZFD-UHFFFAOYSA-N 0.000 description 1
- WRZOGOURZGOUAO-UHFFFAOYSA-N 1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazole-5-carboxylic acid Chemical compound C1=NC2=CC(C(=O)O)=CC=C2N1C(C=C1)=CC=C1OCC1=CC=C(OC(F)(F)F)C=C1 WRZOGOURZGOUAO-UHFFFAOYSA-N 0.000 description 1
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- CVPOWJXYMCMMPD-UHFFFAOYSA-N 2-(benzimidazol-1-yl)phenol Chemical class OC1=CC=CC=C1N1C2=CC=CC=C2N=C1 CVPOWJXYMCMMPD-UHFFFAOYSA-N 0.000 description 1
- FDACVBRDOHNVKP-UHFFFAOYSA-N 2-[2-(4-nitrophenoxy)ethoxy]pyridine Chemical compound C1=CC([N+](=O)[O-])=CC=C1OCCOC1=CC=CC=N1 FDACVBRDOHNVKP-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- ZXNMIUJDTOMBPV-UHFFFAOYSA-N 2-chloroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCl)C=C1 ZXNMIUJDTOMBPV-UHFFFAOYSA-N 0.000 description 1
- OKDGRDCXVWSXDC-UHFFFAOYSA-N 2-chloropyridine Chemical compound ClC1=CC=CC=N1 OKDGRDCXVWSXDC-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- MTAODLNXWYIKSO-UHFFFAOYSA-N 2-fluoropyridine Chemical compound FC1=CC=CC=N1 MTAODLNXWYIKSO-UHFFFAOYSA-N 0.000 description 1
- 125000005975 2-phenylethyloxy group Chemical group 0.000 description 1
- ZOOGRGPOEVQQDX-UUOKFMHZSA-N 3',5'-cyclic GMP Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](O)[C@@H]2N1C(N=C(NC2=O)N)=C2N=C1 ZOOGRGPOEVQQDX-UUOKFMHZSA-N 0.000 description 1
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 description 1
- JRASUUTVFCLPPO-UHFFFAOYSA-N 3-(2-chloroethyl)-1h-indole Chemical compound C1=CC=C2C(CCCl)=CNC2=C1 JRASUUTVFCLPPO-UHFFFAOYSA-N 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- UWLJERQTLRORJN-UHFFFAOYSA-N 3-(trifluoromethoxy)phenol Chemical compound OC1=CC=CC(OC(F)(F)F)=C1 UWLJERQTLRORJN-UHFFFAOYSA-N 0.000 description 1
- NAGDKJNBBOZYEV-UHFFFAOYSA-N 3-[3-(4-methylphenoxy)propoxy]phenol Chemical compound C1=CC(C)=CC=C1OCCCOC1=CC=CC(O)=C1 NAGDKJNBBOZYEV-UHFFFAOYSA-N 0.000 description 1
- WEVYNIUIFUYDGI-UHFFFAOYSA-N 3-[6-[4-(trifluoromethoxy)anilino]-4-pyrimidinyl]benzamide Chemical compound NC(=O)C1=CC=CC(C=2N=CN=C(NC=3C=CC(OC(F)(F)F)=CC=3)C=2)=C1 WEVYNIUIFUYDGI-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- DTGONJAUUOWYGB-UHFFFAOYSA-N 3-fluoro-2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1[N+]([O-])=O DTGONJAUUOWYGB-UHFFFAOYSA-N 0.000 description 1
- DXVQSHRBALIFBC-UHFFFAOYSA-N 3-phenoxypropan-1-amine Chemical compound NCCCOC1=CC=CC=C1 DXVQSHRBALIFBC-UHFFFAOYSA-N 0.000 description 1
- JTWGNQQRTPIYSJ-UHFFFAOYSA-N 3-phenoxypropylazanium;chloride Chemical compound Cl.NCCCOC1=CC=CC=C1 JTWGNQQRTPIYSJ-UHFFFAOYSA-N 0.000 description 1
- IGPFOKFDBICQMC-UHFFFAOYSA-N 3-phenylmethoxyaniline Chemical compound NC1=CC=CC(OCC=2C=CC=CC=2)=C1 IGPFOKFDBICQMC-UHFFFAOYSA-N 0.000 description 1
- VPWZKTIJMIVJBB-UHFFFAOYSA-N 3H-benzimidazole-5-carboxamide dihydrochloride Chemical compound Cl.Cl.N1C=NC2=C1C=C(C=C2)C(=O)N VPWZKTIJMIVJBB-UHFFFAOYSA-N 0.000 description 1
- MHYFFTTYTUCIKP-UHFFFAOYSA-N 4-[2-(3-methylphenoxy)ethoxy]phenol Chemical compound CC1=CC=CC(OCCOC=2C=CC(O)=CC=2)=C1 MHYFFTTYTUCIKP-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- OAHXYWFTOWNMNU-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-4,5-diol Chemical class OC1=CC=C2OC2=C1O OAHXYWFTOWNMNU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 108010039627 Aprotinin Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 229910015845 BBr3 Inorganic materials 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 102100028990 C-X-C chemokine receptor type 3 Human genes 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- 208000002699 Digestive System Neoplasms Diseases 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 102000001301 EGF receptor Human genes 0.000 description 1
- 108060006698 EGF receptor Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 108010074860 Factor Xa Proteins 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 101000916050 Homo sapiens C-X-C chemokine receptor type 3 Proteins 0.000 description 1
- 101000932478 Homo sapiens Receptor-type tyrosine-protein kinase FLT3 Proteins 0.000 description 1
- 108010001336 Horseradish Peroxidase Proteins 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- GDBQQVLCIARPGH-UHFFFAOYSA-N Leupeptin Natural products CC(C)CC(NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(C=O)CCCN=C(N)N GDBQQVLCIARPGH-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 206010064912 Malignant transformation Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- HOKKHZGPKSLGJE-GSVOUGTGSA-N N-Methyl-D-aspartic acid Chemical compound CN[C@@H](C(O)=O)CC(O)=O HOKKHZGPKSLGJE-GSVOUGTGSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 208000034176 Neoplasms, Germ Cell and Embryonal Diseases 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 102000043276 Oncogene Human genes 0.000 description 1
- 206010061535 Ovarian neoplasm Diseases 0.000 description 1
- 108091008606 PDGF receptors Proteins 0.000 description 1
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 1
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 1
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 102000002727 Protein Tyrosine Phosphatase Human genes 0.000 description 1
- 102100020718 Receptor-type tyrosine-protein kinase FLT3 Human genes 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 108091006629 SLC13A2 Proteins 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N Tetrahydrothiophene-1,1-dioxide, Natural products O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- OXEVLIIEDIZZDB-UHFFFAOYSA-N [O-][N+](C1=CC=CC(C(O)=O)=C1NC1=CC(OCC2=CC=CC=C2)=CC=C1)=O Chemical compound [O-][N+](C1=CC=CC(C(O)=O)=C1NC1=CC(OCC2=CC=CC=C2)=CC=C1)=O OXEVLIIEDIZZDB-UHFFFAOYSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000010441 alabaster Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 230000002491 angiogenic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000340 anti-metabolite Effects 0.000 description 1
- 239000002256 antimetabolite Substances 0.000 description 1
- 229940100197 antimetabolite Drugs 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 229960004405 aprotinin Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000003305 autocrine Effects 0.000 description 1
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- QXNDZONIWRINJR-UHFFFAOYSA-N azocane Chemical compound C1CCCNCCC1 QXNDZONIWRINJR-UHFFFAOYSA-N 0.000 description 1
- 108010056708 bcr-abl Fusion Proteins Proteins 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 150000008641 benzimidazolones Chemical class 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000012830 cancer therapeutic Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- ADRVNXBAWSRFAJ-UHFFFAOYSA-N catechin Natural products OC1Cc2cc(O)cc(O)c2OC1c3ccc(O)c(O)c3 ADRVNXBAWSRFAJ-UHFFFAOYSA-N 0.000 description 1
- 235000005487 catechin Nutrition 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 239000012501 chromatography medium Substances 0.000 description 1
- 229950001002 cianidanol Drugs 0.000 description 1
- 230000004186 co-expression Effects 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 230000001010 compromised effect Effects 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- TXWOGHSRPAYOML-UHFFFAOYSA-M cyclobutanecarboxylate Chemical compound [O-]C(=O)C1CCC1 TXWOGHSRPAYOML-UHFFFAOYSA-M 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 239000012636 effector Substances 0.000 description 1
- 229940121647 egfr inhibitor Drugs 0.000 description 1
- 230000013020 embryo development Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000006345 epimerization reaction Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000012091 fetal bovine serum Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000005519 fluorenylmethyloxycarbonyl group Chemical group 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 1
- 229960005277 gemcitabine Drugs 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000003979 granulating agent Substances 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 230000011132 hemopoiesis Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 238000005734 heterodimerization reaction Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 229960002411 imatinib Drugs 0.000 description 1
- 229960003685 imatinib mesylate Drugs 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
- 102000010681 interleukin-8 receptors Human genes 0.000 description 1
- 108010038415 interleukin-8 receptors Proteins 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- GDBQQVLCIARPGH-ULQDDVLXSA-N leupeptin Chemical compound CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CCCN=C(N)N GDBQQVLCIARPGH-ULQDDVLXSA-N 0.000 description 1
- 108010052968 leupeptin Proteins 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000036212 malign transformation Effects 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 230000003061 melanogenesis Effects 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- BYKHAEUVLSBWSU-UHFFFAOYSA-N methyl 3-hydroxycyclobutane-1-carboxylate Chemical compound COC(=O)C1CC(O)C1 BYKHAEUVLSBWSU-UHFFFAOYSA-N 0.000 description 1
- KJJSHOHQQHACLE-UHFFFAOYSA-N methyl 5-hydroxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(O)=C1 KJJSHOHQQHACLE-UHFFFAOYSA-N 0.000 description 1
- CBTGNLZUIZHUHY-UHFFFAOYSA-N methyl cyclobutanecarboxylate Chemical compound COC(=O)C1CCC1 CBTGNLZUIZHUHY-UHFFFAOYSA-N 0.000 description 1
- 229960001238 methylnicotinate Drugs 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- OMHDEIWLFJQWHA-UHFFFAOYSA-N morpholin-4-yl-[1-[3-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]benzimidazol-5-yl]methanone Chemical compound C1=CC(OC(F)(F)F)=CC=C1COC1=CC=CC(N2C3=CC=C(C=C3N=C2)C(=O)N2CCOCC2)=C1 OMHDEIWLFJQWHA-UHFFFAOYSA-N 0.000 description 1
- JEDHEXUPBRMUMB-UHFFFAOYSA-N n,n-dimethylpyridin-3-amine Chemical compound CN(C)C1=CC=CN=C1 JEDHEXUPBRMUMB-UHFFFAOYSA-N 0.000 description 1
- JHHCRFCBLFOTGK-UHFFFAOYSA-N n-(1h-indol-2-ylmethyl)benzamide Chemical class C=1C2=CC=CC=C2NC=1CNC(=O)C1=CC=CC=C1 JHHCRFCBLFOTGK-UHFFFAOYSA-N 0.000 description 1
- AHNSGCVISFJIFT-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]-1-[4-[2-(4-fluorophenoxy)ethoxy]phenyl]benzimidazole-5-carboxamide Chemical compound C1=NC2=CC(C(=O)NCCCN(C)C)=CC=C2N1C(C=C1)=CC=C1OCCOC1=CC=C(F)C=C1 AHNSGCVISFJIFT-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 210000005170 neoplastic cell Anatomy 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- 150000004987 o-phenylenediamines Chemical class 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 230000000771 oncological effect Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- XHWNEBDUPVMPKI-UHFFFAOYSA-N oxazetidine Chemical compound C1CON1 XHWNEBDUPVMPKI-UHFFFAOYSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- UHHKSVZZTYJVEG-UHFFFAOYSA-N oxepane Chemical compound C1CCCOCC1 UHHKSVZZTYJVEG-UHFFFAOYSA-N 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- HZIVRQOIUMAXID-UHFFFAOYSA-N oxocane Chemical compound C1CCCOCCC1 HZIVRQOIUMAXID-UHFFFAOYSA-N 0.000 description 1
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 230000003076 paracrine Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 230000007310 pathophysiology Effects 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920005597 polymer membrane Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- DSNYFFJTZPIKFZ-UHFFFAOYSA-N propoxybenzene Chemical group CCCOC1=CC=CC=C1 DSNYFFJTZPIKFZ-UHFFFAOYSA-N 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 108020000494 protein-tyrosine phosphatase Proteins 0.000 description 1
- 150000003212 purines Chemical class 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- DKPFODGZWDEEBT-QFIAKTPHSA-N taxane Chemical class C([C@]1(C)CCC[C@@H](C)[C@H]1C1)C[C@H]2[C@H](C)CC[C@@H]1C2(C)C DKPFODGZWDEEBT-QFIAKTPHSA-N 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- ISXOBTBCNRIIQO-UHFFFAOYSA-N tetrahydrothiophene 1-oxide Chemical compound O=S1CCCC1 ISXOBTBCNRIIQO-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- XSROQCDVUIHRSI-UHFFFAOYSA-N thietane Chemical compound C1CSC1 XSROQCDVUIHRSI-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 230000001131 transforming effect Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- 229960004528 vincristine Drugs 0.000 description 1
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 1
- 239000011534 wash buffer Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/622—Forming processes; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/626—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B
- C04B35/63—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B using additives specially adapted for forming the products, e.g.. binder binders
- C04B35/632—Organic additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Health & Medical Sciences (AREA)
- Ceramic Engineering (AREA)
- Manufacturing & Machinery (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Inorganic Chemistry (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Hematology (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US49680603P | 2003-08-21 | 2003-08-21 | |
| PCT/US2004/026482 WO2005021531A1 (en) | 2003-08-21 | 2004-08-16 | N-substituted benzimidazolyl c-kit inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MXPA06002018A true MXPA06002018A (es) | 2006-05-31 |
Family
ID=34272519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MXPA06002018A MXPA06002018A (es) | 2003-08-21 | 2004-08-16 | Bencimidazolilo n-sustituidos inhibidores de c-kit. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US7521448B2 (enExample) |
| EP (1) | EP1664021A1 (enExample) |
| JP (1) | JP4769720B2 (enExample) |
| KR (1) | KR20060121818A (enExample) |
| CN (1) | CN1852905A (enExample) |
| AP (1) | AP2006003549A0 (enExample) |
| AR (1) | AR045387A1 (enExample) |
| AU (1) | AU2004268949A1 (enExample) |
| BR (1) | BRPI0413746A (enExample) |
| CA (1) | CA2535896A1 (enExample) |
| IL (1) | IL173614A0 (enExample) |
| IS (1) | IS8319A (enExample) |
| MX (1) | MXPA06002018A (enExample) |
| NO (1) | NO20060664L (enExample) |
| RU (1) | RU2006108803A (enExample) |
| TW (1) | TW200524905A (enExample) |
| UA (1) | UA82395C2 (enExample) |
| WO (1) | WO2005021531A1 (enExample) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX242553B (es) | 2000-10-20 | 2006-12-06 | Eisai Co Ltd | Derivados aromaticos que contienen nitrogeno. |
| US7442709B2 (en) * | 2003-08-21 | 2008-10-28 | Osi Pharmaceuticals, Inc. | N3-substituted imidazopyridine c-Kit inhibitors |
| US7683172B2 (en) * | 2003-11-11 | 2010-03-23 | Eisai R&D Management Co., Ltd. | Urea derivative and process for preparing the same |
| WO2006030826A1 (ja) * | 2004-09-17 | 2006-03-23 | Eisai R & D Management Co., Ltd. | 医薬組成物 |
| EP1831206B1 (en) | 2004-12-01 | 2011-08-24 | OSI Pharmaceuticals, Inc. | N-substituted benzimidazolyl c-kit inhibitors and combinatorial benzimidazole library |
| JP2008534683A (ja) * | 2005-04-04 | 2008-08-28 | オーエスアイ・ファーマスーティカルズ・インコーポレーテッド | 過剰増殖性疾患の治療のためのピロロ[2,3−d]イミダゾール |
| WO2006108800A1 (en) * | 2005-04-13 | 2006-10-19 | Neurosearch A/S | Benzimidazole derivatives and their use for modulating the gabaa receptor complex |
| GB0507575D0 (en) | 2005-04-14 | 2005-05-18 | Novartis Ag | Organic compounds |
| EP1874758A1 (en) * | 2005-04-19 | 2008-01-09 | Neurosearch A/S | Benzimidazole derivatives and their use for modulating the gabaa receptor complex |
| EP1925941B1 (en) * | 2005-08-01 | 2012-11-28 | Eisai R&D Management Co., Ltd. | Method for prediction of the efficacy of vascularization inhibitor |
| EP2281901B1 (en) * | 2005-08-02 | 2013-11-27 | Eisai R&D Management Co., Ltd. | Anti-tumour pharmaceutical composition with angiogenesis inhibitors |
| KR101353763B1 (ko) | 2005-11-07 | 2014-01-21 | 에자이 알앤드디 매니지먼트 가부시키가이샤 | 혈관 신생 저해 물질과 c―kit 키나아제 저해 물질의병용 |
| CA2632395A1 (en) * | 2005-12-05 | 2007-06-14 | Neurosearch A/S | Benzimidazole derivatives and their use for modulating the gabaa receptor complex |
| TW200740776A (en) * | 2006-02-06 | 2007-11-01 | Osi Pharm Inc | N-phenylbenzotriazolyl c-kit inhibitors |
| AU2007252506C1 (en) * | 2006-05-18 | 2012-07-19 | Eisai R & D Management Co., Ltd. | Antitumor agent for thyroid cancer |
| EP2065372B1 (en) * | 2006-08-28 | 2012-11-28 | Eisai R&D Management Co., Ltd. | Antitumor agent for undifferentiated gastric cancer |
| JP2010506879A (ja) * | 2006-10-16 | 2010-03-04 | ノバルティス アーゲー | プロテインキナーゼ阻害剤として有用なフェニルアセトアミド |
| AU2007337886C1 (en) | 2006-12-22 | 2014-10-16 | Astex Therapeutics Limited | Bicyclic heterocyclic compounds as FGFR inhibitors |
| CN101679409B (zh) * | 2006-12-22 | 2014-11-26 | Astex治疗学有限公司 | 双环杂环衍生化合物、其医药组合物和其用途 |
| AU2008205847A1 (en) * | 2007-01-19 | 2008-07-24 | Eisai R & D Management Co., Ltd. | Composition for treatment of pancreatic cancer |
| CN101600694A (zh) * | 2007-01-29 | 2009-12-09 | 卫材R&D管理有限公司 | 未分化型胃癌治疗用组合物 |
| EP1997381A1 (en) * | 2007-06-01 | 2008-12-03 | Commissariat à l'Energie Atomique | Use of a compound having a monogalactosyldiacylglycerol synthase inhibitory activity as herbicide or algaecide, herbicide and algaecide compositions |
| DK2181990T3 (da) | 2007-08-31 | 2012-09-10 | Astellas Pharma Inc | Piperidinderivat |
| GB0720041D0 (en) | 2007-10-12 | 2007-11-21 | Astex Therapeutics Ltd | New Compounds |
| GB0720038D0 (en) | 2007-10-12 | 2007-11-21 | Astex Therapeutics Ltd | New compounds |
| AU2008325608B2 (en) * | 2007-11-09 | 2013-03-14 | Eisai R & D Management Co., Ltd. | Combination of anti-angiogenic substance and anti-tumor platinum complex |
| BRPI0906576A2 (pt) * | 2008-01-29 | 2015-07-07 | Eisai R&D Man Co Ltd | Composição farmacêutica, kit, uso de um composto, e, agente terapêutico para câncer |
| GB0810902D0 (en) | 2008-06-13 | 2008-07-23 | Astex Therapeutics Ltd | New compounds |
| EP2400985A2 (en) | 2009-02-25 | 2012-01-04 | OSI Pharmaceuticals, LLC | Combination of an either an anti-igf-1r antibody or an igf binding protein and a small molecule igf-1r kinase inhibitor |
| WO2010099364A2 (en) | 2009-02-27 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| WO2010099138A2 (en) | 2009-02-27 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| EP2401614A1 (en) | 2009-02-27 | 2012-01-04 | OSI Pharmaceuticals, LLC | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| GB0906472D0 (en) | 2009-04-15 | 2009-05-20 | Astex Therapeutics Ltd | New compounds |
| GB0906470D0 (en) | 2009-04-15 | 2009-05-20 | Astex Therapeutics Ltd | New compounds |
| US20110030037A1 (en) * | 2009-07-07 | 2011-02-03 | Vadim Olshansky | Zone migration in network access |
| AU2011246067A1 (en) * | 2010-04-28 | 2012-09-27 | Daiichi Sankyo Company, Limited | [5,6] heterocyclic compound |
| KR101677790B1 (ko) | 2010-06-25 | 2016-11-18 | 에자이 알앤드디 매니지먼트 가부시키가이샤 | 키나제 저해 작용을 갖는 화합물의 병용에 의한 항종양제 |
| US8889684B2 (en) * | 2011-02-02 | 2014-11-18 | Boehringer Ingelheim International Gmbh | Azaindolylphenyl sulfonamides as serine/threonine kinase inhibitors |
| KR101762999B1 (ko) | 2011-04-18 | 2017-07-28 | 에자이 알앤드디 매니지먼트 가부시키가이샤 | 종양 치료제 |
| JP2014519813A (ja) | 2011-04-25 | 2014-08-21 | オーエスアイ・ファーマシューティカルズ,エルエルシー | 癌薬剤発見、診断、および治療におけるemt遺伝子シグネチャーの使用 |
| US9945862B2 (en) | 2011-06-03 | 2018-04-17 | Eisai R&D Management Co., Ltd. | Biomarkers for predicting and assessing responsiveness of thyroid and kidney cancer subjects to lenvatinib compounds |
| UA111382C2 (uk) * | 2011-10-10 | 2016-04-25 | Оріон Корпорейшн | Інгібітори протеїнкінази |
| WO2013152252A1 (en) | 2012-04-06 | 2013-10-10 | OSI Pharmaceuticals, LLC | Combination anti-cancer therapy |
| CA2889866A1 (en) | 2012-12-21 | 2014-06-26 | Eisai R&D Management Co., Ltd. | Amorphous form of quinoline derivative, and method for producing same |
| WO2014145887A1 (en) * | 2013-03-15 | 2014-09-18 | Whitehead Institute For Biomedical Research | Benzimidazole derivatives and uses thereof |
| TWI628176B (zh) * | 2013-04-04 | 2018-07-01 | 奧利安公司 | 蛋白質激酶抑制劑 |
| NZ714049A (en) | 2013-05-14 | 2020-05-29 | Eisai R&D Man Co Ltd | Biomarkers for predicting and assessing responsiveness of endometrial cancer subjects to lenvatinib compounds |
| HRP20221047T1 (hr) | 2014-08-28 | 2022-11-11 | Eisai R&D Management Co., Ltd. | Derivat kinolina visoke čistoće i postupak za njegovu proizvodnju |
| HUE064614T2 (hu) | 2015-02-25 | 2024-04-28 | Eisai R&D Man Co Ltd | Eljárás egy kinolin-származék keserû ízének elnyomására |
| CA2978226C (en) | 2015-03-04 | 2025-02-18 | Eisai R&D Management Co., Ltd. | COMBINATION OF A PD-1 ANTAGONIST AND A VEGFR/FGFR/RET TYROSINE KINASE INHIBITOR TO TREAT CANCER |
| BR112017027227B1 (pt) | 2015-06-16 | 2023-12-12 | Eisai R&D Management Co., Ltd | Agente anti-câncer |
| MX381976B (es) | 2015-08-20 | 2025-03-13 | Eisai R&D Man Co Ltd | Agente terapéutico contra tumores. |
| CN110291081B (zh) * | 2016-12-15 | 2023-01-31 | 阿瑞雅德制药公司 | 作为c-kit抑制剂的苯并咪唑化合物 |
| KR102539920B1 (ko) | 2017-02-08 | 2023-06-05 | 에자이 알앤드디 매니지먼트 가부시키가이샤 | 종양-치료용 약제학적 조성물 |
| RU2019134940A (ru) | 2017-05-16 | 2021-06-16 | Эйсай Ар Энд Ди Менеджмент Ко., Лтд. | Лечение гепатоцеллюлярной карциномы |
| CN113490667B (zh) * | 2018-12-29 | 2023-10-27 | 盛世泰科生物医药技术(苏州)股份有限公司 | 作为fgfr和vegfr双重抑制剂的咪唑并吡啶衍生物 |
| KR20210142154A (ko) | 2019-03-21 | 2021-11-24 | 옹쎄오 | 암 치료를 위한 키나제 억제제와 조합된 dbait 분자 |
| JP2023500906A (ja) | 2019-11-08 | 2023-01-11 | インサーム(インスティテュ ナシオナル ドゥ ラ サンテ エ ドゥ ラ ルシェルシェ メディカル) | キナーゼ阻害剤に対する獲得抵抗性を有するがんの処置方法 |
| WO2021148581A1 (en) | 2020-01-22 | 2021-07-29 | Onxeo | Novel dbait molecule and its use |
| WO2024029489A1 (en) * | 2022-08-01 | 2024-02-08 | Modulus Discovery, Inc. | Kit inhibitors, compounds, pharmaceutical compositions, and methods of use thereof |
| WO2024117179A1 (en) * | 2022-11-30 | 2024-06-06 | Alivexis, Inc. | Kit inhibitors, compounds, pharmaceutical compositions, and methods of use thereof |
Family Cites Families (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6087380A (en) * | 1949-11-24 | 2000-07-11 | Boehringer Ingelheim Pharma Kg | Disubstituted bicyclic heterocycles, the preparations and the use thereof as pharmaceutical compositions |
| BE788751A (fr) * | 1971-09-13 | 1973-01-02 | Teijin Ltd | Membranes polymeres permselectives |
| GB8610980D0 (en) * | 1986-05-06 | 1986-06-11 | Ici America Inc | Heterocyclic fused tricyclic compounds |
| US5111688A (en) * | 1988-01-22 | 1992-05-12 | Measurex Corporation | Device and method for calibrating a non-destructive sheet strength measuring system |
| DK40192D0 (da) * | 1992-03-26 | 1992-03-26 | Neurosearch As | Imidazolforbindelser, deres fremstilling og anvendelse |
| US5814651A (en) * | 1992-12-02 | 1998-09-29 | Pfizer Inc. | Catechol diethers as selective PDEIV inhibitors |
| KR970701182A (ko) * | 1994-02-10 | 1997-03-17 | 스피겔 알렌 제이 | 벤조다이아제핀 수용체 부위의 작용물질 및 길항물질로서의 5-헤테로아릴인돌 유도체(5-heteroarylindole derivatives as benzodiazepine receptor site agonists and antagonists) |
| US5563143A (en) * | 1994-09-21 | 1996-10-08 | Pfizer Inc. | Catechol diether compounds as inhibitors of TNF release |
| US6001866A (en) * | 1995-10-05 | 1999-12-14 | Warner-Lambert Company | Method for treating and preventing inflammation and atherosclerosis |
| US5972980A (en) * | 1995-10-05 | 1999-10-26 | Warner-Lambert Company | Method for treating and preventing inflammation and atherosclerosis |
| US6548524B2 (en) * | 1996-10-16 | 2003-04-15 | American Cyanamid Company | Preparation and use of ortho-sulfonamido bicyclic heteroaryl hydroxamic acids as matrix metalloproteinase and TACE inhibitors |
| DE69739733D1 (de) * | 1996-10-21 | 2010-02-25 | Neurosearch As | 1-phenyl-benzimidazolverbindungen und ihre verwendung als modulatoren des gaba-a-rezeptors |
| PT846689E (pt) | 1996-12-09 | 2004-06-30 | Pfizer | Compostos de benzimidazole |
| US6414008B1 (en) * | 1997-04-29 | 2002-07-02 | Boehringer Ingelheim Pharma Kg | Disubstituted bicyclic heterocycles, the preparation thereof, and their use as pharmaceutical compositions |
| EP0995742A4 (en) * | 1997-06-27 | 2004-08-25 | Fujisawa Pharmaceutical Co | SULPHONAMIDE COMPOUNDS AND THEIR MEDICAL USE |
| US5990146A (en) * | 1997-08-20 | 1999-11-23 | Warner-Lambert Company | Benzimidazoles for inhibiting protein tyrosine kinase mediated cellular proliferation |
| US6162804A (en) * | 1997-09-26 | 2000-12-19 | Merck & Co., Inc. | Tyrosine kinase inhibitors |
| US6465484B1 (en) * | 1997-09-26 | 2002-10-15 | Merck & Co., Inc. | Angiogenesis inhibitors |
| US6127381A (en) * | 1998-04-28 | 2000-10-03 | Basu; Amaresh | Isoquinoline compound melanocortin receptor ligands and methods of using same |
| EP1101758A4 (en) * | 1998-07-28 | 2002-04-03 | Nihon Nohyaku Co Ltd | CONDENSED HETEROCYCLIC DICARBONIC ACID DIAMOND DERIVATIVES OR SALTS THEREOF, HERBICIDES AND THEIR USE |
| US6326379B1 (en) * | 1998-09-16 | 2001-12-04 | Bristol-Myers Squibb Co. | Fused pyridine inhibitors of cGMP phosphodiesterase |
| US6348032B1 (en) * | 1998-11-23 | 2002-02-19 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with benzimidazole derivatives |
| US6329383B1 (en) * | 1999-01-25 | 2001-12-11 | Pharmacia Ab | 2-amino-5-pyrimidine acetic acid compounds |
| US6281237B1 (en) * | 1999-04-02 | 2001-08-28 | Neurogen Corporation | N-phenyl benzimidazolecarboxamide and N-phenyl indolecarboxamide derivatives |
| CO5190696A1 (es) | 1999-06-16 | 2002-08-29 | Smithkline Beecham Corp | Antagonistas de los receptores il-8 |
| US6316444B1 (en) * | 1999-06-30 | 2001-11-13 | Merck & Co., Inc. | SRC kinase inhibitor compounds |
| ATE253915T1 (de) * | 1999-06-30 | 2003-11-15 | Merck & Co Inc | Src-kinase hemmende verbindungen |
| JP2003503351A (ja) * | 1999-06-30 | 2003-01-28 | メルク エンド カムパニー インコーポレーテッド | Srcキナーゼ阻害化合物 |
| WO2001012600A1 (en) * | 1999-08-12 | 2001-02-22 | Cor Therapeutics, Inc. | INHIBITORS OF FACTOR Xa |
| US6512000B1 (en) * | 1999-08-20 | 2003-01-28 | Boehringer Ingelheim Pharma Kg | Aminocarbonyl-substituted benzimidazoles having tryptase-inhibitory activity |
| DE60016858T2 (de) | 1999-09-13 | 2005-12-08 | Eastman Kodak Co. | Photographisches Material mit verbesserter Farbwiedergabe |
| US6316474B1 (en) * | 1999-10-29 | 2001-11-13 | Merck & Co., Inc. | 2-benzyl and 2-heteroaryl benzimidazole NMDA/NR2B antagonists |
| UA75055C2 (uk) * | 1999-11-30 | 2006-03-15 | Пфайзер Продактс Інк. | Похідні бензоімідазолу, що використовуються як антипроліферативний засіб, фармацевтична композиція на їх основі |
| EP1263754A1 (en) * | 2000-02-01 | 2002-12-11 | Millennium Pharmaceuticals, Inc. | INDALONE AND BENZIMIDAZOLONE INHIBITORS OF FACTOR Xa |
| EP1255750A1 (en) * | 2000-02-01 | 2002-11-13 | Millenium Pharmaceuticals, Inc. | INDOLE AND BENZIMIDAZOLE INHIBITORS OF FACTOR Xa |
| US6448281B1 (en) * | 2000-07-06 | 2002-09-10 | Boehringer Ingelheim (Canada) Ltd. | Viral polymerase inhibitors |
| AU2002216314A1 (en) * | 2000-10-12 | 2002-04-22 | Scott A Henderson | Heterocyclic angiogenesis inhibitors |
| AU2002221566A1 (en) * | 2000-12-20 | 2002-07-01 | Neurosearch A/S | Novel benzimidazole derivatives for the treatment of gaba-alpha mediated disorders |
| GB0102109D0 (en) | 2001-01-26 | 2001-03-14 | Syngenta Ltd | Chemical process |
| EP1387680A4 (en) * | 2001-03-05 | 2010-01-13 | Transtech Pharma Inc | AGENTS TH RAPEUTICES D RIV S BENZIMIDAZOLE BASE |
| US20030109714A1 (en) * | 2001-03-22 | 2003-06-12 | Neil Wishart | Transition metal mediated process |
| US6794379B2 (en) * | 2001-06-06 | 2004-09-21 | Tularik Inc. | CXCR3 antagonists |
| AUPS251402A0 (en) * | 2002-05-23 | 2002-06-13 | Cytopia Pty Ltd | Kinase inhibitors |
| WO2003099811A1 (en) * | 2002-05-23 | 2003-12-04 | Cytopia Pty Ltd | Kinase inhibitors |
| BR0313160A (pt) * | 2002-08-08 | 2005-07-12 | Smithkline Beecham Corp | Composto, composição farmacêutica, métodos para tratar uma condição e um neoplasmo suscetìvel em um animal em um animal, processo para preparar um composto e uso de um composto |
-
2004
- 2004-08-16 WO PCT/US2004/026482 patent/WO2005021531A1/en not_active Ceased
- 2004-08-16 US US10/921,414 patent/US7521448B2/en not_active Expired - Fee Related
- 2004-08-16 JP JP2006523955A patent/JP4769720B2/ja not_active Expired - Fee Related
- 2004-08-16 CA CA002535896A patent/CA2535896A1/en not_active Abandoned
- 2004-08-16 RU RU2006108803/04A patent/RU2006108803A/ru not_active Application Discontinuation
- 2004-08-16 KR KR1020067003585A patent/KR20060121818A/ko not_active Withdrawn
- 2004-08-16 AU AU2004268949A patent/AU2004268949A1/en not_active Abandoned
- 2004-08-16 UA UAA200602942A patent/UA82395C2/uk unknown
- 2004-08-16 BR BRPI0413746-9A patent/BRPI0413746A/pt not_active IP Right Cessation
- 2004-08-16 MX MXPA06002018A patent/MXPA06002018A/es unknown
- 2004-08-16 AP AP2006003549A patent/AP2006003549A0/xx unknown
- 2004-08-16 CN CNA2004800240461A patent/CN1852905A/zh active Pending
- 2004-08-16 EP EP04781204A patent/EP1664021A1/en not_active Withdrawn
- 2004-08-20 AR ARP040103008A patent/AR045387A1/es not_active Application Discontinuation
- 2004-08-20 TW TW093125230A patent/TW200524905A/zh unknown
-
2006
- 2006-02-08 IL IL173614A patent/IL173614A0/en unknown
- 2006-02-10 NO NO20060664A patent/NO20060664L/no not_active Application Discontinuation
- 2006-02-21 IS IS8319A patent/IS8319A/is unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AP2006003549A0 (en) | 2006-04-30 |
| JP4769720B2 (ja) | 2011-09-07 |
| NO20060664L (no) | 2006-05-16 |
| BRPI0413746A (pt) | 2006-10-24 |
| AR045387A1 (es) | 2005-10-26 |
| AU2004268949A1 (en) | 2005-03-10 |
| RU2006108803A (ru) | 2007-09-27 |
| EP1664021A1 (en) | 2006-06-07 |
| CA2535896A1 (en) | 2005-03-10 |
| TW200524905A (en) | 2005-08-01 |
| US20060189629A1 (en) | 2006-08-24 |
| UA82395C2 (en) | 2008-04-10 |
| US7521448B2 (en) | 2009-04-21 |
| IS8319A (is) | 2006-02-21 |
| JP2007502821A (ja) | 2007-02-15 |
| WO2005021531A1 (en) | 2005-03-10 |
| KR20060121818A (ko) | 2006-11-29 |
| CN1852905A (zh) | 2006-10-25 |
| IL173614A0 (en) | 2006-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7521448B2 (en) | N-substituted benzimidazolyl c-Kit inhibitors | |
| AU2010244684B2 (en) | Substituted aromatic carboxamide and urea derivatives as vanilloid receptor ligands | |
| JP5261575B2 (ja) | 化学化合物 | |
| CA2649736C (en) | Heterocyclic compounds as inhibitors of c-fms kinase | |
| DK3087070T3 (en) | PYRAZOLO [1,5-A] PYRIDINE DERIVATIVES AND PROCEDURES FOR THEIR USE | |
| JP4035559B1 (ja) | 酸分泌抑制薬としての1−ヘテロシクリルスルホニル、2−アミノメチル、5−(ヘテロ−)アリール置換1−h−ピロール誘導体 | |
| MXPA06002017A (es) | Pirazolil-amidil-bencimidazolilo n-sustituidos, ibnhibidores de c-kit. | |
| US7485658B2 (en) | N-substituted pyrazolyl-amidyl-benzimidazolyl c-Kit inhibitors | |
| US7419995B2 (en) | N-substituted benzimidazoyl c-Kit inhibitors and combinatorial benzimidazole library | |
| CA2816769A1 (en) | Substituted heteroaromatic carboxamide and urea derivatives as vanilloid receptor ligands | |
| JP2004509885A (ja) | 抗菌薬としてのキノリン誘導体 | |
| WO2001058900A1 (en) | 1h-imidazopyridine derivatives | |
| KR20050072824A (ko) | 과다증식성 질환 및 혈관신생과 관련된 질병의 치료에유용한 인돌릴 피라지논 유도체 | |
| JP4988584B2 (ja) | Vegf受容体キナーゼインヒビターとしてのアントラニルアミドピリジンウレア | |
| WO2005023782A1 (ja) | 置換された縮環ピリミジン-4(3h)-オン化合物 | |
| JP5069119B2 (ja) | 血管内皮成長因子(vegf)受容体キナーゼインヒビターとしてのニコチンアミドピリジンウレア | |
| MX2007006555A (en) | N-substituted benzimidazolyl c-kit inhibitors and combinatorial benzimidazole library |