JPH0745464B2 - β―ラクタム化合物類の製造法 - Google Patents
β―ラクタム化合物類の製造法Info
- Publication number
- JPH0745464B2 JPH0745464B2 JP59060505A JP6050584A JPH0745464B2 JP H0745464 B2 JPH0745464 B2 JP H0745464B2 JP 59060505 A JP59060505 A JP 59060505A JP 6050584 A JP6050584 A JP 6050584A JP H0745464 B2 JPH0745464 B2 JP H0745464B2
- Authority
- JP
- Japan
- Prior art keywords
- azetidinone
- formula
- hydroxy
- hydroxamic acid
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 β-lactam compounds Chemical class 0.000 title claims description 71
- 238000000034 method Methods 0.000 title claims description 23
- 239000002253 acid Substances 0.000 claims description 48
- 150000002148 esters Chemical class 0.000 claims description 37
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 32
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 claims description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 21
- 125000003277 amino group Chemical group 0.000 claims description 19
- 238000004519 manufacturing process Methods 0.000 claims description 18
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 12
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 claims description 8
- 125000004442 acylamino group Chemical group 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 6
- 125000005604 azodicarboxylate group Chemical group 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 4
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 229910052744 lithium Inorganic materials 0.000 claims description 4
- 239000012312 sodium hydride Substances 0.000 claims description 4
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 4
- 239000004305 biphenyl Substances 0.000 claims description 3
- 235000010290 biphenyl Nutrition 0.000 claims description 3
- 125000006267 biphenyl group Chemical group 0.000 claims description 3
- CIJWIJSYZZLMGD-UHFFFAOYSA-N diphenylphosphoryloxybenzene Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)OC1=CC=CC=C1 CIJWIJSYZZLMGD-UHFFFAOYSA-N 0.000 claims description 3
- 150000002903 organophosphorus compounds Chemical class 0.000 claims description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 3
- QLZHNIAADXEJJP-UHFFFAOYSA-L dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-L 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 238000007363 ring formation reaction Methods 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- 125000006239 protecting group Chemical group 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 20
- WPVIUZQMFSKPMN-UHFFFAOYSA-N 1-hydroxyazetidin-2-one Chemical compound ON1CCC1=O WPVIUZQMFSKPMN-UHFFFAOYSA-N 0.000 description 17
- 239000011541 reaction mixture Substances 0.000 description 17
- 238000003797 solvolysis reaction Methods 0.000 description 17
- 239000000047 product Substances 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 150000003952 β-lactams Chemical class 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 125000002252 acyl group Chemical group 0.000 description 10
- 238000005917 acylation reaction Methods 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 230000010933 acylation Effects 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000004809 thin layer chromatography Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 238000002329 infrared spectrum Methods 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- FYRWCLCXYGPMHL-UHFFFAOYSA-N [2-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl] acetate Chemical compound O=C1N(OC(=O)C)CC1NC(=O)OCC1=CC=CC=C1 FYRWCLCXYGPMHL-UHFFFAOYSA-N 0.000 description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229930189801 nocardicin Natural products 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- WZPBZJONDBGPKJ-VEHQQRBSSA-N aztreonam Chemical compound O=C1N(S([O-])(=O)=O)[C@@H](C)[C@@H]1NC(=O)C(=N/OC(C)(C)C(O)=O)\C1=CSC([NH3+])=N1 WZPBZJONDBGPKJ-VEHQQRBSSA-N 0.000 description 4
- 229960003644 aztreonam Drugs 0.000 description 4
- HEYRGKBQFPRFGI-UHFFFAOYSA-N benzyl n-(1-hydroxy-2-oxoazetidin-3-yl)carbamate Chemical compound O=C1N(O)CC1NC(=O)OCC1=CC=CC=C1 HEYRGKBQFPRFGI-UHFFFAOYSA-N 0.000 description 4
- 230000003115 biocidal effect Effects 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QOUVZVMYLLSASH-UHFFFAOYSA-N [2-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl] acetate Chemical compound O=C1N(OC(=O)C)CC1NC(=O)CC1=CC=CC=C1 QOUVZVMYLLSASH-UHFFFAOYSA-N 0.000 description 3
- 229960001171 acetohydroxamic acid Drugs 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- BSIMZHVOQZIAOY-SCSAIBSYSA-N 1-carbapenem-3-carboxylic acid Chemical compound OC(=O)C1=CC[C@@H]2CC(=O)N12 BSIMZHVOQZIAOY-SCSAIBSYSA-N 0.000 description 2
- QOEUNLQGZBSTBB-UHFFFAOYSA-N 1-methylazetidin-2-one Chemical group CN1CCC1=O QOEUNLQGZBSTBB-UHFFFAOYSA-N 0.000 description 2
- MBIZFBDREVRUHY-UHFFFAOYSA-N 2,6-Dimethoxybenzoic acid Chemical compound COC1=CC=CC(OC)=C1C(O)=O MBIZFBDREVRUHY-UHFFFAOYSA-N 0.000 description 2
- WIPRZRRNYWZHTF-UHFFFAOYSA-N 3-amino-1-hydroxyazetidin-2-one Chemical compound NC1CN(O)C1=O WIPRZRRNYWZHTF-UHFFFAOYSA-N 0.000 description 2
- PQKZFHHQCJHGQF-UHFFFAOYSA-N 4-aminoazetidin-2-one Chemical class NC1CC(=O)N1 PQKZFHHQCJHGQF-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- HPRXFUFSUCVUGS-UHFFFAOYSA-N [2-methyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl] acetate Chemical compound O=C1N(OC(C)=O)C(C)C1NC(=O)CC1=CC=CC=C1 HPRXFUFSUCVUGS-UHFFFAOYSA-N 0.000 description 2
- JIZQWIFMQSSNQE-UHFFFAOYSA-N [2-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazol-3-yl)azetidin-1-yl] acetate Chemical compound O=C1N(OC(=O)C)CC1N1C(=O)OC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 JIZQWIFMQSSNQE-UHFFFAOYSA-N 0.000 description 2
- CDOMXXVCZQOOMT-UHFFFAOYSA-N [phenoxy(phenyl)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(C=1C=CC=CC=1)(=O)OC1=CC=CC=C1 CDOMXXVCZQOOMT-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000002015 acyclic group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- NQXRQYKIEKLAHI-UHFFFAOYSA-N benzyl n-(2-oxoazetidin-3-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC1CNC1=O NQXRQYKIEKLAHI-UHFFFAOYSA-N 0.000 description 2
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 2
- 239000003781 beta lactamase inhibitor Substances 0.000 description 2
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 2
- 235000019796 monopotassium phosphate Nutrition 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- 229960003424 phenylacetic acid Drugs 0.000 description 2
- 239000003279 phenylacetic acid Substances 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229960001153 serine Drugs 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 2
- 229940126085 β‑Lactamase Inhibitor Drugs 0.000 description 2
- FAFRSCWDXJHQGG-UHFFFAOYSA-N (2-oxoazetidin-1-yl) acetate Chemical compound CC(=O)ON1CCC1=O FAFRSCWDXJHQGG-UHFFFAOYSA-N 0.000 description 1
- JAUFWTSSYRTLLB-UHFFFAOYSA-N (2-phenylacetyl) 2-phenylacetate Chemical compound C=1C=CC=CC=1CC(=O)OC(=O)CC1=CC=CC=C1 JAUFWTSSYRTLLB-UHFFFAOYSA-N 0.000 description 1
- VIKZIPIQNIJTFL-WMZJFQQLSA-N (2z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetamide Chemical compound CO\N=C(/C(N)=O)C1=CSC(N)=N1 VIKZIPIQNIJTFL-WMZJFQQLSA-N 0.000 description 1
- FYUVRCFERKALLL-UHFFFAOYSA-N (3-acetamido-2-oxoazetidin-1-yl) benzoate Chemical compound O=C1C(NC(=O)C)CN1OC(=O)C1=CC=CC=C1 FYUVRCFERKALLL-UHFFFAOYSA-N 0.000 description 1
- OIUQAVHMUQRHCM-UHFFFAOYSA-N (3-acetamido-2-oxoazetidin-1-yl) butanoate Chemical compound CCCC(=O)ON1CC(NC(C)=O)C1=O OIUQAVHMUQRHCM-UHFFFAOYSA-N 0.000 description 1
- POOBOZCGYDRECW-UHFFFAOYSA-N (3-benzamido-2-methyl-4-oxoazetidin-1-yl) 2-methoxyacetate Chemical compound O=C1N(OC(=O)COC)C(C)C1NC(=O)C1=CC=CC=C1 POOBOZCGYDRECW-UHFFFAOYSA-N 0.000 description 1
- YYLQUHNPNCGKJQ-NHYDCYSISA-N (3R)-3-hydroxy-L-aspartic acid Chemical compound OC(=O)[C@@H](N)[C@@H](O)C(O)=O YYLQUHNPNCGKJQ-NHYDCYSISA-N 0.000 description 1
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- VSCWEIHBQCQDNR-UHFFFAOYSA-N 1-acetyloxy-2-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazol-3-yl)azetidine-3-carboxylic acid Chemical compound O=C1N(OC(=O)C)CC1(C(O)=O)N1C(=O)OC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 VSCWEIHBQCQDNR-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- SMJRBWINMFUUDS-UHFFFAOYSA-N 2-thienylacetic acid Chemical compound OC(=O)CC1=CC=CS1 SMJRBWINMFUUDS-UHFFFAOYSA-N 0.000 description 1
- SROHGOJDCAODGI-UHFFFAOYSA-N 4,5-diphenyl-1,3-dioxol-2-one Chemical compound O1C(=O)OC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 SROHGOJDCAODGI-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- FVAADQUKVVRZOV-UHFFFAOYSA-N Cl.Cl.Cl.Cl.C(C)N(CC)CC Chemical compound Cl.Cl.Cl.Cl.C(C)N(CC)CC FVAADQUKVVRZOV-UHFFFAOYSA-N 0.000 description 1
- HZZVJAQRINQKSD-UHFFFAOYSA-N Clavulanic acid Natural products OC(=O)C1C(=CCO)OC2CC(=O)N21 HZZVJAQRINQKSD-UHFFFAOYSA-N 0.000 description 1
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- MHABMANUFPZXEB-UHFFFAOYSA-N O-demethyl-aloesaponarin I Natural products O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=C(O)C(C(O)=O)=C2C MHABMANUFPZXEB-UHFFFAOYSA-N 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- AXZNBAXFFGBXNW-UHFFFAOYSA-N [2-ethyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl] 2-phenylacetate Chemical compound O=C1N(OC(=O)CC=2C=CC=CC=2)C(CC)C1NC(=O)COC1=CC=CC=C1 AXZNBAXFFGBXNW-UHFFFAOYSA-N 0.000 description 1
- JPMYSUXSMRZMBC-UHFFFAOYSA-N [2-methyl-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl] acetate Chemical compound O=C1N(OC(C)=O)C(C)C1NC(=O)OCC1=CC=CC=C1 JPMYSUXSMRZMBC-UHFFFAOYSA-N 0.000 description 1
- BQAAFJLJDAFULB-UHFFFAOYSA-N [2-methyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl] hydrogen sulfate Chemical compound O=C1N(OS(O)(=O)=O)C(C)C1NC(=O)CC1=CC=CC=C1 BQAAFJLJDAFULB-UHFFFAOYSA-N 0.000 description 1
- RGMWDAPSYVPPMW-UHFFFAOYSA-N [2-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl] 2,2-dimethylpropanoate Chemical compound O=C1N(OC(=O)C(C)(C)C)CC1NC(=O)COC1=CC=CC=C1 RGMWDAPSYVPPMW-UHFFFAOYSA-N 0.000 description 1
- NNKLQHXWOBQRDL-UHFFFAOYSA-N [2-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl] 2-chloroacetate Chemical compound O=C1N(OC(=O)CCl)CC1NC(=O)COC1=CC=CC=C1 NNKLQHXWOBQRDL-UHFFFAOYSA-N 0.000 description 1
- WSUPZZZZGROKIO-UHFFFAOYSA-N [2-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl] 4-chlorobenzoate Chemical compound C1=CC(Cl)=CC=C1C(=O)ON1C(=O)C(NC(=O)CC=2SC=CC=2)C1 WSUPZZZZGROKIO-UHFFFAOYSA-N 0.000 description 1
- XDTUWHLTOIFHMS-UHFFFAOYSA-N [2-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl] acetate Chemical compound O=C1N(OC(=O)C)CC1NC(=O)CC1=CC=CS1 XDTUWHLTOIFHMS-UHFFFAOYSA-N 0.000 description 1
- XKWJKIAJMJORFK-UHFFFAOYSA-N [3-(1,3-dioxoisoindol-2-yl)-3-ethyl-2-oxoazetidin-1-yl] acetate Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1(CC)CN(OC(C)=O)C1=O XKWJKIAJMJORFK-UHFFFAOYSA-N 0.000 description 1
- FYOMSUVNKKFPPT-UHFFFAOYSA-N [3-(1-adamantyloxycarbonylamino)-2-oxo-4-phenylazetidin-1-yl] acetate Chemical compound C1C(C2)CC(C3)CC2CC13OC(=O)NC1C(=O)N(OC(=O)C)C1C1=CC=CC=C1 FYOMSUVNKKFPPT-UHFFFAOYSA-N 0.000 description 1
- BFCDJJGXOKMJEB-UHFFFAOYSA-N [3-(2,5-dioxopyrrolidin-1-yl)-2-oxoazetidin-1-yl] acetate Chemical compound O=C1N(OC(=O)C)CC1N1C(=O)CCC1=O BFCDJJGXOKMJEB-UHFFFAOYSA-N 0.000 description 1
- IZJFNXGBAONMPC-UHFFFAOYSA-N [3-(cyclohexyloxycarbonylamino)-2-oxoazetidin-1-yl] acetate Chemical compound O=C1N(OC(=O)C)CC1NC(=O)OC1CCCCC1 IZJFNXGBAONMPC-UHFFFAOYSA-N 0.000 description 1
- DYCOBZUDWPZLPO-UHFFFAOYSA-N [3-[(2,6-dimethoxybenzoyl)amino]-2-oxoazetidin-1-yl] acetate Chemical compound COC1=CC=CC(OC)=C1C(=O)NC1C(=O)N(OC(C)=O)C1 DYCOBZUDWPZLPO-UHFFFAOYSA-N 0.000 description 1
- CUGJBAJARSWQNY-UHFFFAOYSA-N [3-[(2,6-dimethoxybenzoyl)amino]-2-oxoazetidin-1-yl] propanoate Chemical compound O=C1N(OC(=O)CC)CC1NC(=O)C1=C(OC)C=CC=C1OC CUGJBAJARSWQNY-UHFFFAOYSA-N 0.000 description 1
- VBGQYCKSYCOHAW-UHFFFAOYSA-N [3-[(4-methylbenzoyl)amino]-2-oxoazetidin-1-yl] acetate Chemical compound O=C1N(OC(=O)C)CC1NC(=O)C1=CC=C(C)C=C1 VBGQYCKSYCOHAW-UHFFFAOYSA-N 0.000 description 1
- YNVWISHVXHVCGG-UHFFFAOYSA-N [3-methyl-2-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazol-3-yl)azetidin-1-yl] benzoate Chemical compound O=C1C(C)(N2C(OC(=C2C=2C=CC=CC=2)C=2C=CC=CC=2)=O)CN1OC(=O)C1=CC=CC=C1 YNVWISHVXHVCGG-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 125000005076 adamantyloxycarbonyl group Chemical group C12(CC3CC(CC(C1)C3)C2)OC(=O)* 0.000 description 1
- 125000000676 alkoxyimino group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001277 beta hydroxy acids Chemical class 0.000 description 1
- 125000003460 beta-lactamyl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Substances ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- HZZVJAQRINQKSD-PBFISZAISA-N clavulanic acid Chemical compound OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21 HZZVJAQRINQKSD-PBFISZAISA-N 0.000 description 1
- 229960003324 clavulanic acid Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- SFYDVRNDKJIDOO-UHFFFAOYSA-N ethyl 1-benzoyloxy-4-oxo-3-[(2-phenylacetyl)amino]azetidine-2-carboxylate Chemical compound O=C1N(OC(=O)C=2C=CC=CC=2)C(C(=O)OCC)C1NC(=O)CC1=CC=CC=C1 SFYDVRNDKJIDOO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 125000006331 halo benzoyl group Chemical group 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- RZYQVFNZQTZPKQ-UHFFFAOYSA-N lithium;ditert-butylazanide Chemical compound [Li+].CC(C)(C)[N-]C(C)(C)C RZYQVFNZQTZPKQ-UHFFFAOYSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- ANSUDRATXSJBLY-VKHMYHEASA-N methyl (2s)-2-amino-3-hydroxypropanoate Chemical compound COC(=O)[C@@H](N)CO ANSUDRATXSJBLY-VKHMYHEASA-N 0.000 description 1
- CINAUOAOVQPWIB-JTQLQIEISA-N methyl (2s)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate Chemical compound COC(=O)[C@H](CO)NC(=O)OCC1=CC=CC=C1 CINAUOAOVQPWIB-JTQLQIEISA-N 0.000 description 1
- OPZWAOJFQFYYIX-KOLCDFICSA-N methyl (2s,3r)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate Chemical compound COC(=O)[C@H]([C@@H](C)O)NC(=O)OCC1=CC=CC=C1 OPZWAOJFQFYYIX-KOLCDFICSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229940041009 monobactams Drugs 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003791 organic solvent mixture Substances 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- HHXMXAQDOUCLDN-RXMQYKEDSA-N penem Chemical compound S1C=CN2C(=O)C[C@H]21 HHXMXAQDOUCLDN-RXMQYKEDSA-N 0.000 description 1
- 150000002961 penems Chemical class 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 125000005543 phthalimide group Chemical group 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical group CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 238000005556 structure-activity relationship Methods 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BFRQXLVMBSCYLP-UHFFFAOYSA-N tert-butyl n-(2-oxo-1-sulfooxyazetidin-3-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CN(OS(O)(=O)=O)C1=O BFRQXLVMBSCYLP-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000006004 trihaloethyl group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002132 β-lactam antibiotic Substances 0.000 description 1
- 229940124586 β-lactam antibiotics Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/085—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a nitrogen atom directly attached in position 3
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US479375 | 1983-03-28 | ||
| US06/479,375 US4565654A (en) | 1983-03-28 | 1983-03-28 | N-Acyloxy monocyclic β-lactams |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6045560A JPS6045560A (ja) | 1985-03-12 |
| JPH0745464B2 true JPH0745464B2 (ja) | 1995-05-17 |
Family
ID=23903742
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59060505A Expired - Lifetime JPH0745464B2 (ja) | 1983-03-28 | 1984-03-27 | β―ラクタム化合物類の製造法 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4565654A (enExample) |
| EP (1) | EP0123442B1 (enExample) |
| JP (1) | JPH0745464B2 (enExample) |
| KR (1) | KR910004090B1 (enExample) |
| CA (1) | CA1331755C (enExample) |
| DE (1) | DE3472102D1 (enExample) |
| DK (2) | DK171132B1 (enExample) |
| GB (1) | GB2137203B (enExample) |
| GR (1) | GR81468B (enExample) |
| HU (1) | HU197303B (enExample) |
| IE (1) | IE57040B1 (enExample) |
| IL (1) | IL71300A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4638061A (en) * | 1985-01-28 | 1987-01-20 | E. R. Squibb & Sons, Inc. | [3S(Z)]-2-[[[1-(2-amino-4-thiazolyl)-2-[[2,2-dimethyl-4-oxo-1-(sulfooxy)-3-azetidinyl]amino]-2-oxoethylidene]-amino]oxy] acetic acid and intermediate |
| US4772694A (en) * | 1986-07-24 | 1988-09-20 | Eli Lilly And Company | Chiral 3-(1,2,5-trisubstituted imidazolidinone) azetidinone antibiotic intermediates |
| US4751296A (en) * | 1986-08-06 | 1988-06-14 | University Of Notre Dame Du Lac | Process for 4-halomethyl-azetidinones by cyclization of O-acylhydroxamates |
| JP2591233Y2 (ja) * | 1991-06-25 | 1999-03-03 | 東プレ株式会社 | バン型車における荷物扉の煽止装置 |
| US5631365A (en) | 1993-09-21 | 1997-05-20 | Schering Corporation | Hydroxy-substituted azetidinone compounds useful as hypocholesterolemic agents |
| US5925659A (en) * | 1996-05-07 | 1999-07-20 | Merck & Co., Inc. | Antibacterial agents |
| WO2019070672A1 (en) * | 2017-10-05 | 2019-04-11 | University Of Notre Dame Du Lac | ANTIBACTERIAL MONOBACTERAMES |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US337197A (en) * | 1886-03-02 | Ments | ||
| US4337197A (en) * | 1980-10-31 | 1982-06-29 | E. R. Squibb & Sons, Inc. | O-sulfated β-lactam hydroxamic acids and intermediates |
| US4386034A (en) * | 1981-02-02 | 1983-05-31 | E. R. Squibb & Sons, Inc. | Sulfamated amino acid amides |
| JPS58113174A (ja) * | 1981-12-26 | 1983-07-05 | Toyama Chem Co Ltd | 新規なアゼチジン誘導体またはその塩類を含有する抗菌剤 |
| EP0117053A1 (en) * | 1983-02-10 | 1984-08-29 | Ajinomoto Co., Inc. | Azetidinone derivatives |
-
1983
- 1983-03-28 US US06/479,375 patent/US4565654A/en not_active Expired - Fee Related
-
1984
- 1984-02-28 DK DK114384A patent/DK171132B1/da not_active IP Right Cessation
- 1984-03-21 IL IL71300A patent/IL71300A/xx not_active IP Right Cessation
- 1984-03-21 CA CA000450139A patent/CA1331755C/en not_active Expired - Fee Related
- 1984-03-23 KR KR1019840001503A patent/KR910004090B1/ko not_active Expired
- 1984-03-26 GR GR74220A patent/GR81468B/el unknown
- 1984-03-26 EP EP84302005A patent/EP0123442B1/en not_active Expired
- 1984-03-26 DE DE8484302005T patent/DE3472102D1/de not_active Expired
- 1984-03-26 GB GB08407768A patent/GB2137203B/en not_active Expired
- 1984-03-27 IE IE742/84A patent/IE57040B1/en not_active IP Right Cessation
- 1984-03-27 HU HU841219A patent/HU197303B/hu not_active IP Right Cessation
- 1984-03-27 JP JP59060505A patent/JPH0745464B2/ja not_active Expired - Lifetime
-
1995
- 1995-10-10 DK DK113695A patent/DK171676B1/da active
Also Published As
| Publication number | Publication date |
|---|---|
| KR910004090B1 (ko) | 1991-06-22 |
| DK114384D0 (da) | 1984-02-28 |
| DK171132B1 (da) | 1996-06-24 |
| HU197303B (en) | 1989-03-28 |
| KR840008145A (ko) | 1984-12-13 |
| GB2137203A (en) | 1984-10-03 |
| GR81468B (enExample) | 1984-12-11 |
| JPS6045560A (ja) | 1985-03-12 |
| DK114384A (da) | 1984-09-29 |
| CA1331755C (en) | 1994-08-30 |
| IL71300A0 (en) | 1984-06-29 |
| DK171676B1 (da) | 1997-03-10 |
| DK113695A (da) | 1995-10-10 |
| IL71300A (en) | 1990-01-18 |
| EP0123442A1 (en) | 1984-10-31 |
| EP0123442B1 (en) | 1988-06-15 |
| GB8407768D0 (en) | 1984-05-02 |
| GB2137203B (en) | 1987-01-14 |
| US4565654A (en) | 1986-01-21 |
| IE57040B1 (en) | 1992-03-25 |
| IE840742L (en) | 1984-09-28 |
| DE3472102D1 (en) | 1988-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4675399A (en) | Cyclization process for β-lactams | |
| EP0362902B1 (en) | Process and intermediates for beta-lactam antibiotics | |
| US4144232A (en) | Substituted azetidin-2-one antibiotics | |
| JP2529544B2 (ja) | 抗生物質のための中間体の製造方法 | |
| JPS6139313B2 (enExample) | ||
| JPH0745464B2 (ja) | β―ラクタム化合物類の製造法 | |
| KR870000230B1 (ko) | N-(치환된-메틸)-아제티딘-2-온의 제조방법 | |
| EP0256763B1 (en) | Process for azetidinones | |
| US4203896A (en) | Acetoxy azetidin-2-one antibiotics via thiazolidine ring cleavage | |
| KR900005322B1 (ko) | β-락탐 항생물질 제조용 중간체 | |
| CA1332059C (en) | Process for preparing cis-1-carba(1-dethia)cephalosporins and intermediates therefor | |
| US4127568A (en) | Process for 3β-aminoazetidin-2-ones | |
| US4257947A (en) | 3-Amino-2-hydroxy, halo or mercaptomethyl-4-oxoazetidines | |
| EP0132395A1 (en) | Improvements in or relating to the preparation of azetidinone sulfinic acids from cephalosporin sulfones | |
| US4243587A (en) | Process for 3β-aminoazetidin-2-ones | |
| US4180507A (en) | 4-Oxa 2,6 diazabicycloheptane derivatives | |
| US4226767A (en) | Intermediates for 3-aminoazetidin-2-ones | |
| JPH0516432B2 (enExample) | ||
| JPS60123465A (ja) | 4‐(3‐アシルアミノ‐2‐オキソ‐1‐アゼチジニル)‐4‐オキソ‐2‐ブテン酸 | |
| HK1007140B (en) | Process and intermediates for beta-lactam antibiotics | |
| PL108419B1 (en) | Method of producing sulfinyl chlorides | |
| JPH0565268A (ja) | アゼチジノン誘導体及びその製造法 | |
| ITMI960885A1 (it) | Procedimento per la preparazione di un azetidinone | |
| HU212104B (en) | Process for producing 3 beta-/4(s)-aryl-oxazolidine-2-one-3-il/-azetidine-2-one derivatives |