KR20090010174A - Eg5 유전자의 발현을 억제하는 조성물 및 억제 방법 - Google Patents
Eg5 유전자의 발현을 억제하는 조성물 및 억제 방법 Download PDFInfo
- Publication number
- KR20090010174A KR20090010174A KR1020087026420A KR20087026420A KR20090010174A KR 20090010174 A KR20090010174 A KR 20090010174A KR 1020087026420 A KR1020087026420 A KR 1020087026420A KR 20087026420 A KR20087026420 A KR 20087026420A KR 20090010174 A KR20090010174 A KR 20090010174A
- Authority
- KR
- South Korea
- Prior art keywords
- base
- modified
- dsrna
- mod
- gene
- Prior art date
Links
- SGNSBFALHLLMAE-NWELLFRESA-N CCOC(C(CN(C1)C(CCCCCNC(OC2CC3=CCC(C(CC4)[C@](C)(CC5)[C@H]4C(C)CCCC(C)C)C5[C@@]3(C)CC2)=O)=O)C1=O)=O Chemical compound CCOC(C(CN(C1)C(CCCCCNC(OC2CC3=CCC(C(CC4)[C@](C)(CC5)[C@H]4C(C)CCCC(C)C)C5[C@@]3(C)CC2)=O)=O)C1=O)=O SGNSBFALHLLMAE-NWELLFRESA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H21/00—Compounds containing two or more mononucleotide units having separate phosphate or polyphosphate groups linked by saccharide radicals of nucleoside groups, e.g. nucleic acids
- C07H21/02—Compounds containing two or more mononucleotide units having separate phosphate or polyphosphate groups linked by saccharide radicals of nucleoside groups, e.g. nucleic acids with ribosyl as saccharide radical
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/11—DNA or RNA fragments; Modified forms thereof; Non-coding nucleic acids having a biological activity
- C12N15/113—Non-coding nucleic acids modulating the expression of genes, e.g. antisense oligonucleotides; Antisense DNA or RNA; Triplex- forming oligonucleotides; Catalytic nucleic acids, e.g. ribozymes; Nucleic acids used in co-suppression or gene silencing
- C12N15/1138—Non-coding nucleic acids modulating the expression of genes, e.g. antisense oligonucleotides; Antisense DNA or RNA; Triplex- forming oligonucleotides; Catalytic nucleic acids, e.g. ribozymes; Nucleic acids used in co-suppression or gene silencing against receptors or cell surface proteins
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K48/00—Medicinal preparations containing genetic material which is inserted into cells of the living body to treat genetic diseases; Gene therapy
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/11—DNA or RNA fragments; Modified forms thereof; Non-coding nucleic acids having a biological activity
- C12N15/113—Non-coding nucleic acids modulating the expression of genes, e.g. antisense oligonucleotides; Antisense DNA or RNA; Triplex- forming oligonucleotides; Catalytic nucleic acids, e.g. ribozymes; Nucleic acids used in co-suppression or gene silencing
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/11—DNA or RNA fragments; Modified forms thereof; Non-coding nucleic acids having a biological activity
- C12N15/113—Non-coding nucleic acids modulating the expression of genes, e.g. antisense oligonucleotides; Antisense DNA or RNA; Triplex- forming oligonucleotides; Catalytic nucleic acids, e.g. ribozymes; Nucleic acids used in co-suppression or gene silencing
- C12N15/1137—Non-coding nucleic acids modulating the expression of genes, e.g. antisense oligonucleotides; Antisense DNA or RNA; Triplex- forming oligonucleotides; Catalytic nucleic acids, e.g. ribozymes; Nucleic acids used in co-suppression or gene silencing against enzymes
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/10—Type of nucleic acid
- C12N2310/11—Antisense
- C12N2310/111—Antisense spanning the whole gene, or a large part of it
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/10—Type of nucleic acid
- C12N2310/14—Type of nucleic acid interfering N.A.
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/30—Chemical structure
- C12N2310/31—Chemical structure of the backbone
- C12N2310/314—Phosphoramidates
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/30—Chemical structure
- C12N2310/31—Chemical structure of the backbone
- C12N2310/315—Phosphorothioates
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/30—Chemical structure
- C12N2310/32—Chemical structure of the sugar
- C12N2310/321—2'-O-R Modification
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/30—Chemical structure
- C12N2310/32—Chemical structure of the sugar
- C12N2310/322—2'-R Modification
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/30—Chemical structure
- C12N2310/32—Chemical structure of the sugar
- C12N2310/323—Chemical structure of the sugar modified ring structure
- C12N2310/3233—Morpholino-type ring
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/30—Chemical structure
- C12N2310/35—Nature of the modification
- C12N2310/351—Conjugate
- C12N2310/3515—Lipophilic moiety, e.g. cholesterol
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2330/00—Production
- C12N2330/30—Production chemically synthesised
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Genetics & Genomics (AREA)
- Chemical & Material Sciences (AREA)
- Biomedical Technology (AREA)
- Organic Chemistry (AREA)
- Molecular Biology (AREA)
- Biotechnology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Engineering & Computer Science (AREA)
- Zoology (AREA)
- Wood Science & Technology (AREA)
- General Health & Medical Sciences (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- Plant Pathology (AREA)
- Physics & Mathematics (AREA)
- Microbiology (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Virology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Saccharide Compounds (AREA)
Abstract
본 발명은 길이가 30개 뉴클레오타이드 미만, 일반적으로 길이가 19 내지 25개 뉴클레오타이드이고, Eg5 유전자의 적어도 일부에 대해 실질적으로 상보적인 뉴클레오타이드 서열을 갖는 안티센스 쇄를 포함하는, Eg5 유전자의 발현을 억제하기 위한 이본쇄 리보핵산(dsRNA)에 관한 것이다. 본 발명은 또한 dsRNA와 함께 약제학적으로 허용되는 담체를 포함하는 약제학적 조성물; 당해 약제학적 조성물을 사용하여 Eg5 발현 및 Eg5 유전자의 발현에 의해 발생하는 질병을 치료하는 방법; 및 세포 내에서 Eg5 유전자의 발현을 억제하는 방법에 관한 것이다.
Eg5 유전자, Eg5 유전자 발현 억제, 이본쇄 리보핵산(dsRNA), RNA 간섭(RNAi), VEGF 유전자
Description
관련 출원
본 출원은 2006년 3월 31일에 출원된 미국 임시출원 제60/787,762호 및 2006년 12월 15일에 출원된 미국 임시출원 제60/870,259호의 이익을 청구한다. 상기 두 선출원 모두는 전문이 본원에 참조로 인용된다.
본 발명은 이본쇄 리보핵산(dsRNA), 및 RNA 간섭(interference)을 매개하여 Eg5 유전자의 발현을 억제하는데 있어서의 상기 dsRNA의 용도, 및 단독으로 또는 혈관 내피 성장 인자(VEGF)를 표적화하는 dsRNA와 함께 사용되어, 암과 같이 Eg5 발현에 의해 매개되는 병리학적 과정들을 치료하기 위한 상기 dsRNA의 용도에 관한 것이다.
유기체 내에서 세포 집단의 유지는 세포 분열 및 프로그램화된 세포 사멸의 세포 과정에 의해 조절된다. 정상 세포 내에서, 각각의 과정의 개시 및 완료와 관 련된 세포 현상(event)은 고도로 조절된다. 암과 같은 증식성 질병에서, 이들 과정 중 하나 또는 둘 모두가 교란될 수 있다. 예를 들어, 암 세포는 아마도 돌연변이로 인하여 양성 조절인자가 과발현되거나 음성 조절인자가 손실되어 세포 분열 주기의 조절[체크포인트 조절(checkpoint control)]을 상실했을 수 있다.
또는, 암 세포는 음성 조절인자가 과발현되어 프로그램화된 세포 사멸이 일어나는 능력을 상실했을 수 있다. 따라서, 암 세포에 대한 체크포인트 조절 및 프로그램화된 세포 사멸의 과정을 회복시킬 새로운 화학치료 약물의 개발이 요구된다.
사람 암의 치료에 대한 하나의 접근법은 세포 주기 진행에 필수적인 단백질을 표적화하는 것이다. 세포 주기가 하나의 단계에서 다음 단계로 진행되기 위해서는, 특정한 필수 현상이 완료되어야 한다. 현상 및 단계들의 적절한 순서를 진행하는 체크포인트가 세포 주기 내에 존재한다. 한가지 이러한 체크포인트로는 유사분열의 중기 단계 동안에 일어나는 방추사 체크포인트이다. 유사분열에서 필수적인 기능을 지닌 단백질을 표적화하는 소분자가 방추사 체크포인트를 개시하여 유사분열중인 세포를 정지(arrest)시킬 수 있다. 유사분열중인 세포를 정지시키는 소분자 중에서, 임상에서 항-종양 활성을 나타내는 것들은 또한 아폽토시스(apoptosis), 프로그램화된 세포 사멸과 관련된 형태학적 변화를 유발한다. 따라서, 암 치료에 효과적인 화학치료제는 체크포인트 조절 및 프로그램화된 세포 사멸을 유발하는 것일 수 있다. 불행하게도, 세포 내에서 이러한 과정들을 조절하는데 이용가능한 화합물이 거의 없다. 유사분열 정지 및 아폽토시스를 유발하는 것 으로 공지된 대부분의 화합물은 튜불린 결합제로서 작용한다. 이들 화합물은 미세소관의 역학적 불안정성을 변경시키고 유사분열 방추사의 기능/구조를 간접적으로 변경시킴으로써 유사분열 정지를 일으킨다. 이들 화합물 대부분은 모든 미세소체의 성분인 튜불린 단백질을 특이적으로 표적화하므로, 이들은 미세소체가 역할을 담당하는 다수의 정상적인 세포 과정 중 하나 이상에 영향을 미칠 수도 있다. 따라서, 증식 세포와 관련된 표적 단백질을 보다 특이적으로 표적화하는 소분자도 요구된다.
Eg5는 유사분열 방추사에 위치하고, 양극성 유사분열 방추사의 형성 및/또는 기능에 필요한 것으로 알려진 다수의 키네신-유사 운동 단백질 중 하나이다. 최근에, 유사분열 방추사의 양극성을 교란시키는 소분자가 보고되었다[참조: 본원에 참조로 인용된 Mayer, T, U. et. al. 1999. Science 286(5441) 971-4]. 보다 구체적으로, 당해 소분자는 비정상적인 유사분열 방추사의 형성을 유발시켰는데, 즉 미세소관의 모노아스트럴 배열(monoastral array)이 중심체의 중심 쌍으로부터 방사되고, 염색체가 미세소관의 원위 말단에 부착되었다. 당해 소분자는 모노아스트럴 배열을 따라 "모나스트롤(monastrol)"이라고 명명되었다. 이러한 모노아스트럴 배열 표현형은 Eg5 운동 단백질이 면역고갈된 유사분열 세포에서 이미 관측되었다. 이러한 특별한 모노아스트럴 배열 표현형은 Eg5의 잠재적 억제제로서의 모나스트롤의 확인을 용이하게 하였다. 게다가, 모나스트롤은 또한 시험관내 검정에서 미세소체의 Eg5 운동 단백질에 의한 운동성을 억제시키는 것으로 밝혀졌다. Eg5 억제제 모나스트롤은 세포 내에서 관련 키네신 모터에 대해 또는 골지체 운동에 관여하 는 모터(들)에 대해 분명한 영향을 미치지 않았다. Eg5의 면역고갈 또는 Eg5의 모나스트롤 억제를 통해 모노아스트럴 배열 표현형을 나타내는 세포는 세포 주기의 M 단계에서 정지시킨다. 그러나, Eg5의 면역고갈 또는 억제에 의해 유도된 유사분열 정지는 일시적이다[참조: Kapoor, T. M., 2000, J Cell Biol 150(5) 975-80]. 모나스트롤에 의해 유도된 모노아스트럴 배열 표현형 및 유사분열에서의 세포 주기 정지 둘 모두는 가역적이다. 세포는 회복되어 정상적인 양극성 유사분열 방추사를 형성하고, 유사분열을 완료하여 세포 주기 및 정상적인 세포 증식이 진행된다. 이러한 데이터는, 일시적인 유사분열 정지를 유도하는 Eg5의 소분자 억제제가 암세포 증식의 치료에 효과적이지 않을 수 있다는 것을 시사한다. 그럼에도 불구하고, 모나스트롤이 유사분열 정지를 일으킨다는 발견은 흥미로우며, 따라서 사람 암의 치료에 효과적인 방식으로 Eg5 운동 단백질을 조절하는데 사용될 수 있는 화합물을 추가로 연구하고 확인할 필요가 있다. 이들 화합물을 다른 항신생물제와 함께 사용하는 것을 조사할 필요도 있다.
VEGF(혈관 투과성 인자, VPF로도 공지되어 있음)는 혈관신생(angiogenesis), 상피 세포 증식 및 내피 세포 생존을 자극하는 다기능성 사이토카인이다. VEGF는 매우 다양한 조직에 의해 생산될 수 있고, 이의 과발현 또는 비정상적인 발현은 암을 포함하는 각종 질환 및 노화 관련 황반 변성과 같은 망막 질환 및 기타 혈관신생 질환을 일으킬 수 있다.
최근에, 이본쇄 RNA 분자(dsRNA)는 RNA 간섭(RNAi)으로 알려진 고도로 보존된 조절 기전에서 유전자 발현을 차단하는 것으로 밝혀졌다. 국제공개공보 제WO 99/32619호(Fire et al.)에는 길이가 25개 뉴클레오타이드 이상인 dsRNA를 사용하여 씨.엘레간스(C. elegans)에서 유전자의 발현을 억제하는 것이 기술되어 있다. dsRNA는 식물[참조: 국제공개공보 제WO 99/53050호, Waterhouse et al.; 및 제WO 99/61631호, Heifetz et al.), 드로소필라(Drosophila)[참조: Yang, D., et al., Curr. Biol. (2000) 10:1191-1200), 및 포유동물[참조: 국제공개공보 제WO 00/44895호, Limmer; 및 독일특허출원 제DE 101 00 586.5호, Kreutzer et al.)을 포함하는 다른 유기체에서 표적 RNA를 분해시키는 것으로도 밝혀졌다. 현재 이러한 천연 기전은 비정상적이거나 원하지 않는 유전자 조절에 의해 발생하는 질환을 치료하기 위한 새로운 계열의 약제를 개발하는데 있어서 집중을 받게 되었다.
RNAi 분야에서의 현저한 발전과 Eg5 발현에 의해 매개되는 병리학적 과정의 치료에 있어서의 발전에도 불구하고, 높은 생물학적 활성과 생체내 안정성 둘 모두를 갖는 세포 자체의 RNAi 기구를 사용하여 Eg5 유전자를 선택적으로 그리고 효과적으로 사일런싱(silencing)시킬 수 있고, Eg5 발현에 의해 매개되는 병리학적 과정을 치료하는데 사용하기 위하여 표적 Eg5 유전자의 발현을 효과적으로 억제할 수 있는 제제가 여전히 요구된다.
발명의 개요
본 발명은 이본쇄 리보핵산(dsRNA), 및 이러한 dsRNA를 단독으로 또는 VEGF를 표적화하는 dsRNA와 함께 사용하여 세포 또는 포유동물에서 Eg5 유전자의 발현을 억제하기 위한 조성물 및 방법을 제공한다. 본 발명은 또한 암에서와 같이, Eg5 유전자의 발현에 의해 발생하는 병리학적 상태 및 질병을 치료하기 위한 조성물 및 방법을 제공한다. 본 발명의 dsRNA는, 길이가 30개 뉴클레오타이드 미만, 일반적으로 길이가 19 내지 24개 뉴클레오타이드이고 Eg5 유전자의 mRNA 전사체의 적어도 일부에 대해 실질적으로 상보적인 영역을 갖는 RNA 쇄(안티센스(antisense) 쇄)를 포함한다.
하나의 양태에서, 본 발명은 Eg5 유전자의 발현을 억제하기 위한 이본쇄 리보핵산(dsRNA)을 제공한다. dsRNA는 서로 상보적인 2개 이상의 서열을 포함한다. dsRNA는 제1 서열을 포함하는 센스 쇄 및 제2 서열을 포함하는 안티센스 쇄를 포함한다. 안티센스 쇄는 Eg5를 암호화하는 mRNA의 적어도 일부에 대해 실질적으로 상보적인 뉴클레오타이드 서열을 포함하고, 상보성 영역의 길이는 30개 뉴클레오타이드 미만, 일반적으로는 19 내지 24개 뉴클레오타이드이다. dsRNA를 Eg5를 발현하는 세포와 접촉시키면, Eg5 유전자의 발현이 40% 이상 억제된다.
예를 들어, 본 발명의 dsRNA 분자는 표 1 내지 3의 센스 서열로 이루어진 그룹으로부터 선택된 dsRNA의 제1 서열 및 표 1 내지 3의 안티센스 서열로 이루어진 그룹으로부터 선택된 제2 서열을 포함할 수 있다. 본 발명의 dsRNA 분자는 천연 뉴클레오타이드를 포함할 수 있거나, 또는 2'-O-메틸 변형된 뉴클레오타이드, 5'-포스포로티오에이트 그룹을 포함하는 뉴클레오타이드, 및 콜레스테릴 유도체에 연결된 말단 뉴클레오타이드와 같은 하나 이상의 변형된 뉴클레오타이드를 포함할 수 있다. 또는, 변형된 뉴클레오타이드는 2'-데옥시-2'-플루오로 변형된 뉴클레오타이드, 2'-데옥시-변형된 뉴클레오타이드, 고정된(locked) 뉴클레오타이드, 무염 기(abasic) 뉴클레오타이드, 2'-아미노-변형된 뉴클레오타이드, 2'-알킬-변형된 뉴클레오타이드, 모르폴리노 뉴클레오타이드, 포스포르아미데이트 및 비-천연 염기 포함 뉴클레오타이드의 그룹으로부터 선택될 수 있다. 일반적으로, 이러한 변형된 서열은 표 1 내지 3의 센스 서열로 이루어진 그룹으로부터 선택된 상기 dsRNA의 제1 서열 및 표 1 내지 3의 안티센스 서열로 이루어진 그룹으로부터 선택된 제2 서열에 기초할 것이다.
다른 양태에서, 본 발명은 본 발명의 dsRNA 중 하나를 포함하는 세포를 제공한다. 당해 세포는 일반적으로 사람 세포와 같은 포유동물 세포이다.
다른 양태에서, 본 발명은 본 발명의 하나 이상의 dsRNA 및 약제학적으로 허용되는 담체 또는 전달 비히클을 포함하는, 유기체, 일반적으로 사람 피험자에서 Eg5 유전자의 발현을 억제하기 위한 약제학적 조성물을 제공한다.
다른 양태에서, 본 발명은
(a) 서로 상보적인 2개 이상의 서열을 포함하는 이본쇄 리보핵산(dsRNA)을 세포 속으로 도입시키는 단계 [여기서, 상기 dsRNA는 제1 서열을 포함하는 센스 쇄 및 제2 서열을 포함하는 안티센스 쇄를 포함한다. 상기 안티센스 쇄는 Eg5를 암호화하는 mRNA의 적어도 한 부분에 대해 실질적으로 상보적인 상보성 영역을 포함하고, 상기 상보성 영역의 길이는 30개 뉴클레오타이드 미만, 일반적으로 19 내지 24개의 뉴클레오타이드이며, 상기 dsRNA를 Eg5를 발현하는 세포와 접촉시키면 Eg5 유전자의 발현이 40% 이상 억제된다]; 및
(b) 단계 (a)에서 생성된 세포를 Eg5 유전자의 mRNA 전사체가 분해되는데 충 분한 시간 동안 유지시켜, 세포 내에서 Eg5 유전자의 발현을 억제하는 단계를 포함하여,
세포 내에서 Eg5 유전자의 발현을 억제하는 방법을 제공한다.
다른 양태에서, 본 발명은 Eg5 발현에 의해 매개되는 병리학적 과정의 치료, 예방 또는 관리를 필요로 하는 환자에게 본 발명의 하나 이상의 dsRNA의 치료학적 또는 예방학적 유효량을 투여함을 포함하여, Eg5 발현에 의해 매개되는 병리학적 과정, 예를 들면, 암을 치료하거나, 예방하거나, 관리하는 방법을 제공한다.
다른 양태에서, 본 발명은 본 발명의 하나의 dsRNA의 하나 이상의 쇄를 암호화하는 뉴클레오타이드 서열에 작동가능하게 연결된 조절 서열을 포함하는, 세포 내에서 Eg5 유전자의 발현을 억제하기 위한 벡터를 제공한다.
다른 양태에서, 본 발명은 세포 내에서 Eg5 유전자의 발현을 억제하기 위한 벡터를 포함하는 세포를 제공한다. 당해 벡터는 본 발명의 하나의 dsRNA의 하나 이상의 쇄를 암호화하는 뉴클레오타이드 서열에 작동가능하게 연결된 조절 서열을 포함한다.
추가의 양태에서, 본 발명은 Eg5 dsRNA, 및 VEGF mRNA를 표적화하는 제2의 dsRNA와 함께 사용되는 상기 Eg5 dsRNA의 상기한 바와 같은 용도를 제공한다. Eg5를 표적화하는 dsRNA 및 VEGF를 표적화하는 제2의 dsRNA의 배합물은 과증식성 질환, 특히 간암종을 치료하기 위한 상보적이고 상승적인 활성을 제공한다.
본 발명은 이본쇄 리보핵산(dsRNA), 및 상기 dsRNA를 사용하여 세포 또는 포유동물에서 Eg5 유전자의 발현을 억제하는 조성물 및 방법을 제공한다. 본 발명은 또한 dsRNA를 사용하여 Eg5 유전자의 발현에 의해 발생하는 포유동물에서의 병리학적 상태 및 질병을 치료하기 위한 조성물 및 방법을 제공한다. dsRNA는 RNA 간섭(RNAi)으로 공지진 과정을 통해 mRNA의 서열-특이적 분해를 지시한다. 본 발명은 또한 상기 dsRNA와 함께 VEGF 유전자의 발현을 억제하는 제2의 dsRNA를 제공한다.
본 발명의 dsRNA는, 길이가 30개 뉴클레오타이드 미만, 일반적으로 19 내지 24개 뉴클레오타이드이고 Eg5 유전자의 mRNA 전사체의 적어도 일부에 대해 실질적으로 상보적인 영역을 갖는 RNA 쇄(안티센스 쇄)를 포함한다. 이러한 dsRNA의 사용은 포유동물에서 복제 및/또는 암 세포의 유지에 관여된 유전자의 mRNA의 표적화된 분해를 가능하게 한다. 세포-기반 검정 및 동물 검정을 사용하여, 본 발명자들은 매우 낮은 용량의 이러한 dsRNA가 RNAi를 특이적으로 그리고 효율적으로 매개함으로써 Eg5 유전자의 발현을 상당히 억제할 수 있음을 입증하였다. 따라서, 이러한 dsRNA를 포함하는 본 발명의 방법 및 조성물은 유사분열에 관련된 유전자를 표적화함으로써, Eg5 발현에 의해 매개되는 병리학적 과정, 예를 들면, 암을 치료하는데 유용하다.
다음의 상세한 설명은 Eg5 유전자의 발현을 억제시키기 위한 dsRNA 및 dsRNA를 함유하는 조성물의 제조 및 사용 방법, 및 단독으로 또는 VEGF 유전자를 표적화하는 제2의 dsRNA와 함께 사용되어, 암과 같이 Eg5의 발현에 의해 발생하는 질병 및 질환을 치료하기 위한 조성물 및 방법을 기술한다. 본 발명의 약제학적 조성물은, 길이가 30개 뉴클레오타이드 미만, 일반적으로 19 내지 24개의 뉴클레오타이드이고 Eg5 유전자의 RNA 전사체의 적어도 일부에 대해 실질적으로 상보적인 상보성 영역을 포함하는 안티센스 쇄를 갖는 dsRNA와 함께, 약제학적으로 허용되는 담체를 포함한다. 앞서 논의한 바와 같이, 이러한 조성물은 VEGF를 표적화하는 제2의 dsRNA를 추가로 포함할 수 있다.
따라서, 본 발명의 특정 양상은 본 발명의 dsRNA와 함께 약제학적으로 허용되는 담체를 포함하는 약제학적 조성물, Eg5 유전자의 발현을 억제하기 위하여 상기 조성물을 사용하는 방법, 및 Eg5 유전자의 발현에 의해 발생하는 질병을 치료하기 위하여 상기 약제학적 조성물을 사용하는 방법을 제공한다. 본 발명은 또한 VEGF의 발현을 억제하도록 설계된 제2의 dsRNA를 추가로 함유하는 상기 약제학적 조성물을 제공한다.
I. 정의
편의상, 명세서, 실시예 및 첨부된 청구항에서 사용된 특정 용어 및 어구에 대한 의미를 아래에 제공한다. 본 명세서의 다른 부분에서의 용어의 사용과 당해 단락에서 제공된 용어의 정의 사이에 분명한 불일치가 있는 경우, 당해 단락의 정의가 우선할 것이다.
"G", "C", "A" 및 "U"는 각각 일반적으로 염기로서 구아닌, 시토신, 아데닌 및 우라실을 각각 함유하는 뉴클레오타이드를 나타낸다. 그러나, 용어 "리보뉴클레오타이드" 또는 "뉴클레오타이드"는 아래에서 상세히 기술한 바와 같은 변형된 뉴클레오타이드 또는 대체(surrogate) 치환 잔기를 말할 수도 있다는 것이 이해될 것이다. 당업자는 구아닌, 시토신, 아데닌 및 우라실을 다른 잔기로 치환시키는 경우, 이러한 치환 잔기를 갖는 뉴클레오타이드를 포함하는 올리고뉴클레오타이드의 염기쌍 형성 특성은 실질적으로 변화되지 않으면서 치환될 수 있다는 것을 잘 알고 있다. 예를 들면, 이노신을 염기로서 포함하는 뉴클레오타이드는 아데닌, 시토신 또는 우라실을 함유하는 뉴클레오타이드와 염기쌍을 형성할 수 있지만, 이에 제한되는 것은 아니다. 따라서, 우라실, 구아닌 또는 아데닌을 함유하는 뉴클레오타이드는, 예를 들면, 이노신을 함유하는 뉴클레오타이드에 의해 본 발명의 뉴클레오타이드 서열 내에서 치환될 수 있다. 이러한 치환 잔기를 포함하는 서열은 본 발명의 양태이다.
본원에 사용되는 "Eg5"는 사람 키네신 계열 일원 11을 말하며, 이는 KIF11, Eg5, HKSP, KNSL1 또는 TRIP5로도 공지되어 있다. Eg5 서열은 NCBI 유전자확인번호: 3832, HGNC 확인번호: HGNC:6388 및 RefSeq 확인번호: NM-004523으로 찾을 수 있다.
본원에 사용되는 "표적 서열"은 1차 전사 생성물의 RNA 프로세싱의 생성물인 mRNA를 포함하는, Eg5 유전자의 전사 동안 형성된 mRNA 분자의 뉴클레오타이드 서열의 연속된 부분을 말한다.
본원에 사용되는 VEGF는 혈관 투과성 인자로도 공지되어 있으며, 이는 혈관신생 성장 인자이다. VEGF는 3개 이상의 상이한 동종형(isoform)으로 존재하는 동종이량체성(homodimeric) 45kDa 당단백질이다. VEGF 동종형은 내피 세포에서 발현된다. VEGF 유전자는 189-아미노산 단백질 동종형을 발현하는 8개의 엑손(exon)을 함유한다. 165-아미노산 동종형은 엑손 6에 의해 암호화된 잔기가 결여된 반면에, 121-아미노산 동종형은 엑손 6 및 7에 의해 암호화된 잔기가 결여되어 있다. VEGF145는 145개 아미노산을 함유하며 엑손 7이 결여된 것으로 예측되는 동종형이다. VEGF는 Flt-1(VEGFR-1) 또는 KDR/flk-1 (VEGFR-2)와 같은 내피 티로신 키나제 수용체에 결합함으로써 내피 세포 상에서 작용할 수 있다. VEGFR-2는 내피 세포에서 발현되며 내피 세포 분화 및 혈관형성에 관여되어 있다. 제3 수용체, VEGFR-3은 림프형성에 관련되어 있다.
각종 동종형은 상이한 생물학적 활성 및 임상 관련성을 갖는다. 예를 들어, VEGF145는 혈관신생을 유도하며 VEGF189와 같이(그러나 VEGF165와는 달리) VEGF145는 세포외 매트릭스-관련 헤파린 설페이트에 비-의존적인 기전에 의해 세포외 매트릭스에 효율적으로 결합한다. VEGF는 시험관내에서 내피 세포 유사분열물질(mitogen) 및 화학유인물질로서의 활성을 나타내며 생체내에서 혈관 투과성 및 혈관신생을 유도한다. VEGF는 매우 다양한 암 세포 종류에 의해 분비되며 종양-관련 혈관구조의 발생을 유도함으로써 종양의 성장을 촉진시킨다. VEGF 기능의 억제는 원발성 실험 종양의 성장 및 면역손상된(immunocompromised) 마우스에서의 전이의 발생 둘 모두를 제한하는 것으로 밝혀졌다. VEGF에 대해 지시된 각종 dsRNA는 본원에서 참조로 인용된 공동-계류중인 미국 특허원 제11/078,073호 및 제11/340,080호에 기술되어 있다.
본원에 사용되는 용어 "서열을 포함하는 쇄"는 표준 뉴클레오타이드 명명법을 사용하여 언급된 서열에 의해 기술되는 뉴클레오타이드의 쇄를 포함하는 올리고뉴클레오타이드를 말한다.
본원에 사용되는 용어 "상보적인"은, 다른 언급이 없는 한, 제2 뉴클레오타이드 서열과 관련하여 제1 뉴클레오타이드 서열을 기술하는데 사용되는 경우, 당업자가 이해하는 바와 같이, 특정 조건 하에서 제2 뉴클레오타이드 서열을 포함하는 올리고뉴클레오타이드 또는 폴리뉴클레오타이드와 하이브리드화하여 듀플렉스(duplex) 구조를 형성하는 제1 뉴클레오타이드 서열을 포함하는 올리고뉴클레오타이드 또는 폴리뉴클레오타이드의 능력을 말한다. 이러한 조건은, 예를 들면, 엄중한(stringent) 조건일 수 있으며, 여기서 엄중한 조건은 400 mM NaCl 40 mM PIPES pH 6.4, 1 mM EDTA, 50℃ 또는 70℃에서 12 내지 16시간 후 세척을 포함할 수 있다. 유기체 내부에서 직면할 수 있는 생리학적 관련 조건과 같은 다른 조건도 적용할 수 있다. 당업자는 하이브리드화된 뉴클레오타이드의 궁극적인 적용에 따라 2개의 서열의 상보성 시험에 가장 적절한 조건의 집합을 결정할 수 있을 것이다.
여기에는 제1 뉴클레오타이드 서열을 포함하는 올리고뉴클레오타이드 또는 폴리뉴클레오타이드가 제2 뉴클레오타이드 서열을 포함하는 올리고뉴클레오타이드 또는 폴리뉴클레오타이드에 대해 제1 및 제2 뉴클레오타이드 서열의 전체 길이에 걸쳐 염기쌍을 형성하는 것이 포함된다. 이러한 서열은 본원에서 서로 "완전히 상보적인"으로 언급될 수 있다. 그러나, 제1 서열이 본원에서 제2 서열과 관련하여 "실질적으로 상보적인"으로 언급되는 경우, 2개의 서열은 완전히 상보적이거나, 또는 이들의 궁극적인 적용과 가장 관련된 조건 하에서 하이브리드화하는 능력을 유지하면서, 하이브리드화시 하나 이상, 그러나 일반적으로 4, 3 또는 2개 이하의 미스매치된(mismatched) 염기쌍을 형성할 수 있다. 그러나, 2개의 올리고뉴클레오타이드가 하이브리드화시, 하나 이상의 일본 쇄의 오버행(overhang)을 형성하도록 설계된 경우, 이러한 오버행은 상보성 결정과 관련하여 미스매치로서 고려되지 않을 것이다. 예를 들어, 길이가 21개 뉴클레오타이드인 하나의 올리고뉴클레오타이드 및 길이가 23개 뉴클레오타이드인 다른 올리고뉴클레오타이드를 포함하는 dsRNA(이때, 긴 올리고뉴클레오티드는 짧은 올리고뉴클레오타이드에 대해 완전히 상보적인 21개 뉴클레오타이드의 서열을 포함한다)는 본 발명의 목적상 여전히 "완전히 상보적인"으로 언급될 수 있다.
본원에 사용되는 "상보적인" 서열은, 하이브리드화하는 이들의 능력과 관련하여 상기 요구 조건이 충족되는 한, 비-왓슨-크릭(non-Watson-Crick) 염기쌍 및/또는 비-천연 및 변형된 뉴클레오타이드로부터 형성된 염기쌍을 포함할 수 있거나, 또는 전체가 이러한 염기쌍으로부터 형성될 수 있다.
본원에서 용어 "상보적인", "완전히 상보적인" 및 "실질적으로 상보적인"은 이들이 사용되는 문맥에서 이해되는 바와 같이, dsRNA의 센스 쇄와 안티센스 쇄 사이, 또는 dsRNA의 안티센스 쇄와 표적 서열 사이에서의 염기 미스매칭과 관련하여 사용될 수 있다.
본원에 사용되는 전령 RNA(mRNA)의 "적어도 일부에 대해 실질적으로 상보적인" 폴리뉴클레오타이드는 목적한 mRNA의 연속적인 부분(예: Eg5 암호화 부분)에 대해 실질적으로 상보적인 폴리뉴클레오타이드를 말한다. 예를 들어, Eg5를 암호화하는 mRNA의 비-개입된(non-interrupted) 부분에 대해 서열이 실질적으로 상보적이면, 폴리뉴클레오타이드는 Eg5 mRNA의 적어도 일부에 대해 상보적인 것이다.
본원에 사용되는 용어 "이본쇄 RNA" 또는 "dsRNA"는 앞서 정의한 바와 같이, 역평행하고 실질적으로 상보적인 2개의 핵산 쇄를 포함하는 듀플렉스 구조를 갖는 리보핵산 분자의 복합체를 말한다. 듀플렉스 구조를 형성하는 2개의 쇄는 하나의 보다 큰 RNA 분자의 상이한 부분일 수 있거나, 별개의 RNA 분자일 수 있다. 2개의 쇄가 하나의 보다 큰 분자의 일부이고, 이에 따라, 듀플렉스 구조를 형성하는 하나의 쇄의 3'-말단과 각각의 다른 쇄의 5' 말단 사이에서 뉴클레오타이드의 비-개입된 쇄에 의해 연결되는 경우, 이러한 연결하는 RNA 쇄를 "헤어핀 루프(hairpin loop)"라고 한다. 2개의 쇄가 듀플렉스 구조를 형성하는 하나의 쇄의 3'-말단과 각각의 다른 쇄의 5' 말단 사이에서 뉴클레오타이드의 비-개입된 쇄 이외의 수단에 의해 공유결합된 경우, 이러한 연결하는 구조를 "링커(linker)"라고 한다. RNA 쇄는 동일하거나 또는 상이한 수의 뉴클레오타이드를 가질 수 있다. 염기쌍의 최대 수는 (dsRNA의 가장 짧은 쇄의 뉴클레오타이드의 수)에서 (듀플렉스에 존재하는 임의의 오버행)을 뺀 수이다. 듀플렉스 구조 외에도, dsRNA는 하나 이상의 뉴클레오타이드 오버행을 포함할 수 있다.
본원에 사용되는 "뉴클레오타이드 오버행"은 dsRNA의 하나의 쇄의 3'-말단이 다른 쇄의 5'-말단 이상으로 연장되거나, 또는 그 반대인 경우, dsRNA의 듀플렉스 구조로부터 돌출되어 쌍을 이루지 못한 뉴클레오타이드(들)를 말한다. "평활" 또는 "평활 말단"은, dsRNA의 말단에 쌍을 이루지 못한 뉴클레오타이드, 예를 들면, 뉴클레오타이드 오버행이 없음을 의미한다. "평활말단화된" dsRNA는 전체 길이에 걸쳐 이본쇄를 형성한 dsRNA, 즉 분자의 두 말단에 모두 뉴클레오타이드 오버행이 없는 dsRNA이다.
용어 "안티센스 쇄"는 표적 서열에 대해 실질적으로 상보적인 영역을 포함하는 dsRNA의 쇄를 말한다. 본원에 사용되는 용어 "상보성 영역"은 본원에서 정의한 바와 같이, 서열, 예를 들면, 표적 서열에 대해 실질적으로 상보적인 안티센스 쇄 상의 영역을 말한다. 상보성 영역이 표적 서열에 대해 완전히 상보적이지 않은 경우, 미스매치는 말단 영역에서 가장 허용되며, 존재하는 경우에는, 일반적으로 말단 영역(들), 예를 들면, 5' 및/또는 3' 말단의 6, 5, 4, 3 또는 2개의 뉴클레오타이드 이내에 존재한다.
본원에 사용되는 용어 "센스 쇄"는 안티센스 쇄의 영역에 대해 실질적으로 상보적인 영역을 포함하는 dsRNA의 쇄를 말한다.
dsRNA를 말하는 경우에 "세포 속으로 도입하는"은 당업자가 이해하는 바와 같이, 세포 속으로의 섭취 또는 흡수를 용이하게 함을 의미한다. dsRNA의 흡수 또는 섭취는 자발적인 확산 또는 능동적인 세포 과정을 통해, 또는 보조제 또는 장치에 의해 일어날 수 있다. 당해 용어의 의미는 시험관내의 세포에 한정되지 않으며, dsRNA는 또한 "세포 속으로 도입"될 수 있는데, 여기서 세포는 살아있는 유기체의 일부이다. 이러한 경우, 세포 속으로의 도입은 유기체로의 전달을 포함할 것이다. 예를 들어, 생체내 전달의 경우, dsRNA는 조직 부위 속으로 주사되거나 또는 전신적으로 투여될 수 있다. 세포 속으로의 시험관내 도입에는 전기천공(electroporation) 및 리포펙션과 같이 당업계에 공지된 방법이 포함된다.
용어 "사일런스(silence)" 및 "~의 발현을 억제"는 Eg5 유전자를 언급하는 한 본원에서는, 제1 세포 또는 세포의 그룹과 실질적으로 동일하지만 Eg5 유전자의 발현이 억제되도록 처리되지 않은 제2 세포(대조군 세포) 또는 세포의 그룹과 비교하여, Eg5 유전자가 전사되고 Eg5 유전자의 발현이 억제되도록 처리된 제1 세포 또는 세포의 그룹으로부터 분리될 수 있는 Eg5 유전자로부터 전사된 mRNA의 양의 감소에 의해 나타나는 바와 같이, Eg5 유전자의 발현의 적어도 부분적인 억제를 말한다. 억제 정도는 일반적으로 다음의 식으로 표현된다.
또는, 억제 정도는 Eg5 유전자 전사에 기능적으로 연결된 매개변수, 예를 들면, 세포에 의해 분비된 Eg5 유전자에 의해 암호화된 단백질의 양, 또는 특정 표현형, 예를 들면, 아폽토시스를 나타내는 세포의 수의 감소로 표현될 수 있다. 원칙적으로, Eg5 유전자 사일런싱은 구성적으로 또는 게놈 조작에 의해 표적을 발현하는 임의의 세포 내에서, 그리고 임의의 적절한 검정에 의해서 측정될 수 있다. 그러나, 제공된 dsRNA가 Eg5 유전자의 발현을 특정 정도로 억제하여 본 발명에 포함되는지를 측정하기 위하여 참조가 요구되는 경우, 하기 실시예에 제공된 검정이 이러한 참조로서 역할을 할 것이다.
예를 들어, 특정 예에서, Eg5 유전자(또는 VEGF 유전자)의 발현은 본 발명의 이본쇄 올리고뉴클레오타이드의 투여에 의해 약 20%, 25%, 35% 또는 50% 이상 억제된다. 일부 양태에서, Eg5 유전자는 본 발명의 이본쇄 올리고뉴클레오타이드의 투여에 의해 약 60%, 70% 또는 80% 이상 억제된다. 일부 양태에서, Eg5 유전자는 본 발명의 이본쇄 올리고뉴클레오타이드의 투여에 의해 약 85%, 90% 또는 95% 이상 억제된다. 표 1 내지 3은 각종 농도에서 각종 Eg5 dsRNA를 사용한 발현의 억제에 대한 값을 제공한다.
Eg5 발현과 관련하여 본원에 사용되는 용어 "치료하다", "치료" 등은 Eg5 발현에 의해 매개되는 병리학적 과정으로부터의 경감 또는 이의 완화를 말한다. 본 발명과 관련하여 본원에서 아래에 인용된 다른 상태들(Eg5 발현에 의해 매개되는 병리학적 과정 제외) 중 어느 것과 관련되는 한, 용어 "치료하다", "치료" 등은 이러한 상태와 관련된 하나 이상의 증상의 경감 또는 완화시키거나, 간 암종의 지연 및 진행과 같은 이러한 상태의 진행을 지연시키거나 역행시키는 것을 의미한다.
본원에서 사용되는 "치료학적 유효량" 및 "예방학적 유효량"이라는 말은 Eg5 발현에 의해 매개되는 병리학적 과정 또는 Eg5 발현에 의해(단독으로 또는 VEGF 발현과 함께) 매개되는 병리학적 과정의 명백한 증상의 치료, 예방 또는 관리에 있어서 치료학적 이점을 제공하는 양을 말한다. 치료학적으로 유효한 특정 양은 통상의 의학 전문의에 의해 용이하게 결정될 수 있고, 예를 들면, Eg5 발현에 의해 매개되는 병리학적 과정의 유형, 환자의 병력 및 연령, Eg5 발현에 의해 매개되는 병리학적 과정의 단계 및 Eg5 발현에 의해 매개되는 다른 항-병리학적 과정 제제의 투여와 같은 당업계에 공지된 요인에 따라 달라질 수 있다.
본원에 사용되는 "약제학적 조성물"은 약리학적 유효량의 dsRNA 및 약제학적으로 허용되는 담체를 포함한다. 본원에 사용되는 "약리학적 유효량", "치료학적 유효량" 또는 간단히 "유효량"은 의도하는 약리학적, 치료학적 또는 예방학적 결과를 달성하는데 유효한 RNA의 양을 말한다. 예를 들어, 질병 또는 질환과 관련된 측정가능한 매개변수가 25% 이상 감소되면 제공된 임상 치료를 유효한 것으로 간주할 때, 질병 또는 질환을 치료하기 위한 약물의 치료학적 유효량은 상기 매개변수의 25% 이상의 감소를 달성하는데 필요한 양이다.
용어 "약제학적으로 허용되는 담체"는 치료제의 투여를 위한 담체를 말한다. 이러한 담체에는 염수, 완충 염수, 덱스트로스, 물, 글리세롤, 에탄올 및 이들의 배합물이 포함되지만, 이에 제한되는 것은 아니다. 당해 용어에서 특별히 세포 배양 배지는 제외된다. 경구 투여되는 약물의 경우, 약제학적으로 허용되는 담체에는 약제학적으로 허용되는 부형제, 예를 들면 불활성 희석제, 붕해제, 결합제, 윤활제, 감미제, 풍미제, 착색제 및 보존제가 포함되지만, 이에 제한되는 것은 아니다. 적당한 불활성 희석제에는 탄산나트륨 및 탄산칼슘, 인산나트륨 및 인산칼슘, 및 락토스가 포함되는 반면에, 옥수수 전분 및 알긴산은 적당한 붕해제이다. 결합제에는 전분 및 젤라틴이 포함할 수 있는 반면에, 윤활제는, 존재하는 경우, 일반적으로 마그네슘 스테아레이트, 스테아르산 또는 활석(talc)일 것이다. 경우에 따라, 정제는 위장관에서의 흡수를 지연시키기 위하여, 글리세릴 모노스테아레이트 또는 글리세릴 디스테아레이트와 같은 물질로 피복할 수 있다.
본원에 사용되는 "형질전환된 세포"는 dsRNA 분자가 발현될 수 있도록 벡터가 도입된 세포이다.
II
.
이본쇄
리보핵산(
dsRNA
)
하나의 양태에서, 본 발명은 세포 또는 포유동물에서 (단독으로 또는 VEGF의 발현을 억제하기 위한 제2의 dsRNA과 함께) Eg5 유전자의 발현을 억제하기 위한 이본쇄 리보핵산(dsRNA) 분자를 제공하며, 여기서 daRNA는 Eg5 유전자의 발현시 형성된 mRNA의 적어도 일부에 대해 상보적인 상보성 영역을 포함하는 안티센스 쇄를 포함하며, 여기서 상보성 영역은 일반적으로 길이가 30개 뉴클레오타이드 미만, 일반적으로 길이가 19 내지 24개 뉴클레오타이드이고, 여기서 상기 dsRNA를 상기 Eg5 유전자를 발현하는 세포와 접촉시키면 상기 Eg5 유전자의 발현이 40% 이상 억제된다. dsRNA는 하이브리드화되어서 듀플렉스 구조를 형성하기에 충분히 상보적인 2개의 RNA 쇄를 포함한다. dsRNA의 하나의 쇄(안티센스 쇄)는 Eg5 유전자의 발현 동안 형성된 mRNA의 서열로부터 유래된 표적 서열에 대해 실질적으로 상보적이며, 일반적으로 완전히 상보적인 영역을 포함하고, 다른 쇄(센스 쇄)는 안티센스 쇄에 대해 상보적인 영역을 포함함으로써, 2개의 쇄는 적당한 조건 하에서 배합되는 경우 하이브리드화되어 듀플렉스 구조를 형성한다. 일반적으로, 듀플렉스 구조는 길이가 15 내지 30개, 보다 일반적으로 18 내지 25개, 보다 더 일반적으로 19 내지 24개, 가장 일반적으로 19 내지 21개 염기쌍이다. 유사하게, 표적 서열에 대한 상보성 영역은 길이가 15 내지 30, 보다 일반적으로 18 내지 25, 보다 더 일반적으로 19 내지 24, 가장 일반적으로 19 내지 21개 뉴클레오타이드이다. 본 발명의 dsRNA는 하나 이상의 일본쇄 뉴클레오타이드 오버행(들)을 추가로 포함할 수 있다. dsRNA는 아래에 추가로 논의된 바와 같이 당업계에 공지된 표준 방법에 의해, 예를 들면, 바이오서치(Biosearch), 어플라이드 바이오시스템스, 인코포레이티드(Applied Biosystems, Inc.)사로부터 시판되는 것과 같은 자동화된 DNA 합성기의 사용에 의해 합성할 수 있다. 바람직한 양태에서, Eg5 유전자는 사람 Eg5 유전자이다. 특정 양태에서, dsRNA의 안티센스 쇄는 표 1 내지 3의 센스 서열을 포함하며, 제2 서열은 표 1 내지 3의 안티센스 서열로 이루어진 그룹으로부터 선택된다. 표 1 내지 3에 제공된 표적 서열에서 다른 부분을 표적화하는 다른 안티센스제는 표적 서열 및 플랭킹(flanking) Eg5 서열을 사용하여 용이하게 결정할 수 있다. VEGF를 표적화하는 제2의 dsRNA를 사용하는 양태에서, 이러한 제제는 실시예 및 본원에 참조로서 인용된 공동-계류중인 미국 특허원 제11/078,073호 및 제11/340,080호에 예시되어 있다.
dsRNA는 표 1 내지 3에 제공된 서열의 그룹으로부터 선택된 2개 이상의 뉴클레오타이드 서열을 포함할 것이다. 2개의 서열 중 하나는 2개의 서열 중 다른 하나에 대해 상보적이며, 서열 중 하나는 Eg5 유전자의 발현시 생성된 mRNA의 서열에 대해 실질적으로 상보적이다. 이와 같이, dsRNA는 2개의 올리고뉴클레오타이드를 포함할 것이며, 여기서 하나의 올리고뉴클레오타이드는 표 1 내지 3에 센스 쇄로 기술되어 있고 제2 올리고뉴클레오타이드는 표 1 내지 3에 안티센스 쇄로 기술되어 있다.
당업자는 20 내지 23번, 그러나 특히 21번 염기쌍의 듀플렉스 구조를 포함하는 dsRNA가 RNA 간섭을 유도하는데 특히 효과적인 것으로서 논의되었음을 잘 알고 있다[참조: Elbashir et al, EMBO 2001, 20:6877-6888). 그러나, 다른 당업자는 더 짧거나 더 긴 dsRNA도 효과적일 수 있음을 밝혀내었다. 앞서 기술한 양태에서, 표 1 내지 3에 제공된 올리고뉴클레오타이드 서열의 특성으로 인하여, 본 발명의 dsRNA는 길이가 최소 21nt인 하나 이상의 쇄를 포함할 수 있다. 표 1 내지 3의 서열 중 하나를 포함하는 더 짧은 dsRNA에서 하나 또는 두 말단의 단지 몇 개의 뉴클레오티드만을 뺀 것이 앞서 기술한 dsRNA와 비교하여 유사하게 효과적일 수 있음은 충분히 예상할 수 있다. 따라서, 표 1 내지 3의 서열 중 하나로부터의 15, 16, 17, 18, 19, 20개 이상의 연속된 뉴클레오타이드의 부분 서열을 포함하고 본원에서 아래에 기술된 바와 같이 FACS 검정에서 Eg5 유전자의 발현을 억제하는 능력이 전체 서열을 포함하는 dsRNA와 5, 10, 15, 20, 25 또는 30% 이하의 억제로 상이한 dsRNA가 본 발명에서 고려된다. 또한, 표 1 내지 3에 제공된 표적 서열 내에서 절단시키는 dsRNA는 제공된 표적 서열 및 Eg5 서열을 사용하여 용이하게 제조할 수 있다.
또한, 표 1 내지 3에 제공된 RNAi 제제는 RNAi에 의한 절단에 민감한 Eg5 mRNA 내의 부위를 확인한다. 이와 같이, 본 발명은 본 발명의 제제 중 하나에 의해 표적화된 서열 내에서 표적화하는 RNAi 제제를 추가로 포함한다. 본원에 사용되는 제2 RNAi 제제는, 당해 제2 RNAi 제제가 제1 RNAi 제제의 안티센스 쇄에 대해 상보적인 mRNA 내에서 어디에서든지 전령을 절단하는 경우, 제1 RNAi 제제의 서열 내에서 표적화한다고 말한다. 이러한 제2 제제는 일반적으로 Eg5 유전자 내에서 선택된 서열에 연속적인 영역으로부터 취해진 추가의 뉴클레오타이드 서열에 연결된 표 1 내지 3에서 제공된 서열 중 하나로부터의 15개 이상의 연속된 뉴클레오타이드로 일반적으로 이루어질 것이다. 예를 들어, 표적 Eg5 유전자로부터 다음 6개의 뉴클레오타이드와 결합된 서열번호 1의 마지막 15개 뉴클레오타이드는 표 1 내지 3에 제공된 서열 중 하나를 기본으로 하는 21개 뉴클레오타이드의 일본쇄 제제를 생성한다.
본 발명의 dsRNA는 표적 서열에 대해 하나 이상의 미스매치를 함유할 수 있다. 바람직한 양태에서, 본 발명의 dsRNA는 3개 이하의 미스매치를 함유한다. dsRNA의 안티센스 쇄가 표적 서열에 대해 미스매치를 함유하는 경우, 미스매치 영역은 상보성 영역의 중심에 위치하지 않는 것이 바람직하다. dsRNA의 안티센스 쇄가 표적 서열에 대해 미스매치를 함유하는 경우, 미스매치는 한쪽 말단으로부터 5개의 뉴클레오타이드, 예를 들면, 상보성 영역의 5' 또는 3' 말단으로부터 5, 4, 3, 2, 또는 1개의 뉴클레오타이드로 한정되는 것이 바람직하다. 예를 들어, Eg5 유전자의 영역에 대해 상보적인 23개 뉴클레오타이드 dsRNA 쇄의 경우, dsRNA는 일반적으로 중심의 13개 뉴클레오타이드 내에 어떠한 미스매치도 함유하지 않는다. 본 발명 내에서 기술된 방법은 표적 서열에 대해 미스매치를 함유하는 dsRNA가 Eg5 유전자의 발현을 억제하는데 효과적인지를 측정하는데 사용될 수 있다. Eg5 유전자의 발현을 억제하는데 있어서 미스매치를 갖는 dsRNA의 효능의 고려는, 특히, Eg5 유전자 내의 특정한 상보성 영역이 집단 내에서 다형성(polymorphic) 서열 변이를 갖는 것으로 알려진 경우에 중요하다.
하나의 양태에서, dsRNA의 하나 이상의 말단은 1 내지 4개, 일반적으로 1 또는 2개의 뉴클레오타이드의 일본쇄 뉴클레오타이드 오버행을 갖는다. 하나 이상의 뉴클레오타이드 오버행을 갖는 dsRNA는 이들의 평활말단화된 대응물보다 예상치못한 우수한 억제 특성을 갖는다. 또한, 본 발명자들은 단지 하나의 뉴클레오타이드 오버행의 존재가 이의 전체 안정성에 영향을 미치지 않으면서 dsRNA의 간섭 활성을 강화시킴을 발견하였다. 단지 하나의 오버행을 갖는 dsRNA는 생체내에서, 및 다양한 세포, 세포 배양 배지, 혈액 및 혈청에서 특히 안정하고 효과적인 것으로 입증되었다. 일반적으로, 일본쇄 오버행은 안티센스 쇄의 3'-말단에 위치하거나, 또는 센스 쇄의 3'-말단에 위치한다. dsRNA는 평활 말단을 가질 수도 있으며, 일반적으로 안티센스 쇄의 5'-말단에 위치한다. 이러한 dsRNA는 안정성 및 억제 활성이 개선되어 있으므로, 낮은 용량, 즉 하루에 수용자의 체중kg당 1mg 미만의 투여가 가능하다. 일반적으로, dsRNA의 안티센스 쇄는 3'-말단에서 뉴클레오타이드 오버행을 갖고, 5'-말단이 평활 말단이다. 다른 양태에서, 오버행 내의 하나 이상의 뉴클레오타이드를 뉴클레오사이드 티오포스페이트로 치환한다.
또 다른 양태에서, dsRNA를 화학적으로 변형시켜 안정성을 향상시킨다. 본 발명의 핵산은 본원에 참조로서 인용된 문헌[참조: "Current protocols in nucleic acid chemistry", Beaucage, S.L. et al. (Edrs.), John Wiley & Sons, Inc., New York, NY, USA]에 기술된 것과 같이 당업계에 익히 확립된 방법에 의해 합성하고/하거나 변형시킬 수 있다. 본 발명에 유용한 바람직한 dsRNA 화합물의 구체적인 예에는 변형된 골격을 함유하거나 천연의 뉴클레오사이드간 연결이 없는 dsRNA가 포함된다. 본 명세서에서 정의한 바와 같이, 변형된 골격을 갖는 dsRNA에는 골격 내에 인 원자를 보유하는 것들과 골격 내에 인 원자를 갖지 않는 것들이 포함된다. 본 명세서의 목적상, 그리고 당업계에서 종종 언급되는 바와 같이, 뉴클레오사이드 골격 내에 인 원자를 갖지 않는 변형된 dsRNA도 올리고뉴클레오사이드인 것으로 고려될 수 있다.
바람직한 변형된 dsRNA 골격에는, 예를 들면, 포스포로티오에이트, 키랄성 포스포로티오에이트, 포스포로디티오에이트, 포스포트리에스테르, 아미노알킬포스포트리에스테르, 3'-알킬렌 포스포네이트 및 키랄성 포스포네이트를 포함하는 메틸 및 기타 알킬 포스포네이트, 포스피네이트, 3'-아미노 포스포르아미데이트 및 아미노알킬포스포르아미데이트를 포함하는 포스포르아미데이트, 티오노포스포르아미데이트, 티오노알킬포스포네이트, 티오노알킬포스포트리에스테르, 및 일반적인 3'-5' 연결, 이의 2'-5' 연결된 유사체 및 역위된 극성(여기서, 뉴클레오사이드 단위의 인접 쌍은 3'-5'에서 5'-3'으로 또는 2'-5'에서 5'-2'으로 연결된다)을 갖는 보라노포스페이트가 포함된다. 다양한 염, 혼합염 및 유리 산 형태도 포함된다.
상기 인-함유 연결의 제조방법을 설명하고 있는 대표적인 미국 특허에는 미국 특허 제3,687,808호; 제4,469,863호; 제4,476,301호; 제5,023,243호; 제5,177,195호; 제5,188,897호; 제5,264,423호; 제5,276,019호; 제5,278,302호; 제5,286,717호; 제5,321,131호; 제5,399,676호; 제5,405,939호; 제5,453,496호; 제5,455,233호; 제5,466,677호; 제5,476,925호; 제5,519,126호; 제5,536,821호; 제5,541,316호; 제5,550,111호; 제5,563,253호; 제5,571,799호; 제5,587,361호 및 제5,625,050호가 포함되지만, 이에 제한되는 것은 아니며, 이들 문헌 각각은 본원에 참조로서 인용된다.
자체에 인 원자를 포함하지 않는 바람직한 변형된 dsRNA 골격은 단쇄 알킬 또는 사이클로알킬 뉴클레오사이드간 연결, 혼합된 이종원자 및 알킬 또는 사이클로알킬 뉴클레오사이드간 연결, 또는 하나 이상의 단쇄 이종원자 또는 헤테로사이클릭 뉴클레오사이드간 연결에 의해 형성된 골격을 갖는다. 여기에는 모르폴리노 연결(뉴클레오사이드의 당 부분으로부터 일부분 형성됨); 실록산 골격; 설파이드, 설폭사이드 및 설폰 골격, 포름아세틸 및 티오포름아세틸 골격; 메틸렌 포름아세틸 및 티오포름아세틸 골격; 알켄 함유 골격; 설파메이트 골격; 메틸렌이미노 및 메틸렌하이드라지노 골격; 설포네이트 및 설폰아미드 골격; 아미드 골격을 갖는 것; 및 혼합된 N, O, S 및 CH2 구성요소 일부를 갖는 것들이 포함된다.
상기 올리고뉴클레오사이드의 제조방법을 설명하고 있는 대표적인 미국 특허에는 미국특허 제5,034,506호; 제5,166,315호; 제5,185,444호; 제5,214,134호; 제5,216,141호; 제5,235,033호; 제5,64,562호; 제5,264,564호; 제5,405,938호; 제5,434,257호; 제5,466,677호; 제5,470,967호; 제5,489,677호; 제5,541,307호; 제5,561,225호; 제5,596,086호; 제5,602,240호; 제5,608,046호; 제5,610;289호; 제5,618,704호; 제5,623,070호; 제5,663,312호; 제5,633,360호; 제5,677,437호 및 제5,677,439호가 포함되지만, 이에 제한되는 것은 아니며, 이들 문헌 각각은 본원에 참조로서 인용된다.
다른 바람직한 dsRNA 모사체(mimetic)에 있어서, 뉴클레오타이드 단위의 당 및 뉴클레오사이드간 연결 둘 모두, 즉 골격이 신규 그룹으로 치환된다. 염기 단위는 적절한 핵산 표적 화합물과의 하이브리드화를 위하여 유지시킨다. 이러한 올리고머 화합물의 하나로서, 탁월한 하이브리드화 특성을 갖는 것으로 밝혀진 dsRNA 모사체를 펩타이드 핵산(PNA)이라고 한다. PNA 화합물에서, dsRNA의 당 골격은 아미드 함유 골격, 특히 아미노에틸글리신 골격으로 치환된다. 뉴클레오염기는 유지되어, 골격의 아미드 부분의 아자 질소 원자에 직접 또는 간접적으로 결합된다. PNA 화합물의 제조방법을 설명하고 있는 대표적인 미국특허에는 미국특허 제5,539,082호; 제5,714,331호 및 제5,719,262호가 포함되지만, 이에 제한되는 것은 아니며, 이들 문헌 각각은 본원에 참조로서 인용된다. PNA 화합물에 대한 추가의 설명은 문헌[참조: Nielsen et al., Science, 1991, 254, 1497-1500]에서 찾을 수 있다.
본 발명의 가장 바람직한 양태는 포스포로티오에이트 골격을 갖는 dsRNA 및 헤테로원자 골격을 갖는 올리고뉴클레오사이드, 및 특히 상기 언급된 미국특허 제5,489,677호의 --CH2-NH-CH2--, CH2-N(CH3)--O--CH2--[메틸렌(메틸이미노) 또는 MMI 골격으로 공지됨], --CH2-O--N(CH3)-CH2--, --CH2--N(CH3)--N(CH3)--CH2-- 및 --N(CH3)--CH2--CH2--[여기서, 천연 포스포디에스테르 골격은 -0--P--O-CH2--으로 나타낸다], 및 상기 언급된 미국 특허 제5,602,240호의 아미드 골격이다. 또한, 상기 언급된 미국 특허 제5,034,506호의 모르폴리노 골격 구조를 갖는 dsRNA도 바람직하다.
변형된 dsRNA는 하나 이상의 치환된 당 잔기를 함유할 수도 있다. 바람직한 dsRNA는 2' 위치에 다음 중 하나를 포함한다: OH; F; O-, S- 또는 N-알킬; O-, S- 또는 N-알케닐; O-, S- 또는 N-알키닐; 또는 0-알킬-O-알킬(여기서, 알킬, 알케닐 및 알키닐은 치환되거나 또는 비치환된 C1-C10 알킬 또는 C2-C10 알케닐 및 알키닐일 수 있다). O[(CH2)n0]mCH3, O(CH2)nOCH3, O(CH2)nNH2, O(CH2)nCH3, O(CH2)nONH2 및 O(CH2)nON[(CH2)nCH3)]2(여기서, n 및 m은 1 내지 약 10이다)가 특히 바람직하다. 다른 바람직한 dsRNA는 2' 위치에 다음 중 하나를 포함한다: C1-C10 저급 알킬, 치환된 저급 알킬, 알카릴, 아르알킬, O-알카릴 또는 O-아르알킬, SH, SCH3, OCN, Cl, Br, CN, CF3, OCH3, SOCH3, SO2CH3, ONO2, NO2, N3, NH2, 헤테로사이클로알킬, 헤테로사이클로알카릴, 아미노알킬아미노, 폴리알킬아미노, 치환된 실릴, RNA 절단 그룹, 리포터 그룹, 인터컬레이터(intercalator), dsRNA의 약동학적 특성을 증진시키는 그룹, 또는 dsRNA의 약력학적 특성을 증진시키는 그룹, 및 유사한 특성을 갖는 다른 치환체. 바람직한 변형에는 2'-메톡시에톡시(2'-O-CH2CH2OCH3: 2'-O-(2-메톡시에틸) 또는 2'-MOE로도 공지되어 있음)[참조: Martin et al., Helv. Chim. Acta, 1995; 78, 486-504], 즉 알콕시-알콕시 그룹이 포함된다. 추가의 바람직한 변형에는 하기 실시예에 기술된 2'-디메틸아미노옥시에톡시, 즉 O(CH2)2ON(CH3)2 그룹(2'-DMAOE로도 공지되어 있음), 및 마찬가지로 하기 실시예에 기술된 2'-디메틸아미노에톡시에톡시(당업계에서 2'-O-디메틸아미노에톡시에틸 또는 2'-DMAEOE로도 공지되어 있음), 즉 2'-O--CH2--O--CH2--N(CH2)2가 포함된다.
다른 바람직한 변형에는 2'-메톡시(2'-OCH3), 2'-아미노프로폭시(2'-OCH2CH2CH2NH2) 및 2'-플루오로(2'-F)가 포함된다. 유사한 변형이 또한 dsRNA 상의 다른 위치에서, 특히 3' 말단 뉴클레오타이드 또는 2'-5' 연결된 dsRNA의 당의 3' 위치 및 5' 말단 뉴클레오타이드의 5' 위치에서 이루어질 수 있다. dsRNA는 또한 펜토푸라노실 당 대신에 사이클로부틸 잔기와 같은 당 모사체를 가질 수 있다. 이러한 변형된 당 구조물의 제조방법을 설명하고 있는 대표적인 미국 특허에는 미국 특허 제4,981,957호; 제5,118,800호; 제5,319,080호; 제5,359,044호; 제5,393,878호; 제5,446,137호; 제5,466,786호; 제5,514,785호; 제5,519,134호; 제5,567,811호; 제5,576,427호; 제5, 591,722호; 제5,597,909호; 제5,610,3OO호; 제5,627,053호; 제5,639,873호; 제5,646,265호; 제5,658,873호; 제5,670,633호 및 제5,700,920호가 포함되지만, 이에 제한되는 것은 아니며, 이들 중 일부는 본 출원과 함께 공동으로 소유하고 있고, 이들 문헌 각각은 전문이 본원에 참조로서 인용된다.
dsRNA는 또한 뉴클레오염기(종종 당업계에서 간단히 "염기"라고 함) 변형 또는 치환을 포함할 수 있다. 본원에 사용되는 "비변형된" 또는 "천연" 뉴클레오염기에는 퓨린 염기 아데닌(A) 및 구아닌(G), 및 피리미딘 염기 티민(T), 시토신(C) 및 우라실(U)이 포함된다. 변형된 뉴클레오염기에는 5-메틸시토신(5-Me-C), 5-하이드록시메틸 시토신, 크산틴, 하이포크산틴, 2-아미노아데닌, 아데닌 및 구아닌의 6-메틸 및 기타 알킬 유도체, 아데닌 및 구아닌의 2-프로필 및 기타 알킬 유도체, 2-티오우라실, 2-티오티민 및 2-티오시토신, 5-할로우라실 및 시토신, 5-프로피닐 우라실 및 시토신, 6-아조 우라실, 시토신 및 티민, 5-우라실(슈도우라실), 4-티오우라실, 8-할로, 8-아미노, 8-티오, 8-티오알킬, 8-하이드록실 및 기타 8-치환된 아데닌 및 구아닌, 5-할로, 특히 5-브로모, 5-트리플루오로메틸 및 기타 5-치환된 우라실 및 시토신, 7-메틸구아닌 및 7-메틸아데닌, 8-아자구아닌 및 8-아자아데닌, 7-데아자구아닌 및 7-데아자아데닌 및 3-데아자구아닌 및 3-데아자아데닌이 포함된다. 추가의 뉴클레오염기에는 미국 특허 제3,687,808호에 기술된 것들, 문헌[참조: The Concise Encyclopedia Of Polymer Science And Engineering, pages 858-859, Krosehwitz, J. L, ed. John Wiley & Sons, 1990]에 기술된 것들, 문헌[참조: Englisch et al., Angewaindte Chemie, International Edition, 1991, 30, 613]에 기술된 것들, 및 문헌[참조: Sanghvi, Y S., Chapter 15, DsRNA Research and Applications, pages 289-302, Crooke, S. T. and Lebleu, B,, Ed.. CRC Press, 1993]에 기술된 것들이 포함된다. 이들 중 특정 뉴클레오염기는 본 발명의 올리고머 화합물의 결합 친화성을 증가시키는데 특히 유용하다. 여기에는 5-치환된 피리미딘, 6-아자피리미딘 및 N-2, N-6 및 O-6 치환된 퓨린, 예를 들면 2-아미노프로필아데닌, 5-프로피닐우라실 및 5-프로피닐시토신이 포함된다. 5-메틸시토신 치환은 핵산 듀플렉스의 안정성을 0.6 내지 1.2℃ 만큼 증가시키는 것으로 밝혀졌고[참조: Sanghvi, Y. S., Crooks, S. T. and Lebleu, S., Eds., DsRNA Research and Applications, CRC Press, Boca Raton, 1993, pp. 276-278], 현재 바람직한 염기 치환이며, 특히 2'-O-메톡시에틸 당 변형과 함께 사용되는 경우 더 바람직한 염기 치환이다.
앞서 언급한 변형된 뉴클레오염기 및 다른 변형된 뉴클레오염기 중 몇몇의 제조방법을 설명하는 대표적인 미국 특허에는 앞서 언급한 미국 특허 제3,687,8O8호 및 미국 특허 제4,845,205호; 제5,130,30호; 제5,134,066호; 제5,175,273호; 제5,367,066호; 제5,432,272호; 제5,457,187호; 제5,459,255호; 제5,484,908호; 제5,502,177호; 제5,525,711호; 제5,552,540호; 제5,587,469호; 제5,594,121호; 제5,596,091호; 제3,614,617호 및 제5,681,941호(이들 각각은 본원에 참조로서 인용된다), 및 또한 본원에 참조로서 인용된 미국 특허 제5,750,692호가 포함되지만, 이에 제한되는 것은 아니다.
본 발명의 dsRNA의 다른 변형에는 dsRNA의 활성, 세포 분포 또는 세포 흡수를 향상시키는 하나 이상의 잔기 또는 접합체를 dsRNA에 화학적으로 연결시키는 것이 포함된다. 이러한 잔기에는 지질 잔기, 예를 들면 콜레스테롤 잔기[참조: Letsinger et al., Proc. Natl. Acid. Sci. USA, 199, 86, 6553-6556], 콜산[참조: Manoharan et al., Biorg, Med. Chem. Let., 1994 4 1053-1060], 티오에테르, 예를 들면, 베릴-S-트리틸티올[참조: Manoharan et al., Ann. N.Y. Acad. Sci., 1992, 660, 306-309; Manoharan et al., Biorg. Med. Chem. Let.. 1993, 3, 2765-2770], 티오콜레스테롤[참조: Oberhauser et al., Nucl. Acids Res., 1992, 20, 533-538], 지방족 쇄, 예를 들면, 도데칸디올 또는 운데실 잔기[참조: Saison-Behmoaras et al., EMBO J, 1991, 10, 1111-1118; Kabanov et al., FHBS Lett., 1990, 259, 327-330; Svinarchuk et al., Biochimie, 1993, 75, 49-54], 인지질, 예를 들면, 디-헥사데실-락-글리세롤 또는 트리에틸-암모늄 1,2-디-O-헥사데실-락-글리세로-3-H-포스포네이트[참조: Mauoharan et al., Tetrahedron Lett,, 1995, 36, 3651-3654; Shea et al. Nucl Acids Res., 1990, 18, 3777-3783], 폴리아민 또는 폴리에틸렌 글리콜 쇄[참조: Manoharan, et al., Nucleosides & Nucleotides, 1995, 14, 969-973], 또는 아다만탄 아세트산[참조: Manoharan et al., Tetrahedron Lett., 1995, 36, 3651-3654], 팔미틸 잔기[참조: Mishra et al.. Biochim. Biophys, Acta. 1995, 1264, 229-237] 또는 옥타데실아민 또는 헥실아미노-카보닐옥시콜레스테롤 잔기[참조: Crcoke et al., J. Pharmacol. Exp. Ther.. 1996, 277, 923-937]가 포함되지만, 이에 제한되는 것은 아니다.
이러한 dsRNA 접합체의 제조방법을 설명하고 있는 대표적인 미국 특허에는 미국 특허 제4,828,979호; 제4,948,882호; 제5,218,105호; 제5,525,465호; 제5,541,313호; 제5,545,730호; 제5,552,538호; 제5,578,717호, 제5,580,731호; 제5,591,584호; 제5,109,124호; 제5,118,802호; 제5,138,045호; 제5,414,077호; 제5,486,603호; 제5,512,439호; 제5,578,718호; 제5,608,046호; 제4,587,044호; 제4,605,735호; 제4,667,025호; 제4,762,779호; 제4,789,737호; 제4,824,941호; 제4,835,263호; 제4,876,335호; 제4,904,582호; 제4,958,013호; 제5,082,830호; 제5,112,963호; 제5,214,136호; 제5,082,830호; 제5,112,963호; 제5,214,136호; 5,245,022호; 제5,254,469호; 제5,258,506호; 제5,262,536호; 제5,272,250호; 제5,292,873호; 제5,317,098호; 제5,371,241호; 제5,391,723호; 제5,416,203호; 제5,451,463호; 제5,510.475호; 제5,512,667호; 제5,514,785호; 제5,565,552호; 제5,567,810호; 제5,574,142호; 제5,585,481호; 제5,587,371호; 제5,595,726호; 제5,597,696호; 제5,599,923호; 제5,599,928호 및 제5,688,941호가 포함되지만, 이에 제한되는 것은 아니며, 이들 각각은 본원에 참조로서 인용된다.
제공된 화합물 내의 모든 위치를 균일하게 변형시킬 필요는 없으며, 실제로는 앞서 언급한 변형 중 하나 이상을 dsRNA 내의 단일 화합물 또는 심지어 단일 뉴클레오사이드에 혼입시킬 수 있다. 본 발명은 또한 키메릭(chimeric) 화합물인 dsRNA 화합물을 포함한다. 본 발명과 관련하여 "키메릭" dsRNA 화합물 또는 "키메라(chimera)"는 각각 하나 이상의 단량체 단위(즉, dsRNA 화합물의 경우에 뉴클레오타이드)로 구성된 2개 이상의 화학적으로 상이한 영역을 함유하는 dsRNA 화합물, 특히 dsRNA이다. 이들 dsRNA는 뉴클레아제 분해에 대한 증가된 내성, 증가된 세포 흡수 및/또는 표적 핵산에 대한 증가된 결합 친화성이 dsRNA에 부여되도록 dsRNA가 변형된, 하나 이상의 영역을 통상적으로 함유한다. dsRNA의 추가의 영역은 RNA:DNA 또는 RNA:RNA 하이브리드를 절단할 수 있는 효소에 대한 기질로서 역할을 할 수 있다. 예로써, RNase H는 RNA:DNA 듀플렉스의 RNA 쇄를 절단하는 세포 엔도뉴클레아제이다. 그러므로, RNase H의 활성화는 RNA 표적을 분해시켜, 유전자 발현의 dsRNA 억제의 효능을 크게 향상시킨다. 그 결과, 동일한 표적 영역에 하이브리드화하는 포스포로티오에이트 데옥시dsRNA와 비교하여, 키메릭 dsRNA를 사용하는 경우에 더 짧은 dsRNA를 사용하여 동등한 결과를 종종 얻을 수 있다. RNA 표적의 절단은 통상적으로 겔 전기영동, 및 경우에 따라, 당업계에 공지된 관련된 핵산 하이브리드화 기술에 의해 검출할 수 있다.
특정 예에서, dsRNA는 비-리간드 그룹에 의해 변형될 수 있다. dsRNA의 활성, 세포 분포 또는 세포 흡수를 향상시키기 위하여 다수의 비-리간드 분자가 dsRNA에 접합되었으며, 이러한 접합을 수행하는 방법은 과학 문헌에서 찾을 수 있다. 이러한 비-리간드 잔기에는 지질 잔기, 예를 들면 콜레스테롤[참조: Letsinger et al, Proc, Natl. Acad. Sci USA, 1989, 86:6553], 콜산[참조: Manoharan et al., Bioorg. Med. Chem. Lett,, 1994, 4: 1053], 티오에테르, 예를 들면, 헥실-S-트리틸티올[참조: Manoharan et al., Ann. MY, Acad, Sci., 1992, 660:306; Manobaran et al., Bioorg. Med. Chem. Let., 1993, 3:2765], 티오콜레스테롤[참조: Oberhauser et al., Nucl. Acids Res., 1992, 20:533], 지방족 쇄, 예를 들면, 도데칸디올 또는 운데실 잔기[참조: Saison-Behmoaras et al., EMBO J., 1991, 10:1 11; Kabanov et al., FEBS Lett., 1990, 259:327; Svinarchuk et al., Biochimie, 1993, 75:49], 인지질, 예를 들면, 디-헥사데실-락-글리세롤 또는 트리에틸암모늄 1,2-디-O-헥사데실-락-글리세로-3-H-포스포네이트[참조: Manoharan et al, Tetrahedron Lett., 1995, 36:3651; Shea et al., Nucl. Acids Res., 1990, 18:3777], 폴리아민 또는 폴리에틸렌 글리콜 쇄[참조: Manoharan et al., Nucleosides & Nucleotides, 1995, 14:969], 또는 아다만탄 아세트산[참조: Manoharan et al., Tetrahedron Lett., 1995, 36:3651], 팔미틸 잔기[참조: Mishra et al., Biochim, Biophys. Acta, 1995, 1264:229], 또는 옥타데실아민 또는 헥실아미노-카보닐-옥시콜레스테롤 잔기[참조: Crooke et al.. J. Pharmacol. Exp. Ther., 1996, 277:923]가 포함되었다. 이러한 dsRNA 접합체의 제조방법을 설명하는 대표적인 미국 특허는 앞서 열거되었다. 통상적인 접합 프로토콜은 서열의 하나 이상의 위치에서 아미노링커를 갖는 dsRNA의 합성을 포함한다. 이어서, 아미노 그룹을 적절한 결합 또는 활성화 시약을 사용하여 접합되는 분자와 반응시킨다. 접합 반응은 여전히 고체 지지체에 결합된 dsRNA를 사용하여 수행하거나, 용액상에서의 dsRNA의 절단 후 수행할 수 있다. HPLC에 의해 dsRNA 접합체를 정제하여 순수한 접합체를 통상적으로 수득한다.
RNAi 제제를 암호화하는 벡터
본 발명의 dsRNA는 생체내에서 세포내에서 재조합 바이러스 벡터로부터 발현될 수도 있다. 본 발명의 재조합 바이러스 벡터는 본 발명의 dsRNA를 암호화하는 서열 및 dsRNA 서열을 발현시키는데 적합한 임의의 프로모터를 포함한다. 적합한 프로모터에는, 예를 들면, U6 또는 H1 RNA pol III 프로모터 서열 및 사이토메갈로바이러스 프로모터가 포함된다. 다른 적합한 프로모터의 선택은 당업계의 기술 내에 있다. 본 발명의 재조합 바이러스 벡터는 특정 조직 또는 특정 세포내 환경에서의 dsRNA의 발현을 위한 유도성 또는 조절성 프로모터를 포함할 수도 있다. 본 발명의 dsRNA를 생체내에서 세포에 전달하기 위한 재조합 바이러스 벡터의 사용은 아래에서 보다 상세히 논의한다.
본 발명의 dsRNA는 2개의 별개의 상보적인 RNA 분자로서, 또는 2개의 상보적인 영역을 갖는 단일 RNA 분자로서 재조합 바이러스 벡터로부터 발현될 수 있다.
발현될 dsRNA 분자(들)에 대한 암호화 서열을 수용할 수 있는 임의의 바이러스 벡터, 예를 들면, 아데노바이러스(AV); 아데노-관련 바이러스(AAV); 레트로바이러스(예: 렌티바이러스(LV), 라브도바이러스, 쥐 백혈병 바이러스); 헤르페스 바이러스 등을 사용할 수 있다. 다른 바이러스로부터의 외피(envelope) 단백질 또는 기타 표면 항원으로 벡터를 슈도타입화(pseudotyping)시키거나, 또는 경우에 따라, 상이한 바이러스 캡시드(capsid) 단백질을 치환시켜, 바이러스 벡터의 향성(tropism)을 변형시킬 수 있다.
예를 들면, 본 발명의 렌티바이러스 벡터를 수포성 구내염 바이러스(VSV), 광견병 바이러스, 에볼라 바이러스, 모콜라 바이러스 등으로부터의 표면 단백질로 슈도타입화시킬 수 있다. 본 발명의 AAV 벡터를 조작하여 상이한 캡시드 단백질 혈청형을 발현하도록 함으로써 당해 벡터가 상이한 세포를 표적화하게 할 수 있다. 예를 들어, 혈청형 2 게놈 상의 혈청형 2 캡시드를 발현하는 AAV 벡터를 AAV 2/2라고 한다. AAV 2/2 벡터 내의 이러한 혈청형 2 캡시드 유전자를 혈청형 5 캡시드 유전자로 치환시켜 AAV 2/5 벡터를 제조할 수 있다. 상이한 캡시드 단백질 혈청형을 발현하는 AAV 벡터를 작제하기 위한 기술은 당업계의 기술 내에 있다[참조: Rabinowitz J E et al. (2002), J Virol 76:791-801 (전문이 본원에 참조로서 인용됨)].
본 발명에서 사용하기에 적합한 재조합 바이러스 벡터의 선택, dsRNA 발현용 핵산 서열을 벡터 속으로 삽입시키는 방법, 및 바이러스 벡터를 목적한 세포로 전달하는 방법은 당업계의 기술 내에 있다[참조: Dornburg R (1995). Gene Therap, 2: 301-310; Eglitis M A (1988), Biotechniques 6: 608-614; Miller A D (1990), Hum Gene Therap. I: 5-14; Anderson W F(1998), Nature 392: 25-30; 및 Rubinson D A et al., Nat. Genet. 33: 401-406 (전문이 본원에 참조로 인용됨)].
바람직한 바이러스 벡터는 AV 및 AAV로부터 유래된 것들이다. 특히 바람직한 양태에서, 본 발명의 dsRNA는, 예를 들면, U6 또는 H1 RNA 프로모터, 또는 사이토메갈로바이러스(CMV) 프로모터를 포함하는 재조합 AAV 벡터로부터 2개의 별개의 상보적인 일본쇄 RNA 분자로서 발현된다.
본 발명의 dsRNA를 발현시키기에 적합한 AV 벡터, 재조합 AV 벡터를 작제하는 방법, 및 당해 벡터를 표적 세포 속으로 전달하는 방법은 문헌[참조: Xia H et al. (2002), Nat. Biotech. 20: 1006-1010]에 기술되어 있다.
본 발명의 dsRNA를 발현시키기에 적합한 AAV 벡터, 재조합 AV 벡터를 작제하는 방법, 및 당해 벡터를 표적 세포 속으로 전달하는 방법은 문헌[참조: Samulski R et al. (1987), J. Virol 61: 3096-3101; Fisher K. J et el. (1906), J. Virol 70: 520-532; Samulski R et al.(1989), J. Virol. 63; 3822-3826; 미국 특허 제5,252,479호: 제5,139,941호; 국제 특허원 제WO 94/13788호; 및 제WO 93/24641호]에 기술되어 있고, 이들의 전문은 본원에 참조로 인용된다.
III
.
dsRNA
를 포함하는 약제학적 조성물
하나의 양태에서, 본 발명은 본원에 기술된 바와 같은 dsRNA, 및 약제학적으로 허용되는 담체를 포함하는 약제학적 조성물을 제공한다. dsRNA를 포함하는 약제학적 조성물은 Eg5 발현에 의해 매개되는 병리학적 과정과 같은 Eg5 유전자의 발현 또는 활성과 관련된 질병 또는 질환을 치료하는데 유용하다. 이러한 약제학적 조성물은 전달 방식을 기준으로 제형화된다. 하나의 예로는 비경구 전달을 통한 전신 투여용으로 제형화된 조성물이 있다.
다른 양태에서, 이러한 조성물은 VEGF 발현을 억제하는 제2의 dsRNA를 추가로 포함할 것이다. VEGF에 대해 지시된 dsRNA는 실시예 및 공동-계류중인 미국 특허원 제11/078,073호 및 제11/340,080호에 기술되어 있다.
본 발명의 약제학적 조성물은 Eg5 유전자의 발현 (및, 제2의 dsRNA가 포함되는 경우, VEGF 발현)을 억제하는데 충분한 용량으로 투여된다. 일반적으로, dsRNA의 적합한 투여량은 하루에 수용자의 체중kg당 0.01 내지 5.0mg의 범위, 일반적으로 하루에 체중kg당 1㎍ 내지 1mg의 범위일 것이다. 약제학적 조성물은 하루에 1회 투여될 수 있거나, 또는 dsRNA는 하루에 2회, 3회 이상의 소용량으로 적절한 간격으로, 또는 제어 방출 제형을 통한 연속 주입 또는 전달도 사용하여 투여할 수 있다. 이러한 경우, 각각의 소용량에 함유된 dsRNA는 총 1일 용량이 달성되도록 상응하게 더 작아야 한다. 용량 단위는, 예를 들면, 수일 동안에 걸쳐 dsRNA의 지속적인 방출을 제공하는 통상적인 서방성 제형을 사용하여, 수일에 걸쳐 전달되도록 복합될 수 있다. 서방성 제형은 당업계에 익히 공지되어 있고, 본 발명의 제제와 함께 사용될 수 있는 바와 같이 특정 부위에 제제를 전달하는데 특히 유용하다. 당해 양태에서, 용량 단위는 1일 투여량의 상응하는 몇 배를 함유한다.
당업자는, 피험자의 질병 또는 질환의 중증도, 이전의 치료, 전반적인 건강 및/또는 연령 및 존재하는 다른 질병을 포함하나, 이에 한정되지 않는 특정 요인들이 피험자를 효과적으로 치료하는데 요구되는 용량 및 시간에 영향을 미칠 수 있다는 것을 인지할 것이다. 또한, 치료학적 유효량의 조성물을 사용한 피험자의 치료는 단일 치료 또는 일련의 치료를 포함할 수 있다. 본 발명에 포함된 개개의 dsRNA에 대한 유효량 및 생체내 반감기는 통상적인 방법론을 사용하거나, 본원에 기술된 바와 같은 적절한 동물 모델을 사용한 생체내 시험을 기준으로 하여 평가할 수 있다.
마우스 유전학에 있어서의 진보는 Eg5 발현에 의해 매개되는 병리학적 과정과 같은 각종 사람 질병의 연구를 위한 다수의 마우스 모델을 생성시켰다. 이러한 모델은 dsRNA의 생체내 시험에 사용될 뿐만 아니라, 치료학적 유효량을 결정하는데에도 사용된다.
본 발명은 또한 본 발명의 dsRNA 화합물을 포함하는 약제학적 조성물 및 제형을 포함한다. 본 발명의 약제학적 조성물은 국소 또는 전신 치료가 바람직한지에 따라서 그리고 치료되는 부위에 따라서 다양한 방법으로 투여될 수 있다. 투여는 국소 투여, 폐 투여, 예를 들면, 분무기에 의한 투여를 포함하는 분말 또는 에어로졸의 흡입 또는 통기에 의한 폐 투여; 기관내, 비강내, 상피 및 경피, 경구 또는 비경구 투여일 수 있다. 비경구 투여에는 정맥내, 동맥내, 피하, 복강내 또는 근육내 주사 또는 주입; 또는 두개내, 예를 들면, 경막내 또는 뇌실내 투여가 포함된다.
국소 투여용의 약제학적 조성물 및 제형에는 경피 패치제, 연고제, 로션제, 크림제, 겔제, 점적제, 좌제, 분무제, 용액제 및 산제가 포함될 수 있다. 통상적인 약제학적 담체, 수성, 분말 또는 유성 기제, 증점제 등이 요구되거나 바람직할 수 있다. 피복된 콘돔, 글로브 등도 유용할 수 있다. 바람직한 국소 제형에는 본 발명의 dsRNA가 지질, 리포좀, 지방산, 지방산 에스테르, 스테로이드, 킬레이트제 및 계면활성제와 같은 국소 전달제와 혼합된 제형이 포함된다. 바람직한 지질 및 리포좀에는 중성(예: 디올레오일포스파티딜 DOPE 에탄올아민, 디미리스토일포스파티딜 콜린 DMPC, 디스테아로일포스파티딜 콜린), 음성(예: 디미리스토일포스파티딜 글리세롤 DMPG) 및 양이온성(예: 디올레오일테트라메틸아미노프로필 DOTAP 및 디올레오일포스파티딜 에탄올아민 DOTMA)이 포함된다. 본 발명의 dsRNA는 리포좀 내에 캡슐화되거나, 또는 이에 대해, 특히 양이온성 리포좀에 대해 착화될 수 있다. 또는, dsRNA는 지질, 특히 양이온성 지질과 착화될 수 있다. 바람직한 지방산 및 에스테르에는 아라키돈산, 올레산, 에이코사노산, 라우르산, 카프릴산, 카프르산, 미리스트산, 팔미트산, 스테아르산, 리놀산, 리놀렌산, 디카프레이트, 트리카프레이트, 모노올레인, 딜라우린, 글리세릴 1-모노카프레이트, 1-도데실아자사이클로헵탄-2-온, 아크릴카르니틴, 아실콜린 또는 C1 -10 알킬 에스테르(예: 이소프로필미리스테이트 IPM), 모노글리세라이드, 디글리세라이드 또는 이의 약제학적으로 허용되는 염이 포함되지만, 이에 제한되는 것은 아니다. 국소 제형은 전문이 본원에 참조로서 인용된 1999년 5월 20일자 출원된 미국 특허원 제09/315,298호에 상세히 기술되어 있다.
경구 투여용 조성물 및 제형에는 산제 또는 과립제, 미립제, 나노미립제, 물 또는 비-수성 매질 중의 현탁액제 또는 용액제, 캡슐제, 겔 캡슐제, 사세제(sachet), 정제 또는 미니정제(minitablet)가 포함된다. 증점제, 풍미제, 희석제, 유화제, 분산 보조제 또는 결합제가 바람직할 수 있다. 바람직한 경구 제형은, 본 발명의 dsRNA가 하나 이상의 침투 향상제, 계면활성제 및 킬레이트제와 함께 투여되는 것들이다. 바람직한 계면활성제에는 지방산 및/또는 이의 에스테르 또는 염, 담즙산 및/또는 이의 염이 포함된다. 바람직한 담즙산/염에는 케노데옥시콜산(CDCA) 및 우르소데옥시케노데옥시콜산(UDCA), 콜산, 데하이드로콜산, 데옥시콜산, 글루콜산, 글리콜산, 글리코데옥시콜산, 타우로콜산, 타우로데옥시콜산, 나트륨 타우로-24,25-디하이드로-푸시데이트 및 나트륨 글리코디하이드로푸시데이트가 포함된다. 바람직한 지방산에는 아라키돈산, 운데칸산, 올레산, 라우르산, 카프릴산, 카프르산, 미리스트산, 팔미트산, 스테아르산, 리놀레산, 리놀렌산, 디카프레이트, 트리카프레이트, 모노올레인, 딜라우린, 글리세릴 1-모노카프레이트, 1-도데실아자사이클로헵탄-2-온, 아크릴카르니틴, 아실콜린 또는 모노글리세라이드, 디글리세라이드 또는 이의 약제학적으로 허용되는 염(예: 나트륨)이 포함된다. 또한, 침투 향상제의 배합물, 예를 들면, 담즙산/염과 배합된 지방산/염이 바람직하다. 특히 바람직한 배합물은 라우르산, 카프르산 및 UDCA의 나트륨 염이다. 추가의 침투 향상제에는 폴리옥시에틸렌-9-라우릴 에테르, 폴리옥시에틸렌-20-세틸 에테르가 포함된다. 본 발명의 dsRNA는 분무 건조된 입자를 포함하는 과립 형태로 경구 전달되거나, 또는 착화되어 마이크로입자 또는 나노입자를 형성할 수 있다. dsRNA 착화제에는 폴리-아미노산; 폴리이민; 폴리아크릴레이트; 폴리알킬아크릴레이트, 폴리옥세탄, 폴리알킬시아노아크릴레이트; 양이온화된 젤라틴, 알부민, 전분, 아크릴레이트, 폴리에틸렌글리콜(PEG) 및 전분; 폴리알킬시아노아크릴레이트; DEAE-유도체화된 폴리이민, 폴룰란, 셀룰로스 및 전분이 포함된다. 특히 바람직한 착화제에는 키토산, N-트리메틸키토산, 폴리-L-리신, 폴리히스티딘, 폴리오르니틴, 폴리스페르민, 프로타민, 폴리비닐피리딘, 폴리티오디에틸아미노메틸에틸렌 P(TDAE), 폴리아미노스티렌(예: p-아미노), 폴리(메틸시아노아크릴레이트), 폴리(에틸시아노아크릴레이트), 폴리(부틸시아노아크릴레이트), 폴리(이소부틸시아노아크릴레이트), 폴리(이소헥실시아노아크릴레이트), DEAE-메타크릴레이트, DEAE-헥실아크릴레이트, DEAE-아크릴아미드, DEAE-알부민 및 DEAE-덱스트란, 폴리메틸아크릴레이트, 폴리헥실아크릴레이트, 폴리(D,L-락트산), 폴리(DL-락틱-코-글리콜산(PLGA), 알기네이트 및 폴리에틸렌글리콜(PEG)이 포함된다. dsRNA용 경구 제형 및 이의 제조방법은 미국 특허원 제08/886,829호(1997년 7월 1일 출원), 제09/108,673호(1998년 7월 1일 출원), 제09/256,515호(1999년 2월 23일 출원), 제09/082,624호(1998년 5월 21일 출원) 및 제09/315,298호(1999년 5월 20일 출원)에 상세히 기술되어 있으며, 이들 각각은 전문이 본원에 참조로서 인용된다.
비경구, 수막내, 뇌실내 또는 간내 투여용 조성물 및 제형에는 완충제, 희석제 및 침투 향상제, 담체 화합물 및 기타 약제학적으로 허용되는 담체 또는 부형제와 같은, 그러나 이에 한정되지 않는 기타 적합한 첨가제를 함유할 수도 있는 멸균 수용액이 포함될 수 있다.
본 발명의 약제학적 조성물에는 용액, 에멀젼 및 리포좀-함유 제형이 포함되지만, 이에 제한되는 것은 아니다. 이들 조성물은 예비형성된 액체, 자가-유화성 고체 및 자가-유화성 반고체가 포함되지만, 이에 한정되지 않는 다양한 성분으로부터 생성될 수 있다. 간 암종과 같은 간 질환을 치료하는 경우 간을 표적화하는 제형이 특히 바람직하다.
단위 투여형으로 편리하게 제공될 수 있는 본 발명의 약제학적 제형은 약제 산업에 익히 공지된 통상적인 기술에 따라 제조할 수 있다. 이러한 기술은 활성 성분을 약제학적 담체(들) 또는 부형제(들)과 배합하는 단계를 포함한다. 일반적으로, 제형은 활성 성분을 액체 담체 또는 미분된 고체 담체 또는 이들 둘 모두를 균질하고 긴밀하게 배합하고 나서, 경우에 따라, 제품을 성형하여 제조한다.
본 발명의 조성물은 정제, 캡슐제, 겔 캡슐제, 액체 시럽제, 연질 겔제, 좌제 및 관장제와 같은, 그러나 이에 한정되지 않는 임의의 많은 가능한 투여형으로 제형화될 수 있다. 본 발명의 조성물은 또한 수성, 비-수성 또는 혼합 매질 중의 좌제로서 제형화될 수 있다. 수성 현탁액제는, 예를 들면, 나트륨 카복시메틸셀룰로스, 소르비톨 및/또는 덱스트란을 포함하는, 현탁액제의 점도를 증가시키는 물질을 추가로 함유할 수 있다.
에멀젼
본 발명의 조성물을 제조하여 에멀젼으로서 제형화할 수 있다. 에멀젼은 통상적으로 하나의 액체가 일반적으로 직경이 0.1㎛를 초과하는 점적제 형태의 다른 액체 속에 분산된 불균일계이다[참조: Idson, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel. Dekker, Inc., New York, N. Y.. volume 1, p. 199; Rosoff in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc., New York, N. Y., Volume 1, p. 245; Block in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc., New York, M.Y., volume 2, p. 335; Higuchi et al., in Remington's Pharmaceutical Sciences, Mack Publishing Co., Easton, Pa.. 1985, p. 301]. 흔히 에멀젼은 서로 긴밀하게 혼합되어 분산된 2개의 비-혼화성 액체상을 포함하는 이상(biphasic) 시스템이다. 일반적으로, 에멀젼은 유중수(w/o) 또는 수중유(o/w) 종류일 수 있다. 수성상이 대량의 유성상 속에 미세한 점적제로서 미분되어 분산된 경우, 수득되는 조성물을 유중수(w/o) 에멀젼이라고 부른다. 또는, 유성상이 대량의 수성상 속에 미세한 점적제로서 미분되어 분산된 경우, 수득되는 조성물을 수중유(o/w) 에멀젼이라고 부른다. 에멀젼은 분산상 외에도 추가의 성분들, 및 수성상, 유성상 또는 분리된 상 자체로 용액으로서 존재할 수 있는 활성 약물을 함유할 수 있다. 유화제, 안정화제, 염료 및 항산화제와 같은 약제학적 부형제가 경우에 따라 에멀젼에 존재할 수도 있다. 약제학적 에멀젼은, 예를 들면, 유중수중유(o/w/o) 및 수중유중수(w/o/w) 에멀젼의 경우에서와 같이 2개 이상의 상을 포함하는 다중 에멀젼일 수도 있다. 이러한 복합 제형은 종종 단순한 이원(binary) 에멀젼이 갖고 있지 않은 특정한 장점을 제공한다. o/w 에멀젼의 개개의 오일 점적이 작은 물 점적을 봉입한 다중 에멀젼은 w/o/w 에멀젼을 구성한다. 유사하게, 유성 연속상 중에 안정화된 물의 액적 안에 봉입된 오일 점적 시스템은 o/w/o 에멀젼을 제공한다.
에멀젼은 열역학적 안정성이 거의 없거나 또는 전혀 없는 것을 특징으로 한다. 흔히, 에멀젼의 분산상 또는 불연속상은 외부 또는 연속상 안에 잘 분산되어, 유화제 또는 제형의 점도를 통해 이러한 형태로 유지된다. 에멀젼의 2개의 상 중 하나는 에멀젼형 연고 기제 및 크림제의 경우와 같이 반고체 또는 고체일 수 있다. 안정화 에멀젼의 다른 수단은 에멀젼의 2개의 상 중 하나의 상 속으로 혼입될 수 있는 유화제의 사용을 포함한다. 유화제는 4개 범주로 광범위하게 분류될 수 있다: 합성 계면활성제, 천연 유화제, 흡수 기제 및 미분된 고체[참조: Idson, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds,), 1988, Marcel Dekker, Inc, New York, N.Y., volume 1, p. 199].
표면 활성제로도 공지되어 있는 합성 계면활성제는 에멀젼의 제형에서 광범위한 적용성을 갖는 것으로 밝혀졌으며, 문헌[참조: Rieger, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (eds.), Marcel Dekker, Inc.. New York, N.Y.. volume 1, p. 285; Idson, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), Marcel Dekker, Inc., New York, N.Y., 1988, volume 1, p. 199]에서 고찰되었다. 계면활성제는 통상적으로 양친매성이며 친수성 부분과 소수성 부분을 포함한다. 계면활성제의 친수성 특성 대 소수성 특성의 비는 친수성/친지성 균형(HLB)이라고 명명되었고, 제형의 제조시 계면활성제를 분류하고 선택하는데 있어서 유용한 수단이다. 계면활성제는 친수성 그룹의 특성에 따라 상이한 계열로 분류할 수 있다: 비이온성, 음이온성, 양이온성 및 양쪽성[참조: Rieger, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc., New York, N.Y., volume 1, p. 285].
에멀젼 제형에 사용되는 천연 유화제에는 라놀린, 밀납, 포스파티드, 레시틴 및 아카시아가 포함된다. 흡수 기제는 친수성 특성을 지님으로써, 이들은 물을 흡수하여 무수 라놀린 및 친수성 바세린과 같이 여전히 반고체 농도를 유지하는 w/o 에멀젼을 형성할 수 있다. 미분된 고체는 또한 특히 계면활성제와 함께 그리고 점성 제제에서 우수한 유화제로서 사용되었다. 여기에는 중금속 수산화물, 비팽윤 점토, 예를 들면 벤토나이트, 애터펄자이트(attapulgite), 헥토라이트, 카올린, 몬트모릴로나이트, 콜로이드성 알루미늄 실리케이트 및 콜로이드성 마그네슘 알루미늄 실리케이트, 색소 및 비극성 고체, 예를 들면 탄소 또는 글리세릴 트리스테아레이트가 포함된다.
매우 다량한 비-유화성 물질도 에멀젼 제형 속에 포함되며 에멀젼의 특성에 기여한다. 여기에는 지방, 오일, 왁스, 지방산, 지방 알코올, 지방 에스테르, 습윤제, 친수성 콜로이드, 보존제 및 항산화제가 포함된다[참조: Block, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc., New York, N. Y., volume 1, p, 335; Idson, in Pharmaceutical Dosage Forms, Liebecroan, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc.. New York, N.Y.. volume 1, p. 199].
친수성 콜로이드 또는 하이드로콜로이드에는 천연 검 및 합성 중합체, 예를 들면 다당류(예를 들면, 아카시아, 한천, 알긴산, 카라기난, 구아 검, 카라야 검 및 트라가칸트), 셀룰로스 유도체(예를 들면, 카복시메틸셀룰로스 및 카복시프로필셀룰로스), 및 합성 중합체(예를 들면, 카보머, 셀룰로스 에테르 및 카복시비닐 중합체)가 포함된다. 이들은 수중에서 분산 또는 팽윤되어, 분산상 점적 주변에 강력한 계면 필름을 형성하고 외부상의 점도를 증가시킴에 의해 에멀젼을 안정화시키는 콜로이드성 액체를 형성한다.
에멀젼은 흔히 미생물의 성장을 용이하게 지지할 수 있는 탄수화물, 단백질, 스테롤 및 포스파티드와 같은 다수의 성분을 함유하므로, 이들 제형은 흔히 보존제를 포함한다. 에멀젼 제형에 포함되는 일반적으로 사용되는 보존제에는 메틸 파라벤, 프로필 파라벤, 4급 암모늄 염, 벤즈알코늄 클로라이드, p-하이드록시벤조산의 에스테르 및 붕산이 포함된다. 항산화제도 에멀젼 제형에 통상적으로 첨가되어 제형의 변형을 방지한다. 사용되는 항산화제에는 유리 라디칼 스캐빈저(scavenger), 예를 들면 토코페롤, 알킬 갈레이트, 부틸화된 하이드록시아니솔, 부틸화된 하이드록시톨루엔, 또는 환원제, 예를 들면 아스코르브산 및 나트륨 메타비설파이트 및 항산화성 상승제, 예를 들면 시트르산, 타르타르산 및 레시틴일 수 있다.
피부, 경구 및 비경구 경로를 통한 에멀젼 제형의 투여 및 이들의 제조 방법은 문헌[참조: Idson, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc.. New York, N. Y., volume 1, p. 199]에서 고찰되었다. 경구 전달용 에멀젼 제형은 제형의 용이성, 및 흡수 및 생체이용률 관점에서의 효능으로 인하여 매우 광범위하게 사용되어 왔다[참조: Rosoff; in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc., New York, N. Y., volume 1, p. 245; Idson, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds.), 1988, Marcel Dekker, Inc., New York, N.Y., volume 1, p. 199]. 미네랄오일 기제 하제(laxative), 지용성 비타민 및 고지방 영양 제제는 통상적으로 o/w 에멀젼으로서 경구투여되어 온 물질에 속한다.
본 발명의 하나의 양태에서, dsRNA 및 핵산의 조성물은 마이크로에멀젼으로 제형화된다. 마이크로에멀젼은 광학적으로 등방성이고 열역학적으로 안정한 단일 액체 용액인 물, 오일 및 양친매성 물질의 시스템으로서 정의될 수 있다[참조: Rosoff, in Pharmaceutical Dosage Forms. Lieberman, Rieger and Banker (Eds.) 1988, Marcel Dekker, Inc.,, New York, MY., volume 1, p. 245]. 통상적으로 마이크로에멀젼은 오일을 먼저 수성 계면활성제 용액 중에 분산시키고 나서, 충분한 양의 제4 성분, 일반적으로 중간 쇄 길이의 알코올을 첨가하여 투명한 시스템을 형성시킴으로써 제조된 시스템이다. 그러므로, 마이크로에멀젼은 또한 표면-활성 분자의 계면 필름에 의해 안정화된 2개의 비-혼화성 액체의 열역학적으로 안정하고, 등방적으로 투명한 분산액으로도 기술되었다[참조: Leung and Shah, in; Controlled Release of Drugs: Polymers and Aggregate Systems, Rosoff, M. Ed., 19S0, VCH Publishers. New York, pages 185-215]. 마이크로에멀젼은 통상적으로 오일, 물, 계면활성제, 공계면활성제 및 전해질을 포함하는 3 내지 5개의 성분의 배합을 통해 제조된다. 마이크로에멀젼이 유중수(w/o) 또는 수중유(o/w) 유형인지의 여부는 사용된 오일 및 계면활성제의 특성 및 계면활성제 분자의 극성 헤드와 탄화수소 꼬리의 구조 및 기하학적 패킹(packing)에 따라 달라진다[참조: Schott, in Remington's Pharmaceutical Sciences, Mack Publishing Co., Easton, Pa., 1985, p. 271].
상태도(phase diagram)를 사용한 현상학적 접근법이 집중적으로 연구되어 당업자에게 마이크로에멀젼을 제형화하는 방법에 대한 종합적인 지식이 제공되었다[참조: Rosoff, in Pharmaceutical Dosage Forms, Lieberman, Rigger and Banker (Eds.), 1988, Marcel Dekker, Inc., New York, N,Y.; volume 1, p. 245; Block, in Pharmaceutical Dosage forms, Lieberman, Rieger and Banker (Eds), 1988, Marcel Dekker, Inc.. New York, N.Y., volume 1, p. 335]. 통상적인 에멀젼과 비교하여, 마이크로에멀젼은 자발적으로 형성된 열역학적으로 안정한 점적의 제형 중에 수불용성 약물을 가용화시키는 장점을 제공한다.
마이크로에멀젼의 제조에 사용되는 계면활성제에는, 단독으로 또는 공계면활성제와 함께 사용되는, 음이온성 계면활성제, 비-이온성 계면활성제, Brij 96, 폴리옥시에틸렌 올레일 에테르, 폴리글리세롤 지방상 에스테르, 테트라글리세롤 모노라우레이트(ML310), 테트라글리세롤 모노올레에이트(MO310), 헥사글리세롤 모노올레에이트(PO310), 헥사글리세롤 펜타올레에이트(PO500), 데카글리세롤 모노카프레이트(MCA750), 데카글리세롤 모노올레에이트(MO750), 데카글리세롤 세퀴올레에이트(SO750), 데카글리세롤 데카올레에이트(DAO750)가 포함된다. 공계면활성제, 일반적으로 에탄올, 1-프로판올 및 1-부탄올과 같은 단쇄 알코올은 계면활성제 필름 속으로 침투하여. 그 결과 계면활성제 분자 사이에 형성된 빈 공간으로 인하여 정렬되지 않은 필름을 형성함으로써 계면 유동성을 증가시키는 역할을 한다. 그러나, 마이크로에멀젼은 공계면활성제의 사용 없이 제조할 수 있으며, 알코올-무함유 자가-유화성 마이크로에멀젼 시스템은 당업계에 공지되어 있다. 수성상은 통상적으로 물, 약물, 글리세롤, PEG300, PEG400, 폴리글리세롤, 프로필렌 글리콜 및 에틸렌 글리콜의 유도체의 수용액일 수 있지만, 이에 한정되지 않는다. 유성상에는 캡텍스(Captex) 300, 캡텍스 355, 캡물(Capmul) MCM, 지방산 에스테르, 중간 쇄(C8-C12) 모노, 디 및 트리-글리세라이드, 폴리옥시에틸화된 글리세릴 지방산 에스테르, 지방 알코올, 폴리글리콜화된 글리세라이드, 포화된 폴리글리콜화된 C8-C10 글리세라이드, 식물성 오일 및 실리콘 오일과 같은 물질이 포함되지만, 이에 제한되는 것은 아니다.
마이크로에멀젼은 약물 가용성 및 약물의 흡수 향상 측면에서 특히 관심이 집중되고 있다. 지질계 마이크로에멀젼(o/w 및 w/o 둘 모두)은 펩타이드를 포함하는 약물의 경구 생체이용률을 향상시키는 것으로 제안되었다[참조: Constantinides et al. Pharmaceutical Research, 1994, 11, 1385-1390; Ritschel Meth. Find. Exp. Clin. Pharmacol., 1993, 13, 205]. 마이크로에멀젼은 향상된 약물 가용성, 효소적 가수분해로부터의 약물의 보호, 막 유동성 및 투과성에 있어서 계면활성제-유도된 변형으로 인한 약물 흡수의 가능한 향상, 제조의 용이성, 고체 투여형 이상의 경구 투여의 용이성, 향상된 임상 효능, 및 감소된 독성의 장점을 제공한다[참조: Constantinides et al. Pharmaceutical Research, 1994, 11, 1385; Ho et al., J. Pharm. Sci., 1996, 85, 138-143]. 흔히, 마이크로에멀젼은 이의 성분들이 함께 주위 온도에 있는 경우 자발적으로 형성될 수 있다. 이는, 열불안정성 약물, 펩타이드 또는 dsRNA를 제형화하는 경우에 특히 유리할 수 있다. 마이크로에멀젼은 화장 용도 및 약제학적 용도에서 활성 성분의 경피 전달에서도 효과적이었다. 본 발명의 마이크로에멀젼 조성물 및 제형은 위장관으로부터 dsRNA 및 핵산의 증가된 전신적 흡수를 촉진시키고 dsRNA 및 핵산의 국부적 세포 흡수를 향상시킬 것으로 예측된다.
본 발명의 마이크로에멀젼은 추가의 성분 및 소르비탄 모노스테아레이트(그릴(Grill) 3), 라브라솔(Labrasol)과 같은 첨가제, 및 본 발명의 제형의 특성을 향상시키고 본 발명의 dsRNA 및 핵산의 흡수를 향상시키기 위한 침투 향상제를 함유할 수도 있다. 본 발명의 마이크로에멀젼에 사용되는 침투 향상제는 5개의 광범위한 범주 중 하나에 속하는 것으로 분류될 수 있다 -- 계면활성제, 지방산, 담즙염, 킬레이트제 및 비-킬레이트성 비-계면활성제 [참조: Lee et al., Critical Reviews in Therapeutic Drug Carrier Systems, 1991, p. 92]. 이들 계열 각각은 앞서 논의하였다.
리포좀
약물의 제형을 위해 연구되고 사용된 마이크로에멀젼 이외에 많은 조직화된 계면활성제 구조가 있다. 여기에는 단층, 마이셀(micelle), 이중층 및 소포가 포함된다. 리포좀과 같은 소포는 약물 전달의 관점에서 이들이 제공하는 특이성 및 작용 기간으로 인하여 많은 관심을 받았다. 본 발명에 사용되는 용어 "리포좀"은 구형 이중층(들)에 배열된 양친매성 지질로 구성된 소포를 의미한다.
리포좀은 친지성 물질 및 수성 내부로부터 형성된 막을 갖는 단일막 또는 다중막 소포이다. 수성 부분은 전달될 조성물을 함유한다. 양이온성 리포좀은 세포벽에 융합할 수 있는 장점을 갖는다. 비-양이온성 리포좀은, 세포벽과 효율적으로 융합될 수 없지만, 생체내에서 대식세포에 의해 흡수된다.
온전한 포유동물 피부를 통과하기 위하여, 지질 소포는 직경이 각각 50nm 미만인 일련의 미세 공극을 적합한 경피 구배의 영향 하에서 통과하여야만 한다. 그러므로, 고도로 변형가능하며 이러한 미세 공극을 통과할 수 있는 리포좀을 사용하는 것이 바람직하다.
리포좀의 추가의 장점에는 다음이 포함된다: 천연 인지질로부터 수득한 리포좀은 생체적합성이며 생분해성이다; 리포좀은 광범위한 물 및 지용성 약물을 혼입할 수 있다; 리포좀은 내부 구획 내에 캡슐화된 약물을 대사 및 분해로부터 보호할 수 있다[참조: Rosoff, in Pharmaceutical Dosage Forms, Lieberman, Rieger and Banker (Eds,), 1988, Marcel Dekker, Inc., New York, N.Y., volume 1, p. 245]. 리포좀 제형의 제조에서 중요한 고려사항은 지질 표면 전하, 소포 크기 및 리포좀의 수성 용적이다.
리포좀은 작용 부위로 활성 성분을 이동시키고 전달하는데 유용하다. 리포좀 막은 생물학적 막과 구조적으로 유사하기 때문에, 리포좀을 조직에 적용하는 경우, 리포좀은 세포막과 융합되기 시작하고, 리포좀과 세포의 융합이 진행되면서, 리포좀 내용물은 활성 제제가 작용할 수 있는 세포 속으로 비워진다.
리포좀 제형은 많은 약물에 대한 전달 방법으로서 집중적인 연구의 대상이었다. 국소 투여시, 리포좀은 다른 제형에 비해 몇가지 장점을 제공한다는 것이 점점 입증되고 있다. 이러한 장점에는 투여된 약물의 높은 전신적 흡수와 관련된 부작용의 감소, 목적한 표적에서의 투여된 약물의 축적 증가, 및 친수성 및 소수성인 매우 다양한 약물을 피부 속으로 투여하는 능력이 포함된다.
몇몇 보고에서 고분자량 DNA를 포함하는 제제를 피부 속으로 전달하는 리포좀의 능력이 상세히 기술되었다. 진통제, 항체, 호르몬 및 고분자량 DNA를 포함하는 화합물이 피부에 투여되었다. 대부분의 투여 결과, 상부 상피가 표적화되었다.
리포좀은 2개의 광범위한 계열로 나뉜다. 양이온성 리포좀은 음전하를 띤 DNA 분자와 상호작용하여 안정한 복합체를 형성하는 양전하를 띤 리포좀이다. 양전하를 띤 DNA/리포좀 복합체는 음전하를 띤 세포 표면에 결합하여 엔도좀 안에 내재화된다. 엔도좀 내의 산성 pH로 인하여, 리포좀이 파괴되어 내용물이 세포질로 방출된다[참조: Wang et al., Biochem. Biophys. Res, Commun, 1987, 147, 980-985].
pH-민감성 또는 음전하를 띤 리포좀은 DNA와 복합체를 형성하기보다는 DNA를 포획한다. DNA 및 지질 둘 모두는 유사하게 하전되어 있으므로, 복합체 형성보다는 반발이 일어난다. 그럼에도 불구하고, 일부 DNA는 이들 리포좀의 수성 내부 안에 포획된다. pH-민감성 리포좀은 티미딘 키나제 유전자를 암호화하는 DNA를 배양물내 세포 단층으로 전달하는데 사용되었다. 외인성 유전자의 발현이 표적 세포에서 검출되었다[참조: Zhou et al., Journal of Controlled Release, 1992, 19, 269-274].
리포좀 조성물의 한가지 주요 유형에는 천연 유래의 포스파티딜콜린 외에도 인지질이 포함된다. 예를 들어, 천연 리포좀 조성물은 디미리스토일 포스파티딜콜린(DMPC) 또는 디팔미토일 포스파티딜콜린(DPPC)으로부터 형성될 수 있다. 음이온성 리포좀 조성물은 일반적으로 디미리스토일 포스파티딜글리세롤로부터 형성되는 반면, 양이온성 융합 리포좀은 주로 디올레오일 포스파티딜에탄올아민(DOPE)으로부터 형성된다. 다른 유형의 리포좀 조성물은, 예를 들면, 대두 포스파티딜콜린(PC) 및 계란 PC와 같은 PC로부터 형성된다. 다른 유형은 인지질 및/또는 포스파티딜콜린 및/또는 콜레스테롤의 혼합물로부터 형성된다.
여러 연구에서 피부로의 리포좀 약물 제형의 국소 전달이 평가되었다. 인터페론 함유 리포좀의 기니피그 피부로의 투여는 피부 헤르페스 상처를 감소시킨 반면, 다른 수단(예: 용액 또는 에멀젼으로서)을 통한 인터페론의 전달은 효과적이지 않았다[참조: Weiner et al., Journal of Drug Targeting, 1992, 2, 405-410]. 또한, 추가의 연구에서는 수성 시스템을 사용한 인터페론의 투여에 대하여 리포좀 제형의 일부로서 투여된 인터페론의 효능을 시험하였으며, 리포좀 제형이 수성 투여보다 우수하다고 결론을 내렸다[참조: du Plessis et al.. Antiviral Research, 1992, 18, 259-265].
비-이온성 리포좀 시스템, 특히 비-이온성 계면활성제 및 콜레스테롤을 포함하는 시스템도 피부로의 약물의 전달에서 유용성을 측정하기 위하여 검사되었다. NovasomeTM I(글리세릴 디라우레이트/콜레스테롤/폴리옥시에틸렌-10-스테아릴 에테르) 및 NovasomeTM II(글리세릴 디스테아레이트/콜레스테롤/폴리옥시에틸렌-10-스테아릴 에테르)를 포함하는 비-이온성 리포좀 제형을 사용하여 사이클로스포린-A를 마우스 피부의 진피 속으로 전달하였다. 그 결과, 이러한 비-이온성 리포좀 시스템은 피부의 상이한 층으로의 사이클로스포린-A의 침착을 촉진시키는데 효과적인 것으로 나타났다[참조: Hu et al., S.T.P.Pharma, Sci, 1994, 4, 6, 466].
리포좀에는 또한 "입체적으로 안정한" 리포좀이 포함되며, 본원에 사용되는 바와 같이 당해 용어는, 리포좀 속으로 혼입되는 경우, 이러한 특수화된 지질이 결여된 리포좀과 비교하여 향상된 순환 수명(circulation lifetime)을 초래하는 하나 이상의 특수화된 지질을 포함하는 리포좀을 말한다. 입체적으로 안정화된 리포좀의 예로는 리포좀의 소포-형성 지질 부분의 일부가 (A) 모노시알로갱글리오사이드 GM1과 같은 하나 이상의 당지질을 포함하거나, (B) 폴리에틸렌 글리콜(PEG) 잔기와 같은 하나 이상의 친수성 중합체로 유도체화된 것들이 있다. 어떠한 이론에도 구속되기를 바라지 않으면서, 당업계에서는, 갱글리오사이드, 스핑고마이엘린 또는 PEG-유도체화된 지질을 함유하는 입체적으로 안정화된 리포좀의 경우에는 적어도, 이러한 입체적으로 안정화된 리포좀의 향상된 순환 반감기는 세망내피계(RES)의 세포 속으로의 감소된 흡수로부터 유래한다고 여겨진다[참조: Allen et al., FEBS Letters, 1987, 223. 42; Wu et al. Cancer Research, 1993, 53, 3765].
하나 이상의 당지질을 포함하는 각종 리포좀이 당업계에 공지되어 있다. 문헌[참조: Papahadjopoulos et al., Ann. N. Y. Acad. Sci., 1987, 507, 64]에는 모노시알로갱글리오사이드 GM1, 갈락토세레브로사이드 설페이트 및 포스파티딜이노시톨이 리포좀의 혈액 반감기를 향상시키는 능력이 보고되었다. 이러한 발견은 문헌[참조: Gabizon et al., Proc. Natl Acad, Sci, U.S.A., 1988, 85, 6949]에 상세히 설명되었다. 알렌(Allen) 등의 미국특허 제4,837,028호 및 국제공개공보 제WO 88/04924호에는 (1) 스핑고마이엘린 및 (2) 갱글리오사이드 GM1 또는 갈락토세레브로사이드 설페이트 에스테르를 포함하는 리포좀이 기술되어 있다. 웹(Webb) 등의 미국특허 제5,543,152호에는 스핑고마이엘린을 포함하는 리포좀이 기술되어 있다. 1,2-sn-디미리스토일포스파티딜콜린을 포함하는 리포좀은 림(Lim) 등의 국제공개공보 제WO 97/13499호에 기술되어 있다.
하나 이상의 친수성 중합체로 유도체화된 지질을 포함하는 많은 리포좀, 및 이의 제조 방법은 당업계에 공지되어 있다. 문헌[참조: Sunamoto et al., Bull. Chem. Soc. Jpn.., 1980, 53, 2778]에는 PEG 잔기를 함유하는 비이온성 세제 2C1215G를 포함하는 리포좀이 기술되었다. 문헌[참조: Illum et al., FEBS Lett., 1984. 167, 79]에는 폴리스티렌 입자를 중합체성 글리콜로 친수성 피복하면 혈액 반감기가 상당히 향상된다는 것이 언급되었다. 폴리알킬렌 글리콜(예: PEG)의 카복실 그룹의 부착에 의해 변형된 합성 인지질은 시어스(Sears)의 미국특허 제4,426,330호 및 제4,534,899호에 기술되어 있다. 문헌[참조: Klibanov et al., FEBS Lett., 1990, 268, 235]에는 PEG 또는 PEG 스테아레이트로 유도체화된 포스파티딜에탄올아민(PE)을 포함하는 리포좀이 혈액 순환 반감기를 상당히 증가시킴을 입증하는 실험이 기술되었다. 문헌[참조: Blume et al., Biochemica et Biopbysica Acta, 1990, 1029, 91]에서는 이러한 관찰을 다른 PEG-유도체화된 인지질, 예를 들면, 디스테아로일포스파티딜에탄올아민(DSPE) 및 PEG의 배합으로부터 형성된 DSPE-PEG로 확장시켰다. 외부 표면에 공유결합된 PEG 잔기를 갖는 리포좀은 피셔(Fisher)의 유럽 특허 제0 445 131 Bl호 및 국제공개공보 제WO 90/04384호에 기술되어 있다. PEG로 유도체화된 1 내지 20몰%의 PE를 함유하는 리포좀 조성물 및 이의 사용 방법은 우들(Woodle) 등의 미국 특허 제5,013,556호 및 제5,356,633호 및 마틴(Martin) 등의 미국 특허 제5,213,804호 및 유럽 특허 제0 496 813 Bl호에 기술되어 있다. 다수의 다른 지질-중합체 접합체를 포함하는 리포좀은 마틴(Martin) 등의 국제공개공보 제WO 91/05545호 및 미국 특허 제5,225,212호 및 잘립스키(Zalipsky) 등의 국제공개공보 제WO 94/20073호에 기술되어 있다. PEG-변형된 세라마이드 지질을 포함하는 리포좀은 최(Choi) 등의 국제공개공보 제WO 96/10391호에 기술되어 있다. 미야자키(Miyazaki) 등의 미국 특허 제5,540,935호 및 다가와(Tagawa) 등의 미국 특허 제5,556,948호에는 표면에서 관능성 잔기로 추가로 유도체화될 수 있는 PEG-함유 리포좀이 기술되어 있다.
핵산을 포함하는 제한된 수의 리포좀이 당업계에 공지되어 있다. 티에리(Thierry) 등의 국제공개공보 제WO 96/40062호에는 리포좀 안에 고분자량 핵산을 캡슐화하는 방법이 기술되고 있다. 다가와(Tagawa) 등의 미국 특허 제5,264,221호에는 단백질-결합된 리포좀이 기술되어 있으며, 이러한 리포좀의 내용물이 dsRNA RNA를 포함할 수 있다고 주장하고 있다. 라흐만(Rahman) 등의 미국특허 제5,665,710호에는 리포좀 안에 올리고데옥시뉴클레오타이드를 캡슐화하는 특정 방법이 기술되어 있다. 로브(Love) 등의 국제공개공보 제WO 97/04787호에는 raf 유전자에 대해 표적화된 dsRNA(들)을 포함하는 리포좀이 기술되어 있다.
트랜스퍼좀(transfersome)은 또 다른 유형의 리포좀이며, 약물 전달 비히클용으로 매력적인 후보물질인 고도로 변형가능한 지질 응집체이다. 트랜스퍼좀은 고도로 변형가능하여 액적보다 작은 공극을 통해 투과할 수 있는 지질 액적으로서 기술될 수 있다. 트랜스퍼좀은 이들이 사용되는 환경에 적용될 수 있는데, 예를 들면, 이들은 자가-최적화되고(피부내 공극의 형태에 적용가능), 자가-복구성이고, 단편화되지 않으면서 이들의 표적에 도달하고, 종종 자가-로딩(self-loading)한다. 트랜스퍼좀을 제조하기 위하여, 표면 가장자리-활성화제(edge-activator), 일반적으로 계면활성제를 표준 리포좀 조성물에 첨가할 수 있다. 포랜스퍼좀은 피부에 혈청 알부민을 전달하는데 사용되었다. 트랜스퍼좀-매개된 혈청 알부민의 전달은 혈청 알부민을 함유하는 용액의 피하 주사만큼 효과적인 것으로 밝혀졌다.
계면활성제는 에멀젼(예: 마이크로에멀젼) 및 리포좀과 같은 제형에서 광범위한 적용성을 갖는다. 많은 상이한 종류의 천연 및 합성 계면활성제의 특성을 분류하고 등급을 부여하는 가장 일반적인 방법은 친수성/친지성 균형(HLB)을 사용하는 것이다. 친수성 그룹("헤드"로도 공지됨)의 특성은 제형에 사용된 상이한 계면활성제를 분류하는 가장 유용한 수단을 제공한다[참조: Rieger, in Pharmaceutical Dosage Forms, Marcel Dekker, Inc., New York, N. Y., 1988, p. 285].
계면활성제 분자가 이온화되지 않는 경우, 이는 비이온성 계면활성제로 분류된다. 비이온성 계면활성제는 약제학적 및 화장 제품에서 광범위한 적용성을 갖고 광범위한 pH 값에서 유용하다. 일반적으로 이들의 HLB 값은 이들의 구조에 따라 2 내지 약 18의 범위이다. 비이온성 계면활성제에는 에틸렌 글리콜 에스테르, 프로필렌 글리콜 에스테르, 글리세릴 에스테르, 폴리글리세릴 에스테르, 소르비탄 에스테르, 수크로스 에스테르 및 에톡실화된 에스테르와 같은 비이온성 에스테르가 포함된다. 지방산 알코올 에톡실레이트, 프로폭실화된 알코올 및 에톡실화된/프로폭실화된 블록 중합체와 같은 비이온성 알칸올아미드 및 에테르도 당해 계열에 포함된다. 폴리옥시에틸렌 계면활성제는 비이온성 계면활성제 계열 중 가장 널리 사용되는 일원이다.
계면활성제 분자가 물 속에 용해되거나 분산될 때 음전하를 보유하는 경우, 이러한 계면활성제는 음이온성으로 분류된다. 음이온성 계면활성제에는 카복실레이트, 예를 들면 비누, 아실 락틸레이트, 아미노산의 아실 아미드, 알킬 설페이트 및 에톡실화된 알킬 설페이트와 같은 황산의 에스테르, 알킬 벤젠 설포네이트와 같은 설포네이트, 아실 이소티오네이트, 아실 타우레이트 및 설포석시네이트 및 포스페이트가 포함된다. 음이온성 계면활성제 계열의 가장 중요한 일원은 알킬 설페이트 및 비누이다.
계면활성제 분자가 물 속에 용해되거나 분산될 때 양전하를 보유하는 경우, 이러한 계면활성제는 양이온성으로 분류한다. 양이온성 계면활성제에는 4급 암모늄 염 및 에톡실화된 아민이 포함된다. 4급 암모늄 염은 당해 계열 중 가장 많이 사용되는 일원이다.
계면활성제 분자가 양전하 또는 음전하를 보유할 수 있는 능력을 갖는 경우, 이러한 계면활성제는 양쪽성으로 분류된다. 양쪽성 계면활성제에는 아크릴산 유도체, 치환된 알킬아미드, N-알킬베타인 및 포스파티드가 포함된다.
약물 제품, 제형 및 에멀젼에서의 계면활성제의 사용이 고찰되었다[참조: Rieger, in Pharmaceutical Dosage Forms, Marcel Dekker, Inc., New York, N Y,, 1988, p. 285].
침투 향상제
하나의 양태에서, 본 발명은 핵산, 특히 dsRNA를 동물의 피부에 효율적으로 전달하기 위하여 다양한 침투 향상제를 사용한다. 대부분의 약물은 이온화된 및 비이온화된 형태로 용액 중에 존재한다. 그러나, 일반적으로 지용성 또는 친지성 약물만이 세포막을 쉽게 통과한다. 통과될 막을 침투 향상제로 처리하면, 비-친지성 약물도 세포막을 통과할 수 있음이 밝혀졌다. 세포막을 통한 비-친지성 약물의 확산을 보조하는 것 외에도, 침투 향상제는 친지성 약물의 투과성도 향상시킨다.
침투 향상제는 5개의 광범위한 범주, 즉 계면활성제, 지방산, 담즙염, 킬레이트제 및 비-킬레이트성 비-계면활성제 중 하나에 속하도록 분류될 수 있다[참조: Lee et al., Critical Reviews in Therapeutic Drug Carrier Systems, 1991, p.92]. 위에서 언급한 각가의 계열의 침투 향상제는 아래에서 더 상세히 기술한다.
계면활성제: 본 발명과 관련하여, 계면활성제(또는 "표면활성제")는 수용액 중에 용해되는 경우, 용액의 표면 장력 또는 수용액과 다른 액체 사이의 계면 장력을 감소시켜, 점막을 통한 dsRNA의 흡수를 향상시키는 화학 물질이다. 담즙산 및 지방산 외에도, 이러한 침투 향상제에는, 예를 들면, 나트륨 라우릴 설페이트, 폴리옥시에틸렌-9-라우릴 에테르 및 폴리옥시에틸렌-20-세틸 에테르[참조: Lee et al., Critical Reviews in Therapeutic Drug Carrier Systems, 1991, p.92]; 및 퍼플루오로케미칼 에멀젼, 예를 들면 FC-43[참조: Takahashi et al., J. Pharma. Pharmacol., 1988, 40, 252]이 포함된다.
지방산: 침투 향상제로서 작용하는 다양한 지방산 및 이들의 유도체에는, 예를 들면, 올레산, 라우르산, 카프르산(n-데칸산), 미리스트산, 팔미트산, 스테아르산, 리놀레산, 리놀렌산, 디카프레이트, 트리카프레이트, 모노올레인(1-모노올레오일-락-글리세롤), 디라우린, 카프릴산, 아라키돈산, 글리세롤 1-모노카프레이트, 1-도데실아자사이클로헵탄-2-온, 아실카르니틴, 아실콜린, 이의 C1 -10 알킬 에스테르(예: 메틸, 이소프로필 및 t-부틸), 및 이의 모노- 및 디-글리세라이드(예: 올레에이트, 라우레이트, 카프레이트, 미리스테이트, 팔미테이트, 스테아레이트, 리놀레이트 등)가 포함된다[참조: Lee et al., Critical Reviews in Therapeutic 'Drug Carryier Systems, 1991, p.92; Muranishi, Critical Reviews in Therapeutic Drug Carrier Systems, 1990, 7, 1-33; El Hariri et al., J. Pharm. Pharmacol, 1992, 44, 651-654].
담즙염: 담즙의 생리학적 역할에는 지질 및 지용성 비타민의 분산 및 흡수의 촉진이 포함된다[참조: Brunton Chapter 38 in: Goodman & Gilman's The Pharmacological Basis of Therapeutics. 9th Ed.. Hardman et al., Eds., McGraw-Hill New York. 1906, pp. 934-935]. 다양한 천연 담즙염, 및 이들의 합성 유도체는 침투 향상제로서 작용한다. 따라서, 용어 "담즙염"에는 담즙의 임의의 천연 성분, 및 이들의 임의의 합성 유도체가 포함된다. 본 발명의 담즘염에는, 예를 들면, 콜산(또는 이의 약제학적으로 허용되는 나트륨 염, 나트륨 콜레이트), 데하이드로콜산(나트륨 데하이드로콜레이트), 데옥시콜산(나트륨 데옥시콜레이트), 글루콜산(나트륨 글루콜레이트), 글리콜산(나트륨 글리코콜레이트), 글리코데옥시콜산(나트륨 글리코데옥시콜레이트), 타우로콜산(나트륨 타우로콜레이트), 타우로데옥시콜산(나트륨 타우로데옥시콜레이트), 케노데옥시콜산(나트륨 케노데옥시콜레이트), 우르소데옥시콜산(UDCA), 나트륨 타우로-24,25-디하이드로-푸시데이트(STDHF), 나트륨 글리코디하이드루푸시데이트 및 폴리옥시에틸렌-9-라우릴 에테르(POE)가 포함된다[참조: Lee et al., Critical Reviews in Therapeutic Drug Carrier Systems, 1991, page 92; Swinyard, Chapter 39 in: Remington's Pharmaceutical Sciences, 18th Ed., Gennaro, ed., Mack Publishing Co., Easton. Pa., 1990, pages 782-783; Mutanishi, Critical Reviews in Therapeutic Drug Carrier Systems, 1990, 7, 1-33; Yamamoto et al., J. Pharm. Exp. Ther., 1992, 263, 25; Yamashita et al., J. Pharm. Sci., 1990, 79, 579-583].
킬레이트제: 본 발명과 관련하여 사용되는 킬레이트제는 이와 착물을 형성함으로써 용액으로부터 금속 이온을 제거하여, 점막을 통한 dsRNA의 흡수를 향상시키는 화합물로 정의될 수 있다. 본 발명에서의 침투 향상제로서의 이들의 용도와 관련하여, 킬레이트제는 DNase 억제제로서의 역할도 하는 추가적인 장점을 갖는데, 그 이유는 가장 특징적인 DNA 뉴클레아제가 촉매작용을 위하여 2가 금속 이온을 필요로 하기 때문에 킬레이트제에 의해 억제되기 때문이다[참조: Jarrett. J, Chromatogr., 1993, 618, 315-339]. 본 발명의 킬레이트제에는 이나트륨 에틸렌디아민테트라아세테이트(EDTA), 시트르산, 살리실레이트(예: 나트륨 살리실레이트, 5-메톡시살리실레이트 및 호모바닐레이트), 콜라겐의 N-아실 유도체, 베타-디케톤의 라우레쓰-9 및 N-아미노 아실 유도체(엔아민)이 포함되지만, 이에 제한되는 것은 아니다[참조: Lee et al., Critical Reviews in Therapeutic Drug Carrier Systems, 1991, page 92; Muranishi, Critical Reviews in Therapeutic Drug Carrier Systems, 1990, 7, 1-33; Buur et al, J. Control Rel, 1990, 14, 43-51].
비-킬레이트성 비-계면활성제: 본원에 사용되는 비-킬레이트성 비-계면활성제 침투 증진 화합물은 킬레이트제 또는 계면활성제로서는 현저한 활성을 나타내지 않지만, 그럼에도 불구하고 소화 점막을 통한 dsRNA의 흡수를 향상시키는 화합물로서 정의될 수 있다[참조: Muranishi, Critical Reviews in Therapeutic Drug Carrier Systems, 1990, 7, 1-33]. 이러한 계열의 침투 향상제에는, 예를 들면, 불포화된 사이클릭 우레아, 1-알킬- 및 1-알케닐아자사이클로-알카논 유도체[참조: Lee et al., Critical Reviews in Therapeutic Drug Carrier Systems, 1991, page 92]; 및 비-스테로이드성 소염제, 예를 들면 디클로페낙 나트륨, 인도메타신 및 페닐부타존[참조: Yamashita et al., J. Pharm. Pharmacol. 1987, 39, 621-626]이 포함된다.
세포 수준에서 dsRNA의 흡수를 향상시키는 제제를 또한 본 발명의 약제학적 조성물 및 기타 조성물에 첨가할 수 있다. 예를 들면, 리포펙틴과 같은 양이온성 지질[참조: 주니치(Junichi) 등의 미국 특허 제5,705,188호], 양이온성 글리세롤 유도체 및 다양이온성(polycationic) 분자, 예를 들면 폴리리신[참조: 롤로(Lollo) 등의 PCT 출원 제WO 97/30731호]은 또한 dsRNA의 세포 흡수를 향상시키는 것으로 공지되어 있다.
에틸렌 글리콜 및 프로필렌 글리콜과 같은 글리콜, 2-피롤과 같은 피롤, 아존, 및 리모넨 및 멘톤과 같은 테르펜을 포함하는 다른 제제를 사용하여, 투여된 핵산의 침투를 향상시킬 수 있다.
담체
본 발명의 특정 조성물은 또한 제형 안에 담체 화합물을 혼입한다. 본원에 사용되는 "담체 화합물" 또는 "담체"는 불활성(즉, 그 자체로는 생물학적 활성을 갖지 않는다)이지만, 예를 들면, 생물학적 활성 핵산을 분해하거나 또는 순환으로부터 핵산의 제거를 촉진시킴으로써, 생물학적 활성을 갖는 핵산의 생체이용률을 감소시키는 생체내 과정에 의해 핵산으로서 인지되는 핵산 또는 이의 유사체를 말할 수 있다. 핵산과 담체 화합물의 공동투여(통상적으로 담체 화합물은 과량이다)는, 아마도 공통 수용체에 대한 담체 화합물과 핵산 사이의 경쟁으로 인하여, 간, 신장 및 기타 순환계외 저장기(reservoir)에서 회수되는 핵산의 양을 상당히 감소시킬 수 있다. 예를 들어, 간 조직에서 부분적 포스포로티오에이트 dsRNA의 회수는, 이것이 폴리이노신산, 덱스트란 설페이트, 폴리시티드산 또는 4-아세트아미도-4'-이소티오시아노-스틸벤-2,2'-디설폰산과 공동투여되는 경우에 감소될 수 있다[참조: Miyao et al., DsRNA Res. Dev,, 1995, 5, 1 15-121; Takakura et al., DsRNA & Nucl. Acid Drug Dev., 1996, 6, 177-183].
부형제
담체 화합물과 대조적으로, "약제학적 담체" 또는 "부형제"는 하나 이상의 핵산을 동물에게 전달하기 위한 약제학적으로 허용되는 용매, 현탁화제 또는 임의의 다른 약리학적으로 불활성인 비히클이다. 부형제는 액체 또는 고체일 수 있으며, 계획된 투여 방식을 염두에 두고, 제공된 약제학적 조성물의 핵산 및 다른 성분과 배합되는 경우 바람직한 용적, 점도 등을 제공하도록 선택한다. 통상적인 약제학적 담체에는 결합제(예: 예비젤라틴화된 옥수수 전분, 폴리비닐피롤리돈 또는 하이드록시프로필 메틸셀룰로스 등); 충전재(예: 락토스 및 기타 당, 미세결정성 셀룰로스, 펙틴, 젤라틴, 황산칼슘, 에틸 셀룰로스, 폴리아크릴레이트 또는 인산수소칼슘 등); 윤활제(예: 마그네슘 스테아레이트, 활석, 실리카, 콜로이드성 이산화규소, 스테아르산, 메탈릭 스테아레이트, 수소화된 식물성 오일, 옥수수 전분, 폴리에틸렌 글리콜, 나트륨 벤조에이트, 나트륨 아세테이트 등); 붕해제(예: 전분, 나트륨 전분 글리콜레이트 등); 및 습윤제(예: 나트륨 라우릴 설페이트 등)이 포함되지만, 이에 제한되는 것은 아니다.
핵산과 유해하게 반응하지 않는 경구 투여에 적합한 약제학적으로 허용되는 유기 또는 무기 부형제를 사용하여 본 발명의 조성물을 제형화할 수도 있다. 적합한 약제학적으로 허용되는 담체에는 물, 염 용액, 알코올, 폴리에틸렌 글리콜, 젤라틴, 락토스, 아밀로스, 마그네슘 스테아레이트, 활석, 실릭산, 점성 파라핀, 하이드록시메틸셀룰로스, 폴리비닐피롤리돈 등이 포함되지만, 이에 제한되는 것은 아니다.
핵산의 국소 투여용 제형은 알코올과 같은 일반적인 용매 중의 멸균 및 비-멸균 수용액, 비-수성 용액, 또는 액체 또는 고체 오일 기제 중의 핵산 용액을 포함할 수 있다. 용액은 완충제, 희석제 및 기타 적합한 첨가제를 함유할 수도 있다. 핵산과 유해하게 반응하지 않는 경구 투여에 적합한 약제학적으로 허용되는 유기 또는 무기 부형제를 사용할 수 있다.
적합한 약제학적으로 허용되는 부형제에는 물, 염 용액, 알코올, 폴리에틸렌 글리콜, 젤라틴, 락토스, 아밀로스, 마그네슘 스테아레이트, 활석, 실릭산, 점성 파라핀, 하이드록시메틸셀룰로스, 폴리비닐피롤리돈 등이 포함되지만, 이에 제한되는 것은 아니다.
기타 성분
본 발명의 조성물은 약제학적 조성물 중에 통상적으로 발견되는 기타 보조제 성분을 당업계에 확립된 사용 수준으로 추가적으로 함유할 수 있다. 따라서, 예를 들면, 조성물은, 예를 들면, 항소양제, 수렴제, 국소 마취제 또는 소염제와 같은 추가의 상용성 약제학적 활성 물질을 함유할 수 있거나, 또는 염료, 풍미제, 보존제, 항산화제, 유백화제, 증점제 및 안정화제와 같이 본 발명의 조성물의 각종 투여형을 물리학적으로 제형화하는데 유용한 추가적인 물질을 함유할 수 있다. 그러나, 이러한 물질은, 첨가되는 경우, 본 발명의 조성물의 성분의 생물학적 활성을 과도하게 방해하지 않아야 한다. 제형은 멸균될 수 있으며, 경우에 따라 제형의 핵산(들)과 유해하게 상호작용하지 않는 보조제, 예를 들면, 윤활제, 보존제, 안정화제, 습윤제, 유화제, 삼투압에 영향을 미치는 염, 완충제, 착색제, 풍미제 및/또는 방향족 물질 등과 혼합될 수 있다.
수성 현탁액제는, 예를 들면, 나트륨 카복시메틸셀룰로스, 소르비톨 및/또는 덱스트란을 포함하는 현탁액의 점도를 증가시키는 물질을 함유할 수 있다. 현탁액제는 안정화제를 함유할 수도 있다.
본 발명의 특정 양태는 (a) 하나 이상의 안티센스 화합물 및 (b) 비-안티센스 기전에 의해 기능하는 하나 이상의 다른 화학치료제를 함유하는 약제학적 조성물을 제공한다. 이러한 화학치료제의 예는 다우노루비신, 다우노마이신, 닥티노마이신, 독소루비신, 에피루비신, 이다루비신, 에소루비신, 블레오마이신, 마포스파미드, 이포스파미드, 시토신 아라비노사이드, 비스-클로로에틸니트로스우레아, 부설판, 마이토마이신 C, 악티노마이신 D, 미트라마이신, 프레드니손, 하이드록시프로게스테론, 테스토스테론, 타목시펜, 다카르바진, 프로카르바진, 헥사메틸멜라민, 펜타메틸멜라민, 미톡산트론, 암사크린, 클로람부실, 메틸사이클로헥실니트로스우레아, 질소 무스타드, 멜팔란, 사이클로포스파미드, 6-머캅토퓨린, 6-티오구아닌, 사이타라빈, 5-아자시티딘, 하이드록시우레아, 데옥시코포르마이신, 4-하이드록시퍼옥시사이클로포스포르-아미드, 5-플루오로우라실(5-FU), 5-플루오로데옥시우리딘(5-FUdR), 메토트렉세이트(MTX), 콜치킨, 탁솔, 빈크리스틴, 빈블라스틴, 에토포시드(VP-16), 트리메트렉세이트, 이리노테칸, 토포테칸, 겜시타빈, 테니포시드, 시스플라틴 및 디에틸스틸베스트롤(DES)이 포함되지만, 이에 제한되는 것은 아니다[참조: The Merck Manual of Diagnosis and Therapy, 15th Ed. 1987, pp. 1206-1228, Berkow et al, eds., Rahway, N.J.]. 본 발명의 화합물과 함께 사용되는 경우, 이러한 화학치료제는 개별적으로 (예: 5-FU 및 올리고뉴클레오타이드), 순차적으로 (예: 일정 기간 동안 5-FU 및 올리고뉴클레오타이드를 사용하고 나서, MTX 및 올리고뉴클레오타이드를 사용), 또는 하나 이상의 다른 이러한 화학치료제와 함께 (예: 5-FU, MTX 및 올리고뉴클레오타이드, 또는 5-FU, 방사치료요법 및 올리고뉴클레오타이드) 사용될 수 있다. 비스테로이드성 소염 약물 및 코르티코스테로이드를 포함하나, 이에 한정되지 않는 소염 약물, 및 리비비린, 비다라빈, 아시클로비르 및 간시클로비르를 포함하나, 이에 한정되지 않는 항바이러스 약물도 본 발명의 조성물에 배합될 수 있다[참조: The Merck Manual of Diagnosis and Therapy, 15th Ed., Berkow et al., eds., 1987, Rahway, NJ., pages 2499-2506 및 46-49, 각각). 기타 비-안티센스 화학치료제도 본 발명의 범위 내에 있다. 2개 이상의 배합된 화합물을 함께 또는 순차적으로 사용할 수 있다.
이러한 화합물의 독성 및 치료 효능은, 예를 들면, LD50(집단의 50%에 대해 치명적인 용량) 및 ED50(집단의 50%에서 치료학적으로 유효한 용량)을 측정하기 위하여, 세포 배양물 또는 실험 동물에서 표준 약제학적 방법에 의해 측정할 수 있다. 독성과 치료 효과 사이의 용량 비를 치료 지수(therapeutic index)라고 하며, 이는 LD50/ED50의 비로 나타낼 수 있다. 높은 치료 지수를 나타내는 화합물이 바람직하다.
세포 배양 검정 및 동물 연구로부터 얻은 데이터는 사람에서 사용하기 위한 용량 범위를 공식화하는데 사용할 수 있다. 본 발명의 조성물의 용량은 일반적으로 독성이 거의 없거나 또는 전혀 없는 ED50을 포함하는 순환 농도의 범위 내에 있다. 용량은 사용된 투여형 및 사용된 투여 경로에 따라 상기 범위 내에서 달라질 수 있다. 본 발명의 방법에 사용된 어떠한 화합물의 경우에도, 치료학적 유효량을 초기에는 세포 배양 검정으로부터 평가할 수 있다. 투여량을 동물 모델에서 공식화하여 화합물의 순환 혈장 농도 범위를 달성하거나, 또는 경우에 따라, 세포 배양물 속에서 측정된 IC50(즉, 증상의 최대 억제의 1/2을 달성하는 시험 화합물의 농도)을 포함하는 표적 서열의 폴리펩타이드 생성물의 순환 혈장 농도 범위(예: 폴리펩타이드의 감소된 농도 달성)를 달성할 수 있다. 이러한 정보를 사용하여 사람에서 유용한 투여량을 더 정확하게 결정할 수 있다. 혈장 수준은, 예를 들면, 고성능 액체 크로마토그래피에 의해 측정할 수 있다.
앞서 논의한 바와 같이, 개별적으로 또는 다수로 투여하는 것 외에도, 본 발명의 dsRNA는 Eg5 발현에 의해 매개되는 병리학적 과정의 치료에 효과적인 것으로 공지된 다른 제제와 함께 투여할 수 있다. 어떠한 경우에서도, 투여하는 주치의는 당업계에 공지되거나 본원에 기술된 효능의 표준 척도를 사용하여 관찰된 결과를 기준으로 하여 dsRNA의 투여량 및 투여 시기를 조절할 수 있다.
Eg5
유전자의 발현에 의해 발생하는 질병을 치료하는 방법
본 발명은 특히, 암을 치료하기 위한, 예를 들면, 종양 성장 및 종양 전이를 억제하기 위한, dsRNA 또는 이로부터 제조된 약제학적 조성물의 용도에 관한 것이다. 예를 들어, dsRNA 또는 이로부터 제조된 약제학적 조성물은 유방암, 폐암, 두경부암, 뇌암, 복부암, 결장암, 결장직장암, 식도암, 위장관암, 아교종, 간암, 설암, 신경모세포종, 골육종, 난소암, 췌장암, 전립선암, 망막모세포종, 윌름스 종양(Wilm's tumor), 다발성 골수종과 같은 고형 종양의 치료 및 흑색종과 같은 피부암의 치료, 림프종 및 혈액암의 치료에 사용될 수 있다. 본 발명은 또한 Eg5 발현을 억제하고/하거나 상이한 종류의 암, 예를 들면, 유방암, 폐암, 두부암, 경부암, 뇌암, 복부암, 결장암, 결장직장암, 식도암, 위장관암, 아교종, 간암, 설암, 신경모세포종, 골육종, 난소암, 췌장암, 전립선암, 망막모세포종, 윌름스 종양, 다발성 골수종, 피부암, 흑색종, 림프종 및 혈액암에서 복수 및 흉막 삼출물의 축적을 억제하기 위한 본 발명에 따른 dsRNA 또는 이로부터 제조된 약제학적 조성물의 용도에 관한 것이다. Eg5 발현에 미치는 억제 효과로 인하여, 본 발명에 따른 dsRNA 또는 이로부터 제조된 약제학적 조성물은 삶의 질을 향상시킬 수 있다.
본 발명은 또한, 다른 약제 및/또는 다른 치료 방법 (예: 공지된 약제 및/또는 공지된 치료 방법, 예를 들면, 암을 치료하고/하거나 종양 전이를 예방하기 위해 현재 사용되는 것들)과 함께 사용되어, 예를 들면, 암을 치료하거나 또는 종양 전이를 예방하기 위한, dsRNA 또는 이의 약제학적 조성물의 용도에 관한 것이다. 방사선 치료요법 및 화학치료제, 예를 들면 시스플라틴, 사이클로포스파미드, 5-플루오로우라실, 아드리아마이신, 다우노루비신 또는 타목시펜과 함께 사용되는 것이 바람직하다. 다른 양태는 VEGF의 발현을 억제하기 위해 사용되는 제2의 dsRNA의 사용을 포함한다.
본 발명은 특정 RNAi 제제와 함께, 임의의 통상적인 화학치료제와 같은 다른 항암 화학치료제 또는 VEGF의 발현을 억제하는데 사용되는 다른 dsRNA를 함께 포함시켜 실시할 수도 있다. 특정 결합제와 이러한 다른 제제의 배합은 화학치료 프로토콜을 강화시킬 수 있다. 숙련된 의료인은 본 발명의 방법에 도입시킬 수 있는 것으로서 다수의 화학치료 프로토콜을 염두에 둘 것이다. 알킬화제, 항대사물질, 호르몬 및 길항제, 방사선동위원소, 및 천연 생성물을 포함하는 어떠한 화학치료제도 사용할 수 있다. 예를 들어, 본 발명의 화합물은 독소루비신 및 기타 안트라사이클린 유사체와 같은 항생제, 사이클로포스파미드와 같은 질소 머스타드, 5-플루오로우라실과 같은 피리미딘 유사체, 시스플라틴, 하이드록시우레아, 탁솔 및 이의 천연 및 합성 유도체 등과 함께 투여될 수 있다. 다른 예로서, 종양이 생식선자극호르몬-의존성 및 생식선자극호르몬-독립성 세포를 포함하는, 유방 선암종과 같은 혼합 종양의 경우에, 화합물은 류프롤라이드 또는 고세렐린(LH-RH의 합성 펩타이드 유사체)와 함께 투여될 수 있다. 다른 항신생물 프로토콜은 테트라사이클린 화합물과 함께, 본원에서 "항신생물 보조 양식"으로도 언급된 다른 치료 양식, 예를 들면, 수술, 방사선 등의 사용을 포함한다. 따라서, 본 발명의 방법은 부작용을 감소시키고 효능을 향상시키는 이점이 있는 이러한 통상적인 방법과 함께 사용될 수 있다.
Eg5
유전자의 발현을 억제하는 방법
또 다른 양상에서, 본 발명은 포유동물에서 Eg5 유전자의 발현을 억제하는 방법을 제공한다. 당해 방법은 본 발명의 조성물을 포유동물에게 투여함으로써 표적 Eg5 유전자의 발현이 사일런싱되게 되도록 함을 포함한다. 높은 특이성으로 인하여, 본 발명의 dsRNA는 표적 Eg5 유전자의 표적 RNA(1차 또는 프로세싱된)를 특이적으로 표적화한다. dsRNA를 사용하여 이러한 Eg5 유전자의 발현을 억제하는 조성물 및 방법은 본원에서 기술된 바와 같이 수행할 수 있다.
하나의 양태에서, 당해 방법은 dsRNA를 포함하는 조성물을 투여함을 포함하며, 여기서 dsRNA는 치료될 포유동물의 Eg5 유전자의 RNA 전사체의 적어도 일부에 상보적인 뉴클레오타이드 서열을 포함한다. 치료될 유기체가 사람과 같은 포유동물인 경우, 조성물은 경구 또는 비경구 경로, 예를 들면 정맥내, 근육내, 피하, 경피, 기도(에어로졸), 비강, 직장 및 국소(예: 구강 및 설하) 투여를 포함하지만, 이에 한정되지 않는 당업계에 공지된 어떠한 방법으로도 투여할 수 있다. 바람직한 양태에서, 조성물은 정맥내 주입 또는 주사에 의해 투여된다.
달리 정의하지 않는 한, 본원에서 사용된 모든 기술적 및 과학적 용어는 본 발명이 속한 당업계의 숙련자가 통상적으로 이해되는 바와 동일한 의미를 갖는다. 본원에 기술된 것과 유사하거나 동등한 방법 및 물질을 본 발명의 실시 또는 시험에 사용할 수 있지만, 적합한 방법 및 물질이 아래에 기술되어 있다. 본원에 언급된 모든 공보, 특허원, 특허 및 기타 참조 문헌은 전문이 참조로 인용된다. 상충되는 경우, 정의들을 포함하는 본 명세서가 주가 될 것이다. 또한, 물질, 방법 및 실시예는 단지 예시적인 것이며 제한하려는 의도가 아니다.
Eg5
유전자의 유전자 워킹(
Gene
Walking
)
초기 스크리닝 세트
siRNA 설계를 수행하여 Eg5(KIF11, HSKP, KNSL1 및 TRIP5로도 공지됨)를 표적화하는 siRNA를 확인하였다. Eg5에 대한 사람 mRNA 서열, RefSeq 확인번호: NM_004523을 사용하였다.
사람 및 마우스 Eg5에 대하여 교차반응성인 siRNA 듀플렉스를 설계하였다. 24개의 듀플렉스를 스크리닝을 위하여 합성하였다(표 1).
확장된 스크리닝 세트
사람 EG5를 표적화하는 266개의 siRNA 및 이의 리서스(rhesus) 원숭이 오르토로그(ortholog)를 사용하여 제2 스크리닝 세트를 정의하였다(표 2). 다른 종의 어떠한 EG5 mRNA를 히트(hit)할 필요없이, 사람 EG5를 표적화하는 328개의 siRNA를 사용하여, 확장된 스크리닝 세트를 선택하였다(표 3).
사람 및 부분적인 리서스 EG5 mRNA에 대한 서열을 NCBI 뉴클레오타이드 데이터베이스로부터 다운로드하고, 사람 서열을 또한 참조 서열로서 사용하였다(사람 EG5: NM_004523.2, 4908 bp, 및 리서스 EG5: XM_001087644.1, 878 bp(사람 EG5의 단지 5' 부분).
추가의 리서스 EG5 서열을 확인하기 위하여 사람 서열을 사용한 메가 블라스트(mega blast) 검색을 NCBI에서 리서스 참조 게놈에 대해 수행하였다. 다운로드한 리서스 서열 및 블라스트 히트에서의 히트 영역을 전체 길이에 걸쳐 사람 EG5에 대해 약 92%의 동일성을 갖는 리서스 컨센서스(consensus) 서열에 어셈블리(assembly)하였다.
모든 가능한 19량체를 사람 mRNA 서열로부터 추출하여, 사람-반응성 EG5 siRNA의 4890(센스 쇄) 서열에 상응하는 후보 표적 부위의 풀(pool)을 생성하였다.
사람-리서스 교차반응성은 상기 후보 풀로부터 초기 스크리닝 세트를 위한 siRNA의 인실리코(in silico) 선별에 있어서 필수요건이다. 리서스-반응성 siRNA를 판정하기 위하여, 각각의 후보 siRNA 표적 부위를 어셈블리된 리서스 서열에서의 존재에 대해 조사하였다. 또한, 사람-리서스 교차반응성 siRNA의 풀로부터의 선별을 위한 기준으로서 siRNA의 예측된 특이성은, 사람 EG5 mRNA 서열은 표적화하지만 다른 사람 mRNA는 표적화하지 않음에 의해 나타났다.
siRNA의 특이성은 "비표적(off-target) 유전자"라고 하는 다른 유전자를 표적화할 가능성을 통해 나타낼 수 있다.
siRNA의 비표적 가능성을 예측하기 위해, 다음과 같이 가정하였다:
1) 쇄의 비표적 가능성은 비표적에 대한 미스매치의 수 및 분포로부터 유추할 수 있다.
2) 가장 관련성이 있는 비표적(즉, 미스매치가 용인되어 사일런싱될 가능성이 가장 높을 것으로 예측되는 유전자)은 쇄의 비표적 가능성을 결정한다.
3) 쇄의 2 내지 9번 위치(5'에서 3'으로 계수)(시드 영역(seed region))는 서열의 나머지(비-시드 및 절단 부위 영역)보다 비표적 가능성에 더 기여할 수 있다.
4) 쇄의 10 및 11번 위치(5'에서 3'으로 계수)(절단 부위 영역)는 비-시드 영역(즉, 5'에서 3'으로 계수하여 12 내지 18번 위치)보다 비표적 가능성에 더 기여할 수 있다.
5) 각각의 쇄의 1 및 19번 위치는 비표적 상호작용에 관련되어 있지 않다.
6) 비표적 가능성은 가정 3) 내지 5)를 고려하여 비표적 유전자에서 가장 상동성인 영역에 대한 쇄의 미스매치의 수 및 위치를 기준으로 하여 계산한, 가장 관련된 비표적의 비표적 점수에 의해 나타낼 수 있다.
7) 안티센스 쇄와 센스 쇄의 비표적 가능성은 관련이 있을 것이지만, 도입된 내부 변형에 의해 센스 쇄 활성이 소실될 가능성이 있을 것으로 보인다.
낮은 비표적 가능성을 갖는 siRNA를 바람직한 것으로 정의하였고, 더 특이적인 것으로 가정하였다.
사람 EG5-특이적 siRNA를 확인하기 위하여, 잠재적인 비표적으로 고려되었던 모든 다른 사람 전사체를 사람-리서스 교차반응성 19량체 센스 쇄 서열 및 상보적 인 안티센스 쇄에 대한 가능한 표적 영역에 대해 조사하였다. 이를 위하여, fastA 알고리듬을 사용하여, 종합적인 사람 트랜스크립톰(transcriptome)을 나타낸다고 본 발명자들이 가정한 사람 RefSeq 데이터베이스의 각각의 서열에서 가장 상동성인 히트 영역을 결정하였다.
가정 3) 내지 5)에 따라 모든 가능한 비표적을 정렬시키고, 이로써 가장 관련이 있는 비표적 유전자 및 이의 비표적 점수를 확인하기 위하여, fastA 출력 파일을 펄 스크립트(perl script)에 의해 추가로 분석하였다.
스크립트는 각각의 19량체 입력 서열 및 각각의 비표적 유전자에 대한 다음의 비표적 특성을 추출하여 비표적 점수를 계산하였다:
비-시드 영역내 미스매치의 수
시드 영역내 미스매치의 수
절단 부위 영역내 미스매치의 수.
비표적 점수는 가정 3) 내지 5)를 고려하여 다음과 같이 계산하였다:
비표적 점수 = 시드 미스매치의 수 * 10
+ 절단 부위 미스매치의 수 * 1.2
+ 비-시드 미스매치의 수 * 1
각각의 19량체 서열에 대한 가장 관련이 있는 비표적 유전자는 최저 비표적 점수를 갖는 유전자로 정의하였다. 따라서, 최저 비표적 점수는 쇄의 비표적 가능성을 나타내는 것으로 정의하였다.
표 2의 스크리닝 세트의 경우, 안티센스 쇄는 3점 이상, 그리고 센스 쇄는 2 점 이상의 비표적 점수를 siRNA의 선택을 위한 필수요건으로서 선택하였지만, 4개 이상의 연속적인 G(폴리-G 서열)을 함유하는 모든 서열은 제외시켰다. 특이성 기준을 통과하는 266개의 사람-리서스 교차반응성 서열을 이러한 컷-오프(cut-off)를 기준으로 선별하였다(표 2 참조).
확장된 스크리닝 세트의 정의를 위하여, 리서스에 대한 교차반응성을 폐기하고, 새로이 이용가능한 사람 RefSeq 데이터베이스를 기초로 예측된 특이성을 재계산하여, 안티센스 및 센스 쇄에 대해 2.2 이상의 비표적 점수를 갖는 328개의 비-폴리-G siRNA만을 선별하였다(표 3 참조).
표에서 사용된 기호 - A, G, C, U, 리보뉴클레오타이드; T, 데옥시티미딘; u, c, 2'-O-메틸 뉴클레오타이드; s, 포스포로티오에이트 연결
dsRNA
합성
시약 공급원
시약의 공급원이 본원에서 특별히 제공되지 않는 경우, 이러한 시약은 분자생물학에서의 적용을 위한 품질/순도 표준으로 분자생물학용 시약의 어떠한 공급업자로부터도 입수할 수 있다.
siRNA
합성
일본쇄 RNA를, 엑스퍼다이트 8909 합성기(Expedite 8909 synthesizer)[판매원: 독일, 다름슈타트 소재의 어플라이드 바이오시스템스(Applied Biosystems), 아 플레라 도이칠란트 게엠베하(Applera Deutschland GmbH)] 및 조절된 공극 유리[CPG, 500Å, 판매원: 독일 함부르크 소재의 프롤리고 바이오케미 게엠베하(Proligo Biochemie GmbH)]를 고체 지지체로서 사용하여 1 μmole의 규모로 고체상 합성에 의해 제조하였다. RNA 및 2'-O-메틸 뉴클레오타이드를 함유하는 RNA를, 상응하는 포스포르아미디트 및 2'-O-메틸 포스포르아미디트[판매원: 독일 함부르크 소재의 프롤리고 바이오케미 게엠베하]를 각각 사용하여 고체상 합성에 의해 생성시켰다. 이들 빌딩 블록(building block)을 문헌[참조: Current protocols in nucleic acid chemistry, Beaucage, S. L. et al. (Edrs.), John Wiley & Sons, Inc., New York, NY, USA]에 기술된 바와 같은 표준 뉴클레오사이드 포스포르아미디트 화학을 사용하여 올리고리보뉴클레오타이드 쇄의 서열 내에 선택 부위에 혼입시켰다. 아세토니트릴(1%) 중의 뷰케이지(Beaucage) 시약[판매원: 영국 글라스고우 소재의 크루아켐 리미티트(Chruachem Ltd.)]의 용액으로 요오드 산화제 용액을 치환시켜 포스포로티오에이트 연결을 도입하였다. 추가의 보조 시약을 판매원[독일 그리스하임 소재의 말린크로트 바커(Mallinchrodt Baker)]로부터 입수하였다.
음이온 교환 HPLC에 의한 조 올리고리보뉴클레오타이드의 탈보호 및 정제를 확립된 방법에 따라 수행하였다. 수율 및 농도를 스펙트럼 광도계[DU 640B, 판매원: 독일 운터슐라이쓰하임 소재의 베크만 코울터 게엠베하(Beckman Coulter GmbH)]를 사용하여 260nm의 파장에서 각각의 RNA의 용액의 UV 흡광도에 의해 측정하였다. 이본쇄 RNA는 상응하는 쇄의 등몰 용액을 어닐링 완충액(20mM 인산나트륨, pH 6.8; 100mM 염화나트륨) 중에서 혼합시켜 생성시키고, 수조에서 85 내지 90 ℃로 3분 동안 가열하고 3 내지 4시간에 걸쳐 실온으로 냉각시켰다. 어닐링된 RNA 용액을 사용할 때까지 -20℃에서 저장하였다.
3'-콜레스테롤-접합된 siRNA(본원에서 -Chol-3'이라고 함)의 합성을 위하여, 적절히 변형된 고체 지지체를 RNA 합성에 사용하였다. 변형된 고체 지지체는 다음과 같이 제조하였다:
디에틸-2-아자부탄-1,4-디카복실레이트 (화학식 AA)
4.7M 수산화나트륨 수용액(50mL)을 수중의 에틸 글리시네이트 하이드로클로라이드(32.19 g, 0.23 mole)의 교반되고 빙-냉각시킨 용액(50mL) 속에 첨가하였다. 이어서, 에틸 아크릴레이트(23.1 g, 0.23 mole)를 첨가하고, TLC에 의해 반응 완료가 확인될 때까지 혼합물을 실온에서 교반하였다. 19시간 후 용액을 디클로로메탄(3 x 100 mL)으로 분배하였다. 유기층을 무수 황산나트륨으로 건조시켜, 여과하고, 증발시켰다. 잔류물을 증류시켜 AA(28.8 g, 61%)를 수득하였다.
3-{에톡시카보닐메틸-[6-(9H-플루오렌-9-일메톡시카보닐-아미노)-헥사노일]-아미노}-프로피온산 에틸 에스테르 (화학식 AB)
Fmoc-6-아미노-헥사노산(9.12 g, 25.83 mmol)을 디클로로메탄(50mL) 중에 용해시키고 얼음으로 냉각시켰다. 디이소프로필카보디이미드(3.25 g, 3.99 mL, 25.83 mmol)를 0℃에서 당해 용액에 첨가하였다. 이어서, 디에틸-아자부탄-1,4-디카복실레이트(5 g, 24.6 mmol) 및 디메틸아미노 피리딘(0.305 g, 2.5 mmol)을 첨가하였다. 용액을 실온으로 되도록 하고 추가로 6시간 동안 교반하였다. 반응의 완료를 TLC에 의해 확인하였다. 반응 혼합물을 진공 하에서 농축시키고 에틸 아세테이트를 첨가하여 디이소프로필 우레아를 침전시켰다. 현탁액을 여과하였다. 여과액을 5% 수성 염산, 5% 중탄산나트륨 및 물로 세척하였다. 합한 유기층을 황산나트륨 상에서 건조시키고 농축시켜, 조 생성물을 수득하고, 이를 칼럼 크로마토그래피(50% EtOAC/헥산)에 의해 정제하여 11.87 g(88%)의 AB를 수득하였다.
3-[(6-아미노-헥사노일)-에톡시카보닐메틸-아미노]-프로피온산 에틸 에스테르 (화학식 AC)
3-{에톡시카보닐메틸[6-(9H-플루오렌-9-일메톡시카보닐아미노)-헥사노닐]-아 미노}-프로피온산 에틸 에스테르 AB(11.5 g, 21.3 mmol)를 디메틸포름아미드 중의 20% 피페리딘 중에 0℃에서 용해시켰다. 당해 용액을 1시간 동안 계속 교반하였다. 반응 혼합물을 진공 하에서 농축시켜, 물을 잔류물에 첨가하고, 생성물을 에틸 아세테이트로 추출하였다. 조 생성물을 이의 하이드로클로라이드 염으로 전환시켜 정제하였다.
3-({6-[17-(1,5-디메틸-헥실)-10,13-디메틸-2,3,4,7,8,9,10,11,12,13,14,15, 16,17-테트라데카하이드로-1H-사이클로펜타[a]페난트렌-3-일옥시카보닐아미노]-헥사노일)에톡시카보닐메틸-아미노)-프로피온산 에틸 에스테르 (화학식 AD)
3-[(6-아미노-헥사노일)-에톡시카보닐메틸-아미노]-프로피온산 에틸 에스테르 AC의 하이드로클로라이드 염(4.7 g, 14.8 mmol)을 디클로로메탄 중에 흡수시켰다. 현탁액을 얼음 상에서 0℃로 냉각시켰다. 현탁액에 디이소프로필에틸아민(3.87 g, 5.2 mL, 30 mmol)을 첨가하였다. 생성된 용액에 콜레스테릴 클로로포르메이트(6.675 g, 14.8 mmol)를 첨가하였다. 반응 혼합물을 하룻밤 동안 교반하였다. 반응 혼합물을 디클로로메탄으로 희석시키고 10% 염산으로 세척하였다. 생 성물을 플래시 크로마토그래피에 의해 정제하였다 (10.3 g, 92%).
1-{6-[17-(1,5-디메틸-헥실)-10,13-디메틸-2,3,4,7,8,9,10,11,12,13,14,15,16,17-테트라데카하이드로-1H-사이클로펜타[a]페난트렌-3-일옥시카보닐아미노]-헥사노일}-4-옥소-피롤리딘-3-카복실산 에틸 에스테르 (화학식 AE)
칼륨 t-부톡사이드(1.1 g, 9.8 mmol)를 30mL의 무수 톨루엔 속에서 슬러리화하였다. 혼합물을 얼음 상에서 0℃로 냉각시키고 5g(6.6 mmol)의 디에스테르 AD를 교반하면서 20분 이내에 서서히 첨가하였다. 첨가하는 동안 온도를 5℃ 이하로 유지시켰다. 0℃에서 30분 동안 계속 교반하고 1mL의 빙초산을 가한 즉시, 40mL의 물 중의 4g의 NaH2PO4·H2O를 첨가하였다. 생성된 혼합물을 100mL의 디클로로메탄으로 각각 2회 추출하고 합한 유기 추출물을 10mL의 인산염 완충액으로 각각 2회 세척하고, 건조시키고, 증발 건조시켰다. 잔류물을 60mL의 톨루엔 중에 용해시켜, 0℃로 냉각시키고, pH 9.5의 냉 탄산염 완충액의 50mL 3분획으로 추출하였다. 수 성 추출물을 인산으로 pH 3으로 조절하여, 클로로포름의 40mL 5분획으로 추출하고, 이를 합하여, 건조시키고 증발 건조시켰다. 잔류물을 25% 에틸아세테이트/헥산을 사용한 칼럼 크로마토그래피에 의해 정제하여 1.9g의 b-케토에스테르(39%)를 수득하였다.
[6-(3-하이드록시-4-하이드록시메틸-피롤리딘-1-일)-6-옥소-헥실]-카밤산 17-(1,5-디메틸-헥실)-10,13-디메틸-2,3,4,7,8,9,10,11,13,14,15,16,17-테트라데카하이드로-1H-사이클로펜타[a]페난트렌-3-일 에스테르 (화학식 AF)
메탄올(2 mL)을 테트라하이드로푸란(10mL) 중의 b-케토에스테르 AE(1.5 g, 2.2 mmol) 및 나트륨 보로하이드라이드(0.226 g, 6 mmol)의 환류 혼합물에 1시간에 걸쳐 적가하였다. 환류 온도에서 1시간 동안 교반을 계속하였다. 실온으로 냉각시킨 후, 1N HCl(12.5 mL)를 첨가하고, 혼합물을 에틸아세테이트(3 x 40 mL)로 추출하였다. 합한 에틸아세테이트 층을 무수 황산마그네슘 상에서 건조시키고, 진공 하에서 농축시켜 생성물을 수득하고, 이를 칼럼 크로마토그래피(10% MeOH/CHCl3)에 의해 정제하였다 (89%).
(6-{3-[비스-(4-메톡시-페닐)-페닐-메톡시메틸]-4-하이드록시-피롤리딘-1-일}-6-옥소-헥실)-카밤산 17-(1,5-디메틸-헥실)-10,13-디메틸-2,3,4,7,8,9,10,11,12,13,14,15,16,17-테트라데카하이드로-1H-사이클로펜타[a]페난트렌-3-일에스테르 (화학식 AG)
디올 AF(1.25 g, 1.994 mmol)를 진공 하에서 피리딘(2 x 5 mL)과 함께 증발시켜 건조하였다. 무수 피리딘(1O mL) 및 4,4'-디메톡시트리틸클로라이드(0.724 g, 2.13 mmol)를 교반하면서 첨가하였다. 반응을 실온에서 하룻밤 동안 수행하였다. 메탄올을 첨가하여 반응물을 냉각시켰다. 반응 혼합물을 진공 하에서 농축시키고 잔류물에 디클로로메탄(50 mL)을 첨가하였다. 유기층을 1M 수성 중탄산나트륨으로 세척하였다. 유기층을 무수 황산나트륨 상에서 건조시켜, 여과하고, 농축시켰다. 잔류 피리딘을 톨루엔과 함께 증발시켜 제거하였다. 조 생성물을 칼럼 크로마토그래피(2% MeOH/클로로포름, 5% MeOH/CHCl3 중에서 Rf = 0.5)에 의해 정제 하였다 (1.75 g, 95%).
석신산 모노-(4-[비스-(4-메톡시-페닐)-페닐-메톡시메틸]-1-{6-[17-(1,5-디메틸-헥실)-10,13-디메틸-2,3,4,7,8,9,10,11,12,13,14,15,16,17-테트라데카하이드로-1H-사이클로펜타[a]페난트렌-3-일옥시카보닐아미노]-헥사노일}-피롤리딘-3-일)에스테르 (화학식 AH)
화합물 AG(1.0 g, 1.05 mmol)를 석신산 무수물(0.150 g, 1.5 mmol) 및 DMAP (0.073 g, 0.6 mmol)과 혼합하고 진공 하에서 40℃에서 하룻밤 동안 건조시켰다. 혼합물을 무수 디클로로에탄(3mL) 중에 용해시키고, 트리에틸아민(0.318 g, 0.440 mL, 3.15 mmol)을 첨가하고, 용액을 실온에서 아르곤 대기 하에서 16시간 동안 교반하였다. 이어서, 이를 디클로로메탄(40mL)으로 희석시키고 빙냉 수성 시트르산(5 중량%, 30mL) 및 물(2 X 20 mL)로 세척하였다. 유기상을 무수 황산나트륨 상에서 건조시키고 농축 건조시켰다. 잔류물은 그 자체로서 다음 단계에 사용하였다.
콜레스테롤 유도체화된 CPG (화학식 AI)
석시네이트 AH(0.254 g, 0.242 mmol)를 디클로로메탄/아세토니트릴(3:2, 3 mL)의 혼합물에 용해시켰다. 당해 용액에, 아세토니트릴(1.25mL) 중의 DMAP (0.0296 g, 0.242mmol), 아세토니트릴/디클로로에탄(3:1, 1.25mL) 중의 2,2'-디티오-비스(5-니트로피리딘)(0.075g, 0.242mmol)을 연속하여 첨가하였다. 생성된 용액에 아세토니르릴(0.6ml) 중의 트리페닐포스핀(0.064g, 0.242mmol)을 첨가하였다. 반응 혼합물의 색이 밝은 오렌지색으로 변하였다. 용액을 손목동작 진탕기(wrist-action shaker)를 사용하여 잠시 동안 교반하였다 (5분). 장쇄 알킬 아민-CPG(LCAA-CPG)(1.5g, 61mM)를 첨가하였다. 현탁액을 2시간 동안 교반하였다. CPG를 소결된 깔대기를 통해 여과시키고 아세토니트릴, 디클로로메탄 및 에테르로 연속해서 세척하였다. 반응하지 않은 아미노 그룹을 아세트산 무수물/피리딘을 사용하여 차폐시켰다. CPG의 달성된 로딩을 UV 측정에 의해 측정하였다 (37mM/g).
5'-12-도데칸산 비스데실아미드 그룹(본원에서 "5'-C32-"라고 함) 또는 5'- 콜레스테릴 유도체 그룹(본원에서 "5'-Chol-"이라고 함)을 갖는 siRNA의 합성을 국제공개공보 제WO 2004/065601호에 기술된 바와 같이 수행하였고, 단, 콜레스테릴 유도체의 경우, 산화 단계를 뷰케이지 시약을 사용하여 수행함으로써 핵산 올리고머의 5'-말단에 포스포로티오에이트 연결을 도입시켰다.
핵산 서열은 아래에서 표준 명명법 및 특히 표 4의 약어를 사용하여 제시된다.
dsRNA
발현 벡터
본 발명의 다른 양상에서, Eg5 유전자 발현 활성을 조절하는 Eg5 특이적인 dsRNA 분자는 DNA 또는 RNA 벡터 속으로 삽입된 전사 단위로부터 발현된다[참조: Couture, A, et al., TIG. (1996), 12:5-10; Skillem. A., et al., 국제 PCT 특허 공보 제WO 00/22113호, Conrad, 국제 PCT 특허 공보 제WO 00/22114호, 및 Conrad, 미국 특허 제6,054,299호]. 이들 전이유전자(transgene)는, 숙주 게놈 속으로 통합된 전이유전자로서 혼입되어 유전될 수 있는, 선형 작제물, 환형 플라스미드 또는 바이러스 벡터로서 도입될 수 있다. 전이유전자는 염색체외 플라스미드로서 유전되도록 작제될 수도 있다[참조: Gassmann, et al., Proc . Natl . Acad . Sci . USA(1995) 92:1292].
dsRNA의 개개의 쇄는 2개의 별개의 발현 벡터 상에서 프로모터에 의해 전사되어 표적 세포 속으로 공동-형질감염될 수 있다. 또는, dsRNA의 각각의 개개 쇄는 둘다 동일한 발현 플라스미드 상에 위치하는 프로모터에 의해 전사될 수 있다. 바람직한 양태에서, dsRNA는 링커 폴리뉴클레오타이드 서열에 의해 연결된 역위 반복부(inverted repeat)로서 발현되어, dsRNA가 스템 앤 루프(stem and loop) 구조를 갖게 된다.
재조합 dsRNA 발현 벡터는 일반적으로 DNA 플라스미드 또는 바이러스 벡터이다. dsRNA 발현 바이러스 벡터는 아데노-관련 바이러스[참조: Muryczka, et al., Curr. Topics Micro . Immunol. (1992) 158:97-129]; 아데노바이러스[참조: Berkner, et al., BioTechniques(1998) 6:616], Rosenfeld et al.(1991, Science 252:431-434), 및 Rosenfeld et al.(1992), Cell 68:143-155)]; 또는 알파바이러스 및 당업계에 공지된 기타 바이러스를 기초로 하여 작제할 수 있지만, 이에 제한되는 것은 아니다. 레트로바이러스는 시험관내 및/또는 생체내에서 상피 세포를 포함하는 많은 상이한 세포 종류 속으로 다양한 유전자를 도입시키는데 사용되었다[참조: Eglitis, et al., Science (1985) 230:1395-1398; Danos and Mulligan, Proc. Natl . Acad Sci . USA (1998) 85:6460-6464; Wilson et al., 1988, Proc. Natl, Acad. Sci. USA 85:3014-3018; Armentano et al., 1990, Proc. Natl. Acad. Sci. USA 87:6141-6145; Huber et al., 1991, Proc. Natl. Acad. Sci. USA 88:8039-8043; Ferry et al., 1991, Proc. Natl. Acad. Sci. USA 88:8377-8381; Chowdhury et al., 1991, Science 254:1802-1805; van Beusechem. et al., 1992, Proc. Natl, Acad. Sci. USA 80:7640-19; Kay et al., 1992, Human Gene Therapy 3:641-647; Dai et al., 1992, Proc. Natl. Acad. Sci. USA 89: 10892-10895; Hwu et al., 1993. J, Immunol. 150:4104-4115; 미국 특허 제4,868,116호: 미국 특허 제4,980,286호: PCT 출원 제WO 89/07136호; PCT 출원 제WO 89/02468호; PCT 출원 제WO 89/05345호; 및 PCT 출원 제WO 92/07573호]. 형질도입시킬 수 있고 세포의 게놈 속으로 삽입된 유전자를 발현시킬 수 있는 재조합 레트로바이러스 벡터는, 재조합 레트로바이러스 게놈을 PA317 및 Psi-CRIP와 같은 적합한 패키징 세포주 속으로 형질감염시킴에 의해 생성할 수 있다[참조: Comette et al., 1991, Human Gene Therapy 2:5-10; Cone et al., 1984, Froc, Natl. Acad. Sci. USA 81:6349]. 재조합 아데노 바이러스 벡터는 감염되기 쉬운 숙주(예: 랫트, 햄스터, 개 및 침팬지)에서 다양한 세포 및 조직을 감염시키는데 사용될 수 있으며[참조: Hsu et al., 1992, J. Infectious Disease, 166:769], 또한 감염을 위해 유사분열적으로 활성인 세포를 필요로 하지 않는다는 장점을 갖는다.
본 발명의 DNA 플라스미드 또는 바이러스 벡터에서 dsRNA가 발현되게 하는 프로모터는 진핵생물 RNA 폴리머라제 I(예: 리보솜 RNA 프로모터), RNA 폴리머라제 II(예: CMV 초기 프로모터 또는 액틴 프로모터 또는 U1 snRNA 프로모터) 또는 일반적으로 RNA 폴리머라제 III 프로모터(예: U6 snRNA 또는 7SK RNA 프로모터) 또는 원핵생물 프로모터, 예를 들면, T7 프로모터일 수 있으며, 단, 발현 플라스미드는 또한 T7 프로모터로부터의 전사에 필요한 T7 RNA 폴리머라제를 암호화한다. 프로모터는 또한 췌장으로 전이유전자 발현을 지시할 수 있다 [예: 췌장용 인슐린 조절 서열(참조: Bucchini et al., 1986, Proc. Natl. Acad. Sci, USA 83:2511-2515)].
또한, 전이유전자의 발현은, 예를 들면, 특정 생리학적 조절인자, 예를 들면, 순환 글루코스 수준, 또는 호르몬에 대해 민감성인 조절 서열과 같은 유도성 조절 서열 및 발현 시스템을 사용함으로써 정확하게 조절될 수 있다[참조: Docherty et al., 1994, FASEB J. 8:20-24]. 세포 또는 포유동물에서 전이유전자 발현을 조절하는데 적합한 이러한 유도성 발현 시스템에는 엑디손, 에스트로겐, 프로게스테론, 테트라사이클린, 이량체화의 화학적 유도인자 및 이소프로필-베타-D1-티오갈락토피라노사이드(EPTG)에 의한 조절이 포함된다. 당업자는 dsRNA 전이유전자의 의도된 용도에 따라 적절한 조절/프로모터 서열을 선택할 수 있을 것이다.
일반적으로, dsRNA 분자를 발현시킬 수 있는 재조합 벡터는 후술한 바와 같이 전달되어 표적 세포에서 유지된다. 또는, dsRNA 분자의 일시적인 발현을 제공하는 바이러스 벡터를 사용할 수 있다. 이러한 벡터는 경우에 따라 반복적으로 투여될 수 있다. 일단 발현되면, dsRNA는 표적 RNA에 결합하여 이의 기능 또는 발현을 조절한다. dsRNA를 발현하는 벡터의 전달은 정맥내 또는 근육내 투여에 의해, 또는 환자로부터 외식된(ex-planted) 표적 세포에 투여한 후 환자에게 재도입시킴에 의해, 또는 목적한 표적 세포 속으로 도입되게 하는 임의의 다른 수단에 의해서와 같이 전신적일 수 있다.
dsRNA 발현 DNA 플라스미드는 통상적으로 양이온성 지질 담체(예: 올리고펙타민) 또는 비-양이온성 지질계 담체(예: Transit-TKOTM)를 사용하여 복합체로서 표적 세포 속으로 형질감염된다. 단일 Eg5 유전자 또는 다수의 Eg5 유전자의 상이한 영역을 표적화하는 dsRNA-매개된 녹다운(knockdown)을 위한 1주 이상의 기간에 걸친 다중 지질 형질감염이 또한 본 발명에 의해 고려된다. 숙주 세포 속으로의 본 발명의 벡터의 성공적인 도입은 다양한 공지된 방법을 사용하여 모니터할 수 있다. 예를 들어, 일시적인 형질감염은 녹색 형광 단백질(GFP)과 같은 형광 마커와 같은 리포터를 사용하여 시그날화될 수 있다. 생체외 세포의 안정한 형질감염은 특정한 환경 인자에 대한 내성(예: 하이그로마이신 B 내성)을 형질감염된 세포에 제공하는 마커(예: 항생제 및 약물)를 사용하여 확인할 수 있다.
Eg5 특이적인 dsRNA 분자는 또한 벡터 속으로 삽입되어 사람 환자용 유전자 치료요법 벡터로서 사용될 수 있다. 유전자 치료요법 벡터는, 예를 들면, 정맥내 주사, 국소 투여[참조: 미국 특허 제5,328,470호]에 의해, 또는 정위(stereotactic) 주사[참조: Chen et al. (1994) proc. Natl. Acad. Sci. USA 91:3054-3057]에 의해 피험자에게 전달될 수 있다. 유전자 치료요법 벡터의 약제학적 제제는 허용되는 희석제 중의 유전자 치료요법 벡터를 포함할 수 있거나, 또는 유전자 전달 비히클이 포매된 서방성 매트릭스를 포함할 수 있다. 또는, 완전한 유전자 전달 벡터가 재조합 세포로부터 온전하게 생성될 수 있는 경우 (예: 레트로바이러스 벡터), 약제학적 제제는 유전자 전달 시스템을 생성하는 하나 이상의 세포를 포함할 수 있다.
세포 증식을 통한 Eg5 siRNA 시험관내 스크리닝
Eg5의 사일런싱은 유사분열 정지를 일으키는 것으로 밝혀졌기 때문에[참조: Weil, D, et al (2002) Biotechniques 33: 1244-8], 세포 생존성 검정을 siRNA 활성 스크리닝에 사용하였다. 헬라 세포(HeLa cell)(웰당 14000개 [스크리닝 1 및 3] 또는 웰당 10000개 [스크리닝 2])를 96-웰 플레이트에 접종하고, 30nM의 웰 중 최종 siRNA 농도 및 50nM(1차 스크리닝) 및 25nM(2차 스크리링)의 최종 농도에서 리포펙타민(Lipofectamine) 2000[판매원: 인비트로겐(Invitrogen)]으로 동시에 형질감염시켰다. 듀플렉스의 부분집합을 3차 스크리닝에서 25nM에서 시험하였다(표 5).
형질감염 후 72시간 후, WST-1 시약[판매원: 로슈(Roche)]을 배양 배지에 첨가하고 나서, 450nm에서 흡광도를 측정하여 세포 증식을 검정하였다. 대조군(비-형질감염된) 세포의 흡광도 값을 100%로 간주하고, siRNA 형질감염된 웰의 흡광도를 대조군 값과 비교하였다. 검정은 각각의 3개 스크리닝에 대해 6중으로 수행하였다. siRNA의 부분집합을 siRNA 농도 범위에서 추가로 시험하였다. 검정은 헬라 세포(웰당 14000개; 위에서와 동일한 방법, 표 5)에서 수행하였다.
표 5에서 최대 성장 억제를 나타낸 9개의 siRNA 듀플렉스를 헬라 세포에서 siRNA 농도의 범위에서 재-시험하였다. 시험한 siRNA 농도는 100nM, 33.3nM, 11.1nM, 3.70nM, 1.23nM, 0.41nM, 0.14nM 및 0.046nM이었다. 검정은 6중으로 수행하였으며, 세포 증식을 50% 억제하는 각각의 siRNA의 농도(IC50)를 계산하였다. 이러한 용량-반응 분석은 각각의 듀플렉스에 대해 2회 내지 4회 수행하였다. 평균 IC50 값(nM)을 표 6에 제시한다.
세포 증식을 통한 Eg5 siRNA 시험관내 스크리닝
형질감염 직전에, 헬라 S3[ATCC 번호: CCL-2.2, 독일 베젤 소재의 프로모켐 게엠베하(Promochem GmbH)] 세포를 96-웰 플레이트[독일 프릭켄하우젠 소재의 그라이너 바이오-원 게엠베하(Greiner Bio-One GmbH)] 상에서 1.5 x 104개 세포/웰로 75㎕의 성장 배지[햄스(Ham's) F12, 10% 태아 송아지 혈청, 1O0u 페니실린/100㎍/ml 스트렙토마이신, 모두 독일 베를린 소재의 바이오크롬 아게(Biochrom AG)로부터 입수] 중에 접종하였다. 형질감염은 4중으로 수행하였다. 각각의 웰에 대해 0.5㎕의 리포펙타민2000[판매원: 독일 칼스루헤 소재의 인비트로겐 게엠베하(Invitrogen GmbH)]을 12㎕의 Opti-MEM[판매원: 인비트로겐]과 혼합하고 15분 동안 실온에서 항온배양하였다. siRNA 농도가 100㎕의 형질감염 용적에서 50nM인 경우, 5㎕의 siRNA 중 1㎕를 웰당 11.5㎕의 Opti-MEM과 혼합하고, 리포펙타민2000-Opti-MEM 혼합물과 합하여, 다시 실온에서 15분 동안 항온배양하였다. siRNA-리포펙타민2000-복합체를 세포에 완전히(웰당 25㎕) 가하고 세포를 24시간 동안 37℃ 및 5% CO2에서 습윤 배양기[판매원: 하나우 소재의 헤라에우스 게엠베하(Heraeus GmbH)]에서 항온배양하였다. 단일 용량의 스크리닝을 각각 50nM 및 25nM에서 1회 수행하였다.
50㎕의 용해(lysis) 혼합물[미국 프레몬트 소재의 게노스펙트라(Genospectra)로부터의 QuantiGene bDNA-키트의 내용물]을 100㎕의 성장 배지를 함유하는 각각의 웰에 가하여, 세포를 수거하고, 53℃에서 30분 동안 용해시켰다. 이후에, 50㎕의 용해물을 사람 Eg5 및 사람 GAPDH에 대해 특이적인 프로브세트와 함께 항온처리하고 QuantiGene의 제조업자의 프로토콜에 따라 진행시켰다. 마지막에 화학발광을 Victor2-Light[판매원: 독일 비스바덴 소재의 퍼킨 엘머(Perkin Elmer)]에서 RLU(상대적인 광 단위)로서 측정하고, hEg5 프로브세트를 사용하여 얻은 값을 각각의 웰의 경우 각각의 GAPDH 값에 대해 정규화하였다. Eg5에 대해 지시된 siRNA를 사용하여 얻은 값은 100%로 정한 비특이적인 siRNA(HCV에 대해 지시됨)를 사용하여 얻은 값과 관련되었다(표 1, 2 및 3).
스크리닝으로부터 유효한 siRNA를 용량 반응 곡선에 의해 추가로 특성규명하였다. 용량 반응 곡선의 형질감염은 100nM, 16.7nM, 2.8nM, 0.46nM, 77pM, 12.8pM, 2.1pM, 0.35pM, 59.5fM, 9.9fM 및 모크(mock: siRNA 부재) 농도에서 수행하고 Opti-MEM으로 상기 프로토콜에 따라 12.5㎕의 최종 농도로 희석시켰다. 데이터 분석은 마이크로소프트 엑셀이 포함된 소프트웨어 XL-fit 4.2[판매원: 영국 서리 길드포드 소재의 아이디비에스(IDBS)]를 사용하고 용량 반응 모델 205번을 적용시켜 수행하였다(표 1, 2 및 3).
리드(lead) siRNA AD12115를 로슈로부터의 WST-증식 검정을 적용시켜(위에서 기술한 바와 같이) 추가로 분석하였다.
최대 활성을 나타낸 표 2로부터의 34개의 듀플렉스의 부분집합을 100nM 내지 10fM 범위의 최종 농도에서 헬라 세포에서의 형질감염에 의해 검정하였다. 형질감염은 4중으로 수행하였다. 2회의 용량-반응 검정을 각각의 듀플렉스에 대해 수행하였다. KSP mRNA가 20%, 50% 및 80% 감소되게 하는 농도(IC20, IC50 및 IC80)를 각각의 듀플렉스에 대해 계산하였다(표 7).
LNP01
제형화된
siRNA
의 단일 일시(
bolus
) 투여 후 성장기(
juvenile
)
랫트에서의
간
Eg5
/
KSP
의
사일런싱
출생시부터 대략 23일령까지, Eg5/KSP 발현은 성장중인 랫트 간에서 검출할 수 있다. 제형화된 Eg5/KSP siRNA를 사용한 표적 사일런싱을 성장기 랫트에서 평가하였다.
시험한 KSP 듀플렉스
방법
동물 투여. 수컷 성장기 Sprague-Dawley 랫트(19일령)에 꼬리 정맥 주사를 통해 리피도이드("LNP01") 제형화된 siRNA의 단일 용량을 투여하였다. 10마리의 그룹에 AD6248 또는 비특이적인 siRNA를 체중kg당 10mg (10mg/kg)의 용량으로 투여하였다. 용량 수준은 제형으로 투여되는 siRNA 듀플렉스의 양을 말한다. 제3 그룹에는 인산염-완충된 염수를 투여하였다. 동물을 siRNA 투여 2일 후에 희생시켰다. 간을 절제하여, 액체 질소에서 급속 동결시키고 분말로 분쇄시켰다.
mRNA 측정. Eg5/KSP mRNA의 수준을 모든 처리 그룹으로부터의 간에서 측정하였다. 각각의 간 분말의 샘플(대략 10mg)을 프로테이나제 K를 함유하는 조직 용해 완충액 중에서 균질화하였다. Eg5/KSP 및 GAPDH mRNA의 수준을 퀀티젠(Quantigene) 분지(branched) DNA 검정[판매원: 게노스펙트라(GenoSpectra)]을 사용하여 각각의 샘플에 대해 3중으로 측정하였다. Eg5/KSP에 대한 평균값을 각각의 샘플의 경우 평균 GAPDH 값에 대해 정규화하였다. 그룹 평균을 계산하여 각각의 실험의 경우 PBS 그룹에 대해 정규화하였다.
통계적 분석. ANOVA에 이어서 튜키 사후 검정(Tukey post-hoc test)에 의해 유의성을 계산하였다.
결과
데이터 요약
Eg5/KSP mRNA에 대한 평균값(±표준편차)을 제시한다. PBS 그룹에 대한 통계적 유의성(p 값)이 제시되어 있다 (유의적이지 않음 : p>0.05).
실험 1
제형화된 AD6248을 10mg/kg의 용량으로 처리한 후, 간 Eg5/KSP mRNA가 통계적으로 유의하게 감소되었다.
LNP01
제형화된
siRNA
듀플렉스의
정맥내
주입 후
랫트
간
VEGF
의
사일런싱
2개의 siRNA의 등몰 혼합물을 포함하는 "리피도이드" 제형을 랫트에게 투여하였다. 하나의 siRNA(AD3133)는 VEGF에 대해 지시되었다. 다른 하나(AD12115)는 Eg5/KSP에 대해 지시되었다. Eg5/KSP 발현은 성체 랫트 간에서 거의 검출불가능하므로, siRNA 처리 후 VEGF 수준만을 측정하였다.
투여된 siRNA 듀플렉스
기호 - A,G,C,U, 리보뉴클레오타이드; c, u, 2'-O-Me 리보뉴클레오타이드; s, 포스포로티오에이트.
방법
동물 투여. 성체 암컷 Sprague-Dawley 랫트에 대퇴 정맥 속으로 2시간 주입에 의해 리피도이드("LNP01") 제형화된 siRNA를 투여하였다. 4마리의 그룹에는 5, 10 및 15mg/체중kg (mg/kg)의 제형화된 siRNA의 용량을 투여하였다. 용량 수준은 제형으로 투여되는 siRNA 듀플렉스의 총량을 말한다. 4번째 그룹에는 인산염 완충된 염수를 투여하였다. siRNA 주입 완료 72시간 후 동물을 희생시켰다. 간을 절제하여, 액체 질소에서 급속 동결시키고 분말로 분쇄시켰다.
제형 과정
리피도이드 ND98-4HCl(분자량 1487)(화학식 1), 콜레스테롤[판매원: 시그마-알드리히(Sigma-Aldrich)] 및 PEG-세라마이드 C16[판매원: 아반티 폴라 리피즈(Avanti Polar Lipids)]를 사용하여 지질-siRNA 나노입자를 제조하였다. 에탄올중의 각각의 원액을 제조하였다: ND98, 133mg/mL; 콜레스테롤, 25mg/mL, PEG-세라마이드 C16, 100mg/mL. 이어서, ND98, 콜레스테롤 및 PEG-세라마이드 C16 원액을 42:48:10의 몰 비로 합하였다. 합한 지질 용액을 수성 siRNA(아세트산나트륨(pH 5) 중의 수성 siRNA)와 신속하게 혼합시켜 최종 에탄올 농도가 35 내지 45%가 되도록 하고 최종 아세트산나트륨 농도가 100 내지 300mM이 되도록 하였다. 혼합시 지질-siRNA 나노입자가 자발적으로 형성되었다. 원하는 입자 크기 분포에 따라, 써모배럴 압출기(thermobarrel extruder)(리펙스 익스트루더(Lipex Extruder)[판매원: 노던 리피드 인코포레이티드(Northern Lipids, Inc.)]를 사용하여, 폴리카보네이트 막(100nm 컷-오프)을 통해, 생성된 나노입자 혼합물을 일부 경우에 압출시켰다. 다른 경우에는 압출 단계를 생략하였다. 에탄올 제거 및 동시적인 완충제 교환을 투석 또는 접선 유동 여과에 의해 달성하였다. 완충액을 포스페이트 완충된 염수(PBS)(pH 7.2)로 교환하였다.
제형의 특성규명
표준 방법 또는 압출-제외 방법에 의해 제조된 제형을 유사한 방식으로 특성규명한다. 제형을 먼저 육안 검사에 의해 특성규명한다. 이들은 응집물 또는 침전물이 없는 백색의 투명한 용액이어야 한다. 지질-나노입자의 입자 크기 및 입자 크기 분포는 Malvern Zetasizer Nano ZS[판매원: 미국 소재의 맬버른(Malvern)]를 사용하여 동적 광 산란에 의해 측정한다. 입자는 20 내지 300nm이며, 이상적으로는 40 내지 100nm의 크기이다. 입자 크기 분포은 단일모드이어야 한다. 제형 중의 총 siRNA 농도 및 포획된 분획은 염료 배제 검정(dye exclusion assay)을 사용하여 평가한다. 제형화된 siRNA의 샘플을 RNA-결합 염료 리보그린(Ribogreen)[판매원: 몰레큘러 프로브스(Molecular Probes)]과 함께, 제형을 파괴하는 계면활성제, 0.5% 트리톤 X-100의 존재 또는 부재 하에서 항온처리한다. 제형 중의 총 siRNA를, 표준 곡선과 비교하여, 계면활성제를 함유하는 샘플로부터의 시그날에 의해 측정하였다. 포획된 분획은 총 siRNA 함량으로부터 "유리" siRNA 함량(계면활성제의 부재 하에서의 시그날에 의해 측정됨)을 감산하여 계산한다. 포획된 siRNA 의 %는 통상적으로 >85%이다.
mRNA 측정. 각각의 간 분말(대락 10mg)의 샘플을 프로테이나제 K를 함유하는 조직 용해 완충액 중에서 균질화하였다. VEGF 및 GAPDH mRNA의 수준을 각각의 샘플에 대해 퀀티젠 분지 DNA 검정[판매원: 게노스펙트라(GenoSpectra)]을 사용하여 3중으로 측정하였다. VEGF에 대한 평균값을 각각의 샘플의 경우 평균 GAPDH 값에 대해 정규화하였다. 그룹 평균을 계산하여 각각의 실험의 경우 PBS 그룹에 대해 정규화하였다.
단백질 측정. 각각의 간 분말(대략 60mg)의 샘플을 1ml의 RIPA 완충액 중에서 균질화하였다. 총 단백질 농도를 마이크로 BCA 단백질 검정 키트[판매원: 피어스(Pierce)]를 사용하여 측정하였다. 각각의 동물로부터의 총 단백질의 샘플을 사용하여 VEGF ELISA 검정[판매원: 알 앤 디 시스템스(R&D systems)]을 사용하여 VEGF 단백질 수준을 측정하였다. 그룹 평균을 계산하여 각각의 실험의 경우 PBS 그룹에 대해 정규화하였다.
통계적 분석. ANOVA에 이어서 튜키 사후 검정에 의해 유의성을 계산하였다.
결과
데이터 요약
mRNA(VEGF/GAPDH) 및 단백질(상대적인 VEGF)에 대한 평균값(±표준 편차)를 각각의 처리 그룹에 대해 제시한다. 각각의 실험의 경우 PBS 그룹에 대한 통계적 유의성(p 값)이 제시되어 있다.
간 VEGF mRNA 및 단백질의 통계적으로 유의적인 감소가 모든 3개의 siRNA 용량 수준에서 측정되었다.
<110> Alnylam Pharmaceuticals, Inc.
<120> Compositions and methods for inhibiting expression of Eg5 gene
<130> 14174-131WO1
<150> US 60/787,762
<151> 2006-03-31
<150> US 60/870,259
<151> 2006-12-15
<160> 1236
<170> KopatentIn 1.71
<210> 1
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 8, 9, 11, 12, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 10, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1
cgaaguguug uuuguccaat t 21
<210> 2
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 2
uuggacaaac aacacuucgt t 21
<210> 3
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 7, 8, 13, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 9, 10, 11, 12, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 3
ugguguuugg agcaucuact t 21
<210> 4
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 11, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 4
guagaugcuc caaacaccat t 21
<210> 5
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 7, 8, 11, 12, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 9, 10, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 5
ucuaaacuaa cuagaaucct t 21
<210> 6
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 6
ggauucuagu uaguuuagat t 21
<210> 7
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 12, 13, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 7, 8, 9, 10, 11, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 7
cuuaucgaga aucuaaacut t 21
<210> 8
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 8
aguuuagauu cucgauaagt t 21
<210> 9
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 9, 11, 12, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 10, 13, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 9
uugauguuua ccgaagugut t 21
<210> 10
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 10
acacuucggu aaacaucaat t 21
<210> 11
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 9, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 10, 11, 12, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 11
gugagaugca gaccauuuat t 21
<210> 12
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 12
uaaauggucu gcaucucact t 21
<210> 13
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 7, 9, 11, 12, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 8, 10, 13, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 13
ucugaguaca uuggaauaut t 21
<210> 14
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 14
auauuccaau guacucagat t 21
<210> 15
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 8, 10, 11, 12, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 9, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 15
gaaguguugu uuguccaaut t 21
<210> 16
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 16
auuggacaaa caacacuuct t 21
<210> 17
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 11, 12, 14, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 8, 9, 10, 13, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 17
uuauuauggg cuauaauugt t 21
<210> 18
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 7, 12, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 8, 9, 10, 11, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 18
caauuauagc ccauaauaat t 21
<210> 19
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 12, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 19
aaggugaaag gucaccuaat t 21
<210> 20
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 20
uuaggugacc uuucaccuut t 21
<210> 21
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 21
uuacaaugga aggugaaagt t 21
<210> 22
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 22
cuuucaccuu ccauuguaat t 21
<210> 23
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 11, 12, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 23
aggugaaagg ucaccuaaut t 21
<210> 24
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 24
auuaggugac cuuucaccut t 21
<210> 25
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 11, 13, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 12, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 25
ggugaaaggu caccuaaugt t 21
<210> 26
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 26
cauuagguga ccuuucacct t 21
<210> 27
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 13, 14, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 8, 9, 10, 11, 12, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 27
ccuuaucgag aaucuaaact t 21
<210> 28
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 28
guuuagauuc ucgauaaggt t 21
<210> 29
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 9, 10, 11, 12, 13, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 29
cucuuauuaa ggaguauact t 21
<210> 30
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 30
guauacuccu uaauaagagt t 21
<210> 31
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 8, 9, 10, 12, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 11, 13, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 31
gagagauucu gugcuuuggt t 21
<210> 32
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 32
ccaaagcaca gaaucucuct t 21
<210> 33
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 8, 9, 12, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 6, 7, 10, 11, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 33
aucuaaacua acuagaauct t 21
<210> 34
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 34
gauucuaguu aguuuagaut t 21
<210> 35
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 7, 8, 9, 10, 11, 12, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 35
ucaccaaaaa agcucuuaut t 21
<210> 36
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 36
auaagagcuu uuuuggugat t 21
<210> 37
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 12, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 10, 11, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 37
gagcuuuuug aucuucuuat t 21
<210> 38
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 38
uaagaagauc aaaaagcuct t 21
<210> 39
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 11, 13, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 7, 8, 9, 10, 12, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 39
cguacaagaa caucuauaat t 21
<210> 40
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 40
uuauagaugu ucuuguacgt t 21
<210> 41
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 6, 8, 9, 10, 12, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 7, 11, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 41
auugauguuu accgaagugt t 21
<210> 42
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 9, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 42
cacuucggua aacaucaaut t 21
<210> 43
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 7, 10, 11, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 8, 9, 12, 13, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 43
cuaaacuaac uagaauccut t 21
<210> 44
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 44
aggauucuag uuaguuuagt t 21
<210> 45
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 8, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 9, 12, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 45
accgaagugu uguuugucct t 21
<210> 46
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 46
ggacaaacaa cacuucggut t 21
<210> 47
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7, 12, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 8, 9, 10, 11, 13, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 47
ugguggugag augcagacct t 21
<210> 48
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and mouse Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 12, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 48
ggucugcauc ucaccaccat t 21
<210> 49
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 11, 12, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 9, 10, 13, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 49
cauacucuag ucguucccat t 21
<210> 50
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 50
ugggaacgac uagaguaugt t 21
<210> 51
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 7, 9, 10, 11, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 8, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 51
agcgcccauu caauaguagt t 21
<210> 52
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 52
cuacuauuga augggcgcut t 21
<210> 53
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 8, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 9, 10, 12, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 53
ggaaagcuag cgcccauuct t 21
<210> 54
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 54
gaaugggcgc uagcuuucct t 21
<210> 55
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 10, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 9, 11, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 55
gaaagcuagc gcccauucat t 21
<210> 56
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 56
ugaaugggcg cuagcuuuct t 21
<210> 57
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 9, 12, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 10, 11, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 57
agaaacuacg auugauggat t 21
<210> 58
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 58
uccaucaauc guaguuucut t 21
<210> 59
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 11, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 9, 12, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 59
uguuccuuau cgagaaucut t 21
<210> 60
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 60
agauucucga uaaggaacat t 21
<210> 61
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 8, 9, 10, 11, 12, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 7, 13, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 61
cagauuaccu cugcgagcct t 21
<210> 62
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 62
ggcucgcaga gguaaucugt t 21
<210> 63
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 9, 10, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 7, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 63
gcgcccauuc aauaguagat t 21
<210> 64
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 64
ucuacuauug aaugggcgct t 21
<210> 65
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 9, 10, 11, 12, 13, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 8, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 65
uugcacuauc uuugcguaut t 21
<210> 66
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 66
auacgcaaag auagugcaat t 21
<210> 67
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 13, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 67
cagagcggaa agcuagcgct t 21
<210> 68
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 68
gcgcuagcuu uccgcucugt t 21
<210> 69
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 7, 9, 10, 11, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 8, 12, 13, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 69
agaccuuauu ugguaaucut t 21
<210> 70
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 70
agauuaccaa auaaggucut t 21
<210> 71
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 9, 10, 11, 12, 13, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 71
auucucuugg agggcguact t 21
<210> 72
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 72
guacgcccuc caagagaaut t 21
<210> 73
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 9, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 10, 11, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 73
ggcugguaua auuccacgut t 21
<210> 74
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 74
acguggaauu auaccagcct t 21
<210> 75
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 9, 10, 13, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 11, 12, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 75
gcggaaagcu agcgcccaut t 21
<210> 76
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 76
augggcgcua gcuuuccgct t 21
<210> 77
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 8, 9, 10, 11, 12, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 7, 13, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 77
ugcacuaucu uugcguaugt t 21
<210> 78
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 7, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 9, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 78
cauacgcaaa gauagugcat t 21
<210> 79
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 7, 8, 9, 10, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 11, 13, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 79
guauaauucc acguacccut t 21
<210> 80
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 80
aggguacgug gaauuauact t 21
<210> 81
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 11, 12, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 9, 10, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 81
agaaucuaaa cuaacuagat t 21
<210> 82
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 82
ucuaguuagu uuagauucut t 21
<210> 83
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 11, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 9, 10, 12, 13, 14, 15, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 83
aggagcugaa uaggguuact t 21
<210> 84
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 84
guaacccuau ucagcuccut t 21
<210> 85
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 9, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 10, 11, 12, 13, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 85
gaaguacaua agaccuuaut t 21
<210> 86
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 86
auaaggucuu auguacuuct t 21
<210> 87
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 9, 10, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 87
gacaguggcc gauaagauat t 21
<210> 88
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 88
uaucuuaucg gccacuguct t 21
<210> 89
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 12, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 10, 11, 13, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 89
aaaccacuua guagugucct t 21
<210> 90
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 90
ggacacuacu aagugguuut t 21
<210> 91
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 7, 8, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 91
ucccuagacu ucccuauuut t 21
<210> 92
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 92
aaauagggaa gucuagggat t 21
<210> 93
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 12, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 93
uagacuuccc uauuucgcut t 21
<210> 94
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 94
agcgaaauag ggaagucuat t 21
<210> 95
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 7, 10, 11, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 8, 9, 12, 13, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 95
gcgucgcagc caaauucgut t 21
<210> 96
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 96
acgaauuugg cugcgacgct t 21
<210> 97
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 9, 10, 11, 13, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 12, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 97
agcuagcgcc cauucaauat t 21
<210> 98
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 98
uauugaaugg gcgcuagcut t 21
<210> 99
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 8, 11, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 9, 10, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 99
gaaacuacga uugauggagt t 21
<210> 100
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 100
cuccaucaau cguaguuuct t 21
<210> 101
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 10, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 101
ccgauaagau agaagaucat t 21
<210> 102
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 102
ugaucuucua ucuuaucggt t 21
<210> 103
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 7, 8, 10, 11, 12, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 9, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 103
uagcgcccau ucaauaguat t 21
<210> 104
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 104
uacuauugaa ugggcgcuat t 21
<210> 105
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 9, 12, 13, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 6, 8, 10, 11, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 105
uuugcguaug gccaaacugt t 21
<210> 106
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 106
caguuuggcc auacgcaaat t 21
<210> 107
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 9, 10, 11, 12, 14, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 13, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 107
cacguacccu ucaucaaaut t 21
<210> 108
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 108
auuugaugaa ggguacgugt t 21
<210> 109
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 9, 11, 14, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 8, 10, 12, 13, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 109
ucuuugcgua uggccaaact t 21
<210> 110
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 110
guuuggccau acgcaaagat t 21
<210> 111
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 7, 9, 10, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 8, 11, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 111
ccgaaguguu guuuguccat t 21
<210> 112
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 112
uggacaaaca acacuucggt t 21
<210> 113
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 12, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 113
agagcggaaa gcuagcgcct t 21
<210> 114
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 114
ggcgcuagcu uuccgcucut t 21
<210> 115
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 6, 8, 9, 10, 12, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 7, 11, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 115
gcuagcgccc auucaauagt t 21
<210> 116
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 116
cuauugaaug ggcgcuagct t 21
<210> 117
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 8, 10, 12, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 9, 11, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 117
aaguuagugu acgaacuggt t 21
<210> 118
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 9, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 118
ccaguucgua cacuaacuut t 21
<210> 119
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 8, 9, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 10, 11, 12, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 119
guacgaacug gaggauuggt t 21
<210> 120
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 120
ccaauccucc aguucguact t 21
<210> 121
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 7, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 8, 9, 10, 11, 12, 13, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 121
acgaacugga ggauuggcut t 21
<210> 122
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 122
agccaauccu ccaguucgut t 21
<210> 123
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 8, 10, 11, 12, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 9, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 123
agauugaugu uuaccgaagt t 21
<210> 124
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 124
cuucgguaaa caucaaucut t 21
<210> 125
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 7, 8, 10, 13, 14, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 9, 11, 12, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 125
uaugggcuau aauugcacut t 21
<210> 126
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 11, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 126
agugcaauua uagcccauat t 21
<210> 127
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 10, 12, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 7, 9, 11, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 127
aucuuugcgu auggccaaat t 21
<210> 128
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 128
uuuggccaua cgcaaagaut t 21
<210> 129
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 6, 7, 10, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 129
acucuagucg uucccacuct t 21
<210> 130
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 130
gagugggaac gacuagagut t 21
<210> 131
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 9, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 131
aacuacgauu gauggagaat t 21
<210> 132
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 9, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 132
uucuccauca aucguaguut t 21
<210> 133
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11, 12, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 133
gauaagagag cucgggaagt t 21
<210> 134
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 134
cuucccgagc ucucuuauct t 21
<210> 135
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 8, 9, 10, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 11, 12, 13, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 135
ucgagaaucu aaacuaacut t 21
<210> 136
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 136
aguuaguuua gauucucgat t 21
<210> 137
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 8, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 9, 10, 11, 12, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 137
aacuaacuag aauccuccat t 21
<210> 138
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 138
uggaggauuc uaguuaguut t 21
<210> 139
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 8, 9, 10, 11, 12, 13, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 139
ggaucguaag aaggcaguut t 21
<210> 140
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 140
aacugccuuc uuacgaucct t 21
<210> 141
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 13, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 6, 7, 8, 9, 10, 11, 12, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 141
aucguaagaa ggcaguugat t 21
<210> 142
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 142
ucaacugccu ucuuacgaut t 21
<210> 143
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 8, 11, 12, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 9, 10, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 143
aggcaguuga ccaacacaat t 21
<210> 144
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 144
uuguguuggu caacugccut t 21
<210> 145
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 8, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 6, 7, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 145
uggccgauaa gauagaagat t 21
<210> 146
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 146
ucuucuaucu uaucggccat t 21
<210> 147
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 9, 11, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 10, 12, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 147
ucuaaggaua uagucaacat t 21
<210> 148
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 148
uguugacuau auccuuagat t 21
<210> 149
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 7, 8, 9, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 10, 11, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 149
acuaagcuua auugcuuuct t 21
<210> 150
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 150
gaaagcaauu aagcuuagut t 21
<210> 151
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 8, 9, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 6, 7, 10, 11, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 151
gcccagauca accuuuaaut t 21
<210> 152
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 152
auuaaagguu gaucugggct t 21
<210> 153
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 8, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 153
uuaauuuggc agagcggaat t 21
<210> 154
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 154
uuccgcucug ccaaauuaat t 21
<210> 155
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 11, 12, 13, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 7, 8, 9, 10, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 155
uuaucgagaa ucuaaacuat t 21
<210> 156
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 156
uaguuuagau ucucgauaat t 21
<210> 157
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 9, 11, 12, 13, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 10, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 157
cuagcgccca uucaauagut t 21
<210> 158
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 158
acuauugaau gggcgcuagt t 21
<210> 159
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 11, 13, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 10, 12, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 159
aauaguagaa ugugauccut t 21
<210> 160
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 9, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 160
aggaucacau ucuacuauut t 21
<210> 161
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 13, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 161
uacgaaaaga aguuagugut t 21
<210> 162
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 162
acacuaacuu cuuuucguat t 21
<210> 163
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 10, 12, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 9, 11, 13, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 163
agaaguuagu guacgaacut t 21
<210> 164
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 164
aguucguaca cuaacuucut t 21
<210> 165
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 7, 11, 12, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 8, 9, 10, 13, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 165
acuaaacaga uugauguuut t 21
<210> 166
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 166
aaacaucaau cuguuuagut t 21
<210> 167
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 10, 13, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 7, 9, 11, 12, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 167
cuuugcguau ggccaaacut t 21
<210> 168
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 168
aguuuggcca uacgcaaagt t 21
<210> 169
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 12, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 13, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 169
aaugaagagu auaccugggt t 21
<210> 170
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 9, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 170
cccagguaua cucuucauut t 21
<210> 171
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 6, 7, 8, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 9, 11, 13
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 171
auaauuccac guacccuuct t 21
<210> 172
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 172
gaaggguacg uggaauuaut t 21
<210> 173
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 7, 8, 9, 10, 11, 13, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 12, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 173
acguacccuu caucaaauut t 21
<210> 174
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 174
aauuugauga aggguacgut t 21
<210> 175
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 12, 13, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 11, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 175
cguacccuuc aucaaauuut t 21
<210> 176
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 176
aaauuugaug aaggguacgt t 21
<210> 177
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 11, 12, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 10, 13, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 177
guacccuuca ucaaauuuut t 21
<210> 178
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 178
aaaauuugau gaaggguact t 21
<210> 179
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 7, 8, 11, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 9, 10, 12, 13, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 179
aacuuacuga uaaugguact t 21
<210> 180
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 8, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 180
guaccauuau caguaaguut t 21
<210> 181
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 12, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 8, 9, 10, 11, 13, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 181
uucagucaaa gugucucugt t 21
<210> 182
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 182
cagagacacu uugacugaat t 21
<210> 183
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 9, 10, 12, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 7, 11, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 183
uucuuaaucc aucaucugat t 21
<210> 184
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 184
ucagaugaug gauuaagaat t 21
<210> 185
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 7, 9, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 8, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 185
acaguacaca acaaggaugt t 21
<210> 186
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 186
cauccuuguu guguacugut t 21
<210> 187
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 8, 10, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 9, 11, 12, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 187
aagaaacuac gauugauggt t 21
<210> 188
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 188
ccaucaaucg uaguuucuut t 21
<210> 189
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 10, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 8, 9, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 189
aaacuacgau ugauggagat t 21
<210> 190
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 190
ucuccaucaa ucguaguuut t 21
<210> 191
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 7, 9, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 8, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 191
uggagcuguu gauaagagat t 21
<210> 192
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 9, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 192
ucucuuauca acagcuccat t 21
<210> 193
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 6, 11, 12, 13, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 7, 8, 9, 10, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 193
cuaacuagaa uccuccaggt t 21
<210> 194
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 194
ccuggaggau ucuaguuagt t 21
<210> 195
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 8, 9, 10, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 195
gaauaugcuc auagagcaat t 21
<210> 196
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 196
uugcucuaug agcauauuct t 21
<210> 197
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 7, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 197
augcucauag agcaaagaat t 21
<210> 198
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 198
uucuuugcuc uaugagcaut t 21
<210> 199
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 10, 12, 13, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 9, 11, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 199
aaaaauuggu gcuguugagt t 21
<210> 200
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 200
cucaacagca ccaauuuuut t 21
<210> 201
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 8, 12, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 9, 10, 11, 13, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 201
gaggagcuga auaggguuat t 21
<210> 202
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 202
uaacccuauu cagcuccuct t 21
<210> 203
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 10, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 8, 9, 11, 12, 13, 14, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 203
ggagcugaau aggguuacat t 21
<210> 204
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 204
uguaacccua uucagcucct t 21
<210> 205
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 9, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 8, 10, 11, 12, 13, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 205
gagcugaaua ggguuacagt t 21
<210> 206
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 206
cuguaacccu auucagcuct t 21
<210> 207
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 8, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 9, 10, 11, 12, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 207
agcugaauag gguuacagat t 21
<210> 208
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 208
ucuguaaccc uauucagcut t 21
<210> 209
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 7, 12, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 8, 9, 10, 11, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 209
gcugaauagg guuacagagt t 21
<210> 210
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 210
cucuguaacc cuauucagct t 21
<210> 211
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 7, 11, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 8, 9, 10, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 211
ccaaacugga ucguaagaat t 21
<210> 212
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 212
uucuuacgau ccaguuuggt t 21
<210> 213
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 14, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 9, 10, 11, 12, 13, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 213
gaucguaaga aggcaguugt t 21
<210> 214
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 214
caacugccuu cuuacgauct t 21
<210> 215
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 9, 12, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 6, 10, 11, 13, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 215
accuuauuug guaaucugct t 21
<210> 216
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 216
gcagauuacc aaauaaggut t 21
<210> 217
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 8, 9, 11, 12, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 7, 10, 13, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 217
uuagauacca uuacuacagt t 21
<210> 218
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 218
cuguaguaau gguaucuaat t 21
<210> 219
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 7, 8, 10, 11, 13, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 9, 12, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 219
auaccauuac uacaguagct t 21
<210> 220
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 220
gcuacuguag uaaugguaut t 21
<210> 221
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 6, 9, 12, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 7, 8, 10, 11, 13, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 221
uacuacagua gcacuuggat t 21
<210> 222
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 222
uccaagugcu acuguaguat t 21
<210> 223
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 10, 11, 13, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 12, 14, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 223
aaaguaaaac uguacuacat t 21
<210> 224
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 224
uguaguacag uuuuacuuut t 21
<210> 225
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 8, 9, 12, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 10, 11, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 225
cucaagacug aucuucuaat t 21
<210> 226
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 226
uuagaagauc agucuugagt t 21
<210> 227
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 8, 11, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 7, 9, 10, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 227
uugacagugg ccgauaagat t 21
<210> 228
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 228
ucuuaucggc cacugucaat t 21
<210> 229
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7, 10, 11, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 8, 9, 12, 13, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 229
ugacaguggc cgauaagaut t 21
<210> 230
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 230
aucuuaucgg ccacugucat t 21
<210> 231
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 7, 13, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 8, 9, 10, 11, 12, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 231
gcaaugugga aaccuaacut t 21
<210> 232
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 232
aguuagguuu ccacauugct t 21
<210> 233
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 9, 12, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 7, 8, 10, 11, 13, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 233
ccacuuagua guguccaggt t 21
<210> 234
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 234
ccuggacacu acuaaguggt t 21
<210> 235
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 11, 12, 13, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 235
agaagguaca aaauugguut t 21
<210> 236
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 236
aaccaauuuu guaccuucut t 21
<210> 237
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 9, 10, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 7, 8, 11, 12, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 237
ugguuugacu aagcuuaaut t 21
<210> 238
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 238
auuaagcuua gucaaaccat t 21
<210> 239
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 8, 9, 13, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 10, 11, 12, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 239
gguuugacua agcuuaauut t 21
<210> 240
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 240
aauuaagcuu agucaaacct t 21
<210> 241
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 7, 8, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 9, 10, 11, 12, 13, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 241
ucuaagucaa gagccaucut t 21
<210> 242
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 242
agauggcucu ugacuuagat t 21
<210> 243
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 9, 11, 12, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 243
ucaucccuau aguucacuut t 21
<210> 244
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 244
aagugaacua uagggaugat t 21
<210> 245
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 8, 10, 11, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 245
caucccuaua guucacuuut t 21
<210> 246
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 246
aaagugaacu auagggaugt t 21
<210> 247
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 7, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 247
cccuagacuu cccuauuuct t 21
<210> 248
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 248
gaaauaggga agucuagggt t 21
<210> 249
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 11, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 249
agacuucccu auuucgcuut t 21
<210> 250
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 250
aagcgaaaua gggaagucut t 21
<210> 251
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 9, 10, 12, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 7, 8, 11, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 251
ucaccaaacc auuuguagat t 21
<210> 252
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 252
ucuacaaaug guuuggugat t 21
<210> 253
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 13, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 7, 8, 9, 10, 11, 12, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 253
uccuuuaaga ggccuaacut t 21
<210> 254
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 254
aguuaggccu cuuaaaggat t 21
<210> 255
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 10, 11, 12, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 13, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 255
uuuaagaggc cuaacucaut t 21
<210> 256
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 256
augaguuagg ccucuuaaat t 21
<210> 257
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 9, 10, 11, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 8, 12, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 257
uuaagaggcc uaacucauut t 21
<210> 258
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 258
aaugaguuag gccucuuaat t 21
<210> 259
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 8, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 11, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 259
ggccuaacuc auucacccut t 21
<210> 260
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 260
agggugaaug aguuaggcct t 21
<210> 261
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 7, 8, 9, 10, 13, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 11, 12, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 261
ugguauuuuu gaucuggcat t 21
<210> 262
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 10, 11, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 262
ugccagauca aaaauaccat t 21
<210> 263
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 8, 10, 12, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 9, 11, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 263
aguuuagugu guaaaguuut t 21
<210> 264
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 264
aaacuuuaca cacuaaacut t 21
<210> 265
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 7, 8, 9, 11, 12, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 10, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 265
gccaaauucg ucugcgaagt t 21
<210> 266
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 266
cuucgcagac gaauuuggct t 21
<210> 267
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 7, 8, 9, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 267
aauucgucug cgaagaagat t 21
<210> 268
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 268
ucuucuucgc agacgaauut t 21
<210> 269
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 9, 11, 12, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 10, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 269
ugaaagguca ccuaaugaat t 21
<210> 270
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 270
uucauuaggu gaccuuucat t 21
<210> 271
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 8, 9, 10, 13, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 7, 11, 12, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 271
cagaccauuu aauuuggcat t 21
<210> 272
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 272
ugccaaauua aauggucugt t 21
<210> 273
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 12, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 10, 11, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 273
agaccauuua auuuggcagt t 21
<210> 274
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 274
cugccaaauu aaauggucut t 21
<210> 275
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 9, 13, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 8, 10, 11, 12, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 275
aguuauuaug ggcuauaaut t 21
<210> 276
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 10, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 276
auuauagccc auaauaacut t 21
<210> 277
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 6, 8, 11, 12, 13, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 7, 9, 10, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 277
gcugguauaa uuccacguat t 21
<210> 278
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 11, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 278
uacguggaau uauaccagct t 21
<210> 279
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 7, 8, 9, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 6, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 279
auuuaauuug gcagagcggt t 21
<210> 280
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 280
ccgcucugcc aaauuaaaut t 21
<210> 281
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 8, 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 281
uuuaauuugg cagagcggat t 21
<210> 282
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 282
uccgcucugc caaauuaaat t 21
<210> 283
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 11, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 283
uuuggcagag cggaaagcut t 21
<210> 284
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 284
agcuuuccgc ucugccaaat t 21
<210> 285
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 9, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 7, 8, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 285
uuuuacaaug gaaggugaat t 21
<210> 286
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 286
uucaccuucc auuguaaaat t 21
<210> 287
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 287
aauggaaggu gaaaggucat t 21
<210> 288
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 288
ugaccuuuca ccuuccauut t 21
<210> 289
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 8, 12, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 9, 10, 11, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 289
ugagaugcag accauuuaat t 21
<210> 290
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 290
uuaaaugguc ugcaucucat t 21
<210> 291
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 8, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 9, 10, 11, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 291
ucgcagccaa auucgucugt t 21
<210> 292
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 292
cagacgaauu uggcugcgat t 21
<210> 293
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 9, 10, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 11, 13, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 293
ggcuauaauu gcacuaucut t 21
<210> 294
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 10, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 294
agauagugca auuauagcct t 21
<210> 295
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 6, 9, 12, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 7, 8, 10, 11, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 295
auugacagug gccgauaagt t 21
<210> 296
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 296
cuuaucggcc acugucaaut t 21
<210> 297
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 13, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 297
cuagacuucc cuauuucgct t 21
<210> 298
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 298
gcgaaauagg gaagucuagt t 21
<210> 299
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 11, 13, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 10, 12, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 299
acuaucuuug cguauggcct t 21
<210> 300
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 300
ggccauacgc aaagauagut t 21
<210> 301
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 8, 9, 12, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 301
auacucuagu cguucccact t 21
<210> 302
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 302
gugggaacga cuagaguaut t 21
<210> 303
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 9, 11, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 10, 12, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 303
aaagaaacua cgauugaugt t 21
<210> 304
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 304
caucaaucgu aguuucuuut t 21
<210> 305
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 8, 9, 10, 11, 12, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 6, 7, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 305
gccuugauuu uuuggcgggt t 21
<210> 306
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 306
cccgccaaaa aaucaaggct t 21
<210> 307
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 10, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 307
cgcccauuca auaguagaat t 21
<210> 308
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 308
uucuacuauu gaaugggcgt t 21
<210> 309
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 11, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 9, 10, 12, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 309
ccuuauuugg uaaucugcut t 21
<210> 310
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 310
agcagauuac caaauaaggt t 21
<210> 311
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 9, 10, 11, 12, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 311
agagacaauu ccggaugugt t 21
<210> 312
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 312
cacauccgga auugucucut t 21
<210> 313
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 10, 13, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 8, 9, 11, 12, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 313
ugacuuugau agcuaaauut t 21
<210> 314
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 314
aauuuagcua ucaaagucat t 21
<210> 315
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 9, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 315
uggcagagcg gaaagcuagt t 21
<210> 316
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 316
cuagcuuucc gcucugccat t 21
<210> 317
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 11, 12, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 13, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 317
gagcggaaag cuagcgccct t 21
<210> 318
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 318
gggcgcuagc uuuccgcuct t 21
<210> 319
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 9, 12, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 10, 11, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 319
aaagaaguua guguacgaat t 21
<210> 320
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 320
uucguacacu aacuucuuut t 21
<210> 321
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 7, 8, 10, 11, 12, 13, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 6, 9, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 321
auugcacuau cuuugcguat t 21
<210> 322
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 322
uacgcaaaga uagugcaaut t 21
<210> 323
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 8, 9, 10, 11, 13, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 12, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 323
gguauaauuc cacguaccct t 21
<210> 324
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 324
ggguacgugg aauuauacct t 21
<210> 325
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 7, 8, 11, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 325
uacucuaguc guucccacut t 21
<210> 326
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 326
agugggaacg acuagaguat t 21
<210> 327
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 12, 13, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 10, 11, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 327
uaugaaagaa acuacgauut t 21
<210> 328
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 328
aaucguaguu ucuuucauat t 21
<210> 329
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 11, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 7, 8, 9, 10, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 329
augcuagaag uacauaagat t 21
<210> 330
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 330
ucuuauguac uucuagcaut t 21
<210> 331
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 8, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 9, 10, 11, 12, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 331
aaguacauaa gaccuuauut t 21
<210> 332
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 332
aauaaggucu uauguacuut t 21
<210> 333
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 6, 7, 11, 12, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 8, 9, 10, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 333
acagccugag cuguuaaugt t 21
<210> 334
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 334
cauuaacagc ucaggcugut t 21
<210> 335
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 335
aaagaagaga caauuccggt t 21
<210> 336
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 336
ccggaauugu cucuucuuut t 21
<210> 337
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 7, 8, 9, 10, 11, 12, 13, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 337
cacacuggag aggucuaaat t 21
<210> 338
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 338
uuuagaccuc uccagugugt t 21
<210> 339
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 12, 13, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 6, 7, 8, 9, 10, 11, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 339
cacuggagag gucuaaagut t 21
<210> 340
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 340
acuuuagacc ucuccagugt t 21
<210> 341
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 11, 12, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 8, 9, 10, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 341
acuggagagg ucuaaagugt t 21
<210> 342
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 342
cacuuuagac cucuccagut t 21
<210> 343
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 6, 9, 10, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 7, 8, 11, 12, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 343
cgucgcagcc aaauucguct t 21
<210> 344
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 344
gacgaauuug gcugcgacgt t 21
<210> 345
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 9, 10, 13, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 11, 12, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 345
gaaggcaguu gaccaacact t 21
<210> 346
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 346
guguugguca acugccuuct t 21
<210> 347
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 10, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 11, 12, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 347
cauucacccu gacagaguut t 21
<210> 348
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 348
aacucuguca gggugaaugt t 21
<210> 349
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 8, 9, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 10, 11, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 349
aagaggccua acucauucat t 21
<210> 350
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 350
ugaaugaguu aggccucuut t 21
<210> 351
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8, 9, 10, 11, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 351
gagacaauuc cggauguggt t 21
<210> 352
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 352
ccacauccgg aauugucuct t 21
<210> 353
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 10, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 7, 9, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 353
uuccggaugu ggauguagat t 21
<210> 354
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 9, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 354
ucuacaucca cauccggaat t 21
<210> 355
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 8, 10, 11, 12, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 9, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 355
aagcuagcgc ccauucaaut t 21
<210> 356
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 356
auugaauggg cgcuagcuut t 21
<210> 357
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 9, 11, 13, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 8, 10, 12, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 357
gaaguuagug uacgaacugt t 21
<210> 358
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 358
caguucguac acuaacuuct t 21
<210> 359
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 6, 7, 8, 9, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 10, 12, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 359
uauaauucca cguacccuut t 21
<210> 360
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 360
aaggguacgu ggaauuauat t 21
<210> 361
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 8, 9, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 361
acaguggccg auaagauagt t 21
<210> 362
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 362
cuaucuuauc ggccacugut t 21
<210> 363
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 7, 13, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 363
ucugucaucc cuauaguuct t 21
<210> 364
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 364
gaacuauagg gaugacagat t 21
<210> 365
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 10, 13, 14, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 9, 11, 12, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 365
uucuugcuau gacuugugut t 21
<210> 366
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 9, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 366
acacaaguca uagcaagaat t 21
<210> 367
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10, 13, 14, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 12, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 367
guaagaaggc aguugaccat t 21
<210> 368
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 368
uggucaacug ccuucuuact t 21
<210> 369
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 7, 10, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 6, 8, 9, 11, 12, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 369
cauugacagu ggccgauaat t 21
<210> 370
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 9, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 370
uuaucggcca cugucaaugt t 21
<210> 371
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 9, 10, 11, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 12, 13, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 371
agaaaccacu uaguagugut t 21
<210> 372
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 372
acacuacuaa gugguuucut t 21
<210> 373
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 11, 12, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 10, 13, 14, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 373
ggauuguuca ucaauuggct t 21
<210> 374
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 374
gccaauugau gaacaaucct t 21
<210> 375
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 9, 10, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 11, 12, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 375
uaagaggccu aacucauuct t 21
<210> 376
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 376
gaaugaguua ggccucuuat t 21
<210> 377
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 9, 11, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 10, 12, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 377
aguuagugua cgaacuggat t 21
<210> 378
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 378
uccaguucgu acacuaacut t 21
<210> 379
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 7, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 8, 9, 10, 11, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 379
aguacauaag accuuauuut t 21
<210> 380
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 380
aaauaagguc uuauguacut t 21
<210> 381
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 7, 8, 10, 12, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 9, 11, 13, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 381
ugagccuugu guauagauut t 21
<210> 382
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 9, 11, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 10, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 382
aaucuauaca caaggcucat t 21
<210> 383
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 12, 13, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 7, 8, 9, 10, 11, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 383
ccuuuaagag gccuaacuct t 21
<210> 384
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 384
gaguuaggcc ucuuaaaggt t 21
<210> 385
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 10, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 8, 9, 11, 12, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 385
accacuuagu aguguccagt t 21
<210> 386
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 386
cuggacacua cuaaguggut t 21
<210> 387
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 8, 9, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 10, 11, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 387
gaaacuucca auuaugucut t 21
<210> 388
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 388
agacauaauu ggaaguuuct t 21
<210> 389
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 9, 10, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 11, 12, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 389
ugcauacucu agucguucct t 21
<210> 390
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 390
ggaacgacua gaguaugcat t 21
<210> 391
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 10, 11, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 12, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 391
agaaggcagu ugaccaacat t 21
<210> 392
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 392
uguuggucaa cugccuucut t 21
<210> 393
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 11, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 9, 10, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 393
guacauaaga ccuuauuugt t 21
<210> 394
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 394
caaauaaggu cuuauguact t 21
<210> 395
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 6, 7, 9, 11, 12, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 8, 10, 13, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 395
uauaauugca cuaucuuugt t 21
<210> 396
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 12, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 396
caaagauagu gcaauuauat t 21
<210> 397
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 10, 13, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 9, 11, 12, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 397
ucucuguuac aauacauaut t 21
<210> 398
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 398
auauguauug uaacagagat t 21
<210> 399
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 9, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 8, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 399
uaugcucaua gagcaaagat t 21
<210> 400
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 400
ucuuugcucu augagcauat t 21
<210> 401
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 10, 11, 12, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 9, 13, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 401
uguuguuugu ccaauucugt t 21
<210> 402
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 11, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 402
cagaauugga caaacaacat t 21
<210> 403
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 6, 7, 12, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 8, 9, 10, 11, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 403
acuaacuaga auccuccagt t 21
<210> 404
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 404
cuggaggauu cuaguuagut t 21
<210> 405
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 6, 8, 9, 10, 12, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 7, 11, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 405
uguggugucu auacugaaat t 21
<210> 406
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 9, 13, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 10, 11, 12, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 406
uuucaguaua gacaccacat t 21
<210> 407
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 6, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 7, 8, 9, 10, 11, 12, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 407
uauuauggga gaccacccat t 21
<210> 408
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 408
uggguggucu cccauaauat t 21
<210> 409
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 12, 13, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 409
aaggaugaag ucuaucaaat t 21
<210> 410
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 410
uuugauagac uucauccuut t 21
<210> 411
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 13, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 9, 10, 11, 12, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 411
uugauaagag agcucgggat t 21
<210> 412
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 412
ucccgagcuc ucuuaucaat t 21
<210> 413
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 11, 12, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 10, 13, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 413
auguuccuua ucgagaauct t 21
<210> 414
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 414
gauucucgau aaggaacaut t 21
<210> 415
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 9, 10, 11, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 415
ggaauaugcu cauagagcat t 21
<210> 416
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 416
ugcucuauga gcauauucct t 21
<210> 417
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 11, 12, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 8, 9, 10, 13, 14, 15, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 417
ccauuccaaa cuggaucgut t 21
<210> 418
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 418
acgauccagu uuggaauggt t 21
<210> 419
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 7, 10, 11, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 8, 9, 12, 13, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 419
ggcaguugac caacacaaut t 21
<210> 420
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 420
auuguguugg ucaacugcct t 21
<210> 421
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 12, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 7, 8, 9, 10, 11, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 421
caugcuagaa guacauaagt t 21
<210> 422
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 422
cuuauguacu ucuagcaugt t 21
<210> 423
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 8, 10, 12, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 9, 11, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 423
cuagaaguac auaagaccut t 21
<210> 424
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 424
aggucuuaug uacuucuagt t 21
<210> 425
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 7, 8, 9, 10, 11, 13, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 12, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 425
uuggaucucu cacaucuaut t 21
<210> 426
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 426
auagauguga gagauccaat t 21
<210> 427
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 9, 11, 12, 13, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 10, 14, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 427
aacuguggug ucuauacugt t 21
<210> 428
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 10, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 7, 8, 9, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 428
caguauagac accacaguut t 21
<210> 429
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 8, 11, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 7, 9, 10, 12, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 429
ucauugacag uggccgauat t 21
<210> 430
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 430
uaucggccac ugucaaugat t 21
<210> 431
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 431
auaaagcaga cccauuccct t 21
<210> 432
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 432
gggaaugggu cugcuuuaut t 21
<210> 433
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 9, 11, 12, 13, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 10, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 433
acagaaacca cuuaguagut t 21
<210> 434
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 434
acuacuaagu gguuucugut t 21
<210> 435
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 8, 9, 10, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 11, 12, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 435
gaaaccacuu aguaguguct t 21
<210> 436
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 436
gacacuacua agugguuuct t 21
<210> 437
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 12, 14, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 7, 8, 9, 10, 11, 13, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 437
aaaucuaagg auauagucat t 21
<210> 438
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 438
ugacuauauc cuuagauuut t 21
<210> 439
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 10, 11, 12, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 7, 9, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 439
uuauuuauac ccaucaacat t 21
<210> 440
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 440
uguugauggg uauaaauaat t 21
<210> 441
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 10, 11, 14, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 12, 13, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 441
acagaggcau uaacacacut t 21
<210> 442
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 442
aguguguuaa ugccucugut t 21
<210> 443
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 7, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 8, 9, 10, 11, 12, 13, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 443
acacacugga gaggucuaat t 21
<210> 444
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 444
uuagaccucu ccagugugut t 21
<210> 445
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 13, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 7, 8, 9, 10, 11, 12, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 445
acacuggaga ggucuaaagt t 21
<210> 446
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 446
cuuuagaccu cuccagugut t 21
<210> 447
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 7, 11, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 8, 9, 10, 13, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 447
cgagcccaga ucaaccuuut t 21
<210> 448
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 448
aaagguugau cugggcucgt t 21
<210> 449
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 11
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 449
ucccuauuuc gcuuucucct t 21
<210> 450
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 450
ggagaaagcg aaauagggat t 21
<210> 451
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 8, 9, 11, 12, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 10, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 451
ucuaaaauca cugucaacat t 21
<210> 452
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 452
uguugacagu gauuuuagat t 21
<210> 453
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 8, 9, 10, 12, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 11, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 453
agccaaauuc gucugcgaat t 21
<210> 454
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 454
uucgcagacg aauuuggcut t 21
<210> 455
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 10, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 8, 9, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 455
cccauucaau aguagaaugt t 21
<210> 456
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 456
cauucuacua uugaaugggt t 21
<210> 457
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 9, 11, 13, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 10, 12, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 457
gaugaaugca uacucuagut t 21
<210> 458
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 458
acuagaguau gcauucauct t 21
<210> 459
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 9, 10, 11, 12, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 6, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 459
cucauguucc uuaucgagat t 21
<210> 460
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 460
ucucgauaag gaacaugagt t 21
<210> 461
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 8, 12, 13, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 9, 10, 11, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 461
gagaaucuaa acuaacuagt t 21
<210> 462
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 462
cuaguuaguu uagauucuct t 21
<210> 463
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 9, 11, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 10, 12, 13, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 463
uagaaguaca uaagaccuut t 21
<210> 464
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 464
aaggucuuau guacuucuat t 21
<210> 465
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 10, 11, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 7, 8, 9, 12, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 465
cagccugagc uguuaaugat t 21
<210> 466
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 8, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 466
ucauuaacag cucaggcugt t 21
<210> 467
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 13, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 467
aagaagagac aauuccggat t 21
<210> 468
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 468
uccggaauug ucucuucuut t 21
<210> 469
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 7, 9, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 6, 8, 10, 11, 12, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 469
ugcuggugug gauuguucat t 21
<210> 470
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 10, 12, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 11, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 470
ugaacaaucc acaccagcat t 21
<210> 471
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 8, 9, 10, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 7, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 471
aaauucgucu gcgaagaagt t 21
<210> 472
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 472
cuucuucgca gacgaauuut t 21
<210> 473
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 11, 12, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 7, 8, 9, 10, 13, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 473
uuucuggaag uugagaugut t 21
<210> 474
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 474
acaucucaac uuccagaaat t 21
<210> 475
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 8, 12, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 6, 7, 9, 10, 11, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 475
uacuaaacag auugauguut t 21
<210> 476
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 476
aacaucaauc uguuuaguat t 21
<210> 477
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 9, 10, 11, 13, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 12, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 477
gauugauguu uaccgaagut t 21
<210> 478
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 478
acuucgguaa acaucaauct t 21
<210> 479
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 7, 8, 9, 10, 11, 13, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 12, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 479
gcacuaucuu ugcguauggt t 21
<210> 480
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 480
ccauacgcaa agauagugct t 21
<210> 481
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 9, 10, 11, 12, 14, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 7, 8, 13, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 481
ugguauaauu ccacguacct t 21
<210> 482
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 13, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 482
gguacgugga auuauaccat t 21
<210> 483
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 8, 10, 11, 12, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 9, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 483
agcaagcugc uuaacacagt t 21
<210> 484
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 484
cuguguuaag cagcuugcut t 21
<210> 485
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 8, 10, 11, 12, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 9, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 485
cagaaaccac uuaguagugt t 21
<210> 486
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 486
cacuacuaag ugguuucugt t 21
<210> 487
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 7, 8, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 9, 10, 11, 12, 13, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 487
aacuuauugg agguuguaat t 21
<210> 488
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 488
uuacaaccuc caauaaguut t 21
<210> 489
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 10, 11, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 8, 9, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 489
cuggagaggu cuaaaguggt t 21
<210> 490
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 490
ccacuuuaga ccucuccagt t 21
<210> 491
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 491
aaaaaagaua uaaggcagut t 21
<210> 492
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 492
acugccuuau aucuuuuuut t 21
<210> 493
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 7, 10, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 8, 9, 11, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 493
gaauuuugau aucuacccat t 21
<210> 494
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 494
uggguagaua ucaaaauuct t 21
<210> 495
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 11, 12, 13, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 9, 10, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 495
guauuuuuga ucuggcaact t 21
<210> 496
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 496
guugccagau caaaaauact t 21
<210> 497
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 8, 9, 10, 13, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 11, 12, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 497
aggaucccuu ggcugguaut t 21
<210> 498
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 498
auaccagcca agggauccut t 21
<210> 499
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 12, 13, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 10, 11, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 499
ggaucccuug gcugguauat t 21
<210> 500
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 6, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 500
uauaccagcc aagggaucct t 21
<210> 501
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7, 12, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 8, 9, 10, 11, 13, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 501
caauaguaga augugaucct t 21
<210> 502
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 502
ggaucacauu cuacuauugt t 21
<210> 503
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 8, 9, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 6, 7, 10, 12, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 503
gcuauaauug cacuaucuut t 21
<210> 504
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 10, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 504
aagauagugc aauuauagct t 21
<210> 505
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 11, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 9, 12, 13, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 505
uacccuucau caaauuuuut t 21
<210> 506
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 506
aaaaauuuga ugaaggguat t 21
<210> 507
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 9, 10, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 11, 12, 13, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 507
agaacauauu gaauaagcct t 21
<210> 508
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 508
ggcuuauuca auauguucut t 21
<210> 509
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 8, 10, 11, 13, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 9, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 509
aaauuggugc uguugaggat t 21
<210> 510
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 510
uccucaacag caccaauuut t 21
<210> 511
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 10, 11, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 12, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 511
ugaauagggu uacagaguut t 21
<210> 512
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 512
aacucuguaa cccuauucat t 21
<210> 513
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 8, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 9, 10, 11, 12, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 513
aagaacuuga aaccacucat t 21
<210> 514
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 514
ugagugguuu caaguucuut t 21
<210> 515
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 11, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 515
aauaaagcag acccauucct t 21
<210> 516
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 516
ggaauggguc ugcuuuauut t 21
<210> 517
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 9, 12, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 7, 10, 11, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 517
auacccauca acacugguat t 21
<210> 518
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 518
uaccaguguu gauggguaut t 21
<210> 519
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 8, 9, 10, 12, 13, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 7, 11, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 519
uggauuguuc aucaauuggt t 21
<210> 520
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 520
ccaauugaug aacaauccat t 21
<210> 521
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 9, 10, 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 521
uggagagguc uaaaguggat t 21
<210> 522
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 522
uccacuuuag accucuccat t 21
<210> 523
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 11, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 10, 12, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 523
gucaucccua uaguucacut t 21
<210> 524
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 524
agugaacuau agggaugact t 21
<210> 525
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 8, 9, 11, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 10, 12, 13
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 525
auaauggcua uaauuucuct t 21
<210> 526
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 526
gagaaauuau agccauuaut t 21
<210> 527
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 10, 11, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 8, 9, 12, 13, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 527
aucccuuggc ugguauaaut t 21
<210> 528
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 8, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 528
auuauaccag ccaagggaut t 21
<210> 529
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 10, 11, 13, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 8, 9, 12, 14, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 529
gggcuauaau ugcacuauct t 21
<210> 530
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 530
gauagugcaa uuauagccct t 21
<210> 531
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 8, 9, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 531
gauucucuug gagggcguat t 21
<210> 532
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 532
uacgcccucc aagagaauct t 21
<210> 533
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 12, 13, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 10, 11, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 533
gcaucucuca aucuugaggt t 21
<210> 534
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 534
ccucaagauu gagagaugct t 21
<210> 535
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 10, 11, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 535
cagcagaaau cuaaggauat t 21
<210> 536
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 536
uauccuuaga uuucugcugt t 21
<210> 537
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 9, 10, 12, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 8, 11, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 537
gucaagagcc aucuguagat t 21
<210> 538
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 538
ucuacagaug gcucuugact t 21
<210> 539
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 10, 12, 13, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 11, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 539
aaacagaggc auuaacacat t 21
<210> 540
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 540
uguguuaaug ccucuguuut t 21
<210> 541
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 9, 10, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 8, 11, 12, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 541
agcccagauc aaccuuuaat t 21
<210> 542
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 542
uuaaagguug aucugggcut t 21
<210> 543
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 10, 11, 12, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 8, 9, 13, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 543
uauuuuugau cuggcaacct t 21
<210> 544
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 544
gguugccaga ucaaaaauat t 21
<210> 545
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 10, 12, 13, 14, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 7, 8, 9, 11, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 545
uguuuggagc aucuacuaat t 21
<210> 546
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 546
uuaguagaug cuccaaacat t 21
<210> 547
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 8, 11, 13, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 9, 10, 12, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 547
gaaauuacag uacacaacat t 21
<210> 548
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 548
uguuguguac uguaauuuct t 21
<210> 549
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 7, 8, 11, 13, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 6, 9, 10, 12, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 549
acuugaccag uguaaaucut t 21
<210> 550
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 550
agauuuacac uggucaagut t 21
<210> 551
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 6, 8, 12, 13, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 7, 9, 10, 11, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 551
accaguguaa aucugaccut t 21
<210> 552
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 552
aggucagauu uacacuggut t 21
<210> 553
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8, 9, 11, 12, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 10, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 553
agaacaauca uuagcagcat t 21
<210> 554
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 554
ugcugcuaau gauuguucut t 21
<210> 555
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 12, 13, 14, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 7, 8, 9, 10, 11, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 555
caauguggaa accuaacugt t 21
<210> 556
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 556
caguuagguu uccacauugt t 21
<210> 557
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 11, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 557
accaagaagg uacaaaauut t 21
<210> 558
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 558
aauuuuguac cuucuuggut t 21
<210> 559
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 10, 11, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 559
gguacaaaau ugguugaagt t 21
<210> 560
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 560
cuucaaccaa uuuuguacct t 21
<210> 561
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 9, 10, 12, 13, 14, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 11, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 561
gguguggauu guucaucaat t 21
<210> 562
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 562
uugaugaaca auccacacct t 21
<210> 563
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 9, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 10, 11, 12, 13, 14, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 563
agaguucaca aaaagcccat t 21
<210> 564
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 564
ugggcuuuuu gugaacucut t 21
<210> 565
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7, 8, 12, 13, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 9, 10, 11, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 565
ugauagcuaa auuaaaccat t 21
<210> 566
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 566
ugguuuaauu uagcuaucat t 21
<210> 567
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 8, 9, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 10, 11, 12, 13, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 567
aauaagccug aagugaauct t 21
<210> 568
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 568
gauucacuuc aggcuuauut t 21
<210> 569
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 8, 9, 12, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 6, 7, 10, 11, 13, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 569
caguugacca acacaaugct t 21
<210> 570
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 570
gcauuguguu ggucaacugt t 21
<210> 571
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 10, 11, 13, 14, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 7, 8, 9, 12, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 571
ugguguggau uguucaucat t 21
<210> 572
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 13, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 572
ugaugaacaa uccacaccat t 21
<210> 573
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 12, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 10, 11, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 573
auucacccug acagaguuct t 21
<210> 574
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 574
gaacucuguc agggugaaut t 21
<210> 575
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 7, 8, 9, 11, 12, 13, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 10, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 575
uaagaccuua uuugguaaut t 21
<210> 576
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 10, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 576
auuaccaaau aaggucuuat t 21
<210> 577
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 9, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 10, 11, 12, 13, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 577
aagcaaugug gaaaccuaat t 21
<210> 578
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 578
uuagguuucc acauugcuut t 21
<210> 579
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 8, 9, 13, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 10, 11, 12, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 579
ucugaaacug gauaucccat t 21
<210> 580
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA cross-reactive to human and rhesus monkey Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 580
ugggauaucc aguuucagat t 21
<210> 581
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 10, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 9, 11, 12, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 581
ccauuacuac aguagcacut t 21
<210> 582
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 582
agugcuacug uaguaauggt t 21
<210> 583
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 7, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 6, 8, 9, 12, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 583
aucuggcaac cauauuucut t 21
<210> 584
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 584
agaaauaugg uugccagaut t 21
<210> 585
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 7, 11, 12, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 8, 9, 10, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 585
gauagcuaaa uuaaaccaat t 21
<210> 586
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 586
uugguuuaau uuagcuauct t 21
<210> 587
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 7, 9, 10, 12, 13, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 8, 11, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 587
agauaccauu acuacaguat t 21
<210> 588
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 9, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 588
uacuguagua augguaucut t 21
<210> 589
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 10, 11, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 9, 12, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 589
gauuguucau caauuggcgt t 21
<210> 590
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 590
cgccaauuga ugaacaauct t 21
<210> 591
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 12, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 591
gcuuucuccu cggcucacut t 21
<210> 592
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 592
agugagccga ggagaaagct t 21
<210> 593
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 8, 11, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 9, 10, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 593
ggaggauugg cugacaagat t 21
<210> 594
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 594
ucuugucagc caauccucct t 21
<210> 595
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 11, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 12, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 595
uaaugaagag uauaccuggt t 21
<210> 596
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 8, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 9, 10, 11, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 596
ccagguauac ucuucauuat t 21
<210> 597
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 11, 12, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 8, 9, 10, 13, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 597
uuucaccaaa ccauuuguat t 21
<210> 598
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 598
uacaaauggu uuggugaaat t 21
<210> 599
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 13, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 7, 8, 9, 10, 11, 12, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 599
cuuauuaagg aguauacggt t 21
<210> 600
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 9, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 600
ccguauacuc cuuaauaagt t 21
<210> 601
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 10, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 8, 9, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 601
gaaaucagau ggacguaagt t 21
<210> 602
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 602
cuuacgucca ucugauuuct t 21
<210> 603
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 7, 8, 11, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 9, 10, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 603
cagaugucag cauaagcgat t 21
<210> 604
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 604
ucgcuuaugc ugacaucugt t 21
<210> 605
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 7, 8, 9, 10, 13, 14, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 6, 11, 12, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 605
aucuaacccu aguuguauct t 21
<210> 606
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 9, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 606
gauacaacua ggguuagaut t 21
<210> 607
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 8, 10, 11, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 9, 12, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 607
aagagcuugu uaaaaucggt t 21
<210> 608
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 608
ccgauuuuaa caagcucuut t 21
<210> 609
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 9, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 8, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 609
uuaaggagua uacggaggat t 21
<210> 610
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 610
uccuccguau acuccuuaat t 21
<210> 611
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 9, 13, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 8, 10, 11, 12, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 611
uugcaaugua aauacguaut t 21
<210> 612
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 10, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 612
auacguauuu acauugcaat t 21
<210> 613
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 8, 9, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 10, 11, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 613
ucuaacccua guuguaucct t 21
<210> 614
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 614
ggauacaacu aggguuagat t 21
<210> 615
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 615
cauguaucuu uuucucgaut t 21
<210> 616
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 616
aucgagaaaa agauacaugt t 21
<210> 617
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 9, 11, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 7, 8, 10, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 617
gaugucagca uaagcgaugt t 21
<210> 618
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 618
caucgcuuau gcugacauct t 21
<210> 619
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 11, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 8, 9, 10, 12, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 619
ucccaacagg uacgacacct t 21
<210> 620
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 620
ggugucguac cuguugggat t 21
<210> 621
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 10, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 8, 9, 11, 12, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 621
ugcucacgau gaguuuagut t 21
<210> 622
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 622
acuaaacuca ucgugagcat t 21
<210> 623
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 9, 10, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 11, 12, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 623
agagcuuguu aaaaucggat t 21
<210> 624
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 624
uccgauuuua acaagcucut t 21
<210> 625
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 12, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 9, 10, 11, 13, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 625
gcguacaaga acaucuauat t 21
<210> 626
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 626
uauagauguu cuuguacgct t 21
<210> 627
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 8, 12, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 9, 10, 11, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 627
gagguuguaa gccaauguut t 21
<210> 628
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 628
aacauuggcu uacaaccuct t 21
<210> 629
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 9, 12, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 10, 11, 13, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 629
aacagguacg acaccacagt t 21
<210> 630
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 630
cugugguguc guaccuguut t 21
<210> 631
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 6, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 7, 8, 11, 13
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 631
aacccuaguu guaucccuct t 21
<210> 632
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 632
gagggauaca acuaggguut t 21
<210> 633
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 8, 11, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 9, 10, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 633
gcauaagcga uggauaauat t 21
<210> 634
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 8, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 634
uauuauccau cgcuuaugct t 21
<210> 635
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 11, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 12, 13, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 635
aagcgaugga uaauaccuat t 21
<210> 636
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 8, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 636
uagguauuau ccaucgcuut t 21
<210> 637
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 9, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 8, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 637
ugauccugua cgaaaagaat t 21
<210> 638
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 638
uucuuuucgu acaggaucat t 21
<210> 639
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 8, 11, 12, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 9, 10, 13, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 639
aaaacauugg ccguucuggt t 21
<210> 640
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 640
ccagaacggc caauguuuut t 21
<210> 641
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 10, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 641
cuuggagggc guacaagaat t 21
<210> 642
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 642
uucuuguacg cccuccaagt t 21
<210> 643
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 7, 13, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 8, 9, 10, 11, 12, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 643
ggcguacaag aacaucuaut t 21
<210> 644
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 644
auagauguuc uuguacgcct t 21
<210> 645
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 9, 11, 13, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 6, 7, 8, 10, 12, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 645
acucugagua cauuggaaut t 21
<210> 646
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 646
auuccaaugu acucagagut t 21
<210> 647
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 12, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 7, 8, 9, 10, 11, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 647
uuauuaagga guauacggat t 21
<210> 648
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 648
uccguauacu ccuuaauaat t 21
<210> 649
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 10, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 649
uaaggaguau acggaggagt t 21
<210> 650
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 650
cuccuccgua uacuccuuat t 21
<210> 651
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 8, 11, 12, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 9, 10, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 651
aaaucaauag ucaacuaaat t 21
<210> 652
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 652
uuuaguugac uauugauuut t 21
<210> 653
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 10, 11, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 9, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 653
aaucaauagu caacuaaagt t 21
<210> 654
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 654
cuuuaguuga cuauugauut t 21
<210> 655
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 10, 12, 13, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 7, 9, 11, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 655
uucucaguau acuguguaat t 21
<210> 656
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 9, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 656
uuacacagua uacugagaat t 21
<210> 657
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 8, 10, 11, 12, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 9, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 657
ugugaaacac ucugauaaat t 21
<210> 658
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 658
uuuaucagag uguuucacat t 21
<210> 659
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 10, 11, 12, 13, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 9, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 659
agaugugaau cucugaacat t 21
<210> 660
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 660
uguucagaga uucacaucut t 21
<210> 661
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 11, 12, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 8, 9, 10, 13, 14, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 661
agguuguaag ccaauguugt t 21
<210> 662
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 662
caacauuggc uuacaaccut t 21
<210> 663
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 9, 13, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 10, 11, 12, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 663
ugagaaauca gauggacgut t 21
<210> 664
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 664
acguccaucu gauuucucat t 21
<210> 665
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 11, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 9, 10, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 665
agaaaucaga uggacguaat t 21
<210> 666
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 666
uuacguccau cugauuucut t 21
<210> 667
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 10, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 8, 9, 11, 12, 13, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 667
auaucccaac agguacgact t 21
<210> 668
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 668
gucguaccug uugggauaut t 21
<210> 669
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 10, 12, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 11, 13, 14, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 669
cccaacaggu acgacaccat t 21
<210> 670
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 670
uggugucgua ccuguugggt t 21
<210> 671
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 7, 8, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 9, 10, 11, 12, 13, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 671
aguauacuga agaaccucut t 21
<210> 672
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 672
agagguucuu caguauacut t 21
<210> 673
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 8, 9, 12, 13, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 7, 10, 11, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 673
auauauauca gccgggcgct t 21
<210> 674
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 674
gcgcccggcu gauauauaut t 21
<210> 675
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 8, 9, 10, 11, 14, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 12, 13, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 675
aaucuaaccc uaguuguaut t 21
<210> 676
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 676
auacaacuag gguuagauut t 21
<210> 677
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 8, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 9, 10, 13, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 677
cuaacccuag uuguauccct t 21
<210> 678
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 678
gggauacaac uaggguuagt t 21
<210> 679
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 7, 9
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 679
cuaguuguau cccuccuuut t 21
<210> 680
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 680
aaaggaggga uacaacuagt t 21
<210> 681
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 7, 8, 11, 12, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 9, 10, 13, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 681
agacaucuga cuaauggcut t 21
<210> 682
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 682
agccauuagu cagaugucut t 21
<210> 683
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 9, 12, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 10, 11, 13, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 683
gaagcucaca augauuuaat t 21
<210> 684
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 684
uuaaaucauu gugagcuuct t 21
<210> 685
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 7, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 685
acauguaucu uuuucucgat t 21
<210> 686
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 686
ucgagaaaaa gauacaugut t 21
<210> 687
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 11, 12, 13, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 8, 9, 10, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 687
ucgauucaaa ucuuaaccct t 21
<210> 688
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 688
ggguuaagau uugaaucgat t 21
<210> 689
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 8, 9, 10, 11, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 12, 13, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 689
ucuuaacccu uaggacucut t 21
<210> 690
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 690
agaguccuaa ggguuaagat t 21
<210> 691
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 6, 9, 13, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 7, 8, 10, 11, 12, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 691
gcucacgaug aguuuagugt t 21
<210> 692
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 692
cacuaaacuc aucgugagct t 21
<210> 693
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 7, 10, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 9, 11, 12, 13, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 693
cauaagcgau ggauaauact t 21
<210> 694
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 9, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 694
guauuaucca ucgcuuaugt t 21
<210> 695
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 9, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 10, 11, 12, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 695
auaagcgaug gauaauacct t 21
<210> 696
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 10, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 9, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 696
gguauuaucc aucgcuuaut t 21
<210> 697
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 10, 11, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 12, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 697
ccuaauaaac ugcccucagt t 21
<210> 698
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 698
cugagggcag uuuauuaggt t 21
<210> 699
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 9, 10, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 8, 11, 12, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 699
ucggaaaguu gaacuuggut t 21
<210> 700
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 700
accaaguuca acuuuccgat t 21
<210> 701
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 9, 12, 13, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 10, 11, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 701
gaaaacauug gccguucugt t 21
<210> 702
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 702
cagaacggcc aauguuuuct t 21
<210> 703
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 9, 10, 11, 12, 13, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 8, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 703
aagacugauc uucuaaguut t 21
<210> 704
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 704
aacuuagaag aucagucuut t 21
<210> 705
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 8, 9, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 7, 10, 11, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 705
gagcuuguua aaaucggaat t 21
<210> 706
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 706
uuccgauuuu aacaagcuct t 21
<210> 707
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 8, 9, 11, 12, 13, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 7, 10, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 707
acauuggccg uucuggagct t 21
<210> 708
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 708
gcuccagaac ggccaaugut t 21
<210> 709
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 9, 10, 12, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 11, 13, 14, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 709
aagaacaucu auaauugcat t 21
<210> 710
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 710
ugcaauuaua gauguucuut t 21
<210> 711
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 8, 9, 10, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 11, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 711
aaaugugucu acucauguut t 21
<210> 712
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 712
aacaugagua gacacauuut t 21
<210> 713
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 11, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 10, 12, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 713
ugucuacuca uguuucucat t 21
<210> 714
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 714
ugagaaacau gaguagacat t 21
<210> 715
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 7, 9, 11, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 8, 10, 12, 13, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 715
guauacugug uaacaaucut t 21
<210> 716
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10, 12, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 716
agauuguuac acaguauact t 21
<210> 717
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 8, 10, 13, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 7, 9, 11, 12, 14, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 717
uauacugugu aacaaucuat t 21
<210> 718
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 9, 11, 13, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 718
uagauuguua cacaguauat t 21
<210> 719
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 9, 11, 12, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 7, 8, 10, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 719
cuuaguagug uccaggaaat t 21
<210> 720
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 720
uuuccuggac acuacuaagt t 21
<210> 721
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 10, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 7, 8, 9, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 721
ucagauggac guaaggcagt t 21
<210> 722
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 722
cugccuuacg uccaucugat t 21
<210> 723
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 9, 12, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 10, 11, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 723
agauaaauug auagcacaat t 21
<210> 724
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 724
uugugcuauc aauuuaucut t 21
<210> 725
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 8, 10, 13, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 9, 11, 12, 14, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 725
caacagguac gacaccacat t 21
<210> 726
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 726
uguggugucg uaccuguugt t 21
<210> 727
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 6, 8, 12, 14, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 7, 9, 10, 11, 13, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 727
ugcaauguaa auacguauut t 21
<210> 728
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 11, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 728
aauacguauu uacauugcat t 21
<210> 729
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 9, 10, 11, 12, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 8, 13, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 729
agucagaauu uuaucuagat t 21
<210> 730
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 730
ucuagauaaa auucugacut t 21
<210> 731
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 8, 9, 10, 11, 12, 13, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 731
cuagaaaucu uuuaacacct t 21
<210> 732
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 732
gguguuaaaa gauuucuagt t 21
<210> 733
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 8, 9, 12, 13, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 10, 11, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 733
aauaaaucua acccuaguut t 21
<210> 734
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 734
aacuaggguu agauuuauut t 21
<210> 735
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 8, 10, 11, 12, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 9, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 735
aauuuucugc ucacgaugat t 21
<210> 736
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 736
ucaucgugag cagaaaauut t 21
<210> 737
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 9, 13, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 7, 8, 10, 11, 12, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 737
gcccucagua aauccauggt t 21
<210> 738
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 738
ccauggauuu acugagggct t 21
<210> 739
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 11, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 7, 8, 9, 10, 12, 13, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 739
acguuuaaaa cgagaucuut t 21
<210> 740
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 740
aagaucucgu uuuaaacgut t 21
<210> 741
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 12, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 13, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 741
aggagauaga acguuuaaat t 21
<210> 742
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 742
uuuaaacguu cuaucuccut t 21
<210> 743
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 9, 12, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 8, 10, 11, 13, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 743
gaccgucaug gcgucgcagt t 21
<210> 744
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 744
cugcgacgcc augacgguct t 21
<210> 745
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 8, 11, 13, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 7, 9, 10, 12, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 745
accgucaugg cgucgcagct t 21
<210> 746
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 746
gcugcgacgc caugacggut t 21
<210> 747
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 7, 8, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 9, 10, 11, 12, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 747
gaacguuuaa aacgagauct t 21
<210> 748
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 748
gaucucguuu uaaacguuct t 21
<210> 749
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 7, 8, 11, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 9, 10, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 749
uugagcuuaa cauagguaat t 21
<210> 750
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 750
uuaccuaugu uaagcucaat t 21
<210> 751
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 7, 8, 11, 12, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 9, 10, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 751
acuaaauuga ucucguagat t 21
<210> 752
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 752
ucuacgagau caauuuagut t 21
<210> 753
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 9, 10, 12, 13, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 7, 8, 11, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 753
ucguagaauu aucuuaauat t 21
<210> 754
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 9, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 754
uauuaagaua auucuacgat t 21
<210> 755
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 13, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 755
ggagauagaa cguuuaaaat t 21
<210> 756
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 756
uuuuaaacgu ucuaucucct t 21
<210> 757
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 6, 7, 9, 10, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 8, 11, 12, 13, 14, 15, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 757
acaacuuauu ggagguugut t 21
<210> 758
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 758
acaaccucca auaaguugut t 21
<210> 759
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 7, 10, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 8, 9, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 759
ugagcuuaac auagguaaat t 21
<210> 760
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 760
uuuaccuaug uuaagcucat t 21
<210> 761
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 12, 13, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 6, 8, 9, 10, 11, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 761
aucucguaga auuaucuuat t 21
<210> 762
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 762
uaagauaauu cuacgagaut t 21
<210> 763
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 6, 8, 11, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 7, 9, 10, 13, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 763
cugcgugcag ucgguccuct t 21
<210> 764
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 764
gaggaccgac ugcacgcagt t 21
<210> 765
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 8, 10, 11, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 7, 9, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 765
cacgcagcgc ccgagaguat t 21
<210> 766
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 766
uacucucggg cgcugcgugt t 21
<210> 767
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 7, 8, 9, 10, 11, 12, 13, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 767
aguaccaggg agacuccggt t 21
<210> 768
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 768
ccggagucuc ccugguacut t 21
<210> 769
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 11, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 769
acggaggaga uagaacguut t 21
<210> 770
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 770
aacguucuau cuccuccgut t 21
<210> 771
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 8, 9, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 10, 11, 12, 13, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 771
agaacguuua aaacgagaut t 21
<210> 772
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 772
aucucguuuu aaacguucut t 21
<210> 773
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 7, 12, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 8, 9, 10, 11, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 773
aacguuuaaa acgagaucut t 21
<210> 774
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 774
agaucucguu uuaaacguut t 21
<210> 775
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 9, 10, 11, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 8, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 775
agcuugagcu uaacauaggt t 21
<210> 776
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 776
ccuauguuaa gcucaagcut t 21
<210> 777
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 8, 10, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 9, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 777
agcuuaacau agguaaauat t 21
<210> 778
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 9, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 778
uauuuaccua uguuaagcut t 21
<210> 779
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 7, 9, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 8, 10, 11, 12, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 779
uagagcuaca aaaccuauct t 21
<210> 780
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 780
gauagguuuu guagcucuat t 21
<210> 781
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 6, 8, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 781
uaguuguauc ccuccuuuat t 21
<210> 782
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 12, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 782
uaaaggaggg auacaacuat t 21
<210> 783
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 11, 13, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 8, 9, 10, 12, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 783
accacccaga caucugacut t 21
<210> 784
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 784
agucagaugu cuggguggut t 21
<210> 785
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 11, 12, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 9, 10, 13, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 785
agaaacuaaa uugaucucgt t 21
<210> 786
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 786
cgagaucaau uuaguuucut t 21
<210> 787
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 11, 12, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 7, 8, 9, 10, 13, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 787
ucucguagaa uuaucuuaat t 21
<210> 788
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 788
uuaagauaau ucuacgagat t 21
<210> 789
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 8, 9, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 7, 10, 11, 12, 13, 14, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 789
caacuuauug gagguuguat t 21
<210> 790
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 790
uacaaccucc aauaaguugt t 21
<210> 791
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 791
uuguaucccu ccuuuaagut t 21
<210> 792
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 792
acuuaaagga gggauacaat t 21
<210> 793
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 8, 9, 11, 12, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 10, 13, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 793
ucacaacuua uuggagguut t 21
<210> 794
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 794
aaccuccaau aaguugugat t 21
<210> 795
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 8, 10, 11, 12, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 9, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 795
agaacuguac ucuucucagt t 21
<210> 796
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 796
cugagaagag uacaguucut t 21
<210> 797
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 9, 11, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 7, 8, 10, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 797
gagcuuaaca uagguaaaut t 21
<210> 798
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 798
auuuaccuau guuaagcuct t 21
<210> 799
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 7, 9, 10, 11, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 6, 8, 12, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 799
caccaacauc uguccuuagt t 21
<210> 800
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 800
cuaaggacag auguuggugt t 21
<210> 801
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 9, 10, 11, 12, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 13, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 801
aaagcccacu uuagaguaut t 21
<210> 802
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 802
auacucuaaa gugggcuuut t 21
<210> 803
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 8, 9, 10, 11, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 7, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 803
aagcccacuu uagaguauat t 21
<210> 804
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 804
uauacucuaa agugggcuut t 21
<210> 805
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 6, 8, 9, 10, 13, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 7, 11, 12, 14, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 805
gaccuuauuu gguaaucugt t 21
<210> 806
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 9, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 806
cagauuacca aauaagguct t 21
<210> 807
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 9, 11, 12, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 10, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 807
gauuaaugua cucaagacut t 21
<210> 808
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 808
agucuugagu acauuaauct t 21
<210> 809
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 11, 12, 13, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 7, 8, 9, 10, 14, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 809
cuuuaagagg ccuaacucat t 21
<210> 810
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 810
ugaguuaggc cucuuaaagt t 21
<210> 811
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 6, 7, 11, 12, 13, 14, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 8, 9, 10, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 811
uuaaaccaaa cccuauugat t 21
<210> 812
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 812
ucaauagggu uugguuuaat t 21
<210> 813
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 12, 13, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 7, 8, 9, 10, 11, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 813
ucuguuggag aucuauaaut t 21
<210> 814
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 814
auuauagauc uccaacagat t 21
<210> 815
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 9, 10, 11, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 12, 13, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 815
cugauguuuc ugagagacut t 21
<210> 816
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 816
agucucucag aaacaucagt t 21
<210> 817
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 7, 8, 9, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 10, 11, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 817
gcauacucua gucguuccct t 21
<210> 818
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 818
gggaacgacu agaguaugct t 21
<210> 819
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 10, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 8, 11, 12, 13, 14, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 819
guuccuuauc gagaaucuat t 21
<210> 820
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 820
uagauucucg auaaggaact t 21
<210> 821
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 7, 8, 9, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 821
gcacuuggau cucucacaut t 21
<210> 822
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 822
augugagaga uccaagugct t 21
<210> 823
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 12, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 13, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 823
aaaaaaggaa cuagauggct t 21
<210> 824
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 824
gccaucuagu uccuuuuuut t 21
<210> 825
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 10, 12, 13, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 11, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 825
agagcagauu accucugcgt t 21
<210> 826
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 826
cgcagaggua aucugcucut t 21
<210> 827
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 8, 10, 11, 12, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 9, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 827
agcagauuac cucugcgagt t 21
<210> 828
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 828
cucgcagagg uaaucugcut t 21
<210> 829
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 12, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 8, 9, 10, 11, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 829
cccugacaga guucacaaat t 21
<210> 830
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 830
uuugugaacu cugucagggt t 21
<210> 831
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 8, 9, 10, 11, 13, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 831
guuuaccgaa guguuguuut t 21
<210> 832
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 832
aaacaacacu ucgguaaact t 21
<210> 833
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 9, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 8, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 833
uuacaguaca caacaaggat t 21
<210> 834
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 834
uccuuguugu guacuguaat t 21
<210> 835
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 7, 8, 10, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 9, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 835
acuggaucgu aagaaggcat t 21
<210> 836
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 836
ugccuucuua cgauccagut t 21
<210> 837
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 9, 11, 12, 13, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 10, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 837
gagcagauua ccucugcgat t 21
<210> 838
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 838
ucgcagaggu aaucugcuct t 21
<210> 839
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 10, 13, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 11, 12, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 839
aaaagaaguu aguguacgat t 21
<210> 840
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 840
ucguacacua acuucuuuut t 21
<210> 841
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 11, 12, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 9, 10, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 841
gaccauuuaa uuuggcagat t 21
<210> 842
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 842
ucugccaaau uaaaugguct t 21
<210> 843
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 12, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 843
gagaggagug auaauuaaat t 21
<210> 844
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 844
uuuaauuauc acuccucuct t 21
<210> 845
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 9, 10, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 8, 11, 12, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 845
cuggaggauu ggcugacaat t 21
<210> 846
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 846
uugucagcca auccuccagt t 21
<210> 847
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 8, 10, 11, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 9, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 847
cucuagucgu ucccacucat t 21
<210> 848
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 848
ugagugggaa cgacuagagt t 21
<210> 849
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 8, 9, 11, 12, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 7, 10, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 849
gauaccauua cuacaguagt t 21
<210> 850
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 850
cuacuguagu aaugguauct t 21
<210> 851
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 851
uucgucugcg aagaagaaat t 21
<210> 852
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 852
uuucuucuuc gcagacgaat t 21
<210> 853
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 11, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 12, 13, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 853
gaaaagaagu uaguguacgt t 21
<210> 854
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 854
cguacacuaa cuucuuuuct t 21
<210> 855
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 6, 7, 8, 10, 11, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 9, 12, 13, 14, 15, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 855
ugauguuuac cgaaguguut t 21
<210> 856
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 856
aacacuucgg uaaacaucat t 21
<210> 857
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 12, 13, 14, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 10, 11, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 857
uguuugucca auucuggaut t 21
<210> 858
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 858
auccagaauu ggacaaacat t 21
<210> 859
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 9, 11, 13, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 12, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 859
augaagagua uaccugggat t 21
<210> 860
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 10, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 860
ucccagguau acucuucaut t 21
<210> 861
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 11, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 9, 10, 12, 13, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 861
gcuacucuga ugaaugcaut t 21
<210> 862
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 862
augcauucau cagaguagct t 21
<210> 863
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 7, 9, 10, 11, 12, 13, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 863
gcccuuguag aaagaacact t 21
<210> 864
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 864
guguucuuuc uacaagggct t 21
<210> 865
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 13, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 865
ucauguuccu uaucgagaat t 21
<210> 866
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 866
uucucgauaa ggaacaugat t 21
<210> 867
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9, 10, 12, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 11, 13, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 867
gaauaggguu acagaguugt t 21
<210> 868
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 9, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 868
caacucugua acccuauuct t 21
<210> 869
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 10, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 7, 8, 9, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 869
caaacuggau cguaagaagt t 21
<210> 870
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 870
cuucuuacga uccaguuugt t 21
<210> 871
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 10, 13, 14, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 8, 9, 11, 12, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 871
cuuauuuggu aaucugcugt t 21
<210> 872
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 9, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 872
cagcagauua ccaaauaagt t 21
<210> 873
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 8, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 9, 10, 11, 12, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 873
agcaaugugg aaaccuaact t 21
<210> 874
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 874
guuagguuuc cacauugcut t 21
<210> 875
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 10, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 11, 12, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 875
acaauaaagc agacccauut t 21
<210> 876
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 876
aaugggucug cuuuauugut t 21
<210> 877
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 11, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 9, 10, 12, 13, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 877
aaccacuuag uaguguccat t 21
<210> 878
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 878
uggacacuac uaagugguut t 21
<210> 879
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 10, 11, 13, 14, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 8, 9, 12, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 879
agucaagagc caucuguagt t 21
<210> 880
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 880
cuacagaugg cucuugacut t 21
<210> 881
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 7, 8, 9, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 881
cucccuagac uucccuauut t 21
<210> 882
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 882
aauagggaag ucuagggagt t 21
<210> 883
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 6, 10, 11, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 7, 8, 9, 12, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 883
auagcuaaau uaaaccaaat t 21
<210> 884
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 884
uuugguuuaa uuuagcuaut t 21
<210> 885
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 8, 10, 13, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 6, 7, 9, 11, 12, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 885
uggcugguau aauuccacgt t 21
<210> 886
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 886
cguggaauua uaccagccat t 21
<210> 887
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 9, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 7, 8, 10, 11, 15, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 887
uuauuuggua aucugcugut t 21
<210> 888
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 10, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 888
acagcagauu accaaauaat t 21
<210> 889
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 8, 11, 12, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 9, 10, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 889
aacuagaugg cuuucucagt t 21
<210> 890
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 890
cugagaaagc caucuaguut t 21
<210> 891
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 9, 10, 12, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 8, 11, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 891
ucauggcguc gcagccaaat t 21
<210> 892
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 892
uuuggcugcg acgccaugat t 21
<210> 893
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 10, 11, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 8, 9, 12, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 893
acuggaggau uggcugacat t 21
<210> 894
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 894
ugucagccaa uccuccagut t 21
<210> 895
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 8, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 9, 11, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 895
cuauaauugc acuaucuuut t 21
<210> 896
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 896
aaagauagug caauuauagt t 21
<210> 897
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 9, 10, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 897
aaaggucacc uaaugaagat t 21
<210> 898
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 898
ucuucauuag gugaccuuut t 21
<210> 899
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 8, 10, 12, 13, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 9, 11, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 899
augaaugcau acucuaguct t 21
<210> 900
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 900
gacuagagua ugcauucaut t 21
<210> 901
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 7, 8, 12, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 9, 10, 11, 13, 14, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 901
aacauauuga auaagccugt t 21
<210> 902
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 902
caggcuuauu caauauguut t 21
<210> 903
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 11, 12, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 13, 14, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 903
aagaaggcag uugaccaact t 21
<210> 904
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 904
guuggucaac ugccuucuut t 21
<210> 905
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 14, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 7, 8, 9, 10, 11, 12, 13, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 905
gauacuaaaa gaacaaucat t 21
<210> 906
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 906
ugauuguucu uuuaguauct t 21
<210> 907
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 11, 12, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 7, 8, 9, 10, 13, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 907
auacugaaaa ucaauaguct t 21
<210> 908
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 908
gacuauugau uuucaguaut t 21
<210> 909
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 11, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 12, 13, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 909
aaaaaggaac uagauggcut t 21
<210> 910
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 910
agccaucuag uuccuuuuut t 21
<210> 911
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 9, 12, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 8, 10, 11, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 911
gaacuagaug gcuuucucat t 21
<210> 912
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 912
ugagaaagcc aucuaguuct t 21
<210> 913
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 10, 11, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 9, 12, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 913
gaaaccuaac ugaagaccut t 21
<210> 914
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 914
aggucuucag uuagguuuct t 21
<210> 915
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 11, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 9, 10, 12, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 915
uacccaucaa cacugguaat t 21
<210> 916
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 916
uuaccagugu ugauggguat t 21
<210> 917
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 8, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 6, 7, 9, 13, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 917
auuuugauau cuacccauut t 21
<210> 918
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 918
aauggguaga uaucaaaaut t 21
<210> 919
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 11, 12, 13, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 7, 9, 10, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 919
aucccuauag uucacuuugt t 21
<210> 920
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 920
caaagugaac uauagggaut t 21
<210> 921
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 7, 9, 12, 13, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 8, 10, 11, 14, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 921
augggcuaua auugcacuat t 21
<210> 922
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 6, 10, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 7, 8, 9, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 922
uagugcaauu auagcccaut t 21
<210> 923
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 10, 11, 13, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 12, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 923
agauuaccuc ugcgagccct t 21
<210> 924
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 924
gggcucgcag agguaaucut t 21
<210> 925
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 9, 11, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 8, 10, 12, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 925
uaauuccacg uacccuucat t 21
<210> 926
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 926
ugaaggguac guggaauuat t 21
<210> 927
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 10, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 927
gucguuccca cucaguuuut t 21
<210> 928
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 928
aaaacugagu gggaacgact t 21
<210> 929
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 8, 9, 10, 11, 12, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 13, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 929
aaaucaaucc cuguugacut t 21
<210> 930
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 930
agucaacagg gauugauuut t 21
<210> 931
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 9, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 931
ucauagagca aagaacauat t 21
<210> 932
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 932
uauguucuuu gcucuaugat t 21
<210> 933
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 10, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 8, 9, 11, 12, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 933
uuacuacagu agcacuuggt t 21
<210> 934
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 9, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 934
ccaagugcua cuguaguaat t 21
<210> 935
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 10, 11, 12, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 13, 14, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 935
auguggaaac cuaacugaat t 21
<210> 936
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 936
uucaguuagg uuuccacaut t 21
<210> 937
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 9, 10, 11, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 937
uguggaaacc uaacugaagt t 21
<210> 938
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 938
cuucaguuag guuuccacat t 21
<210> 939
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 939
ucuuccuuaa augaaagggt t 21
<210> 940
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 940
cccuuucauu uaaggaagat t 21
<210> 941
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 9, 10, 11, 12, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 941
ugaagaaccu cuaagucaat t 21
<210> 942
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 942
uugacuuaga gguucuucat t 21
<210> 943
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 7, 8, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 943
agaggucuaa aguggaagat t 21
<210> 944
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 944
ucuuccacuu uagaccucut t 21
<210> 945
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 7, 11, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 945
auaucuaccc auuuuucugt t 21
<210> 946
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 13, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 946
cagaaaaaug gguagauaut t 21
<210> 947
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 6, 7, 12, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 8, 9, 10, 11, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 947
uaagccugaa gugaaucagt t 21
<210> 948
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 948
cugauucacu ucaggcuuat t 21
<210> 949
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 10, 11, 13, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 9, 12, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 949
agaugcagac cauuuaauut t 21
<210> 950
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 950
aauuaaaugg ucugcaucut t 21
<210> 951
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 8, 9, 10, 12, 13, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 7, 11, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 951
aguguuguuu guccaauuct t 21
<210> 952
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 952
gaauuggaca aacaacacut t 21
<210> 953
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 8, 9, 10, 11, 12, 13
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 953
cuauaaugaa gagcuuuuut t 21
<210> 954
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 954
aaaaagcucu ucauuauagt t 21
<210> 955
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 11, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 955
agaggaguga uaauuaaagt t 21
<210> 956
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 956
cuuuaauuau cacuccucut t 21
<210> 957
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 12, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 8, 11, 13, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 957
uuucucuguu acaauacaut t 21
<210> 958
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 958
auguauugua acagagaaat t 21
<210> 959
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 7, 9, 12, 13, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 8, 10, 11, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 959
aacaucuaua auugcaacat t 21
<210> 960
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 10, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 960
uguugcaauu auagauguut t 21
<210> 961
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 10, 12, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 6, 7, 8, 9, 11, 13, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 961
ugcuagaagu acauaagact t 21
<210> 962
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 11, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 962
gucuuaugua cuucuagcat t 21
<210> 963
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 7, 8, 9, 14, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 10, 11, 12, 13, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 963
aauguacuca agacugauct t 21
<210> 964
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 964
gaucagucuu gaguacauut t 21
<210> 965
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 6, 11, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 7, 8, 9, 10, 13, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 965
guacucaaga cugaucuuct t 21
<210> 966
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 966
gaagaucagu cuugaguact t 21
<210> 967
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 9, 13, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 7, 8, 10, 11, 12, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 967
cacucugaua aacucaaugt t 21
<210> 968
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 968
cauugaguuu aucagagugt t 21
<210> 969
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 12, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 969
aagagcagau uaccucugct t 21
<210> 970
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 970
gcagagguaa ucugcucuut t 21
<210> 971
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 9, 10, 11, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 6, 7, 8, 12, 13, 14, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 971
ucugcgagcc cagaucaact t 21
<210> 972
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 972
guugaucugg gcucgcagat t 21
<210> 973
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 9, 10, 11, 12, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 8, 13, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 973
aacuugagcc uuguguauat t 21
<210> 974
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 7, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 974
uauacacaag gcucaaguut t 21
<210> 975
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 8, 10, 12, 13, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 9, 11, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 975
gaauauauau aucagccggt t 21
<210> 976
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 976
ccggcugaua uauauauuct t 21
<210> 977
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 12, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 11, 13, 14, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 977
ugucaucccu auaguucact t 21
<210> 978
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 978
gugaacuaua gggaugacat t 21
<210> 979
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 8, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 9, 10, 13, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 979
gaucuggcaa ccauauuuct t 21
<210> 980
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 980
gaaauauggu ugccagauct t 21
<210> 981
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7, 8, 10, 12, 13, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 9, 11, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 981
uggcaaccau auuucuggat t 21
<210> 982
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 982
uccagaaaua ugguugccat t 21
<210> 983
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 7, 9, 10, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 8, 11, 12, 13, 14, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 983
gauguuuacc gaaguguugt t 21
<210> 984
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 12, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 984
caacacuucg guaaacauct t 21
<210> 985
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 7, 10, 11, 12, 13, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 985
uuccuuaucg agaaucuaat t 21
<210> 986
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 986
uuagauucuc gauaaggaat t 21
<210> 987
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 8, 9, 11, 12, 13, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 10, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 987
agcuuaauug cuuucuggat t 21
<210> 988
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 988
uccagaaagc aauuaagcut t 21
<210> 989
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 7, 8, 10, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 9, 11, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 989
uugcuauuau gggagaccat t 21
<210> 990
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 990
uggucuccca uaauagcaat t 21
<210> 991
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 8, 10, 11, 13, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 6, 7, 9, 12, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 991
gucauggcgu cgcagccaat t 21
<210> 992
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 992
uuggcugcga cgccaugact t 21
<210> 993
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 7, 9, 10, 12, 13, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 6, 8, 11, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 993
uaauugcacu aucuuugcgt t 21
<210> 994
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 9, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 994
cgcaaagaua gugcaauuat t 21
<210> 995
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 10, 12, 14, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 9, 11, 13, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 995
cuaucuuugc guauggccat t 21
<210> 996
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 996
uggccauacg caaagauagt t 21
<210> 997
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 8, 9, 13, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 997
ucccuauagu ucacuuugut t 21
<210> 998
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 998
acaaagugaa cuauagggat t 21
<210> 999
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 6, 7, 8, 9, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 10, 11, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 999
ucaaccuuua auucacuugt t 21
<210> 1000
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1000
caagugaauu aaagguugat t 21
<210> 1001
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 6, 7, 9, 11, 12, 13, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 8, 10, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1001
ggcaaccaua uuucuggaat t 21
<210> 1002
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1002
uuccagaaau augguugcct t 21
<210> 1003
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 7, 8, 13, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 9, 10, 11, 12, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1003
auguacucaa gacugaucut t 21
<210> 1004
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1004
agaucagucu ugaguacaut t 21
<210> 1005
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 7, 9, 10, 11, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 8, 12, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1005
gcagaccauu uaauuuggct t 21
<210> 1006
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1006
gccaaauuaa auggucugct t 21
<210> 1007
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 10, 11, 13, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 12, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1007
ucugagagac uacagaugut t 21
<210> 1008
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1008
acaucuguag ucucucagat t 21
<210> 1009
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 12, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1009
ugcucauaga gcaaagaact t 21
<210> 1010
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1010
guucuuugcu cuaugagcat t 21
<210> 1011
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 9, 10, 11, 12, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1011
acauaagacc uuauuuggut t 21
<210> 1012
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1012
accaaauaag gucuuaugut t 21
<210> 1013
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 8, 11, 12, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 6, 9, 10, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1013
uuugugcuga uucugauggt t 21
<210> 1014
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 11, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 8, 9, 10, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1014
ccaucagaau cagcacaaat t 21
<210> 1015
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 8, 10, 11, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 6, 7, 9, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1015
ccaucaacac ugguaagaat t 21
<210> 1016
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1016
uucuuaccag uguugauggt t 21
<210> 1017
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 8, 9, 10, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1017
agacaauucc ggauguggat t 21
<210> 1018
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1018
uccacauccg gaauugucut t 21
<210> 1019
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 10, 11, 12, 13, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 7, 8, 9, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1019
gaacuugagc cuuguguaut t 21
<210> 1020
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1020
auacacaagg cucaaguuct t 21
<210> 1021
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 9, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 7, 8, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1021
uaauuuggca gagcggaaat t 21
<210> 1022
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1022
uuuccgcucu gccaaauuat t 21
<210> 1023
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 10, 11, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 12, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1023
uggaugaagu uauuaugggt t 21
<210> 1024
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 8, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1024
cccauaauaa cuucauccat t 21
<210> 1025
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 6, 8, 12, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 7, 9, 10, 11, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1025
aucuacauga acuacaagat t 21
<210> 1026
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1026
ucuuguaguu cauguagaut t 21
<210> 1027
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 7, 8, 9, 12, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 10, 11, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1027
gguauuuuug aucuggcaat t 21
<210> 1028
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1028
uugccagauc aaaaauacct t 21
<210> 1029
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 12, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 9, 10, 11, 13, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1029
cuaaugaaga guauaccugt t 21
<210> 1030
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 7, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 8, 9, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1030
cagguauacu cuucauuagt t 21
<210> 1031
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 10, 11, 12, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1031
uuugagaaac uuacugauat t 21
<210> 1032
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 7, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1032
uaucaguaag uuucucaaat t 21
<210> 1033
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 9, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1033
cgauaagaua gaagaucaat t 21
<210> 1034
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1034
uugaucuucu aucuuaucgt t 21
<210> 1035
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 5, 8, 9, 11, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 6, 7, 10, 12, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1035
cuggcaacca uauuucuggt t 21
<210> 1036
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1036
ccagaaauau gguugccagt t 21
<210> 1037
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 7, 8, 10, 11, 13, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 9, 12, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1037
uagauaccau uacuacagut t 21
<210> 1038
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 8, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1038
acuguaguaa ugguaucuat t 21
<210> 1039
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 9, 10, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 7, 8, 11, 12, 13, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1039
guauuaaauu ggguuucaut t 21
<210> 1040
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1040
augaaaccca auuuaauact t 21
<210> 1041
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 8, 10, 11, 12, 15, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 9, 13, 14, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1041
aagaccuuau uugguaauct t 21
<210> 1042
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1042
gauuaccaaa uaaggucuut t 21
<210> 1043
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 5, 6, 9, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 7, 8, 10, 11, 12, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1043
gcuguugaua agagagcuct t 21
<210> 1044
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1044
gagcucucuu aucaacagct t 21
<210> 1045
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 9, 10, 11, 12, 13, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 8, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1045
uacucauguu ucucagauut t 21
<210> 1046
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1046
aaucugagaa acaugaguat t 21
<210> 1047
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 9, 11, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 10, 12, 13, 14, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1047
cagauggacg uaaggcagct t 21
<210> 1048
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1048
gcugccuuac guccaucugt t 21
<210> 1049
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 9, 13, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 7, 8, 10, 11, 12, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1049
uaucccaaca gguacgacat t 21
<210> 1050
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1050
ugucguaccu guugggauat t 21
<210> 1051
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 6, 7, 9, 10, 12, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 8, 11, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1051
cauugcuauu augggagact t 21
<210> 1052
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1052
gucucccaua auagcaaugt t 21
<210> 1053
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 8, 12, 13, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 7, 9, 10, 11, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1053
cccucaguaa auccauggut t 21
<210> 1054
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1054
accauggauu uacugagggt t 21
<210> 1055
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 9, 10, 12, 13, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 8, 11, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1055
ggucauuacu gcccuuguat t 21
<210> 1056
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1056
uacaagggca guaaugacct t 21
<210> 1057
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 9, 10, 11, 12, 13, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1057
aaccacucaa aaacauuugt t 21
<210> 1058
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2..19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1058
caaauguuuu ugagugguut t 21
<210> 1059
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 5, 9, 10, 13, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 6, 7, 8, 11, 12, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1059
uuugcaaguu aaugaaucut t 21
<210> 1060
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 9, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1060
agauucauua acuugcaaat t 21
<210> 1061
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 11, 14, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 9, 10, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1061
uuauuuucag uagucagaat t 21
<210> 1062
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1062
uucugacuac ugaaaauaat t 21
<210> 1063
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 10, 11, 12, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 8, 9, 13, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1063
uuuucucgau ucaaaucuut t 21
<210> 1064
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1064
aagauuugaa ucgagaaaat t 21
<210> 1065
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 14, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1065
guacgaaaag aaguuagugt t 21
<210> 1066
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1066
cacuaacuuc uuuucguact t 21
<210> 1067
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 8, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 9, 10, 11, 12, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1067
uuuaaaacga gaucuugcut t 21
<210> 1068
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1068
agcaagaucu cguuuuaaat t 21
<210> 1069
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 8, 9, 12, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 10, 11, 13, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1069
gaauugauua auguacucat t 21
<210> 1070
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1070
ugaguacauu aaucaauuct t 21
<210> 1071
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 9, 14, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 10, 11, 12, 13, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1071
gauggacgua aggcagcuct t 21
<210> 1072
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1072
gagcugccuu acguccauct t 21
<210> 1073
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 8, 9, 12, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 7, 10, 11, 13, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1073
caucugacua auggcucugt t 21
<210> 1074
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1074
cagagccauu agucagaugt t 21
<210> 1075
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 5, 6, 7, 8, 10, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 9, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1075
gugauccugu acgaaaagat t 21
<210> 1076
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1076
ucuuuucgua caggaucact t 21
<210> 1077
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 9, 10, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 8, 11, 12, 13, 14, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1077
agcucuuauu aaggaguaut t 21
<210> 1078
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1078
auacuccuua auaagagcut t 21
<210> 1079
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 7, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1079
gcucuuauua aggaguauat t 21
<210> 1080
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 10, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1080
uauacuccuu aauaagagct t 21
<210> 1081
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 8, 9, 10, 11, 12, 13, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1081
ucuuauuaag gaguauacgt t 21
<210> 1082
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 12, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1082
cguauacucc uuaauaagat t 21
<210> 1083
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 11, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 5, 6, 7, 8, 9, 10, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1083
uauuaaggag uauacggagt t 21
<210> 1084
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 15, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 9, 10, 11, 12, 13, 14, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1084
cuccguauac uccuuaauat t 21
<210> 1085
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 7, 8, 9, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1085
cugcagcccg ugagaaaaat t 21
<210> 1086
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1086
uuuuucucac gggcugcagt t 21
<210> 1087
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 7, 8, 11, 12, 13, 14, 15, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 9, 10, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1087
ucaagacuga ucuucuaagt t 21
<210> 1088
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1088
cuuagaagau cagucuugat t 21
<210> 1089
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 9, 10, 11, 13, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 7, 8, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1089
cuucuaaguu cacuggaaat t 21
<210> 1090
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1090
uuuccaguga acuuagaagt t 21
<210> 1091
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 7, 8, 11, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 9, 10, 12, 13, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1091
ugcaaguuaa ugaaucuuut t 21
<210> 1092
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 11, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1092
aaagauucau uaacuugcat t 21
<210> 1093
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 11, 13, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 6, 7, 8, 9, 10, 12, 14, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1093
aaucuaagga uauagucaat t 21
<210> 1094
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1094
uugacuauau ccuuagauut t 21
<210> 1095
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 10, 12, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 7, 8, 9, 11, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1095
aucucugaac acaagaacat t 21
<210> 1096
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1096
uguucuugug uucagagaut t 21
<210> 1097
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 11, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 7, 9, 10, 12, 13, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1097
uucugaacag uggguaucut t 21
<210> 1098
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1098
agauacccac uguucagaat t 21
<210> 1099
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 7, 8, 10, 12, 13, 14, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 9, 11, 15, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1099
aguuauuuau acccaucaat t 21
<210> 1100
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1100
uugaugggua uaaauaacut t 21
<210> 1101
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 9, 10, 12, 13, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 7, 8, 11, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1101
augcuaaacu guucagaaat t 21
<210> 1102
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1102
uuucugaaca guuuagcaut t 21
<210> 1103
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 9, 11, 12, 13, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 7, 8, 10, 14, 15, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1103
cuacagagca cuugguuact t 21
<210> 1104
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1104
guaaccaagu gcucuguagt t 21
<210> 1105
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 11, 12, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 9, 10, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1105
uauauaucag ccgggcgcgt t 21
<210> 1106
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1106
cgcgcccggc ugauauauat t 21
<210> 1107
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 8, 10, 12, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 9, 11, 13, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1107
auguaaauac guauuucuat t 21
<210> 1108
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 11, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1108
uagaaauacg uauuuacaut t 21
<210> 1109
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 11, 12, 13, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 9, 10, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1109
uuuuucucga uucaaaucut t 21
<210> 1110
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1110
agauuugaau cgagaaaaat t 21
<210> 1111
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 6, 9, 10, 11, 12, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 7, 8, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1111
aaucuuaacc cuuaggacut t 21
<210> 1112
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1112
aguccuaagg guuaagauut t 21
<210> 1113
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 9, 10, 11, 12, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 7, 8, 13, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1113
ccuuaggacu cugguauuut t 21
<210> 1114
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1114
aaauaccaga guccuaaggt t 21
<210> 1115
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 7, 8, 10, 11, 12, 13, 14, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 9, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1115
aauaaacugc ccucaguaat t 21
<210> 1116
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 11, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1116
uuacugaggg caguuuauut t 21
<210> 1117
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 5, 6, 8, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 7, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1117
gauccuguac gaaaagaagt t 21
<210> 1118
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1118
cuucuuuucg uacaggauct t 21
<210> 1119
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 8, 9, 10, 11, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1119
aaugugaucc uguacgaaat t 21
<210> 1120
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 9, 10, 11, 12, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1120
uuucguacag gaucacauut t 21
<210> 1121
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 10, 11, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 12, 13, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1121
gugaaaacau uggccguuct t 21
<210> 1122
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1122
gaacggccaa uguuuucact t 21
<210> 1123
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 11, 12, 13, 14, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 6, 7, 8, 9, 10, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1123
cuugaggaaa cucugaguat t 21
<210> 1124
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 5, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1124
uacucagagu uuccucaagt t 21
<210> 1125
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 10, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 7, 8, 9, 11, 12, 13, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1125
cguuuaaaac gagaucuugt t 21
<210> 1126
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1126
caagaucucg uuuuaaacgt t 21
<210> 1127
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 7, 12, 13, 14, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 8, 9, 10, 11, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1127
uuaaaacgag aucuugcugt t 21
<210> 1128
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1128
cagcaagauc ucguuuuaat t 21
<210> 1129
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 8, 10, 11, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 9, 13, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1129
aaagauguau cuggucucct t 21
<210> 1130
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1130
ggagaccaga uacaucuuut t 21
<210> 1131
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 10, 12, 13, 14, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 11, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1131
cagaaaaugu gucuacucat t 21
<210> 1132
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 9, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1132
ugaguagaca cauuuucugt t 21
<210> 1133
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 8, 11, 12, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 9, 10, 13, 14, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1133
caggaauuga uuaauguact t 21
<210> 1134
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 7, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1134
guacauuaau caauuccugt t 21
<210> 1135
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 8, 13, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 9, 10, 11, 12, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1135
agucaacuaa agcauauuut t 21
<210> 1136
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 11
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1136
aaauaugcuu uaguugacut t 21
<210> 1137
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 8, 11, 12, 13, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 6, 7, 9, 10, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1137
uguguaacaa ucuacaugat t 21
<210> 1138
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1138
ucauguagau uguuacacat t 21
<210> 1139
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 5, 7, 8, 9, 11, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 6, 10, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1139
auaccauuug uuccuuggut t 21
<210> 1140
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1140
accaaggaac aaaugguaut t 21
<210> 1141
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 9, 10, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1141
gcagaaaucu aaggauauat t 21
<210> 1142
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1142
uauauccuua gauuucugct t 21
<210> 1143
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 8, 9, 11, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 10, 12, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1143
uggcuucuca caggaacuct t 21
<210> 1144
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1144
gaguuccugu gagaagccat t 21
<210> 1145
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 11, 12, 13, 14, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1145
gagaugugaa ucucugaact t 21
<210> 1146
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1146
guucagagau ucacaucuct t 21
<210> 1147
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 7, 8, 11, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 9, 10, 12, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1147
uguaagccaa uguugugagt t 21
<210> 1148
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 8, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 9, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1148
cucacaacau uggcuuacat t 21
<210> 1149
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 9, 10, 12, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 8, 11, 13, 14, 15, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1149
agccaauguu gugaggcuut t 21
<210> 1150
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 7, 9, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 8, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1150
aagccucaca acauuggcut t 21
<210> 1151
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 9, 10, 11, 12, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 5, 6, 7, 8, 13, 14, 15, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1151
uugugaggcu ucaaguucat t 21
<210> 1152
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1152
ugaacuugaa gccucacaat t 21
<210> 1153
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 7, 8, 9, 11, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 10, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1153
aggcagcuca ugagaaacat t 21
<210> 1154
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1154
uguuucucau gagcugccut t 21
<210> 1155
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 7, 10, 13, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 8, 9, 11, 12, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1155
auaaauugau agcacaaaat t 21
<210> 1156
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1156
uuuugugcua ucaauuuaut t 21
<210> 1157
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 8, 9, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 10, 11, 12, 13, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1157
acaaaaucua gaacuuaaut t 21
<210> 1158
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1158
auuaaguucu agauuuugut t 21
<210> 1159
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 6, 7, 8, 11, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 9, 10, 12, 13, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1159
gauaucccaa cagguacgat t 21
<210> 1160
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1160
ucguaccugu ugggauauct t 21
<210> 1161
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 8, 9, 11, 13, 14, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 10, 12, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1161
aaguuauuua uacccaucat t 21
<210> 1162
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8, 10, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1162
ugauggguau aaauaacuut t 21
<210> 1163
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 7, 9, 11, 13, 14, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 10, 12, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1163
uguaaauacg uauuucuagt t 21
<210> 1164
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 12, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 11, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1164
cuagaaauac guauuuacat t 21
<210> 1165
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 8, 9, 10, 12, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 4, 5, 11, 13, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1165
ucuaguuuuc auauaaagut t 21
<210> 1166
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 9, 10, 11, 12, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1166
acuuuauaug aaaacuagat t 21
<210> 1167
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 7, 10, 11, 12, 13, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 8, 9, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1167
auaaaguagu ucuuuuauat t 21
<210> 1168
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 12, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1168
uauaaaagaa cuacuuuaut t 21
<210> 1169
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 8, 13, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 7, 9, 10, 11, 12, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1169
ccauuuguag agcuacaaat t 21
<210> 1170
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 11, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1170
uuuguagcuc uacaaauggt t 21
<210> 1171
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 10, 13, 14, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 8, 9, 11, 12, 15, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1171
uauuuucagu agucagaaut t 21
<210> 1172
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1172
auucugacua cugaaaauat t 21
<210> 1173
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 6, 9, 10, 11, 12, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 7, 8, 13, 14, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1173
aaaucuaacc cuaguuguat t 21
<210> 1174
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 7, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1174
uacaacuagg guuagauuut t 21
<210> 1175
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 9, 11, 13, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 5, 6, 7, 8, 10, 12, 14, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1175
cuuuagagua uacauugcut t 21
<210> 1176
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 8, 10, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 9, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1176
agcaauguau acucuaaagt t 21
<210> 1177
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 7, 8, 11, 14, 15, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 6, 9, 10, 12, 13, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1177
aucugacuaa uggcucugut t 21
<210> 1178
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 8, 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1178
acagagccau uagucagaut t 21
<210> 1179
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 6, 9, 10, 11, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 7, 8, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1179
cacaaugauu uaaggacugt t 21
<210> 1180
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 8, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1180
caguccuuaa aucauugugt t 21
<210> 1181
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 13, 14, 15, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 11, 12, 16, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1181
ucuuuuucuc gauucaaaut t 21
<210> 1182
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1182
auuugaaucg agaaaaagat t 21
<210> 1183
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 12, 13, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 10, 11, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1183
cuuuuucucg auucaaauct t 21
<210> 1184
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1184
gauuugaauc gagaaaaagt t 21
<210> 1185
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 9, 10, 11, 13, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 8, 12, 14, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1185
auuuucugcu cacgaugagt t 21
<210> 1186
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1186
cucaucguga gcagaaaaut t 21
<210> 1187
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 11, 14, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 6, 10, 12, 13, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1187
uuucugcuca cgaugaguut t 21
<210> 1188
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1188
aacucaucgu gagcagaaat t 21
<210> 1189
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 8, 13, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 7, 9, 10, 11, 12, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1189
agagcuacaa aaccuaucct t 21
<210> 1190
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 13
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 12, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1190
ggauagguuu uguagcucut t 21
<210> 1191
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 11, 13, 15, 16, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 8, 9, 10, 12, 14, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1191
gagccaaagg uacaccacut t 21
<210> 1192
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1192
agugguguac cuuuggcuct t 21
<210> 1193
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 9, 11, 13, 14, 16, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 8, 10, 12, 15, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1193
gccaaaggua caccacuact t 21
<210> 1194
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1194
guaguggugu accuuuggct t 21
<210> 1195
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 7, 9, 10, 11, 12, 13, 14, 15, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 8, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1195
gaacuguacu cuucucagct t 21
<210> 1196
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 12, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1196
gcugagaaga guacaguuct t 21
<210> 1197
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 8, 10, 11, 13, 14, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 9, 12, 15, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1197
agguaaauau caccaacaut t 21
<210> 1198
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 11, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1198
auguugguga uauuuaccut t 21
<210> 1199
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 6, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 7, 8, 9, 10, 14
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1199
agcuacaaaa ccuauccuut t 21
<210> 1200
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1200
aaggauaggu uuuguagcut t 21
<210> 1201
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 9, 11, 12, 13, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 5, 6, 7, 8, 10, 14, 15
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1201
ugugaaagca uuuaauucct t 21
<210> 1202
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1202
ggaauuaaau gcuuucacat t 21
<210> 1203
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 6, 7, 8, 9, 14, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 5, 10, 11, 12, 13, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1203
gcccacuuua gaguauacat t 21
<210> 1204
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1204
uguauacucu aaagugggct t 21
<210> 1205
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 8, 10, 11, 12, 13, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 7, 9, 14, 15, 16, 17
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1205
ugugccacac uccaagacct t 21
<210> 1206
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1206
ggucuuggag uguggcacat t 21
<210> 1207
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 5, 9, 10, 13, 14, 15, 16, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 6, 7, 8, 11, 12, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1207
aaacuaaauu gaucucguat t 21
<210> 1208
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 9, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1208
uacgagauca auuuaguuut t 21
<210> 1209
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 4, 5, 6, 7, 9, 14, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 8, 10, 11, 12, 13, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1209
ugaucucgua gaauuaucut t 21
<210> 1210
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 10, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1210
agauaauucu acgagaucat t 21
<210> 1211
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4, 6, 9, 10, 13, 14, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 7, 8, 11, 12, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1211
gcgugcaguc gguccuccat t 21
<210> 1212
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1212
uggaggaccg acugcacgct t 21
<210> 1213
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 6, 7, 13, 15, 16, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 8, 9, 10, 11, 12, 14, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1213
aaaguuuaga gacaucugat t 21
<210> 1214
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 12
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1214
ucagaugucu cuaaacuuut t 21
<210> 1215
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10, 12, 14, 16
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 13, 15, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1215
cagaaggaau auguacaaat t 21
<210> 1216
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 7, 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1216
uuuguacaua uuccuucugt t 21
<210> 1217
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 4, 5, 11, 13, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 6, 7, 8, 9, 10, 12, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1217
cgcccgagag uaccagggat t 21
<210> 1218
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1218
ucccugguac ucucgggcgt t 21
<210> 1219
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 10, 15, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 16
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1219
cggaggagau agaacguuut t 21
<210> 1220
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 9
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1220
aaacguucua ucuccuccgt t 21
<210> 1221
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 9, 11, 12, 13, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 6, 7, 8, 10, 14, 15, 16, 17, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1221
agauagaacg uuuaaaacgt t 21
<210> 1222
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1222
cguuuuaaac guucuaucut t 21
<210> 1223
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 5, 11, 12, 13, 14, 16, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 6, 7, 8, 9, 10, 15, 17, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1223
ggaacaggaa cuucacaact t 21
<210> 1224
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 5, 14
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 4, 6, 7, 8, 9, 10, 11, 12, 13, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1224
guugugaagu uccuguucct t 21
<210> 1225
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 6, 7, 13, 15, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 8, 9, 10, 11, 12, 14, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1225
gugagccaaa gguacaccat t 21
<210> 1226
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 6, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1226
ugguguaccu uuggcucact t 21
<210> 1227
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 7, 8, 9, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 10, 11, 12
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1227
auccucccua gacuucccut t 21
<210> 1228
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 10
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1228
agggaagucu agggaggaut t 21
<210> 1229
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 13, 14, 15, 17, 19
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 4, 9, 10, 11, 12, 16, 18
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1229
cacacuccaa gaccugugct t 21
<210> 1230
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 4
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1230
gcacaggucu uggagugugt t 21
<210> 1231
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 2, 11, 13, 15, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 3, 4, 5, 6, 7, 8, 9, 10, 12, 14, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1231
acagaaggaa uauguacaat t 21
<210> 1232
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 4, 6, 8
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 3, 5, 7, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1232
uuguacauau uccuucugut t 21
<210> 1233
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 2, 8, 10, 11, 12, 15, 16, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 3, 4, 5, 6, 7, 9, 13, 14, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1233
uuagagacau cugacuuugt t 21
<210> 1234
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 17
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 15, 16, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1234
caaagucaga ugucucuaat t 21
<210> 1235
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 3, 4, 7, 8, 9, 10, 12, 17, 18
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 1, 2, 5, 6, 11, 13, 14, 15, 16, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1235
aauugaucuc guagaauuat t 21
<210> 1236
<211> 21
<212> DNA
<213> artificial sequence
<220>
<223> siRNA reactive to human Eg5
<220>
<223> 5'-terminal nucleic acid is a nucleoside, i.e. base + sugar but
lacking 5'-phosphate
<220>
<221> modified_base
<222> 1, 7, 15
<223> /mod_base = "2'-O-methyl corresponding base"
<220>
<221> modified_base
<222> 21
<223> /mod_base = "5'-thio thymidine"
<220>
<221> modified_base
<222> 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14, 16, 17, 18, 19
<223> /mod_base = "2'-hydroxy corresponding base"
<400> 1236
uaauucuacg agaucaauut t 21
Claims (17)
- 세포 내에서 사람 Eg5 유전자의 발현을 억제하기 위한 이본쇄 리보핵산(dsRNA)으로서,상기 dsRNA는 서로 상보적인 2개 이상의 서열을 포함하고, 상기 dsRNA의 센스 쇄는 제1 서열을 포함하고, 상기 dsRNA의 안티센스 쇄는 Eg5를 암호화하는 mRNA의 적어도 일부에 대해 실질적으로 상보적인 상보성 영역을 포함하는 제2 서열을 포함하며, 상기 상보성 영역은 길이가 30개 뉴클레오타이드 미만이고, 상기 dsRNA를 상기 Eg5를 발현하는 세포와 접촉시키면 상기 Eg5 유전자의 발현이 억제되는,세포 내에서 사람 Eg5 유전자의 발현을 억제하기 위한 이본쇄 리보핵산(dsRNA).
- 제1항에 있어서, 제1 서열이 표 1 내지 3의 안티센스 쇄 서열로 이루어진 그룹으로부터 선택되고, 제2 서열이 표 1 내지 3의 센스 쇄 서열로 이루어진 그룹으로부터 선택되는 이본쇄 리보핵산(dsRNA).
- 제1항에 있어서, dsRNA가 하나 이상의 변형된 뉴클레오타이드를 포함하는 이본쇄 리보핵산(dsRNA).
- 제2항에 있어서, dsRNA가 하나 이상의 변형된 뉴클레오타이드를 포함하는 이 본쇄 리보핵산(dsRNA).
- 제4항에 있어서, 변형된 뉴클레오타이드가 2'-O-메틸 변형된 뉴클레오타이드, 5'-포스포로티오에이트 그룹을 포함하는 뉴클레오타이드, 및 콜레스테릴 유도체 또는 도데칸산 비스데실아미드 그룹에 연결된 말단 뉴클레오타이드로 이루어진 그룹으로부터 선택되는 이본쇄 리보핵산(dsRNA).
- 제4항에 있어서, 변형된 뉴클레오타이드가 2'-데옥시-2'-플루오로 변형된 뉴클레오타이드, 2'-데옥시-변형된 뉴클레오타이드, 고정된(locked) 뉴클레오타이드, 무염기(abasic) 뉴클레오타이드, 2'-아미노-변형된 뉴클레오타이드, 2'-알킬-변형된 뉴클레오타이드, 모르폴리노 뉴클레오타이드, 포스포르아미데이트 및 비-천연 염기 포함 뉴클레오타이드로 이루어진 그룹으로부터 선택되는 이본쇄 리보핵산(dsRNA).
- 제4항에 있어서, 제1 서열이 표 1 내지 3으로 이루어진 그룹으로부터 선택되고, 제2 서열이 표 1 내지 3으로 이루어진 그룹으로부터 선택되는 이본쇄 리보핵산(dsRNA).
- 제1항에 따른 dsRNA를 포함하는 세포.
- 제2항에 따른 dsRNA를 포함하는, Eg5 유전자의 발현을 억제하기 위한 약제학적 조성물.
- 제9항에 있어서, dsRNA의 제1 서열이 표 1 내지 3의 센스 쇄 서열로 이루어진 그룹으로부터 선택되고, dsRNA의 제2 서열이 표 1 내지 3의 안티센스 쇄 서열로 이루어진 그룹으로부터 선택되는 약제학적 조성물.
- 제10항에 있어서, VEGF 유전자의 발현을 억제하는 dsRNA를 추가로 포함하는 약제학적 조성물.
- (a) 제2항에 따른 dsRNA를 세포 속으로 도입시키는 단계; 및(b) 단계 (a)에서 생성된 세포를 Eg5 유전자의 mRNA 전사체가 분해되는데 충분한 시간 동안 유지시켜, 세포 내에서 상기 Eg5 유전자의 발현을 억제하는 단계를 포함하여, 세포 내에서 Eg5 유전자의 발현을 억제하는 방법.
- 제12항에 있어서, VEGF의 발현을 억제하는 제2의 dsRNA를 세포 속으로 도입시키는 방법.
- Eg5 발현에 의해 매개되는 병리학적 과정의 치료, 예방 또는 관리를 필요로 하는 환자에게 제2항에 따른 dsRNA의 치료학적 또는 예방학적 유효량을 투여함을 포함하여, Eg5 발현에 의해 매개되는 병리학적 과정을 치료하거나, 예방하거나, 관리하는 방법.
- 제14항에 있어서, VEGF의 발현을 억제하는 제2의 dsRNA를 투여함을 추가로 포함하는 방법.
- 세포 내에서 Eg5 유전자의 발현을 억제하기 위한 벡터로서,상기 벡터는 dsRNA의 하나 이상의 쇄를 암호화하는 뉴클레오타이드 서열에 작동가능하게 연결된 조절 서열을 포함하고, 상기 dsRNA의 쇄 중 하나는 Eg5를 암호화하는 mRNA의 적어도 일부에 대해 실질적으로 상보적이고, 상기 dsRNA는 길이가 30개 염기쌍 미만이고, 상기 dsRNA를 상기 Eg5를 발현하는 세포와 접촉시키면 상기 Eg5 유전자의 발현이 40% 이상 억제되는,세포 내에서 Eg5 유전자의 발현을 억제하기 위한 벡터.
- 제16항에 따른 벡터를 포함하는 세포.
Applications Claiming Priority (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US78776206P | 2006-03-31 | 2006-03-31 | |
US60/787,762 | 2006-03-31 | ||
US87025906P | 2006-12-15 | 2006-12-15 | |
US60/870,259 | 2006-12-15 | ||
PCT/US2007/065636 WO2007115168A2 (en) | 2006-03-31 | 2007-03-30 | Compositions and methods for inhibiting expression of eg5 gene |
Related Child Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020127010548A Division KR101462874B1 (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20090010174A true KR20090010174A (ko) | 2009-01-29 |
KR101362681B1 KR101362681B1 (ko) | 2014-02-13 |
Family
ID=38564242
Family Applications (5)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020177014179A KR20170061189A (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
KR20157005346A KR20150038522A (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
KR1020147012816A KR101547579B1 (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
KR1020087026420A KR101362681B1 (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 조성물 및 억제 방법 |
KR1020127010548A KR101462874B1 (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
Family Applications Before (3)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020177014179A KR20170061189A (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
KR20157005346A KR20150038522A (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
KR1020147012816A KR101547579B1 (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020127010548A KR101462874B1 (ko) | 2006-03-31 | 2007-03-30 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
Country Status (14)
Country | Link |
---|---|
US (5) | US7718629B2 (ko) |
EP (2) | EP2008274B1 (ko) |
JP (4) | JP5704741B2 (ko) |
KR (5) | KR20170061189A (ko) |
CN (1) | CN101448849B (ko) |
AU (2) | AU2007233109B2 (ko) |
CA (2) | CA2873833A1 (ko) |
EA (1) | EA014886B1 (ko) |
ES (1) | ES2544861T3 (ko) |
HK (1) | HK1126782A1 (ko) |
IL (2) | IL194419A (ko) |
NZ (2) | NZ571568A (ko) |
SG (1) | SG170780A1 (ko) |
WO (1) | WO2007115168A2 (ko) |
Families Citing this family (123)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE19956568A1 (de) | 1999-01-30 | 2000-08-17 | Roland Kreutzer | Verfahren und Medikament zur Hemmung der Expression eines vorgegebenen Gens |
US8546143B2 (en) | 2001-01-09 | 2013-10-01 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of a target gene |
US9228186B2 (en) | 2002-11-14 | 2016-01-05 | Thermo Fisher Scientific Inc. | Methods and compositions for selecting siRNA of improved functionality |
US9879266B2 (en) | 2002-11-14 | 2018-01-30 | Thermo Fisher Scientific Inc. | Methods and compositions for selecting siRNA of improved functionality |
US10011836B2 (en) | 2002-11-14 | 2018-07-03 | Thermo Fisher Scientific Inc. | Methods and compositions for selecting siRNA of improved functionality |
US9839649B2 (en) | 2002-11-14 | 2017-12-12 | Thermo Fisher Scientific Inc. | Methods and compositions for selecting siRNA of improved functionality |
US7480382B2 (en) * | 2003-09-30 | 2009-01-20 | Microsoft Corporation | Image file container |
EP1735009A4 (en) | 2004-03-12 | 2011-03-30 | Alnylam Pharmaceuticals Inc | RNAI AGENTS TARGETING THE VASCULAR ENDOTHELIUM GROWTH FACTOR (VEGF) |
NZ586217A (en) * | 2004-09-24 | 2011-12-22 | Alnylam Pharmaceuticals Inc | RNAI modulation of APOB and uses thereof |
US7790878B2 (en) * | 2004-10-22 | 2010-09-07 | Alnylam Pharmaceuticals, Inc. | RNAi modulation of RSV, PIV and other respiratory viruses and uses thereof |
EP2487243A3 (en) * | 2005-01-07 | 2013-08-28 | Alnylam Pharmaceuticals Inc. | RNAI modulation of RSV and therapeutic uses thereof |
CA2594919A1 (en) * | 2005-01-24 | 2006-08-03 | Alnylam Pharmaceuticals, Inc. | Rnai modulation of the nogo-l or nogo-r gene and uses thereof |
JP5116107B2 (ja) * | 2005-06-27 | 2013-01-09 | アルナイラム ファーマシューティカルズ, インコーポレイテッド | HIF−1のRNAi調節及びその治療的利用 |
US7772200B2 (en) * | 2005-07-21 | 2010-08-10 | Alnylam Pharmaceuticals, Inc. | iRNA agents targeted to the Rho-A gene |
WO2007051045A2 (en) | 2005-10-28 | 2007-05-03 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of huntingtin gene |
ATE510545T1 (de) | 2005-11-09 | 2011-06-15 | Alnylam Pharmaceuticals Inc | Zusammensetzungen und verfahren zur hemmung der expression von faktor v leiden mutationsgen |
EP1976567B1 (en) * | 2005-12-28 | 2020-05-13 | The Scripps Research Institute | Natural antisense and non-coding rna transcripts as drug targets |
US8229398B2 (en) * | 2006-01-30 | 2012-07-24 | Qualcomm Incorporated | GSM authentication in a CDMA network |
MX2008012173A (es) * | 2006-03-24 | 2008-10-03 | Novartis Ag | Composiciones de arnds y métodos para el tratamiento de infecciones por el virus de papiloma humano (hpv). |
KR20170061189A (ko) * | 2006-03-31 | 2017-06-02 | 알닐람 파마슈티칼스 인코포레이티드 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
EP2013222B1 (en) | 2006-04-28 | 2013-02-13 | Alnylam Pharmaceuticals Inc. | Compositions and methods for inhibiting expression of a gene from the jc virus |
NZ587616A (en) | 2006-05-11 | 2012-03-30 | Alnylam Pharmaceuticals Inc | Compositions and methods for inhibiting expression of the pcsk9 gene |
CA2653451C (en) * | 2006-05-22 | 2015-12-29 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of ikk-b gene |
US8598333B2 (en) * | 2006-05-26 | 2013-12-03 | Alnylam Pharmaceuticals, Inc. | SiRNA silencing of genes expressed in cancer |
WO2008036933A2 (en) | 2006-09-21 | 2008-03-27 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of the hamp gene |
US8227436B2 (en) | 2007-01-16 | 2012-07-24 | University Of Queensland | Method of inducing an immune response |
PE20090064A1 (es) * | 2007-03-26 | 2009-03-02 | Novartis Ag | Acido ribonucleico de doble cadena para inhibir la expresion del gen e6ap humano y composicion farmaceutica que lo comprende |
CA2682161A1 (en) * | 2007-03-29 | 2008-10-09 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of a gene from ebola virus |
EP2617828B1 (en) | 2007-12-10 | 2014-09-24 | Alnylam Pharmaceuticals Inc. | Compositions and methods for inhibiting expression of factor VII gene |
WO2009076679A2 (en) | 2007-12-13 | 2009-06-18 | Alnylam Pharmaceuticals Inc. | Methods and compositions for prevention or treatment of rsv infection |
WO2009137128A2 (en) * | 2008-02-12 | 2009-11-12 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of cd45 gene |
KR101397407B1 (ko) * | 2008-03-05 | 2014-06-19 | 알닐람 파마슈티칼스 인코포레이티드 | Eg5 및 VEGF 유전자의 발현을 억제하기 위한 조성물 및 방법 |
WO2009129465A2 (en) | 2008-04-17 | 2009-10-22 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of xbp-1 gene |
US20110184046A1 (en) | 2008-07-11 | 2011-07-28 | Dinah Wen-Yee Sah | Compositions And Methods For Inhibiting Expression Of GSK-3 Genes |
EP3109321B1 (en) | 2008-09-25 | 2019-05-01 | Alnylam Pharmaceuticals, Inc. | Lipid formulated compositions and methods for inhibiting expression of serum amyloid a gene |
KR101770435B1 (ko) * | 2008-10-03 | 2017-09-05 | 큐알엔에이, 인크. | 자연 안티센스 전사체가 아포리포단백질-a1로 억제에 의해 아포리포단백-a1 관련된 질환의 치료 |
WO2010042547A1 (en) | 2008-10-06 | 2010-04-15 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibiting expression of an rna from west nile virus |
IL281434B2 (en) | 2008-10-20 | 2023-09-01 | Alnylam Pharmaceuticals Inc | Compounds and methods for inhibiting transthyretin expression |
ES2637063T3 (es) | 2008-12-04 | 2017-10-10 | Curna, Inc. | Tratamiento de enfermedades relacionadas con genes supresores de tumor mediante inhibición del transcrito antisentido natural al gen |
CA2745329C (en) | 2008-12-04 | 2022-07-12 | Opko Curna, Llc | Treatment of erythropoietin (epo) related diseases by inhibition of natural antisense transcript to epo |
JP5971948B2 (ja) * | 2008-12-04 | 2016-08-17 | クルナ・インコーポレーテッド | Vegfに対する天然アンチセンス転写物の抑制による血管内皮増殖因子(vegf)関連疾患の治療 |
CA2746514C (en) * | 2008-12-10 | 2018-11-27 | Alnylam Pharmaceuticals, Inc. | Gnaq targeted dsrna compositions and methods for inhibiting expression |
PL2396038T3 (pl) | 2009-02-12 | 2016-05-31 | Curna Inc | Leczenie chorób związanych z neurotropowym czynnikiem pochodzenia mózgowego (bdnf) poprzez zahamowanie naturalnego antysensownego transkryptu bdnf |
AU2010223967B2 (en) * | 2009-03-12 | 2015-07-30 | Alnylam Pharmaceuticals, Inc. | Lipid formulated compositions and methods for inhibiting expression of Eg5 and VEGF genes |
MX2011009751A (es) | 2009-03-16 | 2011-09-29 | Opko Curna Llc | Tratamiento de enfermedades relacionadas con factor nuclear (eritroide derivado 2) tipo 2 (nrf2) por inhibicion del transcrito antisentido natural a nrf2. |
WO2010107740A2 (en) | 2009-03-17 | 2010-09-23 | Curna, Inc. | Treatment of delta-like 1 homolog (dlk1) related diseases by inhibition of natural antisense transcript to dlk1 |
US9155754B2 (en) | 2009-05-06 | 2015-10-13 | Curna, Inc. | Treatment of ABCA1 gene related diseases by inhibition of a natural antisense transcript to ABCA1 |
CA2761142C (en) | 2009-05-06 | 2021-06-08 | Opko Curna, Llc | Treatment of tristetraproline (ttp) related diseases by inhibition of natural antisense transcript to ttp |
JP5931720B2 (ja) | 2009-05-08 | 2016-06-08 | クルナ・インコーポレーテッド | Dmdファミリーに対する天然アンチセンス転写物の抑制によるジストロフィンファミリー関連疾患の治療 |
ES2664590T3 (es) | 2009-05-18 | 2018-04-20 | Curna, Inc. | Tratamiento de enfermedades relacionadas con factores de reprogramación por inhibición del tránscrito antisentido natural a un factor de reprogramación |
WO2011005363A2 (en) * | 2009-05-18 | 2011-01-13 | Ensysce Biosciences, Inc. | Carbon nanotubes complexed with multiple bioactive agents and methods related thereto |
CN102549158B (zh) | 2009-05-22 | 2017-09-26 | 库尔纳公司 | 通过抑制针对转录因子e3(tfe3)的天然反义转录物来治疗tfe3和胰岛素受体底物蛋白2(irs2)相关的疾病 |
US8791085B2 (en) | 2009-05-28 | 2014-07-29 | Curna, Inc. | Treatment of antiviral gene related diseases by inhibition of natural antisense transcript to an antiviral gene |
ES2804764T3 (es) | 2009-06-01 | 2021-02-09 | Halo Bio Rnai Therapeutics Inc | Polinucleótidos para la interferencia de ARN multivalente, composiciones y métodos de uso de los mismos |
WO2010147992A1 (en) | 2009-06-15 | 2010-12-23 | Alnylam Pharmaceuticals, Inc. | Methods for increasing efficacy of lipid formulated sirna |
CN102458366B (zh) * | 2009-06-15 | 2015-02-11 | 阿尔尼拉姆医药品有限公司 | 靶向pcsk9基因的脂质配制的dsrna |
US20120171170A1 (en) | 2009-06-16 | 2012-07-05 | Opko Curna, Llc | Treatment of collagen gene related diseases by inhibition of natural antisense transcript to a collagen gene |
US8951981B2 (en) | 2009-06-16 | 2015-02-10 | Curna, Inc. | Treatment of paraoxonase 1 (PON1) related diseases by inhibition of natural antisense transcript to PON1 |
WO2010151671A2 (en) | 2009-06-24 | 2010-12-29 | Curna, Inc. | Treatment of tumor necrosis factor receptor 2 (tnfr2) related diseases by inhibition of natural antisense transcript to tnfr2 |
US8921330B2 (en) | 2009-06-26 | 2014-12-30 | Curna, Inc. | Treatment of down syndrome gene related diseases by inhibition of natural antisense transcript to a down syndrome gene |
JP2013500017A (ja) | 2009-07-24 | 2013-01-07 | カッパーアールエヌエー,インコーポレイテッド | サ−チュイン(sirt)への天然アンチセンス転写物の阻止によるサ−チュイン(sirt)関連疾患の治療 |
WO2011017548A1 (en) * | 2009-08-05 | 2011-02-10 | Alnylam Pharmaceuticals, Inc. | Lipid formulated compositions and methods for inhibiting expression of eg5 and vegf genes |
EP2462229B1 (en) | 2009-08-05 | 2016-05-11 | CuRNA, Inc. | Treatment of insulin gene (ins) related diseases by inhibition of natural antisense transcript to an insulin gene (ins) |
CA2770104C (en) | 2009-08-11 | 2019-03-19 | Opko Curna, Llc | Treatment of adiponectin (adipoq) related diseases by inhibition of natural antisense transcript to an adiponectin (adipoq) |
AP3574A (en) | 2009-08-14 | 2016-02-08 | Alnylam Pharmaceuticals Inc | Lipid formulated compositions and methods for inhibiting expression of a gene from the ebola virus |
EP2467482A4 (en) | 2009-08-21 | 2013-12-11 | Curna Inc | TREATMENT OF DISEASES RELATED TO "CIP PROTEIN CHIP EXTREME (PROTEIN INTERACTING WITH HSP70)" BY INHIBITION OF CHIP NATURAL ANTISENSE TRANSCRIPT |
WO2011031482A2 (en) | 2009-08-25 | 2011-03-17 | Curna, Inc. | Treatment of 'iq motif containing gtpase activating protein' (iqgap) related diseases by inhibition of natural antisense transcript to iqgap |
CN107519133A (zh) * | 2009-09-15 | 2017-12-29 | 阿尔尼拉姆医药品有限公司 | 脂质配制的组合物及抑制Eg5和VEGF基因的表达的方法 |
US9187746B2 (en) | 2009-09-22 | 2015-11-17 | Alnylam Pharmaceuticals, Inc. | Dual targeting siRNA agents |
JP6175236B2 (ja) | 2009-09-25 | 2017-08-09 | カッパーアールエヌエー,インコーポレイテッド | フィラグリン(flg)の発現および活性の調整によるflg関連疾患の処置 |
JP5723378B2 (ja) | 2009-11-03 | 2015-05-27 | アルナイラム ファーマシューティカルズ, インコーポレイテッドAlnylam Pharmaceuticals, Inc. | トランスサイレチン(ttr)を阻害する脂質製剤化組成物及び方法 |
US9173895B2 (en) | 2009-12-16 | 2015-11-03 | Curna, Inc. | Treatment of membrane bound transcription factor peptidase, site 1 (MBTPS1) related diseases by inhibition of natural antisense transcript to MBTPS1 |
KR101891352B1 (ko) | 2009-12-23 | 2018-08-24 | 큐알엔에이, 인크. | 간세포 성장 인자(hgf)에 대한 천연 안티센스 전사체의 억제에 의한 hgf 관련 질환의 치료 |
CA2782375C (en) | 2009-12-23 | 2023-10-31 | Opko Curna, Llc | Treatment of uncoupling protein 2 (ucp2) related diseases by inhibition of natural antisense transcript to ucp2 |
RU2611186C2 (ru) | 2009-12-29 | 2017-02-21 | Курна, Инк. | ЛЕЧЕНИЕ ЗАБОЛЕВАНИЙ, СВЯЗАННЫХ С ОПУХОЛЕВЫМ БЕЛКОМ 63 (р63), ПУТЕМ ИНГИБИРОВАНИЯ ПРИРОДНОГО АНТИСМЫСЛОВОГО ТРАНСКРИПТА К р63 |
ES2657452T3 (es) | 2009-12-29 | 2018-03-05 | Curna, Inc. | Tratamiento de enfermedades relacionadas con el factor respiratorio nuclear 1 (NRF1) mediante inhibición de transcrito antisentido natural a NRF1 |
CN102791862B (zh) | 2009-12-31 | 2017-04-05 | 库尔纳公司 | 通过抑制胰岛素受体底物2(irs2)和转录因子e3(tfe3)的天然反义转录物而治疗irs2相关疾病 |
JP5886757B2 (ja) | 2010-01-04 | 2016-03-16 | カッパーアールエヌエー,インコーポレイテッド | インターフェロン調節因子8(irf8)に対する天然アンチセンス転写物の阻害によるインターフェロン調節因子8(irf8)関連疾患の治療 |
CN102822342B (zh) | 2010-01-06 | 2017-05-10 | 库尔纳公司 | 通过抑制胰腺发育基因的天然反义转录物而治疗胰腺发育基因相关疾病 |
CA2786535C (en) | 2010-01-11 | 2019-03-26 | Curna, Inc. | Treatment of sex hormone binding globulin (shbg) related diseases by inhibition of natural antisense transcript to shbg |
NO2529015T3 (ko) | 2010-01-25 | 2018-04-14 | ||
US8962586B2 (en) | 2010-02-22 | 2015-02-24 | Curna, Inc. | Treatment of pyrroline-5-carboxylate reductase 1 (PYCR1) related diseases by inhibition of natural antisense transcript to PYCR1 |
WO2011123745A2 (en) | 2010-04-02 | 2011-10-06 | Opko Curna Llc | Treatment of colony-stimulating factor 3 (csf3) related diseases by inhibition of natural antisense transcript to csf3 |
CN102858979B (zh) | 2010-04-09 | 2018-01-26 | 库尔纳公司 | 通过抑制成纤维细胞生长因子21(fgf21)的天然反义转录物而治疗fgf21相关疾病 |
CN102933711B (zh) | 2010-05-03 | 2018-01-02 | 库尔纳公司 | 通过抑制沉默调节蛋白(sirt)的天然反义转录物而治疗沉默调节蛋白(sirt)相关疾病 |
TWI531370B (zh) | 2010-05-14 | 2016-05-01 | 可娜公司 | 藉由抑制par4天然反股轉錄本治療par4相關疾病 |
US8980858B2 (en) | 2010-05-26 | 2015-03-17 | Curna, Inc. | Treatment of methionine sulfoxide reductase a (MSRA) related diseases by inhibition of natural antisense transcript to MSRA |
US8895528B2 (en) | 2010-05-26 | 2014-11-25 | Curna, Inc. | Treatment of atonal homolog 1 (ATOH1) related diseases by inhibition of natural antisense transcript to ATOH1 |
US20130210733A1 (en) | 2010-06-17 | 2013-08-15 | Cytokinetics, Inc. | Methods of treating lung disease |
US9771579B2 (en) | 2010-06-23 | 2017-09-26 | Curna, Inc. | Treatment of sodium channel, voltage-gated, alpha subunit (SCNA) related diseases by inhibition of natural antisense transcript to SCNA |
EP2593547B1 (en) | 2010-07-14 | 2017-11-15 | CuRNA, Inc. | Treatment of discs large homolog (dlg) related diseases by inhibition of natural antisense transcript to dlg |
CA2810928A1 (en) | 2010-09-22 | 2012-03-29 | Alios Biopharma, Inc. | Substituted nucleotide analogs |
JP5830329B2 (ja) * | 2010-09-28 | 2015-12-09 | 国立大学法人 岡山大学 | 腎障害の新規マーカー |
ES2640755T3 (es) | 2010-10-06 | 2017-11-06 | Curna, Inc. | Tratamiento de enfermedades relacionadas con la Sialidasa 4 (neu4) mediante inhibición del transcrito antisentido natural al gen neu4 |
RU2597972C2 (ru) | 2010-10-22 | 2016-09-20 | Курна Инк. | Лечение заболеваний, связанных с геном альфа-l-идуронидазы (idua), путем ингибирования природного антисмыслового транскрипта гена idua |
US9339513B2 (en) | 2010-11-09 | 2016-05-17 | Alnylam Pharmaceuticals, Inc. | Lipid formulated compositions and methods for inhibiting expression of Eg5 and VEGF genes |
WO2012068340A2 (en) | 2010-11-18 | 2012-05-24 | Opko Curna Llc | Antagonat compositions and methods of use |
EP2643463B1 (en) | 2010-11-23 | 2017-09-27 | CuRNA, Inc. | Treatment of nanog related diseases by inhibition of natural antisense transcript to nanog |
TWI658830B (zh) * | 2011-06-08 | 2019-05-11 | 日東電工股份有限公司 | Hsp47表現調控強化用類視色素脂質體 |
KR102043422B1 (ko) | 2011-06-09 | 2019-11-11 | 큐알엔에이, 인크. | 프라탁신 (fxn)에 대한 자연 안티센스 전사체의 저해에 의한 프라탁신 (fxn) 관련된 질환의 치료 |
WO2012177949A2 (en) | 2011-06-21 | 2012-12-27 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for inhibition of expression of protein c (proc) genes |
KR20230084331A (ko) | 2011-06-21 | 2023-06-12 | 알닐람 파마슈티칼스 인코포레이티드 | 아포리포단백질 c-iii(apoc3) 유전자의 발현 억제를 위한 조성물 및 방법 |
US9228188B2 (en) | 2011-06-21 | 2016-01-05 | Alnylam Pharmaceuticals, Inc. | Compositions and method for inhibiting hepcidin antimicrobial peptide (HAMP) or HAMP-related gene expression |
MX368573B (es) * | 2011-07-18 | 2019-10-08 | Devgen Nv | Regulacion hacia abajo de la expresion de genes en plagas de insectos. |
BR112014005234A2 (pt) | 2011-09-06 | 2017-04-11 | Curna Inc | tratamento de doenças relacionadas com subunididades alfa dos canais de sódio dependentes de voltagem (scnxa) com pequenas moléculas |
KR102095699B1 (ko) | 2011-11-18 | 2020-04-02 | 알닐람 파마슈티칼스 인코포레이티드 | 트랜스티레틴(TTR) 관련 질병을 치료하기 위한 RNAi 제제, 조성 및 그의 사용방법 |
AU2012358804B2 (en) | 2011-12-22 | 2018-04-19 | Alios Biopharma, Inc. | Substituted phosphorothioate nucleotide analogs |
TR201815503T4 (tr) | 2012-03-15 | 2018-11-21 | Curna Inc | Beyin kaynaklı nörotrofik faktör (bknf) ile ilişkili hastalıkların doğal antisens transkriptinin bknf'ye inhibisyonu ile muamelesi. |
EP2828277A1 (en) | 2012-03-21 | 2015-01-28 | Vertex Pharmaceuticals Incorporated | Solid forms of a thiophosphoramidate nucleotide prodrug |
EP2827876A4 (en) | 2012-03-22 | 2015-10-28 | Alios Biopharma Inc | PHARMACEUTICAL COMBINATIONS WITH A THIONUCLEOTIDE ANALOG |
EP2994167B1 (en) | 2013-05-06 | 2020-05-06 | Alnylam Pharmaceuticals, Inc. | Dosages and methods for delivering lipid formulated nucleic acid molecules |
KR102631505B1 (ko) | 2014-08-29 | 2024-02-01 | 알닐람 파마슈티칼스 인코포레이티드 | 트랜스타이레틴(ttr) 매개 아밀로이드증의 치료 방법 |
JOP20200115A1 (ar) | 2014-10-10 | 2017-06-16 | Alnylam Pharmaceuticals Inc | تركيبات وطرق لتثبيط التعبير الجيني عن hao1 (حمض أوكسيداز هيدروكسيلي 1 (أوكسيداز جليكولات)) |
WO2016081444A1 (en) | 2014-11-17 | 2016-05-26 | Alnylam Pharmaceuticals, Inc. | Apolipoprotein c3 (apoc3) irna compositions and methods of use thereof |
CN104450706B (zh) * | 2014-12-10 | 2017-04-05 | 中山大学 | 利用rna干扰技术诱导凡纳滨对虾血淋巴细胞发生upr的方法 |
MY195720A (en) | 2015-07-31 | 2023-02-07 | Alnylam Pharmaceuticals Inc | Transthyretin (Ttr) Irna Compositions and Methods of Use Thereof for Treating or Preventing Ttr-Associated Diseases |
CA2995995A1 (en) | 2015-08-24 | 2017-03-02 | Halo-Bio Rnai Therapeutics, Inc. | Polynucleotide nanoparticles for the modulation of gene expression and uses thereof |
CN108348541A (zh) | 2015-08-25 | 2018-07-31 | 阿尔尼拉姆医药品有限公司 | 用于治疗前蛋白转化酶枯草杆菌蛋白酶kexin(pcsk9)基因相关障碍的方法和组合物 |
US11613754B2 (en) * | 2017-02-20 | 2023-03-28 | Northwestern University | Toxic RNAi active seed sequences for killing cancer cells |
JP7337044B2 (ja) | 2017-07-13 | 2023-09-01 | アルナイラム ファーマシューティカルズ, インコーポレイテッド | Hao1(ヒドロキシ酸オキシダーゼ1(グリコール酸オキシダーゼ))遺伝子発現の阻害方法 |
AU2018336806A1 (en) | 2017-09-19 | 2020-05-07 | Alnylam Pharmaceuticals, Inc. | Compositions and methods for treating transthyretin (TTR) mediated amyloidosis |
KR20190069245A (ko) | 2017-12-11 | 2019-06-19 | 대한민국(전북기계공업고등학교장) | 원적외선으로 사람을 인식하고, 가변저항 값으로 사람의 위치정보를 정하여 자동으로 돌아가는 인체감지센서 테이블 |
AU2022323090A1 (en) | 2021-08-03 | 2024-02-01 | Alnylam Pharmaceuticals, Inc. | Transthyretin (ttr) irna compositions and methods of use thereof |
Family Cites Families (227)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US564562A (en) | 1896-07-21 | Joseph p | ||
US513030A (en) | 1894-01-16 | Machine for waxing or coating paper | ||
US3687808A (en) | 1969-08-14 | 1972-08-29 | Univ Leland Stanford Junior | Synthetic polynucleotides |
US4469863A (en) | 1980-11-12 | 1984-09-04 | Ts O Paul O P | Nonionic nucleic acid alkyl and aryl phosphonates and processes for manufacture and use thereof |
US4426330A (en) | 1981-07-20 | 1984-01-17 | Lipid Specialties, Inc. | Synthetic phospholipid compounds |
US4534899A (en) | 1981-07-20 | 1985-08-13 | Lipid Specialties, Inc. | Synthetic phospholipid compounds |
US5023243A (en) | 1981-10-23 | 1991-06-11 | Molecular Biosystems, Inc. | Oligonucleotide therapeutic agent and method of making same |
US4476301A (en) | 1982-04-29 | 1984-10-09 | Centre National De La Recherche Scientifique | Oligonucleotides, a process for preparing the same and their application as mediators of the action of interferon |
JPS5927900A (ja) | 1982-08-09 | 1984-02-14 | Wakunaga Seiyaku Kk | 固定化オリゴヌクレオチド |
FR2540122B1 (fr) | 1983-01-27 | 1985-11-29 | Centre Nat Rech Scient | Nouveaux composes comportant une sequence d'oligonucleotide liee a un agent d'intercalation, leur procede de synthese et leur application |
US4605735A (en) | 1983-02-14 | 1986-08-12 | Wakunaga Seiyaku Kabushiki Kaisha | Oligonucleotide derivatives |
US4948882A (en) | 1983-02-22 | 1990-08-14 | Syngene, Inc. | Single-stranded labelled oligonucleotides, reactive monomers and methods of synthesis |
US4824941A (en) | 1983-03-10 | 1989-04-25 | Julian Gordon | Specific antibody to the native form of 2'5'-oligonucleotides, the method of preparation and the use as reagents in immunoassays or for binding 2'5'-oligonucleotides in biological systems |
US4587044A (en) | 1983-09-01 | 1986-05-06 | The Johns Hopkins University | Linkage of proteins to nucleic acids |
US5118800A (en) | 1983-12-20 | 1992-06-02 | California Institute Of Technology | Oligonucleotides possessing a primary amino group in the terminal nucleotide |
US5118802A (en) | 1983-12-20 | 1992-06-02 | California Institute Of Technology | DNA-reporter conjugates linked via the 2' or 5'-primary amino group of the 5'-terminal nucleoside |
US5550111A (en) | 1984-07-11 | 1996-08-27 | Temple University-Of The Commonwealth System Of Higher Education | Dual action 2',5'-oligoadenylate antiviral derivatives and uses thereof |
FR2567892B1 (fr) | 1984-07-19 | 1989-02-17 | Centre Nat Rech Scient | Nouveaux oligonucleotides, leur procede de preparation et leurs applications comme mediateurs dans le developpement des effets des interferons |
US5430136A (en) | 1984-10-16 | 1995-07-04 | Chiron Corporation | Oligonucleotides having selectably cleavable and/or abasic sites |
US5367066A (en) | 1984-10-16 | 1994-11-22 | Chiron Corporation | Oligonucleotides with selectably cleavable and/or abasic sites |
US5258506A (en) | 1984-10-16 | 1993-11-02 | Chiron Corporation | Photolabile reagents for incorporation into oligonucleotide chains |
US4828979A (en) | 1984-11-08 | 1989-05-09 | Life Technologies, Inc. | Nucleotide analogs for nucleic acid labeling and detection |
FR2575751B1 (fr) | 1985-01-08 | 1987-04-03 | Pasteur Institut | Nouveaux nucleosides de derives de l'adenosine, leur preparation et leurs applications biologiques |
US5034506A (en) | 1985-03-15 | 1991-07-23 | Anti-Gene Development Group | Uncharged morpholino-based polymers having achiral intersubunit linkages |
US5166315A (en) | 1989-12-20 | 1992-11-24 | Anti-Gene Development Group | Sequence-specific binding polymers for duplex nucleic acids |
US5405938A (en) | 1989-12-20 | 1995-04-11 | Anti-Gene Development Group | Sequence-specific binding polymers for duplex nucleic acids |
US5185444A (en) | 1985-03-15 | 1993-02-09 | Anti-Gene Deveopment Group | Uncharged morpolino-based polymers having phosphorous containing chiral intersubunit linkages |
US5235033A (en) | 1985-03-15 | 1993-08-10 | Anti-Gene Development Group | Alpha-morpholino ribonucleoside derivatives and polymers thereof |
US4762779A (en) | 1985-06-13 | 1988-08-09 | Amgen Inc. | Compositions and methods for functionalizing nucleic acids |
DE3681787D1 (de) | 1985-07-05 | 1991-11-07 | Whitehead Biomedical Inst | Expression von fremdem genetischem material in epithelzellen. |
US4980286A (en) | 1985-07-05 | 1990-12-25 | Whitehead Institute For Biomedical Research | In vivo introduction and expression of foreign genetic material in epithelial cells |
US5139941A (en) | 1985-10-31 | 1992-08-18 | University Of Florida Research Foundation, Inc. | AAV transduction vectors |
US5317098A (en) | 1986-03-17 | 1994-05-31 | Hiroaki Shizuya | Non-radioisotope tagging of fragments |
JPS638396A (ja) | 1986-06-30 | 1988-01-14 | Wakunaga Pharmaceut Co Ltd | ポリ標識化オリゴヌクレオチド誘導体 |
US4920016A (en) | 1986-12-24 | 1990-04-24 | Linear Technology, Inc. | Liposomes with enhanced circulation time |
US4837028A (en) | 1986-12-24 | 1989-06-06 | Liposome Technology, Inc. | Liposomes with enhanced circulation time |
US5276019A (en) | 1987-03-25 | 1994-01-04 | The United States Of America As Represented By The Department Of Health And Human Services | Inhibitors for replication of retroviruses and for the expression of oncogene products |
US5264423A (en) | 1987-03-25 | 1993-11-23 | The United States Of America As Represented By The Department Of Health And Human Services | Inhibitors for replication of retroviruses and for the expression of oncogene products |
US4904582A (en) | 1987-06-11 | 1990-02-27 | Synthetic Genetics | Novel amphiphilic nucleic acid conjugates |
NZ225176A (en) | 1987-06-24 | 1990-09-26 | Florey Howard Inst | Nucleoside derivatives |
DE3852823T2 (de) | 1987-09-11 | 1995-05-24 | Whitehead Biomedical Inst | Transduktionsveränderte fibroblasten und ihre anwendung. |
US5585481A (en) | 1987-09-21 | 1996-12-17 | Gen-Probe Incorporated | Linking reagents for nucleotide probes |
US5188897A (en) | 1987-10-22 | 1993-02-23 | Temple University Of The Commonwealth System Of Higher Education | Encapsulated 2',5'-phosphorothioate oligoadenylates |
US4924624A (en) | 1987-10-22 | 1990-05-15 | Temple University-Of The Commonwealth System Of Higher Education | 2,',5'-phosphorothioate oligoadenylates and plant antiviral uses thereof |
US5525465A (en) | 1987-10-28 | 1996-06-11 | Howard Florey Institute Of Experimental Physiology And Medicine | Oligonucleotide-polyamide conjugates and methods of production and applications of the same |
DE3738460A1 (de) | 1987-11-12 | 1989-05-24 | Max Planck Gesellschaft | Modifizierte oligonukleotide |
EP0391960B1 (en) | 1987-12-11 | 1994-08-17 | Whitehead Institute For Biomedical Research | Genetic modification of endothelial cells |
ATE152169T1 (de) | 1988-02-05 | 1997-05-15 | Whitehead Biomedical Inst | Modifizierte hepatozyten und deren anwendung |
US5082830A (en) | 1988-02-26 | 1992-01-21 | Enzo Biochem, Inc. | End labeled nucleotide probe |
WO1989009221A1 (en) | 1988-03-25 | 1989-10-05 | University Of Virginia Alumni Patents Foundation | Oligonucleotide n-alkylphosphoramidates |
US5278302A (en) | 1988-05-26 | 1994-01-11 | University Patents, Inc. | Polynucleotide phosphorodithioates |
US5109124A (en) | 1988-06-01 | 1992-04-28 | Biogen, Inc. | Nucleic acid probe linked to a label having a terminal cysteine |
US5216141A (en) | 1988-06-06 | 1993-06-01 | Benner Steven A | Oligonucleotide analogs containing sulfur linkages |
US5175273A (en) | 1988-07-01 | 1992-12-29 | Genentech, Inc. | Nucleic acid intercalating agents |
US5262536A (en) | 1988-09-15 | 1993-11-16 | E. I. Du Pont De Nemours And Company | Reagents for the preparation of 5'-tagged oligonucleotides |
GB8824593D0 (en) | 1988-10-20 | 1988-11-23 | Royal Free Hosp School Med | Liposomes |
US5512439A (en) | 1988-11-21 | 1996-04-30 | Dynal As | Oligonucleotide-linked magnetic particles and uses thereof |
US5599923A (en) | 1989-03-06 | 1997-02-04 | Board Of Regents, University Of Tx | Texaphyrin metal complexes having improved functionalization |
US5457183A (en) | 1989-03-06 | 1995-10-10 | Board Of Regents, The University Of Texas System | Hydroxylated texaphyrins |
US5328470A (en) | 1989-03-31 | 1994-07-12 | The Regents Of The University Of Michigan | Treatment of diseases by site-specific instillation of cells or site-specific transformation of cells and kits therefor |
US5391723A (en) | 1989-05-31 | 1995-02-21 | Neorx Corporation | Oligonucleotide conjugates |
US4958013A (en) | 1989-06-06 | 1990-09-18 | Northwestern University | Cholesteryl modified oligonucleotides |
US5451463A (en) | 1989-08-28 | 1995-09-19 | Clontech Laboratories, Inc. | Non-nucleoside 1,3-diol reagents for labeling synthetic oligonucleotides |
US5134066A (en) | 1989-08-29 | 1992-07-28 | Monsanto Company | Improved probes using nucleosides containing 3-dezauracil analogs |
US5254469A (en) | 1989-09-12 | 1993-10-19 | Eastman Kodak Company | Oligonucleotide-enzyme conjugate that can be used as a probe in hybridization assays and polymerase chain reaction procedures |
US5591722A (en) | 1989-09-15 | 1997-01-07 | Southern Research Institute | 2'-deoxy-4'-thioribonucleosides and their antiviral activity |
US5013556A (en) | 1989-10-20 | 1991-05-07 | Liposome Technology, Inc. | Liposomes with enhanced circulation time |
US5225212A (en) | 1989-10-20 | 1993-07-06 | Liposome Technology, Inc. | Microreservoir liposome composition and method |
US5356633A (en) | 1989-10-20 | 1994-10-18 | Liposome Technology, Inc. | Method of treatment of inflamed tissues |
US5399676A (en) | 1989-10-23 | 1995-03-21 | Gilead Sciences | Oligonucleotides with inverted polarity |
EP0942000B1 (en) | 1989-10-24 | 2004-06-23 | Isis Pharmaceuticals, Inc. | 2'-Modified oligonucleotides |
US5264564A (en) | 1989-10-24 | 1993-11-23 | Gilead Sciences | Oligonucleotide analogs with novel linkages |
US5292873A (en) | 1989-11-29 | 1994-03-08 | The Research Foundation Of State University Of New York | Nucleic acids labeled with naphthoquinone probe |
US5177198A (en) | 1989-11-30 | 1993-01-05 | University Of N.C. At Chapel Hill | Process for preparing oligoribonucleoside and oligodeoxyribonucleoside boranophosphates |
US5486603A (en) | 1990-01-08 | 1996-01-23 | Gilead Sciences, Inc. | Oligonucleotide having enhanced binding affinity |
US5587470A (en) | 1990-01-11 | 1996-12-24 | Isis Pharmaceuticals, Inc. | 3-deazapurines |
US5587361A (en) | 1991-10-15 | 1996-12-24 | Isis Pharmaceuticals, Inc. | Oligonucleotides having phosphorothioate linkages of high chiral purity |
US5681941A (en) | 1990-01-11 | 1997-10-28 | Isis Pharmaceuticals, Inc. | Substituted purines and oligonucleotide cross-linking |
US5578718A (en) | 1990-01-11 | 1996-11-26 | Isis Pharmaceuticals, Inc. | Thiol-derivatized nucleosides |
US5670633A (en) | 1990-01-11 | 1997-09-23 | Isis Pharmaceuticals, Inc. | Sugar modified oligonucleotides that detect and modulate gene expression |
US5459255A (en) | 1990-01-11 | 1995-10-17 | Isis Pharmaceuticals, Inc. | N-2 substituted purines |
US5646265A (en) | 1990-01-11 | 1997-07-08 | Isis Pharmceuticals, Inc. | Process for the preparation of 2'-O-alkyl purine phosphoramidites |
US5214136A (en) | 1990-02-20 | 1993-05-25 | Gilead Sciences, Inc. | Anthraquinone-derivatives oligonucleotides |
AU7579991A (en) | 1990-02-20 | 1991-09-18 | Gilead Sciences, Inc. | Pseudonucleosides and pseudonucleotides and their polymers |
US5321131A (en) | 1990-03-08 | 1994-06-14 | Hybridon, Inc. | Site-specific functionalization of oligodeoxynucleotides for non-radioactive labelling |
US5470967A (en) | 1990-04-10 | 1995-11-28 | The Dupont Merck Pharmaceutical Company | Oligonucleotide analogs with sulfamate linkages |
US5665710A (en) | 1990-04-30 | 1997-09-09 | Georgetown University | Method of making liposomal oligodeoxynucleotide compositions |
GB9009980D0 (en) | 1990-05-03 | 1990-06-27 | Amersham Int Plc | Phosphoramidite derivatives,their preparation and the use thereof in the incorporation of reporter groups on synthetic oligonucleotides |
EP0455905B1 (en) | 1990-05-11 | 1998-06-17 | Microprobe Corporation | Dipsticks for nucleic acid hybridization assays and methods for covalently immobilizing oligonucleotides |
US5218105A (en) | 1990-07-27 | 1993-06-08 | Isis Pharmaceuticals | Polyamine conjugated oligonucleotides |
US5602240A (en) | 1990-07-27 | 1997-02-11 | Ciba Geigy Ag. | Backbone modified oligonucleotide analogs |
US5541307A (en) | 1990-07-27 | 1996-07-30 | Isis Pharmaceuticals, Inc. | Backbone modified oligonucleotide analogs and solid phase synthesis thereof |
US5608046A (en) | 1990-07-27 | 1997-03-04 | Isis Pharmaceuticals, Inc. | Conjugated 4'-desmethyl nucleoside analog compounds |
US5677437A (en) | 1990-07-27 | 1997-10-14 | Isis Pharmaceuticals, Inc. | Heteroatomic oligonucleoside linkages |
WO1992002258A1 (en) | 1990-07-27 | 1992-02-20 | Isis Pharmaceuticals, Inc. | Nuclease resistant, pyrimidine modified oligonucleotides that detect and modulate gene expression |
US5138045A (en) | 1990-07-27 | 1992-08-11 | Isis Pharmaceuticals | Polyamine conjugated oligonucleotides |
US5688941A (en) | 1990-07-27 | 1997-11-18 | Isis Pharmaceuticals, Inc. | Methods of making conjugated 4' desmethyl nucleoside analog compounds |
US5623070A (en) | 1990-07-27 | 1997-04-22 | Isis Pharmaceuticals, Inc. | Heteroatomic oligonucleoside linkages |
US5618704A (en) | 1990-07-27 | 1997-04-08 | Isis Pharmacueticals, Inc. | Backbone-modified oligonucleotide analogs and preparation thereof through radical coupling |
US5610289A (en) | 1990-07-27 | 1997-03-11 | Isis Pharmaceuticals, Inc. | Backbone modified oligonucleotide analogues |
US5489677A (en) | 1990-07-27 | 1996-02-06 | Isis Pharmaceuticals, Inc. | Oligonucleoside linkages containing adjacent oxygen and nitrogen atoms |
US5245022A (en) | 1990-08-03 | 1993-09-14 | Sterling Drug, Inc. | Exonuclease resistant terminally substituted oligonucleotides |
EP0541722B1 (en) | 1990-08-03 | 1995-12-20 | Sterling Winthrop Inc. | Compounds and methods for inhibiting gene expression |
US5512667A (en) | 1990-08-28 | 1996-04-30 | Reed; Michael W. | Trifunctional intermediates for preparing 3'-tailed oligonucleotides |
US5214134A (en) | 1990-09-12 | 1993-05-25 | Sterling Winthrop Inc. | Process of linking nucleosides with a siloxane bridge |
US5561225A (en) | 1990-09-19 | 1996-10-01 | Southern Research Institute | Polynucleotide analogs containing sulfonate and sulfonamide internucleoside linkages |
CA2092002A1 (en) | 1990-09-20 | 1992-03-21 | Mark Matteucci | Modified internucleoside linkages |
US5432272A (en) | 1990-10-09 | 1995-07-11 | Benner; Steven A. | Method for incorporating into a DNA or RNA oligonucleotide using nucleotides bearing heterocyclic bases |
DE69123979T2 (de) | 1990-10-12 | 1997-04-30 | Max Planck Gesellschaft | Abgeänderte ribozyme |
AU659824B2 (en) | 1990-10-31 | 1995-06-01 | Cell Genesys, Inc. | Retroviral vectors useful for gene therapy |
CA2095212A1 (en) | 1990-11-08 | 1992-05-09 | Sudhir Agrawal | Incorporation of multiple reporter groups on synthetic oligonucleotides |
GB9100304D0 (en) | 1991-01-08 | 1991-02-20 | Ici Plc | Compound |
JP3220180B2 (ja) | 1991-05-23 | 2001-10-22 | 三菱化学株式会社 | 薬剤含有タンパク質結合リポソーム |
US5539082A (en) | 1993-04-26 | 1996-07-23 | Nielsen; Peter E. | Peptide nucleic acids |
US5714331A (en) | 1991-05-24 | 1998-02-03 | Buchardt, Deceased; Ole | Peptide nucleic acids having enhanced binding affinity, sequence specificity and solubility |
US5719262A (en) | 1993-11-22 | 1998-02-17 | Buchardt, Deceased; Ole | Peptide nucleic acids having amino acid side chains |
DE4216134A1 (de) | 1991-06-20 | 1992-12-24 | Europ Lab Molekularbiolog | Synthetische katalytische oligonukleotidstrukturen |
US5371241A (en) | 1991-07-19 | 1994-12-06 | Pharmacia P-L Biochemicals Inc. | Fluorescein labelled phosphoramidites |
US5571799A (en) | 1991-08-12 | 1996-11-05 | Basco, Ltd. | (2'-5') oligoadenylate analogues useful as inhibitors of host-v5.-graft response |
EP0538194B1 (de) | 1991-10-17 | 1997-06-04 | Novartis AG | Bicyclische Nukleoside, Oligonukleotide, Verfahren zu deren Herstellung und Zwischenprodukte |
US5594121A (en) | 1991-11-07 | 1997-01-14 | Gilead Sciences, Inc. | Enhanced triple-helix and double-helix formation with oligomers containing modified purines |
US5252479A (en) | 1991-11-08 | 1993-10-12 | Research Corporation Technologies, Inc. | Safe vector for gene therapy |
US5484908A (en) | 1991-11-26 | 1996-01-16 | Gilead Sciences, Inc. | Oligonucleotides containing 5-propynyl pyrimidines |
US5359044A (en) | 1991-12-13 | 1994-10-25 | Isis Pharmaceuticals | Cyclobutyl oligonucleotide surrogates |
US5595726A (en) | 1992-01-21 | 1997-01-21 | Pharmacyclics, Inc. | Chromophore probe for detection of nucleic acid |
US5565552A (en) | 1992-01-21 | 1996-10-15 | Pharmacyclics, Inc. | Method of expanded porphyrin-oligonucleotide conjugate synthesis |
US5652094A (en) | 1992-01-31 | 1997-07-29 | University Of Montreal | Nucleozymes |
FR2687679B1 (fr) | 1992-02-05 | 1994-10-28 | Centre Nat Rech Scient | Oligothionucleotides. |
DE4203923A1 (de) | 1992-02-11 | 1993-08-12 | Henkel Kgaa | Verfahren zur herstellung von polycarboxylaten auf polysaccharid-basis |
US5633360A (en) | 1992-04-14 | 1997-05-27 | Gilead Sciences, Inc. | Oligonucleotide analogs capable of passive cell membrane permeation |
CA2135646A1 (en) | 1992-05-11 | 1993-11-25 | Kenneth G. Draper | Method and reagent for inhibiting viral replication |
US5434257A (en) | 1992-06-01 | 1995-07-18 | Gilead Sciences, Inc. | Binding compentent oligomers containing unsaturated 3',5' and 2',5' linkages |
US5587308A (en) | 1992-06-02 | 1996-12-24 | The United States Of America As Represented By The Department Of Health & Human Services | Modified adeno-associated virus vector capable of expression from a novel promoter |
EP0577558A2 (de) | 1992-07-01 | 1994-01-05 | Ciba-Geigy Ag | Carbocyclische Nukleoside mit bicyclischen Ringen, Oligonukleotide daraus, Verfahren zu deren Herstellung, deren Verwendung und Zwischenproduckte |
US5272250A (en) | 1992-07-10 | 1993-12-21 | Spielvogel Bernard F | Boronated phosphoramidate compounds |
EP1251170A3 (en) | 1992-07-17 | 2002-10-30 | Ribozyme Pharmaceuticals, Inc. | Method and reagent for treatment of NF-kappaB dependent animal diseases |
US5478745A (en) | 1992-12-04 | 1995-12-26 | University Of Pittsburgh | Recombinant viral vector system |
US5574142A (en) | 1992-12-15 | 1996-11-12 | Microprobe Corporation | Peptide linkers for improved oligonucleotide delivery |
US5672659A (en) | 1993-01-06 | 1997-09-30 | Kinerton Limited | Ionic molecular conjugates of biodegradable polyesters and bioactive polypeptides |
JP3351476B2 (ja) | 1993-01-22 | 2002-11-25 | 三菱化学株式会社 | リン脂質誘導体及びそれを含有するリポソーム |
DE69333930T8 (de) | 1993-01-22 | 2007-02-22 | The Regents Of The University Of Colorado, Boulder | Lokalisierung von therapeutischen mitteln |
US5476925A (en) | 1993-02-01 | 1995-12-19 | Northwestern University | Oligodeoxyribonucleotides including 3'-aminonucleoside-phosphoramidate linkages and terminal 3'-amino groups |
US6020317A (en) | 1993-02-19 | 2000-02-01 | Nippon Shinyaku Co. Ltd. | Glycerol derivative, device and pharmaceutical composition |
US5395619A (en) | 1993-03-03 | 1995-03-07 | Liposome Technology, Inc. | Lipid-polymer conjugates and liposomes |
GB9304618D0 (en) | 1993-03-06 | 1993-04-21 | Ciba Geigy Ag | Chemical compounds |
ATE155467T1 (de) | 1993-03-30 | 1997-08-15 | Sanofi Sa | Acyclische nucleosid analoge und sie enthaltende oligonucleotidsequenzen |
AU6412794A (en) | 1993-03-31 | 1994-10-24 | Sterling Winthrop Inc. | Oligonucleotides with amide linkages replacing phosphodiester linkages |
DE4311944A1 (de) | 1993-04-10 | 1994-10-13 | Degussa | Umhüllte Natriumpercarbonatpartikel, Verfahren zu deren Herstellung und sie enthaltende Wasch-, Reinigungs- und Bleichmittelzusammensetzungen |
US5502177A (en) | 1993-09-17 | 1996-03-26 | Gilead Sciences, Inc. | Pyrimidine derivatives for labeled binding partners |
US5540935A (en) | 1993-12-06 | 1996-07-30 | Nof Corporation | Reactive vesicle and functional substance-fixed vesicle |
US5457187A (en) | 1993-12-08 | 1995-10-10 | Board Of Regents University Of Nebraska | Oligonucleotides containing 5-fluorouracil |
US5446137B1 (en) | 1993-12-09 | 1998-10-06 | Behringwerke Ag | Oligonucleotides containing 4'-substituted nucleotides |
US5519134A (en) | 1994-01-11 | 1996-05-21 | Isis Pharmaceuticals, Inc. | Pyrrolidine-containing monomers and oligomers |
US5902880A (en) | 1994-08-19 | 1999-05-11 | Ribozyme Pharmaceuticals, Inc. | RNA polymerase III-based expression of therapeutic RNAs |
US5596091A (en) | 1994-03-18 | 1997-01-21 | The Regents Of The University Of California | Antisense oligonucleotides comprising 5-aminoalkyl pyrimidine nucleotides |
US5627053A (en) | 1994-03-29 | 1997-05-06 | Ribozyme Pharmaceuticals, Inc. | 2'deoxy-2'-alkylnucleotide containing nucleic acid |
US5625050A (en) | 1994-03-31 | 1997-04-29 | Amgen Inc. | Modified oligonucleotides and intermediates useful in nucleic acid therapeutics |
US6054299A (en) | 1994-04-29 | 2000-04-25 | Conrad; Charles A. | Stem-loop cloning vector and method |
US5525711A (en) | 1994-05-18 | 1996-06-11 | The United States Of America As Represented By The Secretary Of The Department Of Health And Human Services | Pteridine nucleotide analogs as fluorescent DNA probes |
US5543152A (en) | 1994-06-20 | 1996-08-06 | Inex Pharmaceuticals Corporation | Sphingosomes for enhanced drug delivery |
EP0769552A4 (en) | 1994-06-27 | 1997-06-18 | Toagosei Co Ltd | ANTISENSE NUCLEIC ACID COMPOUND |
US5597696A (en) | 1994-07-18 | 1997-01-28 | Becton Dickinson And Company | Covalent cyanine dye oligonucleotide conjugates |
US6146886A (en) | 1994-08-19 | 2000-11-14 | Ribozyme Pharmaceuticals, Inc. | RNA polymerase III-based expression of therapeutic RNAs |
US5580731A (en) | 1994-08-25 | 1996-12-03 | Chiron Corporation | N-4 modified pyrimidine deoxynucleotides and oligonucleotide probes synthesized therewith |
US5597909A (en) | 1994-08-25 | 1997-01-28 | Chiron Corporation | Polynucleotide reagents containing modified deoxyribose moieties, and associated methods of synthesis and use |
US5595760A (en) | 1994-09-02 | 1997-01-21 | Delab | Sustained release of peptides from pharmaceutical compositions |
US5753613A (en) | 1994-09-30 | 1998-05-19 | Inex Pharmaceuticals Corporation | Compositions for the introduction of polyanionic materials into cells |
US5820873A (en) | 1994-09-30 | 1998-10-13 | The University Of British Columbia | Polyethylene glycol modified ceramide lipids and liposome uses thereof |
US5885613A (en) | 1994-09-30 | 1999-03-23 | The University Of British Columbia | Bilayer stabilizing components and their use in forming programmable fusogenic liposomes |
US5716824A (en) | 1995-04-20 | 1998-02-10 | Ribozyme Pharmaceuticals, Inc. | 2'-O-alkylthioalkyl and 2-C-alkylthioalkyl-containing enzymatic nucleic acids (ribozymes) |
US5756122A (en) | 1995-06-07 | 1998-05-26 | Georgetown University | Liposomally encapsulated nucleic acids having high entrapment efficiencies, method of manufacturer and use thereof for transfection of targeted cells |
JPH11511128A (ja) | 1995-08-01 | 1999-09-28 | ノバルティス・アクチエンゲゼルシャフト | リポソームオリゴヌクレオチド組成物 |
US5858397A (en) | 1995-10-11 | 1999-01-12 | University Of British Columbia | Liposomal formulations of mitoxantrone |
EP1108724B1 (en) | 1996-01-16 | 2007-09-19 | Sirna Therpeutics, Inc. | Synthesis of methoxy nucleosides and enzymatic nucleic acid molecules |
US5994316A (en) | 1996-02-21 | 1999-11-30 | The Immune Response Corporation | Method of preparing polynucleotide-carrier complexes for delivery to cells |
US5849902A (en) | 1996-09-26 | 1998-12-15 | Oligos Etc. Inc. | Three component chimeric antisense oligonucleotides |
US6395713B1 (en) | 1997-07-23 | 2002-05-28 | Ribozyme Pharmaceuticals, Inc. | Compositions for the delivery of negatively charged molecules |
US6506559B1 (en) | 1997-12-23 | 2003-01-14 | Carnegie Institute Of Washington | Genetic inhibition by double-stranded RNA |
EP3214177A3 (en) | 1998-04-08 | 2017-11-22 | Commonwealth Scientific and Industrial Research Organisation | Methods and means for obtaining modified phenotypes |
AR020078A1 (es) | 1998-05-26 | 2002-04-10 | Syngenta Participations Ag | Metodo para alterar la expresion de un gen objetivo en una celula de planta |
MXPA01003643A (es) | 1998-10-09 | 2003-07-21 | Ingene Inc | Produccion de adnss in vivo. |
JP2002527061A (ja) | 1998-10-09 | 2002-08-27 | インジーン・インコーポレイテッド | ssDNAの酵素的合成 |
DE19956568A1 (de) | 1999-01-30 | 2000-08-17 | Roland Kreutzer | Verfahren und Medikament zur Hemmung der Expression eines vorgegebenen Gens |
AU767195B2 (en) | 1999-03-10 | 2003-11-06 | Phogen Limited | Delivery of substances to cells |
DE19935303A1 (de) * | 1999-07-28 | 2001-02-08 | Aventis Pharma Gmbh | Oligonukleotide zur Inhibierung der Expression von humanem eg5 |
DE10100586C1 (de) | 2001-01-09 | 2002-04-11 | Ribopharma Ag | Verfahren zur Hemmung der Expression eines Ziegens |
WO2003070918A2 (en) * | 2002-02-20 | 2003-08-28 | Ribozyme Pharmaceuticals, Incorporated | Rna interference by modified short interfering nucleic acid |
WO2002081628A2 (en) | 2001-04-05 | 2002-10-17 | Ribozyme Pharmaceuticals, Incorporated | Modulation of gene expression associated with inflammation proliferation and neurite outgrowth, using nucleic acid based technologies |
EP1873259B1 (en) | 2000-12-01 | 2012-01-25 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V. | RNA interference mediated by 21 and 22nt RNAs |
WO2003070910A2 (en) | 2002-02-20 | 2003-08-28 | Ribozyme Pharmaceuticals, Incorporated | INHIBITION OF VASCULAR ENDOTHELIAL GROWTH FACTOR (VEGF) AND VEGF RECEPTOR GENE EXPRESSION USING SHORT INTERFERING NUCLEIC ACID (siNA) |
US20040209832A1 (en) | 2001-11-30 | 2004-10-21 | Mcswiggen James | RNA interference mediated inhibition of vascular endothelial growth factor and vascular endothelial growth factor receptor gene expression using short interfering nucleic acid (siNA) |
US20030170891A1 (en) | 2001-06-06 | 2003-09-11 | Mcswiggen James A. | RNA interference mediated inhibition of epidermal growth factor receptor gene expression using short interfering nucleic acid (siNA) |
US7981863B2 (en) | 2001-09-19 | 2011-07-19 | Neuronova Ab | Treatment of Parkinson's disease with PDGF |
US7199107B2 (en) | 2002-05-23 | 2007-04-03 | Isis Pharmaceuticals, Inc. | Antisense modulation of kinesin-like 1 expression |
NO20023047A (no) | 2002-06-21 | 2003-09-01 | Hydralift Asa | Kompenseringsanordning |
CN1156336C (zh) | 2002-07-12 | 2004-07-07 | 清华大学 | 柔性基底材料表面负载二氧化钛薄膜光催化剂的制备方法 |
US7148342B2 (en) | 2002-07-24 | 2006-12-12 | The Trustees Of The University Of Pennyslvania | Compositions and methods for sirna inhibition of angiogenesis |
EP1546575A1 (en) | 2002-07-29 | 2005-06-29 | The Gates Corporation | Belt |
US7036793B2 (en) | 2002-07-31 | 2006-05-02 | Brass-Craft Manufacturing Company | Stop valve |
US7923547B2 (en) | 2002-09-05 | 2011-04-12 | Sirna Therapeutics, Inc. | RNA interference mediated inhibition of gene expression using chemically modified short interfering nucleic acid (siNA) |
US20040115201A1 (en) * | 2002-09-25 | 2004-06-17 | Paz Einat | Mitotic kinesin-like protein-1, MKLP1, and uses thereof |
JP2004159653A (ja) * | 2002-10-24 | 2004-06-10 | Sankyo Co Ltd | 癌遺伝子及びその用途 |
US7887431B2 (en) | 2008-05-16 | 2011-02-15 | Taylor Made Golf Company, Inc. | Golf club |
US8090542B2 (en) | 2002-11-14 | 2012-01-03 | Dharmacon Inc. | Functional and hyperfunctional siRNA |
WO2004064737A2 (en) | 2003-01-17 | 2004-08-05 | Alnylam Pharmaceuticals | Therapeutics compositions |
DE10302421A1 (de) | 2003-01-21 | 2004-07-29 | Ribopharma Ag | Doppelsträngige Ribonukleinsäure mit verbesserter Wirksamkeit |
CA2860151A1 (en) * | 2003-02-10 | 2004-08-26 | Agensys, Inc. | Nucleic acid and corresponding protein named 158p1d7 useful in the treatment and detection of bladder and other cancers |
WO2004090108A2 (en) | 2003-04-03 | 2004-10-21 | Alnylam Pharmaceuticals | Irna conjugates |
EP2216407B1 (en) | 2003-03-07 | 2016-01-13 | Alnylam Pharmaceuticals, Inc. | Therapeutic compositions |
WO2004094345A2 (en) | 2003-04-17 | 2004-11-04 | Alnylam Pharmaceuticals Inc. | Protected monomers |
EP1620544B1 (en) | 2003-04-17 | 2018-09-19 | Alnylam Pharmaceuticals Inc. | MODIFIED iRNA AGENTS |
AU2004235755A1 (en) * | 2003-04-30 | 2004-11-18 | Agensys, Inc. | Nucleic acids and corresponding proteins entitled 109P1D4 useful in treatment and detection of cancer |
EP2497485A1 (en) | 2003-05-09 | 2012-09-12 | Transfert Plus | Compound and method for regulating plasminogen activation and cell migration |
EP1635763B1 (en) * | 2003-06-09 | 2012-08-08 | Alnylam Pharmaceuticals Inc. | Method of treating neurodegenerative disease |
EP3604537B1 (en) * | 2003-06-13 | 2021-12-08 | Alnylam Europe AG | Double-stranded ribonucleic acid with increased effectiveness in an organism |
JP2007505634A (ja) | 2003-09-22 | 2007-03-15 | ロゼッタ インファーマティクス エルエルシー | Rna干渉を用いる合成致死スクリーニング |
EP1735009A4 (en) * | 2004-03-12 | 2011-03-30 | Alnylam Pharmaceuticals Inc | RNAI AGENTS TARGETING THE VASCULAR ENDOTHELIUM GROWTH FACTOR (VEGF) |
WO2006105361A2 (en) | 2005-03-31 | 2006-10-05 | Calando Pharmaceuticals, Inc. | Inhibitors of ribonucleotide reductase subunit 2 and uses thereof |
KR20170061189A (ko) | 2006-03-31 | 2017-06-02 | 알닐람 파마슈티칼스 인코포레이티드 | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 |
US8598333B2 (en) * | 2006-05-26 | 2013-12-03 | Alnylam Pharmaceuticals, Inc. | SiRNA silencing of genes expressed in cancer |
US20080213350A1 (en) | 2007-02-20 | 2008-09-04 | Texas Tech University System | Encapsulation of nucleic acids in liposomes |
US7858592B2 (en) | 2007-02-26 | 2010-12-28 | The Board Of Regents Of The University Of Texas System | Interfering RNAs against the promoter region of P53 |
JP5697988B2 (ja) | 2007-12-27 | 2015-04-08 | プロチバ バイオセラピューティクス インコーポレイティッド | 干渉rnaを使用したポロ様キナーゼ発現のサイレンシング方法 |
KR101397407B1 (ko) | 2008-03-05 | 2014-06-19 | 알닐람 파마슈티칼스 인코포레이티드 | Eg5 및 VEGF 유전자의 발현을 억제하기 위한 조성물 및 방법 |
AU2010223967B2 (en) | 2009-03-12 | 2015-07-30 | Alnylam Pharmaceuticals, Inc. | Lipid formulated compositions and methods for inhibiting expression of Eg5 and VEGF genes |
WO2010147992A1 (en) | 2009-06-15 | 2010-12-23 | Alnylam Pharmaceuticals, Inc. | Methods for increasing efficacy of lipid formulated sirna |
US10867398B2 (en) | 2017-11-21 | 2020-12-15 | Reliance Core Consulting LLC | Methods, systems, apparatuses and devices for facilitating motion analysis in an environment |
-
2007
- 2007-03-30 KR KR1020177014179A patent/KR20170061189A/ko not_active Application Discontinuation
- 2007-03-30 JP JP2009503309A patent/JP5704741B2/ja not_active Expired - Fee Related
- 2007-03-30 ES ES07759825.8T patent/ES2544861T3/es active Active
- 2007-03-30 US US11/694,215 patent/US7718629B2/en not_active Expired - Fee Related
- 2007-03-30 CN CN2007800184075A patent/CN101448849B/zh active Active
- 2007-03-30 AU AU2007233109A patent/AU2007233109B2/en not_active Ceased
- 2007-03-30 EA EA200870401A patent/EA014886B1/ru not_active IP Right Cessation
- 2007-03-30 EP EP07759825.8A patent/EP2008274B1/en not_active Not-in-force
- 2007-03-30 KR KR20157005346A patent/KR20150038522A/ko active Application Filing
- 2007-03-30 KR KR1020147012816A patent/KR101547579B1/ko not_active IP Right Cessation
- 2007-03-30 EP EP12166396A patent/EP2527354A1/en not_active Withdrawn
- 2007-03-30 SG SG201102165-6A patent/SG170780A1/en unknown
- 2007-03-30 KR KR1020087026420A patent/KR101362681B1/ko not_active IP Right Cessation
- 2007-03-30 NZ NZ571568A patent/NZ571568A/en not_active IP Right Cessation
- 2007-03-30 KR KR1020127010548A patent/KR101462874B1/ko not_active IP Right Cessation
- 2007-03-30 CA CA2873833A patent/CA2873833A1/en not_active Abandoned
- 2007-03-30 WO PCT/US2007/065636 patent/WO2007115168A2/en active Application Filing
- 2007-03-30 CA CA2647728A patent/CA2647728C/en not_active Expired - Fee Related
- 2007-03-30 NZ NZ587704A patent/NZ587704A/en not_active IP Right Cessation
-
2008
- 2008-09-28 IL IL194419A patent/IL194419A/en not_active IP Right Cessation
-
2009
- 2009-06-24 HK HK09105669.0A patent/HK1126782A1/xx not_active IP Right Cessation
-
2010
- 2010-04-05 US US12/754,110 patent/US20110015250A1/en not_active Abandoned
- 2010-04-21 JP JP2010098329A patent/JP2010166930A/ja active Pending
- 2010-10-15 AU AU2010235872A patent/AU2010235872B2/en not_active Ceased
-
2011
- 2011-06-21 US US13/165,568 patent/US20120136145A1/en not_active Abandoned
-
2013
- 2013-03-12 US US13/797,176 patent/US9057069B2/en not_active Expired - Fee Related
- 2013-08-13 JP JP2013168007A patent/JP2013226160A/ja not_active Withdrawn
-
2014
- 2014-03-24 IL IL231688A patent/IL231688A0/en unknown
-
2015
- 2015-05-22 US US14/720,685 patent/US20160017337A1/en not_active Abandoned
-
2016
- 2016-09-23 JP JP2016185278A patent/JP2016214266A/ja active Pending
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR101547579B1 (ko) | Eg5 유전자의 발현을 억제하는 이본쇄 리보핵산 | |
US9963700B2 (en) | GNAQ targeted dsRNA compositions and methods for inhibiting expression | |
KR101635436B1 (ko) | 트랜스티레틴의 발현을 억제하기 위한 조성물 및 방법 | |
JP5431940B2 (ja) | SCAPのRNAi調節およびその治療的使用 | |
EP2023937B1 (en) | Rnai modulation of aha and therapeutic uses thereof | |
KR20100126461A (ko) | Eg5 및 VEGF 유전자의 발현을 억제하기 위한 조성물 및 방법 | |
US20120016006A1 (en) | Compositions And Methods For Increasing Cellular Uptake Of RNAi Via SID-1 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
E902 | Notification of reason for refusal | ||
A107 | Divisional application of patent | ||
E902 | Notification of reason for refusal | ||
E701 | Decision to grant or registration of patent right | ||
GRNT | Written decision to grant | ||
FPAY | Annual fee payment |
Payment date: 20170131 Year of fee payment: 4 |
|
LAPS | Lapse due to unpaid annual fee |