JPH051792B2 - - Google Patents
Info
- Publication number
- JPH051792B2 JPH051792B2 JP59172528A JP17252884A JPH051792B2 JP H051792 B2 JPH051792 B2 JP H051792B2 JP 59172528 A JP59172528 A JP 59172528A JP 17252884 A JP17252884 A JP 17252884A JP H051792 B2 JPH051792 B2 JP H051792B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- indazole
- piperidinyl
- hydrogen
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 claims abstract description 10
- -1 ethoxycarbonylethyl Chemical group 0.000 claims description 78
- 150000001875 compounds Chemical class 0.000 claims description 55
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 claims description 54
- 229910052739 hydrogen Inorganic materials 0.000 claims description 52
- 239000001257 hydrogen Substances 0.000 claims description 52
- 150000003839 salts Chemical class 0.000 claims description 43
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- 239000002904 solvent Substances 0.000 claims description 37
- 229910052736 halogen Chemical group 0.000 claims description 28
- 150000002367 halogens Chemical group 0.000 claims description 28
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 27
- 125000001589 carboacyl group Chemical group 0.000 claims description 25
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 11
- 230000003287 optical effect Effects 0.000 claims description 11
- 238000007363 ring formation reaction Methods 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 8
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 5
- 230000000561 anti-psychotic effect Effects 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 230000000202 analgesic effect Effects 0.000 claims description 4
- 238000007796 conventional method Methods 0.000 claims description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- SGPHKYYTTJBXFC-UHFFFAOYSA-N [3-(1-methylpiperidin-4-yl)indazol-1-yl]-phenylmethanone Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=CC=C1 SGPHKYYTTJBXFC-UHFFFAOYSA-N 0.000 claims description 2
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- JMANVNJQNLATNU-UHFFFAOYSA-N glycolonitrile Natural products N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 20
- HTSYZZUOESDOGP-UHFFFAOYSA-N 1-(cyclopropylmethyl)-3-(1-methylpiperidin-4-yl)indazole Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1CC1CC1 HTSYZZUOESDOGP-UHFFFAOYSA-N 0.000 claims 1
- TVWAKSMIVLMEGV-UHFFFAOYSA-N 1-[3-(1-methylpiperidin-4-yl)indazol-1-yl]ethanone Chemical compound C1CN(C)CCC1C1=NN(C(C)=O)C2=CC=CC=C12 TVWAKSMIVLMEGV-UHFFFAOYSA-N 0.000 claims 1
- KGOQMWAJZAYHBQ-UHFFFAOYSA-N 1-benzyl-3-(1-methylpiperidin-4-yl)indazole Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1CC1=CC=CC=C1 KGOQMWAJZAYHBQ-UHFFFAOYSA-N 0.000 claims 1
- PZSQXJZPGBMFKN-UHFFFAOYSA-N 1-ethyl-3-(1-methylpiperidin-4-yl)indazole Chemical compound C12=CC=CC=C2N(CC)N=C1C1CCN(C)CC1 PZSQXJZPGBMFKN-UHFFFAOYSA-N 0.000 claims 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 229940079593 drug Drugs 0.000 claims 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims 1
- HEEOHMKCCDUYLO-UHFFFAOYSA-N 3-pyrrolidin-1-yl-1h-indazole Chemical class C1CCCN1C1=NNC2=CC=CC=C12 HEEOHMKCCDUYLO-UHFFFAOYSA-N 0.000 abstract description 13
- 208000028017 Psychotic disease Diseases 0.000 abstract description 3
- 239000000543 intermediate Substances 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 138
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 115
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 111
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 92
- 239000011541 reaction mixture Substances 0.000 description 79
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 79
- 239000000047 product Substances 0.000 description 75
- 239000000203 mixture Substances 0.000 description 67
- 239000003921 oil Substances 0.000 description 66
- 238000002844 melting Methods 0.000 description 65
- 230000008018 melting Effects 0.000 description 65
- 238000000921 elemental analysis Methods 0.000 description 61
- 239000000243 solution Substances 0.000 description 58
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- 239000007787 solid Substances 0.000 description 50
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 40
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 37
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 31
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 238000010992 reflux Methods 0.000 description 29
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 26
- 239000000725 suspension Substances 0.000 description 26
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 25
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 24
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 22
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 22
- 229910052757 nitrogen Inorganic materials 0.000 description 22
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 20
- 229910000027 potassium carbonate Inorganic materials 0.000 description 20
- 235000011181 potassium carbonates Nutrition 0.000 description 20
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 19
- CUMYVWVEQXBEQZ-UHFFFAOYSA-N (2-fluorophenyl)-piperidin-1-ylmethanone Chemical compound FC1=CC=CC=C1C(=O)N1CCCCC1 CUMYVWVEQXBEQZ-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 18
- 239000012312 sodium hydride Substances 0.000 description 18
- 229910000104 sodium hydride Inorganic materials 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 17
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 17
- 239000002253 acid Substances 0.000 description 16
- 239000000284 extract Substances 0.000 description 16
- 239000004533 oil dispersion Substances 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 239000001530 fumaric acid Substances 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 238000001953 recrystallisation Methods 0.000 description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 239000000523 sample Substances 0.000 description 14
- VIQDUCBDZPYNNX-UHFFFAOYSA-N phenyl(pyrrolidin-1-yl)methanone Chemical compound C=1C=CC=CC=1C(=O)N1CCCC1 VIQDUCBDZPYNNX-UHFFFAOYSA-N 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 229960001701 chloroform Drugs 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 12
- 239000007788 liquid Substances 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 11
- KKXOXLSLPLCIQE-UHFFFAOYSA-N 3-piperidin-1-yl-1h-indazole Chemical compound C1CCCCN1C1=NNC2=CC=CC=C12 KKXOXLSLPLCIQE-UHFFFAOYSA-N 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 10
- 239000007900 aqueous suspension Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 239000000908 ammonium hydroxide Substances 0.000 description 9
- 230000009194 climbing Effects 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- RNSGBYUFHBXKPU-UHFFFAOYSA-N 1-chloropyrrolidine Chemical compound ClN1CCCC1 RNSGBYUFHBXKPU-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 8
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 8
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 8
- JLVASVCIQIXUIE-UHFFFAOYSA-N phenyl 2-(2-fluorobenzoyl)pyrrolidine-1-carboxylate Chemical compound FC1=CC=CC=C1C(=O)C1N(C(=O)OC=2C=CC=CC=2)CCC1 JLVASVCIQIXUIE-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- GDHXJNRAJRCGMX-UHFFFAOYSA-N 2-fluorobenzonitrile Chemical compound FC1=CC=CC=C1C#N GDHXJNRAJRCGMX-UHFFFAOYSA-N 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 239000002024 ethyl acetate extract Substances 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000000538 analytical sample Substances 0.000 description 6
- 229960004046 apomorphine Drugs 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000011736 potassium bicarbonate Substances 0.000 description 6
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 6
- 235000015497 potassium bicarbonate Nutrition 0.000 description 6
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 235000017550 sodium carbonate Nutrition 0.000 description 6
- ANRNAWIFBBHGTG-UHFFFAOYSA-N 3-(1-methylpiperidin-4-yl)-2h-indazole Chemical compound C1CN(C)CCC1C1=C2C=CC=CC2=NN1 ANRNAWIFBBHGTG-UHFFFAOYSA-N 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 5
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 5
- NTBUQDLWHOHUDR-UHFFFAOYSA-N ethyl acetate;n-ethylethanamine Chemical compound CCNCC.CCOC(C)=O NTBUQDLWHOHUDR-UHFFFAOYSA-N 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- GOYDNIKZWGIXJT-UHFFFAOYSA-N 1,2-difluorobenzene Chemical compound FC1=CC=CC=C1F GOYDNIKZWGIXJT-UHFFFAOYSA-N 0.000 description 4
- GZAJLJZAEGURHR-UHFFFAOYSA-N 1-(1-methylpiperidin-4-yl)indazole Chemical compound C1CN(C)CCC1N1C2=CC=CC=C2C=N1 GZAJLJZAEGURHR-UHFFFAOYSA-N 0.000 description 4
- YXTROGRGRSPWKL-UHFFFAOYSA-N 1-benzoylpiperidine Chemical compound C=1C=CC=CC=1C(=O)N1CCCCC1 YXTROGRGRSPWKL-UHFFFAOYSA-N 0.000 description 4
- 241000699666 Mus <mouse, genus> Species 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 235000008504 concentrate Nutrition 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 4
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 150000003053 piperidines Chemical class 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003235 pyrrolidines Chemical class 0.000 description 4
- 239000002516 radical scavenger Substances 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- AZBXHPRYPHBYCV-UHFFFAOYSA-N (2-fluorophenyl)-pyrrolidin-1-ylmethanone Chemical compound FC1=CC=CC=C1C(=O)N1CCCC1 AZBXHPRYPHBYCV-UHFFFAOYSA-N 0.000 description 3
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 3
- DBOWKWSBQIBMRD-UHFFFAOYSA-N 6-fluoro-3-(1-methylpiperidin-4-yl)-2h-indazole Chemical compound C1CN(C)CCC1C1=NNC2=CC(F)=CC=C12 DBOWKWSBQIBMRD-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000003849 aromatic solvent Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 3
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- GGZDLAOKPXEJCP-UHFFFAOYSA-N phenyl piperidine-1-carboxylate Chemical compound C1CCCCN1C(=O)OC1=CC=CC=C1 GGZDLAOKPXEJCP-UHFFFAOYSA-N 0.000 description 3
- FYQGHJHASJALLI-UHFFFAOYSA-N phenyl pyrrolidine-1-carboxylate Chemical compound C1CCCN1C(=O)OC1=CC=CC=C1 FYQGHJHASJALLI-UHFFFAOYSA-N 0.000 description 3
- 239000003880 polar aprotic solvent Substances 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- MSCURGXTUQIQQN-UHFFFAOYSA-N (2-fluorophenyl)-(1-methylpiperidin-4-yl)methanone Chemical compound C1CN(C)CCC1C(=O)C1=CC=CC=C1F MSCURGXTUQIQQN-UHFFFAOYSA-N 0.000 description 2
- VGMGTQOMZFTZEF-UHFFFAOYSA-N (4-fluorophenyl)-(5-nitro-3-piperidin-4-ylindazol-1-yl)methanone Chemical compound C12=CC([N+](=O)[O-])=CC=C2N(C(=O)C=2C=CC(F)=CC=2)N=C1C1CCNCC1 VGMGTQOMZFTZEF-UHFFFAOYSA-N 0.000 description 2
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- KDISMIMTGUMORD-UHFFFAOYSA-N 1-acetylpiperidine Chemical compound CC(=O)N1CCCCC1 KDISMIMTGUMORD-UHFFFAOYSA-N 0.000 description 2
- QJGYTZXVKOEVPG-UHFFFAOYSA-N 1-methyl-3-[3-[4-[1-(1,3-thiazole-2-carbonyl)indazol-3-yl]piperidin-1-yl]propyl]benzimidazol-2-one Chemical compound O=C1N(C)C2=CC=CC=C2N1CCCN(CC1)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=NC=CS1 QJGYTZXVKOEVPG-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- RUBYJGUJWAWMDX-UHFFFAOYSA-N 2-[3-[7-(trifluoromethyl)-2h-indazol-3-yl]piperidin-1-yl]acetonitrile Chemical compound N=1NC=2C(C(F)(F)F)=CC=CC=2C=1C1CCCN(CC#N)C1 RUBYJGUJWAWMDX-UHFFFAOYSA-N 0.000 description 2
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 2
- XZLFPRHKUAYTLM-UHFFFAOYSA-N 3-(1-ethylpiperidin-4-yl)-6-fluoro-2h-indazole Chemical compound C1CN(CC)CCC1C1=NNC2=CC(F)=CC=C12 XZLFPRHKUAYTLM-UHFFFAOYSA-N 0.000 description 2
- NUTVXXBYEOMWCL-UHFFFAOYSA-N 3-(1-formylpiperidin-4-yl)indazole-1-carbaldehyde Chemical compound C1CN(C=O)CCC1C1=NN(C=O)C2=CC=CC=C12 NUTVXXBYEOMWCL-UHFFFAOYSA-N 0.000 description 2
- ARIUDBMLSDSQLR-UHFFFAOYSA-N 3-[1-(3-phenylpropyl)piperidin-4-yl]-2h-indazole Chemical compound C1CC(C=2C3=CC=CC=C3NN=2)CCN1CCCC1=CC=CC=C1 ARIUDBMLSDSQLR-UHFFFAOYSA-N 0.000 description 2
- RSTVGZVJMOSMCP-UHFFFAOYSA-N 3-[4-(cyclopropylmethyl)piperidin-3-yl]-6-methyl-1-pyrimidin-2-ylindazole Chemical compound C12=CC(C)=CC=C2C(C2C(CCNC2)CC2CC2)=NN1C1=NC=CC=N1 RSTVGZVJMOSMCP-UHFFFAOYSA-N 0.000 description 2
- NSWCVGLOSFLVQJ-UHFFFAOYSA-N 3-pyrrolidin-3-yl-2h-indazole Chemical compound C1NCCC1C1=NNC2=CC=CC=C12 NSWCVGLOSFLVQJ-UHFFFAOYSA-N 0.000 description 2
- NKMLGWFQRBENHW-UHFFFAOYSA-N 4-(1-benzoylindazol-3-yl)piperidine-1-carbonitrile Chemical compound N1=C(C2CCN(CC2)C#N)C2=CC=CC=C2N1C(=O)C1=CC=CC=C1 NKMLGWFQRBENHW-UHFFFAOYSA-N 0.000 description 2
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 2
- QDJBZCFDSIEFDW-UHFFFAOYSA-N 4-[4-(5,6-dichloro-1-prop-1-enylindazol-3-yl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one Chemical compound C12=CC(Cl)=C(Cl)C=C2N(C=CC)N=C1C(CC1)CCN1CCCC(=O)C1=CC=C(F)C=C1 QDJBZCFDSIEFDW-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- CXPQMMRSFJHSER-UHFFFAOYSA-N 6-chloro-3-(1-methylpiperidin-4-yl)-2h-indazole Chemical compound C1CN(C)CCC1C1=NNC2=CC(Cl)=CC=C12 CXPQMMRSFJHSER-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- MGAVDVHTZXNMPF-UHFFFAOYSA-N [3-(1-methylpiperidin-4-yl)indazol-1-yl]-phenylmethanone;hydrochloride Chemical compound Cl.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=CC=C1 MGAVDVHTZXNMPF-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- AQIXEPGDORPWBJ-UHFFFAOYSA-N pentan-3-ol Chemical compound CCC(O)CC AQIXEPGDORPWBJ-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000008174 sterile solution Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NDFAEBPEDOZSTQ-UHFFFAOYSA-N (2,3-dichlorophenyl)-[3-(1-methylpiperidin-4-yl)indazol-1-yl]methanone Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=CC(Cl)=C1Cl NDFAEBPEDOZSTQ-UHFFFAOYSA-N 0.000 description 1
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- AXMFFPFZQFTQPB-UHFFFAOYSA-N (3-chlorophenyl)-[3-(1-methylpiperidin-4-yl)indazol-1-yl]methanone;hydrochloride Chemical compound Cl.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=CC(Cl)=C1 AXMFFPFZQFTQPB-UHFFFAOYSA-N 0.000 description 1
- KZENPBQLSRBKBE-UHFFFAOYSA-N (3-pyrrolidin-1-ylindazol-1-yl)methanol Chemical compound C12=CC=CC=C2N(CO)N=C1N1CCCC1 KZENPBQLSRBKBE-UHFFFAOYSA-N 0.000 description 1
- LXJVBAGCDGSHFZ-UHFFFAOYSA-N (4-chlorophenyl)-[3-(1-ethylpiperidin-4-yl)-6-fluoroindazol-1-yl]methanone;hydrochloride Chemical compound Cl.C1CN(CC)CCC1C(C1=CC=C(F)C=C11)=NN1C(=O)C1=CC=C(Cl)C=C1 LXJVBAGCDGSHFZ-UHFFFAOYSA-N 0.000 description 1
- GDNMXTQHRGTAIP-UHFFFAOYSA-N (4-fluorophenyl)-[3-(1-methylpiperidin-4-yl)indazol-1-yl]methanone Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=C(F)C=C1 GDNMXTQHRGTAIP-UHFFFAOYSA-N 0.000 description 1
- BCIBWTCZEQZGBO-WLHGVMLRSA-N (e)-but-2-enedioic acid;(4-chlorophenyl)-[3-(1-methylpiperidin-4-yl)indazol-1-yl]methanone Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=C(Cl)C=C1 BCIBWTCZEQZGBO-WLHGVMLRSA-N 0.000 description 1
- GDANOTNLVPICMD-WLHGVMLRSA-N (e)-but-2-enedioic acid;(4-methylphenyl)-[3-(1-methylpiperidin-4-yl)indazol-1-yl]methanone Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=C(C)C=C1 GDANOTNLVPICMD-WLHGVMLRSA-N 0.000 description 1
- BORHVPUHIPRYPO-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-(2-chlorophenyl)-3-(1-methylpiperidin-4-yl)indazole Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=C1Cl BORHVPUHIPRYPO-WLHGVMLRSA-N 0.000 description 1
- MMFLCJAUFDLRHW-WLHGVMLRSA-N (e)-but-2-enedioic acid;2-[3-(1-methylpiperidin-4-yl)indazol-1-yl]aniline Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=C1N MMFLCJAUFDLRHW-WLHGVMLRSA-N 0.000 description 1
- OVKOQOJTBVXVII-WLHGVMLRSA-N (e)-but-2-enedioic acid;3-(1-methylpiperidin-4-yl)-1-(2-nitrophenyl)indazole Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=C1[N+]([O-])=O OVKOQOJTBVXVII-WLHGVMLRSA-N 0.000 description 1
- CYQMHQAGRSLPEP-WLHGVMLRSA-N (e)-but-2-enedioic acid;3-(1-methylpiperidin-4-yl)-1-pyridin-2-ylindazole Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=N1 CYQMHQAGRSLPEP-WLHGVMLRSA-N 0.000 description 1
- SKIGBHMAKNGDAP-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-fluoro-1-(2-fluorophenyl)-3-(1-methylpiperidin-4-yl)indazole Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=C(F)C=C11)=NN1C1=CC=CC=C1F SKIGBHMAKNGDAP-WLHGVMLRSA-N 0.000 description 1
- DDSYFWZBECUJSD-WLHGVMLRSA-N (e)-but-2-enedioic acid;[3-(1-methylpiperidin-4-yl)indazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C(=O)C1=CC=C(C(F)(F)F)C=C1 DDSYFWZBECUJSD-WLHGVMLRSA-N 0.000 description 1
- CNAZPOFMEKQKQI-WLHGVMLRSA-N (e)-but-2-enedioic acid;[6-fluoro-3-(1-methylpiperidin-4-yl)indazol-1-yl]-phenylmethanone Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(C1=CC=C(F)C=C11)=NN1C(=O)C1=CC=CC=C1 CNAZPOFMEKQKQI-WLHGVMLRSA-N 0.000 description 1
- PSLOWOWGMZXKAT-LVEZLNDCSA-N (e)-but-2-enedioic acid;n,n-dimethyl-3-[3-(1-methylpiperidin-4-yl)indazol-1-yl]propan-1-amine Chemical compound OC(=O)\C=C\C(O)=O.OC(=O)\C=C\C(O)=O.C12=CC=CC=C2N(CCCN(C)C)N=C1C1CCN(C)CC1 PSLOWOWGMZXKAT-LVEZLNDCSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- UEMGWPRHOOEKTA-UHFFFAOYSA-N 1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1 UEMGWPRHOOEKTA-UHFFFAOYSA-N 0.000 description 1
- RSRLBVBPWVCXOU-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-(1-methylpiperidin-4-yl)indazole Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=C1Cl RSRLBVBPWVCXOU-UHFFFAOYSA-N 0.000 description 1
- JOTSTDGUMMVNKI-UHFFFAOYSA-N 1-(2-fluorophenyl)-3-(1-methylpiperidin-4-yl)indazole;hydrochloride Chemical compound Cl.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=C1F JOTSTDGUMMVNKI-UHFFFAOYSA-N 0.000 description 1
- GKDMDZCDOBMIDA-UHFFFAOYSA-N 1-(3-fluorophenyl)-3-(1-methylpiperidin-4-yl)indazole;hydrochloride Chemical compound Cl.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC(F)=C1 GKDMDZCDOBMIDA-UHFFFAOYSA-N 0.000 description 1
- QYYXRNNZWYUBLW-UHFFFAOYSA-N 1-(benzenesulfonyl)-3-(1-methylpiperidin-4-yl)indazole;hydrochloride Chemical compound Cl.C1CN(C)CCC1C1=NN(S(=O)(=O)C=2C=CC=CC=2)C2=CC=CC=C12 QYYXRNNZWYUBLW-UHFFFAOYSA-N 0.000 description 1
- MOBRMRJUKNQBMY-UHFFFAOYSA-N 1-(chloromethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CCl MOBRMRJUKNQBMY-UHFFFAOYSA-N 0.000 description 1
- IVNWMSMPZDTPEO-UHFFFAOYSA-N 1-[(2-fluorophenyl)methyl]-3-(1-methylpiperidin-4-yl)indazole;hydrobromide Chemical compound Br.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1CC1=CC=CC=C1F IVNWMSMPZDTPEO-UHFFFAOYSA-N 0.000 description 1
- QWIWEPHEVMBSNO-UHFFFAOYSA-N 1-[3-(1-methylpiperidin-4-yl)indazol-1-yl]ethanone;hydrochloride Chemical compound Cl.C1CN(C)CCC1C1=NN(C(C)=O)C2=CC=CC=C12 QWIWEPHEVMBSNO-UHFFFAOYSA-N 0.000 description 1
- XXLLNVFCASMNBJ-UHFFFAOYSA-N 1-[4-(6-bromo-2h-indazol-3-yl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C1=NNC2=CC(Br)=CC=C12 XXLLNVFCASMNBJ-UHFFFAOYSA-N 0.000 description 1
- MBKYAOWBXGGFQJ-UHFFFAOYSA-N 1-[4-(6-fluoro-1-phenylindazol-3-yl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(C1=CC=C(F)C=C11)=NN1C1=CC=CC=C1 MBKYAOWBXGGFQJ-UHFFFAOYSA-N 0.000 description 1
- VUXKMLSMXRMFMC-UHFFFAOYSA-N 1-[4-(6-fluoro-2h-indazol-3-yl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C1=C2C=CC(F)=CC2=NN1 VUXKMLSMXRMFMC-UHFFFAOYSA-N 0.000 description 1
- ILUBCSYYADPWFB-UHFFFAOYSA-N 1-[4-[c-(2,4-difluorophenyl)carbonohydrazonoyl]piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=NN)C1=CC=C(F)C=C1F ILUBCSYYADPWFB-UHFFFAOYSA-N 0.000 description 1
- UXXLTPGCINZEFM-UHFFFAOYSA-N 1-[4-chloro-1-(4-fluorophenyl)butyl]-4-fluorobenzene Chemical compound C1=CC(F)=CC=C1C(CCCCl)C1=CC=C(F)C=C1 UXXLTPGCINZEFM-UHFFFAOYSA-N 0.000 description 1
- OHCPVLJEAHBMEG-UHFFFAOYSA-N 1-acetylpiperidine-4-carbonyl chloride Chemical compound CC(=O)N1CCC(C(Cl)=O)CC1 OHCPVLJEAHBMEG-UHFFFAOYSA-N 0.000 description 1
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- QDFKKJYEIFBEFC-UHFFFAOYSA-N 1-bromo-3-fluorobenzene Chemical compound FC1=CC=CC(Br)=C1 QDFKKJYEIFBEFC-UHFFFAOYSA-N 0.000 description 1
- WLDBFHWXAVBMAN-UHFFFAOYSA-N 1-bromoindazole Chemical compound C1=CC=C2N(Br)N=CC2=C1 WLDBFHWXAVBMAN-UHFFFAOYSA-N 0.000 description 1
- RJCGZNCCVKIBHO-UHFFFAOYSA-N 1-chloro-4-fluorobenzene Chemical compound FC1=CC=C(Cl)C=C1 RJCGZNCCVKIBHO-UHFFFAOYSA-N 0.000 description 1
- JPZXCTCYMWFXCA-UHFFFAOYSA-N 1-ethyl-3-(1-methylpiperidin-4-yl)indazole;hydrobromide Chemical compound Br.C12=CC=CC=C2N(CC)N=C1C1CCN(C)CC1 JPZXCTCYMWFXCA-UHFFFAOYSA-N 0.000 description 1
- BGVGHYOIWIALFF-UHFFFAOYSA-N 1-fluoro-2-(trifluoromethyl)benzene Chemical compound FC1=CC=CC=C1C(F)(F)F BGVGHYOIWIALFF-UHFFFAOYSA-N 0.000 description 1
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 1
- UNNNAIWPDLRVRN-UHFFFAOYSA-N 1-fluoro-4-(trifluoromethyl)benzene Chemical compound FC1=CC=C(C(F)(F)F)C=C1 UNNNAIWPDLRVRN-UHFFFAOYSA-N 0.000 description 1
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- XKVRLLXHIWKFFR-UHFFFAOYSA-N 1-piperidin-1-ylindazole Chemical compound C1CCCCN1N1C2=CC=CC=C2C=N1 XKVRLLXHIWKFFR-UHFFFAOYSA-N 0.000 description 1
- LJCZNYWLQZZIOS-UHFFFAOYSA-N 2,2,2-trichlorethoxycarbonyl chloride Chemical compound ClC(=O)OCC(Cl)(Cl)Cl LJCZNYWLQZZIOS-UHFFFAOYSA-N 0.000 description 1
- MUCJPWCFAGJZMX-UHFFFAOYSA-N 2,2,2-trichloroethyl 3-(1-methylpiperidin-4-yl)indazole-1-carboxylate;hydrochloride Chemical compound Cl.C1CN(C)CCC1C1=NN(C(=O)OCC(Cl)(Cl)Cl)C2=CC=CC=C12 MUCJPWCFAGJZMX-UHFFFAOYSA-N 0.000 description 1
- YBONBWJSFMTXLE-UHFFFAOYSA-N 2,3-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1Cl YBONBWJSFMTXLE-UHFFFAOYSA-N 0.000 description 1
- DAEBQCQIJHJNPE-UHFFFAOYSA-N 2-(benzenesulfonyl)-1h-indole Chemical compound C=1C2=CC=CC=C2NC=1S(=O)(=O)C1=CC=CC=C1 DAEBQCQIJHJNPE-UHFFFAOYSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- MTAODLNXWYIKSO-UHFFFAOYSA-N 2-fluoropyridine Chemical compound FC1=CC=CC=N1 MTAODLNXWYIKSO-UHFFFAOYSA-N 0.000 description 1
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- HILNSYHKKWOONT-UHFFFAOYSA-N 3-(1-methylpiperidin-4-yl)-1-(2-nitrophenyl)indazole Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=C1[N+]([O-])=O HILNSYHKKWOONT-UHFFFAOYSA-N 0.000 description 1
- PTLCZSJYDQWKDN-UHFFFAOYSA-N 3-(1-methylpiperidin-4-yl)-1-(2-phenylethyl)indazole;hydrobromide Chemical compound Br.C1CN(C)CCC1C(C1=CC=CC=C11)=NN1CCC1=CC=CC=C1 PTLCZSJYDQWKDN-UHFFFAOYSA-N 0.000 description 1
- QXYNCDHQQINWDJ-UHFFFAOYSA-N 3-(1-methylpiperidin-4-yl)-1-[2-(trifluoromethyl)phenyl]indazole Chemical compound C1CN(C)CCC1C(C1=CC=CC=C11)=NN1C1=CC=CC=C1C(F)(F)F QXYNCDHQQINWDJ-UHFFFAOYSA-N 0.000 description 1
- OGZMTWNGJWMUAD-UHFFFAOYSA-N 3-(1-prop-1-enylpiperidin-4-yl)-2h-indazole Chemical compound C1CN(C=CC)CCC1C1=NNC2=CC=CC=C12 OGZMTWNGJWMUAD-UHFFFAOYSA-N 0.000 description 1
- XONBKLFCLPGIPC-UHFFFAOYSA-N 3-(3-chloropropyl)-6-fluoro-1,2-benzoxazole Chemical compound FC1=CC=C2C(CCCCl)=NOC2=C1 XONBKLFCLPGIPC-UHFFFAOYSA-N 0.000 description 1
- PLUHCUWLPHGUMP-UHFFFAOYSA-N 3-[3-(1-methylpiperidin-4-yl)indazol-1-yl]propan-1-ol Chemical compound C1CN(C)CCC1C1=NN(CCCO)C2=CC=CC=C12 PLUHCUWLPHGUMP-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- NXXBDKOYTAXAKM-UHFFFAOYSA-N 3-piperidin-4-yl-2h-indazole Chemical compound C1CNCCC1C1=C2C=CC=CC2=NN1 NXXBDKOYTAXAKM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QCECVXDZBKNFLW-UHFFFAOYSA-N 4-[1-(2-chlorophenyl)indazol-3-yl]piperidine-1-carbonitrile Chemical compound ClC1=CC=CC=C1N1C2=CC=CC=C2C(C2CCN(CC2)C#N)=N1 QCECVXDZBKNFLW-UHFFFAOYSA-N 0.000 description 1
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 1
- PVMNPAUTCMBOMO-UHFFFAOYSA-N 4-chloropyridine Chemical compound ClC1=CC=NC=C1 PVMNPAUTCMBOMO-UHFFFAOYSA-N 0.000 description 1
- XGAFCCUNHIMIRV-UHFFFAOYSA-N 4-chloropyridine;hydron;chloride Chemical compound Cl.ClC1=CC=NC=C1 XGAFCCUNHIMIRV-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- UTZMEPQGJYECQR-UHFFFAOYSA-N 6-bromo-1-methyl-3-piperidin-4-ylindazole;hydrochloride Chemical compound Cl.C12=CC=C(Br)C=C2N(C)N=C1C1CCNCC1 UTZMEPQGJYECQR-UHFFFAOYSA-N 0.000 description 1
- UIHKJMALLZWACK-UHFFFAOYSA-N 6-fluoro-2-piperidin-4-yl-1,3-dihydroindazole Chemical compound N1C2=CC(F)=CC=C2CN1C1CCNCC1 UIHKJMALLZWACK-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- OJEPAFJIBGIPCP-VQYXCCSOSA-N C(\C=C\C(=O)O)(=O)O.N1=CC=C(C=C1)N1N=C(C2=CC=CC=C12)C1CCN(CC1)C.C(\C=C\C(=O)O)(=O)O.C(\C=C\C(=O)O)(=O)O.N1=CC=C(C=C1)N1N=C(C2=CC=CC=C12)C1CCN(CC1)C Chemical compound C(\C=C\C(=O)O)(=O)O.N1=CC=C(C=C1)N1N=C(C2=CC=CC=C12)C1CCN(CC1)C.C(\C=C\C(=O)O)(=O)O.C(\C=C\C(=O)O)(=O)O.N1=CC=C(C=C1)N1N=C(C2=CC=CC=C12)C1CCN(CC1)C OJEPAFJIBGIPCP-VQYXCCSOSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000006679 Mentha X verticillata Nutrition 0.000 description 1
- 235000002899 Mentha suaveolens Nutrition 0.000 description 1
- 235000001636 Mentha x rotundifolia Nutrition 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- WOWGKFCYAIIZJJ-UHFFFAOYSA-N [1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-(2-fluorophenyl)methanone;oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCN1CCC(C(=O)C=2C(=CC=CC=2)F)CC1 WOWGKFCYAIIZJJ-UHFFFAOYSA-N 0.000 description 1
- UQCAZWTVOXEBBL-UHFFFAOYSA-N [3-(1-methylpiperidin-4-yl)indazol-1-yl]methanol Chemical compound C1CN(C)CCC1C1=NN(CO)C2=CC=CC=C12 UQCAZWTVOXEBBL-UHFFFAOYSA-N 0.000 description 1
- LLASROSDHRVWHT-UHFFFAOYSA-N [3-[1-(2-ethylphenyl)piperidin-4-yl]indazol-1-yl]-phenylmethanone;hydrochloride Chemical compound Cl.CCC1=CC=CC=C1N1CCC(C=2C3=CC=CC=C3N(C(=O)C=3C=CC=CC=3)N=2)CC1 LLASROSDHRVWHT-UHFFFAOYSA-N 0.000 description 1
- SETYGXSNCXFROP-UHFFFAOYSA-N [6-chloro-3-(1-methylpiperidin-4-yl)indazol-1-yl]-phenylmethanone;hydrochloride Chemical compound Cl.C1CN(C)CCC1C(C1=CC=C(Cl)C=C11)=NN1C(=O)C1=CC=CC=C1 SETYGXSNCXFROP-UHFFFAOYSA-N 0.000 description 1
- AVMNFQHJOOYCAP-UHFFFAOYSA-N acetic acid;propanoic acid Chemical compound CC(O)=O.CCC(O)=O AVMNFQHJOOYCAP-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000000164 antipsychotic agent Substances 0.000 description 1
- 229940005529 antipsychotics Drugs 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- ZVTQWXCKQTUVPY-UHFFFAOYSA-N chloromethylcyclopropane Chemical compound ClCC1CC1 ZVTQWXCKQTUVPY-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000003074 decanoyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- RWLDAJMGAVDXSH-UHFFFAOYSA-N ethane-1,1,2-tricarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(O)=O RWLDAJMGAVDXSH-UHFFFAOYSA-N 0.000 description 1
- GXSSRMFELQFULB-UHFFFAOYSA-N ethene;3-[1-[4-(4-fluorophenyl)-4-oxobutyl]pyrrolidin-3-yl]indazole-1-carbonitrile Chemical group C=C.C1=CC(F)=CC=C1C(=O)CCCN1CC(C=2C3=CC=CC=C3N(C#N)N=2)CC1 GXSSRMFELQFULB-UHFFFAOYSA-N 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- PGVZKSKOVSPNOD-UHFFFAOYSA-N ethyl 3-(1-methylpiperidin-4-yl)indazole-1-carboxylate;hydrochloride Chemical compound Cl.C12=CC=CC=C2N(C(=O)OCC)N=C1C1CCN(C)CC1 PGVZKSKOVSPNOD-UHFFFAOYSA-N 0.000 description 1
- FQTIYMRSUOADDK-UHFFFAOYSA-N ethyl 3-bromopropanoate Chemical compound CCOC(=O)CCBr FQTIYMRSUOADDK-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000006332 fluoro benzoyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- KWOITLGQRDFDFP-UHFFFAOYSA-N formyl iodide Chemical compound IC=O KWOITLGQRDFDFP-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- DKMSPQHIXQDZAZ-UHFFFAOYSA-N indazol-1-yl(phenyl)methanone Chemical compound N1=CC2=CC=CC=C2N1C(=O)C1=CC=CC=C1 DKMSPQHIXQDZAZ-UHFFFAOYSA-N 0.000 description 1
- RMUBNCHBHNTGPS-UHFFFAOYSA-N indazol-1-ylmethanol Chemical compound C1=CC=C2N(CO)N=CC2=C1 RMUBNCHBHNTGPS-UHFFFAOYSA-N 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- GCLQHCPLZVWLKJ-UHFFFAOYSA-N methyl 4-(6-chloro-2h-indazol-3-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC)CCC1C1=NNC2=CC(Cl)=CC=C12 GCLQHCPLZVWLKJ-UHFFFAOYSA-N 0.000 description 1
- HBFPJOANHQVWII-UHFFFAOYSA-N methyl 4-(6-fluoro-2h-indazol-3-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC)CCC1C1=NNC2=CC(F)=CC=C12 HBFPJOANHQVWII-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- XGZVNVFLUGNOJQ-UHFFFAOYSA-N n,n-dimethylformamide;ethyl acetate Chemical compound CN(C)C=O.CCOC(C)=O XGZVNVFLUGNOJQ-UHFFFAOYSA-N 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- CEOWBGJKZVFBAR-UHFFFAOYSA-N phenyl 2-(2-fluorobenzoyl)piperidine-1-carboxylate Chemical compound FC1=CC=CC=C1C(=O)C1N(C(=O)OC=2C=CC=CC=2)CCCC1 CEOWBGJKZVFBAR-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- SRNGVSZRTVNIJT-UHFFFAOYSA-N phenyl indazole-1-carboxylate Chemical compound N1=CC2=CC=CC=C2N1C(=O)OC1=CC=CC=C1 SRNGVSZRTVNIJT-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-OUBTZVSYSA-N potassium-40 Chemical compound [40K] ZLMJMSJWJFRBEC-OUBTZVSYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000012748 slip agent Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- SUBJHSREKVAVAR-UHFFFAOYSA-N sodium;methanol;methanolate Chemical compound [Na+].OC.[O-]C SUBJHSREKVAVAR-UHFFFAOYSA-N 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- NZZWXABIGMMKQL-UHFFFAOYSA-N tert-butyl 4-chloropiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(Cl)CC1 NZZWXABIGMMKQL-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/26—Psychostimulants, e.g. nicotine, cocaine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/30—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom
- C07D211/32—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Neurosurgery (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biomedical Technology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Neurology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Psychiatry (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52508883A | 1983-08-22 | 1983-08-22 | |
| US525,088 | 1983-08-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS60100573A JPS60100573A (ja) | 1985-06-04 |
| JPH051792B2 true JPH051792B2 (enExample) | 1993-01-11 |
Family
ID=24091865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59172528A Granted JPS60100573A (ja) | 1983-08-22 | 1984-08-21 | 3―(ピペリジニル)―1h―インダゾール化合物およびその製法 |
Country Status (17)
| Country | Link |
|---|---|
| EP (1) | EP0135781B1 (enExample) |
| JP (1) | JPS60100573A (enExample) |
| KR (1) | KR880002356B1 (enExample) |
| AT (1) | ATE47139T1 (enExample) |
| AU (1) | AU575846B2 (enExample) |
| CA (1) | CA1292232C (enExample) |
| DE (1) | DE3480091D1 (enExample) |
| DK (1) | DK400284A (enExample) |
| ES (2) | ES8601964A1 (enExample) |
| FI (1) | FI82242C (enExample) |
| GR (1) | GR80160B (enExample) |
| HU (1) | HU198036B (enExample) |
| IL (1) | IL72743A (enExample) |
| NZ (1) | NZ209279A (enExample) |
| PH (1) | PH22032A (enExample) |
| PT (1) | PT79110B (enExample) |
| ZA (1) | ZA846485B (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0181793B1 (fr) * | 1984-10-16 | 1988-07-27 | Synthelabo | Dérivés de pipéridine, leur préparation et leur application en thérapeutique |
| ATE61054T1 (de) * | 1985-01-23 | 1991-03-15 | Hoechst Roussel Pharma | 3-piperidinyl- 1h-indazole, verfahren zu deren herstellung und deren anwendung als arzneimittel. |
| US4999356A (en) * | 1987-08-07 | 1991-03-12 | Hoechst-Roussel Pharmaceuticals, Inc. | 1-phenyl-3-(1-piperazinyl)-1H-indazoles |
| GB8811299D0 (en) * | 1988-05-12 | 1988-06-15 | Grayshan R | Indazole derivatives |
| US4957916A (en) * | 1988-08-05 | 1990-09-18 | Janssen Pharmaceutica N.V. | Antipsychotic 3-piperazinylbenzazole derivatives |
| NZ230045A (en) * | 1988-08-05 | 1990-11-27 | Janssen Pharmaceutica Nv | 3-piperazinylbenzazole derivatives and pharmaceutical compositions |
| US5015740A (en) * | 1988-08-05 | 1991-05-14 | Janssen Pharmaceutica N.V. | Antipsychotic 3-piperazinylbenzazole derivatives |
| IL90879A0 (en) * | 1988-09-02 | 1990-02-09 | Janssen Pharmaceutica Nv | 3-piperidinyl-indazole derivatives,their preparation and antihypertensive compositions containing them |
| US5776963A (en) * | 1989-05-19 | 1998-07-07 | Hoechst Marion Roussel, Inc. | 3-(heteroaryl)-1- (2,3-dihydro-1h-isoindol-2-yl)alkyl!pyrrolidines and 3-(heteroaryl)-1- (2,3-dihydro-1h-indol-1-yl)alkyl!pyrrolidines and related compounds and their therapeutic untility |
| US5364866A (en) * | 1989-05-19 | 1994-11-15 | Hoechst-Roussel Pharmaceuticals, Inc. | Heteroarylpiperidines, pyrrolidines and piperazines and their use as antipsychotics and analetics |
| US5561128A (en) * | 1989-05-19 | 1996-10-01 | Hoechst-Roussel Pharmaceuticals, Inc. | N-[(4-(heteroaryl)-1-piperidinyl)alkyl]-10,11-dihydro-5H-dibenz[B,F]azepines and related compounds and their therapeutic utility |
| ATE126512T1 (de) * | 1989-05-19 | 1995-09-15 | Hoechst Roussel Pharma | N-(aryloxyalkyl)heteroarylpiperidine und - heteroarylpiperazine, verfahren zu ihrer herstellung und ihre verwendung als medikamente. |
| DK181190D0 (da) * | 1990-07-30 | 1990-07-30 | Lundbeck & Co As H | 3-aryl-indol- eller 3-aryl-indazolderivater |
| US5051430A (en) * | 1990-09-10 | 1991-09-24 | Hoechst-Roussel Pharmaceuticals Incorporated | 3-(1H-indazol-3-yl)-4-pyridinamines |
| NZ243065A (en) * | 1991-06-13 | 1995-07-26 | Lundbeck & Co As H | Piperidine derivatives and pharmaceutical compositions |
| DK55192D0 (da) * | 1992-04-28 | 1992-04-28 | Lundbeck & Co As H | 1-piperazino-1,2-dihydroindenderivater |
| ATE182139T1 (de) * | 1992-10-23 | 1999-07-15 | Merck Sharp & Dohme | Dopamin rezeptor subtyp liganden |
| JPH08502958A (ja) * | 1992-10-23 | 1996-04-02 | メルク シヤープ エンド ドーム リミテツド | ドーパミンレセプターサブタイプリガンド |
| DE4414113A1 (de) * | 1994-04-22 | 1995-10-26 | Merck Patent Gmbh | 3-Indolylpiperidine |
| US5668148A (en) * | 1995-04-20 | 1997-09-16 | Merck & Co., Inc. | Alpha1a adrenergic receptor antagonists |
| EP0934311B1 (de) * | 1996-10-14 | 2009-05-13 | Bayer HealthCare AG | Neue heterocyclylmethyl-substituierte pyrazolderivate und ihre verwendung in der behandlung von herz-kreislauf-erkrankungen |
| FR2767827A1 (fr) * | 1997-09-03 | 1999-02-26 | Adir | Nouveaux derives de l'indole et de l'indazole, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| IL126745A (en) * | 1997-11-04 | 2003-09-17 | Pfizer Prod Inc | Methods of preparing 4-cyano-4- (substituted indazole) cyclohexanecarboxylic acids useful as pde4 inhibitors |
| US6133290A (en) * | 1998-07-31 | 2000-10-17 | Eli Lilly And Company | 5-HT1F agonists |
| JPWO2004069828A1 (ja) * | 2003-02-04 | 2006-05-25 | 三菱ウェルファーマ株式会社 | ピペリジン化合物およびその医薬用途 |
| WO2005066165A1 (en) * | 2003-12-31 | 2005-07-21 | Warner-Lambert Company Llc | N-substituted piperidine and piperazine derivatives |
| ES2339794T3 (es) | 2004-11-29 | 2010-05-25 | Warner-Lambert Company Llc | Pirazolo(3,4-b)piridinas e indazoles terapeuticos. |
| ES2565611T3 (es) * | 2008-10-14 | 2016-04-05 | Entasis Therapeutics Limited | Compuestos heteroaromáticos espirocíclicos y condensados para el tratamiento de infecciones bacterianas |
| JP2015500345A (ja) * | 2011-12-16 | 2015-01-05 | トランスポサジェン・バイオファーマシューティカルズ・インコーポレイテッドTransposagen Biopharmaceuticals, Inc. | 疼痛の治療または予防に使用されるtrpc4調節因子 |
| JP2015214492A (ja) * | 2012-09-07 | 2015-12-03 | 大日本住友製薬株式会社 | 3−(4−ピペリジル)−インダゾール誘導体 |
| JP7090639B2 (ja) * | 2017-04-11 | 2022-06-24 | サンシャイン・レイク・ファーマ・カンパニー・リミテッド | フッ素置換されたインダゾール化合物及びその使用 |
-
1984
- 1984-08-15 HU HU843095A patent/HU198036B/hu not_active IP Right Cessation
- 1984-08-17 AT AT84109800T patent/ATE47139T1/de not_active IP Right Cessation
- 1984-08-17 EP EP84109800A patent/EP0135781B1/en not_active Expired
- 1984-08-17 DE DE8484109800T patent/DE3480091D1/de not_active Expired
- 1984-08-20 NZ NZ209279A patent/NZ209279A/en unknown
- 1984-08-20 ES ES535289A patent/ES8601964A1/es not_active Expired
- 1984-08-20 FI FI843281A patent/FI82242C/fi not_active IP Right Cessation
- 1984-08-20 PH PH31122A patent/PH22032A/en unknown
- 1984-08-21 ZA ZA846485A patent/ZA846485B/xx unknown
- 1984-08-21 PT PT79110A patent/PT79110B/pt not_active IP Right Cessation
- 1984-08-21 JP JP59172528A patent/JPS60100573A/ja active Granted
- 1984-08-21 AU AU32250/84A patent/AU575846B2/en not_active Ceased
- 1984-08-21 DK DK400284A patent/DK400284A/da not_active Application Discontinuation
- 1984-08-21 KR KR1019840005046A patent/KR880002356B1/ko not_active Expired
- 1984-08-21 CA CA000461452A patent/CA1292232C/en not_active Expired - Lifetime
- 1984-08-21 GR GR80160A patent/GR80160B/el unknown
- 1984-08-28 IL IL72743A patent/IL72743A/xx unknown
-
1985
- 1985-05-16 ES ES543206A patent/ES8603867A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| KR880002356B1 (ko) | 1988-10-29 |
| DK400284A (da) | 1985-02-23 |
| ZA846485B (en) | 1985-03-27 |
| IL72743A0 (en) | 1984-11-30 |
| FI82242B (fi) | 1990-10-31 |
| PT79110B (en) | 1986-09-15 |
| HUT37139A (en) | 1985-11-28 |
| ES543206A0 (es) | 1986-01-01 |
| AU575846B2 (en) | 1988-08-11 |
| ES8603867A1 (es) | 1986-01-01 |
| HU198036B (en) | 1989-07-28 |
| ATE47139T1 (de) | 1989-10-15 |
| DE3480091D1 (en) | 1989-11-16 |
| IL72743A (en) | 1989-01-31 |
| PT79110A (en) | 1984-09-01 |
| FI843281A7 (fi) | 1985-02-23 |
| GR80160B (en) | 1984-12-19 |
| CA1292232C (en) | 1991-11-19 |
| EP0135781B1 (en) | 1989-10-11 |
| FI843281A0 (fi) | 1984-08-20 |
| FI82242C (fi) | 1991-02-11 |
| KR850001748A (ko) | 1985-04-01 |
| ES535289A0 (es) | 1985-11-01 |
| AU3225084A (en) | 1985-02-28 |
| ES8601964A1 (es) | 1985-11-01 |
| EP0135781A1 (en) | 1985-04-03 |
| DK400284D0 (da) | 1984-08-21 |
| NZ209279A (en) | 1988-05-30 |
| JPS60100573A (ja) | 1985-06-04 |
| PH22032A (en) | 1988-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH051792B2 (enExample) | ||
| US4670447A (en) | Antipsychotic 3-(piperidinyl)- and 3-(pyrrolidinyl)-1H-indazoles | |
| JP2788551B2 (ja) | 5−アリールインドール誘導体およびセロトニン(5−ht▲下1▼)作用薬としてのそれらの用途 | |
| RU2062776C1 (ru) | Способ получения замещенных n-(арилоксиалкил)-гетероарилпиперидина или гетероарилпиперазина | |
| US4352811A (en) | 3-(1-Substituted-4-piperidyl)-1,2-benzisoxazoles | |
| JP2614981B2 (ja) | インドール、インダゾール及びベンズイソオキサゾール化合物、それらの製法およびそれらを含有する製薬組成物 | |
| EP0080104B1 (en) | 3-(4-piperidyl)-1,2-benzisoxazoles, process for the preparation thereof, and a pharmaceutical composition comprising the same | |
| US4458076A (en) | 3-(4-Piperidinyl)-1,2-benzisothiazoles | |
| JP2000512296A (ja) | セロトニン再取込み阻害 | |
| JPH11322751A (ja) | 7―ヘテロ―ビシクロ[2.2.1]―ヘプタン類 | |
| JP2001504129A (ja) | ピリジン―2―イル―メチルアミン誘導体、それらの製造方法および医薬としてのそれらの適用 | |
| JPS63146874A (ja) | インドール誘導体 | |
| US4775761A (en) | 3-(piperidinyl)- and 3-(pyrrolidinyl)-1H-indazoles | |
| EP0144729B1 (en) | 11-Substituted 5H,11H-pyrrolo[2,1-c][1,4]benzoxazepines, a process for their preparation and their use in medicaments | |
| US4408054A (en) | Oximes of 4-benzoyl-piperidines | |
| US4806649A (en) | 3-(piperidinyl)- and 3- (pyrrolidinyl)-1H-indazoles | |
| US4710573A (en) | 3-(piperidinyl)-and 3-(pyrrolidinyl)-1H-indazoles | |
| US4853470A (en) | 3-(piperidinyl)- and 3-(pyrrolidinyl)-1H-indazoles | |
| US4681879A (en) | 11-substituted 5H,11H-pyrrolo[2,1-c][1,4]benzoxazepines as antipsychotic and analgesic agents | |
| WO1993020066A1 (en) | Imidazole, triazole and tetrazole derivatives | |
| US4758668A (en) | 3-(piperidinyl)- and 3-(pyrrolidinyl)-1H-indazoles | |
| JPH0725736B2 (ja) | トランス−ピペリジン−2,5−ジカルボキシレートの製法 | |
| US4667039A (en) | 11-substituted 5H,11H-pyrrolo(2,1-C) (1,4)benzoxazepines as antipsychotic and analgesic agents | |
| US4528376A (en) | 3-(4-Piperidyl)-1,2-benzisoxazoles | |
| KR19990022265A (ko) | 항정신병제로서의 피리딘이미닐-1,2-벤즈이속사졸 및-벤즈이소티아졸 |