JPH08500580A - 5ht▲下2c▼および5ht▲下2b▼拮抗薬用縮合インドール誘導体 - Google Patents
5ht▲下2c▼および5ht▲下2b▼拮抗薬用縮合インドール誘導体Info
- Publication number
- JPH08500580A JPH08500580A JP6505828A JP50582894A JPH08500580A JP H08500580 A JPH08500580 A JP H08500580A JP 6505828 A JP6505828 A JP 6505828A JP 50582894 A JP50582894 A JP 50582894A JP H08500580 A JPH08500580 A JP H08500580A
- Authority
- JP
- Japan
- Prior art keywords
- indole
- methyl
- dihydropyrrolo
- pyridylcarbamoyl
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000002475 indoles Chemical class 0.000 title description 3
- 239000005557 antagonist Substances 0.000 title 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 148
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 77
- 239000001257 hydrogen Substances 0.000 claims abstract description 51
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 46
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 35
- 150000003839 salts Chemical class 0.000 claims abstract description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 16
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 15
- 150000002367 halogens Chemical class 0.000 claims abstract description 15
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims abstract description 14
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 11
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 5
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims abstract description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 4
- 239000001301 oxygen Chemical group 0.000 claims abstract description 4
- 229910052717 sulfur Chemical group 0.000 claims abstract description 3
- 239000011593 sulfur Chemical group 0.000 claims abstract description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 73
- -1 Methyl-1- (4-pyridylcarbamoyl) -2,3-dihydropyrrolo [2,3-f] indole Chemical compound 0.000 claims description 47
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 35
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 35
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- WWORPZXUCHHSOT-UHFFFAOYSA-N 3-methyl-n-pyridin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C12=CC=C3N(C)C=CC3=C2CCN1C(=O)NC1=CC=CN=C1 WWORPZXUCHHSOT-UHFFFAOYSA-N 0.000 claims description 8
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 7
- BQLGGSFLVVEQFN-UHFFFAOYSA-N 1-methyl-n-(2-methylquinolin-4-yl)-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1=CC=CC2=NC(C)=CC(NC(=O)N3C4=CC=5C=CN(C)C=5C=C4CC3)=C21 BQLGGSFLVVEQFN-UHFFFAOYSA-N 0.000 claims description 6
- CBDICMXAVIEZAC-UHFFFAOYSA-N 1-ethyl-n-pyridin-3-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(CC)C=CC3=CC=2N1C(=O)NC1=CC=CN=C1 CBDICMXAVIEZAC-UHFFFAOYSA-N 0.000 claims description 5
- MFDGTFLMDIUFFP-UHFFFAOYSA-N 1-methyl-n-pyridin-3-yl-2,3,6,7-tetrahydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(C)CCC3=CC=2N1C(=O)NC1=CC=CN=C1 MFDGTFLMDIUFFP-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- CQJPEGFBIWGAGS-UHFFFAOYSA-N 1,2-dimethyl-n-pyridin-3-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(C)C(C)=CC3=CC=2N1C(=O)NC1=CC=CN=C1 CQJPEGFBIWGAGS-UHFFFAOYSA-N 0.000 claims description 4
- YRRLZUPWARBIBX-UHFFFAOYSA-N 1-methyl-n-quinolin-6-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound N1=CC=CC2=CC(NC(=O)N3C=4C=C5C=CN(C5=CC=4CC3)C)=CC=C21 YRRLZUPWARBIBX-UHFFFAOYSA-N 0.000 claims description 4
- YWHQPNSSLZNZSS-UHFFFAOYSA-N 1-propyl-n-pyridin-3-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(CCC)C=CC3=CC=2N1C(=O)NC1=CC=CN=C1 YWHQPNSSLZNZSS-UHFFFAOYSA-N 0.000 claims description 4
- ZSYIGWOSJXPYML-UHFFFAOYSA-N 2,3-dimethyl-n-pyridin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C12=CC=C3N(C)C(C)=CC3=C2CCN1C(=O)NC1=CC=CN=C1 ZSYIGWOSJXPYML-UHFFFAOYSA-N 0.000 claims description 4
- PTSBGLQTHXMYEO-UHFFFAOYSA-N 3-methyl-n-(2-methylquinolin-4-yl)-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C1=CC=CC2=NC(C)=CC(NC(=O)N3C4=C(C=5C=CN(C)C=5C=C4)CC3)=C21 PTSBGLQTHXMYEO-UHFFFAOYSA-N 0.000 claims description 4
- RXBFFHSMIUPBSJ-UHFFFAOYSA-N 3-methyl-n-pyridin-4-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C12=CC=C3N(C)C=CC3=C2CCN1C(=O)NC1=CC=NC=C1 RXBFFHSMIUPBSJ-UHFFFAOYSA-N 0.000 claims description 4
- OISBKHDJEYRHLR-UHFFFAOYSA-N 3-methyl-n-quinolin-5-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C1=CC=C2C(NC(=O)N3CCC4=C5C=CN(C5=CC=C43)C)=CC=CC2=N1 OISBKHDJEYRHLR-UHFFFAOYSA-N 0.000 claims description 4
- YVXBHIFSSHPBDE-UHFFFAOYSA-N 6-methyl-n-pyridin-3-yl-1,2,7,8-tetrahydropyrrolo[3,2-e]indole-3-carboxamide Chemical compound C12=CC=C3N(C)CCC3=C2CCN1C(=O)NC1=CC=CN=C1 YVXBHIFSSHPBDE-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000000524 functional group Chemical group 0.000 claims description 4
- AZMQHXVJUIAXHL-UHFFFAOYSA-N n-pyridin-3-yl-6,7-dihydro-1h-pyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC2=CC=3NC=CC=3C=C2N1C(=O)NC1=CC=CN=C1 AZMQHXVJUIAXHL-UHFFFAOYSA-N 0.000 claims description 4
- WPMNXTGBLNQBMP-UHFFFAOYSA-N 1,3-dimethyl-n-pyridin-3-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1=2C=C3C(C)=CN(C)C3=CC=2CCN1C(=O)NC1=CC=CN=C1 WPMNXTGBLNQBMP-UHFFFAOYSA-N 0.000 claims description 3
- QAAZWNMOAPVHLY-UHFFFAOYSA-N 1-methyl-n-(3-methyl-1,2-thiazol-5-yl)-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound S1N=C(C)C=C1NC(=O)N1C2=CC(C=CN3C)=C3C=C2CC1 QAAZWNMOAPVHLY-UHFFFAOYSA-N 0.000 claims description 3
- FZWWVCLHOQKQGY-UHFFFAOYSA-N 1-methyl-n-pyridin-2-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(C)C=CC3=CC=2N1C(=O)NC1=CC=CC=N1 FZWWVCLHOQKQGY-UHFFFAOYSA-N 0.000 claims description 3
- ITVMJNOYTVOMMO-UHFFFAOYSA-N 1-methyl-n-pyridin-3-yl-7,8-dihydro-6h-pyrrolo[2,3-g]quinoline-5-carboxamide Chemical compound C1CCC=2C=C3N(C)C=CC3=CC=2N1C(=O)NC1=CC=CN=C1 ITVMJNOYTVOMMO-UHFFFAOYSA-N 0.000 claims description 3
- GMSRWMJQHSAGRF-UHFFFAOYSA-N 1-methyl-n-quinolin-5-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1=CC=C2C(NC(=O)N3C=4C=C5C=CN(C5=CC=4CC3)C)=CC=CC2=N1 GMSRWMJQHSAGRF-UHFFFAOYSA-N 0.000 claims description 3
- DOQXHXHGMBEJOO-UHFFFAOYSA-N 3-methyl-n-quinolin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C1=CC=CC2=CC(NC(=O)N3CCC4=C5C=CN(C5=CC=C43)C)=CN=C21 DOQXHXHGMBEJOO-UHFFFAOYSA-N 0.000 claims description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- NPPUDFKFXWTSSN-UHFFFAOYSA-N 4-methyl-n-(3-methyl-1,2-thiazol-5-yl)-3,6,7,8-tetrahydropyrrolo[3,2-e]indole-8-carboxamide Chemical compound S1N=C(C)C=C1NC(=O)C1C2=C3C=CNC3=C(C)C=C2NC1 NPPUDFKFXWTSSN-UHFFFAOYSA-N 0.000 claims description 3
- DKYNEZGZHFYVLE-UHFFFAOYSA-N n-isoquinolin-5-yl-1-methyl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound N1=CC=C2C(NC(=O)N3C=4C=C5C=CN(C5=CC=4CC3)C)=CC=CC2=C1 DKYNEZGZHFYVLE-UHFFFAOYSA-N 0.000 claims description 3
- 230000001225 therapeutic effect Effects 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- CGWOEOXQHIMZEQ-UHFFFAOYSA-N 3-[1-[[4-(2-phenylquinolin-3-yl)phenyl]methyl]piperidin-4-yl]-1h-benzimidazol-2-one Chemical compound OC1=NC2=CC=CC=C2N1C(CC1)CCN1CC(C=C1)=CC=C1C1=CC2=CC=CC=C2N=C1C1=CC=CC=C1 CGWOEOXQHIMZEQ-UHFFFAOYSA-N 0.000 claims 1
- 229940126062 Compound A Drugs 0.000 claims 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 claims 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- 229940044551 receptor antagonist Drugs 0.000 abstract description 7
- 239000002464 receptor antagonist Substances 0.000 abstract description 7
- 208000019901 Anxiety disease Diseases 0.000 abstract description 5
- 230000036506 anxiety Effects 0.000 abstract description 5
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 3
- 125000003118 aryl group Chemical group 0.000 abstract description 2
- 208000015114 central nervous system disease Diseases 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 98
- 239000000203 mixture Substances 0.000 description 75
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 72
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 72
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 69
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 61
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 49
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 47
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 46
- 238000000034 method Methods 0.000 description 46
- 239000007787 solid Substances 0.000 description 44
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 40
- 235000019439 ethyl acetate Nutrition 0.000 description 34
- 229910052799 carbon Inorganic materials 0.000 description 33
- 239000000243 solution Substances 0.000 description 32
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 239000011734 sodium Substances 0.000 description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 26
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 238000002844 melting Methods 0.000 description 23
- 230000008018 melting Effects 0.000 description 23
- 239000003921 oil Substances 0.000 description 21
- 235000019198 oils Nutrition 0.000 description 21
- 239000000741 silica gel Substances 0.000 description 21
- 229910002027 silica gel Inorganic materials 0.000 description 21
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 20
- 238000010992 reflux Methods 0.000 description 20
- 238000003756 stirring Methods 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- 229960004756 ethanol Drugs 0.000 description 15
- 238000004587 chromatography analysis Methods 0.000 description 14
- 241000700159 Rattus Species 0.000 description 12
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 239000012442 inert solvent Substances 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 229910052786 argon Inorganic materials 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 10
- WSDUFDGEYKOQRT-UHFFFAOYSA-N 1-(5-amino-2,3-dihydroindol-1-yl)ethanone Chemical compound NC1=CC=C2N(C(=O)C)CCC2=C1 WSDUFDGEYKOQRT-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 102000005962 receptors Human genes 0.000 description 8
- 108020003175 receptors Proteins 0.000 description 8
- 230000003997 social interaction Effects 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- 239000003981 vehicle Substances 0.000 description 8
- YMWUUYVVMXEBMD-UHFFFAOYSA-N 1-methyl-6,7-dihydro-5h-pyrrolo[2,3-f]indole Chemical compound C1=C2N(C)C=CC2=CC2=C1CCN2 YMWUUYVVMXEBMD-UHFFFAOYSA-N 0.000 description 7
- JBRNEAZTLHDKBX-UHFFFAOYSA-N 2-(2-chlorophenyl)piperazine Chemical compound ClC1=CC=CC=C1C1NCCNC1 JBRNEAZTLHDKBX-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000007363 ring formation reaction Methods 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 241000400611 Eucalyptus deanei Species 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- QJQORSLQNXDVGE-UHFFFAOYSA-N SB 206553 Chemical compound C1CC=2C=C3N(C)C=CC3=CC=2N1C(=O)NC1=CC=CN=C1 QJQORSLQNXDVGE-UHFFFAOYSA-N 0.000 description 6
- 229910004298 SiO 2 Inorganic materials 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 239000012279 sodium borohydride Substances 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- 238000001308 synthesis method Methods 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- XWPZLIQUEPXRMN-UHFFFAOYSA-N 1-(2-methyl-3,5-dihydro-2h-pyrrolo[2,3-f]indol-1-yl)ethanone Chemical compound C1=C2N(C(C)=O)C(C)CC2=CC2=C1C=CN2 XWPZLIQUEPXRMN-UHFFFAOYSA-N 0.000 description 5
- AMGUMEGDMJDXLL-UHFFFAOYSA-N 1-(5-amino-2-methyl-2,3-dihydroindol-1-yl)ethanone Chemical compound NC1=CC=C2N(C(C)=O)C(C)CC2=C1 AMGUMEGDMJDXLL-UHFFFAOYSA-N 0.000 description 5
- UZQLEMVKVAREMX-UHFFFAOYSA-N 1-(6,7-dihydro-1h-pyrrolo[2,3-f]indol-5-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC2=C1C=CN2 UZQLEMVKVAREMX-UHFFFAOYSA-N 0.000 description 5
- FHQOORLMOLNDJT-UHFFFAOYSA-N 1-[5-(2,2-dimethoxyethylamino)-2-methyl-2,3-dihydroindol-1-yl]ethanone Chemical compound COC(OC)CNC1=CC=C2N(C(C)=O)C(C)CC2=C1 FHQOORLMOLNDJT-UHFFFAOYSA-N 0.000 description 5
- WUTIWOZYHHSBBU-UHFFFAOYSA-N 3-methoxy-4-nitrobenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1[N+]([O-])=O WUTIWOZYHHSBBU-UHFFFAOYSA-N 0.000 description 5
- UYFAPJGHSQYTDE-UHFFFAOYSA-N 3-methyl-7,8-dihydro-6h-pyrrolo[3,2-e]indole;hydrochloride Chemical compound Cl.C1=C2N(C)C=CC2=C2CCNC2=C1 UYFAPJGHSQYTDE-UHFFFAOYSA-N 0.000 description 5
- CXVKECUDFFGKHO-UHFFFAOYSA-N CN(C)CC(C1=C2CC3)=CN(C)C1=CC=C2N3C(NC1=CC=CN=C1)=O Chemical compound CN(C)CC(C1=C2CC3)=CN(C)C1=CC=C2N3C(NC1=CC=CN=C1)=O CXVKECUDFFGKHO-UHFFFAOYSA-N 0.000 description 5
- 239000005909 Kieselgur Substances 0.000 description 5
- 230000000949 anxiolytic effect Effects 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- YONPEASLQMRVMY-UHFFFAOYSA-N 1-(1,3-dimethyl-6,7-dihydropyrrolo[2,3-f]indol-5-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC2=C1C(C)=CN2C YONPEASLQMRVMY-UHFFFAOYSA-N 0.000 description 4
- BTFMMADXDCOETJ-UHFFFAOYSA-N 1-(2,5-dimethyl-2,3-dihydropyrrolo[2,3-f]indol-1-yl)ethanone Chemical compound C1=C2N(C(C)=O)C(C)CC2=CC2=C1C=CN2C BTFMMADXDCOETJ-UHFFFAOYSA-N 0.000 description 4
- XIKHMUMEEURMLM-UHFFFAOYSA-N 1-(2-methyl-2,3-dihydroindol-1-yl)ethanone Chemical compound C1=CC=C2N(C(C)=O)C(C)CC2=C1 XIKHMUMEEURMLM-UHFFFAOYSA-N 0.000 description 4
- FNGVDDLTALTXPK-UHFFFAOYSA-N 1-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)ethanone Chemical compound [O-][N+](=O)C1=CC=C2N(C(C)=O)C(C)CC2=C1 FNGVDDLTALTXPK-UHFFFAOYSA-N 0.000 description 4
- LJXNOLZIJYHNQI-UHFFFAOYSA-N 1-(5-acetyl-6,7-dihydropyrrolo[2,3-f]indol-1-yl)-2,2,2-trifluoroethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC2=C1C=CN2C(=O)C(F)(F)F LJXNOLZIJYHNQI-UHFFFAOYSA-N 0.000 description 4
- LNRLPJULUCCQFR-UHFFFAOYSA-N 1-ethyl-6,7-dihydro-5h-pyrrolo[2,3-f]indole Chemical compound C1=C2N(CC)C=CC2=CC2=C1CCN2 LNRLPJULUCCQFR-UHFFFAOYSA-N 0.000 description 4
- WAAYFJHPXWHVGT-UHFFFAOYSA-N 1-methyl-5,6,7,8-tetrahydropyrrolo[2,3-g]quinoline Chemical compound N1CCCC2=C1C=C1C=CN(C)C1=C2 WAAYFJHPXWHVGT-UHFFFAOYSA-N 0.000 description 4
- RLIXZWRURCOIGP-UHFFFAOYSA-N 2,2,2-trifluoro-n-quinolin-6-ylacetamide Chemical compound N1=CC=CC2=CC(NC(=O)C(F)(F)F)=CC=C21 RLIXZWRURCOIGP-UHFFFAOYSA-N 0.000 description 4
- IAWBISGTEYZEBP-UHFFFAOYSA-N 2,5-dimethyl-2,3-dihydro-1h-pyrrolo[2,3-f]indole Chemical compound C1=C2NC(C)CC2=CC2=C1C=CN2C IAWBISGTEYZEBP-UHFFFAOYSA-N 0.000 description 4
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 4
- HCXJLIBCKKJAEQ-UHFFFAOYSA-N 3-methyl-6,7,8,9-tetrahydropyrrolo[3,2-f]quinoline Chemical compound C1CCNC2=CC=C3N(C)C=CC3=C21 HCXJLIBCKKJAEQ-UHFFFAOYSA-N 0.000 description 4
- WNZPRUOBSHDYKC-UHFFFAOYSA-N C1=C2N(C)C=CC2=C2CCNC2=C1 Chemical compound C1=C2N(C)C=CC2=C2CCNC2=C1 WNZPRUOBSHDYKC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 4
- 230000003042 antagnostic effect Effects 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 230000006742 locomotor activity Effects 0.000 description 4
- AAKGWOBBFFIURQ-UHFFFAOYSA-N n-(1-acetyl-3,4-dihydro-2h-quinolin-6-yl)-2,2,2-trifluoroacetamide Chemical compound FC(F)(F)C(=O)NC1=CC=C2N(C(=O)C)CCCC2=C1 AAKGWOBBFFIURQ-UHFFFAOYSA-N 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- HXIVZXPPYOENNA-UHFFFAOYSA-N 1,2-dimethyl-6,7-dihydro-5h-pyrrolo[2,3-f]indole Chemical compound C1=C2N(C)C(C)=CC2=CC2=C1CCN2 HXIVZXPPYOENNA-UHFFFAOYSA-N 0.000 description 3
- FKTCCMLMYHUHNJ-UHFFFAOYSA-N 1,3-dimethyl-6,7-dihydro-5h-pyrrolo[2,3-f]indole Chemical compound C1=C2C(C)=CN(C)C2=CC2=C1NCC2 FKTCCMLMYHUHNJ-UHFFFAOYSA-N 0.000 description 3
- YBGNQEMICNYGIU-UHFFFAOYSA-N 1,3-dimethyl-n-pyridin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C1CC2=C3C(C)=CN(C)C3=CC=C2N1C(=O)NC1=CC=CN=C1 YBGNQEMICNYGIU-UHFFFAOYSA-N 0.000 description 3
- PIYQYCJTNUQLAB-UHFFFAOYSA-N 1-(1-methyl-6,7-dihydropyrrolo[2,3-f]indol-5-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC2=C1C=CN2C PIYQYCJTNUQLAB-UHFFFAOYSA-N 0.000 description 3
- NBOQSNULXHSCTK-UHFFFAOYSA-N 1-(1-methyl-7,8-dihydro-6h-pyrrolo[2,3-g]quinolin-5-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCCC2=CC2=C1C=CN2C NBOQSNULXHSCTK-UHFFFAOYSA-N 0.000 description 3
- PRYXAMLHOPMIQO-UHFFFAOYSA-N 1-(1-propyl-6,7-dihydropyrrolo[2,3-f]indol-5-yl)ethanone Chemical compound C1=C2N(CCC)C=CC2=CC2=C1CCN2C(C)=O PRYXAMLHOPMIQO-UHFFFAOYSA-N 0.000 description 3
- HQJKYNXISRRJFQ-UHFFFAOYSA-N 1-(3-methyl-6,7-dihydro-1h-pyrrolo[2,3-f]indol-5-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC2=C1C(C)=CN2 HQJKYNXISRRJFQ-UHFFFAOYSA-N 0.000 description 3
- PXQAEZQSAKPIOH-UHFFFAOYSA-N 1-(5-acetyl-3-methyl-6,7-dihydropyrrolo[2,3-f]indol-1-yl)-2,2,2-trifluoroethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC2=C1C(C)=CN2C(=O)C(F)(F)F PXQAEZQSAKPIOH-UHFFFAOYSA-N 0.000 description 3
- YQSKRNAMJFNZIR-UHFFFAOYSA-N 1-methyl-N-(2-methylquinolin-4-yl)-2,3,6,7-tetrahydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1=CC=C2C(NC(=O)N3C=4C=C5CCN(C5=CC=4CC3)C)=CC(C)=NC2=C1 YQSKRNAMJFNZIR-UHFFFAOYSA-N 0.000 description 3
- UDDLNSUXPBREKR-UHFFFAOYSA-N 1-methyl-n-pyridin-4-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(C)C=CC3=CC=2N1C(=O)NC1=CC=NC=C1 UDDLNSUXPBREKR-UHFFFAOYSA-N 0.000 description 3
- GAPWUKPSRLTVQM-UHFFFAOYSA-N 2,2,2-trifluoro-n-(1,2,3,4-tetrahydroquinolin-6-yl)acetamide Chemical compound N1CCCC2=CC(NC(=O)C(F)(F)F)=CC=C21 GAPWUKPSRLTVQM-UHFFFAOYSA-N 0.000 description 3
- OFLYOZJGDHCZJM-UHFFFAOYSA-N 2,3-dimethyl-7,8-dihydro-6h-pyrrolo[3,2-e]indole Chemical compound C1=C2N(C)C(C)=CC2=C2CCNC2=C1 OFLYOZJGDHCZJM-UHFFFAOYSA-N 0.000 description 3
- OMFFMBPYTYQBGJ-UHFFFAOYSA-N 2-methyl-2,3-dihydropyrrolo[2,3-f]indole Chemical compound C=1C2=NC=CC2=CC2=NC(C)CC2=1 OMFFMBPYTYQBGJ-UHFFFAOYSA-N 0.000 description 3
- HQXNVMCOIATJLQ-UHFFFAOYSA-N 3-(1-methyl-5-nitroindol-4-yl)propanenitrile Chemical compound [O-][N+](=O)C1=CC=C2N(C)C=CC2=C1CCC#N HQXNVMCOIATJLQ-UHFFFAOYSA-N 0.000 description 3
- FXLKHJJDBKPAAS-UHFFFAOYSA-N 3-(1-methyl-5-nitroindol-4-yl)propanoic acid Chemical compound [O-][N+](=O)C1=CC=C2N(C)C=CC2=C1CCC(O)=O FXLKHJJDBKPAAS-UHFFFAOYSA-N 0.000 description 3
- SHVVSKCXWMEDRW-UHFFFAOYSA-N 3-isocyanatopyridine Chemical compound O=C=NC1=CC=CN=C1 SHVVSKCXWMEDRW-UHFFFAOYSA-N 0.000 description 3
- WEWKWAVBLVLCPH-UHFFFAOYSA-N 3-methyl-n-pyridin-2-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide Chemical compound C12=CC=C3N(C)C=CC3=C2CCN1C(=O)NC1=CC=CC=N1 WEWKWAVBLVLCPH-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 208000024827 Alzheimer disease Diseases 0.000 description 3
- 208000019695 Migraine disease Diseases 0.000 description 3
- 208000021384 Obsessive-Compulsive disease Diseases 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 239000002249 anxiolytic agent Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229940049706 benzodiazepine Drugs 0.000 description 3
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- CLTIEWLQUWPOMG-UHFFFAOYSA-N imidazol-1-yl-(1-methyl-6,7-dihydropyrrolo[2,3-f]indol-5-yl)methanone Chemical compound C1CC=2C=C3N(C)C=CC3=CC=2N1C(=O)N1C=CN=C1 CLTIEWLQUWPOMG-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 206010027599 migraine Diseases 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- PRUNLDOGKNWIJD-UHFFFAOYSA-N 1-(1,6,7,8-tetrahydropyrrolo[2,3-g]quinolin-5-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCCC2=CC2=C1C=CN2 PRUNLDOGKNWIJD-UHFFFAOYSA-N 0.000 description 2
- FUXANRQWSQEXGS-UHFFFAOYSA-N 1-(1-ethyl-6,7-dihydropyrrolo[2,3-f]indol-5-yl)ethanone Chemical compound C1=C2N(CC)C=CC2=CC2=C1CCN2C(C)=O FUXANRQWSQEXGS-UHFFFAOYSA-N 0.000 description 2
- ONTBWNBXMXSDDT-UHFFFAOYSA-N 1-(5-acetyl-7,8-dihydro-6h-pyrrolo[2,3-g]quinolin-1-yl)-2,2,2-trifluoroethanone Chemical compound C1=C2N(C(=O)C)CCCC2=CC2=C1C=CN2C(=O)C(F)(F)F ONTBWNBXMXSDDT-UHFFFAOYSA-N 0.000 description 2
- VORCSTVWTCFCFA-UHFFFAOYSA-N 1-(6-amino-3,4-dihydro-2h-quinolin-1-yl)ethanone Chemical compound NC1=CC=C2N(C(=O)C)CCCC2=C1 VORCSTVWTCFCFA-UHFFFAOYSA-N 0.000 description 2
- RTRMDNPHPWZNFL-UHFFFAOYSA-N 1-[5-(2,2-diethoxyethylamino)-2,3-dihydroindol-1-yl]ethanone Chemical compound CCOC(OCC)CNC1=CC=C2N(C(C)=O)CCC2=C1 RTRMDNPHPWZNFL-UHFFFAOYSA-N 0.000 description 2
- YNEMICRTXIILNC-UHFFFAOYSA-N 1-ethyl-n-pyridin-3-yl-2,3,6,7-tetrahydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(CC)CCC3=CC=2N1C(=O)NC1=CC=CN=C1 YNEMICRTXIILNC-UHFFFAOYSA-N 0.000 description 2
- WNQLPEASDFDRIX-UHFFFAOYSA-N 1-methyl-6,7-dihydropyrrolo[2,3-f]indol-5-amine Chemical compound C1=C2N(C)C=CC2=CC2=C1CCN2N WNQLPEASDFDRIX-UHFFFAOYSA-N 0.000 description 2
- ALGWFDZQCYDZPU-UHFFFAOYSA-N 1-methyl-n-(3-methyl-1,2-oxazol-5-yl)-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound O1N=C(C)C=C1NC(=O)N1C2=CC(C=CN3C)=C3C=C2CC1 ALGWFDZQCYDZPU-UHFFFAOYSA-N 0.000 description 2
- YQYADMDNTTVUIL-UHFFFAOYSA-N 1-methyl-n-pyrazin-2-yl-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide Chemical compound C1CC=2C=C3N(C)C=CC3=CC=2N1C(=O)NC1=CN=CC=N1 YQYADMDNTTVUIL-UHFFFAOYSA-N 0.000 description 2
- CLNUAVFSLYQINX-UHFFFAOYSA-N 1-propyl-6,7-dihydro-5h-pyrrolo[2,3-f]indole Chemical compound C1=C2N(CCC)C=CC2=CC2=C1CCN2 CLNUAVFSLYQINX-UHFFFAOYSA-N 0.000 description 2
- ZSBIBUPCPAKCHR-UHFFFAOYSA-N 2,5-dimethyl-N-pyridin-3-yl-2,3-dihydropyrrolo[2,3-f]indole-1-carboxamide Chemical compound CC1CC2=CC=3N(C)C=CC=3C=C2N1C(=O)NC1=CC=CN=C1 ZSBIBUPCPAKCHR-UHFFFAOYSA-N 0.000 description 2
- BEYPSASEXGYPQE-UHFFFAOYSA-N 2-(1-methyl-5-nitroindol-4-yl)acetonitrile Chemical compound [O-][N+](=O)C1=CC=C2N(C)C=CC2=C1CC#N BEYPSASEXGYPQE-UHFFFAOYSA-N 0.000 description 2
- TWFXBWAPIMSEGL-UHFFFAOYSA-N 2-(1-methyl-5-nitroindol-4-yl)ethanol Chemical compound [O-][N+](=O)C1=CC=C2N(C)C=CC2=C1CCO TWFXBWAPIMSEGL-UHFFFAOYSA-N 0.000 description 2
- JVKXKIBYHWRLOJ-UHFFFAOYSA-N 2-hydroxyethyl methanesulfonate Chemical compound CS(=O)(=O)OCCO JVKXKIBYHWRLOJ-UHFFFAOYSA-N 0.000 description 2
- HLEMKDAHXGWJOZ-UHFFFAOYSA-N 3-(1-methyl-5-nitroindol-4-yl)propan-1-ol Chemical compound [O-][N+](=O)C1=CC=C2N(C)C=CC2=C1CCCO HLEMKDAHXGWJOZ-UHFFFAOYSA-N 0.000 description 2
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 2
- XTJCKXVBXANUMH-UHFFFAOYSA-N C(C)(=O)N1C(CCC2=CC(=CC=C12)CC(OCC)OCC)N Chemical compound C(C)(=O)N1C(CCC2=CC(=CC=C12)CC(OCC)OCC)N XTJCKXVBXANUMH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 238000006641 Fischer synthesis reaction Methods 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 206010019196 Head injury Diseases 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- UEQUQVLFIPOEMF-UHFFFAOYSA-N Mianserin Chemical compound C1C2=CC=CC=C2N2CCN(C)CC2C2=CC=CC=C21 UEQUQVLFIPOEMF-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- 206010033664 Panic attack Diseases 0.000 description 2
- 229920005439 Perspex® Polymers 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 208000022531 anorexia Diseases 0.000 description 2
- 229940005530 anxiolytics Drugs 0.000 description 2
- 230000006399 behavior Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 206010061428 decreased appetite Diseases 0.000 description 2
- FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical compound CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 229960004979 fampridine Drugs 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 235000003642 hunger Nutrition 0.000 description 2
- 208000003906 hydrocephalus Diseases 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000010534 mechanism of action Effects 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229960003955 mianserin Drugs 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 208000019906 panic disease Diseases 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- UVOMXDZIIPHCIM-UHFFFAOYSA-N pyrrolo[2,3-f]indole Chemical compound C=1C2=NC=CC2=CC2=NC=CC2=1 UVOMXDZIIPHCIM-UHFFFAOYSA-N 0.000 description 2
- XMIAFAKRAAMSGX-UHFFFAOYSA-N quinolin-5-amine Chemical compound C1=CC=C2C(N)=CC=CC2=N1 XMIAFAKRAAMSGX-UHFFFAOYSA-N 0.000 description 2
- RJSRSRITMWVIQT-UHFFFAOYSA-N quinolin-6-amine Chemical compound N1=CC=CC2=CC(N)=CC=C21 RJSRSRITMWVIQT-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 201000000980 schizophrenia Diseases 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 208000019116 sleep disease Diseases 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 230000037351 starvation Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 208000011117 substance-related disease Diseases 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- ZRTGHKVPFXNDHE-UHFFFAOYSA-N (3-methyl-1,2-thiazol-5-yl)azanium;chloride Chemical compound [Cl-].CC=1C=C([NH3+])SN=1 ZRTGHKVPFXNDHE-UHFFFAOYSA-N 0.000 description 1
- CIPPIFNVGHVCOP-UHFFFAOYSA-N 1,2-thiazole;hydrochloride Chemical compound Cl.C=1C=NSC=1 CIPPIFNVGHVCOP-UHFFFAOYSA-N 0.000 description 1
- ORECNKBJIMKZNX-UHFFFAOYSA-N 1,3-thiazol-3-ium;chloride Chemical compound Cl.C1=CSC=N1 ORECNKBJIMKZNX-UHFFFAOYSA-N 0.000 description 1
- MRUOHARYZNVXPI-UHFFFAOYSA-N 1-(1,2-dimethyl-6,7-dihydropyrrolo[2,3-f]indol-5-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC2=C1C=C(C)N2C MRUOHARYZNVXPI-UHFFFAOYSA-N 0.000 description 1
- BCOSCDSMXQOFII-UHFFFAOYSA-N 1-(3-ethyl-1,2-dimethylindol-5-yl)-3-[3-(trifluoromethyl)phenyl]urea Chemical compound C1=C2C(CC)=C(C)N(C)C2=CC=C1NC(=O)NC1=CC=CC(C(F)(F)F)=C1 BCOSCDSMXQOFII-UHFFFAOYSA-N 0.000 description 1
- OJKKTNFCWMBYMT-UHFFFAOYSA-N 1-(5-nitro-2,3-dihydroindol-1-yl)ethanone Chemical compound [O-][N+](=O)C1=CC=C2N(C(=O)C)CCC2=C1 OJKKTNFCWMBYMT-UHFFFAOYSA-N 0.000 description 1
- UERKTBSAPLOJRQ-UHFFFAOYSA-N 1-amino-1-phenylurea Chemical compound NC(=O)N(N)C1=CC=CC=C1 UERKTBSAPLOJRQ-UHFFFAOYSA-N 0.000 description 1
- KGMAATPJHMWNSR-UHFFFAOYSA-N 1-hydrazinyl-1-phenylurea Chemical compound NNN(C(N)=O)C1=CC=CC=C1 KGMAATPJHMWNSR-UHFFFAOYSA-N 0.000 description 1
- PXBQSCHRKSBGKV-UHFFFAOYSA-N 1-methyl-5-nitroindole Chemical compound [O-][N+](=O)C1=CC=C2N(C)C=CC2=C1 PXBQSCHRKSBGKV-UHFFFAOYSA-N 0.000 description 1
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 1
- IDPVCNMIFFCTDW-UHFFFAOYSA-N 2,2-diethoxyethyl trifluoromethanesulfonate Chemical compound CCOC(OCC)COS(=O)(=O)C(F)(F)F IDPVCNMIFFCTDW-UHFFFAOYSA-N 0.000 description 1
- NYPNCQTUZYWFGG-UHFFFAOYSA-N 2,2-dimethoxyethanol Chemical compound COC(CO)OC NYPNCQTUZYWFGG-UHFFFAOYSA-N 0.000 description 1
- FALCMQXTWHPRIH-UHFFFAOYSA-N 2,3-dichloroprop-1-ene Chemical compound ClCC(Cl)=C FALCMQXTWHPRIH-UHFFFAOYSA-N 0.000 description 1
- YUGDKEWUYZXXRU-UHFFFAOYSA-N 2-(4-chlorophenoxy)acetonitrile Chemical compound ClC1=CC=C(OCC#N)C=C1 YUGDKEWUYZXXRU-UHFFFAOYSA-N 0.000 description 1
- QRWRJDVVXAXGBT-UHFFFAOYSA-N 2-Methylindoline Chemical compound C1=CC=C2NC(C)CC2=C1 QRWRJDVVXAXGBT-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 1
- FNYSNYQGTXAVBX-UHFFFAOYSA-N 2-methyl-n-pyridin-3-yl-3,5-dihydro-2h-pyrrolo[2,3-f]indole-1-carboxamide Chemical compound CC1CC2=CC=3NC=CC=3C=C2N1C(=O)NC1=CC=CN=C1 FNYSNYQGTXAVBX-UHFFFAOYSA-N 0.000 description 1
- COCFIBRMFPWUDW-UHFFFAOYSA-N 2-methylquinolin-4-amine Chemical compound C1=CC=CC2=NC(C)=CC(N)=C21 COCFIBRMFPWUDW-UHFFFAOYSA-N 0.000 description 1
- PPHVFMDULQHSTJ-UHFFFAOYSA-N 3-(azidomethyl)pyridine Chemical compound [N-]=[N+]=NCC1=CC=CN=C1 PPHVFMDULQHSTJ-UHFFFAOYSA-N 0.000 description 1
- SVNCRRZKBNSMIV-UHFFFAOYSA-N 3-Aminoquinoline Chemical compound C1=CC=CC2=CC(N)=CN=C21 SVNCRRZKBNSMIV-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- FNXYWHTZDAVRTB-UHFFFAOYSA-N 3-methyl-1,2-oxazol-5-amine Chemical compound CC=1C=C(N)ON=1 FNXYWHTZDAVRTB-UHFFFAOYSA-N 0.000 description 1
- POOWHIHRODVUFI-UHFFFAOYSA-N 3-methyl-n-pyridin-3-yl-8,9-dihydro-7h-pyrrolo[3,2-f]quinoline-6-carboxamide Chemical compound C12=CC=C3N(C)C=CC3=C2CCCN1C(=O)NC1=CC=CN=C1 POOWHIHRODVUFI-UHFFFAOYSA-N 0.000 description 1
- DTVYNUOOZIKEEX-UHFFFAOYSA-N 5-aminoisoquinoline Chemical compound N1=CC=C2C(N)=CC=CC2=C1 DTVYNUOOZIKEEX-UHFFFAOYSA-N 0.000 description 1
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 1
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 108060003345 Adrenergic Receptor Proteins 0.000 description 1
- 102000017910 Adrenergic receptor Human genes 0.000 description 1
- 101000742062 Bos taurus Protein phosphatase 1G Proteins 0.000 description 1
- 241000557626 Corvus corax Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010013654 Drug abuse Diseases 0.000 description 1
- 208000030814 Eating disease Diseases 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 208000019454 Feeding and Eating disease Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 238000006147 Japp-Klingemann synthesis reaction Methods 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 235000003339 Nyssa sylvatica Nutrition 0.000 description 1
- 244000018764 Nyssa sylvatica Species 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 101100386054 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) CYS3 gene Proteins 0.000 description 1
- 241001125046 Sardina pilchardus Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000005864 Sulphur Chemical group 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N alpha-ketodiacetal Natural products O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000005010 aminoquinolines Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 230000009194 climbing Effects 0.000 description 1
- 229960003920 cocaine Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 229960001140 cyproheptadine Drugs 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 235000014632 disordered eating Nutrition 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000003370 grooming effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- CQILOHWHIWNQOE-UHFFFAOYSA-N indole-1-carboxamide Chemical compound C1=CC=C2N(C(=O)N)C=CC2=C1 CQILOHWHIWNQOE-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- FPCCSQOGAWCVBH-UHFFFAOYSA-N ketanserin Chemical compound C1=CC(F)=CC=C1C(=O)C1CCN(CCN2C(C3=CC=CC=C3NC2=O)=O)CC1 FPCCSQOGAWCVBH-UHFFFAOYSA-N 0.000 description 1
- 229960005417 ketanserin Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000002690 local anesthesia Methods 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229950008693 mesulergine Drugs 0.000 description 1
- WZHJKEUHNJHDLS-QTGUNEKASA-N metergoline Chemical compound C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4N(C)C=C(C=34)C2)C1)C)NC(=O)OCC1=CC=CC=C1 WZHJKEUHNJHDLS-QTGUNEKASA-N 0.000 description 1
- 229960004650 metergoline Drugs 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- LFLYALIIJSHAFJ-UHFFFAOYSA-N n-(1h-imidazol-2-yl)pyrrolo[2,3-e]indole-2-carboxamide Chemical compound N=1C2=C3C=CN=C3C=CC2=CC=1C(=O)NC1=NC=CN1 LFLYALIIJSHAFJ-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- LAIZPRYFQUWUBN-UHFFFAOYSA-L nickel chloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Ni+2] LAIZPRYFQUWUBN-UHFFFAOYSA-L 0.000 description 1
- 229960002715 nicotine Drugs 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 230000009871 nonspecific binding Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 229940043274 prophylactic drug Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- YMNAJWHTELQUJU-UHFFFAOYSA-N quinoline-6-carboxamide Chemical compound N1=CC=CC2=CC(C(=O)N)=CC=C21 YMNAJWHTELQUJU-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- JUQLTPCYUFPYKE-UHFFFAOYSA-N ritanserin Chemical compound CC=1N=C2SC=CN2C(=O)C=1CCN(CC1)CCC1=C(C=1C=CC(F)=CC=1)C1=CC=C(F)C=C1 JUQLTPCYUFPYKE-UHFFFAOYSA-N 0.000 description 1
- 229950009626 ritanserin Drugs 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 235000019512 sardine Nutrition 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000007619 statistical method Methods 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 101150035983 str1 gene Proteins 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 201000009032 substance abuse Diseases 0.000 description 1
- 231100000736 substance abuse Toxicity 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000002278 tabletting lubricant Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000004149 tartrazine Substances 0.000 description 1
- 229940126585 therapeutic drug Drugs 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB929217674A GB9217674D0 (en) | 1992-08-20 | 1992-08-20 | Novel compounds |
| GB9217674.2 | 1992-08-20 | ||
| GB939306461A GB9306461D0 (en) | 1993-03-29 | 1993-03-29 | Novel compounds |
| GB9306461.6 | 1993-03-29 | ||
| PCT/EP1993/002031 WO1994004533A1 (en) | 1992-08-20 | 1993-07-29 | Condensed indole derivatives as 5ht2c and 5ht2b antagonists |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPH08500580A true JPH08500580A (ja) | 1996-01-23 |
Family
ID=26301461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP6505828A Pending JPH08500580A (ja) | 1992-08-20 | 1993-07-29 | 5ht▲下2c▼および5ht▲下2b▼拮抗薬用縮合インドール誘導体 |
Country Status (13)
| Country | Link |
|---|---|
| EP (1) | EP0656003A1 (enExample) |
| JP (1) | JPH08500580A (enExample) |
| CN (1) | CN1086819A (enExample) |
| AP (1) | AP9300560A0 (enExample) |
| AU (1) | AU4704693A (enExample) |
| CA (1) | CA2142721A1 (enExample) |
| IL (1) | IL106737A0 (enExample) |
| MA (1) | MA22955A1 (enExample) |
| MX (1) | MX9305037A (enExample) |
| NZ (1) | NZ254785A (enExample) |
| SI (1) | SI9300438A (enExample) |
| TW (1) | TW248557B (enExample) |
| WO (1) | WO1994004533A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2006519798A (ja) * | 2003-03-11 | 2006-08-31 | グラクソ グループ リミテッド | 5HT2c受容体に活性を有する化合物及びその使用 |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9306460D0 (en) * | 1993-03-29 | 1993-05-19 | Smithkline Beecham Plc | Novel compounds |
| GB9313913D0 (en) * | 1993-07-06 | 1993-08-18 | Smithkline Beecham Plc | Novel compounds |
| GB9402542D0 (en) * | 1994-02-10 | 1994-04-06 | Smith Kline Beecham Plc | Novel compounds |
| EP0757687A1 (en) * | 1994-04-23 | 1997-02-12 | Smithkline Beecham Plc | Tricyclic derivatives as 5ht 2c? and 5ht 2b? antagonists |
| GB9420521D0 (en) * | 1994-10-12 | 1994-11-30 | Smithkline Beecham Plc | Novel compounds |
| GB9420999D0 (en) * | 1994-10-18 | 1994-12-07 | Smithkline Beecham Plc | Novel compounds |
| US5972937A (en) * | 1995-02-02 | 1999-10-26 | Smithkline Beecham P.L.C. | Heterocyclic compounds possessing 5HT2C receptor antagonist activity |
| CZ294097B6 (cs) | 1995-02-02 | 2004-10-13 | Smithklineábeechamáplc | Indolový derivátŹ způsob jeho přípravy a farmaceutická kompozice s jeho obsahem |
| GB9517559D0 (en) * | 1995-08-26 | 1995-10-25 | Smithkline Beecham Plc | Novel compounds |
| GB9607219D0 (en) * | 1996-04-04 | 1996-06-12 | Smithkline Beecham Plc | Novel compounds |
| GB9612883D0 (en) | 1996-06-20 | 1996-08-21 | Smithkline Beecham Plc | Novel compounds |
| GB9612885D0 (en) * | 1996-06-20 | 1996-08-21 | Smithkline Beecham Plc | Novel compounds |
| JP2001508767A (ja) * | 1996-12-02 | 2001-07-03 | 藤沢薬品工業株式会社 | 5―ht拮抗作用を有するインドール―ウレア誘導体 |
| GB9724372D0 (en) | 1997-11-18 | 1998-01-14 | Smithkline Beecham Plc | Novel compounds |
| UA77650C2 (en) | 1999-12-06 | 2007-01-15 | Lundbeck & Co As H | Use of serotonin reuptake inhibitor in combination with deramcyclane |
| FR2807754A1 (fr) * | 2000-04-13 | 2001-10-19 | Adir | Nouveaux derives de cyclobuta-indole carboxamide, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| FR2837823B1 (fr) * | 2002-03-27 | 2005-04-08 | Servier Lab | Nouveaux derives d'indoline, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| AU2003290009A1 (en) * | 2002-12-23 | 2004-07-14 | Bayer Healthcare Ag | Diagnostics and therapeutics for diseases assosciated with 5-hydroxytryptamine (serotonin) receptor 2b (5-hteb) |
| WO2014049153A1 (en) * | 2012-09-28 | 2014-04-03 | INSERM (Institut National de la Santé et de la Recherche Médicale) | Antagonists of the 5-ht2b receptor for use in the prevention or treatment of spasticity |
| EP4175637A4 (en) * | 2020-07-02 | 2024-08-07 | Purdue Research Foundation | Tetrahydro-3h-pyrazolo quinolone and tetrahydro-3h-pyrrolo[3,2-f]quinoline-containing compounds and uses thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR930702334A (ko) * | 1990-09-13 | 1993-09-08 | 데이비드 로버트 | 5 하이드록시트립타민 수용체 길항제로서의 인돌우레아 |
-
1993
- 1993-07-29 EP EP93917699A patent/EP0656003A1/en not_active Ceased
- 1993-07-29 CA CA002142721A patent/CA2142721A1/en not_active Abandoned
- 1993-07-29 AU AU47046/93A patent/AU4704693A/en not_active Abandoned
- 1993-07-29 NZ NZ254785A patent/NZ254785A/en unknown
- 1993-07-29 WO PCT/EP1993/002031 patent/WO1994004533A1/en not_active Ceased
- 1993-07-29 JP JP6505828A patent/JPH08500580A/ja active Pending
- 1993-08-18 MA MA23262A patent/MA22955A1/fr unknown
- 1993-08-18 MX MX9305037A patent/MX9305037A/es unknown
- 1993-08-19 AP APAP/P/1993/000560A patent/AP9300560A0/en unknown
- 1993-08-19 CN CN93116553A patent/CN1086819A/zh active Pending
- 1993-08-19 IL IL10673793A patent/IL106737A0/xx unknown
- 1993-08-19 TW TW082106679A patent/TW248557B/zh active
- 1993-08-20 SI SI9300438A patent/SI9300438A/sl unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2006519798A (ja) * | 2003-03-11 | 2006-08-31 | グラクソ グループ リミテッド | 5HT2c受容体に活性を有する化合物及びその使用 |
Also Published As
| Publication number | Publication date |
|---|---|
| CN1086819A (zh) | 1994-05-18 |
| IL106737A0 (en) | 1994-05-30 |
| AU4704693A (en) | 1994-03-15 |
| AP9300560A0 (en) | 1995-02-19 |
| NZ254785A (en) | 1995-09-26 |
| MA22955A1 (fr) | 1994-04-01 |
| WO1994004533A1 (en) | 1994-03-03 |
| TW248557B (enExample) | 1995-06-01 |
| CA2142721A1 (en) | 1994-03-03 |
| MX9305037A (es) | 1994-03-31 |
| EP0656003A1 (en) | 1995-06-07 |
| SI9300438A (en) | 1994-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH08500580A (ja) | 5ht▲下2c▼および5ht▲下2b▼拮抗薬用縮合インドール誘導体 | |
| RU2100357C1 (ru) | Гетероариламины или их фармацевтически приемлемые соли и фармацевтическая композиция на их основе | |
| DE60222396T2 (de) | N-(2-arylethyl) benzylamine als 5-ht6 rezeptor-antagoniste | |
| DE60122767T2 (de) | Indoly-lsulphonyl-verbindungen zur behandlung von störungen des zns | |
| DE60214990T2 (de) | Benzolsulfonsäureester-indol-5-yl als 5-ht6 rezeptor-antagonisten | |
| NZ249565A (en) | Hetring[1,2-a]indole-carboxy derivatives | |
| EA010233B1 (ru) | Противопаразитарные терпеновые алкалоиды | |
| JP2002532501A (ja) | キノリン誘導体 | |
| CZ296163B6 (cs) | Karboxyamidy chinolinu jako inhibitory TNF a inhibitory PDE-IV | |
| JPH07504429A (ja) | 5HT↓1cアンタゴニストとしてのインドール誘導体 | |
| US5872134A (en) | 5-HT4 receptor antagonists | |
| JPH09504519A (ja) | ピリダジノキノリン化合物 | |
| JP3165181B2 (ja) | 新規の3−アリールインドールおよび3−アリールインダゾール誘導体 | |
| DE69819903T2 (de) | Bicyclische verbindungen als liganden der 5-ht1 rezeptoren | |
| JP3803268B2 (ja) | アザビシクロアルカン誘導体とその治療的使用 | |
| JP3014001B2 (ja) | 興奮性アミノ酸拮抗剤 | |
| AU666357B2 (en) | Indole or benzimidazole derivatives | |
| JPH08502273A (ja) | 5−ht▲下4▼レセプターアンタゴニスト用複素環式エステルまたはアミド | |
| HUT51245A (en) | Process for production of derivatives of amidin and medical compositions containing such active substances | |
| JPH09512025A (ja) | 5ht▲下2c▼および5ht▲下2b▼アンタゴニストとしての三環式誘導体 | |
| JPH09508637A (ja) | 5ht2bレセプタ拮抗薬縮合インドール | |
| DE69320542T2 (de) | Pyrrolothienopyrazin-Verbindungen als 5HT3-Rezeptoren-Antagonisten | |
| US20040176370A1 (en) | 3,4-Dihdro-N-[[1-(3-hydroxybutyl)-4-piperidinyl]methyl]-2H-[1,3]oxazino[3,2-a]indole-10-carboxamide as 5-HT(4) receptor antagonist | |
| PL172692B1 (pl) | Skondensowane pochodne indolu PL | |
| HU211821A9 (hu) | Heterociklusos vegyületek |