JPS6113223B2 - - Google Patents
Info
- Publication number
- JPS6113223B2 JPS6113223B2 JP51069648A JP6964876A JPS6113223B2 JP S6113223 B2 JPS6113223 B2 JP S6113223B2 JP 51069648 A JP51069648 A JP 51069648A JP 6964876 A JP6964876 A JP 6964876A JP S6113223 B2 JPS6113223 B2 JP S6113223B2
- Authority
- JP
- Japan
- Prior art keywords
- material according
- electrophotographic copying
- electrophotographic
- copying material
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 23
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 16
- 230000003595 spectral effect Effects 0.000 claims description 14
- 238000007639 printing Methods 0.000 claims description 13
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 11
- 229910052782 aluminium Inorganic materials 0.000 claims description 11
- -1 benzthiazolyl amino group Chemical group 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 10
- 239000000758 substrate Substances 0.000 claims description 9
- 239000011888 foil Substances 0.000 claims description 8
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- MPVDXIMFBOLMNW-ISLYRVAYSA-N 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonic acid Chemical compound OC1=CC=C2C=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=C1\N=N\C1=CC=CC=C1 MPVDXIMFBOLMNW-ISLYRVAYSA-N 0.000 claims description 3
- 238000010521 absorption reaction Methods 0.000 claims description 3
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 2
- 125000001041 indolyl group Chemical group 0.000 claims description 2
- 230000001235 sensitizing effect Effects 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 230000002195 synergetic effect Effects 0.000 claims 1
- 239000000975 dye Substances 0.000 description 15
- 230000035945 sensitivity Effects 0.000 description 14
- 238000007334 copolymerization reaction Methods 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 229920005989 resin Polymers 0.000 description 7
- 239000011347 resin Substances 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Substances [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 5
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 5
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 5
- KKAJSJJFBSOMGS-UHFFFAOYSA-N 3,6-diamino-10-methylacridinium chloride Chemical compound [Cl-].C1=C(N)C=C2[N+](C)=C(C=C(N)C=C3)C3=CC2=C1 KKAJSJJFBSOMGS-UHFFFAOYSA-N 0.000 description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 4
- DPKHZNPWBDQZCN-UHFFFAOYSA-N acridine orange free base Chemical compound C1=CC(N(C)C)=CC2=NC3=CC(N(C)C)=CC=C3C=C21 DPKHZNPWBDQZCN-UHFFFAOYSA-N 0.000 description 4
- BGLGAKMTYHWWKW-UHFFFAOYSA-N acridine yellow Chemical compound [H+].[Cl-].CC1=C(N)C=C2N=C(C=C(C(C)=C3)N)C3=CC2=C1 BGLGAKMTYHWWKW-UHFFFAOYSA-N 0.000 description 4
- DZBUGLKDJFMEHC-UHFFFAOYSA-N benzoquinolinylidene Natural products C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 206010070834 Sensitisation Diseases 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 230000008313 sensitization Effects 0.000 description 3
- LORKUZBPMQEQET-UHFFFAOYSA-M (2e)-1,3,3-trimethyl-2-[(2z)-2-(1-methyl-2-phenylindol-1-ium-3-ylidene)ethylidene]indole;chloride Chemical compound [Cl-].CC1(C)C2=CC=CC=C2N(C)\C1=C/C=C(C1=CC=CC=C1[N+]=1C)/C=1C1=CC=CC=C1 LORKUZBPMQEQET-UHFFFAOYSA-M 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- 238000007644 letterpress printing Methods 0.000 description 2
- 230000036211 photosensitivity Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- GUEIZVNYDFNHJU-UHFFFAOYSA-N quinizarin Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC=C2O GUEIZVNYDFNHJU-UHFFFAOYSA-N 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 1
- IOOMXAQUNPWDLL-UHFFFAOYSA-N 2-[6-(diethylamino)-3-(diethyliminiumyl)-3h-xanthen-9-yl]-5-sulfobenzene-1-sulfonate Chemical compound C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S(O)(=O)=O)C=C1S([O-])(=O)=O IOOMXAQUNPWDLL-UHFFFAOYSA-N 0.000 description 1
- PGMMQIGGQSIEGH-UHFFFAOYSA-N 2-ethenyl-1,3-oxazole Chemical class C=CC1=NC=CO1 PGMMQIGGQSIEGH-UHFFFAOYSA-N 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- RBTBFTRPCNLSDE-UHFFFAOYSA-N 3,7-bis(dimethylamino)phenothiazin-5-ium Chemical compound C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 RBTBFTRPCNLSDE-UHFFFAOYSA-N 0.000 description 1
- IHZXTIBMKNSJCJ-UHFFFAOYSA-N 3-{[(4-{[4-(dimethylamino)phenyl](4-{ethyl[(3-sulfophenyl)methyl]amino}phenyl)methylidene}cyclohexa-2,5-dien-1-ylidene)(ethyl)azaniumyl]methyl}benzene-1-sulfonate Chemical compound C=1C=C(C(=C2C=CC(C=C2)=[N+](C)C)C=2C=CC(=CC=2)N(CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S(O)(=O)=O)=C1 IHZXTIBMKNSJCJ-UHFFFAOYSA-N 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- JSQFXMIMWAKJQJ-UHFFFAOYSA-N [9-(2-carboxyphenyl)-6-(ethylamino)xanthen-3-ylidene]-diethylazanium;chloride Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(NCC)=CC=C2C=1C1=CC=CC=C1C(O)=O JSQFXMIMWAKJQJ-UHFFFAOYSA-N 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000999 acridine dye Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- 238000002048 anodisation reaction Methods 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical group C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- VYXSBFYARXAAKO-WTKGSRSZSA-N chembl402140 Chemical compound Cl.C1=2C=C(C)C(NCC)=CC=2OC2=C\C(=N/CC)C(C)=CC2=C1C1=CC=CC=C1C(=O)OCC VYXSBFYARXAAKO-WTKGSRSZSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- CEJANLKHJMMNQB-UHFFFAOYSA-M cryptocyanin Chemical compound [I-].C12=CC=CC=C2N(CC)C=CC1=CC=CC1=CC=[N+](CC)C2=CC=CC=C12 CEJANLKHJMMNQB-UHFFFAOYSA-M 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- ZXJXZNDDNMQXFV-UHFFFAOYSA-M crystal violet Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 ZXJXZNDDNMQXFV-UHFFFAOYSA-M 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- YQGOJNYOYNNSMM-UHFFFAOYSA-N eosin Chemical compound [Na+].OC(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C(O)=C(Br)C=C21 YQGOJNYOYNNSMM-UHFFFAOYSA-N 0.000 description 1
- SEACYXSIPDVVMV-UHFFFAOYSA-L eosin Y Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C([O-])=C(Br)C=C21 SEACYXSIPDVVMV-UHFFFAOYSA-L 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- GVKCHTBDSMQENH-UHFFFAOYSA-L phloxine B Chemical compound [Na+].[Na+].[O-]C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C([O-])=C(Br)C=C21 GVKCHTBDSMQENH-UHFFFAOYSA-L 0.000 description 1
- QWYZFXLSWMXLDM-UHFFFAOYSA-M pinacyanol iodide Chemical compound [I-].C1=CC2=CC=CC=C2N(CC)C1=CC=CC1=CC=C(C=CC=C2)C2=[N+]1CC QWYZFXLSWMXLDM-UHFFFAOYSA-M 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 150000003219 pyrazolines Chemical class 0.000 description 1
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 1
- 229940043267 rhodamine b Drugs 0.000 description 1
- 238000007788 roughening Methods 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 239000001016 thiazine dye Substances 0.000 description 1
- 239000001003 triarylmethane dye Substances 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 150000001651 triphenylamine derivatives Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000001018 xanthene dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0666—Dyes containing a methine or polymethine group
- G03G5/0668—Dyes containing a methine or polymethine group containing only one methine or polymethine group
- G03G5/067—Dyes containing a methine or polymethine group containing only one methine or polymethine group containing hetero rings
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K3/00—Apparatus or processes for manufacturing printed circuits
- H05K3/02—Apparatus or processes for manufacturing printed circuits in which the conductive material is applied to the surface of the insulating support and is thereafter removed from such areas of the surface which are not intended for current conducting or shielding
- H05K3/06—Apparatus or processes for manufacturing printed circuits in which the conductive material is applied to the surface of the insulating support and is thereafter removed from such areas of the surface which are not intended for current conducting or shielding the conductive material being removed chemically or electrolytically, e.g. by photo-etch process
- H05K3/061—Etching masks
- H05K3/065—Etching masks applied by electrographic, electrophotographic or magnetographic methods
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Printing Plates And Materials Therefor (AREA)
- Liquid Crystal (AREA)
- Light Receiving Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752526720 DE2526720C3 (de) | 1975-06-14 | Material für elektrophotographische Reproduktion |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS522437A JPS522437A (en) | 1977-01-10 |
| JPS6113223B2 true JPS6113223B2 (Direct) | 1986-04-12 |
Family
ID=5949162
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP51069648A Granted JPS522437A (en) | 1975-06-14 | 1976-06-14 | Material for electrophotographic duplication |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4063948A (Direct) |
| JP (1) | JPS522437A (Direct) |
| AT (1) | AT347239B (Direct) |
| AU (1) | AU507694B2 (Direct) |
| BE (1) | BE842889A (Direct) |
| BR (1) | BR7603771A (Direct) |
| CA (1) | CA1084326A (Direct) |
| CH (1) | CH604219A5 (Direct) |
| DK (1) | DK142514C (Direct) |
| ES (1) | ES448823A1 (Direct) |
| FI (1) | FI59681C (Direct) |
| FR (1) | FR2314521A1 (Direct) |
| GB (1) | GB1553696A (Direct) |
| IE (1) | IE42855B1 (Direct) |
| IT (1) | IT1061763B (Direct) |
| LU (1) | LU75147A1 (Direct) |
| NL (1) | NL187249B (Direct) |
| NO (1) | NO142552C (Direct) |
| SE (1) | SE418121B (Direct) |
| ZA (1) | ZA763486B (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02140240U (Direct) * | 1989-04-26 | 1990-11-22 |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2014748B (en) * | 1978-02-07 | 1982-06-16 | Konishiroku Photo Ind | Electrophotographic material for obtaining toner image and process for forming printing plate by using the same |
| DE2817428A1 (de) * | 1978-04-21 | 1979-10-31 | Hoechst Ag | Material fuer elektrophotographische reproduktion |
| US4387149A (en) * | 1978-10-13 | 1983-06-07 | Mitsubishi Paper Mills, Ltd. | Electrophotographic sensitive material having a dye sensitizer containing a carbonium atom |
| JPS5579451A (en) * | 1978-12-12 | 1980-06-14 | Mitsubishi Paper Mills Ltd | Sensitizer for electrophotographic organic photoconductor |
| DE3005695A1 (de) * | 1980-02-15 | 1981-08-20 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung einer flachdruckform auf elektrophotographischem wege |
| DE3024772A1 (de) * | 1980-06-30 | 1982-01-28 | Hoechst Ag, 6000 Frankfurt | Elastische, laminierbare lichtempfindliche schicht |
| DE3210576A1 (de) * | 1982-03-23 | 1983-10-06 | Hoechst Ag | Elektrophotographisches aufzeichnungsmaterial |
| AU2239683A (en) * | 1982-12-16 | 1984-06-21 | Vickers Plc | Photoconductive compositions |
| JPS59216146A (ja) * | 1983-05-24 | 1984-12-06 | Sony Corp | 電子写真用感光材料 |
| DE3319654A1 (de) * | 1983-05-31 | 1984-12-06 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches aufzeichnungsmaterial |
| DE3405487A1 (de) * | 1984-02-16 | 1985-08-22 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches aufzeichnungsmaterial |
| DE3409888A1 (de) * | 1984-03-17 | 1985-09-19 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches aufzeichnungsmaterial und dessen verwendung in einem verfahren zum herstellen einer druckform oder einer gedruckten schaltung |
| DE3417951A1 (de) * | 1984-05-15 | 1985-11-21 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches aufzeichnungsmaterial |
| DE3509147A1 (de) * | 1985-03-14 | 1986-09-18 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches aufzeichnungsmaterial |
| DE3513747A1 (de) * | 1985-04-17 | 1986-10-23 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches aufzeichnungsmaterial |
| DE3541534A1 (de) * | 1985-11-25 | 1987-05-27 | Hoechst Ag | Positiv arbeitendes strahlungsempfindliches gemisch |
| DE3617077A1 (de) * | 1986-05-21 | 1987-11-26 | Hoechst Ag | Emulsion zur nachbehandlung von elektrophotographisch hergestellten flachdruckformen und verfahren zur herstellung der flachdruckplatten |
| DE3627758A1 (de) * | 1986-08-16 | 1988-02-18 | Basf Ag | Verfahren zur herstellung elektrophotographischer aufzeichnungselemente |
| DE3627757A1 (de) * | 1986-08-16 | 1988-02-18 | Basf Ag | Verfahren zur herstellung von flachdruckplatten |
| DE3832903A1 (de) * | 1987-09-29 | 1989-04-06 | Fuji Photo Film Co Ltd | Elektrophotographische druckplatte |
| DE3800617A1 (de) * | 1988-01-12 | 1989-07-20 | Hoechst Ag | Elektrophotographisches aufzeichnungsmaterial |
| JPH01158456A (ja) * | 1988-09-30 | 1989-06-21 | Ricoh Co Ltd | 画像記録方法 |
| DE4118434C2 (de) * | 1990-06-06 | 1996-01-04 | Mitsubishi Paper Mills Ltd | Verfahren zur elektrophotographischen Umkehr-Naßentwicklung |
| US5494764A (en) * | 1992-03-26 | 1996-02-27 | Mitsubishi Paper Mills Limited | Method for making printed circuit boards |
| US6645685B2 (en) * | 2000-09-06 | 2003-11-11 | Mitsubishi Paper Mills Limited | Process for producing printed wiring board |
| US20050091060A1 (en) * | 2003-10-23 | 2005-04-28 | Wing Thomas W. | Hearing aid for increasing voice recognition through voice frequency downshift and/or voice substitution |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2639282A (en) * | 1949-09-29 | 1953-05-19 | Eastman Kodak Co | Resin-dyes of the cyanine type |
| US2974141A (en) * | 1958-12-17 | 1961-03-07 | Gen Aniline & Film Corp | P-(2-pyrazolin-1-yl) styryl dyes |
| BE606888A (Direct) * | 1960-08-05 | 1900-01-01 | ||
| US3287114A (en) * | 1961-07-24 | 1966-11-22 | Azoplate Corp | Process for the sensitization of photoconductors |
| US3666464A (en) * | 1967-04-26 | 1972-05-30 | Itek Corp | Dye-sensitized photosensitive materials having improved photographic speed |
| JPS4946264B1 (Direct) * | 1969-01-17 | 1974-12-09 | ||
| JPS492638B1 (Direct) * | 1970-11-17 | 1974-01-22 | ||
| DE2214054A1 (de) * | 1972-03-23 | 1973-09-27 | Agfa Gevaert Ag | Sensibilisierte elektrophotographische schichten |
| JPS5531463B2 (Direct) * | 1972-05-31 | 1980-08-18 |
-
1976
- 1976-06-09 AU AU14749/76A patent/AU507694B2/en not_active Expired
- 1976-06-10 US US05/694,712 patent/US4063948A/en not_active Expired - Lifetime
- 1976-06-10 CH CH735576A patent/CH604219A5/xx not_active IP Right Cessation
- 1976-06-11 NL NLAANVRAGE7606342,A patent/NL187249B/xx not_active IP Right Cessation
- 1976-06-11 CA CA254,670A patent/CA1084326A/en not_active Expired
- 1976-06-11 DK DK260076A patent/DK142514C/da not_active IP Right Cessation
- 1976-06-11 BE BE167876A patent/BE842889A/xx not_active IP Right Cessation
- 1976-06-11 GB GB24309/76A patent/GB1553696A/en not_active Expired
- 1976-06-11 LU LU75147A patent/LU75147A1/xx unknown
- 1976-06-11 ES ES448823A patent/ES448823A1/es not_active Expired
- 1976-06-11 SE SE7606661A patent/SE418121B/xx not_active IP Right Cessation
- 1976-06-11 NO NO762039A patent/NO142552C/no unknown
- 1976-06-11 BR BR7603771A patent/BR7603771A/pt unknown
- 1976-06-11 FR FR7617720A patent/FR2314521A1/fr active Granted
- 1976-06-11 IT IT49909/76A patent/IT1061763B/it active
- 1976-06-11 ZA ZA763486A patent/ZA763486B/xx unknown
- 1976-06-11 FI FI761678A patent/FI59681C/fi not_active IP Right Cessation
- 1976-06-11 IE IE1263/76A patent/IE42855B1/en unknown
- 1976-06-14 JP JP51069648A patent/JPS522437A/ja active Granted
- 1976-06-14 AT AT433576A patent/AT347239B/de not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02140240U (Direct) * | 1989-04-26 | 1990-11-22 |
Also Published As
| Publication number | Publication date |
|---|---|
| IE42855L (en) | 1976-12-14 |
| DE2526720A1 (de) | 1976-12-16 |
| SE418121B (sv) | 1981-05-04 |
| NO762039L (Direct) | 1976-12-15 |
| AU507694B2 (en) | 1980-02-21 |
| FR2314521B1 (Direct) | 1983-01-28 |
| CH604219A5 (Direct) | 1978-08-31 |
| FR2314521A1 (fr) | 1977-01-07 |
| NO142552C (no) | 1980-09-03 |
| AT347239B (de) | 1978-12-11 |
| NL7606342A (nl) | 1976-12-16 |
| FI761678A7 (Direct) | 1976-12-15 |
| DK142514B (da) | 1980-11-10 |
| LU75147A1 (Direct) | 1978-01-18 |
| GB1553696A (en) | 1979-09-26 |
| IE42855B1 (en) | 1980-11-05 |
| BR7603771A (pt) | 1977-02-08 |
| FI59681C (fi) | 1981-09-10 |
| DK142514C (da) | 1981-06-29 |
| BE842889A (fr) | 1976-12-13 |
| SE7606661L (sv) | 1976-12-15 |
| CA1084326A (en) | 1980-08-26 |
| DE2526720B2 (de) | 1977-06-30 |
| NL187249B (nl) | 1991-02-18 |
| IT1061763B (it) | 1983-04-30 |
| ATA433576A (de) | 1978-04-15 |
| NO142552B (no) | 1980-05-27 |
| ES448823A1 (es) | 1977-12-01 |
| FI59681B (fi) | 1981-05-29 |
| AU1474976A (en) | 1977-12-15 |
| US4063948A (en) | 1977-12-20 |
| JPS522437A (en) | 1977-01-10 |
| DK260076A (da) | 1976-12-15 |
| ZA763486B (en) | 1977-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6113223B2 (Direct) | ||
| US3112197A (en) | Electrophotographic member | |
| US4327169A (en) | Infrared sensitive photoconductive composition, elements and imaging method using trimethine thiopyrylium dye | |
| DE1058836B (de) | Material fuer elektrophotographische Reproduktion | |
| JPS59131655A (ja) | 光導電性組成物及びその利用 | |
| JPS632052A (ja) | 光電写真要素及び光電写真法 | |
| JPS61243457A (ja) | 電子写真記録材料 | |
| JPH037107B2 (Direct) | ||
| US4528256A (en) | Electrophotographic recording material with condensation product | |
| JPH01216362A (ja) | 電子写真記録材料 | |
| JPS61241764A (ja) | 電子写真記録材料 | |
| JPH0230502B2 (Direct) | ||
| JPH0230500B2 (Direct) | ||
| JPS6064355A (ja) | 改善された光感度を有する電子写真記録材料 | |
| JPH0442669B2 (Direct) | ||
| GB1582199A (en) | Process for the preparation of printing forms | |
| DE2526720C3 (de) | Material für elektrophotographische Reproduktion | |
| US4562134A (en) | Electrophotographic material with cyanine sensitizer with betaine group | |
| EP0194624B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| JPH0447312B2 (Direct) | ||
| JPS606512B2 (ja) | 印刷版の製造法 | |
| JPS60191271A (ja) | 電子写真記録材料 | |
| IE45176B1 (en) | Process for the preparation of printing forms | |
| JPS60243668A (ja) | 電子写真製版用印刷原版 | |
| NO142939B (no) | Anordning ved endotrachealslanger. |