JPH0578600B2 - - Google Patents
Info
- Publication number
- JPH0578600B2 JPH0578600B2 JP59180817A JP18081784A JPH0578600B2 JP H0578600 B2 JPH0578600 B2 JP H0578600B2 JP 59180817 A JP59180817 A JP 59180817A JP 18081784 A JP18081784 A JP 18081784A JP H0578600 B2 JPH0578600 B2 JP H0578600B2
- Authority
- JP
- Japan
- Prior art keywords
- detergents
- detergent
- lower alkyl
- aqueous liquid
- viscosity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000003599 detergent Substances 0.000 claims abstract description 124
- 239000007788 liquid Substances 0.000 claims abstract description 68
- 229930182470 glycoside Natural products 0.000 claims abstract description 46
- -1 aliphatic glycosides Chemical class 0.000 claims abstract description 31
- 238000005191 phase separation Methods 0.000 claims abstract description 15
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 6
- 125000000837 carbohydrate group Chemical group 0.000 claims abstract 2
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 235000000346 sugar Nutrition 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 150000002338 glycosides Chemical class 0.000 abstract description 22
- 229920006395 saturated elastomer Polymers 0.000 abstract description 3
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- 239000003752 hydrotrope Substances 0.000 description 18
- 230000000694 effects Effects 0.000 description 16
- 235000019441 ethanol Nutrition 0.000 description 15
- 238000000034 method Methods 0.000 description 13
- 239000003945 anionic surfactant Substances 0.000 description 12
- 239000002736 nonionic surfactant Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000004615 ingredient Substances 0.000 description 10
- 239000000654 additive Substances 0.000 description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 239000000344 soap Substances 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 6
- 150000001720 carbohydrates Chemical class 0.000 description 6
- 125000000129 anionic group Chemical group 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 125000002791 glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 5
- 229920001542 oligosaccharide Polymers 0.000 description 5
- MNQZXJOMYWMBOU-UHFFFAOYSA-N glyceraldehyde Chemical compound OCC(O)C=O MNQZXJOMYWMBOU-UHFFFAOYSA-N 0.000 description 4
- QUCDWLYKDRVKMI-UHFFFAOYSA-M sodium;3,4-dimethylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1C QUCDWLYKDRVKMI-UHFFFAOYSA-M 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000003205 fragrance Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 239000002453 shampoo Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 150000008163 sugars Chemical class 0.000 description 3
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- SRBFZHDQGSBBOR-IOVATXLUSA-N D-xylopyranose Chemical compound O[C@@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-IOVATXLUSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000002280 amphoteric surfactant Substances 0.000 description 2
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 2
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 239000002537 cosmetic Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 229930182478 glucoside Natural products 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000002584 ketoses Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003605 opacifier Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 229940048842 sodium xylenesulfonate Drugs 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 2
- 235000019801 trisodium phosphate Nutrition 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- AVGPOAXYRRIZMM-UHFFFAOYSA-N D-Apiose Natural products OCC(O)(CO)C(O)C=O AVGPOAXYRRIZMM-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-WHZQZERISA-N D-aldose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-WHZQZERISA-N 0.000 description 1
- ASNHGEVAWNWCRQ-LJJLCWGRSA-N D-apiofuranose Chemical compound OC[C@@]1(O)COC(O)[C@@H]1O ASNHGEVAWNWCRQ-LJJLCWGRSA-N 0.000 description 1
- ASNHGEVAWNWCRQ-UHFFFAOYSA-N D-apiofuranose Natural products OCC1(O)COC(O)C1O ASNHGEVAWNWCRQ-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000007976 Ketosis Diseases 0.000 description 1
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001323 aldoses Chemical group 0.000 description 1
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 1
- SRBFZHDQGSBBOR-STGXQOJASA-N alpha-D-lyxopyranose Chemical compound O[C@@H]1CO[C@H](O)[C@@H](O)[C@H]1O SRBFZHDQGSBBOR-STGXQOJASA-N 0.000 description 1
- PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 1
- MWOBKFYERIDQSZ-UHFFFAOYSA-N benzene;sodium Chemical compound [Na].C1=CC=CC=C1 MWOBKFYERIDQSZ-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 229930182830 galactose Natural products 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000008131 glucosides Chemical class 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 150000002402 hexoses Chemical class 0.000 description 1
- 125000002951 idosyl group Chemical class C1([C@@H](O)[C@H](O)[C@@H](O)[C@H](O1)CO)* 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000002482 oligosaccharides Chemical class 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003538 tetroses Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003641 trioses Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/0026—Structured liquid compositions, e.g. liquid crystalline phases or network containing non-Newtonian phase
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/662—Carbohydrates or derivatives
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/20—Organic compounds containing oxygen
- C11D3/22—Carbohydrates or derivatives thereof
- C11D3/221—Mono, di- or trisaccharides or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Molecular Biology (AREA)
- Crystallography & Structural Chemistry (AREA)
- Emergency Medicine (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/529,435 US4488981A (en) | 1983-09-06 | 1983-09-06 | Lower alkyl glycosides to reduce viscosity in aqueous liquid detergents |
| US61529435 | 1983-09-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS60106893A JPS60106893A (ja) | 1985-06-12 |
| JPH0578600B2 true JPH0578600B2 (Direct) | 1993-10-29 |
Family
ID=24109899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59180817A Granted JPS60106893A (ja) | 1983-09-06 | 1984-08-31 | 水性液体洗剤の低級アルキルグリコシド |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4488981A (Direct) |
| EP (1) | EP0136844B1 (Direct) |
| JP (1) | JPS60106893A (Direct) |
| CA (1) | CA1231029A (Direct) |
| DE (1) | DE3481524D1 (Direct) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2557134B1 (fr) * | 1983-12-23 | 1986-11-28 | Produits Ind Cie Fse | Additif pour bains de nettoyage alcalins, produit complet le contenant et utilisation |
| US4732696A (en) * | 1984-11-06 | 1988-03-22 | A. E. Staley Manufacturing Company | Monoglycosides as viscosity modifiers in detergents |
| DE3577878D1 (de) * | 1984-11-06 | 1990-06-28 | Henkel Kgaa | Monoglykoside als viskositaetsregler in detergenzien. |
| USH171H (en) | 1985-06-24 | 1986-12-02 | A. E. Staley Manufacturing Company | Branched chain glycosides |
| US4675127A (en) * | 1985-09-26 | 1987-06-23 | A. E. Staley Manufacturing Company | Process for preparing particulate detergent compositions |
| US5035814A (en) * | 1986-01-30 | 1991-07-30 | Colgate-Palmolive Company | Liquid detergent having improved softening properties |
| IL81354A (en) * | 1986-01-30 | 1990-11-05 | Colgate Palmolive Co | Liquid detergent having improved softening properties |
| DE3603581A1 (de) * | 1986-02-06 | 1987-08-13 | Henkel Kgaa | Verfahren zur reinigung von alkylglycosiden, durch dieses verfahren erhaeltliche produkte und deren verwendung |
| EP0270600A4 (en) * | 1986-05-06 | 1988-07-04 | Staley Mfg Co A E | LIQUID DETERGENT CONTAINING AN ALKYL GLYCOSIDE SURFACE ACTIVE AGENT. |
| DE3640755A1 (de) * | 1986-11-28 | 1988-06-09 | Henkel Kgaa | Fliessfaehiges perlglanzkonzentrat |
| DE3708330A1 (de) * | 1987-03-14 | 1988-09-22 | Henkel Kgaa | Fluessige, alkalische reinigerkonzentrate |
| GB8716949D0 (en) * | 1987-07-17 | 1987-08-26 | Ici Plc | Composition |
| DE3779121D1 (de) * | 1987-07-21 | 1992-06-17 | Chemischer Praeparate Von Dr R | Feuerloeschschaummittel. |
| MY103951A (en) * | 1988-01-12 | 1993-10-30 | Kao Corp | Detergent composition |
| AU5709090A (en) * | 1989-06-30 | 1991-01-03 | Amway Corporation | Built liquid detergent compositions |
| US5242615A (en) * | 1989-09-14 | 1993-09-07 | Henkel Corporation | Anionic and amphoteric surfactant compositions with reduced viscosity |
| US6087320A (en) * | 1989-09-14 | 2000-07-11 | Henkel Corp. | Viscosity-adjusted surfactant concentrate compositions |
| WO1991004313A1 (en) * | 1989-09-14 | 1991-04-04 | Henkel Corporation | Anionic and amphoteric surfactant compositions with reduced viscosity |
| GB8927956D0 (en) * | 1989-12-11 | 1990-02-14 | Unilever Plc | Detergent composition |
| GB8928067D0 (en) * | 1989-12-12 | 1990-02-14 | Unilever Plc | Detergent compositions |
| DE4005958A1 (de) * | 1990-02-26 | 1991-08-29 | Huels Chemische Werke Ag | Fluessiges, schaeumendes reinigungsmittel |
| DE4015655A1 (de) * | 1990-05-16 | 1991-11-21 | Basf Ag | Alkylmono- und alkylpolyglucosidethercarboxylate, verfahren zu ihrer herstellung und ihre verwendung |
| DE4017922A1 (de) * | 1990-06-05 | 1991-12-12 | Henkel Kgaa | Fluessige alkylglykosidhaltige tensidmischung |
| DE4110506A1 (de) * | 1991-03-30 | 1992-10-01 | Huels Chemische Werke Ag | Emulgatoren zur herstellung von in der kosmetik oder medizin verwendbaren oel-in-wasser-emulsionen etherischer oele |
| DE4117689A1 (de) * | 1991-05-29 | 1992-12-03 | Henkel Kgaa | Fluessige, giess- und pumpfaehige tensidzubereitung |
| US5266690A (en) * | 1991-12-19 | 1993-11-30 | Henkel Corporation | Preparation of alkylpolyglycosides |
| US5449763A (en) * | 1991-10-10 | 1995-09-12 | Henkel Corporation | Preparation of alkylpolyglycosides |
| DE4210365C2 (de) * | 1992-03-30 | 1995-06-08 | Henkel Kgaa | Verwendung von Reinigungsmitteln für harte Oberflächen |
| DE4210912A1 (de) * | 1992-04-02 | 1993-10-07 | Henkel Kgaa | Schaumarme wäßrige Detergensgemische |
| CA2135641A1 (en) * | 1992-06-16 | 1993-12-23 | Allen D. Urfer | Viscosity-adjusted surfactant concentrate compositions |
| DE4225224A1 (de) * | 1992-07-30 | 1994-02-03 | Henkel Kgaa | Verfahren zur Herstellung von lagerstabilen nichtionischen Tensiden |
| SK53294A3 (en) * | 1993-05-07 | 1995-04-12 | Albright & Wilson | Concentrated aqueous mixture containing surface active matter and its use |
| GB9309475D0 (en) * | 1993-05-07 | 1993-06-23 | Albright & Wilson | Concentrated aqueous based surfactant compositions |
| US6090762A (en) * | 1993-05-07 | 2000-07-18 | Albright & Wilson Uk Limited | Aqueous based surfactant compositions |
| US5415801A (en) * | 1993-08-27 | 1995-05-16 | The Procter & Gamble Company | Concentrated light duty liquid or gel dishwashing detergent compositions containing sugar |
| US5474710A (en) * | 1993-08-27 | 1995-12-12 | Ofosu-Asanta; Kofi | Process for preparing concentrated surfactant mixtures containing magnesium |
| DE4344991A1 (de) * | 1993-12-30 | 1995-07-06 | Huels Chemische Werke Ag | Verfahren zur Umwandlung hexagonal flüssig-kristalliner wäßriger Tensidphasen |
| AU675833B2 (en) * | 1994-03-23 | 1997-02-20 | Amway Corporation | Concentrated all-purpose light duty liquid cleaning composition and method of use |
| TW294720B (Direct) * | 1994-09-30 | 1997-01-01 | Unilever Nv | |
| US5576280A (en) * | 1994-10-21 | 1996-11-19 | Colgate-Palmolive Company | Solid personal cleansing composition comprising a precomplex of cationic surfactants and anionic materials |
| DE4439091A1 (de) * | 1994-11-02 | 1996-05-09 | Henkel Kgaa | Oberflächenaktive Mittel |
| SE510989C2 (sv) * | 1997-10-29 | 1999-07-19 | Akzo Nobel Nv | Högakaliska kompositioner innehållande en hexylglykosid som hydrotrop |
| US20030162686A1 (en) * | 1997-10-29 | 2003-08-28 | Ingegard Johansson | Highly alkaline compositions containing a hexyl glycoside as a hydrotrope |
| AU1165999A (en) | 1997-11-14 | 1999-06-07 | U.S. Borax Inc. | Bleach catalysts |
| DE19933404A1 (de) * | 1999-07-21 | 2001-01-25 | Henkel Kgaa | Reinigungsmittel für harte Oberflächen |
| EP1754774B1 (en) * | 1999-08-10 | 2012-09-19 | The Procter & Gamble Company | Detergent compositions comprising hydrotropes |
| US6384010B1 (en) | 2000-06-15 | 2002-05-07 | S.C. Johnson & Son, Inc. | All purpose cleaner with low organic solvent content |
| FR2932093B1 (fr) * | 2008-06-05 | 2012-07-20 | Anios Lab Sarl | Composition pour la desinfection et la decontamination simultanees de corps contamines par des agents transmissibles conventionnels (atc) et non conventionnels (atnc). |
| JP5813670B2 (ja) * | 2010-03-12 | 2015-11-17 | コグニス・アイピー・マネージメント・ゲゼルシャフト・ミット・ベシュレンクテル・ハフツングCognis IP Management GmbH | コカミドモノエタノールアミド液状濃厚組成物およびその製造方法 |
| US8389457B2 (en) | 2010-09-22 | 2013-03-05 | Ecolab Usa Inc. | Quaternary functionalized alkyl polyglucosides for enhanced food soil removal |
| US8658584B2 (en) | 2010-06-21 | 2014-02-25 | Ecolab Usa Inc. | Sulfosuccinate functionalized alkyl polyglucosides for enhanced food and oily soil removal |
| US8329633B2 (en) | 2010-09-22 | 2012-12-11 | Ecolab Usa Inc. | Poly quaternary functionalized alkyl polyglucosides for enhanced food soil removal |
| US20120046208A1 (en) | 2010-08-23 | 2012-02-23 | Ecolab Usa Inc. | Poly phosphate functionalized alkyl polyglucosides for enhanced food soil removal |
| US20110312866A1 (en) | 2010-06-21 | 2011-12-22 | Ecolab Usa Inc. | Alkyl polypentosides and alkyl polyglucosides (c8-c11) used for enhanced food soil removal |
| US20110312867A1 (en) | 2010-06-21 | 2011-12-22 | Ecolab Usa Inc. | Betaine functionalized alkyl polyglucosides for enhanced food soil removal |
| US20120046215A1 (en) | 2010-08-23 | 2012-02-23 | Ecolab Usa Inc. | Poly sulfonate functionalized alkyl polyglucosides for enhanced food soil removal |
| US8460477B2 (en) | 2010-08-23 | 2013-06-11 | Ecolab Usa Inc. | Ethoxylated alcohol and monoethoxylated quaternary amines for enhanced food soil removal |
| US8877703B2 (en) | 2010-09-22 | 2014-11-04 | Ecolab Usa Inc. | Stearyl and lauryl dimoniumhydroxy alkyl polyglucosides for enhanced food soil removal |
| GB2495109B (en) * | 2011-09-29 | 2016-06-08 | Gama Healthcare Ltd | A wet wipe |
| US20150252310A1 (en) | 2014-03-07 | 2015-09-10 | Ecolab Usa Inc. | Alkyl amides for enhanced food soil removal and asphalt dissolution |
| FR3068043A1 (fr) * | 2017-06-22 | 2018-12-28 | Societe D'exploitation De Produits Pour Les Industries Chimiques Seppic | Nouveau melange tensioactif, nouvelle composition en comprenant et son utilisation en cosmetique |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3219656A (en) * | 1963-08-12 | 1965-11-23 | Rohm & Haas | Alkylpolyalkoxyalkyl glucosides and process of preparation therefor |
| US3547828A (en) * | 1968-09-03 | 1970-12-15 | Rohm & Haas | Alkyl oligosaccharides and their mixtures with alkyl glucosides and alkanols |
| US3721633A (en) * | 1969-10-06 | 1973-03-20 | Atlas Chem Ind | Aqueous built liquid detergents containing alkyl glycosides |
| US3839318A (en) * | 1970-09-27 | 1974-10-01 | Rohm & Haas | Process for preparation of alkyl glucosides and alkyl oligosaccharides |
| US3892681A (en) * | 1973-02-16 | 1975-07-01 | Procter & Gamble | Detergent compositions containing water insoluble starch |
| US4014808A (en) * | 1973-06-04 | 1977-03-29 | Tennant Company | Detergent composition |
| US4154706A (en) * | 1976-07-23 | 1979-05-15 | Colgate-Palmolive Company | Nonionic shampoo |
| CA1083911A (en) * | 1976-12-13 | 1980-08-19 | Thaddeus J. Kaniecki | Liquid cleaning compositions and process therefor |
| US4240921A (en) * | 1979-03-28 | 1980-12-23 | Stauffer Chemical Company | Liquid cleaning concentrate |
| US4230592A (en) * | 1979-05-31 | 1980-10-28 | Chemed Corporation | Controlled foam detergent additive |
| US4396520A (en) * | 1982-04-26 | 1983-08-02 | The Procter & Gamble Company | Detergent compositions |
| US4393203B2 (en) * | 1982-04-26 | 1997-07-01 | Procter & Gamble | Process of preparing alkylpolysaccharides |
-
1983
- 1983-09-06 US US06/529,435 patent/US4488981A/en not_active Expired - Lifetime
-
1984
- 1984-07-20 CA CA000459406A patent/CA1231029A/en not_active Expired
- 1984-08-31 JP JP59180817A patent/JPS60106893A/ja active Granted
- 1984-09-05 DE DE8484306064T patent/DE3481524D1/de not_active Expired - Fee Related
- 1984-09-05 EP EP84306064A patent/EP0136844B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS60106893A (ja) | 1985-06-12 |
| EP0136844A2 (en) | 1985-04-10 |
| DE3481524D1 (de) | 1990-04-12 |
| EP0136844B1 (en) | 1990-03-07 |
| CA1231029A (en) | 1988-01-05 |
| US4488981A (en) | 1984-12-18 |
| EP0136844A3 (en) | 1987-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0578600B2 (Direct) | ||
| US5627144A (en) | Composition for enhanced crude oil recovery operations containing hydrochloric acid or hydrofluoric acid, or mixtures thereof with ester quaternary ammonium compounds or/and alkyl quaternary ammonium compounds | |
| EP0623670B1 (en) | Aqueous based surfactant compositions | |
| US4675127A (en) | Process for preparing particulate detergent compositions | |
| US5200115A (en) | Paste-form detergent containing alkyl glycoside and α-sulfoffaty acid di-salt as surfactants | |
| JPH0559394A (ja) | 洗剤組成物 | |
| JPS58222196A (ja) | 洗剤組成物 | |
| EP0273472A1 (en) | Aqueous detergent compositions containing diethyleneglycol monohexyl ether solvent | |
| US5118439A (en) | Process for preparing a detergent slurry and particulate detergent composition | |
| US4780234A (en) | Built liquid laundry detergent containing alkyl glycoside surfactant | |
| US4242215A (en) | Substantially environmental-pollution-free laundry detergent composition | |
| US4842767A (en) | Heavy duty built aqueous liquid detergent composition containing stabilized enzymes | |
| JPH10507788A (ja) | 低起泡性液体洗剤組成物 | |
| US4820448A (en) | Surfactant mixtures and their use | |
| KR100278221B1 (ko) | 분말형 계면 활성제 혼합물 | |
| US5395543A (en) | Freeflowing alkaline detergent, and agents for the preparation thereof | |
| US5744441A (en) | Enhanced performance of amphoteric surfactants | |
| JPH037718B2 (Direct) | ||
| WO1990004630A1 (en) | A process for preparing a detergent slurry and particulate detergent composition | |
| US20040005994A1 (en) | Solid compositions containing hydrocolloids and processes for preparing the same | |
| JPS60101200A (ja) | 水性、ビルダー入り液体洗剤組成物 | |
| US5854195A (en) | Light duty liquid cleaning compositions | |
| JPS58132094A (ja) | 洗剤組成物 | |
| JPH0311810B2 (Direct) | ||
| JPH0311811B2 (Direct) |