JPS6018654B2 - イミダゾ−ル誘導体の製法 - Google Patents
イミダゾ−ル誘導体の製法Info
- Publication number
- JPS6018654B2 JPS6018654B2 JP50044147A JP4414775A JPS6018654B2 JP S6018654 B2 JPS6018654 B2 JP S6018654B2 JP 50044147 A JP50044147 A JP 50044147A JP 4414775 A JP4414775 A JP 4414775A JP S6018654 B2 JPS6018654 B2 JP S6018654B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- phenyl
- atoms
- ether
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 63
- 125000004432 carbon atom Chemical group C* 0.000 claims description 49
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 3
- 150000002460 imidazoles Chemical class 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 108
- 238000002844 melting Methods 0.000 description 89
- 230000008018 melting Effects 0.000 description 89
- -1 isobentyl group Chemical group 0.000 description 60
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 59
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 29
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 23
- IRSVDHPYXFLLDS-UHFFFAOYSA-N 2,4-dichloro-1-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1Cl IRSVDHPYXFLLDS-UHFFFAOYSA-N 0.000 description 22
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 22
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 20
- 239000012312 sodium hydride Substances 0.000 description 20
- 229910000104 sodium hydride Inorganic materials 0.000 description 20
- 239000000047 product Substances 0.000 description 19
- 238000001704 evaporation Methods 0.000 description 17
- 239000002904 solvent Substances 0.000 description 16
- 239000000725 suspension Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 238000001035 drying Methods 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- 239000012053 oil suspension Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- 239000003513 alkali Substances 0.000 description 8
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 5
- IVQSHLZYFAKTMH-UHFFFAOYSA-N 4-(1h-imidazol-2-ylmethyl)phenol Chemical compound C1=CC(O)=CC=C1CC1=NC=CN1 IVQSHLZYFAKTMH-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- BXCBUWKTXLWPSB-UHFFFAOYSA-N 1-(chloromethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1CCl BXCBUWKTXLWPSB-UHFFFAOYSA-N 0.000 description 3
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 3
- YNCPXBIZAPNQIJ-UHFFFAOYSA-N 1h-imidazole;sodium Chemical compound [Na].C1=CNC=N1 YNCPXBIZAPNQIJ-UHFFFAOYSA-N 0.000 description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 3
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Natural products C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000001119 stannous chloride Substances 0.000 description 3
- 235000011150 stannous chloride Nutrition 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- SSGARGHTNKIJFT-UHFFFAOYSA-N 2-imidazol-1-ylbenzenethiol Chemical compound SC1=CC=CC=C1N1C=NC=C1 SSGARGHTNKIJFT-UHFFFAOYSA-N 0.000 description 2
- AULKDLUOQCUNOK-UHFFFAOYSA-N 3,5-dichloro-4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(O)C(Cl)=C1 AULKDLUOQCUNOK-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- NTPLXRHDUXRPNE-UHFFFAOYSA-N 4-methoxyacetophenone Chemical compound COC1=CC=C(C(C)=O)C=C1 NTPLXRHDUXRPNE-UHFFFAOYSA-N 0.000 description 2
- NKBASRXWGAGQDP-UHFFFAOYSA-N 5-chlorosalicylic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1O NKBASRXWGAGQDP-UHFFFAOYSA-N 0.000 description 2
- 241000222122 Candida albicans Species 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- YVBSAPDHRXHFHV-UHFFFAOYSA-N [chloro(methoxy)methyl]benzene Chemical compound COC(Cl)C1=CC=CC=C1 YVBSAPDHRXHFHV-UHFFFAOYSA-N 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 229940095731 candida albicans Drugs 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 230000009897 systematic effect Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GNLJBJNONOOOQC-UHFFFAOYSA-N $l^{3}-carbane;magnesium Chemical compound [Mg]C GNLJBJNONOOOQC-UHFFFAOYSA-N 0.000 description 1
- OMWSZDODENFLSV-UHFFFAOYSA-N (5-chloro-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 OMWSZDODENFLSV-UHFFFAOYSA-N 0.000 description 1
- PMRFBLQVGJNGLU-UHFFFAOYSA-N -form-1-(4-Hydroxyphenyl)ethanol Natural products CC(O)C1=CC=C(O)C=C1 PMRFBLQVGJNGLU-UHFFFAOYSA-N 0.000 description 1
- AIPJZPPOFWCJRC-UHFFFAOYSA-N 1,2-dichloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1Cl AIPJZPPOFWCJRC-UHFFFAOYSA-N 0.000 description 1
- LBOBESSDSGODDD-UHFFFAOYSA-N 1,3-dichloro-2-(chloromethyl)benzene Chemical compound ClCC1=C(Cl)C=CC=C1Cl LBOBESSDSGODDD-UHFFFAOYSA-N 0.000 description 1
- SVYOXGBINYWSDQ-UHFFFAOYSA-N 1,4-dioxane;ethanol Chemical compound CCO.C1COCCO1 SVYOXGBINYWSDQ-UHFFFAOYSA-N 0.000 description 1
- WQXWBFZMJXEMAV-UHFFFAOYSA-N 1-(2-methoxy-5-nitrophenyl)imidazole Chemical compound COC1=CC=C([N+]([O-])=O)C=C1N1C=NC=C1 WQXWBFZMJXEMAV-UHFFFAOYSA-N 0.000 description 1
- UFXRSQDZZKCBBQ-UHFFFAOYSA-N 1-(2-methoxyphenyl)imidazole Chemical compound COC1=CC=CC=C1N1C=NC=C1 UFXRSQDZZKCBBQ-UHFFFAOYSA-N 0.000 description 1
- WBPAOUHWPONFEQ-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C(Cl)=C1 WBPAOUHWPONFEQ-UHFFFAOYSA-N 0.000 description 1
- SKYCJQPITLYDOT-UHFFFAOYSA-N 1-(4-chlorobutan-2-yl)-4-methoxybenzene Chemical compound COC1=CC=C(C(C)CCCl)C=C1 SKYCJQPITLYDOT-UHFFFAOYSA-N 0.000 description 1
- PUCOOPJLAXJKOO-UHFFFAOYSA-N 1-(4-nitrophenyl)imidazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1C=NC=C1 PUCOOPJLAXJKOO-UHFFFAOYSA-N 0.000 description 1
- ZZZMTODMWVRWSP-UHFFFAOYSA-N 1-(5-chloro-2-methoxyphenyl)imidazole Chemical compound COC1=CC=C(Cl)C=C1N1C=NC=C1 ZZZMTODMWVRWSP-UHFFFAOYSA-N 0.000 description 1
- XGASTRVQNVVYIZ-UHFFFAOYSA-N 1-(chloromethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCl)=C1 XGASTRVQNVVYIZ-UHFFFAOYSA-N 0.000 description 1
- HUFKNBOVMCCGNV-UHFFFAOYSA-N 1-[1-[2-[(2,4-dichlorophenyl)methoxy]phenyl]ethyl]imidazole Chemical compound C1=CN=CN1C(C)C1=CC=CC=C1OCC1=CC=C(Cl)C=C1Cl HUFKNBOVMCCGNV-UHFFFAOYSA-N 0.000 description 1
- TZPAQISMEALVBV-UHFFFAOYSA-N 1-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethyl]imidazole Chemical compound C1=CN=CN1C(C)C(C=C1)=CC=C1OCC1=CC=C(Cl)C=C1Cl TZPAQISMEALVBV-UHFFFAOYSA-N 0.000 description 1
- APCWYOVODDDRAU-UHFFFAOYSA-N 1-[2-[(2,4-dichlorophenyl)methoxy]phenyl]heptan-1-ol Chemical compound CCCCCCC(O)C1=CC=CC=C1OCC1=CC=C(Cl)C=C1Cl APCWYOVODDDRAU-UHFFFAOYSA-N 0.000 description 1
- QSYSTOPMTCXJME-UHFFFAOYSA-N 1-[2-[(2,4-dichlorophenyl)methoxy]phenyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1COC1=CC=CC=C1N1C=NC=C1 QSYSTOPMTCXJME-UHFFFAOYSA-N 0.000 description 1
- KXRMJRVJSHLNKT-UHFFFAOYSA-N 1-[2-[[(2-imidazol-1-ylphenyl)-(2-nitrophenyl)methoxy]-(2-nitrophenyl)methyl]phenyl]imidazole Chemical compound [O-][N+](=O)C1=CC=CC=C1C(C=1C(=CC=CC=1)N1C=NC=C1)OC(C=1C(=CC=CC=1)[N+]([O-])=O)C1=CC=CC=C1N1C=NC=C1 KXRMJRVJSHLNKT-UHFFFAOYSA-N 0.000 description 1
- KGZPXYLIJGEBSE-UHFFFAOYSA-N 1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1COC1=CC=C(N2C=NC=C2)C=C1 KGZPXYLIJGEBSE-UHFFFAOYSA-N 0.000 description 1
- DDGRAFHHXYIQQR-UHFFFAOYSA-N 1-chloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1 DDGRAFHHXYIQQR-UHFFFAOYSA-N 0.000 description 1
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N 1-propanol Substances CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- JDIIGWSSTNUWGK-UHFFFAOYSA-N 1h-imidazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1C=CN=C1 JDIIGWSSTNUWGK-UHFFFAOYSA-N 0.000 description 1
- UVGQZKHVWWVSGS-UHFFFAOYSA-N 2-(1-phenylethyl)-1h-imidazole Chemical compound C=1C=CC=CC=1C(C)C1=NC=CN1 UVGQZKHVWWVSGS-UHFFFAOYSA-N 0.000 description 1
- KSKKEMJYPOUZKJ-UHFFFAOYSA-N 2-(1h-imidazol-2-ylmethyl)aniline Chemical compound NC1=CC=CC=C1CC1=NC=CN1 KSKKEMJYPOUZKJ-UHFFFAOYSA-N 0.000 description 1
- KPBKFEFUHSYUHE-UHFFFAOYSA-N 2-(1h-imidazol-2-ylmethyl)phenol Chemical compound OC1=CC=CC=C1CC1=NC=CN1 KPBKFEFUHSYUHE-UHFFFAOYSA-N 0.000 description 1
- ABFCOJLLBHXNOU-UHFFFAOYSA-N 2-(2-hydroxyphenyl)ethanol Chemical compound OCCC1=CC=CC=C1O ABFCOJLLBHXNOU-UHFFFAOYSA-N 0.000 description 1
- YCCILVSKPBXVIP-UHFFFAOYSA-N 2-(4-hydroxyphenyl)ethanol Chemical compound OCCC1=CC=C(O)C=C1 YCCILVSKPBXVIP-UHFFFAOYSA-N 0.000 description 1
- JXYBKXKGODSOKU-UHFFFAOYSA-N 2-(imidazol-1-ylmethyl)phenol Chemical compound OC1=CC=CC=C1CN1C=NC=C1 JXYBKXKGODSOKU-UHFFFAOYSA-N 0.000 description 1
- DRVFYNTWCAHSSS-UHFFFAOYSA-N 2-[(2,4-dichlorophenyl)methoxy]benzaldehyde Chemical compound ClC1=CC(Cl)=CC=C1COC1=CC=CC=C1C=O DRVFYNTWCAHSSS-UHFFFAOYSA-N 0.000 description 1
- PXZBQPQSNLSDOI-UHFFFAOYSA-N 2-[(4-ethoxyphenyl)methyl]-1h-imidazole Chemical compound C1=CC(OCC)=CC=C1CC1=NC=CN1 PXZBQPQSNLSDOI-UHFFFAOYSA-N 0.000 description 1
- GBBSBEFPASRVJB-UHFFFAOYSA-N 2-[(4-hexoxyphenyl)methyl]-1h-imidazole Chemical compound C1=CC(OCCCCCC)=CC=C1CC1=NC=CN1 GBBSBEFPASRVJB-UHFFFAOYSA-N 0.000 description 1
- SXLLEHZUPZFSPZ-UHFFFAOYSA-N 2-[(4-prop-2-ynoxyphenyl)methyl]-1H-imidazole Chemical compound N1C(=NC=C1)CC1=CC=C(C=C1)OCC#C SXLLEHZUPZFSPZ-UHFFFAOYSA-N 0.000 description 1
- JQMFQLVAJGZSQS-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JQMFQLVAJGZSQS-UHFFFAOYSA-N 0.000 description 1
- PUNUPYJSSNQURU-UHFFFAOYSA-N 2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-1h-imidazole Chemical compound ClC1=CC(Cl)=CC=C1COC1=CC=CC=C1CC1=NC=CN1 PUNUPYJSSNQURU-UHFFFAOYSA-N 0.000 description 1
- ORXKFTZGLMZRCV-UHFFFAOYSA-N 2-[[2-[(3,4-dichlorophenyl)methylsulfanyl]phenyl]methyl]-1h-imidazole Chemical compound C1=C(Cl)C(Cl)=CC=C1CSC1=CC=CC=C1CC1=NC=CN1 ORXKFTZGLMZRCV-UHFFFAOYSA-N 0.000 description 1
- XKUXOKWLAOUOJL-UHFFFAOYSA-N 2-[[3-[(2,4-dichlorophenyl)methoxy]naphthalen-2-yl]methyl]-1h-imidazole Chemical compound ClC1=CC(Cl)=CC=C1COC1=CC2=CC=CC=C2C=C1CC1=NC=CN1 XKUXOKWLAOUOJL-UHFFFAOYSA-N 0.000 description 1
- VXFNWAVIKRPBKC-UHFFFAOYSA-N 2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-1h-imidazole Chemical compound ClC1=CC(Cl)=CC=C1COC1=CC=CC(CC=2NC=CN=2)=C1 VXFNWAVIKRPBKC-UHFFFAOYSA-N 0.000 description 1
- SVISRHZDLDBQIA-UHFFFAOYSA-N 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-1h-imidazole Chemical compound C=1C=C(OCC=2C(=CC(Cl)=CC=2)Cl)C(OC)=CC=1CC1=NC=CN1 SVISRHZDLDBQIA-UHFFFAOYSA-N 0.000 description 1
- LFIBFXYQHXYKAB-UHFFFAOYSA-N 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methyl]-1h-imidazole Chemical compound C=1C=C(OCC=2C(=CC(Cl)=CC=2)Cl)C([N+](=O)[O-])=CC=1CC1=NC=CN1 LFIBFXYQHXYKAB-UHFFFAOYSA-N 0.000 description 1
- LAKDQQZWDRJBSB-UHFFFAOYSA-N 2-[[4-[(4-chlorophenyl)methoxy]phenyl]methyl]-1h-imidazole Chemical compound C1=CC(Cl)=CC=C1COC(C=C1)=CC=C1CC1=NC=CN1 LAKDQQZWDRJBSB-UHFFFAOYSA-N 0.000 description 1
- ORRYBCNKQFMOJZ-UHFFFAOYSA-N 2-[[4-[(4-methoxyphenyl)methoxy]phenyl]methyl]-1h-imidazole Chemical compound C1=CC(OC)=CC=C1COC(C=C1)=CC=C1CC1=NC=CN1 ORRYBCNKQFMOJZ-UHFFFAOYSA-N 0.000 description 1
- BJYDTIJCIPVEES-UHFFFAOYSA-N 2-[[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]-1h-imidazole Chemical compound FC(F)(F)C1=CC=CC(COC=2C=CC(CC=3NC=CN=3)=CC=2)=C1 BJYDTIJCIPVEES-UHFFFAOYSA-N 0.000 description 1
- FKMJEFZPSNTHFQ-UHFFFAOYSA-N 2-benzyl-1h-imidazol-5-ol Chemical class OC1=CNC(CC=2C=CC=CC=2)=N1 FKMJEFZPSNTHFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- MFSJUURIAOOSJR-UHFFFAOYSA-N 2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(C(O)=O)=C1 MFSJUURIAOOSJR-UHFFFAOYSA-N 0.000 description 1
- DLGBEGBHXSAQOC-UHFFFAOYSA-N 2-hydroxy-5-methylbenzoic acid Chemical compound CC1=CC=C(O)C(C(O)=O)=C1 DLGBEGBHXSAQOC-UHFFFAOYSA-N 0.000 description 1
- JWKPNWPBKAKEGL-UHFFFAOYSA-N 2-hydroxybenzaldehyde hydrochloride Chemical compound C(C=1C(O)=CC=CC1)=O.Cl JWKPNWPBKAKEGL-UHFFFAOYSA-N 0.000 description 1
- RGYBCSOONATOIU-UHFFFAOYSA-N 2-imidazol-1-yl-4-methylphenol Chemical compound CC1=CC=C(O)C(N2C=NC=C2)=C1 RGYBCSOONATOIU-UHFFFAOYSA-N 0.000 description 1
- KJEQFYVOKPIWIZ-UHFFFAOYSA-N 2-imidazol-1-yl-4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1N1C=NC=C1 KJEQFYVOKPIWIZ-UHFFFAOYSA-N 0.000 description 1
- HVECTIQVQPUSEX-UHFFFAOYSA-N 2-imidazol-1-ylaniline Chemical compound NC1=CC=CC=C1N1C=NC=C1 HVECTIQVQPUSEX-UHFFFAOYSA-N 0.000 description 1
- POIGXVYPRGOWQD-UHFFFAOYSA-N 2-imidazol-1-ylphenol Chemical compound OC1=CC=CC=C1N1C=NC=C1 POIGXVYPRGOWQD-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YWFIUDNCQMSKNU-UHFFFAOYSA-N 3-(4-methoxyphenyl)butan-1-ol Chemical compound COC1=CC=C(C(C)CCO)C=C1 YWFIUDNCQMSKNU-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- NCUDAHKHCZVAEU-UHFFFAOYSA-N 3-imidazol-1-yl-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1N1C=NC=C1 NCUDAHKHCZVAEU-UHFFFAOYSA-N 0.000 description 1
- CYKCUAPYWQDIKR-UHFFFAOYSA-N 4-(1h-imidazol-1-yl)phenol Chemical compound C1=CC(O)=CC=C1N1C=NC=C1 CYKCUAPYWQDIKR-UHFFFAOYSA-N 0.000 description 1
- HNJCSRMLVWFRPH-UHFFFAOYSA-N 4-(3-imidazol-1-ylpropyl)aniline Chemical compound C1=CC(N)=CC=C1CCCN1C=NC=C1 HNJCSRMLVWFRPH-UHFFFAOYSA-N 0.000 description 1
- WQZZTPSRAJMDMD-UHFFFAOYSA-N 4-chloro-2-[hydroxy(phenyl)methyl]phenol Chemical compound C=1C(Cl)=CC=C(O)C=1C(O)C1=CC=CC=C1 WQZZTPSRAJMDMD-UHFFFAOYSA-N 0.000 description 1
- RYUORQLHTYZCJV-UHFFFAOYSA-N 4-chloro-2-imidazol-1-ylphenol Chemical compound OC1=CC=C(Cl)C=C1N1C=NC=C1 RYUORQLHTYZCJV-UHFFFAOYSA-N 0.000 description 1
- LVOASPZGXNAHJI-UHFFFAOYSA-N 4-imidazol-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1C=NC=C1 LVOASPZGXNAHJI-UHFFFAOYSA-N 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- HIOOFBBNJCVVJZ-UHFFFAOYSA-N 5-methyl-2-sulfanylbenzoic acid Chemical compound CC1=CC=C(S)C(C(O)=O)=C1 HIOOFBBNJCVVJZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KKUZFMJIXIFTND-UHFFFAOYSA-N CCCCCC[Mg] Chemical compound CCCCCC[Mg] KKUZFMJIXIFTND-UHFFFAOYSA-N 0.000 description 1
- 241000283153 Cetacea Species 0.000 description 1
- 241000238557 Decapoda Species 0.000 description 1
- FZNXAQMQVKBXDR-UHFFFAOYSA-N Diamthazole dihydrochloride Chemical compound Cl.Cl.CCN(CC)CCOC1=CC=C2N=C(N(C)C)SC2=C1 FZNXAQMQVKBXDR-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000046146 Pueraria lobata Species 0.000 description 1
- 235000010575 Pueraria lobata Nutrition 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000224526 Trichomonas Species 0.000 description 1
- 241000223238 Trichophyton Species 0.000 description 1
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 1
- NYRDAKQGNYVKNI-UHFFFAOYSA-N [4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methanol Chemical compound [O-][N+](=O)C1=CC(CO)=CC=C1OCC1=CC=C(Cl)C=C1Cl NYRDAKQGNYVKNI-UHFFFAOYSA-N 0.000 description 1
- GMHDRBDDYDJKIZ-UHFFFAOYSA-N [4-[(2,4-dichlorophenyl)methoxy]phenyl]-phenylmethanol Chemical compound ClC1=C(COC2=CC=C(C(C3=CC=CC=C3)O)C=C2)C=CC(=C1)Cl GMHDRBDDYDJKIZ-UHFFFAOYSA-N 0.000 description 1
- ONBSDZDUXYKLKN-UHFFFAOYSA-N [4-[(2,4-dichlorophenyl)methoxy]phenyl]-phenylmethanone Chemical compound ClC1=CC(Cl)=CC=C1COC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 ONBSDZDUXYKLKN-UHFFFAOYSA-N 0.000 description 1
- NZSIEUJMXKIAOM-UHFFFAOYSA-N [CH2]C[K] Chemical group [CH2]C[K] NZSIEUJMXKIAOM-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 244000144987 brood Species 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 229960004462 dimazole Drugs 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- ZXSBDSGRQIWJPM-UHFFFAOYSA-N dimethylcarbamothioic s-acid Chemical compound CN(C)C(S)=O ZXSBDSGRQIWJPM-UHFFFAOYSA-N 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000035622 drinking Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- CFNFDUJWLXMVHH-KTKRTIGZSA-N ethyl (z)-3-(4-methoxyphenyl)but-2-enoate Chemical compound CCOC(=O)\C=C(\C)C1=CC=C(OC)C=C1 CFNFDUJWLXMVHH-KTKRTIGZSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XUGNVMKQXJXZCD-UHFFFAOYSA-N isopropyl palmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC(C)C XUGNVMKQXJXZCD-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- HLXHDXRVKGTGOC-UHFFFAOYSA-N methyl 3-[(2,4-dichlorophenyl)methoxy]benzoate Chemical compound COC(=O)C1=CC=CC(OCC=2C(=CC(Cl)=CC=2)Cl)=C1 HLXHDXRVKGTGOC-UHFFFAOYSA-N 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 1
- HQGYASGNKTYLBZ-UHFFFAOYSA-N n-[(2,4-dichlorophenyl)methyl]-2-(1h-imidazol-2-ylmethyl)aniline Chemical compound ClC1=CC(Cl)=CC=C1CNC1=CC=CC=C1CC1=NC=CN1 HQGYASGNKTYLBZ-UHFFFAOYSA-N 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- CKQVRZJOMJRTOY-UHFFFAOYSA-N octadecanoic acid;propane-1,2,3-triol Chemical compound OCC(O)CO.CCCCCCCCCCCCCCCCCC(O)=O CKQVRZJOMJRTOY-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229950008882 polysorbate Drugs 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 235000013547 stew Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 210000000689 upper leg Anatomy 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- WKOLLVMJNQIZCI-UHFFFAOYSA-N vanillic acid Chemical compound COC1=CC(C(O)=O)=CC=C1O WKOLLVMJNQIZCI-UHFFFAOYSA-N 0.000 description 1
- TUUBOHWZSQXCSW-UHFFFAOYSA-N vanillic acid Natural products COC1=CC(O)=CC(C(O)=O)=C1 TUUBOHWZSQXCSW-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742418502 DE2418502C3 (de) | 1974-04-11 | 1974-04-11 | Dichlorbenzyl- [2-( a -imidazolylbutyl)-phenyl] -äther und -thioäther, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| DE2418502.2 | 1974-04-11 | ||
| DE2510130.8 | 1975-03-06 | ||
| DE19752510130 DE2510130A1 (de) | 1975-03-06 | 1975-03-06 | Imidazolderivate und verfahren zu ihrer herstellung |
| DE19752510781 DE2510781A1 (de) | 1975-03-07 | 1975-03-07 | Imidazolderivate und verfahren zu ihrer herstellung |
| DE2510781.7 | 1975-03-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS50148357A JPS50148357A (enExample) | 1975-11-27 |
| JPS6018654B2 true JPS6018654B2 (ja) | 1985-05-11 |
Family
ID=27185894
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP50044147A Expired JPS6018654B2 (ja) | 1974-04-11 | 1975-04-11 | イミダゾ−ル誘導体の製法 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4006243A (enExample) |
| JP (1) | JPS6018654B2 (enExample) |
| AT (1) | AT341518B (enExample) |
| CA (1) | CA1051908A (enExample) |
| CH (1) | CH612185A5 (enExample) |
| CS (1) | CS194221B2 (enExample) |
| DD (1) | DD121515A5 (enExample) |
| DK (1) | DK139909C (enExample) |
| ES (1) | ES436546A1 (enExample) |
| FR (1) | FR2267101B1 (enExample) |
| GB (1) | GB1510016A (enExample) |
| HU (1) | HU172895B (enExample) |
| IE (1) | IE40911B1 (enExample) |
| IL (1) | IL47061A (enExample) |
| NL (1) | NL7504387A (enExample) |
| SE (1) | SE418498B (enExample) |
| YU (1) | YU89875A (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT328587B (de) * | 1973-08-20 | 1976-03-25 | Vianova Kunstharz Ag | Verfahren zur herstellung von wasserigen uberzugsmitteln |
| US4237158A (en) * | 1975-02-05 | 1980-12-02 | Rohm And Haas Company | 1-Substituted aralkyl imidazoles and their use as fungicides |
| DE2549798C3 (de) * | 1975-11-06 | 1978-06-29 | Nordmark-Werke Gmbh, 2000 Hamburg | 1,2-Dipheny l-3-(imidazo Wl-1 )propene, Verfahren zu deren Herstellung sowie diese enthaltende Arzneimittel |
| US4115578A (en) * | 1975-12-18 | 1978-09-19 | Rohm And Haas Company | 1-Substituted aralkyl imidazoles |
| US4118461A (en) * | 1975-12-18 | 1978-10-03 | Rohm And Haas Company | 1-Substituted aralkyl imidazoles |
| DE2732750A1 (de) * | 1977-07-20 | 1979-02-08 | Merck Patent Gmbh | Basische thioaether und verfahren zu ihrer herstellung |
| US4284641A (en) * | 1977-08-26 | 1981-08-18 | Burroughs Wellcome Co. | Pharmaceutically active imidazole derivatives |
| US4431815A (en) * | 1977-08-26 | 1984-02-14 | Burroughs Wellcome Co. | 1-[3-(2,4-Dichlorophenyl)propyl]imidazole and salts thereof |
| US4396771A (en) * | 1977-10-19 | 1983-08-02 | Burroughs Wellcome Co. | Imidazole derivatives and salts thereof |
| IT1097314B (it) * | 1978-07-26 | 1985-08-31 | Recordati Chem Pharm | Derivati dell'imidazolo ad attivita' anticonvulsivante |
| JPS5951943B2 (ja) * | 1978-08-21 | 1984-12-17 | キツセイ薬品工業株式会社 | 新規なイミダゾ−ル誘導体 |
| DE2842759A1 (de) * | 1978-09-30 | 1980-04-10 | Merck Patent Gmbh | Basische aether, diese enthaltende pharmazeutische zubereitungen und verfahren zu ihrer herstellung |
| DK531479A (da) * | 1979-01-19 | 1980-07-20 | Pfizer | Fremgangsmaade til fremstilling af imidazolderivater og salte deraf |
| DK157860C (da) * | 1979-06-07 | 1990-07-30 | Shionogi & Co | Analogifremgangsmaade til fremstilling af benzylimidazolderivater samt farmaceutisk acceptable syreadditionssalte deraf |
| US4218461A (en) * | 1979-08-15 | 1980-08-19 | E. R. Squibb & Sons, Inc. | 2,3-Dihydro-2-[(1H-imidazol-1-yl)-methylene]-1H-inden-1-ones |
| GB2069481B (en) * | 1980-02-13 | 1983-07-27 | Farmos Oy | Substituted imidazole derivatives |
| CA1156661A (en) * | 1980-02-25 | 1983-11-08 | Hoffmann-La Roche Limited | Phenoxy-aminopropanol derivatives |
| EP0065974A1 (de) * | 1980-12-05 | 1982-12-08 | Schering Aktiengesellschaft | Antischuppenmittel |
| IL66242A0 (en) * | 1981-07-23 | 1982-11-30 | Erba Farmitalia | N-imidazolyl derivatives of 1,2,3,4-tetrahydro-naphthalene,indan and 2-substituted-1-chroman,their preparation and pharmaceutical compositions containing them |
| JPS58150566A (ja) * | 1982-03-03 | 1983-09-07 | Yoshitomi Pharmaceut Ind Ltd | 新規イミダゾ−ル誘導体 |
| ES523609A0 (es) * | 1982-07-05 | 1985-03-01 | Erba Farmitalia | Procedimiento para preparar derivados n-imidazolilicos de compuestos biciclicos. |
| GB2126218B (en) * | 1982-08-14 | 1986-01-22 | Wellcome Found | Imidazoles |
| JPS60142965A (ja) * | 1983-09-05 | 1985-07-29 | Yoshitomi Pharmaceut Ind Ltd | イミダゾ−ル誘導体の製造法 |
| EP0149976A3 (de) * | 1983-12-30 | 1986-12-10 | Ciba-Geigy Ag | Substituierte Imidazole |
| US4755526A (en) * | 1984-06-18 | 1988-07-05 | Eli Lilly And Company | Method of inhibiting aromatase |
| US4937250A (en) * | 1988-03-07 | 1990-06-26 | Ciba-Geigy Corporation | Alpha-heterocycle substituted tolunitriles |
| US4978672A (en) * | 1986-03-07 | 1990-12-18 | Ciba-Geigy Corporation | Alpha-heterocyclc substituted tolunitriles |
| FI875724L (fi) * | 1986-04-29 | 1987-12-28 | Pfizer | Av kalcium oberoende camp fosfodiesteras-inhibitordepressant. |
| US5459145A (en) * | 1988-01-19 | 1995-10-17 | Pfizer Inc. | Calcium independent camp phosphodiesterase inhibitor antidepressant |
| US5280036A (en) * | 1987-05-02 | 1994-01-18 | Basf Aktiengesellschaft | N-phenoxyphenyloxymethyl substituted azoles and method for controlling pests therewith |
| US5214064A (en) * | 1987-05-02 | 1993-05-25 | Basf Aktiengesellschaft | Phenoxyphenylmethyl substituted azoles and pesticidal composition thereof |
| CA1329614C (en) * | 1987-05-02 | 1994-05-17 | Rainer Buerstinghaus | N-substituted azoles |
| IL91542A0 (en) * | 1988-10-06 | 1990-04-29 | Erba Carlo Spa | N-imidazolyl-and n-imidazolyl-methyl derivatives of substituted bicyclic compounds,their preparation and pharmaceutical compositions containing them |
| ZA923283B (en) * | 1991-05-29 | 1993-01-27 | Akzo Nv | Phenoxyphenyl derivatives |
| US5395935A (en) * | 1992-05-08 | 1995-03-07 | Pfizer Inc. | Endo-bicyclo[2.2.1]heptan-2-ol and derived pharmaceutical agents |
| CA2189068A1 (en) * | 1994-04-27 | 1995-11-02 | Nobuo Mochizuki | Imidazole derivative and process for producing the same |
| US5922751A (en) * | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| DE19541146A1 (de) * | 1995-10-25 | 1997-04-30 | Schering Ag | Imidazolderivate und deren Verwendung als Stickstoffmonoxid-Synthase-Inhibitoren |
| US6297239B1 (en) | 1997-10-08 | 2001-10-02 | Merck & Co., Inc. | Inhibitors of prenyl-protein transferase |
| US6284755B1 (en) | 1998-12-08 | 2001-09-04 | Merck & Co., Inc. | Inhibitors of prenyl-protein transferase |
| WO2001051494A1 (en) | 2000-01-12 | 2001-07-19 | Merck & Co., Inc. | Inhibitors of prenyl-protein transferase |
| EP1178038A1 (en) * | 2000-08-04 | 2002-02-06 | Aventis Cropscience S.A. | Fungicidal phenylamidine derivatives |
| CA2534263A1 (en) * | 2003-08-01 | 2005-02-10 | Nippon Soda Co., Ltd. | Phenylazole compounds, production process and antioxidants |
| NZ595073A (en) | 2009-04-20 | 2012-11-30 | Hoffmann La Roche | Proline derivatives as cathepsin inhibitors |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1908991B2 (de) * | 1969-02-22 | 1977-05-26 | Bayer Ag, 5090 Leverkusen | Alpha, alpha-disubstituierte n- benzylimidazole und deren salze |
| DE2007794A1 (de) * | 1970-02-20 | 1971-09-02 | Farbenfabriken Bayer Aktiengesell schaft, 5090 Leverkusen | Fungizide Mittel |
| US3833603A (en) * | 1970-04-09 | 1974-09-03 | Bayer Ag | 1-(alpha,alpha-disubstituted 4-phenoxy-benzyl)imidazoles |
| NL7108387A (enExample) * | 1970-06-22 | 1971-12-24 | Koninklijke Pharma Fab Nv | |
| US3927017A (en) * | 1974-06-27 | 1975-12-16 | Janssen Pharmaceutica Nv | 1-({62 -Aryl-{62 -R-ethyl)imidazoles |
-
1975
- 1975-04-08 IE IE780/75A patent/IE40911B1/xx unknown
- 1975-04-09 DK DK153075A patent/DK139909C/da not_active IP Right Cessation
- 1975-04-09 DD DD185337A patent/DD121515A5/xx unknown
- 1975-04-09 YU YU00898/75A patent/YU89875A/xx unknown
- 1975-04-09 CS CS752431A patent/CS194221B2/cs unknown
- 1975-04-09 AT AT268675A patent/AT341518B/de not_active IP Right Cessation
- 1975-04-10 CH CH457575A patent/CH612185A5/xx not_active IP Right Cessation
- 1975-04-10 HU HU75SC00000516A patent/HU172895B/hu unknown
- 1975-04-10 IL IL7547061A patent/IL47061A/xx unknown
- 1975-04-10 SE SE7504123A patent/SE418498B/xx unknown
- 1975-04-11 GB GB15012/75A patent/GB1510016A/en not_active Expired
- 1975-04-11 NL NL7504387A patent/NL7504387A/xx not_active Application Discontinuation
- 1975-04-11 FR FR7511415A patent/FR2267101B1/fr not_active Expired
- 1975-04-11 JP JP50044147A patent/JPS6018654B2/ja not_active Expired
- 1975-04-11 ES ES75436546A patent/ES436546A1/es not_active Expired
- 1975-04-11 US US05/567,361 patent/US4006243A/en not_active Expired - Lifetime
- 1975-04-11 CA CA224,402A patent/CA1051908A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE7504123L (sv) | 1975-12-19 |
| NL7504387A (nl) | 1975-10-14 |
| CA1051908A (en) | 1979-04-03 |
| CS194221B2 (en) | 1979-11-30 |
| DK153075A (enExample) | 1975-10-12 |
| FR2267101A1 (enExample) | 1975-11-07 |
| YU89875A (en) | 1982-05-31 |
| IE40911L (en) | 1975-10-11 |
| ES436546A1 (es) | 1977-01-16 |
| JPS50148357A (enExample) | 1975-11-27 |
| CH612185A5 (enExample) | 1979-07-13 |
| HU172895B (hu) | 1978-12-28 |
| ATA268675A (de) | 1977-06-15 |
| US4006243A (en) | 1977-02-01 |
| GB1510016A (en) | 1978-05-10 |
| DK139909C (da) | 1979-10-08 |
| IL47061A0 (en) | 1975-06-25 |
| AU8002575A (en) | 1976-10-14 |
| DK139909B (da) | 1979-05-14 |
| FR2267101B1 (enExample) | 1980-01-25 |
| DD121515A5 (enExample) | 1976-08-05 |
| IL47061A (en) | 1978-08-31 |
| SE418498B (sv) | 1981-06-09 |
| IE40911B1 (en) | 1979-09-12 |
| AT341518B (de) | 1978-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6018654B2 (ja) | イミダゾ−ル誘導体の製法 | |
| FI70709C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 4(5)-substituerade imidazolderivat | |
| DE1493955A1 (de) | Verfahren zur Herstellung substituierter Sulfonanilide | |
| HU194839B (en) | Process for production of derivatives of triasole and imidasole and medical preparatives containing such compounds | |
| BR112016014018B1 (pt) | Processo para a preparação dos compostos de cetona (ia), e processo para a preparação dos compostos de triazol de fórmula | |
| JPH0768190B2 (ja) | 置換アミノアルキルビフエニル誘導体 | |
| NO155884B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater. | |
| DE2732750A1 (de) | Basische thioaether und verfahren zu ihrer herstellung | |
| SE445640B (sv) | Imidazolderivat, forfarande for framstellning derav samt farmaceutiska kompositioner derav | |
| US4327022A (en) | Heterocyclic alkyl naphthols | |
| US4169108A (en) | 5(OR 6)-[(Substituted-amino)alkyl]-2,3-naphthalenediols | |
| DE69403795T2 (de) | Imidazole als lipoxygenase inhibitoren | |
| US5629332A (en) | Triazole compound and use thereof | |
| IE53386B1 (en) | Imidazole antifungal agents | |
| US3629271A (en) | Pyrazolopyridine carboxylic acid compounds and derivatives | |
| EP0000013B1 (de) | 4-Phenyl-8-amino-tetrahydroisochinoline, diese enthaltende pharmazeutische Präparate und Verfahren zur Herstellung dieser Präparate | |
| FR2465733A1 (fr) | Nouveaux derives imidazolylethoxymethyliques de 1,3-dioxoloquinoleines utiles notamment comme medicaments antibacteriens et antifongiques, leur procede de preparation et compositions therapeutiques et formes pharmaceutiques les contenant | |
| US4038404A (en) | 1,2,4-triazole antimycotic compositions and use thereof | |
| JPS6044307B2 (ja) | 新規のo−アルキル化オキシムおよび医薬としてのその用途 | |
| US4002763A (en) | 1,2,4-Triazole antimycotic compositions and use thereof | |
| US3474134A (en) | Phenoxyethyl-guanidines and the salts thereof | |
| US4038406A (en) | 1,2,4-triazole antimycotic compositions and use thereof | |
| US4060623A (en) | 1,2,4-Triazole antimycotic compositions and use thereof | |
| US4066768A (en) | Derivatives of 1-phenoxy-3-amino-propan-2-ol | |
| US4304790A (en) | 2-(Alkylthio, alkylsulfinyl or alkylsulfonyl)-4-[2-anilinoalkylamino)-1-hydroxyethyl]phenols and derivatives thereof |