JPS6412270B2 - - Google Patents
Info
- Publication number
- JPS6412270B2 JPS6412270B2 JP56006571A JP657181A JPS6412270B2 JP S6412270 B2 JPS6412270 B2 JP S6412270B2 JP 56006571 A JP56006571 A JP 56006571A JP 657181 A JP657181 A JP 657181A JP S6412270 B2 JPS6412270 B2 JP S6412270B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- parts
- lower alkyloxy
- phenyl
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 57
- 125000003545 alkoxy group Chemical group 0.000 claims description 56
- -1 amino, 1-pyrrolidinyl Chemical group 0.000 claims description 44
- 239000003054 catalyst Substances 0.000 claims description 40
- 150000003839 salts Chemical class 0.000 claims description 38
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 28
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 20
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 18
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 7
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 239000000739 antihistaminic agent Substances 0.000 claims description 6
- 125000004076 pyridyl group Chemical group 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 125000004104 aryloxy group Chemical group 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 4
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical class OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 239000012258 stirred mixture Substances 0.000 claims description 3
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 claims description 2
- 239000012298 atmosphere Substances 0.000 claims description 2
- 239000011874 heated mixture Substances 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 8
- 125000001475 halogen functional group Chemical group 0.000 claims 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 3
- ZCGOMHNNNFPNMX-UHFFFAOYSA-N 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-4-phenylpiperidine-4-carboxylic acid Chemical compound CC1CN(C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)CCC1(C(O)=O)C1=CC=CC=C1 ZCGOMHNNNFPNMX-UHFFFAOYSA-N 0.000 claims 1
- ZCGOMHNNNFPNMX-YHYDXASRSA-N Levocabastinum Chemical compound C1([C@@]2(C(O)=O)CCN(C[C@H]2C)C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)=CC=CC=C1 ZCGOMHNNNFPNMX-YHYDXASRSA-N 0.000 claims 1
- NJDLNVYIGQXVCT-UHFFFAOYSA-N benzyl 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-4-phenylpiperidine-4-carboxylate Chemical compound CC1CN(C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)CCC1(C=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 NJDLNVYIGQXVCT-UHFFFAOYSA-N 0.000 claims 1
- 125000002757 morpholinyl group Chemical group 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 122
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 84
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 78
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 52
- 238000002844 melting Methods 0.000 description 51
- 230000008018 melting Effects 0.000 description 51
- 239000000203 mixture Substances 0.000 description 49
- 239000000243 solution Substances 0.000 description 46
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 42
- 239000000047 product Substances 0.000 description 34
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 29
- 229960001701 chloroform Drugs 0.000 description 29
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 27
- 239000007788 liquid Substances 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 24
- 239000003480 eluent Substances 0.000 description 23
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 150000002431 hydrogen Chemical class 0.000 description 22
- 238000003756 stirring Methods 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 21
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 19
- 238000010992 reflux Methods 0.000 description 18
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 16
- 238000004440 column chromatography Methods 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 229930192474 thiophene Natural products 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- FNWWTNNFZGBMEM-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-oxocyclohexane-1-carbonitrile Chemical compound C1=CC(F)=CC=C1C1(C#N)CCC(=O)CC1 FNWWTNNFZGBMEM-UHFFFAOYSA-N 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 229920002055 compound 48/80 Polymers 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 5
- 238000006845 Michael addition reaction Methods 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 150000002081 enamines Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000001387 anti-histamine Effects 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000004292 cyclic ethers Chemical class 0.000 description 3
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- BBWMASBANDIFMV-UHFFFAOYSA-N ethyl 4-phenylpiperidine-4-carboxylate;hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C1(C(=O)OCC)CC[NH2+]CC1 BBWMASBANDIFMV-UHFFFAOYSA-N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- XRNHONQUDLZJPC-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C=C(C=CC=2)C(F)(F)F)(C#N)CC1 XRNHONQUDLZJPC-UHFFFAOYSA-N 0.000 description 2
- YJRQMKSUAIKDDF-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C(O)=O)CC1 YJRQMKSUAIKDDF-UHFFFAOYSA-N 0.000 description 2
- BQQAXQSWBZWPAQ-UHFFFAOYSA-N 1-(chloromethyl)-4-fluoro-2-methylbenzene Chemical compound CC1=CC(F)=CC=C1CCl BQQAXQSWBZWPAQ-UHFFFAOYSA-N 0.000 description 2
- VHULROKXGBQUDA-UHFFFAOYSA-N 2-(4-fluoro-2-methylphenyl)acetonitrile Chemical compound CC1=CC(F)=CC=C1CC#N VHULROKXGBQUDA-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- IPEAFVGALSDSIF-UHFFFAOYSA-N 4-(2-fluorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=CC=2)F)(C#N)CC1 IPEAFVGALSDSIF-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 238000003747 Grignard reaction Methods 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 238000007126 N-alkylation reaction Methods 0.000 description 2
- DZZGGKPKWGPNJA-UHFFFAOYSA-N Normeperidinicacid Chemical class C=1C=CC=CC=1C1(C(=O)O)CCNCC1 DZZGGKPKWGPNJA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical class C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 238000005576 amination reaction Methods 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- AVGHPYONFURRIC-UHFFFAOYSA-N ethyl 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=C(C=CC=2)C(F)(F)F)CCN1S(=O)(=O)C1=CC=C(C)C=C1 AVGHPYONFURRIC-UHFFFAOYSA-N 0.000 description 2
- XYEYJRZTGITPQM-UHFFFAOYSA-N ethyl 1-[4-cyano-4-(4-fluorophenyl)cyclohexen-1-yl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)=CCC1(C#N)C1=CC=C(F)C=C1 XYEYJRZTGITPQM-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 150000004820 halides Chemical group 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 231100000225 lethality Toxicity 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 239000013638 trimer Substances 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- YSULUXOLTMBSFF-UHFFFAOYSA-N (4-fluoro-2-methylphenyl)methanol Chemical compound CC1=CC(F)=CC=C1CO YSULUXOLTMBSFF-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- MHUFQTUDUIWESC-UHFFFAOYSA-N 1-(4-fluoro-2-methylphenyl)-4-oxocyclohexane-1-carbonitrile Chemical compound CC1=CC(F)=CC=C1C1(C#N)CCC(=O)CC1 MHUFQTUDUIWESC-UHFFFAOYSA-N 0.000 description 1
- YEXVKPVHKVOTBS-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C=C(C=CC=2)C(F)(F)F)(C(Cl)=O)CC1 YEXVKPVHKVOTBS-UHFFFAOYSA-N 0.000 description 1
- AUOVOWKIVAQAFS-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]piperidine-4-carbonitrile Chemical compound FC(F)(F)C1=CC=CC(N2CCC(CC2)C#N)=C1 AUOVOWKIVAQAFS-UHFFFAOYSA-N 0.000 description 1
- NREUBTUYADXMHQ-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(CCl)=CC=C1Cl NREUBTUYADXMHQ-UHFFFAOYSA-N 0.000 description 1
- MMZYCBHLNZVROM-UHFFFAOYSA-N 1-fluoro-2-methylbenzene Chemical compound CC1=CC=CC=C1F MMZYCBHLNZVROM-UHFFFAOYSA-N 0.000 description 1
- INVROMPFKQTVQD-UHFFFAOYSA-N 1-phenyl-4-[4-phenyl-4-(piperidine-1-carbonyl)piperidin-1-yl]cyclohex-3-ene-1-carbonitrile Chemical compound C1CN(C=2CCC(CC=2)(C#N)C=2C=CC=CC=2)CCC1(C=1C=CC=CC=1)C(=O)N1CCCCC1 INVROMPFKQTVQD-UHFFFAOYSA-N 0.000 description 1
- FHCUCTFVFZRHID-UHFFFAOYSA-N 1-phenyl-4-[4-phenyl-4-(piperidine-1-carbonyl)piperidin-1-yl]cyclohexane-1-carbonitrile;hydrochloride Chemical compound Cl.C1CN(C2CCC(CC2)(C#N)C=2C=CC=CC=2)CCC1(C=1C=CC=CC=1)C(=O)N1CCCCC1 FHCUCTFVFZRHID-UHFFFAOYSA-N 0.000 description 1
- ZUSTZWVULDGMNM-UHFFFAOYSA-N 2,3-bis(2-chloroethyl)-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C(CCCl)=C1CCCl ZUSTZWVULDGMNM-UHFFFAOYSA-N 0.000 description 1
- VJARIBGMDPJLCL-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)acetonitrile Chemical compound ClC1=CC=C(CC#N)C(Cl)=C1 VJARIBGMDPJLCL-UHFFFAOYSA-N 0.000 description 1
- JHQBLYITVCBGTO-UHFFFAOYSA-N 2-(4-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(CC#N)C=C1 JHQBLYITVCBGTO-UHFFFAOYSA-N 0.000 description 1
- COYCHCYSJJZVQR-UHFFFAOYSA-N 2-(5-fluoro-2-methylphenyl)acetonitrile Chemical compound CC1=CC=C(F)C=C1CC#N COYCHCYSJJZVQR-UHFFFAOYSA-N 0.000 description 1
- MTKSHHODKOMICW-UHFFFAOYSA-N 2-(chloromethyl)-4-fluoro-1-methylbenzene Chemical compound CC1=CC=C(F)C=C1CCl MTKSHHODKOMICW-UHFFFAOYSA-N 0.000 description 1
- MFEKBENOMGCXQH-UHFFFAOYSA-N 2-(dimethylamino)ethyl 4-phenylpiperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=CC=1C1(C(=O)OCCN(C)C)CCNCC1 MFEKBENOMGCXQH-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MLJVBFZNPNMMCP-UHFFFAOYSA-N 2-[4-chloro-2-(trifluoromethyl)phenyl]acetonitrile Chemical compound FC(F)(F)C1=CC(Cl)=CC=C1CC#N MLJVBFZNPNMMCP-UHFFFAOYSA-N 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- MYYMXHSLPGPNFB-UHFFFAOYSA-N 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CNCCC1(C=1C=CC=CC=1)C(=O)OCCN1CCCC1 MYYMXHSLPGPNFB-UHFFFAOYSA-N 0.000 description 1
- UVAIKKBLLJUYLF-UHFFFAOYSA-N 3-(dimethylamino)propyl 4-phenylpiperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=CC=1C1(C(=O)OCCCN(C)C)CCNCC1 UVAIKKBLLJUYLF-UHFFFAOYSA-N 0.000 description 1
- VOMQRBFUXOUSFA-UHFFFAOYSA-N 3-methyl-4-phenylpiperidine-4-carboxylic acid hydrochloride Chemical compound Cl.CC1CNCCC1(C(O)=O)c1ccccc1 VOMQRBFUXOUSFA-UHFFFAOYSA-N 0.000 description 1
- PLRXAFVBCHEMGD-UHFFFAOYSA-N 3-piperidin-1-ylpropan-1-ol Chemical compound OCCCN1CCCCC1 PLRXAFVBCHEMGD-UHFFFAOYSA-N 0.000 description 1
- VOGXNUPJCZPKOH-UHFFFAOYSA-N 4-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC(Cl)=CC=2)Cl)(C#N)CC1 VOGXNUPJCZPKOH-UHFFFAOYSA-N 0.000 description 1
- JRQLMRDTCUBTNA-UHFFFAOYSA-N 4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound COC1=CC=CC=C1C1(C#N)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 JRQLMRDTCUBTNA-UHFFFAOYSA-N 0.000 description 1
- PFRIQQVXLNZKFP-UHFFFAOYSA-N 4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound COC1=CC=CC=C1C1(C(O)=O)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 PFRIQQVXLNZKFP-UHFFFAOYSA-N 0.000 description 1
- APLLEMWXOWUFCM-UHFFFAOYSA-N 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=C(Cl)C=CC=2)C)(C#N)CC1 APLLEMWXOWUFCM-UHFFFAOYSA-N 0.000 description 1
- YYFWRAUDAXLUTQ-UHFFFAOYSA-N 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=C(Cl)C=CC=2)C)(C(Cl)=O)CC1 YYFWRAUDAXLUTQ-UHFFFAOYSA-N 0.000 description 1
- ZPMQDIHZFCJQON-UHFFFAOYSA-N 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=C(Cl)C=CC=2)C)(C(O)=O)CC1 ZPMQDIHZFCJQON-UHFFFAOYSA-N 0.000 description 1
- KMWYAZOULFIPLF-UHFFFAOYSA-N 4-(4-chlorophenyl)-n,n-dimethylpiperidine-4-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C1(C(=O)N(C)C)CCNCC1 KMWYAZOULFIPLF-UHFFFAOYSA-N 0.000 description 1
- UQTGVCOKYKBMTP-UHFFFAOYSA-N 4-(4-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC(F)=CC=2)C)(C(Cl)=O)CC1 UQTGVCOKYKBMTP-UHFFFAOYSA-N 0.000 description 1
- STKOBEGLGNQNAP-UHFFFAOYSA-N 4-(4-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC(F)=CC=2)C)(C(O)=O)CC1 STKOBEGLGNQNAP-UHFFFAOYSA-N 0.000 description 1
- NWXRQNSESSFXHD-UHFFFAOYSA-N 4-(5-chloro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound COC1=CC=C(Cl)C=C1C1(C#N)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 NWXRQNSESSFXHD-UHFFFAOYSA-N 0.000 description 1
- KJIZIGVYRJHSEO-UHFFFAOYSA-N 4-(5-chloro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound COC1=CC=C(Cl)C=C1C1(C(Cl)=O)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 KJIZIGVYRJHSEO-UHFFFAOYSA-N 0.000 description 1
- GGEWQZXOTUPZNX-UHFFFAOYSA-N 4-(5-chloro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound COC1=CC=C(Cl)C=C1C1(C(O)=O)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 GGEWQZXOTUPZNX-UHFFFAOYSA-N 0.000 description 1
- CQJIGPGICAGYGI-UHFFFAOYSA-N 4-(5-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=C(F)C=2)C)(C#N)CC1 CQJIGPGICAGYGI-UHFFFAOYSA-N 0.000 description 1
- PHMBKRHVYVITEL-UHFFFAOYSA-N 4-(5-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=C(F)C=2)C)(C(Cl)=O)CC1 PHMBKRHVYVITEL-UHFFFAOYSA-N 0.000 description 1
- HIFMUWZZNPWVNT-UHFFFAOYSA-N 4-(5-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=C(F)C=2)C)(C(O)=O)CC1 HIFMUWZZNPWVNT-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 1
- RYGXCMJMVYJVGM-UHFFFAOYSA-N 4-oxo-1-pyridin-2-ylcyclohexane-1-carbonitrile Chemical compound C1CC(=O)CCC1(C#N)C1=CC=CC=N1 RYGXCMJMVYJVGM-UHFFFAOYSA-N 0.000 description 1
- QIWQJGMBIABGRX-UHFFFAOYSA-N 4-oxocyclohexane-1-carbonitrile Chemical compound O=C1CCC(C#N)CC1 QIWQJGMBIABGRX-UHFFFAOYSA-N 0.000 description 1
- DYANFOFNHRHFGZ-UHFFFAOYSA-N 4-phenylpiperidine-4-carbonyl chloride;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C1(C(=O)Cl)CCNCC1 DYANFOFNHRHFGZ-UHFFFAOYSA-N 0.000 description 1
- JPUKONSIEHCAQA-UHFFFAOYSA-N 4-phenylpiperidine-4-carboxamide Chemical compound C=1C=CC=CC=1C1(C(=O)N)CCNCC1 JPUKONSIEHCAQA-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JAJARZUOZASCDO-UHFFFAOYSA-N C(C(=O)O)(=O)O.C1(=CC=CC=C1)C1(CCNCC1)C(=O)OCCN1CCOCC1 Chemical compound C(C(=O)O)(=O)O.C1(=CC=CC=C1)C1(CCNCC1)C(=O)OCCN1CCOCC1 JAJARZUOZASCDO-UHFFFAOYSA-N 0.000 description 1
- IZTJJKZPDBUODZ-UHFFFAOYSA-N C(C(=O)O)(=O)O.N1(CCCCC1)C(=O)O Chemical compound C(C(=O)O)(=O)O.N1(CCCCC1)C(=O)O IZTJJKZPDBUODZ-UHFFFAOYSA-N 0.000 description 1
- CNKUBSWMHWKTGZ-UHFFFAOYSA-N CO.ClC1=C(C=CC=C1)C(F)(F)F Chemical compound CO.ClC1=C(C=CC=C1)C(F)(F)F CNKUBSWMHWKTGZ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010009192 Circulatory collapse Diseases 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- JCMWSVNNSPUNER-UHFFFAOYSA-N N,O-dimethyltyramine Chemical compound CNCCC1=CC=C(OC)C=C1 JCMWSVNNSPUNER-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004792 aryl magnesium halides Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KMIIXHWQCAAVAK-UHFFFAOYSA-N benzyl 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-4-(2-fluorophenyl)-3-methylpiperidine-4-carboxylate Chemical compound CC1CN(C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)CCC1(C=1C(=CC=CC=1)F)C(=O)OCC1=CC=CC=C1 KMIIXHWQCAAVAK-UHFFFAOYSA-N 0.000 description 1
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical compound [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000002243 cyclohexanonyl group Chemical class *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- MTGYIZREWZMYCL-UHFFFAOYSA-N ethyl 1-(4-cyano-4-phenylcyclohexen-1-yl)-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)=CCC1(C#N)C1=CC=CC=C1 MTGYIZREWZMYCL-UHFFFAOYSA-N 0.000 description 1
- CEEOQIFZVMNMNF-UHFFFAOYSA-N ethyl 1-(4-cyano-4-phenylcyclohexyl)-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=CC=C1 CEEOQIFZVMNMNF-UHFFFAOYSA-N 0.000 description 1
- BKZFYLFPQVGOTM-UHFFFAOYSA-N ethyl 1-(4-cyano-4-pyridin-2-ylcyclohexyl)-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=CC=N1 BKZFYLFPQVGOTM-UHFFFAOYSA-N 0.000 description 1
- WFYINZLCFHNTMC-UHFFFAOYSA-N ethyl 1-[4-(4-chlorophenyl)-4-cyanocyclohexen-1-yl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)=CCC1(C#N)C1=CC=C(Cl)C=C1 WFYINZLCFHNTMC-UHFFFAOYSA-N 0.000 description 1
- HYSRCPNWRVIQQH-UHFFFAOYSA-N ethyl 1-[4-(4-chlorophenyl)-4-cyanocyclohexyl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=C(Cl)C=C1 HYSRCPNWRVIQQH-UHFFFAOYSA-N 0.000 description 1
- FHWBUJSKRYRENQ-UHFFFAOYSA-N ethyl 1-[4-cyano-4-(4-methoxyphenyl)cyclohexen-1-yl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)=CCC1(C#N)C1=CC=C(OC)C=C1 FHWBUJSKRYRENQ-UHFFFAOYSA-N 0.000 description 1
- LZLMOXJDFGPISM-UHFFFAOYSA-N ethyl 1-[4-cyano-4-(4-methoxyphenyl)cyclohexyl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=C(OC)C=C1 LZLMOXJDFGPISM-UHFFFAOYSA-N 0.000 description 1
- HCPOCMMGKBZWSJ-UHFFFAOYSA-N ethyl 3-hydrazinyl-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)NN HCPOCMMGKBZWSJ-UHFFFAOYSA-N 0.000 description 1
- ZAIHLOCRLUZMLV-UHFFFAOYSA-N ethyl 4-(2,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=C(Cl)C=1C1(C(=O)OCC)CCNCC1 ZAIHLOCRLUZMLV-UHFFFAOYSA-N 0.000 description 1
- FWGBILJBFMPONQ-UHFFFAOYSA-N ethyl 4-(2-methoxyphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC=C(OC)C=1C1(C(=O)OCC)CCNCC1 FWGBILJBFMPONQ-UHFFFAOYSA-N 0.000 description 1
- KFLZJCKZAZUXBT-UHFFFAOYSA-N ethyl 4-(3-chloro-2-methylphenyl)piperidine-4-carboxylate Chemical compound C=1C=CC(Cl)=C(C)C=1C1(C(=O)OCC)CCNCC1 KFLZJCKZAZUXBT-UHFFFAOYSA-N 0.000 description 1
- MTUKGHQGRVKLRQ-UHFFFAOYSA-N ethyl 4-(3-ethoxycarbonylphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CC=CC(C2(CCNCC2)C(=O)OCC)=C1 MTUKGHQGRVKLRQ-UHFFFAOYSA-N 0.000 description 1
- GJRKDOZMTZOXPN-UHFFFAOYSA-N ethyl 4-(3-methylphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC(C)=CC=1C1(C(=O)OCC)CCNCC1 GJRKDOZMTZOXPN-UHFFFAOYSA-N 0.000 description 1
- JKZZYHKEWOAMDX-UHFFFAOYSA-N ethyl 4-(4-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C(=CC(F)=CC=2)C)CCN1S(=O)(=O)C1=CC=C(C)C=C1 JKZZYHKEWOAMDX-UHFFFAOYSA-N 0.000 description 1
- WUKZLPFAPAYONG-UHFFFAOYSA-N ethyl 4-(4-fluoro-2-methylphenyl)piperidine-4-carboxylate Chemical compound C=1C=C(F)C=C(C)C=1C1(C(=O)OCC)CCNCC1 WUKZLPFAPAYONG-UHFFFAOYSA-N 0.000 description 1
- YTVSBMQIQJFYGA-UHFFFAOYSA-N ethyl 4-(5-chloro-2-methoxyphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C(Cl)=CC=C(OC)C=1C1(C(=O)OCC)CCNCC1 YTVSBMQIQJFYGA-UHFFFAOYSA-N 0.000 description 1
- HDJXDDARIBRLEJ-UHFFFAOYSA-N ethyl 4-(5-fluoro-2-methylphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C(F)=CC=C(C)C=1C1(C(=O)OCC)CCNCC1 HDJXDDARIBRLEJ-UHFFFAOYSA-N 0.000 description 1
- QWPZTQCCONTMPI-UHFFFAOYSA-N ethyl 4-[3-(trifluoromethyl)phenyl]piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC(C(F)(F)F)=CC=1C1(C(=O)OCC)CCNCC1 QWPZTQCCONTMPI-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- XAVNWNCTXQDFLF-UHFFFAOYSA-N methyl piperidin-1-ium-4-carboxylate;chloride Chemical compound Cl.COC(=O)C1CCNCC1 XAVNWNCTXQDFLF-UHFFFAOYSA-N 0.000 description 1
- RZVWBASHHLFBJF-UHFFFAOYSA-N methyl piperidine-4-carboxylate Chemical compound COC(=O)C1CCNCC1 RZVWBASHHLFBJF-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- NTEHWJBQADMGCG-UHFFFAOYSA-N n,n-dimethylformamide;nitrobenzene Chemical compound CN(C)C=O.[O-][N+](=O)C1=CC=CC=C1 NTEHWJBQADMGCG-UHFFFAOYSA-N 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- FSDNTQSJGHSJBG-UHFFFAOYSA-N piperidine-4-carbonitrile Chemical class N#CC1CCNCC1 FSDNTQSJGHSJBG-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 206010040560 shock Diseases 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229960005137 succinic acid Drugs 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/64—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having an aryl radical as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US11492480A | 1980-01-24 | 1980-01-24 |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS56110674A JPS56110674A (en) | 1981-09-01 |
JPS6412270B2 true JPS6412270B2 (ko) | 1989-02-28 |
Family
ID=22358268
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP657181A Granted JPS56110674A (en) | 1980-01-24 | 1981-01-21 | Novel 11*cyclohexyl**44aryll44piperidine carboxylic acid derivative |
Country Status (4)
Country | Link |
---|---|
JP (1) | JPS56110674A (ko) |
KR (2) | KR840002022B1 (ko) |
SU (1) | SU1132788A3 (ko) |
ZA (1) | ZA81504B (ko) |
Families Citing this family (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JP6083818B2 (ja) | 2011-11-18 | 2017-02-22 | ヘプタレス セラピューティクス リミテッドHeptares Therapeutics Limited | ムスカリンm1受容体アゴニスト |
GB201617454D0 (en) | 2016-10-14 | 2016-11-30 | Heptares Therapeutics Limited | Pharmaceutical compounds |
GB201810239D0 (en) | 2018-06-22 | 2018-08-08 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
GB201819960D0 (en) | 2018-12-07 | 2019-01-23 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
-
1981
- 1981-01-21 JP JP657181A patent/JPS56110674A/ja active Granted
- 1981-01-22 KR KR1019810000184A patent/KR840002022B1/ko active
- 1981-01-23 ZA ZA00810504A patent/ZA81504B/xx unknown
-
1982
- 1982-04-28 SU SU823426504A patent/SU1132788A3/ru active
-
1984
- 1984-07-24 KR KR1019840004375A patent/KR840002003B1/ko not_active IP Right Cessation
Also Published As
Publication number | Publication date |
---|---|
KR840002003B1 (ko) | 1984-10-27 |
JPS56110674A (en) | 1981-09-01 |
ZA81504B (en) | 1982-08-25 |
KR830005139A (ko) | 1983-08-03 |
KR840002022B1 (ko) | 1984-11-05 |
SU1132788A3 (ru) | 1984-12-30 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP0034415B1 (en) | 1-(cyclohexyl or cyclohexenyl)-4-aryl-4-piperidinecarboxylic acid derivatives | |
US7951821B2 (en) | N-[phenyl(piperidin-2-yl)methyl]benzamide derivatives, preparation thereof, and use thereof in therapy | |
TWI295287B (en) | Benzoyl-piperazine derivatives | |
US4329353A (en) | 1-(4-Aryl-cyclohexyl)piperidine derivatives, method of use thereof and pharmaceutical compositions thereof | |
US6610711B2 (en) | 4-phenylpiperidines for the treatment of pruritic dermatoses | |
US20070197601A1 (en) | Use of N-[Phenyl(piperidin-2-yl)methyl]benzamide derivatives in therapy | |
JP3056321B2 (ja) | ピペリジン誘導体 | |
US20050085456A1 (en) | Compounds useful in therapy | |
JPS5946217B2 (ja) | ピペリジン誘導体、その酸付加塩および光学異性体 | |
NO841422L (no) | N-aryl-alfa-amino-karboksamider | |
EP0674514A1 (en) | Use of aryloxyalkyl substituted cyclic amines as calcium channel antagonists and new phenyloxyalkyl piperidin derivatives | |
JPH0578316A (ja) | 置換n−フエニルピペリジン | |
JPS6412270B2 (ko) | ||
EP0035902B1 (en) | 1-(4-aryl-cyclohexyl)piperidine derivatives | |
US6916822B2 (en) | Phenoxyalkylamine derivatives useful as opioid δ receptor agonists | |
US4411904A (en) | Diphenylpropanamines, compositions thereof and use thereof | |
HU204254B (en) | Process for producing pharmaceutical compositions against diarrohe containing 4-(aroyl-amino)-piperidine-butaminide derivatives and for producing the new 4-(aroyl-amino)-piperidine derivatives | |
HU187480B (en) | Process for producing 1-bracket-4-quinolyl-bracket closed-2-bracket-4-piperidyl-bracket closed-ethanol and 1-bracket-4-quinolyl-bracket closed-3-bracket-4-piperidiyl-bracket closed-propanol and pharmaceutival compositions containing them as active agents | |
JPH06758B2 (ja) | イミダゾール誘導体、その製法およびそれを含有する医薬 | |
US4151286A (en) | N-aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
EP1072594A2 (en) | 4-arylpiperidine derivatives for the treatment of pruritus | |
SE437516B (sv) | Analogiforfarande for framstellning av n-fenyl-n-(4-piperidyl)amidderivat | |
EP0502031B1 (en) | N-substituted azaheterocyclic carboxylic acids and a pharmaceutical composition | |
KR860001904B1 (ko) | N-아릴-α-아미노-카복스아미드의 제조방법 | |
NO155489B (no) | Analogifremgangsmaate for fremstilling av nye 1-(csproeyteinnretning til termisk belegging av metalliske og ikke-metalliske overflater paa et arbeidssykloheksyl)-4-aryl -4-piperidinkarboksylsyrederivater. tykke. |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
EXPY | Cancellation because of completion of term |