JPWO2020014246A5 - - Google Patents
Download PDFInfo
- Publication number
- JPWO2020014246A5 JPWO2020014246A5 JP2021500411A JP2021500411A JPWO2020014246A5 JP WO2020014246 A5 JPWO2020014246 A5 JP WO2020014246A5 JP 2021500411 A JP2021500411 A JP 2021500411A JP 2021500411 A JP2021500411 A JP 2021500411A JP WO2020014246 A5 JPWO2020014246 A5 JP WO2020014246A5
- Authority
- JP
- Japan
- Prior art keywords
- trifluoromethyl
- carboxamide
- phenoxy
- pyridin
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 cyano, amino Chemical group 0.000 claims description 824
- 150000001875 compounds Chemical class 0.000 claims description 296
- 125000000217 alkyl group Chemical group 0.000 claims description 252
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 170
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 167
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 153
- 239000000203 mixture Substances 0.000 claims description 124
- 229910052757 nitrogen Inorganic materials 0.000 claims description 98
- 229910052739 hydrogen Inorganic materials 0.000 claims description 92
- 229910052799 carbon Inorganic materials 0.000 claims description 90
- 229910052736 halogen Inorganic materials 0.000 claims description 89
- 150000002367 halogens Chemical class 0.000 claims description 88
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 86
- 201000006417 multiple sclerosis Diseases 0.000 claims description 75
- 125000003545 alkoxy group Chemical group 0.000 claims description 66
- 239000011734 sodium Substances 0.000 claims description 65
- 125000003118 aryl group Chemical group 0.000 claims description 55
- 125000001072 heteroaryl group Chemical group 0.000 claims description 54
- 239000011780 sodium chloride Substances 0.000 claims description 53
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 50
- 150000003839 salts Chemical class 0.000 claims description 50
- 125000001424 substituent group Chemical group 0.000 claims description 43
- 239000001257 hydrogen Substances 0.000 claims description 42
- 125000004076 pyridyl group Chemical group 0.000 claims description 42
- 208000002193 Pain Diseases 0.000 claims description 41
- 125000004432 carbon atoms Chemical group C* 0.000 claims description 41
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 37
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 36
- 230000002401 inhibitory effect Effects 0.000 claims description 36
- 230000036407 pain Effects 0.000 claims description 36
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 35
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 35
- 201000010099 disease Diseases 0.000 claims description 35
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 31
- 239000003814 drug Substances 0.000 claims description 30
- 125000002757 morpholinyl group Chemical group 0.000 claims description 25
- 102000018674 Sodium Channels Human genes 0.000 claims description 24
- 108010052164 Sodium Channels Proteins 0.000 claims description 24
- 125000004043 oxo group Chemical group O=* 0.000 claims description 21
- 125000000623 heterocyclic group Chemical group 0.000 claims description 19
- DFPAKSUCGFBDDF-UHFFFAOYSA-N nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 claims description 19
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 18
- 125000004104 aryloxy group Chemical group 0.000 claims description 17
- 230000000694 effects Effects 0.000 claims description 17
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 16
- 125000005418 aryl aryl group Chemical group 0.000 claims description 16
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims description 16
- 230000014509 gene expression Effects 0.000 claims description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 16
- 125000002971 oxazolyl group Chemical group 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 claims description 12
- 230000001965 increased Effects 0.000 claims description 12
- ILVXOBCQQYKLDS-UHFFFAOYSA-N Pyridine-N-oxide Chemical group [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 claims description 11
- 229940079593 drugs Drugs 0.000 claims description 11
- 239000011570 nicotinamide Substances 0.000 claims description 10
- 235000005152 nicotinamide Nutrition 0.000 claims description 10
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 10
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 10
- 208000004296 Neuralgia Diseases 0.000 claims description 9
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 8
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 8
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 8
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 claims description 8
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 7
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 7
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 claims description 6
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 6
- 125000005360 alkyl sulfoxide group Chemical group 0.000 claims description 6
- 125000005018 aryl alkenyl group Chemical group 0.000 claims description 6
- 201000011384 erythromelalgia Diseases 0.000 claims description 6
- 230000001105 regulatory Effects 0.000 claims description 6
- 206010065390 Inflammatory pain Diseases 0.000 claims description 5
- 206010029331 Neuropathy peripheral Diseases 0.000 claims description 5
- 229940005483 OPIOID ANALGESICS Drugs 0.000 claims description 5
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 201000001119 neuropathy Diseases 0.000 claims description 5
- 239000000014 opioid analgesic Substances 0.000 claims description 5
- 201000010874 syndrome Diseases 0.000 claims description 5
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 4
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 4
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 4
- 206010003119 Arrhythmia Diseases 0.000 claims description 4
- 206010007521 Cardiac arrhythmias Diseases 0.000 claims description 4
- 208000000094 Chronic Pain Diseases 0.000 claims description 4
- 229940093912 Gynecological Sulfonamides Drugs 0.000 claims description 4
- 206010019233 Headache Diseases 0.000 claims description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 4
- 229940079867 intestinal antiinfectives Sulfonamides Drugs 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229940005938 ophthalmologic antiinfectives Sulfonamides Drugs 0.000 claims description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N p-acetaminophenol Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 claims description 4
- 229960005489 paracetamol Drugs 0.000 claims description 4
- 230000002093 peripheral Effects 0.000 claims description 4
- 150000003456 sulfonamides Chemical group 0.000 claims description 4
- 229940026752 topical Sulfonamides Drugs 0.000 claims description 4
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 3
- 229940022659 Acetaminophen Drugs 0.000 claims description 3
- 241000580858 Simian-Human immunodeficiency virus Species 0.000 claims description 3
- 208000009935 Visceral Pain Diseases 0.000 claims description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 3
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 claims description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004361 3,4,5-trifluorophenyl group Chemical group [H]C1=C(F)C(F)=C(F)C([H])=C1* 0.000 claims description 2
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 claims description 2
- 206010002855 Anxiety Diseases 0.000 claims description 2
- 206010057666 Anxiety disease Diseases 0.000 claims description 2
- 206010003210 Arteriosclerosis Diseases 0.000 claims description 2
- 206010003246 Arthritis Diseases 0.000 claims description 2
- 206010003658 Atrial fibrillation Diseases 0.000 claims description 2
- 206010004939 Bipolar I disease Diseases 0.000 claims description 2
- 206010004938 Bipolar disease Diseases 0.000 claims description 2
- 206010011401 Crohn's disease Diseases 0.000 claims description 2
- 208000001636 Diabetic Neuropathy Diseases 0.000 claims description 2
- 206010012680 Diabetic neuropathy Diseases 0.000 claims description 2
- 208000010118 Dystonia Diseases 0.000 claims description 2
- 208000001640 Fibromyalgia Diseases 0.000 claims description 2
- 208000007514 Herpes Zoster Diseases 0.000 claims description 2
- 206010020751 Hypersensitivity Diseases 0.000 claims description 2
- 206010020844 Hyperthermia malignant Diseases 0.000 claims description 2
- 208000003532 Hypothyroidism Diseases 0.000 claims description 2
- 206010022114 Injury Diseases 0.000 claims description 2
- 102100017700 LGI1 Human genes 0.000 claims description 2
- 101700058968 LGI1 Proteins 0.000 claims description 2
- 208000007914 Labor Pain Diseases 0.000 claims description 2
- 206010059204 Labour pain Diseases 0.000 claims description 2
- 206010052313 Liddle's syndrome Diseases 0.000 claims description 2
- 206010027599 Migraine Diseases 0.000 claims description 2
- 208000008085 Migraine Disorders Diseases 0.000 claims description 2
- 206010028372 Muscular weakness Diseases 0.000 claims description 2
- 208000000693 Neurogenic Urinary Bladder Diseases 0.000 claims description 2
- 206010029279 Neurogenic bladder Diseases 0.000 claims description 2
- 208000001293 Peripheral Nervous System Disease Diseases 0.000 claims description 2
- 206010034606 Peripheral neuropathy Diseases 0.000 claims description 2
- 206010056238 Phantom pain Diseases 0.000 claims description 2
- 208000004550 Postoperative Pain Diseases 0.000 claims description 2
- 208000000399 Procedural Pain Diseases 0.000 claims description 2
- 208000003251 Pruritus Diseases 0.000 claims description 2
- 206010037113 Pseudoaldosteronism Diseases 0.000 claims description 2
- 206010039073 Rheumatoid arthritis Diseases 0.000 claims description 2
- FDDDEECHVMSUSB-UHFFFAOYSA-N Sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims description 2
- 206010043269 Tension headache Diseases 0.000 claims description 2
- 208000008548 Tension-Type Headache Diseases 0.000 claims description 2
- 206010043994 Tonic convulsion Diseases 0.000 claims description 2
- 208000004371 Toothache Diseases 0.000 claims description 2
- 231100000765 Toxin Toxicity 0.000 claims description 2
- 210000003901 Trigeminal Nerve Anatomy 0.000 claims description 2
- 208000003663 Ventricular Fibrillation Diseases 0.000 claims description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 2
- 201000005794 allergic hypersensitivity disease Diseases 0.000 claims description 2
- 230000036506 anxiety Effects 0.000 claims description 2
- 201000001320 atherosclerosis Diseases 0.000 claims description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 2
- 201000011510 cancer Diseases 0.000 claims description 2
- 238000002512 chemotherapy Methods 0.000 claims description 2
- 201000003883 cystic fibrosis Diseases 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 231100000869 headache Toxicity 0.000 claims description 2
- 230000009610 hypersensitivity Effects 0.000 claims description 2
- 230000002989 hypothyroidism Effects 0.000 claims description 2
- 230000000302 ischemic Effects 0.000 claims description 2
- 201000010901 lateral sclerosis Diseases 0.000 claims description 2
- 201000007004 malignant hyperthermia Diseases 0.000 claims description 2
- 230000036473 myasthenia Effects 0.000 claims description 2
- 230000004112 neuroprotection Effects 0.000 claims description 2
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 claims description 2
- 201000008482 osteoarthritis Diseases 0.000 claims description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 2
- 230000001314 paroxysmal Effects 0.000 claims description 2
- 230000002085 persistent Effects 0.000 claims description 2
- 201000000980 schizophrenia Diseases 0.000 claims description 2
- 201000009890 sinusitis Diseases 0.000 claims description 2
- 229960001663 sulfanilamide Drugs 0.000 claims description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 2
- 239000003053 toxin Substances 0.000 claims description 2
- 230000000472 traumatic Effects 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 7
- 206010009887 Colitis Diseases 0.000 claims 1
- 210000003414 Extremities Anatomy 0.000 claims 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N Hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims 1
- 101710006116 IL31RA Proteins 0.000 claims 1
- 210000003205 Muscles Anatomy 0.000 claims 1
- 208000005010 Paroxysmal Extreme Pain Disorder Diseases 0.000 claims 1
- 206010011302 Peripheral nerve injury Diseases 0.000 claims 1
- 206010039020 Rhabdomyolysis Diseases 0.000 claims 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 1
- 230000000541 pulsatile Effects 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 93
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N DMSO-d6 Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 88
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- 238000003786 synthesis reaction Methods 0.000 description 63
- 230000015572 biosynthetic process Effects 0.000 description 62
- 230000002194 synthesizing Effects 0.000 description 62
- 239000007787 solid Substances 0.000 description 60
- 239000000243 solution Substances 0.000 description 60
- 238000005160 1H NMR spectroscopy Methods 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 38
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 239000002904 solvent Substances 0.000 description 38
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 36
- 239000002244 precipitate Substances 0.000 description 33
- 238000001914 filtration Methods 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 235000019439 ethyl acetate Nutrition 0.000 description 27
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 26
- 239000003795 chemical substances by application Substances 0.000 description 24
- FJDQFPXHSGXQBY-UHFFFAOYSA-L Caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 22
- 125000004435 hydrogen atoms Chemical class [H]* 0.000 description 22
- 238000003756 stirring Methods 0.000 description 22
- 101710032460 SCN10A Proteins 0.000 description 21
- 102100010564 SCN10A Human genes 0.000 description 20
- 239000003112 inhibitor Substances 0.000 description 20
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- UQYZFNUUOSSNKT-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate Chemical compound F[P-](F)(F)(F)(F)F.C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 UQYZFNUUOSSNKT-UHFFFAOYSA-N 0.000 description 19
- 239000002253 acid Substances 0.000 description 19
- 210000004027 cells Anatomy 0.000 description 18
- 125000004404 heteroalkyl group Chemical group 0.000 description 17
- 125000005842 heteroatoms Chemical group 0.000 description 17
- 229910052708 sodium Inorganic materials 0.000 description 17
- MBNPJRQKQLLRIS-UHFFFAOYSA-N 3-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=CC(N)=C1 MBNPJRQKQLLRIS-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 238000001816 cooling Methods 0.000 description 15
- 238000000746 purification Methods 0.000 description 15
- 125000002947 alkylene group Chemical group 0.000 description 14
- 238000004166 bioassay Methods 0.000 description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- IMNFDUFMRHMDMM-UHFFFAOYSA-N n-heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 14
- OULGLTLTWBZBLO-UHFFFAOYSA-N 4-fluoro-2-methoxyphenol Chemical compound COC1=CC(F)=CC=C1O OULGLTLTWBZBLO-UHFFFAOYSA-N 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 125000004429 atoms Chemical group 0.000 description 13
- 230000000051 modifying Effects 0.000 description 13
- 229910052717 sulfur Inorganic materials 0.000 description 13
- 125000004122 cyclic group Chemical group 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- 102000004310 Ion Channels Human genes 0.000 description 11
- 108090000862 Ion Channels Proteins 0.000 description 11
- 238000007792 addition Methods 0.000 description 11
- 239000012267 brine Substances 0.000 description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 125000000524 functional group Chemical group 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 125000006239 protecting group Chemical group 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- 125000000547 substituted alkyl group Chemical group 0.000 description 11
- 230000002195 synergetic Effects 0.000 description 11
- 150000002430 hydrocarbons Chemical class 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 230000002829 reduced Effects 0.000 description 10
- 238000004007 reversed phase HPLC Methods 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 201000004317 Pitt-Hopkins syndrome Diseases 0.000 description 9
- 102000016913 Voltage-Gated Sodium Channels Human genes 0.000 description 9
- 108010053752 Voltage-Gated Sodium Channels Proteins 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 239000011259 mixed solution Substances 0.000 description 9
- 239000008194 pharmaceutical composition Substances 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 9
- 125000002252 acyl group Chemical group 0.000 description 8
- 230000003042 antagnostic Effects 0.000 description 8
- LKYXEULZVGJVTG-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH] LKYXEULZVGJVTG-UHFFFAOYSA-N 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- CKJNUZNMWOVDFN-UHFFFAOYSA-N methanone Chemical compound O=[CH-] CKJNUZNMWOVDFN-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L mgso4 Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 125000003003 spiro group Chemical group 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 102000009523 Transcription Factor 4 Human genes 0.000 description 7
- 108010048992 Transcription Factor 4 Proteins 0.000 description 7
- 125000003342 alkenyl group Chemical group 0.000 description 7
- 230000000202 analgesic Effects 0.000 description 7
- 239000005557 antagonist Substances 0.000 description 7
- 125000003710 aryl alkyl group Chemical group 0.000 description 7
- 210000002569 neurons Anatomy 0.000 description 7
- 239000011664 nicotinic acid Substances 0.000 description 7
- 229940021182 non-steroidal anti-inflammatory drugs Drugs 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N Oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating Effects 0.000 description 6
- 125000000304 alkynyl group Chemical group 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N cdcl3 Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000002552 dosage form Substances 0.000 description 6
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 6
- 235000001968 nicotinic acid Nutrition 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 125000003107 substituted aryl group Chemical group 0.000 description 6
- 239000011593 sulfur Substances 0.000 description 6
- 229940035676 ANALGESICS Drugs 0.000 description 5
- 210000004556 Brain Anatomy 0.000 description 5
- 210000001428 Peripheral Nervous System Anatomy 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 239000000730 antalgic agent Substances 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M buffer Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 125000004433 nitrogen atoms Chemical group N* 0.000 description 5
- 150000007524 organic acids Chemical class 0.000 description 5
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 5
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 5
- 239000000651 prodrug Substances 0.000 description 5
- 229940002612 prodrugs Drugs 0.000 description 5
- 239000002464 receptor antagonist Substances 0.000 description 5
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 5
- 125000004434 sulfur atoms Chemical group 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N (E)-but-2-enedioate;hydron Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- HUCVOHYBFXVBRW-UHFFFAOYSA-M Caesium hydroxide Chemical compound [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 4
- 210000003169 Central Nervous System Anatomy 0.000 description 4
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapen Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 description 4
- 210000003594 Ganglia, Spinal Anatomy 0.000 description 4
- JKMHFZQWWAIEOD-UHFFFAOYSA-N HEPES Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 4
- KQNPFQTWMSNSAP-UHFFFAOYSA-N Isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- 241000283984 Rodentia Species 0.000 description 4
- VGKDLMBJGBXTGI-SJCJKPOMSA-N Sertraline Chemical compound C1([C@@H]2CC[C@@H](C3=CC=CC=C32)NC)=CC=C(Cl)C(Cl)=C1 VGKDLMBJGBXTGI-SJCJKPOMSA-N 0.000 description 4
- TYFQFVWCELRYAO-UHFFFAOYSA-N Suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- 229960002372 Tetracaine Drugs 0.000 description 4
- GKCBAIGFKIBETG-UHFFFAOYSA-N Tetracaine Chemical compound CCCCNC1=CC=C(C(=O)OCCN(C)C)C=C1 GKCBAIGFKIBETG-UHFFFAOYSA-N 0.000 description 4
- CFMYXEVWODSLAX-QOZOJKKESA-N Tetrodotoxin Chemical compound O([C@@]([C@H]1O)(O)O[C@H]2[C@@]3(O)CO)[C@H]3[C@@H](O)[C@]11[C@H]2[C@@H](O)N=C(N)N1 CFMYXEVWODSLAX-QOZOJKKESA-N 0.000 description 4
- 229950010357 Tetrodotoxin Drugs 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 125000003282 alkyl amino group Chemical group 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 150000001413 amino acids Chemical class 0.000 description 4
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 230000027455 binding Effects 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N fumaric acid Chemical compound OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- 229960002870 gabapentin Drugs 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000004474 heteroalkylene group Chemical group 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 230000000670 limiting Effects 0.000 description 4
- 125000005647 linker group Chemical group 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000006011 modification reaction Methods 0.000 description 4
- 230000001264 neutralization Effects 0.000 description 4
- 125000004430 oxygen atoms Chemical group O* 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 235000021251 pulses Nutrition 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- 239000011550 stock solution Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 230000001225 therapeutic Effects 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- RMSKYTKOFDQVEL-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(C(F)(F)F)=CN=C1Cl RMSKYTKOFDQVEL-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- WDRJNKMAZMEYOF-UHFFFAOYSA-N 4-(trifluoromethoxy)phenol Chemical compound OC1=CC=C(OC(F)(F)F)C=C1 WDRJNKMAZMEYOF-UHFFFAOYSA-N 0.000 description 3
- FBPZVYHRKMIAKN-UHFFFAOYSA-N 4-chloro-6-(trifluoromethyl)pyridine-3-carbaldehyde Chemical compound FC(F)(F)C1=CC(Cl)=C(C=O)C=N1 FBPZVYHRKMIAKN-UHFFFAOYSA-N 0.000 description 3
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- DQWLHBJNNKQNSY-UHFFFAOYSA-N BrC=1C=C(C(=NC=1)OC1=C(C=C(C=C1)F)OC)C(=O)O Chemical compound BrC=1C=C(C(=NC=1)OC1=C(C=C(C=C1)F)OC)C(=O)O DQWLHBJNNKQNSY-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate dianion Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- WSEQXVZVJXJVFP-UHFFFAOYSA-N Citalopram Chemical compound O1CC2=CC(C#N)=CC=C2C1(CCCN(C)C)C1=CC=C(F)C=C1 WSEQXVZVJXJVFP-UHFFFAOYSA-N 0.000 description 3
- CUDDNNSUXBRXNW-UHFFFAOYSA-N ClC1=NC=C(C=C1C(=O)NC1=CC(=CC=C1)S(=O)(=O)C)[N+](=O)[O-] Chemical compound ClC1=NC=C(C=C1C(=O)NC1=CC(=CC=C1)S(=O)(=O)C)[N+](=O)[O-] CUDDNNSUXBRXNW-UHFFFAOYSA-N 0.000 description 3
- MKXZASYAUGDDCJ-SZMVWBNQSA-N Dextromethorphan Chemical compound C1CCC[C@H]2[C@@]3([H])N(C)CC[C@]21C1=CC(OC)=CC=C1C3 MKXZASYAUGDDCJ-SZMVWBNQSA-N 0.000 description 3
- 229960001985 Dextromethorphan Drugs 0.000 description 3
- 241000283086 Equidae Species 0.000 description 3
- ARMIKJIRBALNMN-UHFFFAOYSA-N FC(OC1=CC=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=C1)(F)F Chemical compound FC(OC1=CC=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=C1)(F)F ARMIKJIRBALNMN-UHFFFAOYSA-N 0.000 description 3
- GDIJDGNOZUMRHQ-UHFFFAOYSA-N FC1=CC(=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=C1)OC Chemical compound FC1=CC(=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=C1)OC GDIJDGNOZUMRHQ-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 229940014259 Gelatin Drugs 0.000 description 3
- 229940049906 Glutamate Drugs 0.000 description 3
- 239000007995 HEPES buffer Substances 0.000 description 3
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 3
- 229940040692 Lithium Hydroxide Monohydrate Drugs 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N Meta-Chloroperoxybenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- 210000000449 Purkinje Cells Anatomy 0.000 description 3
- 210000002265 Sensory Receptor Cells Anatomy 0.000 description 3
- 229960002073 Sertraline Drugs 0.000 description 3
- 241000282887 Suidae Species 0.000 description 3
- TVYLLZQTGLZFBW-ZBFHGGJFSA-N Tramadol Chemical compound COC1=CC=CC([C@]2(O)[C@H](CCCC2)CN(C)C)=C1 TVYLLZQTGLZFBW-ZBFHGGJFSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000036982 action potential Effects 0.000 description 3
- 239000000556 agonist Substances 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 150000003857 carboxamides Chemical class 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 description 3
- 125000004663 dialkyl amino group Chemical group 0.000 description 3
- 231100000673 dose–response relationship Toxicity 0.000 description 3
- 230000002708 enhancing Effects 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000010304 firing Methods 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 230000002779 inactivation Effects 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000005342 ion exchange Methods 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 238000010172 mouse model Methods 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 150000002829 nitrogen Chemical group 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- 239000003195 sodium channel blocking agent Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 125000005309 thioalkoxy group Chemical group 0.000 description 3
- 239000002023 wood Substances 0.000 description 3
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- AYXYPKUFHZROOJ-ZETCQYMHSA-N (3S)-3-(aminomethyl)-5-methylhexanoic acid Chemical compound CC(C)C[C@H](CN)CC(O)=O AYXYPKUFHZROOJ-ZETCQYMHSA-N 0.000 description 2
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 2
- IPGAFOVEIIWXFR-UHFFFAOYSA-N 2,3,5-trimethyl-6-(pyridin-3-ylmethyl)cyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C(C)=C(C)C(=O)C(CC=2C=NC=CC=2)=C1C IPGAFOVEIIWXFR-UHFFFAOYSA-N 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K 2qpq Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
- GKQDDKKGDIVDAG-UHFFFAOYSA-N 4-fluoro-2-methylphenol Chemical compound CC1=CC(F)=CC=C1O GKQDDKKGDIVDAG-UHFFFAOYSA-N 0.000 description 2
- YJISHJVIRFPGGN-UHFFFAOYSA-N 5-[5-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy-6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxymethyl]-3,4-dihydroxyoxan-2-yl]oxy-6-(hydroxymethyl)-2-methyloxane-3,4-diol Chemical compound O1C(CO)C(OC)C(O)C(O)C1OCC1C(OC2C(C(O)C(OC)C(CO)O2)O)C(O)C(O)C(OC2C(OC(C)C(O)C2O)CO)O1 YJISHJVIRFPGGN-UHFFFAOYSA-N 0.000 description 2
- 206010001497 Agitation Diseases 0.000 description 2
- 206010003805 Autism Diseases 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N Benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- SNPPWIUOZRMYNY-UHFFFAOYSA-N Bupropion Chemical compound CC(C)(C)NC(C)C(=O)C1=CC=CC(Cl)=C1 SNPPWIUOZRMYNY-UHFFFAOYSA-N 0.000 description 2
- BZDJKOFCZAIGJU-UHFFFAOYSA-N C1(CC1)C=1C=C(C(=NC=1)OC1=C(C=C(C=C1)F)OC)C(=O)O Chemical compound C1(CC1)C=1C=C(C(=NC=1)OC1=C(C=C(C=C1)F)OC)C(=O)O BZDJKOFCZAIGJU-UHFFFAOYSA-N 0.000 description 2
- AIYUHDOJVYHVIT-UHFFFAOYSA-M Caesium chloride Chemical compound [Cl-].[Cs+] AIYUHDOJVYHVIT-UHFFFAOYSA-M 0.000 description 2
- DSSYKIVIOFKYAU-UHFFFAOYSA-N Camphor Chemical compound C1CC2(C)C(=O)CC1C2(C)C DSSYKIVIOFKYAU-UHFFFAOYSA-N 0.000 description 2
- 229960000846 Camphor Drugs 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- 241000283707 Capra Species 0.000 description 2
- YKPUWZUDDOIDPM-SOFGYWHQSA-N Capsaicin Chemical compound COC1=CC(CNC(=O)CCCC\C=C\C(C)C)=CC=C1O YKPUWZUDDOIDPM-SOFGYWHQSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N Carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 210000001638 Cerebellum Anatomy 0.000 description 2
- TVFDJXOCXUVLDH-UHFFFAOYSA-N Cesium Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 2
- 241000723346 Cinnamomum camphora Species 0.000 description 2
- CELFJPRQADAONA-UHFFFAOYSA-N ClC1=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=CC(=C1)OC(F)(F)F Chemical compound ClC1=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=CC(=C1)OC(F)(F)F CELFJPRQADAONA-UHFFFAOYSA-N 0.000 description 2
- GDLIGKIOYRNHDA-UHFFFAOYSA-N Clomipramine Chemical compound C1CC2=CC=C(Cl)C=C2N(CCCN(C)C)C2=CC=CC=C21 GDLIGKIOYRNHDA-UHFFFAOYSA-N 0.000 description 2
- OROGSEYTTFOCAN-DNJOTXNNSA-N Codeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC OROGSEYTTFOCAN-DNJOTXNNSA-N 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L Copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- AEMOLEFTQBMNLQ-YMDCURPLSA-N D-Galacturonic acid Chemical compound OC1O[C@H](C(O)=O)[C@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-YMDCURPLSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N D-Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- ZEUITGRIYCTCEM-KRWDZBQOSA-N Duloxetine Chemical compound C1([C@@H](OC=2C3=CC=CC=C3C=CC=2)CCNC)=CC=CS1 ZEUITGRIYCTCEM-KRWDZBQOSA-N 0.000 description 2
- 239000012594 Earle’s Balanced Salt Solution Substances 0.000 description 2
- CBQGYUDMJHNJBX-OALUTQOASA-N Esreboxetine Chemical compound CCOC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 CBQGYUDMJHNJBX-OALUTQOASA-N 0.000 description 2
- SKJAVPQMOAMMTI-UHFFFAOYSA-N FC1=CC(=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=C1)OC Chemical compound FC1=CC(=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=C1)OC SKJAVPQMOAMMTI-UHFFFAOYSA-N 0.000 description 2
- 229960002464 Fluoxetine Drugs 0.000 description 2
- 229940097043 Glucuronic Acid Drugs 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 2
- JXEHXYFSIOYTAH-SFYZADRCSA-N Imagabalin Chemical compound CCC[C@@H](C)C[C@H](N)CC(O)=O JXEHXYFSIOYTAH-SFYZADRCSA-N 0.000 description 2
- BCGWQEUPMDMJNV-UHFFFAOYSA-N Imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N Indometacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- VPPJLAIAVCUEMN-GFCCVEGCSA-N Lacosamide Chemical compound COC[C@@H](NC(C)=O)C(=O)NCC1=CC=CC=C1 VPPJLAIAVCUEMN-GFCCVEGCSA-N 0.000 description 2
- GUBGYTABKSRVRQ-UUNJERMWSA-N Lactose Natural products O([C@@H]1[C@H](O)[C@H](O)[C@H](O)O[C@@H]1CO)[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](CO)O1 GUBGYTABKSRVRQ-UUNJERMWSA-N 0.000 description 2
- 229960005015 Local anesthetics Drugs 0.000 description 2
- 229940083877 Local anesthetics for treatment of hemorrhoids and anal fissures for topical use Drugs 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N Mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
- SLVMESMUVMCQIY-UHFFFAOYSA-N Mesoridazine Chemical compound CN1CCCCC1CCN1C2=CC(S(C)=O)=CC=C2SC2=CC=CC=C21 SLVMESMUVMCQIY-UHFFFAOYSA-N 0.000 description 2
- 229960000300 Mesoridazine Drugs 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L MgCl2 Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N Morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- RTHCYVBBDHJXIQ-UHFFFAOYSA-N N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine Chemical compound C=1C=CC=CC=1C(CCNC)OC1=CC=C(C(F)(F)F)C=C1 RTHCYVBBDHJXIQ-UHFFFAOYSA-N 0.000 description 2
- XBXCNNQPRYLIDE-UHFFFAOYSA-M N-tert-butylcarbamate Chemical group CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 2
- UZHSEJADLWPNLE-GRGSLBFTSA-N Naloxone Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(O)C2=C5[C@@]13CCN4CC=C UZHSEJADLWPNLE-GRGSLBFTSA-N 0.000 description 2
- 229960004127 Naloxone Drugs 0.000 description 2
- CMWTZPSULFXXJA-VIFPVBQESA-N Naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 2
- 210000000929 Nociceptors Anatomy 0.000 description 2
- 229960002748 Norepinephrine Drugs 0.000 description 2
- 241000283898 Ovis Species 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N P-Toluenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 102100015381 PTGS2 Human genes 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N Phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 102000001708 Protein Isoforms Human genes 0.000 description 2
- 108010029485 Protein Isoforms Proteins 0.000 description 2
- 206010037175 Psychiatric disease Diseases 0.000 description 2
- JUOSGGQXEBBCJB-GORDUTHDSA-N Rivanicline Chemical compound CNCC\C=C\C1=CC=CN=C1 JUOSGGQXEBBCJB-GORDUTHDSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M Sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L Sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 208000006011 Stroke Diseases 0.000 description 2
- KWTWDQCKEHXFFR-SMDDNHRTSA-N Tapentadol Chemical compound CN(C)C[C@H](C)[C@@H](CC)C1=CC=CC(O)=C1 KWTWDQCKEHXFFR-SMDDNHRTSA-N 0.000 description 2
- MKTAGSRKQIGEBH-SSDOTTSWSA-N Tebanicline Chemical compound C1=NC(Cl)=CC=C1OC[C@@H]1NCC1 MKTAGSRKQIGEBH-SSDOTTSWSA-N 0.000 description 2
- KJADKKWYZYXHBB-XBWDGYHZSA-N Topiramic acid Chemical compound C1O[C@@]2(COS(N)(=O)=O)OC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 KJADKKWYZYXHBB-XBWDGYHZSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N Trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K Tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- NNJVILVZKWQKPM-UHFFFAOYSA-N Xylocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 230000035507 absorption Effects 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 230000000996 additive Effects 0.000 description 2
- 230000001058 adult Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000001773 anti-convulsant Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 2
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- 201000002055 autistic disease Diseases 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 230000000903 blocking Effects 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L cacl2 Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- 229910052792 caesium Inorganic materials 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229930007890 camphor Natural products 0.000 description 2
- 229960002504 capsaicin Drugs 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000004517 catalytic hydrocracking Methods 0.000 description 2
- 230000002490 cerebral Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229960001653 citalopram Drugs 0.000 description 2
- 229960004106 citric acid Drugs 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- ZPUCINDJVBIVPJ-BARDWOONSA-N cocaine Natural products O([C@@H]1C[C@H]2CC[C@H](N2C)[C@@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-BARDWOONSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- 230000002999 depolarising Effects 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N deuterium Chemical group [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- 239000002027 dichloromethane extract Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 2
- QGFRSPMTVBPWNK-UHFFFAOYSA-N dilithium;oxygen(2-);hydrate Chemical compound [Li+].[Li+].O.[O-2] QGFRSPMTVBPWNK-UHFFFAOYSA-N 0.000 description 2
- 229960002866 duloxetine Drugs 0.000 description 2
- 230000005014 ectopic expression Effects 0.000 description 2
- 229940009662 edetate Drugs 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N edta Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000003821 enantio-separation Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 230000002068 genetic Effects 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 2
- 229960001680 ibuprofen Drugs 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229960004801 imipramine Drugs 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229960002623 lacosamide Drugs 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 229960004194 lidocaine Drugs 0.000 description 2
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 2
- 239000003589 local anesthetic agent Substances 0.000 description 2
- 229940064003 local anesthetic throat preparations Drugs 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-L maleate(2-) Chemical compound [O-]C(=O)\C=C/C([O-])=O VZCYOOQTPOCHFL-UPHRSURJSA-L 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 229960002510 mandelic acid Drugs 0.000 description 2
- 239000002609 media Substances 0.000 description 2
- 239000002207 metabolite Substances 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 2
- LYQIYWXYYOFZHD-UHFFFAOYSA-N methyl 2-chloro-5-cyclopropylpyridine-3-carboxylate Chemical compound N1=C(Cl)C(C(=O)OC)=CC(C2CC2)=C1 LYQIYWXYYOFZHD-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229960005181 morphine Drugs 0.000 description 2
- 229930014694 morphine Natural products 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 230000035772 mutation Effects 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229960002009 naproxen Drugs 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- 230000003040 nociceptive Effects 0.000 description 2
- 108091008022 nociceptors Proteins 0.000 description 2
- 230000003000 nontoxic Effects 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 239000002767 noradrenalin uptake inhibitor Substances 0.000 description 2
- 230000003364 opioid Effects 0.000 description 2
- 230000003287 optical Effects 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 230000001575 pathological Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-L phosphate Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 2
- 230000004962 physiological condition Effects 0.000 description 2
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical class NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 2
- 239000001184 potassium carbonate Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229960001233 pregabalin Drugs 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 230000001681 protective Effects 0.000 description 2
- 239000000018 receptor agonist Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000001953 sensory Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 229940086735 succinate Drugs 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 239000011885 synergistic combination Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 229960005126 tapentadol Drugs 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 229960001367 tartaric acid Drugs 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 210000001519 tissues Anatomy 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- 229960004394 topiramate Drugs 0.000 description 2
- 125000004954 trialkylamino group Chemical group 0.000 description 2
- YZCKVEUIGOORGS-NJFSPNSNSA-N tritium Chemical group [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 2
- 229910052722 tritium Chemical group 0.000 description 2
- PNVNVHUZROJLTJ-UHFFFAOYSA-N venlafaxine Chemical compound C1=CC(OC)=CC=C1C(CN(C)C)C1(O)CCCCC1 PNVNVHUZROJLTJ-UHFFFAOYSA-N 0.000 description 2
- AEMOLEFTQBMNLQ-QIUUJYRFSA-N β-D-glucuronic acid Chemical compound O[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-QIUUJYRFSA-N 0.000 description 2
- PTJADDMMFYXMMG-LJQANCHMSA-N (1R)-1-(4-fluorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile Chemical compound C1([C@@]2(C3=CC=C(C=C3CO2)C#N)CCCNC)=CC=C(F)C=C1 PTJADDMMFYXMMG-LJQANCHMSA-N 0.000 description 1
- NWBJAUFHPXRBKI-QMMMGPOBSA-N (2R)-2-amino-3-[2-(1-aminoethylideneamino)ethylsulfanyl]-2-methylpropanoic acid Chemical compound CC(=N)NCCSC[C@](C)(N)C(O)=O NWBJAUFHPXRBKI-QMMMGPOBSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2R,3R,4S,5R,6S)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2R,3R,4S,5R,6R)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- CCIWVEMVBWEMCY-RCFOMQFPSA-N (2S)-1-[(3aS,4S,7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(2-methoxyphenyl)propan-1-one Chemical compound COC1=CC=CC=C1[C@H](C)C(=O)N1C[C@H](C(CC[C@@]2(O)C=3C(=CC=CC=3)OC)(C=3C=CC=CC=3)C=3C=CC=CC=3)[C@H]2C1 CCIWVEMVBWEMCY-RCFOMQFPSA-N 0.000 description 1
- MOLOJNHYNHBPCW-ZETCQYMHSA-N (2S)-2-amino-4-[2-(1-aminoethylideneamino)ethylsulfanyl]butanoic acid Chemical compound CC(=N)NCCSCC[C@H](N)C(O)=O MOLOJNHYNHBPCW-ZETCQYMHSA-N 0.000 description 1
- RGFRGRZSMVXTLF-ONGXEEELSA-N (2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)C[C@@H]1CC1=CC=CC(F)=C1 RGFRGRZSMVXTLF-ONGXEEELSA-N 0.000 description 1
- HABFKEHJAQDXFD-UHFFFAOYSA-N (3-methyl-4-propan-2-yloxyphenyl)-[6-(trifluoromethyl)spiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-1'-yl]methanone Chemical compound C1=C(C)C(OC(C)C)=CC=C1C(=O)N1CCC2(C3=CC=C(N3CCN2)C(F)(F)F)CC1 HABFKEHJAQDXFD-UHFFFAOYSA-N 0.000 description 1
- DVOOWDFPPNOBFV-UHFFFAOYSA-N (3E)-penta-1,3-diene Chemical group C=C[CH]C=C DVOOWDFPPNOBFV-UHFFFAOYSA-N 0.000 description 1
- GWLVNOAPYJMHQV-BWZBUEFSSA-N (3R,4R,5R)-3-amino-4,5-dimethylheptanoic acid Chemical compound CC[C@@H](C)[C@@H](C)[C@H](N)CC(O)=O GWLVNOAPYJMHQV-BWZBUEFSSA-N 0.000 description 1
- HLISOYNJVMWYQM-IWSPIJDZSA-N (3R,4R,5R)-3-amino-4,5-dimethyloctanoic acid Chemical compound CCC[C@@H](C)[C@@H](C)[C@H](N)CC(O)=O HLISOYNJVMWYQM-IWSPIJDZSA-N 0.000 description 1
- SIRQBZJUYVPMIC-SFYZADRCSA-N (3S,5R)-3-(aminomethyl)-5-methylheptanoic acid Chemical compound CC[C@@H](C)C[C@H](CN)CC(O)=O SIRQBZJUYVPMIC-SFYZADRCSA-N 0.000 description 1
- KKXFMWXZXDUYBF-BDAKNGLRSA-N (3S,5R)-3-(aminomethyl)-5-methyloctanoic acid Chemical compound CCC[C@@H](C)C[C@H](CN)CC(O)=O KKXFMWXZXDUYBF-BDAKNGLRSA-N 0.000 description 1
- GUEQOLSQPOTTME-RQJHMYQMSA-N (3S,5R)-3-amino-5-methylheptanoic acid Chemical compound CC[C@@H](C)C[C@H](N)CC(O)=O GUEQOLSQPOTTME-RQJHMYQMSA-N 0.000 description 1
- XKWDZEJCUWTBOM-BDAKNGLRSA-N (3S,5R)-3-amino-5-methylnonanoic acid Chemical compound CCCC[C@@H](C)C[C@H](N)CC(O)=O XKWDZEJCUWTBOM-BDAKNGLRSA-N 0.000 description 1
- OQANPHBRHBJGNZ-BKUYFWCQSA-N (3Z)-6-oxo-3-[[4-(pyridin-2-ylsulfamoyl)phenyl]hydrazinylidene]cyclohexa-1,4-diene-1-carboxylic acid Chemical compound C1=CC(=O)C(C(=O)O)=C\C1=N/NC1=CC=C(S(=O)(=O)NC=2N=CC=CC=2)C=C1 OQANPHBRHBJGNZ-BKUYFWCQSA-N 0.000 description 1
- HXTGXYRHXAGCFP-OAQYLSRUSA-N (R)-(2,3-dimethoxyphenyl)-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol Chemical compound COC1=CC=CC([C@H](O)C2CCN(CCC=3C=CC(F)=CC=3)CC2)=C1OC HXTGXYRHXAGCFP-OAQYLSRUSA-N 0.000 description 1
- CRPTXKKKIGGDBX-UHFFFAOYSA-N (Z)-but-2-ene Chemical group [CH2]C=CC CRPTXKKKIGGDBX-UHFFFAOYSA-N 0.000 description 1
- GSMCDXGKZOUAET-UHFFFAOYSA-N (Z)-pent-2-ene Chemical group C[CH]C=CC GSMCDXGKZOUAET-UHFFFAOYSA-N 0.000 description 1
- XRYVIWRHMIMIDT-ATPLWMGHSA-N (Z,2S)-2-amino-7-(1-aminoethylideneamino)-2-methylhept-5-enoic acid Chemical compound CC(=N)NC\C=C/CC[C@](C)(N)C(O)=O XRYVIWRHMIMIDT-ATPLWMGHSA-N 0.000 description 1
- MGNZXYYWBUKAII-UHFFFAOYSA-N 1,3-Cyclohexadiene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QEMSVZNTSXPFJA-HNAYVOBHSA-N 1-[(1S,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol Chemical compound C1([C@H](O)[C@H](C)N2CCC(O)(CC2)C=2C=CC=CC=2)=CC=C(O)C=C1 QEMSVZNTSXPFJA-HNAYVOBHSA-N 0.000 description 1
- KMNLXCBYBKHKSK-BKMJKUGQSA-N 1-[(3S,4R)-4-hydroxy-3-[(4-phenylphenyl)methyl]-3,4-dihydro-2H-chromen-7-yl]cyclopentane-1-carboxylic acid Chemical compound C([C@@H]1[C@H](C2=CC=C(C=C2OC1)C1(CCCC1)C(O)=O)O)C(C=C1)=CC=C1C1=CC=CC=C1 KMNLXCBYBKHKSK-BKMJKUGQSA-N 0.000 description 1
- KMNLXCBYBKHKSK-UHFFFAOYSA-N 1-[4-hydroxy-3-[(4-phenylphenyl)methyl]-3,4-dihydro-2H-chromen-7-yl]cyclopentane-1-carboxylic acid Chemical compound C1OC2=CC(C3(CCCC3)C(O)=O)=CC=C2C(O)C1CC(C=C1)=CC=C1C1=CC=CC=C1 KMNLXCBYBKHKSK-UHFFFAOYSA-N 0.000 description 1
- QRADKVYIJIAENZ-UHFFFAOYSA-N 1-[[bromo(difluoro)methyl]-ethoxyphosphoryl]oxyethane Chemical compound CCOP(=O)(C(F)(F)Br)OCC QRADKVYIJIAENZ-UHFFFAOYSA-N 0.000 description 1
- WCIFVXNIHUSTHF-UHFFFAOYSA-N 1-bromopropane Chemical group [CH2]CCBr WCIFVXNIHUSTHF-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-M 1-carboxynaphthalen-2-olate Chemical compound C1=CC=CC2=C(C([O-])=O)C(O)=CC=C21 UPHOPMSGKZNELG-UHFFFAOYSA-M 0.000 description 1
- BYLAWYTWAYOBDP-UHFFFAOYSA-N 1-chlorobutane Chemical group [CH2]CCCCl BYLAWYTWAYOBDP-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- QMNWYGTWTXOQTP-UHFFFAOYSA-N 1H-triazin-6-one Chemical compound O=C1C=CN=NN1 QMNWYGTWTXOQTP-UHFFFAOYSA-N 0.000 description 1
- VGJWVEYTYIBXIA-UHFFFAOYSA-N 2,2,2-trifluoroethane-1,1-diol Chemical compound OC(O)C(F)(F)F VGJWVEYTYIBXIA-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- NVWVWEWVLBKPSM-UHFFFAOYSA-N 2,4-difluorophenol Chemical compound OC1=CC=C(F)C=C1F NVWVWEWVLBKPSM-UHFFFAOYSA-N 0.000 description 1
- MNVMYTVDDOXZLS-UHFFFAOYSA-N 2,4-dimethoxyphenol Chemical compound COC1=CC=C(O)C(OC)=C1 MNVMYTVDDOXZLS-UHFFFAOYSA-N 0.000 description 1
- SXQSMLIMBNMUNB-UHFFFAOYSA-N 2,5-dichloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=CN=C1Cl SXQSMLIMBNMUNB-UHFFFAOYSA-N 0.000 description 1
- JHMHYTKDALCQSZ-UHFFFAOYSA-N 2,6-dichloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)N=C1Cl JHMHYTKDALCQSZ-UHFFFAOYSA-N 0.000 description 1
- GJSURZIOUXUGAL-UHFFFAOYSA-N 2-((2,6-Dichlorophenyl)imino)imidazolidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- WOFZRBCITDVRON-UHFFFAOYSA-N 2-Chloro-5-nitronicotinic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CN=C1Cl WOFZRBCITDVRON-UHFFFAOYSA-N 0.000 description 1
- MTQLMFXHGFWFIX-UHFFFAOYSA-N 2-N,2-N-dimethylpyridine-2,4-diamine Chemical compound CN(C)C1=CC(N)=CC=N1 MTQLMFXHGFWFIX-UHFFFAOYSA-N 0.000 description 1
- HIMGQYNKYSNTGS-WCQYABFASA-N 2-[(1R,3S)-3-amino-4-hydroxy-1-(1,3-thiazol-5-yl)butyl]sulfanyl-4-chlorobenzonitrile Chemical compound S([C@H](C[C@@H](CO)N)C=1SC=NC=1)C1=CC(Cl)=CC=C1C#N HIMGQYNKYSNTGS-WCQYABFASA-N 0.000 description 1
- IRMTXMJNHRISQH-UHFFFAOYSA-N 2-[2-[2-(diaminomethylideneamino)ethyldisulfanyl]ethyl]guanidine Chemical compound NC(N)=NCCSSCCN=C(N)N IRMTXMJNHRISQH-UHFFFAOYSA-N 0.000 description 1
- VUKAUDKDFVSVFT-UHFFFAOYSA-N 2-[6-[4,5-bis(2-hydroxypropoxy)-2-(2-hydroxypropoxymethyl)-6-methoxyoxan-3-yl]oxy-4,5-dimethoxy-2-(methoxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol Chemical compound COC1C(OC)C(OC2C(C(O)C(OC)C(CO)O2)O)C(COC)OC1OC1C(COCC(C)O)OC(OC)C(OCC(C)O)C1OCC(C)O VUKAUDKDFVSVFT-UHFFFAOYSA-N 0.000 description 1
- XKSAJZSJKURQRX-UHFFFAOYSA-N 2-acetyloxy-5-(4-fluorophenyl)benzoic acid Chemical compound C1=C(C(O)=O)C(OC(=O)C)=CC=C1C1=CC=C(F)C=C1 XKSAJZSJKURQRX-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- LSTYNKXVEMLNBE-UHFFFAOYSA-N 2-chloro-4-(trifluoromethoxy)phenol Chemical compound OC1=CC=C(OC(F)(F)F)C=C1Cl LSTYNKXVEMLNBE-UHFFFAOYSA-N 0.000 description 1
- CEQQAPUZEUIPCH-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridine-3-carbonyl chloride Chemical compound FC(F)(F)C1=CN=C(Cl)C(C(Cl)=O)=C1 CEQQAPUZEUIPCH-UHFFFAOYSA-N 0.000 description 1
- NERLVPPFPICRNA-UHFFFAOYSA-N 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid Chemical compound N1=C(Cl)C(C(=O)O)=CC2=C1CCC2 NERLVPPFPICRNA-UHFFFAOYSA-N 0.000 description 1
- DXRBTBMFFGEVCX-UHFFFAOYSA-N 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=C(C(F)(F)F)N=C1Cl DXRBTBMFFGEVCX-UHFFFAOYSA-N 0.000 description 1
- ACQXHCHKMFYDPM-UHFFFAOYSA-N 2-chloro-6-methylpyridine-3-carboxylic acid Chemical compound CC1=CC=C(C(O)=O)C(Cl)=N1 ACQXHCHKMFYDPM-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- SVEQHRSELNPKJJ-UHFFFAOYSA-N 2-methoxypyridin-4-amine Chemical compound COC1=CC(N)=CC=N1 SVEQHRSELNPKJJ-UHFFFAOYSA-N 0.000 description 1
- KLGMTAAMYJGDAW-UHFFFAOYSA-N 2-methyl-6-(trifluoromethyl)spiro[3,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine] Chemical compound CN1CCN2C(C(F)(F)F)=CC=C2C11CCNCC1 KLGMTAAMYJGDAW-UHFFFAOYSA-N 0.000 description 1
- JRYYVMDEUJQWRO-UHFFFAOYSA-N 2-methylnicotinamide Chemical compound CC1=NC=CC=C1C(N)=O JRYYVMDEUJQWRO-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- BIGWXAGEQONZGD-UHFFFAOYSA-N 2H-oxadiazol-5-one Chemical compound O=C1C=NNO1 BIGWXAGEQONZGD-UHFFFAOYSA-N 0.000 description 1
- HFJUENYHSAZNIR-UHFFFAOYSA-N 3,4-dihydro-2H-thiophene Chemical group [CH]1CCCS1 HFJUENYHSAZNIR-UHFFFAOYSA-N 0.000 description 1
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-Aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-M 3-carboxy-2,3-dihydroxypropanoate Chemical class OC(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-M 0.000 description 1
- DDDOFQQYNZCQSD-UHFFFAOYSA-N 3-fluoro-2-methoxyphenol Chemical compound COC1=C(O)C=CC=C1F DDDOFQQYNZCQSD-UHFFFAOYSA-N 0.000 description 1
- TUAYUJJUGBNFHP-UHFFFAOYSA-N 3-methylsulfinylaniline Chemical compound CS(=O)C1=CC=CC(N)=C1 TUAYUJJUGBNFHP-UHFFFAOYSA-N 0.000 description 1
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- FZINIBTZNSPWQR-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC(Cl)=CC=N1 FZINIBTZNSPWQR-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- VHKBTPQDHDSBSP-UHFFFAOYSA-N 5-(4-chlorophenyl)-N-(3,5-dimethoxyphenyl)furan-2-carboxamide Chemical compound COC1=CC(OC)=CC(NC(=O)C=2OC(=CC=2)C=2C=CC(Cl)=CC=2)=C1 VHKBTPQDHDSBSP-UHFFFAOYSA-N 0.000 description 1
- KQPKPCNLIDLUMF-MRVPVSSYSA-N 5-[(2R)-pentan-2-yl]-5-prop-2-enyl-1,3-diazinane-2,4,6-trione Chemical compound CCC[C@@H](C)C1(CC=C)C(=O)NC(=O)NC1=O KQPKPCNLIDLUMF-MRVPVSSYSA-N 0.000 description 1
- YSZHWMZAKYDTCZ-UHFFFAOYSA-N 5-[2-methyl-4-[2-methyl-6-(2,2,2-trifluoroacetyl)spiro[3,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-1'-carbonyl]phenyl]pyridine-2-carbonitrile Chemical compound CN1CCN2C(C(=O)C(F)(F)F)=CC=C2C1(CC1)CCN1C(=O)C(C=C1C)=CC=C1C1=CC=C(C#N)N=C1 YSZHWMZAKYDTCZ-UHFFFAOYSA-N 0.000 description 1
- 208000005298 Acute Pain Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- XJKJWTWGDGIQRH-BFIDDRIFSA-N Alginic acid Chemical compound O1[C@@H](C(O)=O)[C@@H](OC)[C@H](O)[C@H](O)[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](C)[C@@H](O)[C@H]1O XJKJWTWGDGIQRH-BFIDDRIFSA-N 0.000 description 1
- 206010053552 Allodynia Diseases 0.000 description 1
- 229960000836 Amitriptyline Drugs 0.000 description 1
- KRMDCWKBEZIMAB-UHFFFAOYSA-N Amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 1
- 229960001301 Amobarbital Drugs 0.000 description 1
- VIROVYVQCGLCII-UHFFFAOYSA-N Amobarbital Chemical compound CC(C)CCC1(CC)C(=O)NC(=O)NC1=O VIROVYVQCGLCII-UHFFFAOYSA-N 0.000 description 1
- ATALOFNDEOCMKK-OITMNORJSA-N Aprepitant Chemical compound O([C@@H]([C@@H]1C=2C=CC(F)=CC=2)O[C@H](C)C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)CCN1CC1=NNC(=O)N1 ATALOFNDEOCMKK-OITMNORJSA-N 0.000 description 1
- UORJNBVJVRLXMQ-UHFFFAOYSA-N Aprobarbital Chemical compound C=CCC1(C(C)C)C(=O)NC(=O)NC1=O UORJNBVJVRLXMQ-UHFFFAOYSA-N 0.000 description 1
- CEUORZQYGODEFX-UHFFFAOYSA-N Aripirazole Chemical compound ClC1=CC=CC(N2CCN(CCCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1Cl CEUORZQYGODEFX-UHFFFAOYSA-N 0.000 description 1
- IUVMAUQEZFTTFB-YUMQZZPRSA-N Atagabalin Chemical compound C[C@H]1CC(CN)(CC(O)=O)C[C@@H]1C IUVMAUQEZFTTFB-YUMQZZPRSA-N 0.000 description 1
- 206010003591 Ataxia Diseases 0.000 description 1
- VHGCDTVCOLNTBX-QGZVFWFLSA-N Atomoxetine Chemical compound O([C@H](CCNC)C=1C=CC=CC=1)C1=CC=CC=C1C VHGCDTVCOLNTBX-QGZVFWFLSA-N 0.000 description 1
- KPYSYYIEGFHWSV-UHFFFAOYSA-N Baclofen Chemical compound OC(=O)CC(CN)C1=CC=C(Cl)C=C1 KPYSYYIEGFHWSV-UHFFFAOYSA-N 0.000 description 1
- 229960000794 Baclofen Drugs 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N Barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L Barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 1
- 230000036912 Bioavailability Effects 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- MBDNCUMDSCAALE-UHFFFAOYSA-N BrC=1C(=NC=C(C=1)OC(F)F)OC1=C(C=C(C=C1)F)OC Chemical compound BrC=1C(=NC=C(C=1)OC(F)F)OC1=C(C=C(C=C1)F)OC MBDNCUMDSCAALE-UHFFFAOYSA-N 0.000 description 1
- QIHLUZAFSSMXHQ-UHFFFAOYSA-N Budipine Chemical compound C1CN(C(C)(C)C)CCC1(C=1C=CC=CC=1)C1=CC=CC=C1 QIHLUZAFSSMXHQ-UHFFFAOYSA-N 0.000 description 1
- 229960002452 Budipine Drugs 0.000 description 1
- ZRIHAIZYIMGOAB-UHFFFAOYSA-N Butabarbital Chemical compound CCC(C)C1(CC)C(=O)NC(=O)NC1=O ZRIHAIZYIMGOAB-UHFFFAOYSA-N 0.000 description 1
- IFKLAQQSCNILHL-QHAWAJNXSA-N Butorphanol Chemical compound N1([C@@H]2CC3=CC=C(C=C3[C@@]3([C@]2(CCCC3)O)CC1)O)CC1CCC1 IFKLAQQSCNILHL-QHAWAJNXSA-N 0.000 description 1
- 229960001113 Butorphanol Drugs 0.000 description 1
- BLTFNUUYKICYHH-UHFFFAOYSA-N C(#N)C=1C=C(C(=NC=1C)OC1=C(C=C(C=C1)F)OC)C(=O)O Chemical compound C(#N)C=1C=C(C(=NC=1C)OC1=C(C=C(C=C1)F)OC)C(=O)O BLTFNUUYKICYHH-UHFFFAOYSA-N 0.000 description 1
- ZFGMXPMXECHGJX-UHFFFAOYSA-N C(#N)C=1C=C(C(=NC=1C)OC1=C(C=C(C=C1)F)OC)C(=O)OCC Chemical compound C(#N)C=1C=C(C(=NC=1C)OC1=C(C=C(C=C1)F)OC)C(=O)OCC ZFGMXPMXECHGJX-UHFFFAOYSA-N 0.000 description 1
- DNPMPJQYFQVYAZ-BBWFWOEESA-N C1CCC[C@H]2[C@]3([H])NCC[C@@]21C1=CC=CC(C)=C1C3 Chemical compound C1CCC[C@H]2[C@]3([H])NCC[C@@]21C1=CC=CC(C)=C1C3 DNPMPJQYFQVYAZ-BBWFWOEESA-N 0.000 description 1
- 229940030609 CALCIUM CHANNEL BLOCKERS Drugs 0.000 description 1
- 102100000129 CHURC1 Human genes 0.000 description 1
- 101710014631 CHURC1 Proteins 0.000 description 1
- 101700020356 CREG1 Proteins 0.000 description 1
- YQEZLKZALYSWHR-UHFFFAOYSA-N Calypsol Chemical compound C=1C=CC=C(Cl)C=1C1(NC)CCCCC1=O YQEZLKZALYSWHR-UHFFFAOYSA-N 0.000 description 1
- QHMBSVQNZZTUGM-ZWKOTPCHSA-N Cannabidiol Chemical compound OC1=CC(CCCCC)=CC(O)=C1[C@H]1[C@H](C(C)=C)CCC(C)=C1 QHMBSVQNZZTUGM-ZWKOTPCHSA-N 0.000 description 1
- 229950011318 Cannabidiol Drugs 0.000 description 1
- QHMBSVQNZZTUGM-MSOLQXFVSA-N Cannabidiol Natural products OC1=CC(CCCCC)=CC(O)=C1[C@@H]1[C@@H](C(C)=C)CCC(C)=C1 QHMBSVQNZZTUGM-MSOLQXFVSA-N 0.000 description 1
- 102000018208 Cannabinoid receptor family Human genes 0.000 description 1
- 108050007331 Cannabinoid receptor family Proteins 0.000 description 1
- DRCMAZOSEIMCHM-UHFFFAOYSA-N Capsazepine Chemical compound C1C=2C=C(O)C(O)=CC=2CCCN1C(=S)NCCC1=CC=C(Cl)C=C1 DRCMAZOSEIMCHM-UHFFFAOYSA-N 0.000 description 1
- FFGPTBGBLSHEPO-UHFFFAOYSA-N Carbamazepine Chemical compound C1=CC2=CC=CC=C2N(C(=O)N)C2=CC=CC=C21 FFGPTBGBLSHEPO-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229940063834 Carboxymethylcellulose Sodium Drugs 0.000 description 1
- 229960004587 Carisoprodol Drugs 0.000 description 1
- OFZCIYFFPZCNJE-UHFFFAOYSA-N Carisoprodol Chemical compound NC(=O)OCC(C)(CCC)COC(=O)NC(C)C OFZCIYFFPZCNJE-UHFFFAOYSA-N 0.000 description 1
- AHOUBRCZNHFOSL-YOEHRIQHSA-N Casbol Chemical compound C1=CC(F)=CC=C1[C@H]1[C@H](COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-YOEHRIQHSA-N 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N Celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- WFNAKBGANONZEQ-UHFFFAOYSA-N Chlorcyclizine Chemical compound C1CN(C)CCN1C(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 WFNAKBGANONZEQ-UHFFFAOYSA-N 0.000 description 1
- 229960004782 Chlordiazepoxide Drugs 0.000 description 1
- ANTSCNMPPGJYLG-UHFFFAOYSA-N Chlordiazepoxide Chemical compound O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 ANTSCNMPPGJYLG-UHFFFAOYSA-N 0.000 description 1
- 229940107080 Chlorpheniramine Drugs 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N Chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 229960001076 Chlorpromazine Drugs 0.000 description 1
- TZFWDZFKRBELIQ-UHFFFAOYSA-N Chlorzoxazone Chemical compound ClC1=CC=C2OC(O)=NC2=C1 TZFWDZFKRBELIQ-UHFFFAOYSA-N 0.000 description 1
- 229960003633 Chlorzoxazone Drugs 0.000 description 1
- VHMZNOYZKONXJS-UHFFFAOYSA-N ClC1=C(OC2=C(C=NC(=C2)C(F)(F)F)C=O)C=CC(=C1)OC(F)(F)F Chemical compound ClC1=C(OC2=C(C=NC(=C2)C(F)(F)F)C=O)C=CC(=C1)OC(F)(F)F VHMZNOYZKONXJS-UHFFFAOYSA-N 0.000 description 1
- APHNKPGSHZIOHX-UHFFFAOYSA-N ClC1=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=CC(=C1)OC(F)(F)F Chemical compound ClC1=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=CC(=C1)OC(F)(F)F APHNKPGSHZIOHX-UHFFFAOYSA-N 0.000 description 1
- QZUDBNBUXVUHMW-UHFFFAOYSA-N Clozapine Chemical compound C1CN(C)CCN1C1=NC2=CC(Cl)=CC=C2NC2=CC=CC=C12 QZUDBNBUXVUHMW-UHFFFAOYSA-N 0.000 description 1
- 229940108066 Coal Tar Drugs 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- 229920002676 Complementary DNA Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229940064701 Corticosteroid nasal preparations for topical use Drugs 0.000 description 1
- 229960001334 Corticosteroids Drugs 0.000 description 1
- JURKNVYFZMSNLP-UHFFFAOYSA-N Cyclobenzaprine Chemical compound C1=CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 JURKNVYFZMSNLP-UHFFFAOYSA-N 0.000 description 1
- 108010037462 Cyclooxygenase 2 Proteins 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N Cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 229940029644 Cymbalta Drugs 0.000 description 1
- FBPFZTCFMRRESA-KAZBKCHUSA-N D-Mannitol Natural products OC[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KAZBKCHUSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N D-sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FEWJPZIEWOKRBE-LWMBPPNESA-L D-tartrate(2-) Chemical class [O-]C(=O)[C@@H](O)[C@H](O)C([O-])=O FEWJPZIEWOKRBE-LWMBPPNESA-L 0.000 description 1
- 229950007605 Dapitant Drugs 0.000 description 1
- USRHYDPUVLEVMC-FQEVSTJZSA-N Dapoxetine Chemical compound C1([C@H](CCOC=2C3=CC=CC=C3C=CC=2)N(C)C)=CC=CC=C1 USRHYDPUVLEVMC-FQEVSTJZSA-N 0.000 description 1
- HXGBXQDTNZMWGS-RUZDIDTESA-N Darifenacin Chemical compound C=1C=CC=CC=1C([C@H]1CN(CCC=2C=C3CCOC3=CC=2)CC1)(C(=O)N)C1=CC=CC=C1 HXGBXQDTNZMWGS-RUZDIDTESA-N 0.000 description 1
- NNBZCPXTIHJBJL-UHFFFAOYSA-N Decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 1
- OWZREIFADZCYQD-NSHGMRRFSA-N Deltamethrin Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-NSHGMRRFSA-N 0.000 description 1
- 239000005892 Deltamethrin Substances 0.000 description 1
- 210000003074 Dental Pulp Anatomy 0.000 description 1
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 description 1
- 229960003957 Dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N Dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- SOYKEARSMXGVTM-HNNXBMFYSA-N Dexchlorpheniramine Chemical compound C1([C@H](CCN(C)C)C=2N=CC=CC=2)=CC=C(Cl)C=C1 SOYKEARSMXGVTM-HNNXBMFYSA-N 0.000 description 1
- XLMALTXPSGQGBX-GCJKJVERSA-N Dextropropoxyphene Chemical compound C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 XLMALTXPSGQGBX-GCJKJVERSA-N 0.000 description 1
- JAQUASYNZVUNQP-PVAVHDDUSA-N Dextrorphan Chemical compound C1C2=CC=C(O)C=C2[C@@]23CCN(C)[C@@H]1[C@H]2CCCC3 JAQUASYNZVUNQP-PVAVHDDUSA-N 0.000 description 1
- 206010012601 Diabetes mellitus Diseases 0.000 description 1
- KEIFWROAQVVDBN-UHFFFAOYSA-N Dialin Chemical compound C1=CC=C2C=CCCC2=C1 KEIFWROAQVVDBN-UHFFFAOYSA-N 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N Diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- ATKXDQOHNICLQW-UHFFFAOYSA-N Dichloralphenazone Chemical compound OC(O)C(Cl)(Cl)Cl.OC(O)C(Cl)(Cl)Cl.CN1C(C)=CC(=O)N1C1=CC=CC=C1 ATKXDQOHNICLQW-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N Diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 241000668709 Dipterocarpus costatus Species 0.000 description 1
- XIQVNETUBQGFHX-UHFFFAOYSA-N Ditropan Chemical compound C=1C=CC=CC=1C(O)(C(=O)OCC#CCN(CC)CC)C1CCCCC1 XIQVNETUBQGFHX-UHFFFAOYSA-N 0.000 description 1
- ADEBPBSSDYVVLD-UHFFFAOYSA-N Donepezil Chemical compound O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 ADEBPBSSDYVVLD-UHFFFAOYSA-N 0.000 description 1
- RUZYUOTYCVRMRZ-UHFFFAOYSA-N Doxazosin Chemical compound C1OC2=CC=CC=C2OC1C(=O)N(CC1)CCN1C1=NC(N)=C(C=C(C(OC)=C2)OC)C2=N1 RUZYUOTYCVRMRZ-UHFFFAOYSA-N 0.000 description 1
- 229960001389 Doxazosin Drugs 0.000 description 1
- RMEDXOLNCUSCGS-UHFFFAOYSA-N Droperidol Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CC=C(N2C(NC3=CC=CC=C32)=O)CC1 RMEDXOLNCUSCGS-UHFFFAOYSA-N 0.000 description 1
- 229960000394 Droperidol Drugs 0.000 description 1
- 229940089114 Drug Delivery Device Drugs 0.000 description 1
- 206010013654 Drug abuse Diseases 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- 229940022766 EGTA Drugs 0.000 description 1
- 230000035695 Efflux Effects 0.000 description 1
- JAZBEHYOTPTENJ-JLNKQSITSA-N Eicosapentaenoic acid Chemical compound CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O JAZBEHYOTPTENJ-JLNKQSITSA-N 0.000 description 1
- 208000000999 Encephalomyelitis, Autoimmune, Experimental Diseases 0.000 description 1
- 102000005593 Endopeptidases Human genes 0.000 description 1
- 108010059378 Endopeptidases Proteins 0.000 description 1
- 229940088598 Enzyme Drugs 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 241000283074 Equus asinus Species 0.000 description 1
- WSEQXVZVJXJVFP-FQEVSTJZSA-N Escitalopram Chemical compound C1([C@]2(C3=CC=C(C=C3CO2)C#N)CCCN(C)C)=CC=C(F)C=C1 WSEQXVZVJXJVFP-FQEVSTJZSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- MNJVRJDLRVPLFE-UHFFFAOYSA-N Etoricoxib Chemical compound C1=NC(C)=CC=C1C1=NC=C(Cl)C=C1C1=CC=C(S(C)(=O)=O)C=C1 MNJVRJDLRVPLFE-UHFFFAOYSA-N 0.000 description 1
- 230000036826 Excretion Effects 0.000 description 1
- UZNVLQXBSPDMFN-UHFFFAOYSA-N FC(F)Oc1cnc(Cl)c(Br)c1 Chemical compound FC(F)Oc1cnc(Cl)c(Br)c1 UZNVLQXBSPDMFN-UHFFFAOYSA-N 0.000 description 1
- FXWBFLRNFGZAFD-UHFFFAOYSA-N FC(OC1=CC=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=C1)(F)F Chemical compound FC(OC1=CC=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=C1)(F)F FXWBFLRNFGZAFD-UHFFFAOYSA-N 0.000 description 1
- QCAXPRGXQPVKNT-UHFFFAOYSA-N FC1=CC(=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=C1)C Chemical compound FC1=CC(=C(OC2=C(C=NC(=C2)C(F)(F)F)C(=O)O)C=C1)C QCAXPRGXQPVKNT-UHFFFAOYSA-N 0.000 description 1
- LTHMIHPIKVFYIL-UHFFFAOYSA-N FC1=CC(=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=C1)C Chemical compound FC1=CC(=C(OC2=NC=C(C=C2C(=O)O)C(F)(F)F)C=C1)C LTHMIHPIKVFYIL-UHFFFAOYSA-N 0.000 description 1
- RWDMEUZWGITVFO-UHFFFAOYSA-N FC=1C=C(C(=NC=1OC)OC1=C(C=C(C=C1)F)OC)C(=O)O Chemical compound FC=1C=C(C(=NC=1OC)OC1=C(C=C(C=C1)F)OC)C(=O)O RWDMEUZWGITVFO-UHFFFAOYSA-N 0.000 description 1
- AHABQCOPHRZQPK-UHFFFAOYSA-N FC=1C=C(C(=NC=1OC)OC1=C(C=C(C=C1)F)OC)C(=O)OC Chemical compound FC=1C=C(C(=NC=1OC)OC1=C(C=C(C=C1)F)OC)C(=O)OC AHABQCOPHRZQPK-UHFFFAOYSA-N 0.000 description 1
- 229950007979 FLUFENISAL Drugs 0.000 description 1
- IUJDSEJGGMCXSG-UHFFFAOYSA-N Farmotal Chemical compound CCCC(C)C1(CC)C(=O)NC(=S)NC1=O IUJDSEJGGMCXSG-UHFFFAOYSA-N 0.000 description 1
- OJSFTALXCYKKFQ-YLJYHZDGSA-N Femoxetine Chemical compound C1=CC(OC)=CC=C1OC[C@@H]1[C@@H](C=2C=CC=CC=2)CCN(C)C1 OJSFTALXCYKKFQ-YLJYHZDGSA-N 0.000 description 1
- ZPAKPRAICRBAOD-UHFFFAOYSA-N Fenbufen Chemical compound C1=CC(C(=O)CCC(=O)O)=CC=C1C1=CC=CC=C1 ZPAKPRAICRBAOD-UHFFFAOYSA-N 0.000 description 1
- RDJGLLICXDHJDY-UHFFFAOYSA-N Fenoprofen Chemical compound OC(=O)C(C)C1=CC=CC(OC=2C=CC=CC=2)=C1 RDJGLLICXDHJDY-UHFFFAOYSA-N 0.000 description 1
- 229960001419 Fenoprofen Drugs 0.000 description 1
- PJMPHNIQZUBGLI-UHFFFAOYSA-N Fentanyl Chemical compound C=1C=CC=CC=1N(C(=O)CC)C(CC1)CCN1CCC1=CC=CC=C1 PJMPHNIQZUBGLI-UHFFFAOYSA-N 0.000 description 1
- 229960002428 Fentanyl Drugs 0.000 description 1
- SAADBVWGJQAEFS-UHFFFAOYSA-N Flurazepam Chemical compound N=1CC(=O)N(CCN(CC)CC)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1F SAADBVWGJQAEFS-UHFFFAOYSA-N 0.000 description 1
- 229960003528 Flurazepam Drugs 0.000 description 1
- SYTBZMRGLBWNTM-UHFFFAOYSA-N Flurbiprofen Chemical compound FC1=CC(C(C(O)=O)C)=CC=C1C1=CC=CC=C1 SYTBZMRGLBWNTM-UHFFFAOYSA-N 0.000 description 1
- 108040006927 G protein-coupled serotonin receptor activity proteins Proteins 0.000 description 1
- 102000014630 G protein-coupled serotonin receptor activity proteins Human genes 0.000 description 1
- 229960001731 GLUCEPTATE Drugs 0.000 description 1
- 208000003098 Ganglion Cysts Diseases 0.000 description 1
- JMBQKKAJIKAWKF-UHFFFAOYSA-N Glutethimide Chemical compound C=1C=CC=CC=1C1(CC)CCC(=O)NC1=O JMBQKKAJIKAWKF-UHFFFAOYSA-N 0.000 description 1
- 229960002972 Glutethimide Drugs 0.000 description 1
- INJOMKTZOLKMBF-UHFFFAOYSA-N Guanfacine Chemical compound NC(=N)NC(=O)CC1=C(Cl)C=CC=C1Cl INJOMKTZOLKMBF-UHFFFAOYSA-N 0.000 description 1
- 229960002048 Guanfacine Drugs 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 101700018402 HTR1B Proteins 0.000 description 1
- 102100018050 HTR1B Human genes 0.000 description 1
- 101710045396 HTR2B Proteins 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N Haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 description 1
- 229940120060 Heroin Drugs 0.000 description 1
- 241001272567 Hominoidea Species 0.000 description 1
- LLPOLZWFYMWNKH-CMKMFDCUSA-N Hydrocodone Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)CC(=O)[C@@H]1OC1=C2C3=CC=C1OC LLPOLZWFYMWNKH-CMKMFDCUSA-N 0.000 description 1
- WVLOADHCBXTIJK-YNHQPCIGSA-N Hydromorphone Chemical compound O([C@H]1C(CC[C@H]23)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O WVLOADHCBXTIJK-YNHQPCIGSA-N 0.000 description 1
- UYNVMODNBIQBMV-UHFFFAOYSA-N Ifenprodil Chemical compound C1CC(CC=2C=CC=CC=2)CCN1C(C)C(O)C1=CC=C(O)C=C1 UYNVMODNBIQBMV-UHFFFAOYSA-N 0.000 description 1
- 229950006314 Ifoxetine Drugs 0.000 description 1
- ZHFIAFNZGWCLHU-YPMHNXCESA-N Ifoxetine Chemical compound CC1=CC=CC(O[C@@H]2[C@@H](CNCC2)O)=C1C ZHFIAFNZGWCLHU-YPMHNXCESA-N 0.000 description 1
- 229960000905 Indomethacin Drugs 0.000 description 1
- 208000007906 Intestinal Disease Diseases 0.000 description 1
- 229940044173 Iodine-125 Drugs 0.000 description 1
- 229960001888 Ipratropium Drugs 0.000 description 1
- PWWVAXIEGOYWEE-UHFFFAOYSA-N Isophenergan Chemical compound C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 PWWVAXIEGOYWEE-UHFFFAOYSA-N 0.000 description 1
- RPCVIAXDAUMJJP-PZBABLGHSA-N Ispronicline Chemical compound CN[C@@H](C)C\C=C\C1=CN=CC(OC(C)C)=C1 RPCVIAXDAUMJJP-PZBABLGHSA-N 0.000 description 1
- 229950001646 Ispronicline Drugs 0.000 description 1
- 102000005453 KCNQ2 Potassium Channel Human genes 0.000 description 1
- 108010006746 KCNQ2 Potassium Channel Proteins 0.000 description 1
- FPCCSQOGAWCVBH-UHFFFAOYSA-N Ketanserin Chemical compound C1=CC(F)=CC=C1C(=O)C1CCN(CCN2C(C3=CC=CC=C3NC2=O)=O)CC1 FPCCSQOGAWCVBH-UHFFFAOYSA-N 0.000 description 1
- DKYWVDODHFEZIM-UHFFFAOYSA-N Ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 description 1
- SFLSHLFXELFNJZ-MRVPVSSYSA-N L-Noradrenaline Natural products NC[C@@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-MRVPVSSYSA-N 0.000 description 1
- 239000004201 L-cysteine Substances 0.000 description 1
- 229950005286 LANEPITANT Drugs 0.000 description 1
- 229940001447 Lactate Drugs 0.000 description 1
- JYTUSYBCFIZPBE-AMTLMPIISA-N Lactobionic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O JYTUSYBCFIZPBE-AMTLMPIISA-N 0.000 description 1
- OZYUPQUCAUTOBP-QXAKKESOSA-N Levallorphan Chemical compound C([C@H]12)CCC[C@@]11CCN(CC=C)[C@@H]2CC2=CC=C(O)C=C21 OZYUPQUCAUTOBP-QXAKKESOSA-N 0.000 description 1
- JAQUASYNZVUNQP-USXIJHARSA-N Levorphanol Chemical compound C1C2=CC=C(O)C=C2[C@]23CCN(C)[C@H]1[C@@H]2CCCC3 JAQUASYNZVUNQP-USXIJHARSA-N 0.000 description 1
- 229960003406 Levorphanol Drugs 0.000 description 1
- 239000000867 Lipoxygenase Inhibitor Substances 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N Lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- SAPNXPWPAUFAJU-UHFFFAOYSA-N Lofepramine Chemical compound C12=CC=CC=C2CCC2=CC=CC=C2N1CCCN(C)CC(=O)C1=CC=C(Cl)C=C1 SAPNXPWPAUFAJU-UHFFFAOYSA-N 0.000 description 1
- DIWRORZWFLOCLC-UHFFFAOYSA-N Lorazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(O)N=C1C1=CC=CC=C1Cl DIWRORZWFLOCLC-UHFFFAOYSA-N 0.000 description 1
- 210000004705 Lumbosacral Region Anatomy 0.000 description 1
- 229910052765 Lutetium Inorganic materials 0.000 description 1
- 229940009697 Lyrica Drugs 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- SBDNJUWAMKYJOX-UHFFFAOYSA-N Meclofenamic Acid Chemical compound CC1=CC=C(Cl)C(NC=2C(=CC=CC=2)C(O)=O)=C1Cl SBDNJUWAMKYJOX-UHFFFAOYSA-N 0.000 description 1
- HYYBABOKPJLUIN-UHFFFAOYSA-N Mefenamic acid Chemical compound CC1=CC=CC(NC=2C(=CC=CC=2)C(O)=O)=C1C HYYBABOKPJLUIN-UHFFFAOYSA-N 0.000 description 1
- BUGYDGFZZOZRHP-UHFFFAOYSA-N Memantine Chemical compound C1C(C2)CC3(C)CC1(C)CC2(N)C3 BUGYDGFZZOZRHP-UHFFFAOYSA-N 0.000 description 1
- 229940041655 Meperidine Drugs 0.000 description 1
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 description 1
- 229960004815 Meprobamate Drugs 0.000 description 1
- 230000036740 Metabolism Effects 0.000 description 1
- 241000931046 Metadon Species 0.000 description 1
- USSIQXCVUWKGNF-UHFFFAOYSA-N Methadone Chemical compound C=1C=CC=CC=1C(CC(C)N(C)C)(C(=O)CC)C1=CC=CC=C1 USSIQXCVUWKGNF-UHFFFAOYSA-N 0.000 description 1
- 229960002803 Methaqualone Drugs 0.000 description 1
- GNXFOGHNGIVQEH-UHFFFAOYSA-N Methocarbamol Chemical compound COC1=CC=CC=C1OCC(O)COC(N)=O GNXFOGHNGIVQEH-UHFFFAOYSA-N 0.000 description 1
- NZXKDOXHBHYTKP-UHFFFAOYSA-N Metohexital Chemical compound CCC#CC(C)C1(CC=C)C(=O)NC(=O)N(C)C1=O NZXKDOXHBHYTKP-UHFFFAOYSA-N 0.000 description 1
- VLPIATFUUWWMKC-UHFFFAOYSA-N Mexiletine Chemical compound CC(N)COC1=C(C)C=CC=C1C VLPIATFUUWWMKC-UHFFFAOYSA-N 0.000 description 1
- 229960003955 Mianserin Drugs 0.000 description 1
- 229960000600 Milnacipran Drugs 0.000 description 1
- GJJFMKBJSRMPLA-HIFRSBDPSA-N Milnacipran Chemical compound C=1C=CC=CC=1[C@@]1(C(=O)N(CC)CC)C[C@@H]1CN GJJFMKBJSRMPLA-HIFRSBDPSA-N 0.000 description 1
- DSDNAKHZNJAGHN-MXTYGGKSSA-N MolPort-003-983-798 Chemical compound C1=C(O)C(OC)=CC(CC(=O)OCC=2C[C@]3(O)C(=O)C(C)=C[C@H]3[C@@]34[C@H](C)C[C@@]5(O[C@@](O4)(CC=4C=CC=CC=4)O[C@@H]5[C@@H]3C=2)C(C)=C)=C1 DSDNAKHZNJAGHN-MXTYGGKSSA-N 0.000 description 1
- 210000002027 Muscle, Skeletal Anatomy 0.000 description 1
- 210000004165 Myocardium Anatomy 0.000 description 1
- ZZVGLDBDDYESAB-UHFFFAOYSA-N N-(4-(2-((3-Chlorophenylmethyl)Amino)Ethyl)Phenyl)-2-Thiophecarboxamidine Chemical compound ClC1=CC=CC(CNCCC=2C=CC(NC(=N)C=3SC=CC=3)=CC=2)=C1 ZZVGLDBDDYESAB-UHFFFAOYSA-N 0.000 description 1
- MZXGBYUWONZVFA-UHFFFAOYSA-N N-(trifluoromethyl)pyridine-3-carboxamide Chemical compound FC(F)(F)NC(=O)C1=CC=CN=C1 MZXGBYUWONZVFA-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinylpyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- CVXJAPZTZWLRBP-MUUNZHRXSA-N N-[(2R)-1-[acetyl-[(2-methoxyphenyl)methyl]amino]-3-(1H-indol-3-yl)propan-2-yl]-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide Chemical compound COC1=CC=CC=C1CN(C(C)=O)C[C@H](NC(=O)CN1CCC(CC1)N1CCCCC1)CC1=CNC2=CC=CC=C12 CVXJAPZTZWLRBP-MUUNZHRXSA-N 0.000 description 1
- ZRJGMDIPCQOGNI-UHFFFAOYSA-N N-[6-amino-5-(2-chloro-5-methoxyphenyl)pyridin-2-yl]-2-methylpyrazole-3-carboxamide Chemical compound COC1=CC=C(Cl)C(C=2C(=NC(NC(=O)C=3N(N=CC=3)C)=CC=2)N)=C1 ZRJGMDIPCQOGNI-UHFFFAOYSA-N 0.000 description 1
- 108090001041 N-methyl-D-aspartate receptors Proteins 0.000 description 1
- LFUZWBGNIOHRJJ-UHFFFAOYSA-N N1=C2C(=CC(=C1)C(=O)N)CC=C2 Chemical compound N1=C2C(=CC(=C1)C(=O)N)CC=C2 LFUZWBGNIOHRJJ-UHFFFAOYSA-N 0.000 description 1
- 101700080141 NAV1 Proteins 0.000 description 1
- 102000014649 NMDA glutamate receptor activity proteins Human genes 0.000 description 1
- DQCKKXVULJGBQN-XFWGSAIBSA-N Naltrexone Chemical compound N1([C@@H]2CC3=CC=C(C=4O[C@@H]5[C@](C3=4)([C@]2(CCC5=O)O)CC1)O)CC1CC1 DQCKKXVULJGBQN-XFWGSAIBSA-N 0.000 description 1
- 229960003086 Naltrexone Drugs 0.000 description 1
- UNHGSHHVDNGCFN-UHFFFAOYSA-N Naratriptan Chemical compound C=12[CH]C(CCS(=O)(=O)NC)=CC=C2N=CC=1C1CCN(C)CC1 UNHGSHHVDNGCFN-UHFFFAOYSA-N 0.000 description 1
- 210000004126 Nerve Fibers Anatomy 0.000 description 1
- 229940053128 Nerve Growth Factor Drugs 0.000 description 1
- 102000015336 Nerve Growth Factor Human genes 0.000 description 1
- 108010025020 Nerve Growth Factor Proteins 0.000 description 1
- 206010052639 Nerve injury Diseases 0.000 description 1
- 229940072228 Neurontin Drugs 0.000 description 1
- 231100000618 Neurotoxin Toxicity 0.000 description 1
- 229960002715 Nicotine Drugs 0.000 description 1
- SNICXCGAKADSCV-JTQLQIEISA-N Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
- 102000019315 Nicotinic acetylcholine receptors Human genes 0.000 description 1
- 108050006807 Nicotinic acetylcholine receptors Proteins 0.000 description 1
- 229960001158 Nortriptyline Drugs 0.000 description 1
- PHVGLTMQBUFIQQ-UHFFFAOYSA-N Nortryptiline Chemical compound C1CC2=CC=CC=C2C(=CCCNC)C2=CC=CC=C21 PHVGLTMQBUFIQQ-UHFFFAOYSA-N 0.000 description 1
- 229940083311 Nucynta Drugs 0.000 description 1
- 229910003849 O-Si Inorganic materials 0.000 description 1
- KVWDHTXUZHCGIO-UHFFFAOYSA-N Olanzapine Chemical compound C1CN(C)CCN1C1=NC2=CC=CC=C2NC2=C1C=C(C)S2 KVWDHTXUZHCGIO-UHFFFAOYSA-N 0.000 description 1
- FELGMEQIXOGIFQ-UHFFFAOYSA-N Ondansetron Chemical compound CC1=NC=CN1CC1C(=O)C(C=2C(=CC=CC=2)N2C)=C2CC1 FELGMEQIXOGIFQ-UHFFFAOYSA-N 0.000 description 1
- 229960005343 Ondansetron Drugs 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- LPMXVESGRSUGHW-HBYQJFLCSA-N Ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 1
- LPMXVESGRSUGHW-GHYGWZAOSA-N Ouabain Natural products O([C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O1)[C@H]1C[C@@H](O)[C@@]2(CO)[C@@](O)(C1)CC[C@H]1[C@]3(O)[C@@](C)([C@H](C4=CC(=O)OC4)CC3)C[C@@H](O)[C@H]21 LPMXVESGRSUGHW-GHYGWZAOSA-N 0.000 description 1
- ADIMAYPTOBDMTL-UHFFFAOYSA-N Oxazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(O)N=C1C1=CC=CC=C1 ADIMAYPTOBDMTL-UHFFFAOYSA-N 0.000 description 1
- BRUQQQPBMZOVGD-XFKAJCMBSA-N Oxycontin Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(OC)C2=C5[C@@]13CCN4C BRUQQQPBMZOVGD-XFKAJCMBSA-N 0.000 description 1
- UQCNKQCJZOAFTQ-ISWURRPUSA-N Oxymorphone Chemical compound O([C@H]1C(CC[C@]23O)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O UQCNKQCJZOAFTQ-ISWURRPUSA-N 0.000 description 1
- 229910003872 O—Si Inorganic materials 0.000 description 1
- RXWNCPJZOCPEPQ-NVWDDTSBSA-N PUROMYCIN Chemical compound C1=CC(OC)=CC=C1C[C@H](N)C(=O)N[C@H]1[C@@H](O)[C@H](N2C3=NC=NC(=C3N=C2)N(C)C)O[C@@H]1CO RXWNCPJZOCPEPQ-NVWDDTSBSA-N 0.000 description 1
- 229950010131 PUROMYCIN Drugs 0.000 description 1
- 208000005877 Painful Neuropathy Diseases 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L Palladium(II) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 241000127464 Paubrasilia echinata Species 0.000 description 1
- 229960001412 Pentobarbital Drugs 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N Pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 210000000578 Peripheral Nerves Anatomy 0.000 description 1
- 229960000762 Perphenazine Drugs 0.000 description 1
- XADCESSVHJOZHK-UHFFFAOYSA-N Petidina Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 1
- 229960002695 Phenobarbital Drugs 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N Phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N Phosphite Chemical compound [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- RKEWSXXUOLRFBX-UHFFFAOYSA-N Pimavanserin Chemical compound C1=CC(OCC(C)C)=CC=C1CNC(=O)N(C1CCN(C)CC1)CC1=CC=C(F)C=C1 RKEWSXXUOLRFBX-UHFFFAOYSA-N 0.000 description 1
- QYSPLQLAKJAUJT-UHFFFAOYSA-N Piroxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=CC=CC=N1 QYSPLQLAKJAUJT-UHFFFAOYSA-N 0.000 description 1
- 241000048284 Potato virus P Species 0.000 description 1
- 229940069328 Povidone Drugs 0.000 description 1
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N Prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- QPCVHQBVMYCJOM-UHFFFAOYSA-N Propiverine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(OCCC)C(=O)OC1CCN(C)CC1 QPCVHQBVMYCJOM-UHFFFAOYSA-N 0.000 description 1
- 229940069956 Propoxyphene Drugs 0.000 description 1
- AQHHHDLHHXJYJD-UHFFFAOYSA-N Proprasylyt Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J Pyrophosphate Chemical class [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 229940076788 Pyruvate Drugs 0.000 description 1
- URKOMYMAXPYINW-UHFFFAOYSA-N Quetiapine Chemical compound C1CN(CCOCCO)CCN1C1=NC2=CC=CC=C2SC2=CC=CC=C12 URKOMYMAXPYINW-UHFFFAOYSA-N 0.000 description 1
- 229940101879 Qutenza Drugs 0.000 description 1
- 229940100486 RICE STARCH Drugs 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229960001534 Risperidone Drugs 0.000 description 1
- RAPZEAPATHNIPO-UHFFFAOYSA-N Risperidone Chemical compound FC1=CC=C2C(C3CCN(CC3)CCC=3C(=O)N4CCCCC4=NC=3C)=NOC2=C1 RAPZEAPATHNIPO-UHFFFAOYSA-N 0.000 description 1
- TXHZXHICDBAVJW-UHFFFAOYSA-N Rizatriptan Chemical compound C=1[C]2C(CCN(C)C)=CN=C2C=CC=1CN1C=NC=N1 TXHZXHICDBAVJW-UHFFFAOYSA-N 0.000 description 1
- RZJQGNCSTQAWON-UHFFFAOYSA-N Rofecoxib Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)OC1 RZJQGNCSTQAWON-UHFFFAOYSA-N 0.000 description 1
- 102100010563 SCN9A Human genes 0.000 description 1
- 101700051996 SCN9A Proteins 0.000 description 1
- 241001474728 Satyrodes eurydice Species 0.000 description 1
- 229950008243 Secbutabarbital Drugs 0.000 description 1
- 229950009184 Senrebotase Drugs 0.000 description 1
- GZKLJWGUPQBVJQ-UHFFFAOYSA-N Sertindole Chemical compound C1=CC(F)=CC=C1N1C2=CC=C(Cl)C=C2C(C2CCN(CCN3C(NCC3)=O)CC2)=C1 GZKLJWGUPQBVJQ-UHFFFAOYSA-N 0.000 description 1
- BNRNXUUZRGQAQC-UHFFFAOYSA-N Sildenafil Chemical compound CCCC1=NN(C)C(C(N2)=O)=C1N=C2C(C(=CC=1)OCC)=CC=1S(=O)(=O)N1CCN(C)CC1 BNRNXUUZRGQAQC-UHFFFAOYSA-N 0.000 description 1
- 108020004459 Small Interfering RNA Proteins 0.000 description 1
- 229920001985 Small interfering RNA Polymers 0.000 description 1
- 229940005550 Sodium alginate Drugs 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M Sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- FBOUYBDGKBSUES-VXKWHMMOSA-N Solifenacin Chemical compound C1([C@H]2C3=CC=CC=C3CCN2C(O[C@@H]2C3CCN(CC3)C2)=O)=CC=CC=C1 FBOUYBDGKBSUES-VXKWHMMOSA-N 0.000 description 1
- JEYCTXHKTXCGPB-UHFFFAOYSA-N Somnomed Chemical compound CC1=CC=CC=C1N1C(=O)C2=CC=CC=C2N=C1C JEYCTXHKTXCGPB-UHFFFAOYSA-N 0.000 description 1
- WNUQCGWXPNGORO-NRFANRHFSA-N Sonepiprazole Chemical compound C1=CC(S(=O)(=O)N)=CC=C1N1CCN(CC[C@H]2C3=CC=CC=C3CCO2)CC1 WNUQCGWXPNGORO-NRFANRHFSA-N 0.000 description 1
- 229950001013 Sonepiprazole Drugs 0.000 description 1
- 240000006531 Strophanthus gratus Species 0.000 description 1
- CZMRCDWAGMRECN-GDQSFJPYSA-N Sucrose Natural products O([C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)O1)[C@@]1(CO)[C@H](O)[C@@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-GDQSFJPYSA-N 0.000 description 1
- 229960001940 Sulfasalazine Drugs 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L Sulphite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- GKZARTFJSANTLY-UHFFFAOYSA-N Sumatriptan Chemical compound [CH]1C(CS(=O)(=O)NC)=CC=C2N=CC(CCN(C)C)=C21 GKZARTFJSANTLY-UHFFFAOYSA-N 0.000 description 1
- 229960003708 Sumatriptan Drugs 0.000 description 1
- 208000005400 Synovial Cyst Diseases 0.000 description 1
- 108060008443 TPPP Proteins 0.000 description 1
- 108020003835 TX1 Proteins 0.000 description 1
- IEHKWSGCTWLXFU-IIBYNOLFSA-N Tadalafil Chemical compound C1=C2OCOC2=CC([C@@H]2C3=C([C]4C=CC=CC4=N3)C[C@H]3N2C(=O)CN(C3=O)C)=C1 IEHKWSGCTWLXFU-IIBYNOLFSA-N 0.000 description 1
- VOKSWYLNZZRQPF-UHFFFAOYSA-N Talwin Chemical compound C1C2=CC=C(O)C=C2C2(C)C(C)C1N(CC=C(C)C)CC2 VOKSWYLNZZRQPF-UHFFFAOYSA-N 0.000 description 1
- DRHKJLXJIQTDTD-OAHLLOKOSA-N Tamsulosine Chemical compound CCOC1=CC=CC=C1OCCN[C@H](C)CC1=CC=C(OC)C(S(N)(=O)=O)=C1 DRHKJLXJIQTDTD-OAHLLOKOSA-N 0.000 description 1
- 229950008160 Tanezumab Drugs 0.000 description 1
- 229920002253 Tannate Polymers 0.000 description 1
- 229960003188 Temazepam Drugs 0.000 description 1
- SEQDDYPDSLOBDC-UHFFFAOYSA-N Temazepam Chemical compound N=1C(O)C(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 SEQDDYPDSLOBDC-UHFFFAOYSA-N 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N Tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 229960003279 Thiopental Drugs 0.000 description 1
- UEQUQVLFIPOEMF-UHFFFAOYSA-N Tolvon Chemical compound C1C2=CC=CC=C2N2CCN(C)CC2C2=CC=CC=C21 UEQUQVLFIPOEMF-UHFFFAOYSA-N 0.000 description 1
- 229960004380 Tramadol Drugs 0.000 description 1
- RGCVKNLCSQQDEP-UHFFFAOYSA-N Tranquisan Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 RGCVKNLCSQQDEP-UHFFFAOYSA-N 0.000 description 1
- 229950005135 Traxoprodil Drugs 0.000 description 1
- 229960003991 Trazodone Drugs 0.000 description 1
- PHLBKPHSAVXXEF-UHFFFAOYSA-N Trazodone Chemical compound ClC1=CC=CC(N2CCN(CCCN3C(N4C=CC=CC4=N3)=O)CC2)=C1 PHLBKPHSAVXXEF-UHFFFAOYSA-N 0.000 description 1
- JOFWLTCLBGQGBO-UHFFFAOYSA-N Triazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1Cl JOFWLTCLBGQGBO-UHFFFAOYSA-N 0.000 description 1
- ZEWQUBUPAILYHI-UHFFFAOYSA-N Trifluoperazine Chemical compound C1CN(C)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 ZEWQUBUPAILYHI-UHFFFAOYSA-N 0.000 description 1
- 229960002324 Trifluoperazine Drugs 0.000 description 1
- 206010044652 Trigeminal neuralgia Diseases 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- IYFNEFQTYQPVOC-UHFFFAOYSA-N Udenafil Chemical compound C1=C(C=2NC=3C(CCC)=NN(C)C=3C(=O)N=2)C(OCCC)=CC=C1S(=O)(=O)NCCC1CCCN1C IYFNEFQTYQPVOC-UHFFFAOYSA-N 0.000 description 1
- 229940102566 Valproate Drugs 0.000 description 1
- JQSHBVHOMNKWFT-DTORHVGOSA-N Varenicline Chemical compound C12=CC3=NC=CN=C3C=C2[C@H]2C[C@@H]1CNC2 JQSHBVHOMNKWFT-DTORHVGOSA-N 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 229960001255 Viloxazine Drugs 0.000 description 1
- YWPHCCPCQOJSGZ-UHFFFAOYSA-N Viloxazine Chemical compound CCOC1=CC=CC=C1OCC1OCCNC1 YWPHCCPCQOJSGZ-UHFFFAOYSA-N 0.000 description 1
- 229940089285 Vimpat Drugs 0.000 description 1
- 229940100445 WHEAT STARCH Drugs 0.000 description 1
- HDOZVRUNCMBHFH-UHFFFAOYSA-N Zotepine Chemical compound CN(C)CCOC1=CC2=CC=CC=C2SC2=CC=C(Cl)C=C12 HDOZVRUNCMBHFH-UHFFFAOYSA-N 0.000 description 1
- RVCSYOQWLPPAOA-CVPHZBIISA-M [(5S)-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl] 2-hydroxy-2,2-diphenylacetate;chloride Chemical compound [Cl-].[N+]12([C@H]3CCC2CC(C3)OC(=O)C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CCCC1 RVCSYOQWLPPAOA-CVPHZBIISA-M 0.000 description 1
- PYRLGKOKNUJQQN-UHFFFAOYSA-M [O-]C(=O)N[SiH3] Chemical compound [O-]C(=O)N[SiH3] PYRLGKOKNUJQQN-UHFFFAOYSA-M 0.000 description 1
- 230000001594 aberrant Effects 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000001785 acacia senegal l. willd gum Substances 0.000 description 1
- 150000001241 acetals Chemical group 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000000240 adjuvant Effects 0.000 description 1
- 238000009098 adjuvant therapy Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000005012 alkyl thioether group Chemical group 0.000 description 1
- 125000005237 alkyleneamino group Chemical group 0.000 description 1
- 125000005238 alkylenediamino group Chemical group 0.000 description 1
- 230000000172 allergic Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002333 angiotensin II receptor antagonist Substances 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 229940053202 antiepileptics Carboxamide derivatives Drugs 0.000 description 1
- 229940111121 antirheumatic drugs Quinolines Drugs 0.000 description 1
- 229960001372 aprepitant Drugs 0.000 description 1
- 229960003153 aprobarbital Drugs 0.000 description 1
- 229960004372 aripiprazole Drugs 0.000 description 1
- 125000005251 aryl acyl group Chemical group 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 238000003556 assay method Methods 0.000 description 1
- 229960002430 atomoxetine Drugs 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical class [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000035514 bioavailability Effects 0.000 description 1
- 238000002306 biochemical method Methods 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- QJBRNNNJBVJKPK-UHFFFAOYSA-N but-1-en-3-yne Chemical group C=[C]C#C QJBRNNNJBVJKPK-UHFFFAOYSA-N 0.000 description 1
- 229940015694 butabarbital Drugs 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Inorganic materials [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 1
- 239000000480 calcium channel blocker Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229930003833 capsaicin Natural products 0.000 description 1
- 235000017663 capsaicin Nutrition 0.000 description 1
- 229960000623 carbamazepine Drugs 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- OKTJSMMVPCPJKN-NJFSPNSNSA-N carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 229920003123 carboxymethyl cellulose sodium Polymers 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- 239000006143 cell culture media Substances 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 201000003861 cerebellar disease Diseases 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 239000012069 chiral reagent Substances 0.000 description 1
- 229960004831 chlorcyclizine Drugs 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960003291 chlorphenamine Drugs 0.000 description 1
- 230000001713 cholinergic Effects 0.000 description 1
- 239000000544 cholinesterase inhibitor Substances 0.000 description 1
- 229960004606 clomipramine Drugs 0.000 description 1
- 229960002896 clonidine Drugs 0.000 description 1
- 229960004362 clorazepate Drugs 0.000 description 1
- XDDJGVMJFWAHJX-UHFFFAOYSA-N clorazepic acid Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(C(=O)O)N=C1C1=CC=CC=C1 XDDJGVMJFWAHJX-UHFFFAOYSA-N 0.000 description 1
- 229960004170 clozapine Drugs 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 229960003920 cocaine Drugs 0.000 description 1
- 229960004126 codeine Drugs 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 230000001054 cortical Effects 0.000 description 1
- 210000003618 cortical neuron Anatomy 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000006448 cycloalkyl cycloalkyl group Chemical group 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 229960003572 cyclobenzaprine Drugs 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000002188 cycloheptatrienyl group Chemical group C1(=CC=CC=CC1)* 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- QKJSVPBYHKEILK-UHFFFAOYSA-N cyclohexene Chemical group C1CCC=[C]C1 QKJSVPBYHKEILK-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- WLVKDFJTYKELLQ-UHFFFAOYSA-N cyclopropylboronic acid Chemical compound OB(O)C1CC1 WLVKDFJTYKELLQ-UHFFFAOYSA-N 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 229960005217 dapoxetine Drugs 0.000 description 1
- 229960002677 darifenacin Drugs 0.000 description 1
- 238000007405 data analysis Methods 0.000 description 1
- 229960002483 decamethrin Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent Effects 0.000 description 1
- 229960003914 desipramine Drugs 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229960004193 dextropropoxyphene Drugs 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 1
- 229960002069 diamorphine Drugs 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- 229960005422 dichloralphenazone Drugs 0.000 description 1
- 229960001259 diclofenac Drugs 0.000 description 1
- DCOPUUMXTXDBNB-UHFFFAOYSA-N diclofenac Chemical compound OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl DCOPUUMXTXDBNB-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- XEYBRNLFEZDVAW-DODZYUBVSA-N dinoprostone Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=CCCCC(O)=O XEYBRNLFEZDVAW-DODZYUBVSA-N 0.000 description 1
- 229960000520 diphenhydramine Drugs 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical class C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 239000001177 diphosphate Substances 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000035510 distribution Effects 0.000 description 1
- KLBQZWRITKRQQV-UHFFFAOYSA-N dl-Thioridazine Chemical compound C12=CC(SC)=CC=C2SC2=CC=CC=C2N1CCC1CCCCN1C KLBQZWRITKRQQV-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960003530 donepezil Drugs 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 238000002001 electrophysiology Methods 0.000 description 1
- 201000002491 encephalomyelitis Diseases 0.000 description 1
- 108091005938 enhanced green fluorescent protein Proteins 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 229960004341 escitalopram Drugs 0.000 description 1
- QIALRBLEEWJACW-INIZCTEOSA-N eslicarbazepine acetate Chemical compound CC(=O)O[C@H]1CC2=CC=CC=C2N(C(N)=O)C2=CC=CC=C12 QIALRBLEEWJACW-INIZCTEOSA-N 0.000 description 1
- 229960003233 eslicarbazepine acetate Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- VQWWQKAQHGSJOX-UHFFFAOYSA-N ethyl 4-chloro-6-(trifluoromethyl)pyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=C(C(F)(F)F)C=C1Cl VQWWQKAQHGSJOX-UHFFFAOYSA-N 0.000 description 1
- DEFVIWRASFVYLL-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl)tetraacetic acid Chemical compound OC(=O)CN(CC(O)=O)CCOCCOCCN(CC(O)=O)CC(O)=O DEFVIWRASFVYLL-UHFFFAOYSA-N 0.000 description 1
- 229960004945 etoricoxib Drugs 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 230000002964 excitative Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 229950003930 femoxetine Drugs 0.000 description 1
- 229960001395 fenbufen Drugs 0.000 description 1
- 230000001605 fetal Effects 0.000 description 1
- 239000012091 fetal bovine serum Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 229960002390 flurbiprofen Drugs 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 229940050411 fumarate Drugs 0.000 description 1
- 230000002496 gastric Effects 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 239000006481 glucose medium Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229920000591 gum Polymers 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003106 haloaryl group Chemical group 0.000 description 1
- 229960003878 haloperidol Drugs 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 125000005549 heteroarylene group Chemical group 0.000 description 1
- 125000004366 heterocycloalkenyl group Chemical group 0.000 description 1
- 125000006588 heterocycloalkylene group Chemical group 0.000 description 1
- 239000008079 hexane Substances 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 239000000938 histamine H1 antagonist Substances 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 229960000240 hydrocodone Drugs 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 229960001410 hydromorphone Drugs 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical compound [H]OC([H])([H])* 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 229960003998 ifenprodil Drugs 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 230000001771 impaired Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 150000002468 indanes Chemical class 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002757 inflammatory Effects 0.000 description 1
- 230000003834 intracellular Effects 0.000 description 1
- 238000007917 intracranial administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- OEXHQOGQTVQTAT-JRNQLAHRSA-N ipratropium Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)[N@@+]2(C)C(C)C)C(=O)C(CO)C1=CC=CC=C1 OEXHQOGQTVQTAT-JRNQLAHRSA-N 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-M isethionate Chemical compound OCCS([O-])(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-M 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000155 isotopic Effects 0.000 description 1
- 230000000366 juvenile Effects 0.000 description 1
- 229960003299 ketamine Drugs 0.000 description 1
- 229960005417 ketanserin Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229960000991 ketoprofen Drugs 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 229940099584 lactobionate Drugs 0.000 description 1
- VNYSSYRCGWBHLG-AMOLWHMGSA-M leukotriene B4(1-) Chemical compound CCCCC\C=C/C[C@@H](O)\C=C\C=C\C=C/[C@@H](O)CCCC([O-])=O VNYSSYRCGWBHLG-AMOLWHMGSA-M 0.000 description 1
- 229960000263 levallorphan Drugs 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229960002813 lofepramine Drugs 0.000 description 1
- 229960004391 lorazepam Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229960000994 lumiracoxib Drugs 0.000 description 1
- KHPKQFYUPIUARC-UHFFFAOYSA-N lumiracoxib Chemical compound OC(=O)CC1=CC(C)=CC=C1NC1=C(F)C=CC=C1Cl KHPKQFYUPIUARC-UHFFFAOYSA-N 0.000 description 1
- 230000002934 lysing Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229960003803 meclofenamic acid Drugs 0.000 description 1
- 230000001404 mediated Effects 0.000 description 1
- 229960003464 mefenamic acid Drugs 0.000 description 1
- 229960004640 memantine Drugs 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000035786 metabolism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229960002330 methocarbamol Drugs 0.000 description 1
- 229960002683 methohexital Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- MOMQDEDQGJAKII-UHFFFAOYSA-N methyl 5-bromo-2-chloropyridine-3-carboxylate Chemical compound COC(=O)C1=CC(Br)=CN=C1Cl MOMQDEDQGJAKII-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 229960003404 mexiletine Drugs 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000006682 monohaloalkyl group Chemical group 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 230000004973 motor coordination Effects 0.000 description 1
- 239000003149 muscarinic antagonist Substances 0.000 description 1
- 230000003387 muscular Effects 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- 239000003703 n methyl dextro aspartic acid receptor blocking agent Substances 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BLXXJMDCKKHMKV-UHFFFAOYSA-N nabumeton Chemical compound C1=C(CCC(C)=O)C=CC2=CC(OC)=CC=C21 BLXXJMDCKKHMKV-UHFFFAOYSA-N 0.000 description 1
- 229960004270 nabumetone Drugs 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 229960005254 naratriptan Drugs 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001537 neural Effects 0.000 description 1
- 230000000926 neurological Effects 0.000 description 1
- 230000003955 neuronal function Effects 0.000 description 1
- 230000002981 neuropathic Effects 0.000 description 1
- 239000002581 neurotoxin Substances 0.000 description 1
- 229930015196 nicotine Natural products 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- DLWSRGHNJVLJAH-UHFFFAOYSA-N nitroflurbiprofen Chemical compound FC1=CC(C(C(=O)OCCCCO[N+]([O-])=O)C)=CC=C1C1=CC=CC=C1 DLWSRGHNJVLJAH-UHFFFAOYSA-N 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 125000005485 noradamantyl group Chemical group 0.000 description 1
- WIQRCHMSJFFONW-UHFFFAOYSA-N norfluoxetine Chemical compound C=1C=CC=CC=1C(CCN)OC1=CC=C(C(F)(F)F)C=C1 WIQRCHMSJFFONW-UHFFFAOYSA-N 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 229960005017 olanzapine Drugs 0.000 description 1
- 201000000988 opioid abuse Diseases 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229960003343 ouabain Drugs 0.000 description 1
- 229960004535 oxazepam Drugs 0.000 description 1
- 125000005188 oxoalkyl group Chemical group 0.000 description 1
- 229960005434 oxybutynin Drugs 0.000 description 1
- 229960002085 oxycodone Drugs 0.000 description 1
- 229960005118 oxymorphone Drugs 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 229960004662 parecoxib Drugs 0.000 description 1
- TZRHLKRLEZJVIJ-UHFFFAOYSA-N parecoxib Chemical compound C1=CC(S(=O)(=O)NC(=O)CC)=CC=C1C1=C(C)ON=C1C1=CC=CC=C1 TZRHLKRLEZJVIJ-UHFFFAOYSA-N 0.000 description 1
- 229960002296 paroxetine Drugs 0.000 description 1
- 230000036961 partial Effects 0.000 description 1
- 230000000149 penetrating Effects 0.000 description 1
- 229960005301 pentazocine Drugs 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 229960000482 pethidine Drugs 0.000 description 1
- 239000000546 pharmaceutic aid Substances 0.000 description 1
- 230000036231 pharmacokinetics Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000002590 phosphodiesterase V inhibitor Substances 0.000 description 1
- NJRWNWYFPOFDFN-UHFFFAOYSA-L phosphonate(2-) Chemical compound [O-][P]([O-])=O NJRWNWYFPOFDFN-UHFFFAOYSA-L 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000004437 phosphorous atoms Chemical group 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000004977 physiological function Effects 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229960003300 pimavanserin Drugs 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000000902 placebo Substances 0.000 description 1
- 229940068196 placebo Drugs 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920003255 poly(phenylsilsesquioxane) Polymers 0.000 description 1
- 229920001888 polyacrylic acid Polymers 0.000 description 1
- 125000006684 polyhaloalkyl group Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 230000003389 potentiating Effects 0.000 description 1
- 229960004618 prednisone Drugs 0.000 description 1
- 230000002360 prefrontal Effects 0.000 description 1
- 230000002335 preservative Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 229960003910 promethazine Drugs 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 229960003510 propiverine Drugs 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000002633 protecting Effects 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-M pyridine-3-carboxylate Chemical compound [O-]C(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-M 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- LCTONWCANYUPML-UHFFFAOYSA-M pyruvate Chemical compound CC(=O)C([O-])=O LCTONWCANYUPML-UHFFFAOYSA-M 0.000 description 1
- 229960004431 quetiapine Drugs 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 230000002285 radioactive Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229960003770 reboxetine Drugs 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 230000003252 repetitive Effects 0.000 description 1
- 230000000754 repressing Effects 0.000 description 1
- 230000000241 respiratory Effects 0.000 description 1
- 102000034577 retinoid X receptors Human genes 0.000 description 1
- 108010038912 retinoid X receptors Proteins 0.000 description 1
- 239000003590 rho kinase inhibitor Substances 0.000 description 1
- 229960000425 rizatriptan Drugs 0.000 description 1
- 229960000371 rofecoxib Drugs 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229960002060 secobarbital Drugs 0.000 description 1
- 230000001624 sedative Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 210000001044 sensory neuron Anatomy 0.000 description 1
- 230000020341 sensory perception of pain Effects 0.000 description 1
- 239000003369 serotonin 5-HT3 receptor antagonist Substances 0.000 description 1
- 231100000486 side effect Toxicity 0.000 description 1
- 229960003310 sildenafil Drugs 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000004055 small Interfering RNA Substances 0.000 description 1
- MSXHSNHNTORCAW-UHFFFAOYSA-M sodium 3,4,5,6-tetrahydroxyoxane-2-carboxylate Chemical compound [Na+].OC1OC(C([O-])=O)C(O)C(O)C1O MSXHSNHNTORCAW-UHFFFAOYSA-M 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- BBMHARZCALWXSL-UHFFFAOYSA-M sodium;dihydrogen phosphate;hydrate Chemical compound O.[Na+].OP(O)([O-])=O BBMHARZCALWXSL-UHFFFAOYSA-M 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000012439 solid excipient Substances 0.000 description 1
- 229960003855 solifenacin Drugs 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-M stearate Chemical compound CCCCCCCCCCCCCCCCCC([O-])=O QIQXTHQIDYTFRH-UHFFFAOYSA-M 0.000 description 1
- 230000003637 steroidlike Effects 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N sulfonic acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000005555 sulfoximide group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002459 sustained Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 230000000213 tachycardiac Effects 0.000 description 1
- 229960000835 tadalafil Drugs 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229960002613 tamsulosin Drugs 0.000 description 1
- 108010038329 tanezumab Proteins 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004192 tetrahydrofuran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 229960002784 thioridazine Drugs 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 229960004045 tolterodine Drugs 0.000 description 1
- OOGJQPCLVADCPB-HXUWFJFHSA-N tolterodine Chemical compound C1([C@@H](CCN(C(C)C)C(C)C)C=2C(=CC=C(C)C=2)O)=CC=CC=C1 OOGJQPCLVADCPB-HXUWFJFHSA-N 0.000 description 1
- 230000000699 topical Effects 0.000 description 1
- 229940083878 topical for treatment of hemorrhoids and anal fissures Corticosteroids Drugs 0.000 description 1
- 230000002588 toxic Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 230000001052 transient Effects 0.000 description 1
- DXFZQDKXRIAXCS-UHFFFAOYSA-N triazine-4-carboxamide Chemical class NC(=O)C1=CC=NN=N1 DXFZQDKXRIAXCS-UHFFFAOYSA-N 0.000 description 1
- 229960003386 triazolam Drugs 0.000 description 1
- 239000003029 tricyclic antidepressant agent Substances 0.000 description 1
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 1
- 235000019798 tripotassium phosphate Nutrition 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229960001530 trospium chloride Drugs 0.000 description 1
- 229960001322 trypsin Drugs 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 201000006704 ulcerative colitis Diseases 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 230000003827 upregulation Effects 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229960002004 valdecoxib Drugs 0.000 description 1
- LNPDTQAFDNKSHK-UHFFFAOYSA-N valdecoxib Chemical compound CC=1ON=C(C=2C=CC=CC=2)C=1C1=CC=C(S(N)(=O)=O)C=C1 LNPDTQAFDNKSHK-UHFFFAOYSA-N 0.000 description 1
- 238000010200 validation analysis Methods 0.000 description 1
- NIJJYAXOARWZEE-UHFFFAOYSA-M valproate Chemical compound CCCC(C([O-])=O)CCC NIJJYAXOARWZEE-UHFFFAOYSA-M 0.000 description 1
- 239000000105 vanilloid receptor agonist Substances 0.000 description 1
- 239000000085 vanilloid receptor antagonist Substances 0.000 description 1
- 229960004751 varenicline Drugs 0.000 description 1
- 229960004688 venlafaxine Drugs 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 239000000609 voltage gated sodium channel stimulating agent Substances 0.000 description 1
- MWLSOWXNZPKENC-SSDOTTSWSA-N zileuton Chemical compound C1=CC=C2SC([C@H](N(O)C(N)=O)C)=CC2=C1 MWLSOWXNZPKENC-SSDOTTSWSA-N 0.000 description 1
- 229960005332 zileuton Drugs 0.000 description 1
- 229960004496 zotepine Drugs 0.000 description 1
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US201862695571P | 2018-07-09 | 2018-07-09 | |
US62/695,571 | 2018-07-09 | ||
PCT/US2019/041029 WO2020014246A1 (en) | 2018-07-09 | 2019-07-09 | Pyridine carboxamide compounds for inhibiting nav1.8 |
Publications (2)
Publication Number | Publication Date |
---|---|
JP2021530478A JP2021530478A (ja) | 2021-11-11 |
JPWO2020014246A5 true JPWO2020014246A5 (zh) | 2022-04-12 |
Family
ID=69141639
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP2021500411A Pending JP2021530478A (ja) | 2018-07-09 | 2019-07-09 | NaV1.8を阻害するためのピリジンカルボキシアミド化合物 |
Country Status (9)
Country | Link |
---|---|
US (1) | US20220227732A1 (zh) |
EP (1) | EP3820866A4 (zh) |
JP (1) | JP2021530478A (zh) |
KR (1) | KR20210019581A (zh) |
CN (1) | CN112689633A (zh) |
AU (1) | AU2019301628A1 (zh) |
CA (1) | CA3105657A1 (zh) |
SG (1) | SG11202100130QA (zh) |
WO (1) | WO2020014246A1 (zh) |
Families Citing this family (22)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2020176763A1 (en) | 2019-02-27 | 2020-09-03 | Vertex Pharmaceuticals Incorporated | Dosage form comprising prodrug of na 1.8 sodium channel inhibitor |
WO2020219867A1 (en) | 2019-04-25 | 2020-10-29 | Vertex Pharmaceuticals Incorporated | Pyridone amide co-crystal compositions for the treatment of pain |
CN112390745B (zh) * | 2019-08-19 | 2022-10-21 | 江苏恒瑞医药股份有限公司 | 吡啶烟酰胺类衍生物、其制备方法及其在医药上的应用 |
BR112022004495A8 (pt) * | 2019-09-12 | 2023-04-18 | Jiangxi Jemincare Group Co Ltd | Compostos oxinitreto de piridina, composição farmacêutica compreendendo os mesmos e usos dos mesmos |
AU2020397059A1 (en) | 2019-12-06 | 2022-07-21 | Vertex Pharmaceuticals Incorporated | Substituted tetrahydrofurans as modulators of sodium channels |
AU2022233221A1 (en) * | 2021-03-11 | 2023-10-26 | Jiangxi Jemincare Group Co., Ltd | Crystal form of pyridine nitrogen oxide compound and use thereof |
AU2022232502A1 (en) * | 2021-03-11 | 2023-09-07 | Latigo Biotherapeutics, Inc. | Methyl-substituted pyridine and pyridazine compounds, derivatives thereof, and methods of their use |
IL308953A (en) | 2021-06-04 | 2024-01-01 | Vertex Pharma | N-Hydroalkyl(Hetero)Aryl)Tetrahydrofuran Carboxamides as Natrene Channel Modulators |
JP2024520649A (ja) | 2021-06-04 | 2024-05-24 | バーテックス ファーマシューティカルズ インコーポレイテッド | (2r,3s,4s,5r)-4-[[3-(3,4-ジフルオロ-2-メトキシ-フェニル)-4,5-ジメチル-5-(トリフルオロメチル)テトラヒドロフラン-2-カルボニル]アミノ]ピリジン-2-カルボキサミドを含む固体剤形及び投与レジメン |
CA3221939A1 (en) | 2021-06-04 | 2022-12-08 | Vertex Pharmaceuticals Incorporated | N-(hydroxyalkyl (hetero)aryl) tetrahydrofuran carboxamide analogs as modulators of sodium channels |
AU2022286511A1 (en) | 2021-06-04 | 2023-11-30 | Vertex Pharmaceuticals Incorporated | Hydroxy and (halo)alkoxy substituted tetrahydrofurans as modulators of sodium channels |
CA3221788A1 (en) | 2021-06-04 | 2022-12-08 | Vertex Pharmaceuticals Incorporated | Substituted tetrahydrofuran-2-carboxamides as modulators of sodium channels |
CN117794918A (zh) | 2021-06-04 | 2024-03-29 | 沃泰克斯药物股份有限公司 | 经取代的四氢呋喃类似物作为钠通道调节剂 |
CN116655497A (zh) * | 2022-02-25 | 2023-08-29 | 中国科学院上海药物研究所 | 脒类衍生化合物及其制备方法和用途 |
CN116891432A (zh) * | 2022-04-02 | 2023-10-17 | 武汉人福创新药物研发中心有限公司 | Nav1.8抑制剂及其用途 |
WO2023205468A1 (en) | 2022-04-22 | 2023-10-26 | Vertex Pharmaceuticals Incorporated | Heteroaryl compounds for the treatment of pain |
WO2023205463A1 (en) | 2022-04-22 | 2023-10-26 | Vertex Pharmaceuticals Incorporated | Heteroaryl compounds for the treatment of pain |
WO2023205465A1 (en) | 2022-04-22 | 2023-10-26 | Vertex Pharmaceuticals Incorporated | Heteroaryl compounds for the treatment of pain |
TW202408501A (zh) | 2022-04-22 | 2024-03-01 | 美商維泰克斯製藥公司 | 用於治療疼痛之雜芳基化合物 |
WO2023211990A1 (en) | 2022-04-25 | 2023-11-02 | Siteone Therapeutics, Inc. | Bicyclic heterocyclic amide inhibitors of na v1.8 for the treatment of pain |
TW202400560A (zh) * | 2022-04-28 | 2024-01-01 | 南韓商愛思開生物製藥股份有限公司 | N-氧化物化合物及其用途 |
WO2024123815A1 (en) | 2022-12-06 | 2024-06-13 | Vertex Pharmaceuticals Incorporated | Process for the synthesis of substituted tetrahydrofuran modulators of sodium channels |
Family Cites Families (15)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
IL64220A (en) * | 1980-11-21 | 1985-06-30 | May & Baker Ltd | Nicotinamide derivatives,their preparation and their use as herbicides |
DE19946852A1 (de) * | 1999-09-30 | 2001-04-05 | Bayer Ag | Substituierte N-Phenyl-phenoxynicotinsäure-(thio)amide |
JP4583761B2 (ja) * | 2002-02-11 | 2010-11-17 | ファイザー・インク | Pde4阻害剤として有用なニコチンアミド誘導体 |
JP2004238361A (ja) * | 2003-02-07 | 2004-08-26 | Tosoh Corp | ピリミジン−5−カルボキサミド誘導体、その中間体及びそれらの製造方法 |
US7504396B2 (en) * | 2003-06-24 | 2009-03-17 | Amgen Inc. | Substituted heterocyclic compounds and methods of use |
CN101643458A (zh) * | 2003-08-08 | 2010-02-10 | 沃泰克斯药物股份有限公司 | 在疼痛的治疗中用作钠或钙通道阻断剂的杂芳基氨基磺酰基苯基衍生物 |
WO2005042519A1 (en) * | 2003-10-31 | 2005-05-12 | Warner-Lambert Company Llc | Pyrimidines as inhibitors of phosphoinositide -3-kinases (pi3k) |
MX2010003866A (es) * | 2007-10-11 | 2010-06-01 | Vertex Pharma | Heteroaril amidas utiles como inhibidores de canales de sodio dependientes de voltaje. |
US8779197B2 (en) * | 2007-10-11 | 2014-07-15 | Vertex Pharmaceuticals Incorporated | Aryl amides useful as inhibitors of voltage-gated sodium channels |
US8389734B2 (en) * | 2007-10-11 | 2013-03-05 | Vertex Pharmaceuticals Incorporated | Amides useful as inhibitors of voltage-gated sodium channels |
MX2011003951A (es) * | 2008-10-29 | 2011-05-03 | Hoffmann La Roche | Nuevos derivados de fenilamida o de piridilamida y su uso como agonistas de receptor acoplado a proteina g (gpbar1). |
CN102850321A (zh) * | 2011-06-28 | 2013-01-02 | 中国科学院上海药物研究所 | 芳香氧基嘧啶甲酰胺或芳香氧基吡啶甲酰胺类化合物及其制备方法、药物组合物和用途 |
MX368833B (es) * | 2013-01-31 | 2019-10-18 | Vertex Pharma | Derivados de quinolina y quinazolina amidas como inhibidores de canales de sodio nav1.8 y el uso de los mismos en el tratamiento del dolor. |
WO2015010065A1 (en) * | 2013-07-19 | 2015-01-22 | Vertex Pharmaceuticals Incorporated | Sulfonamides as modulators of sodium channels |
JOP20200001A1 (ar) * | 2017-07-11 | 2022-10-30 | Vertex Pharma | كاربوكسأميدات بوصفها معدلات لقنوات الصوديوم |
-
2019
- 2019-07-09 SG SG11202100130QA patent/SG11202100130QA/en unknown
- 2019-07-09 KR KR1020217004054A patent/KR20210019581A/ko active Search and Examination
- 2019-07-09 WO PCT/US2019/041029 patent/WO2020014246A1/en active Search and Examination
- 2019-07-09 US US17/256,781 patent/US20220227732A1/en active Pending
- 2019-07-09 JP JP2021500411A patent/JP2021530478A/ja active Pending
- 2019-07-09 EP EP19833816.2A patent/EP3820866A4/en active Pending
- 2019-07-09 CN CN201980058952.XA patent/CN112689633A/zh active Pending
- 2019-07-09 AU AU2019301628A patent/AU2019301628A1/en active Pending
- 2019-07-09 CA CA3105657A patent/CA3105657A1/en active Pending
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US20220227732A1 (en) | Pyridine carboxamide compounds for inhibiting nav1.8 | |
US11993581B2 (en) | Pyridazine compounds for inhibiting Nav1.8 | |
JP7104070B2 (ja) | ナトリウムチャネルの調節因子としての重水素化ピリドンアミドおよびそのプロドラッグ | |
JPWO2020014246A5 (zh) | ||
JP6337109B2 (ja) | ナトリウムチャネルの調節剤としてのスルホンアミド | |
RU2658920C2 (ru) | Амиды в качестве модуляторов натриевых каналов | |
JP2020189862A (ja) | ナトリウムチャネルの調節剤として有用なピリドンアミドのプロドラッグ | |
BR112015017997B1 (pt) | Amidas de quinolina e quinoxalina como moduladores de canais de sódio, seus usos, e composição farmacêutica | |
CN105130957A (zh) | 作为钙或钠通道阻滞剂的芳基取代羧酰胺衍生物 | |
EP4304585A2 (en) | Methyl-substituted pyridine and pyridazine compounds, derivatives thereof, and methods of their use | |
JP2024520649A (ja) | (2r,3s,4s,5r)-4-[[3-(3,4-ジフルオロ-2-メトキシ-フェニル)-4,5-ジメチル-5-(トリフルオロメチル)テトラヒドロフラン-2-カルボニル]アミノ]ピリジン-2-カルボキサミドを含む固体剤形及び投与レジメン | |
CN117062607A (zh) | 经甲基取代的吡啶和哒嗪化合物、其衍生物和其使用方法 | |
CN117794537A (zh) | 包含(2r,3s,4s,5r)-4-[[3-(3,4-二氟-2-甲氧基-苯基)-4,5-二甲基-5-(三氟甲基)四氢呋喃-2-羰基]氨基]吡啶-2-甲酰胺的固体剂型和给药方案 | |
BR112016012811B1 (pt) | Pró-fármacos de piridona amidas, suas formas cristalinas,composição que os compreende, processo para preparar a forma b cristalina, e uso |