JPS6327340B2 - - Google Patents
Info
- Publication number
- JPS6327340B2 JPS6327340B2 JP60026637A JP2663785A JPS6327340B2 JP S6327340 B2 JPS6327340 B2 JP S6327340B2 JP 60026637 A JP60026637 A JP 60026637A JP 2663785 A JP2663785 A JP 2663785A JP S6327340 B2 JPS6327340 B2 JP S6327340B2
- Authority
- JP
- Japan
- Prior art keywords
- acid
- phenolsulfonate
- anhydride
- molar ratio
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000008064 anhydrides Chemical class 0.000 claims abstract description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 10
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims abstract description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 6
- 150000001342 alkaline earth metals Chemical class 0.000 claims abstract description 5
- 239000003513 alkali Substances 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 23
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 18
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 239000002904 solvent Substances 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 12
- 229940044652 phenolsulfonate Drugs 0.000 claims description 12
- 150000008065 acid anhydrides Chemical class 0.000 claims description 6
- 230000007935 neutral effect Effects 0.000 claims description 6
- 238000005185 salting out Methods 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229940044654 phenolsulfonic acid Drugs 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- VMNZSPZHEZLXCQ-UHFFFAOYSA-M potassium;4-hydroxybenzenesulfonate Chemical compound [K+].OC1=CC=C(S([O-])(=O)=O)C=C1 VMNZSPZHEZLXCQ-UHFFFAOYSA-M 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims 1
- AXUYHJMSEJPTPI-UHFFFAOYSA-N azane;4-hydroxybenzenesulfonic acid Chemical compound [NH4+].OC1=CC=C(S([O-])(=O)=O)C=C1 AXUYHJMSEJPTPI-UHFFFAOYSA-N 0.000 abstract 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 239000003880 polar aprotic solvent Substances 0.000 abstract 1
- 150000003871 sulfonates Chemical class 0.000 abstract 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 12
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 6
- 239000012429 reaction media Substances 0.000 description 6
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- YDLQSTFHBCVEJV-UHFFFAOYSA-M sodium;2-(3,5,5-trimethylhexanoyloxy)benzenesulfonate Chemical compound [Na+].CC(C)(C)CC(C)CC(=O)OC1=CC=CC=C1S([O-])(=O)=O YDLQSTFHBCVEJV-UHFFFAOYSA-M 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 4
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 4
- BYMHXIQVEAYSJD-UHFFFAOYSA-M sodium;4-sulfophenolate Chemical compound [Na+].OC1=CC=C(S([O-])(=O)=O)C=C1 BYMHXIQVEAYSJD-UHFFFAOYSA-M 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- SBUVJXWGEPFERU-UHFFFAOYSA-N 3,5,5-trimethylhexanoyl 3,5,5-trimethylhexanoate Chemical compound CC(C)(C)CC(C)CC(=O)OC(=O)CC(C)CC(C)(C)C SBUVJXWGEPFERU-UHFFFAOYSA-N 0.000 description 2
- 239000005643 Pelargonic acid Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- PBBAFLCORNAZCD-UHFFFAOYSA-N nonanoyl nonanoate Chemical compound CCCCCCCCC(=O)OC(=O)CCCCCCCC PBBAFLCORNAZCD-UHFFFAOYSA-N 0.000 description 2
- 229960002446 octanoic acid Drugs 0.000 description 2
- RAFYDKXYXRZODZ-UHFFFAOYSA-N octanoyl octanoate Chemical compound CCCCCCCC(=O)OC(=O)CCCCCCC RAFYDKXYXRZODZ-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- PEVPCUFZCODDGN-UHFFFAOYSA-M sodium;2-dodecanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O PEVPCUFZCODDGN-UHFFFAOYSA-M 0.000 description 2
- PHIMXFJEDZOCMI-UHFFFAOYSA-M sodium;2-hexanoyloxy-3,4,5-trimethylbenzenesulfonate Chemical compound [Na+].CCCCCC(=O)OC1=C(C)C(C)=C(C)C=C1S([O-])(=O)=O PHIMXFJEDZOCMI-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- OJEWIWBDGBRNFP-UHFFFAOYSA-N 2,2,3-trimethylhexanoic acid Chemical compound CCCC(C)C(C)(C)C(O)=O OJEWIWBDGBRNFP-UHFFFAOYSA-N 0.000 description 1
- OILUAKBAMVLXGF-UHFFFAOYSA-N 3,5,5-trimethyl-hexanoic acid Chemical compound OC(=O)CC(C)CC(C)(C)C OILUAKBAMVLXGF-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- AWQSAIIDOMEEOD-UHFFFAOYSA-N 5,5-Dimethyl-4-(3-oxobutyl)dihydro-2(3H)-furanone Chemical compound CC(=O)CCC1CC(=O)OC1(C)C AWQSAIIDOMEEOD-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical compound OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- ONMOULMPIIOVTQ-UHFFFAOYSA-N 98-47-5 Chemical group OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 ONMOULMPIIOVTQ-UHFFFAOYSA-N 0.000 description 1
- ZYCHKMJJSBYZOM-UHFFFAOYSA-M C(CCCCCCCCCCC)(=O)OC(CCCCCCCCCCC)=O.C(CCCCCCCCCCC)(=O)OC1=C(C=CC=C1)S(=O)(=O)[O-].[Na+] Chemical compound C(CCCCCCCCCCC)(=O)OC(CCCCCCCCCCC)=O.C(CCCCCCCCCCC)(=O)OC1=C(C=CC=C1)S(=O)(=O)[O-].[Na+] ZYCHKMJJSBYZOM-UHFFFAOYSA-M 0.000 description 1
- 239000005632 Capric acid (CAS 334-48-5) Substances 0.000 description 1
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- YVMPTKYUUVYWNI-UHFFFAOYSA-N N,N-dimethylacetamide N,N-dimethylformamide 1-methylpyrrolidin-2-one methylsulfinylmethane Chemical compound CN1C(CCC1)=O.C(C)(=O)N(C)C.C(=O)N(C)C.CS(=O)C YVMPTKYUUVYWNI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- -1 Sodium octanoyloxybenzenesulfonate Octanoic anhydride Chemical compound 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- NWADXBLMWHFGGU-UHFFFAOYSA-N dodecanoic anhydride Chemical compound CCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCC NWADXBLMWHFGGU-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- PXDLHKPVKLUIJV-UHFFFAOYSA-M sodium;2-octanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O PXDLHKPVKLUIJV-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Medicines Containing Plant Substances (AREA)
- Saccharide Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8402398A FR2559768B1 (fr) | 1984-02-17 | 1984-02-17 | Procede de preparation de para-acyloxybenzenesulfonate par catalyse acide |
| FR84.02398 | 1984-02-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS60202856A JPS60202856A (ja) | 1985-10-14 |
| JPS6327340B2 true JPS6327340B2 (Direct) | 1988-06-02 |
Family
ID=9301117
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP60026637A Granted JPS60202856A (ja) | 1984-02-17 | 1985-02-15 | 酸触媒によるパラ−アシルオキシベンゼンスルホン酸塩の製造方法 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4588532A (Direct) |
| EP (1) | EP0153222B1 (Direct) |
| JP (1) | JPS60202856A (Direct) |
| AT (1) | ATE24313T1 (Direct) |
| BR (1) | BR8500715A (Direct) |
| DE (1) | DE3560032D1 (Direct) |
| DK (1) | DK71485A (Direct) |
| ES (1) | ES540435A0 (Direct) |
| FI (1) | FI80672C (Direct) |
| FR (1) | FR2559768B1 (Direct) |
| GR (1) | GR850408B (Direct) |
| NO (1) | NO160134C (Direct) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2559769B1 (fr) * | 1984-02-17 | 1986-06-13 | Rhone Poulenc Chim Base | Procede de preparation de para acyloxybenzenesulfonate par catalyse basique |
| DE3538141A1 (de) * | 1985-10-26 | 1987-04-30 | Hoechst Ag | Kontinuierliches verfahren zur herstellung von acyloxybenzolsulfonsaeuren |
| GB8531392D0 (en) * | 1985-12-20 | 1986-02-05 | Unilever Plc | Sulphonated aromated esters |
| US4735740A (en) * | 1986-10-03 | 1988-04-05 | The Clorox Company | Diperoxyacid precursors and method |
| ATE65495T1 (de) * | 1986-12-05 | 1991-08-15 | Interox Chemicals Ltd | Esterherstellung. |
| GB8712909D0 (en) * | 1987-06-02 | 1987-07-08 | Interox Chemicals Ltd | Preparation of esters |
| US5078907A (en) * | 1989-11-01 | 1992-01-07 | Lever Brothers Company, Division Of Conopco, Inc. | Unsymmetrical dicarboxylic esters as bleach precursors |
| GB9726246D0 (en) * | 1997-12-11 | 1998-02-11 | Ass Octel | Preparation of esters |
| US6218555B1 (en) | 1999-09-03 | 2001-04-17 | Eastman Chemical Company | Process for the preparation of alkanoyloxy-benzenesulfonic acids and salts thereof |
| US6448430B1 (en) | 1999-09-10 | 2002-09-10 | Eastman Chemical Company | Process for the preparation of aryl carboxylate esters |
| US6448431B1 (en) | 1999-09-13 | 2002-09-10 | Eastman Chemical Company | Production of aryl carboxylate esters |
| US6790981B2 (en) * | 2002-12-13 | 2004-09-14 | Clariant Finance (Bvi) Limited | Process for the preparation of acyloxybenzenesulfonates |
| DE10300981A1 (de) * | 2003-01-14 | 2004-07-22 | Clariant Gmbh | Verfahren zur Herstellung von Acyloxybenzolsulfonaten |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US628503A (en) * | 1898-02-10 | 1899-07-11 | Ernst Twitchell | Fatty aromatic sulfo compound and process of making same. |
| US1642595A (en) * | 1925-05-18 | 1927-09-13 | Petroff Grigori | Process for obtaining sulpho-aromatic fatty acids |
| GB363770A (en) * | 1929-10-29 | 1931-12-31 | Chem Ind Basel | Manufacture of new sulphonation products |
| US3056818A (en) * | 1955-10-13 | 1962-10-02 | Goodrich Co B F | Titanium and zirconium esterification catalysts |
| US3383396A (en) * | 1963-10-30 | 1968-05-14 | Lever Brothers Ltd | Preparation of surface-active agents using a dissolved zirconium catalyst |
| US3394155A (en) * | 1964-05-22 | 1968-07-23 | Lever Brothers Ltd | Preparation of surface-active agents |
| US3636016A (en) * | 1969-05-28 | 1972-01-18 | Continental Oil Co | Surface active agents |
| US3775445A (en) * | 1972-01-14 | 1973-11-27 | Continental Oil Co | Surface active agents |
| GB1519351A (en) * | 1975-01-29 | 1978-07-26 | Unilever Ltd | Preparation of acetoxy arylene sulphonates |
| ATE35978T1 (de) * | 1982-09-28 | 1988-08-15 | Procter & Gamble | Synthese von esterderivaten von hydrophilen phenolen. |
-
1984
- 1984-02-17 FR FR8402398A patent/FR2559768B1/fr not_active Expired
-
1985
- 1985-02-08 EP EP85400208A patent/EP0153222B1/fr not_active Expired
- 1985-02-08 DE DE8585400208T patent/DE3560032D1/de not_active Expired
- 1985-02-08 AT AT85400208T patent/ATE24313T1/de not_active IP Right Cessation
- 1985-02-15 ES ES540435A patent/ES540435A0/es active Granted
- 1985-02-15 JP JP60026637A patent/JPS60202856A/ja active Granted
- 1985-02-15 FI FI850636A patent/FI80672C/fi not_active IP Right Cessation
- 1985-02-15 BR BR8500715A patent/BR8500715A/pt unknown
- 1985-02-15 NO NO850593A patent/NO160134C/no unknown
- 1985-02-15 GR GR850408A patent/GR850408B/el unknown
- 1985-02-15 DK DK71485A patent/DK71485A/da not_active Application Discontinuation
- 1985-02-19 US US06/702,733 patent/US4588532A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DE3560032D1 (en) | 1987-01-29 |
| FI850636L (fi) | 1985-08-18 |
| NO160134B (no) | 1988-12-05 |
| ES8602628A1 (es) | 1985-12-01 |
| BR8500715A (pt) | 1985-10-08 |
| ES540435A0 (es) | 1985-12-01 |
| FR2559768B1 (fr) | 1986-06-13 |
| GR850408B (Direct) | 1985-06-17 |
| EP0153222B1 (fr) | 1986-12-17 |
| FI850636A0 (fi) | 1985-02-15 |
| ATE24313T1 (de) | 1987-01-15 |
| DK71485A (da) | 1985-08-18 |
| FI80672B (fi) | 1990-03-30 |
| DK71485D0 (da) | 1985-02-15 |
| EP0153222A1 (fr) | 1985-08-28 |
| FR2559768A1 (fr) | 1985-08-23 |
| NO850593L (no) | 1985-08-19 |
| US4588532A (en) | 1986-05-13 |
| FI80672C (fi) | 1990-07-10 |
| NO160134C (no) | 1989-03-15 |
| JPS60202856A (ja) | 1985-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6327341B2 (Direct) | ||
| JPS6327340B2 (Direct) | ||
| JPS59144734A (ja) | 親水性フエノ−ルエステル誘導体の合成法 | |
| US5069828A (en) | Process for preparing benzenesulfonate salts | |
| CA2170486C (en) | Synthesis of amido acids from carboxylic acids and lactams | |
| WO1995007882A1 (en) | Synthesis of amido acids from carboxylic acid esters and amino acid salts | |
| JPH078847B2 (ja) | スルホフエニルエステルの製法 | |
| US6448430B1 (en) | Process for the preparation of aryl carboxylate esters | |
| US6448431B1 (en) | Production of aryl carboxylate esters | |
| US6639096B2 (en) | Process for the preparation of acyloxybenzenesulfonates | |
| JPH11501314A (ja) | スチルベンジカルボン酸のエステル類の調製方法 | |
| US6313342B1 (en) | Synthesis of esters of mercaptocarboxylic acids | |
| EP0563986A2 (en) | Process for selective hydrodefluorination | |
| US6822113B2 (en) | Process for preparing acyloxybenzenesulfonates | |
| KR100593529B1 (ko) | 에스테르계 표백활성화제 화합물의 제조방법 | |
| EP1208076B1 (en) | Process for the preparation of alkanoyloxy-benzenesulfonic acids and salts thereof | |
| CA1180030A (en) | Process for the production of 2,6-dichloro-5-hydroxy- aniline | |
| EP0525066A4 (en) | Preparation of 3,4,6-trifluorophthalic acid | |
| JP2003238519A (ja) | スルホン酸無水物の製造方法 | |
| JP2005154294A (ja) | カルボン酸の回収方法 | |
| MXPA00008449A (es) | Proceso para la preparacion de esteres de carboxilato de arilo |