KR20140069563A - 케르세틴 배당체 제조방법 및 이의 기능성 화장품으로서의 용도 - Google Patents
케르세틴 배당체 제조방법 및 이의 기능성 화장품으로서의 용도 Download PDFInfo
- Publication number
- KR20140069563A KR20140069563A KR1020120136966A KR20120136966A KR20140069563A KR 20140069563 A KR20140069563 A KR 20140069563A KR 1020120136966 A KR1020120136966 A KR 1020120136966A KR 20120136966 A KR20120136966 A KR 20120136966A KR 20140069563 A KR20140069563 A KR 20140069563A
- Authority
- KR
- South Korea
- Prior art keywords
- qog
- quercetin
- compound
- test
- glucoside
- Prior art date
Links
- 239000002537 cosmetic Substances 0.000 title claims abstract description 33
- REFJWTPEDVJJIY-UHFFFAOYSA-N Quercetin Chemical compound C=1C(O)=CC(O)=C(C(C=2O)=O)C=1OC=2C1=CC=C(O)C(O)=C1 REFJWTPEDVJJIY-UHFFFAOYSA-N 0.000 title claims description 34
- OVSQVDMCBVZWGM-QSOFNFLRSA-N quercetin 3-O-beta-D-glucopyranoside Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C(C=2C=C(O)C(O)=CC=2)OC2=CC(O)=CC(O)=C2C1=O OVSQVDMCBVZWGM-QSOFNFLRSA-N 0.000 title abstract description 126
- FVQOMEDMFUMIMO-UHFFFAOYSA-N Hyperosid Natural products OC1C(O)C(O)C(CO)OC1OC1C(=O)C2=C(O)C=C(O)C=C2OC1C1=CC=C(O)C(O)=C1 FVQOMEDMFUMIMO-UHFFFAOYSA-N 0.000 title abstract description 122
- QJTYCCFDQWFJHU-UHFFFAOYSA-N Quercetin-5-O-beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OC1=CC(O)=CC2=C1C(=O)C(O)=C(C=1C=C(O)C(O)=CC=1)O2 QJTYCCFDQWFJHU-UHFFFAOYSA-N 0.000 title abstract description 122
- GXMWXESSGGEWEM-UHFFFAOYSA-N isoquercitrin Natural products OCC(O)C1OC(OC2C(Oc3cc(O)cc(O)c3C2=O)c4ccc(O)c(O)c4)C(O)C1O GXMWXESSGGEWEM-UHFFFAOYSA-N 0.000 title abstract description 122
- SZDMSNWMQAMVTJ-UHFFFAOYSA-N quercetin-3-O-glucoside Natural products OC1OC(COC2=C(C(=O)c3cc(O)cc(O)c3O2)c4ccc(O)c(O)c4)C(O)C(O)C1O SZDMSNWMQAMVTJ-UHFFFAOYSA-N 0.000 title abstract description 122
- FZKBNCDAGYDHTP-UHFFFAOYSA-N quercetin-3-O-glycoside Natural products OC1C(O)C(O)C(O)OC1COC1=C(C=2C=C(O)C(O)=CC=2)OC2=CC(O)=CC(O)=C2C1=O FZKBNCDAGYDHTP-UHFFFAOYSA-N 0.000 title abstract description 122
- 238000000034 method Methods 0.000 title abstract description 16
- 230000002087 whitening effect Effects 0.000 claims abstract description 22
- 239000000203 mixture Substances 0.000 claims description 53
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 22
- ZVOLCUVKHLEPEV-UHFFFAOYSA-N Quercetagetin Natural products C1=C(O)C(O)=CC=C1C1=C(O)C(=O)C2=C(O)C(O)=C(O)C=C2O1 ZVOLCUVKHLEPEV-UHFFFAOYSA-N 0.000 claims description 21
- HWTZYBCRDDUBJY-UHFFFAOYSA-N Rhynchosin Natural products C1=C(O)C(O)=CC=C1C1=C(O)C(=O)C2=CC(O)=C(O)C=C2O1 HWTZYBCRDDUBJY-UHFFFAOYSA-N 0.000 claims description 21
- MWDZOUNAPSSOEL-UHFFFAOYSA-N kaempferol Natural products OC1=C(C(=O)c2cc(O)cc(O)c2O1)c3ccc(O)cc3 MWDZOUNAPSSOEL-UHFFFAOYSA-N 0.000 claims description 21
- 235000005875 quercetin Nutrition 0.000 claims description 21
- 229960001285 quercetin Drugs 0.000 claims description 21
- 239000000126 substance Substances 0.000 claims description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 11
- -1 glucosyl quercetin Chemical compound 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- LPTITAGPBXDDGR-UHFFFAOYSA-N Penta-Ac-Mannose Natural products CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O LPTITAGPBXDDGR-UHFFFAOYSA-N 0.000 claims description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 4
- LPTITAGPBXDDGR-IBEHDNSVSA-N beta-d-glucose pentaacetate Chemical compound CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O LPTITAGPBXDDGR-IBEHDNSVSA-N 0.000 claims description 4
- JMGZEFIQIZZSBH-UHFFFAOYSA-N Bioquercetin Natural products CC1OC(OCC(O)C2OC(OC3=C(Oc4cc(O)cc(O)c4C3=O)c5ccc(O)c(O)c5)C(O)C2O)C(O)C(O)C1O JMGZEFIQIZZSBH-UHFFFAOYSA-N 0.000 claims description 3
- BSURNBPIYYGUGJ-UHFFFAOYSA-N Br(=O)(=O)O.Br Chemical compound Br(=O)(=O)O.Br BSURNBPIYYGUGJ-UHFFFAOYSA-N 0.000 claims description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 claims description 3
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 claims description 3
- IVTMALDHFAHOGL-UHFFFAOYSA-N eriodictyol 7-O-rutinoside Natural products OC1C(O)C(O)C(C)OC1OCC1C(O)C(O)C(O)C(OC=2C=C3C(C(C(O)=C(O3)C=3C=C(O)C(O)=CC=3)=O)=C(O)C=2)O1 IVTMALDHFAHOGL-UHFFFAOYSA-N 0.000 claims description 3
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 claims description 3
- FDRQPMVGJOQVTL-UHFFFAOYSA-N quercetin rutinoside Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC=2C(C3=C(O)C=C(O)C=C3OC=2C=2C=C(O)C(O)=CC=2)=O)O1 FDRQPMVGJOQVTL-UHFFFAOYSA-N 0.000 claims description 3
- IKGXIBQEEMLURG-BKUODXTLSA-N rutin Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@@H]1OC[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](OC=2C(C3=C(O)C=C(O)C=C3OC=2C=2C=C(O)C(O)=CC=2)=O)O1 IKGXIBQEEMLURG-BKUODXTLSA-N 0.000 claims description 3
- ALABRVAAKCSLSC-UHFFFAOYSA-N rutin Natural products CC1OC(OCC2OC(O)C(O)C(O)C2O)C(O)C(O)C1OC3=C(Oc4cc(O)cc(O)c4C3=O)c5ccc(O)c(O)c5 ALABRVAAKCSLSC-UHFFFAOYSA-N 0.000 claims description 3
- 235000005493 rutin Nutrition 0.000 claims description 3
- 229960004555 rutoside Drugs 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 235000013305 food Nutrition 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 2
- 230000002194 synthesizing effect Effects 0.000 claims description 2
- FJIHTRXQBVTZHM-ULAWRXDQSA-N [(2r,3s,4r,5r)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] acetate Chemical compound CC(=O)O[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO FJIHTRXQBVTZHM-ULAWRXDQSA-N 0.000 claims 1
- 238000012360 testing method Methods 0.000 abstract description 41
- 239000000463 material Substances 0.000 abstract description 16
- 238000013112 stability test Methods 0.000 abstract description 11
- 238000011076 safety test Methods 0.000 abstract description 6
- 210000003491 skin Anatomy 0.000 description 25
- XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 23
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 18
- 206010015150 Erythema Diseases 0.000 description 18
- 206010030113 Oedema Diseases 0.000 description 18
- 231100000321 erythema Toxicity 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 15
- 239000011780 sodium chloride Substances 0.000 description 14
- 241001465754 Metazoa Species 0.000 description 12
- 210000004027 cell Anatomy 0.000 description 11
- 239000003981 vehicle Substances 0.000 description 11
- 150000008442 polyphenolic compounds Chemical class 0.000 description 10
- 235000013824 polyphenols Nutrition 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000002609 medium Substances 0.000 description 8
- 230000000638 stimulation Effects 0.000 description 8
- 238000010998 test method Methods 0.000 description 8
- 239000006143 cell culture medium Substances 0.000 description 7
- 238000001727 in vivo Methods 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 235000021466 carotenoid Nutrition 0.000 description 6
- 150000001747 carotenoids Chemical class 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- 229920001817 Agar Polymers 0.000 description 5
- 241000283973 Oryctolagus cuniculus Species 0.000 description 5
- HIWYFUGWTWCQOH-FVCCEPFGSA-N [(2r,3r,4s,5r)-3,4,5-triacetyloxy-6-bromo-2-hydroxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(Br)=O HIWYFUGWTWCQOH-FVCCEPFGSA-N 0.000 description 5
- 239000008272 agar Substances 0.000 description 5
- 230000001580 bacterial effect Effects 0.000 description 5
- 230000008859 change Effects 0.000 description 5
- 210000004087 cornea Anatomy 0.000 description 5
- 210000003743 erythrocyte Anatomy 0.000 description 5
- 229930182470 glycoside Natural products 0.000 description 5
- 150000002338 glycosides Chemical class 0.000 description 5
- 210000002752 melanocyte Anatomy 0.000 description 5
- 231100000299 mutagenicity Toxicity 0.000 description 5
- 230000007886 mutagenicity Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- YVLPJIGOMTXXLP-UHFFFAOYSA-N 15-cis-phytoene Chemical compound CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C YVLPJIGOMTXXLP-UHFFFAOYSA-N 0.000 description 4
- FMMWHPNWAFZXNH-UHFFFAOYSA-N Benz[a]pyrene Chemical compound C1=C2C3=CC=CC=C3C=C(C=C3)C2=C2C3=CC=CC2=C1 FMMWHPNWAFZXNH-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 102000003425 Tyrosinase Human genes 0.000 description 4
- 108060008724 Tyrosinase Proteins 0.000 description 4
- 239000002671 adjuvant Substances 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 210000001508 eye Anatomy 0.000 description 4
- BJRNKVDFDLYUGJ-RMPHRYRLSA-N hydroquinone O-beta-D-glucopyranoside Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-RMPHRYRLSA-N 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000013641 positive control Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- BUNGCZLFHHXKBX-UHFFFAOYSA-N 8-methoxypsoralen Natural products C1=CC(=O)OC2=C1C=C1CCOC1=C2OC BUNGCZLFHHXKBX-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 241000700198 Cavia Species 0.000 description 3
- 231100000635 Draize test Toxicity 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- QXKHYNVANLEOEG-UHFFFAOYSA-N Methoxsalen Chemical compound C1=CC(=O)OC2=C1C=C1C=COC1=C2OC QXKHYNVANLEOEG-UHFFFAOYSA-N 0.000 description 3
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 3
- 206010040880 Skin irritation Diseases 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 238000004061 bleaching Methods 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 231100000025 genetic toxicology Toxicity 0.000 description 3
- 229930182478 glucoside Natural products 0.000 description 3
- 150000008131 glucosides Chemical class 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 229960004469 methoxsalen Drugs 0.000 description 3
- SQBBOVROCFXYBN-UHFFFAOYSA-N methoxypsoralen Natural products C1=C2OC(=O)C(OC)=CC2=CC2=C1OC=C2 SQBBOVROCFXYBN-UHFFFAOYSA-N 0.000 description 3
- 231100000150 mutagenicity / genotoxicity testing Toxicity 0.000 description 3
- 238000011587 new zealand white rabbit Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 239000000419 plant extract Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 231100000475 skin irritation Toxicity 0.000 description 3
- 230000036556 skin irritation Effects 0.000 description 3
- IAKHMKGGTNLKSZ-INIZCTEOSA-N (S)-colchicine Chemical compound C1([C@@H](NC(C)=O)CC2)=CC(=O)C(OC)=CC=C1C1=C2C=C(OC)C(OC)=C1OC IAKHMKGGTNLKSZ-INIZCTEOSA-N 0.000 description 2
- YVLPJIGOMTXXLP-UUKUAVTLSA-N 15,15'-cis-Phytoene Natural products C(=C\C=C/C=C(\CC/C=C(\CC/C=C(\CC/C=C(\C)/C)/C)/C)/C)(\CC/C=C(\CC/C=C(\CC/C=C(\C)/C)/C)/C)/C YVLPJIGOMTXXLP-UUKUAVTLSA-N 0.000 description 2
- YVLPJIGOMTXXLP-BAHRDPFUSA-N 15Z-phytoene Natural products CC(=CCCC(=CCCC(=CCCC(=CC=C/C=C(C)/CCC=C(/C)CCC=C(/C)CCC=C(C)C)C)C)C)C YVLPJIGOMTXXLP-BAHRDPFUSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- 208000031404 Chromosome Aberrations Diseases 0.000 description 2
- 201000004624 Dermatitis Diseases 0.000 description 2
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 241000785075 Jatropha podagrica Species 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 206010040914 Skin reaction Diseases 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- YCSBALJAGZKWFF-UHFFFAOYSA-N anthracen-2-amine Chemical compound C1=CC=CC2=CC3=CC(N)=CC=C3C=C21 YCSBALJAGZKWFF-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 229960000271 arbutin Drugs 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 238000011088 calibration curve Methods 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- OVSVTCFNLSGAMM-KGBODLQUSA-N cis-phytofluene Natural products CC(=CCCC(=CCCC(=CCCC(=CC=C/C=C(C)/C=C/C=C(C)/CCC=C(/C)CCC=C(C)C)C)C)C)C OVSVTCFNLSGAMM-KGBODLQUSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000012091 fetal bovine serum Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 230000001738 genotoxic effect Effects 0.000 description 2
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000008099 melanin synthesis Effects 0.000 description 2
- 230000003061 melanogenesis Effects 0.000 description 2
- 201000001441 melanoma Diseases 0.000 description 2
- 230000031864 metaphase Effects 0.000 description 2
- 229960004857 mitomycin Drugs 0.000 description 2
- 229930014626 natural product Natural products 0.000 description 2
- 239000013642 negative control Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- BJRNKVDFDLYUGJ-UHFFFAOYSA-N p-hydroxyphenyl beta-D-alloside Natural products OC1C(O)C(O)C(CO)OC1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 208000007578 phototoxic dermatitis Diseases 0.000 description 2
- 231100000018 phototoxicity Toxicity 0.000 description 2
- 235000011765 phytoene Nutrition 0.000 description 2
- OVSVTCFNLSGAMM-UZFNGAIXSA-N phytofluene Chemical compound CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=C\C=C(/C)\C=C\C=C(C)CCC=C(C)CCC=C(C)C OVSVTCFNLSGAMM-UZFNGAIXSA-N 0.000 description 2
- 235000002677 phytofluene Nutrition 0.000 description 2
- ZYSFBWMZMDHGOJ-SGKBLAECSA-N phytofluene Natural products CC(=CCCC(=CCCC(=CCCC(=CC=C/C=C(C)/CCC=C(/C)C=CC=C(/C)CCC=C(C)C)C)C)C)C ZYSFBWMZMDHGOJ-SGKBLAECSA-N 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 230000035483 skin reaction Effects 0.000 description 2
- 231100000430 skin reaction Toxicity 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000036561 sun exposure Effects 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 231100000820 toxicity test Toxicity 0.000 description 2
- ZIUDAKDLOLDEGU-UHFFFAOYSA-N trans-Phytofluen Natural products CC(C)=CCCC(C)CCCC(C)CC=CC(C)=CC=CC=C(C)C=CCC(C)CCCC(C)CCC=C(C)C ZIUDAKDLOLDEGU-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- UAOKXEHOENRFMP-UHFFFAOYSA-N (2,3,4,5-tetraacetyloxy-6-oxohexyl) acetate Chemical compound CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C=O UAOKXEHOENRFMP-UHFFFAOYSA-N 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- 240000008886 Ceratonia siliqua Species 0.000 description 1
- 235000013912 Ceratonia siliqua Nutrition 0.000 description 1
- 206010008805 Chromosomal abnormalities Diseases 0.000 description 1
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- 241001391944 Commicarpus scandens Species 0.000 description 1
- 208000028006 Corneal injury Diseases 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- ZZZCUOFIHGPKAK-UHFFFAOYSA-N D-erythro-ascorbic acid Natural products OCC1OC(=O)C(O)=C1O ZZZCUOFIHGPKAK-UHFFFAOYSA-N 0.000 description 1
- 208000017701 Endocrine disease Diseases 0.000 description 1
- 208000004232 Enteritis Diseases 0.000 description 1
- 206010014970 Ephelides Diseases 0.000 description 1
- 241001555026 Euphorbia humifusa Species 0.000 description 1
- 241000221017 Euphorbiaceae Species 0.000 description 1
- 102000009123 Fibrin Human genes 0.000 description 1
- 108010073385 Fibrin Proteins 0.000 description 1
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 1
- 208000012671 Gastrointestinal haemorrhages Diseases 0.000 description 1
- 241000208152 Geranium Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 108010024636 Glutathione Proteins 0.000 description 1
- 235000001453 Glycyrrhiza echinata Nutrition 0.000 description 1
- 244000303040 Glycyrrhiza glabra Species 0.000 description 1
- 235000006200 Glycyrrhiza glabra Nutrition 0.000 description 1
- 235000017382 Glycyrrhiza lepidota Nutrition 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- 206010023126 Jaundice Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 1
- UPYKUZBSLRQECL-UKMVMLAPSA-N Lycopene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1C(=C)CCCC1(C)C)C=CC=C(/C)C=CC2C(=C)CCCC2(C)C UPYKUZBSLRQECL-UKMVMLAPSA-N 0.000 description 1
- JEVVKJMRZMXFBT-XWDZUXABSA-N Lycophyll Natural products OC/C(=C/CC/C(=C\C=C\C(=C/C=C/C(=C\C=C\C=C(/C=C/C=C(\C=C\C=C(/CC/C=C(/CO)\C)\C)/C)\C)/C)\C)/C)/C JEVVKJMRZMXFBT-XWDZUXABSA-N 0.000 description 1
- 241000220225 Malus Species 0.000 description 1
- 208000003351 Melanosis Diseases 0.000 description 1
- 229930192392 Mitomycin Natural products 0.000 description 1
- 239000004909 Moisturizer Substances 0.000 description 1
- 240000000249 Morus alba Species 0.000 description 1
- 235000008708 Morus alba Nutrition 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- 240000000783 Origanum majorana Species 0.000 description 1
- 235000006297 Origanum majorana Nutrition 0.000 description 1
- 208000012641 Pigmentation disease Diseases 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 244000178231 Rosmarinus officinalis Species 0.000 description 1
- 206010040829 Skin discolouration Diseases 0.000 description 1
- 206010070835 Skin sensitisation Diseases 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 1
- 244000223014 Syzygium aromaticum Species 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 229930003268 Vitamin C Natural products 0.000 description 1
- 239000001083 [(2R,3R,4S,5R)-1,2,4,5-tetraacetyloxy-6-oxohexan-3-yl] acetate Substances 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- IEOLRPPTIGNUNP-RKQHYHRCSA-N [(2r,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@H]1O[C@@H](O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O IEOLRPPTIGNUNP-RKQHYHRCSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000013096 assay test Methods 0.000 description 1
- 238000001479 atomic absorption spectroscopy Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000008827 biological function Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 210000005252 bulbus oculi Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 231100000005 chromosome aberration Toxicity 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 229960001338 colchicine Drugs 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 210000000795 conjunctiva Anatomy 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- 231100000135 cytotoxicity Toxicity 0.000 description 1
- 230000003013 cytotoxicity Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 208000001848 dysentery Diseases 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethyl mercaptane Natural products CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229950003499 fibrin Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 230000007674 genetic toxicity Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000002791 glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
- 229960003180 glutathione Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 208000035861 hematochezia Diseases 0.000 description 1
- 230000023597 hemostasis Effects 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000037417 hyperactivation Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 210000000554 iris Anatomy 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229960004705 kojic acid Drugs 0.000 description 1
- WZNJWVWKTVETCG-UHFFFAOYSA-N kojic acid Natural products OC(=O)C(N)CN1C=CC(=O)C(O)=C1 WZNJWVWKTVETCG-UHFFFAOYSA-N 0.000 description 1
- BEJNERDRQOWKJM-UHFFFAOYSA-N kojic acid Chemical compound OCC1=CC(=O)C(O)=CO1 BEJNERDRQOWKJM-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 229940010454 licorice Drugs 0.000 description 1
- 229940069445 licorice extract Drugs 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 235000012661 lycopene Nutrition 0.000 description 1
- OAIJSZIZWZSQBC-GYZMGTAESA-N lycopene Chemical compound CC(C)=CCC\C(C)=C\C=C\C(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C=C(/C)CCC=C(C)C OAIJSZIZWZSQBC-GYZMGTAESA-N 0.000 description 1
- 229960004999 lycopene Drugs 0.000 description 1
- 239000001751 lycopene Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000001780 majorana hortensis moench (origanum majorana l.) Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000004530 micro-emulsion Substances 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000004531 microgranule Substances 0.000 description 1
- 230000001333 moisturizer Effects 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 201000005111 ocular hyperemia Diseases 0.000 description 1
- 208000013441 ocular lesion Diseases 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 238000003305 oral gavage Methods 0.000 description 1
- 210000003463 organelle Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229940124595 oriental medicine Drugs 0.000 description 1
- 230000036542 oxidative stress Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 229930000223 plant secondary metabolite Natural products 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 229930010796 primary metabolite Natural products 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000003908 quality control method Methods 0.000 description 1
- 238000004445 quantitative analysis Methods 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000025600 response to UV Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930000044 secondary metabolite Natural products 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 230000037384 skin absorption Effects 0.000 description 1
- 231100000274 skin absorption Toxicity 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 231100000370 skin sensitisation Toxicity 0.000 description 1
- 230000036555 skin type Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 150000003505 terpenes Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 235000015149 toffees Nutrition 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- ZCIHMQAPACOQHT-ZGMPDRQDSA-N trans-isorenieratene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/c1c(C)ccc(C)c1C)C=CC=C(/C)C=Cc2c(C)ccc(C)c2C ZCIHMQAPACOQHT-ZGMPDRQDSA-N 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H17/00—Compounds containing heterocyclic radicals directly attached to hetero atoms of saccharide radicals
- C07H17/04—Heterocyclic radicals containing only oxygen as ring hetero atoms
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23L—FOODS, FOODSTUFFS, OR NON-ALCOHOLIC BEVERAGES, NOT COVERED BY SUBCLASSES A21D OR A23B-A23J; THEIR PREPARATION OR TREATMENT, e.g. COOKING, MODIFICATION OF NUTRITIVE QUALITIES, PHYSICAL TREATMENT; PRESERVATION OF FOODS OR FOODSTUFFS, IN GENERAL
- A23L33/00—Modifying nutritive qualities of foods; Dietetic products; Preparation or treatment thereof
- A23L33/10—Modifying nutritive qualities of foods; Dietetic products; Preparation or treatment thereof using additives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/70—Carbohydrates; Sugars; Derivatives thereof
- A61K31/7042—Compounds having saccharide radicals and heterocyclic rings
- A61K31/7048—Compounds having saccharide radicals and heterocyclic rings having oxygen as a ring hetero atom, e.g. leucoglucosan, hesperidin, erythromycin, nystatin, digitoxin or digoxin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/60—Sugars; Derivatives thereof
- A61K8/602—Glycosides, e.g. rutin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q19/00—Preparations for care of the skin
- A61Q19/02—Preparations for care of the skin for chemically bleaching or whitening the skin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H17/00—Compounds containing heterocyclic radicals directly attached to hetero atoms of saccharide radicals
- C07H17/04—Heterocyclic radicals containing only oxygen as ring hetero atoms
- C07H17/06—Benzopyran radicals
- C07H17/065—Benzo[b]pyrans
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23V—INDEXING SCHEME RELATING TO FOODS, FOODSTUFFS OR NON-ALCOHOLIC BEVERAGES AND LACTIC OR PROPIONIC ACID BACTERIA USED IN FOODSTUFFS OR FOOD PREPARATION
- A23V2002/00—Food compositions, function of food ingredients or processes for food or foodstuffs
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23V—INDEXING SCHEME RELATING TO FOODS, FOODSTUFFS OR NON-ALCOHOLIC BEVERAGES AND LACTIC OR PROPIONIC ACID BACTERIA USED IN FOODSTUFFS OR FOOD PREPARATION
- A23V2200/00—Function of food ingredients
- A23V2200/30—Foods, ingredients or supplements having a functional effect on health
- A23V2200/318—Foods, ingredients or supplements having a functional effect on health having an effect on skin health and hair or coat
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Veterinary Medicine (AREA)
- Molecular Biology (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Biochemistry (AREA)
- Genetics & Genomics (AREA)
- Epidemiology (AREA)
- Biotechnology (AREA)
- Nutrition Science (AREA)
- Medicinal Chemistry (AREA)
- Mycology (AREA)
- Pharmacology & Pharmacy (AREA)
- Food Science & Technology (AREA)
- Polymers & Plastics (AREA)
- Dermatology (AREA)
- Birds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cosmetics (AREA)
Abstract
본 발명은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG) 제법 및 이의 기능성 화장품으로서의 용도에 관한 것으로, 본 화합물은 미백효과시험, 안전성시험, 안정성시험에서 우수한 결과를 보임으로써 기능성화장품 등의 소재로 활용이 가능하다는 것이다.
Description
본 발명은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG) 제법 및 이의 기능성 화장품으로서의 용도에 관한 것으로, 본 화합물은 미백효과시험, 안전성시험, 안정성시험에서 우수한 결과를 보임으로써 기능성화장품 등의 소재로 활용이 가능하다는 것이다.
폴리페놀 (polyphenols)은 terpenoids, alkaloids 등과 함께 대표적인 식물 이차대사산물로서 생명 유지에 필수적인 역할을 하는 일차대사산물과 달리 소량만 생산되나, 다양한 생물학적 기능이 발견되고 있다. 다른 이차대사물들이 그들의 강한 약효로 인해서 다양한 용도로 사용되어 온 것과는 달리, 폴리페놀은 상대적으로 생물학적 기능면에서의 효과가 낮다는 이유로 인해서 활용면에서 관심을 받아오지 못하였다. 그러나 과거에는 치료 목적으로 생리활성물질을 활용해 오던 것과는 달리, 근래에는 예방 목적으로 생리활성물질을 활용하는데 치중하고 있기 때문에 강한 활성보다는 낮은 독성을 갖는 물질에 관심이 더 집중되고 있는데, 비록 활성은 조금 약하더라도 독성이 적으면 장기간 동안 안심하고 투여 또는 복용이 가능하기 때문이다. 이와 같은 조건에 잘 부합하는 화합물이 폴리페놀로서 근래에는 이에 대한 수요가 급상승하고 있는 추세이므로 폴리페놀의 연구는 높은 부가가치를 창출할 수 있는 분야이다. 더욱이 천연물 유래 폴리페놀은 장기간 동안 동양의학 또는 민간요법에서 사용되어 온 경우가 많아서 이미 안전성 면에서 검증된 사례가 많다.
또한 식물이 폴리페놀을 생산하는 이유 중 하나가 자외선으로부터 자신을 보호하기 위함이기 때문에 자외선 차단기능이 필요한 기능성화장품 소재로서는 기본적인 효능을 지니고 있다는 장점을 지닌다. 비록 화장품 산업이 고부가가치 창출이 가능하고 자원이 부족한 국내 현실에 적합한 기술집약적 산업이기는 하나, 다국적 기업과의 경쟁을 위해 블루오션 전략이 절실히 요구되기 때문에 기능성화장품의 개발이 필요하다. 그러나 이미 식물 추출물을 이용한 기능성화장품이 시판 중에 있기 때문에 이들과 차별화된 전략으로 접근할 필요가 있다. 식물 유래 기능성 화장품은 식물 추출물을 활용하는 경우가 대부분인데, 가장 큰 이유는 식물 추출물이 함유한 활성 성분의 대량확보가 어렵다는 점과 활성 성분에 대한 안전성 및 안정성 문제가 선결되어야 한다는 제약이 따르기 때문이다. 따라서, 본 발명에서는 신기능성화장품 소재로서 폴리페놀 중 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)를 대상으로 하였다. QOG는 한방에서 지금초[地錦草]로 부르는 Euphorbia humifusa Willd.에 함유되어 있는 천연물 유래 폴리페놀의 일종인 화합물이다. 지금초는 이질, 장염, 황달, 토혈, 변혈, 지혈, 습진, 화상 등에 사용되어 왔다.
한편, 피부 색은 일차적으로 멜라닌세포, 피부의 표피 기저층에 존재하는 세포에 존재하는 색소 멜라닌의 양에 의해서 결정된다. 멜라닌 생성은 멜라닌소체로 알려진 멜라닌세포 내의 유일한 소기관에서 발생하고, UV광의 유해한 효과로부터 피부를 보호한다. 어떤 사회들의 어두운 피부 톤은 멜라닌의 자연적으로 증가된 생성으로부터 기인하고, UV의 자극에 응답하여 높은 생성은 잘 알려진 피부의 태닝 효과를 도출한다. 노화, 태양에 노출, 내분비 이상 및 다양한 피부 장애는 피부 내에 멜라닌 색소의 축적을 증가시키고, 검은 반점(dark spot) 및 주근깨를 초래한다. 그러한 검은 반점은 다양한 사회들에서 매력적이지 않게 생각될 뿐만 아니라, 건강하지 못한 것으로 알려져 있고, 따라서 바람직하지 않다.
피부에서 검은 반점들의 존재를 제거하거나, 밝은 피부 톤을 원하는 사람들에게, 미백 또는 표백(bleaching) 조성물은 유용한다. 최근 많은 피부-표백 조성물은 멜라닌을 (통상적으로 멜라닌 과립(granules)을 파괴 또는 파열하는 것에 의해서) 파괴하거나, 멜라닌의 형성을 억제하거나( 종종 티로시나제(tyrosinase), 멜라닌 생합성 효소를 억제하거나 멜라닌세포 활성 및 증식을 억제함으로써) 또는 둘 모두를 진행시킨다. 이러한 많은 표백 조성물은 과산화물(peroxides), 산 또는 포름알데이드 또는 글루타티온(glutathione), 시스테닌(cysteine), 메르캅토숙신산(mercaptosuccinic acid), 메르캅토덱스트란(mercaptodextran), 메르캅토에탄올(mercaptoethanol)과 같은 티올레이트 물질(thiolated materials)과 같은 자극성의 화학물질을 포함한다. 이러한 화학물질은 피부에 엄격한 영향을 미치는 데다가 그것을 함유한 물질이 소비자에게 탐탁치 않게 만드는 불쾌한 향을 가지고 있다.
덜 엄격한 요법들은(therapies) 다른 불리한 점을 가진다. 예를 들어 하이드로퀴논(hydroquinone)은 멜라닌세포 활동을 억누르는 작용을 하기 때문에 미백제로 사용된다. 하지만 하이드로퀴논(hydroquinone)은 공기, 빛, 티로시나제 (tyrosinase) 자체에 의해 산화된다. 하이드로퀴논(hydroquinone)의 산화 생성물은 피부 자극과 염증(아마도 세포독성), 색소침착 반발(즉 다크닝에 따라오는 초기 라이트닝)과 관련된다. 게다가 이러한 산화과정 때문에 하이드로퀴논(hydroquinone)을 함유하는 조직표본들의 저장수명과 적용된 생체이용율은 상대적으로 짧다.
화장품 공식서술에서 전형적인 미백제들은 코직산(kojic acid), 알부틴(arbutin), 감초추출물(licorice extract), 비타민 C이다. 이것들은 효과적인 티로시나제(tyrosinase) 억제제들이고 노화방지제들이지만 보통 쉽게 산화되고 퇴화되기 때문에 안정적이지 않다.
유럽 특허 EP0467795는 활성분자들을 세포막을 지나 운반하는 소수층상 리포좀 운반체(paucilamellar liposomal carriers)의 사용을 발표하였는데 이들은 효소활성(enzymatic activity)의 전환에 의해 멜라닌소체 형성을 감소를 유도하는 분자를 포함하며, 멜라닌 저하 효소(melanin-degrading enzymes)의 과잉활성화(hyperactivation)를 초래한다. 그 특허는 또한 이러한 운반체에 기반한 피부 또는 화장품 조성물과 햇빛 노출에 의해 야기되는 흑색종(melanoma)의 치료뿐만 아니라 피부이상변색(dyschromia)의 제거 또는 약화에 대한 사용을 발표하였다.
최근 자연 유도 물질들(naturally derived materials)의 사용이 제안되어왔는데 그 물질들은 사용하기 더 편하고, 어떤 것들은 고대 요법(ancient therapies)에서 미백효과를 가진 것으로 알려져 왔다. 이것들은 레몬, 오렌지, 오이, 은행, 캐러브(carob), 장미열매, 제라늄 허브(geraniuim herb), 계피, 달콤한 마조람(marjoram), 로즈메리, 정향(clove), 오디(mulberry), 감초, 월귤나무(bearberry) 및 아세소라 체리 추출물들을 단독으로 혹은 다른 미백제와 혼합해서 사용하는 것을 포함한다(예를 들어, 미국 특허 Nos. 5,747,006; 5,980,904; 6,994,874 및 7,029,709 등 참조). 이들 자연 물질에 있는 효능성분의 변동성은 가끔 그들의 유용함을 제한하고, 특히 피부유형, 색깔, 나이, 상태 등과 같이 다른 대상에서 많이 변하며 제안된 용량과 용법을 어렵게 만든다.
미백효과를 가진 카로테노이드(carotenoid)를 함유한 화장 조성물도 또한 발표되어 왔다. 일본 특허 No.JP2004300117은 카로테노이드(carotenoid) 및 말루스 속(genus Malus) 식물의 추출물, 바람직하게 과일이나 과즙 추출물을 함유한 화장 조성물을 발표하였는데 거기에서 추출물은 바람직하게 폴리페놀을 함유하고 있으며 카로테노이드는 바람직하게 리코펜(lycopene)을 함유한다.
일본 특허 No. 6279257은 카르테노이드 또는 대극과(Euphorbiaceae family)에 속하고 멜라닌 생합성 억제활동을 하는 자트로파 포다그리카 (Jatropha podagrica)의 크롤로포름(chloroform) 추출물 및 이를 포함하는 화장 및 피부 미백을 위한 화장조성물을 발표하였다.
또 다른 관련특허로 대한민국특허공개번호 제1020090031603호는 피부 미백을 위해서 사용되는 카르테노이드 조성물에 관한 것으로, 피토엔 및 피토플루엔의 조합물이 피부 미백에 효과적이라는 것을 보여주고, 추가적으로 피부 미백에 효과적인 피토엔 및 피토플루엔의 조합물 및 적어도 하나의 추가적인 카로테노이드, 특히 매우 짙은 색이 없는 카로테노이드들을 포함하는 조성물들과 관련된다고 기재되어 있다.
본 발명은 상기의 필요성에 의하여 안출된 것으로서 본 발명의 목적은 신규한 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)를 대량생산할 수 있는 제법을 제공하는 것이다.
본 발명의 다른 목적은 새로운 기능성 화장품 및/또는 약학 소재를 제공하는 것이다.
상기 목적을 달성하기 위하여, 본 발명은 a-1)베타-D글루코오스 펜타아세테이트를 디클로로메탄에 녹인 후, 브롬산(HBr)을 첨가한 후 이 혼합물에 탄산수소나트륨을 첨가하여 1-브로모-2,3,4,6-테트라-O-아세틸-D-글루코오스를 합성하는 단계:a-2)루틴을 디메틸폼아미드에 녹인 용액에 탄산칼륨과 알릴브로마이드을 첨가한 후, 이 혼합물에 에탄올과 염산을 첨가하여 3,5-OH-알릴 케르세틴을 합성하는 단계;b) 상기 a-2) 단계에서 얻은 3,5-OH-알릴 케르세틴을 클로로포름과 물의 혼합액에 녹인 용액에 탄산칼륨, Aliquat 336, 및 상기 a-1)에서 얻은 1-브로모-2,3,4,6-테트라-O-아세틸-D-글루코오스를 첨가한 후, 이 혼합물에 염산 (15 mL)을 첨가하여 7,3‘,4’-트리알릴-3-펜타아세틸글루코실 케르세틴을 합성하는 단계;및 c) 상기 b) 단계에서 얻은 7,3‘,4’-트리알릴-3-펜타아세틸글루코실 케르세틴을 메탄올에 녹인 후, palladium/charcoal과 포름산암모늄(HCO2NH4)을 첨가한 후,여과, 추출, 감압 농축 한 후 정제하여 알릴기가 제거된 화합물을 암모니아가 포화된 메탄올에 녹인 뒤 이 반응물을 감압 농축하여 얻어진 잔류물을 정제하는 단계를 포함하는 하기 화학식 1의 화합물의 제조방법을 제공한다.
[화학식 1]
또 본 발명은 하기 화학식 1의 화합물을 유효성분으로 포함하는 피부 외용제 조성물을 제공한다.
[화학식 1]
본 발명의 일 구현예에 있어서, 상기 조성물은 미백 효과를 가지는 것이 바람직하나 이에 한정되지 아니한다.
또한 본 발명은 하기 화학식 1의 화합물을 유효성분으로 포함하는 화장료 조성물을 제공한다.
[화학식 1]
또한 본 발명은 하기 화학식 1의 화합물을 유효성분으로 포함하는 미백용 약학 조성물을 제공한다.
[화학식 1]
또한 본 발명은 하기 화학식 1의 화합물을 유효성분으로 포함하는 미백 개선용 식품 조성물을 제공한다.
[화학식 1]
이하 본 발명을 설명한다.
본 발명에서는 지금초에 함유된 QOG를 기능성화장품으로 사용하기 위해서 이들의 미백 효능 시험과 안전성, 안정성 시험 등을 수행하였고, 그 결과 QOG가 기능성화장품으로의 활용이 가능하다는 결과를 얻게 되어 본 발명을 완성하였다.
본 발명의 조성물은 미백용 조성물로서 사용될 수 있으며, 이는 티로시나제 활성을 저해하고 멜라닌의 생성을 억제함으로써 우수한 미백 효과를 제공할 수 있다.
또한 본 발명의 조성물은 자외선 차단 효능이 우수한 자외선 차단용 피부 외용제 조성물로서 사용될 수 있다.
본 발명에 따른 조성물은 화장품학 또는 피부과학적으로 허용가능한 매질 또는 기제를 함유하여 제형화될 수 있다. 이는 국소적용에 적합한 모든 제형으로서, 예를 들면, 용액, 겔, 고체, 반죽 무수 생성물, 수상에 유상을 분산시켜 얻은 에멀젼, 현탁액, 마이크로에멀젼, 마이크로캡슐, 미세과립구 또는 이온형(리포좀) 및 비이온형의 소낭 분산제의 형태로, 또는 크림, 스킨, 로션, 파우더, 연고, 스프레이 또는 콘실 스틱의 형태로 제공될 수 있다. 또한 포말(foam)의 형태로 또는 압축된 추진제를 더 함유한 에어로졸 조성물의 형태로도 사용될 수 있다.
이들 조성물은 당해 분야의 통상적인 방법에 따라 제조될 수 있다.
또한 본 발명에 의한 조성물은 지방 물질, 유기용매, 용해제, 농축제, 겔화제, 연화제, 항산화제, 현탁화제, 안정화제, 발포제(foaming agent), 방향제, 계면활성제, 물, 이온형 또는 비이온형 유화제, 충전제, 금속이온봉쇄제, 킬레이트화제, 보존제, 비타민, 차단제, 습윤화제, 필수 오일, 염료, 안료, 친수성 또는 친유성 활성제, 지질 소낭 또는 화장품에 통상적으로 사용되는 임의의 다른 성분과 같은 화장품학 또는 피부과학 분야에서 통상적으로 사용되는 보조제를 함유할 수 있다. 상기 보조제는 화장품학 또는 피부과학 분야에서 일반적으로 사용되는 양으로 도입된다.
또한, 본 발명의 조성물은 피부 개선 효과를 증가시키기 위하여 피부 흡수 촉진 물질을 함유할 수 있다.
본 발명에 의한 조성물은 상기 화학식 1의 화합물을 조성물 총 중량에 대하여 0.001~50중량%로 함유할 수 있다. 상기 화합물의 함량이 0.001중량% 미만이면 상기 성분에 의한 효능, 효과가 미약하고, 50중량%를 초과하면 피부 안전성 또는 제형상의 문제가 있기 때문이다.
본 발명의 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)은 미백효능시험, 안전성시험, 안정성시험 결과로부터 기능성화장품 등의 소재로 유용하게 이용될 수 있다.
도 1은 케르세틴-3-O-글루코사이드 합성 방법 개략도.
도 2는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 멜라닌생성 저해 시험 결과
도 3은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 검정곡선
도 4는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 세포배양액에서의 안정성 시험결과 (a는 시험 결과 얻은 chromatogram, b는 결과물의 area를 그래프로 표시함)
도 5는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 pH 에 대한 안정성 시험결과
도 6은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 온도변화에 대한 안정성 시험결과
도 7은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 Sodium azide를 대조 약물로 유전독성시험 (Bacterial Reverse Mutation Assay 시험)한 결과
도 8은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 2-Aminoanthracene를 대조 약물로 유전독성시험 (Bacterial Reverse Mutation Assay 시험)한 결과
도 9는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 유전독성시험 (In vivo Micronucleus Assay) 결과
도 2는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 멜라닌생성 저해 시험 결과
도 3은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 검정곡선
도 4는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 세포배양액에서의 안정성 시험결과 (a는 시험 결과 얻은 chromatogram, b는 결과물의 area를 그래프로 표시함)
도 5는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 pH 에 대한 안정성 시험결과
도 6은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 온도변화에 대한 안정성 시험결과
도 7은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 Sodium azide를 대조 약물로 유전독성시험 (Bacterial Reverse Mutation Assay 시험)한 결과
도 8은 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 2-Aminoanthracene를 대조 약물로 유전독성시험 (Bacterial Reverse Mutation Assay 시험)한 결과
도 9는 케르세틴-3-O-글루코사이드 (quercetin-3-O-glucoside, QOG)의 유전독성시험 (In vivo Micronucleus Assay) 결과
이하, 실시예를 통하여 본 발명을 더욱 상세히 설명하고자 한다. 이들 실시예는 오로지 본 발명을 예시하기 위한 것으로서, 본 발명의 범위가 이들 실시예에 의해 제한되는 것으로 해석되지는 않는 것은 당업계에서 통상의 지식을 가진 자에게 있어서 자명할 것이다.
실시예
1. 케르세틴-3-O-
글루코사이드
(
quercetin
-3-O-
glucoside
,
QOG
)의 대량생산 방법
QOG의 대량생산을 위해 quercetin에 직접적으로 글루코스를 도입하는 방법, rutin을 출발물질로 하는 생산 방법 등이 알려져 있으나, 대량생산시 방향족 수산화기의 가리움기로 이용된 벤질기를 도입 및 제거하는 과정에서 반응이 완결되지 않아 정제에 어려움이 발생하는 단점을 갖는다. 따라서 본 발명에서는 QOG 생산과정에서 기존에 방향족 수산화기의 가리움기로 이용된 벤질기를 대체할 수 있는 새로운 가리움기를 개발하고자 노력한 결과, 알릴 작용기를 이용한 합성방법을 개발할 수 있었고, 그 결과 대량생산시에도 문제가 없는 새로운 QOG 생산법을 도 1과 같이 개발하였다.
1-브로모-2,3,4,6-테트라-O-아세틸-D-글루코오스(2)의 합성:
베타-D글루코오스 펜타아세테이트 (1, 3.9 g, 10 mmol)을 디클로로메탄(15 mL)에 녹인 후, 브롬산(HBr) (2.6 mL, 45 mmol)을 첨가하여, 4 시간 동안 상온에서 교반한다. 이 혼합물에 탄산수소나트륨 수용액(20 mL)을 첨가하고, 디클로로메탄(60 mL)으로 세 번 추출하여 모아진 유기층에 황산마그네슘(MgSO4)을 첨가하여 남은 물을 제거한 뒤, 여과지를 사용하여 걸러낸다. 이 혼합물을 감압 농축한 뒤 얻어진 농축액을 실리카겔 관크로마토그래피(4:1 = 헥산:아세트산 에틸에스테르)로 정제하여 화합물 2를 흰색 고체 형태로 얻었다(3.84 g, 9.3 mmol, 수율 93%): 1H NMR (400 MHz, Acetone) δ (ppm) 6.28 (d, J= 3.7Hz, 1H), 5.47 (t, J= 10.0 Hz, 1H), 5.14 (t, J= 2.0 Hz, 1H), 5.04(q, J= 3.7 Hz, 1H), 4.20 - 4.26 (m, 2H), 4.05 - 4.09 (m, 1H), 2.00 (s, 6H), 1.99 (s, 6H).
3,5-OH-알릴 quercetin (3)의 합성:
루틴(4.5g, 7.37 mmol)을 디메틸폼아미드(15 mL)에 녹인 용액에 탄산칼륨(3.4 g, 24 mmol)과 알릴브로마이드(2.13 mL, 24 mmol)을 차례대로 상온에서 첨가한 후, 5 시간동안 60 ℃에서 환류 교반한다. 이 혼합물에 에탄올(180 mL)과 농축된 염산(20 mL)를 0 ℃에서 첨가한 후 70 ℃에서 2시간 환류 교반한다. 이 혼합물을 차가운 에탄올로 씻으며 여과지에 거르면, 3,5-OH-알릴 quercetin(16)을 엷은 노란색 고체 형태로 얻을 수 있다(2.1 g, 5 mmol, 수율 67%): 1H NMR (400 MHz, CDCl3) δ (ppm) 7.82 (d, J= 1.4 Hz, 1H), 7.01 (q, J= 8.5 Hz, 1H), 6.59 (s, 1H), 6.49(d, J= 2.1 Hz, 1H), 6.40 (d, J= 2.1 Hz, 1H), 6.01 - 6.18 (m, 3H), 5.31 - 5.50 (m, 6H), 4.62 - 4.70 (m, 6H).
quercetin-3-glucose (4)의 합성:
위에서 얻은 3,5-OH-알릴 quercetin (3) (200 mg, 0.47 mmol)을 클로로포름(10 mL)과 물(10 mL)의 혼합액에 녹인 용액에 탄산칼륨(130 mg, 0.94 mmol), Aliquat 336(0.1 mL, 0.24 mmol), 그리고 1-브로모-2,3,4,6-테트라-O-아세틸-D-글루코오스(2) (503 mg, 1.18 mmoL)을 첨가한 후, 12시간 동안 50 ℃에서 환류 교반한다. 이 혼합물에 2N 염산 (15 mL)을 첨가한 후, 디클로로메탄(15 mL)으로 세 번 추출한다. 모아진 유기층에 황산마그네슘(MgSO4)을 첨가하여 남은 물을 제거한 뒤, 여과지를 사용하여 걸러낸다. 이 혼합물을 감압 농축한 뒤, 얻어진 농축액을 실리카겔 관크로마토그래피(2:1 = 헥산:아세트산에틸에스테르)로 정제하여 quercetin 3번 위치에 글루코스 펜타아세테이트가 도입된 유도체를 옅은 갈색 오일 형태로 얻었다(261.6mg, 수율 74%): 1H NMR (400 MHz, CDCl3) δ (ppm) 7.88 (d, J= 2.1 Hz, 1H), 7.75 (d, J= 2.1 Hz, 1H), 7.14 (d, J= 8.7 Hz, 1H), 6.67 (d, J= 2.1 Hz, 1H), 6.33 (d, J= 2.1 Hz, 1H), 6.05 - 6.30 (m, 3H), 5.79 (d, J= 8.0 Hz, 1H), 5.04 - 5.63 (m, 10H), 4.70 - 4.77 (m, 6H).
위에서 얻은 7,3‘,4’-트리알릴-3-펜타아세틸글루코실 quercetin(262 mg, 0.35 mmol)을 메탄올(10 ml)에 녹인 후, palladium/charcoal (10%, 26 mg, 0.04 mmol)과 포름산암모늄(HCO2NH4) (218.6 mg, 3.5 mmol)을 첨가한다. 이 혼합물을 70 ℃에서 1시간 동안 환류 가열한다. 이 반응물을 규조토를 통해 걸러낸 여과액을 물 (15 mL)에 넣고 디클로로메탄(15 mL)을 이용해 추출한다. 얻어진 유기층에 황산마그네슘(MgSO4)을 첨가하여 남은 물을 제거한 뒤, 여과지를 사용하여 걸러낸다. 이 혼합물을 감압 농축 한 뒤, 이 농축액을 실리카겔 관크로마토그래피(2:1 = 헥산:아세트산에틸에스테르)로 정제하여 알릴기가 제거된 화합물을 갈색의 오일 형태로 얻었다 (64 mg, 수율 29%): 1H NMR (400 MHz, Acetone) δ (ppm) 7.85 (d, J= 2.2 Hz, 1H), 7.62 (d, J= 2.2 Hz, 1H), 6.96 (d, J= 3.7 Hz, 1H), 6.50 (d, J= 2.0 Hz, 1H), 6.26 (d, J= 1.9 Hz, 1H), 5.75 (d, J= 8.0 Hz, 1H), 5.39 (d, J= 9.6 Hz, 1H), 5.22 (d, J= 1.8, 8.0 Hz, 1H), 5.11 (d, J= 9.7 Hz, 1H), 4.09 (q, J= 7.9, 4.3 Hz, 1H) 3.94 - 3.99 (m, 2H), 2.09 (t, J= 1.6, 2.6 Hz, 3H), 1.90 (d, J= 4.3 Hz, 6H), 1.87 (d, J= 3.1 Hz, 3H).
위에서 얻은 알릴기를 제거한 화합물(64 mg, 0.1 mmol)을 암모니아가 포화된 메탄올 (20 mL)에 녹인 뒤 상온에서 8 시간 동안 교반한다. 이 반응물을 감압 농축하여 얻어진 잔류물을 에틸아세테이트로 씻으며 정제하여 목적하는 quercetin-3-글루코오스 (4)를 갈색의 고체 형태로 얻었다(21 mg, 45%): 1H NMR (400 MHz, MeOD) δ (ppm) 7.70 (d, J= 2.2 Hz, 1H), 7.58 (q, J= 2.2, 6.3 Hz, 1H), 6.85 (d, J= 4.8 Hz, 1H), 6.38 (d, J= 2.0 Hz, 1H), 6.19 (d, J= 2.1 Hz, 1H), 5.23 (d, J= 7.5 Hz, 1H), 3.71 (q, J= 2.4, 9.7 Hz, 1H), 3.57 (q, J= 5.3, 6.5 Hz, 1H), 3.49 (q, J= 6.8, 7.1 Hz, 1H), 3.45 (d, J= 7.05 Hz, 1H), 3.41 (d, J= 9.0 Hz, 1H), 3.35 (d, J= 9.4 Hz, 1H).
실시예
2. 케르세틴-3-O-
글루코사이드
(
quercetin
-3-O-
glucoside
,
QOG
)의 멜라닌생성 저해 시험
세포내의 멜라닌생성저해시험 (Melanogenesis inhibition assay)은 murine melanoma(B-16 F1) 세포를 FBS (fetal bovine serum)가 함유된 DMEM 배지로 접종한 후 5% CO2, 37℃에서 배양하였다. 배지를 제거한 세포를 PBS (phosphated buffer saline)로 세척하고 트립신으로 처리하여 세포를 회수하였다. 회수된 세포는 10,000 rpm으로 10분간 원심분리한 다음 상등액을 제거하여 pellet을 얻었다. 이 pellet은 60℃에서 건조한 후 1M NaOH 100 ㎕ (10% DMSO)를 넣어 60℃ 항온조에서 세포내 멜라닌을 얻었다. 이 액의 흡광도를 490 nm에서 측정하여 멜라닌양을 구하였다. 대조물질로는 식약청에서 미백 재료로 고시한 품목인 arbutin을 사용하였는데 1일차에는 약 60%, 3일차에는 약 80%의 효능을 나타냈다 [도 2]. quercetin을 함유하는 기능성화장품이 국내외 화장품 회사에서 제품화한 사례가 있기 때문에 QOG의 출발물질인 quercetin에 대한 실험도 병행하였는데 1일차에는 QOG보다 효능이 좋았으나 3일차에는 QOG가 더 우수한 효능을 나타냈다. 또한 quercetin은 농도가 증가함에 따라 효능의 저하가 관찰되었으나 QOG의 경우는 거의 그와 같은 현상이 관찰되지 않아서 기능성화장품 소재로서 더 우수함을 입증하였다.
실시예
3. 케르세틴-3-O-
글루코사이드
(
quercetin
-3-O-
glucoside
,
QOG
)의 표준화 시스템
QOG가 농도와 HPLC detector의 감도와 linearity를 보이는지 먼저 확인해야 정량분석 방법 확립이 가능하므로 calibration curve를 확보하고자 하였다. HPLC의 실험 조건은 아래와 같다.
- Instrument : Agilent 1100 series
- Column : Phenomenex Luna C18(II) 5um 4.6 X 250mm
- Mobile phase (gradient condition)
A : 1% Formic acid in DIW
B : 1% Formic acid in CH3CN
(min) | B ( % ) |
0 ~ 2 | 17 |
2 ~ 22 | 90 |
22 ~ 23 | 95 |
23 ~ 25 | 95 |
25 ~ 27 | 17 |
27 ~ 45 | 17 |
- Injection Vol. : 10uL
- Flow rate : 1.0mL/min
- Detector : UV 355nm
실험 결과로 얻은 검정곡선은 [도 3]과 같고 correlation coefficient는 0.9975였다. 따라서 QOG는 농도에 비례하여 분석이 가능함을 확인하였으므로 기능성 화장품 소재로서 활용할 때 quality control이 가능하다.
실시예
4. 케르세틴-3-O-
글루코사이드
(
quercetin
-3-O-
glucoside
,
QOG
)의 물리화학적 성질
물리화학적 성질 | 결과 | 비고 |
분자식 | C21H20O12 | |
질량 | 464.1 | |
원소분석 | C, 54.31%; H, 4.34%; O, 41.34% | |
끓는점 | 1599.43K | |
녹는점 | 1259.92K | |
Log P | -1.39 | |
굴절률 | 109.79 cm3/mol | |
비선광도 | 0 (0.4g/100ml, methanol) | |
흡광도 | 359nm,20ug/ml in methanol | |
산도 | 208 | EP method |
강열손실도 | 99.98% | 800℃ |
강열잔분 | 0.02% | 800℃ |
건조손실도 | 6.16% | 60℃ vacuum drying method |
불순물 | Pb< 1ppm As< 5ppm Cd< 5ppm Hg< 1ppm Zn=7.1ppm Al=2.5ppm Fe=2.2ppm Cu=1.6ppm |
atomic absorption spectroscopy로 분석 |
실시예
5. 케르세틴-3-O-
글루코사이드
(
quercetin
-3-O-
glucoside
,
QOG
)의 안정성 시험
quercetin은 5개의 hydroxy 기를 가지고 있기 때문에 5군데에 glucoside가 결합한 배당체가 생길 수 있으나 5번 위치는 4번 위치의 ketone기의 산소와 수소결합을 하기 때문에 실제로는 7번, 3‘번, 4’번, 3번 위치에 glucoside가 결합한 배당체가 발견된다. 3번을 제외한 다른 3종류의 배당체는 quercetin으로부터 생성되기도 쉽고 분해되기도 쉽다는 장단점을 모두 갖는다. 그러나 3번 위치에 glucoside가 결합한 배당체인 quercetin-3-O-glucoside (QOG)는 3번 위치의 hydroxy기가 양쪽의 ring들에 의한 가리움 효과 때문에 생성되기도 어려울 뿐만 아니라 glucoside의 분리도 어려워서 상대적으로 안정한 구조를 보인다.
세포 배양액에서의 안정성시험: 세포배양액은 다양한 전이 금속이온을 포함하여 완충용액보다 강한 산화스트레스를 포함하므로 일반적으로 물질의 안정성은 완충용액보다 세포배양액에서 많이 떨어진다. QOG의 세포 배양액 내에서의 안정성을 검증하기 위하여 세포배양액 (complete Dulbecco's Modified Eagle Medium, cDMEM)에서 24시간 동안 변화를 측정하였다. QOG를 cDMEM배지에 녹여서 최종 농도를 100uM으로 맞추었는데 이 때 용매는 DMSO를 사용하였다. 분석은 HPLC를 사용하였다. 실험 결과 얻은 chromatogram은 [도 4]의 a와 같고 각 결과물의 area를 그래프로 나타낸 그림은 [도 4]의 b와 같다.
82%가 24시간 후까지 잔류하고 있어서 QOG의 세포 배양액 내에서의 안정성을 보여준다.
pH에 대한 안정성시험: pH1부터 pH13.5 사이에서의 QOG 안정성을 측정하였다. pH 용액에 방치하지 않고 바로 측정한 결과부터 27시간 방치한 후 측정한 QOG의 안정성은 [도 5]에서 보듯이 큰 변화를 보이지 않았고, pH1부터 pH9 사이에서는 27시간이 경과하여도 QOG는 변하지 않는다는 결과를 확보하였다.
온도변화에 따른 안정성시험: 25℃에서 85℃ 사이의 온도 변화에 따른 QOG 안정성을 시험한 결과 [도 6]에서 보듯이 20℃에서 75℃ 사이에서는 안정하다는 시험 결과를 확보하였다.
실시예
6. 케르세틴-3-O-
글루코사이드
(
quercetin
-3-O-
glucoside
,
QOG
)의 안전성 시험
단회투여독성시험: 시험에 사용한 동물은 마우스 5마리로 비경구투여로 QOG를 투여하였으며, 14일 관찰기간을 거쳤다. 만일 2,000mg/Kg을 투여하여 한 마리도 죽지 않으면 더 이상의 용량단계 설정을 위한 시험이 불필요하다고 식약청 고시에 명시되어 있는데 QOG는 2,000mg/Kg의 투여시 한 마리도 죽은 경우가 없기 때문에 ‘단회투여독성시험’ 결과로부터 QOG는 2,000mg/Kg의 투여시에도 안전하다고 판정하였다.
유전독성시험 (Bacterial Reverse Mutation Assay 시험): 시험 방법은 아래와 같다.
미리 워밍한 톱 아가를 수조에서 50±2℃로 조정하여 유지시켰다. 박테리아 배양 및 포지티브 화합물 또는 10 배 희석된 테스트 물질을 톱 아가에 첨가하였다. 박테리아 배양, 테스트 화합물, PBS 및 톱 아가의 용액 부피 비는 각 웰에 대해서 2.7 ml에서 1:1:5:20이었다. 그 혼합물을 볼텍싱하고 VB 아가를 포함한 10cm 플레이트에 부었다. 플레이트를 상온에 세워서 톱 아가를 고체화하였다. 역으로 하여서 37℃에서 약 72시간 동안 플레이트를 배양하였다. 복귀돌연변이체(revertant) 콜로니의 수를 수동으로 정량화한다. 돌연변이유발성(mutagenicity)은 복귀돌연변이체 콜로니의 수를 정량화하여 결정하였다.
Sodium azide를 대조 약물로 실험한 결과는 [도 7]과 같고, 2-Aminoanthracene을 대조 약물로 실험한 결과는 [도 8]과 같다. 대조 약물들보다는 mutagenicity가 낮으나 control인 DMSO보다는 mutagenicity가 나타나기 때문에 QOG는 positive mutagenicity를 보이는 것으로 판단되었다. 이와 같은 결과는 이미 QOG의 aglycon 화합물인 quercetin의 실험 결과가 다른 연구자들에 의해서 여러차례 보고된 바 있기 때문에 예측된 결과이다. 즉, quercetin은 in vitro 실험에서는 mutagenicity가 관찰되는 것으로 알려져 있다 [Mutation Res. 726: 60 (2011)].
유전독성시험 (In Vitro Mammalian Chromosomal Aberration Test): 시험 방법은 아래와 같다.
CHO-K1 세포를 5 mL 배지를 가지는 6 cm 플레이트에서 플레이트 당 500,000 세포의 밀도로 37°C, 5% CO2로 시딩하였다. 그 후 세포를 1.0 mg/ml S9[코팩터 보충된 후(post)-미토콘드리아 분획]의 존재 하에서 24시간 동안 배양하고, 여러 농도의 테스트 화합물을 포함하는 for 6 hours followed by additional 18h in S9-free medium, or in S9-없는 배지 또는 S9-없는 배지 배지에서 추가적으로 18시간을 수반하였다. Benzo[a]pyrene (S9를 포함한) 또는 Mitomycin C (S9를 포함하지 않는)을 각각 양성 대조군으로 사용하였다. 최종 DMSO 퍼센트는 0.5%이었다. Colchicine를 수집 3시간 전에 최종 농도 0.5 μg/mL로 첨가하였다. 그 후 세포들을 수집하여 0.075 M KCl 용액에서 팽윤하고, methanol:acetic acid (3:1)에서 고정한 후, 깨끗한 유리 슬라이드 상에 위치하고 Giemsa 염색을 하였다. 슬라이드 당 1백 metaphases(200 metaphases/dose)를 분석하였다.
시험 결과는 아래 표와 같은데, QOG는 세포 사멸을 10 mM, 3 mM, 1 mM에서 일으켰다. 양성 대조군으로 mitomycin과 Benzo[a]pyrene를 사용하였는데 이들과 비교할 때 QOG는 염색체 이상을 유도하는 것으로 판단되었다.
Group | Treatment Time (hr) | S9 Mix | Aberrant Cells (%) | Criteria Range | Result |
DMSO control | 24 | - | 1.5 | <5% | Negative |
QOG (10 mM) | 24 | - | NA | NA | NA |
QOG (3 mM) | 24 | - | NA | NA | NA |
QOG (1 mM) | 24 | - | NA | NA | NA |
QOG (0.1 mM) | 24 | - | NA | NA | NA |
MMC (0.3 ug/ml) | 24 | - | 30.5 | >10% | Positive |
DMSO control | 6 | + | 0.5 | <5% | Negative |
QOG (10 mM) | 6 | + | NA | NA | NA |
QOG (3 mM) | 6 | + | NA | NA | NA |
QOG (1 mM) | 6 | + | NA | NA | NA |
QOG (0.1 mM) | 6 | + | 8.0 | 5 - 10% | Uncertain |
B(a)P (20 ug/ml) | 6 | + | 16.5 | >10% | Positive |
유전독성시험 (In vivo Micronucleus Assay): 시험 방법은 아래와 같다.
9주령의 수컷 CD-1 마우스를 5 군(n=5)으로 랜덤화하였다. 테스트 물질 QOG를 0.5% CMC에서 제조하였다. 동물을 여러 투여 용량(250, 500 및 1000 mg/kg)의 QOG로 처리하고 각 용량을 경구 개바지(gavage)로 2회 투여하였다. 두 투여 사이의 간격은 24 h이었다. 음성 대조군으로 비히클 대조군으로 단지 0.5% CMC만을 수여하였다. 양성 대조군에서 마우스는 80mg/kg 용량에서 단일 i.p. 주사(생리적 식염수에 녹인 cyclophosphamide)를 주었다. 골수 도말(smear)을 마지막 투여 6시간 후 각 처리군으로부터 얻었다. 각 smear를 Giemsa로 염색하고 광학 현미경을 사용하여 조사하였다. Polychromatic erythrocytes (PCEs) 및 normochromatic erythrocytes (NCEs)를 각각 동정하였다. Micronucleated PCEs (MNPCEs)의 수/2000 PCEs를 계수하였다. PCE/NCE 비를 각 동물로부터 얻은 200 적혈구의 조사로 결정하였다.
시험결과는 [도 9]와 같은데 a 그림은 normochromatic erythrocytes (NCEs)를, b 그림은 polychromatic erythrocytes (PCEs)를 나타내는데, 이 결과로부터 QOG는 in vivo Micronucleus Assay에서는 독성이 없음을 보여주었다.
따라서 본 발명의 기능성화장품 소재 QOG는 in vitro 유전독성시험에서는 독성이 관찰되나 in vivo 유전독성시험에서는 독성이 없는 결과를 얻었다.
피부자극시험 (Draize 방법): 시험 방법은 아래와 같다.
2.8 ~ 3.4kg의 네 마리 뉴질랜드 흰 토끼를 in vivo Draize 테스트에 사용하였다. 토끼를 몸통(trunk) 및 측면(lateral)부위를 면도하였다. 테스트 물질(QOG)을 100% 농도(0.5 g를 0.5 mL saline에 녹임)를 3cm 지름 게이지 패치 하에서 맨 살에 적용하였다. 4시간 후, 그 패치를 제거하고 스킨 반응을 제거 후 30min, 60min, 24hr, 48hr 및 72 시간에서 각 토끼에 대하여 홍반 및 부종을 스코어하였다.
시험 결과는 아래 표와 같은데 이 결과에서 보듯이 QOG는 피부자극이 없는 것으로 판명되었다.
Animal # | Sex |
Body
Weight ( kg ) |
1 hr | 24 hr | ||||||||||
QOG | Vehicle | QOG | Vehicle | |||||||||||
Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | |||
1 | M | 3.20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
2 | M | 3.35 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
3 | F | 2.75 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
4 | F | 2.83 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Average | 0 | 0 | 0 | 0 | ||||||||||
Irritancy scores | 0 | 0 | 0 | 0 |
Animal # | Sex |
Body
Weight ( kg ) |
48 hr | 72 hr | ||||||||||
QOG | Vehicle | QOG | Vehicle | |||||||||||
Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | |||
1 | M | 3.20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
2 | M | 3.35 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
3 | F | 2.75 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
4 | F | 2.83 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Average | 0 | 0 | 0 | 0 | ||||||||||
Irritancy scores | 0 | 0 | 0 | 0 |
광자극시험: 기니픽에서 시험한 시험방법은 아래와 같다.
QOG의 광자극 능력을 Adjuvant & Strip 방법을 사용하여 조사하였다. 6 마리 guinea 피그를 각 테스트 군으로 할당하였다. 그룹 1은 0.5% w/v QOG로 유도하고 0.5% w/v QOG 또는 식염수로 챌린지하였다. 그룹 2는 식염수로 유도하고 0.5% w/v QOG 또는 식염수로 하였다. 1일에, guinea 피그를 Freund’s complete adjuvant (FCA) 및 식염수(1: 1)의 0.1 ml에멀젼화된 혼합물을 clipped neck 상에 4 다른 지점에서 피부내에 주사하였다. 그 목을 스카치 테입으로 10회 벗겼다. 식염수 내 0.5% w/v QOG 및 식염수 비히클을 각각 그룹 1 및 2에 적용하였다. 그 유도 면적은 10 J/cm2 UVA로 조사하였다. 동일한 과정을 5일 동안 반복하였다. 22일에 guinea 피그의 등 부위를 면도하였다. 전신성 챌린지를 0.5% w/v QOG 용액 및 식염수로 수행하였다. 오른쪽 면을 10 J/cm2UVA로 조사하였다. 왼쪽 면을 알루미늄 호일로 UVA 조사로부터 응달화하였다.
피부광자극에 대한 scoring은 아래 표와 같이 결정하였다.
QOG에 대한 광자극시험 결과는 아래와 같은데, 이 결과에서 보듯이 QOG는 피부광자극이 없다고 판단되었다.
안점막자극시험 (Draize 방법): 시험 방법은 아래와 같다.
2.8 ~ 3.5kg의 네 마리 뉴질랜드 흰 토끼를 in vivo Draize 테스트에 사용하였다. 테스트에 예비적으로 선택된 각 토끼의 양 눈을 테스트 조사 동안에 사용한 것과 동일한 방법에 의하여 테스트 전 24시간 내에 검사하였다. 눈 충혈, 각막 손상이 있는 동물은 사용하지 않았다. Test 물질(QOG)을 100% 농도(0.5 g를 0.5 mL saline에 녹임)를 안구로부터 아래 꺼플을 부드럽게 당긴 후 각 동물의 한 눈의 결막낭에 위치시켰다. 그 후 꺼플을 물질의 제한된 손실을 위하여 약 1초 동안 부드럽게 붙혔다. 식염수를 다른 눈에 대조군으로 사용하였다. 눈은 1 hr, 24 hr, 48 hr, 72 hr, day 4 및 day 7에 검사하였다. 눈 반응의 등급을 각 검사에서 기록하였다. 각막의 검사를 위하여, 홍채 및 결막 또는 다른 주목할 병소를 기록하고 보고하였다.
시험 결과는 아래 표와 같은데, 이 결과에서 보듯이 QOG는 안점막자극이 없다고 판단되었다.
Animal ID | Sex | Body | Grades for Ocular Lesions | ||||||||||||
Weight | Examination | 1 hr | 24 hr | 48 hr | 72 hr | Day 4 | Day 7 | ||||||||
(kg) | QOG | Con | QOG | Con | QOG | Con | QOG | Con | QOG | Con | QOG | Con | |||
1 | M | 3.51 | Cornea | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Iris | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Conjunctivae | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Total | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
2 | M | 3.25 | Cornea | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Iris | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Conjunctivae | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Total | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
3 | F | 2.82 | Cornea | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Iris | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Conjunctivae | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Total | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
4 | F | 2.95 | Cornea | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Iris | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Conjunctivae | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Total | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Average | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Irritancy scores | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
피부감작성시험 (Draize 방법): 시험 방법은 아래와 같다.
2.8 ~ 3.4kg의 네 마리 뉴질랜드 흰 토끼를 in vivo Draize 테스트에 사용하였다. 토끼를 몸통(trunk) 및 측면(lateral)부위를 면도하였다. 테스트 물질(QOG)을 100% 농도(0.5 g를 0.5 mL saline에 녹임)를 3cm 지름 게이지 패치 하에서 맨 살에 적용하였다. 4시간 후, 그 패치를 제거하고 스킨 반응을 제거 후 30min, 60min, 24hr, 48hr 및 72 시간에서 각 토끼에 대하여 홍반 및 부종을 스코어하였다.
시험 결과는 아래 표와 같은데, 이 결과에서 보듯이 QOG는 피부감자극시험에서 영향이 없다고 판단되었다.
Animal# | Sex | Body Weight (kg) |
1hr | 24hr | 48hr | 72hr | ||||||||||||||||||||
QOG | Vehicle | QOG | Vehicle | QOG | Vehicle | QOG | Vehicle | |||||||||||||||||||
Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | Erythema | Oedema | Total | |||
1 | M | 3.20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
2 | M | 3.35 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
3 | F | 2.75 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
4 | F | 2.83 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Average | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||
Irritancy scores | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
광독성시험: 기니픽에서 수행한 광독성시험 방법은 아래와 같다.
동물 실험시설에서 1주일 순응 후, 18 마리의 guinea 피그를 체중에 따라서 세 군으로 랜덤화하였다. 음성 대조군에서 동물을 비히클로 0.1 mL 식염수로 투여하였다. QOG 군을 0.5% w/v QOG 용액으로 적용하였다. 양성 대조군을 1% w/v 8-Methoxypsoralen (8-MOP)으로 처리하였다. 전체 등 피부의 털을 깍은 후, 4 스퀘어의 1.5 cm × 1.5cm를 2 열과 2 행으로 할당하였다. 한 열에 한 쌍의 스퀘어에서, 테스트 QOG를 12시간 동안 적용하였다. 8-MOP 또는 식염수를 개별적으로 30분간 적용하였다. 다른 열의 스퀘어를 식염수로 처리하였다. 폴티스(poultice)의 제거 후, 오른 편을 10 J/cm2UVA으로 조사하고. 왼편은 알루미늄 호일로 UVA 조사로부터 차단하였다.
피부광자극에 대한 scoring은 아래 표와 같이 결정하였다.
QOG에 대한 광자극시험 결과는 아래와 같은데, 이 결과에서 보듯이 QOG는 광자극이 없다고 판단되었다.
결과적으로, QOG에 대한 안전성시험 7종의 결과로부터 QOG는 기능성화장품 소재로 사용하기에 문제가 없음이 판명되었다.
이상, 본 발명의 내용의 특정한 부분을 상세히 기술하였는바, 당업계의 통상의 지식을 가진 자에게 있어서, 이러한 구체적인 기술은 단지 바람직한 구현 예일 뿐이며, 이에 의해 본 발명의 범위가 제한되는 것이 아닌 점은 명백할 것이다. 따라서, 본 발명의 실질적인 범위는 첨부된 청구항들과 그것들의 등가물에 의하여 정의된다고 할 것이다.
Claims (7)
- a-1)베타-D글루코오스 펜타아세테이트를 디클로로메탄에 녹인 후, 브롬산(HBr)을 첨가한 후 이 혼합물에 탄산수소나트륨을 첨가하여 1-브로모-2,3,4,6-테트라-O-아세틸-D-글루코오스베타-D-글루코오스 펜타 아세테이트를 합성하는 단계;
a-2)루틴을 디메틸폼아미드에 녹인 용액에 탄산칼륨과 알릴브로마이드를 첨가한 후, 이 혼합물에 에탄올과 염산을 첨가하여 3,5-OH-알릴 케르세틴을 합성하는 단계;
b) 상기 a-2) 단계에서 얻은 3,5-OH-알릴 케르세틴을 클로로포름과 물의 혼합액에 녹인 용액에 탄산칼륨, Aliquat 336, 및 상기 a-1)에서 얻은 1-브로모-2,3,4,6-테트라-O-아세틸-D-글루코오스베타-D-글루코오스 펜타아세테이트를 첨가한 후, 이 혼합물에 염산 (15 mL)을 첨가하여 7,3‘,4’-트리알릴-3-펜타아세틸글루코실 케르세틴을 합성하는 단계;및
c) 상기 b) 단계에서 얻은 7,3‘,4’-트리알릴-3-펜타아세틸글루코실 케르세틴을 메탄올에 녹인 후, palladium/charcoal과 포름산암모늄(HCO2NH4)을 첨가한 후,여과, 추출, 감압 농축 한 후 정제하여 알릴기가 제거된 화합물을 암모니아가 포화된 메탄올에 녹인 뒤 이 반응물을 감압 농축하여 얻어진 잔류물을 정제하는 단계를 포함하는 하기 화학식 1의 화합물의 제조방법.
[화학식 1] - 제2항에 있어서, 상기 조성물은 미백 효과를 가지는 것을 특징으로 하는 피부 외용제 조성물.
- 제4항에 있어서, 상기 조성물은 미백 효과를 가지는 것을 특징으로 하는 화장료 조성물.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020120136966A KR20140069563A (ko) | 2012-11-29 | 2012-11-29 | 케르세틴 배당체 제조방법 및 이의 기능성 화장품으로서의 용도 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020120136966A KR20140069563A (ko) | 2012-11-29 | 2012-11-29 | 케르세틴 배당체 제조방법 및 이의 기능성 화장품으로서의 용도 |
Publications (1)
Publication Number | Publication Date |
---|---|
KR20140069563A true KR20140069563A (ko) | 2014-06-10 |
Family
ID=51124631
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020120136966A KR20140069563A (ko) | 2012-11-29 | 2012-11-29 | 케르세틴 배당체 제조방법 및 이의 기능성 화장품으로서의 용도 |
Country Status (1)
Country | Link |
---|---|
KR (1) | KR20140069563A (ko) |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN107880081A (zh) * | 2017-12-22 | 2018-04-06 | 陕西嘉禾生物科技股份有限公司 | 一种异槲皮素的合成方法 |
KR20210056462A (ko) * | 2019-11-07 | 2021-05-20 | 재단법인 경기도경제과학진흥원 | 이삭여뀌 추출물 또는 이로부터 분리된 화합물을 이용한 피부 미백용 조성물 |
-
2012
- 2012-11-29 KR KR1020120136966A patent/KR20140069563A/ko not_active Application Discontinuation
Cited By (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN107880081A (zh) * | 2017-12-22 | 2018-04-06 | 陕西嘉禾生物科技股份有限公司 | 一种异槲皮素的合成方法 |
CN107880081B (zh) * | 2017-12-22 | 2021-07-06 | 陕西嘉禾生物科技股份有限公司 | 一种异槲皮素的合成方法 |
KR20210056462A (ko) * | 2019-11-07 | 2021-05-20 | 재단법인 경기도경제과학진흥원 | 이삭여뀌 추출물 또는 이로부터 분리된 화합물을 이용한 피부 미백용 조성물 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR101740097B1 (ko) | 에델바이스 식물 세포 배양 추출물을 함유한 항염 및 항노화 효과를 지닌 피부 외용제 조성물 및 그 제조방법 | |
KR100825450B1 (ko) | 연교추출물을 함유하는 피부 주름개선용 화장료 조성물 | |
JP2013502380A (ja) | 皮膚清澄複合体、前記複合体の使用、前記複合体を含む化粧又は医薬組成物及びその適用のための方法 | |
KR20010098707A (ko) | 화장품 조성물 | |
WO2008147022A1 (en) | Anti-wrinkle composition for external applications to the skin containing biflavonoid derivatives | |
KR101026879B1 (ko) | 피부주름개선용 화장료 조성물의 제조방법 | |
KR102063686B1 (ko) | 콩뿌리 추출물을 함유하는 피부 외용제 조성물 | |
KR100742267B1 (ko) | 서장채국화 추출물, 이의 제조 방법 및 이를 유효성분으로 함유하는 미백용 화장료 조성물 | |
KR100860605B1 (ko) | 스트로브 잣나무피 추출물 및 니아신아마이드를 함유하는 화장료 조성물 | |
US20060216255A1 (en) | Medicinal cosmetical composition with areca catechu seed extract | |
KR20140069563A (ko) | 케르세틴 배당체 제조방법 및 이의 기능성 화장품으로서의 용도 | |
KR20090013293A (ko) | 배 추출물을 함유하는 피부노화억제용 주름개선 화장료조성물 | |
KR100519154B1 (ko) | 천연물을 이용한 항노화 및 미백 화장료 | |
KR101256971B1 (ko) | 데커시놀의 추출방법 및 상기 데커시놀을 포함하는 화장료 조성물 | |
KR100829718B1 (ko) | 먼나무 추출물을 유효성분으로 포함하는 피부 미백용화장료 조성물 | |
KR101317433B1 (ko) | 지구자, 길경, 밀싹 및 세이지 추출물을 함유하는 미백 화장용 조성물 | |
KR100453217B1 (ko) | 피부미백재 | |
KR20120081289A (ko) | 아이소리퀴리티게닌 함량이 증가된 감초 발효물을 함유하는 피부외용제 조성물 | |
KR20100088463A (ko) | 아로니아 추출물을 유효성분으로 포함하는 피부 미백용 화장료 조성물 | |
KR20210026550A (ko) | 항염, 항산화 및 미백 효과가 우수한 화장료, 이의 제조방법 및 이를 포함하는 화장품 | |
KR101731264B1 (ko) | 아임계추출조건으로 추출한 사간추출물을 포함하는 피부미백용 화장료 조성물 | |
JPH11171722A (ja) | 皮膚外用剤 | |
KR20130119212A (ko) | 녹차 종자 유래의 21-o-안젤로일데아사포젠올 e3 성분을 함유하는 항산화 또는 미백용 조성물 | |
KR100930592B1 (ko) | 반대해 추출물을 함유하는 피부 미백 및 항산화 조성물 | |
KR20080040094A (ko) | 데커시놀의 추출방법 및 상기 데커시놀을 포함하는 화장료조성물 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
E902 | Notification of reason for refusal | ||
E601 | Decision to refuse application |