JPH0475155B2 - - Google Patents
Info
- Publication number
- JPH0475155B2 JPH0475155B2 JP58235997A JP23599783A JPH0475155B2 JP H0475155 B2 JPH0475155 B2 JP H0475155B2 JP 58235997 A JP58235997 A JP 58235997A JP 23599783 A JP23599783 A JP 23599783A JP H0475155 B2 JPH0475155 B2 JP H0475155B2
- Authority
- JP
- Japan
- Prior art keywords
- picture
- frame
- sliding part
- viewer according
- leaf spring
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000007246 mechanism Effects 0.000 description 10
- 238000000926 separation method Methods 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 210000000078 claw Anatomy 0.000 description 5
- 238000010586 diagram Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 238000005452 bending Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03B—APPARATUS OR ARRANGEMENTS FOR TAKING PHOTOGRAPHS OR FOR PROJECTING OR VIEWING THEM; APPARATUS OR ARRANGEMENTS EMPLOYING ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ACCESSORIES THEREFOR
- G03B23/00—Devices for changing pictures in viewing apparatus or projectors
- G03B23/02—Devices for changing pictures in viewing apparatus or projectors in which pictures are removed from, and returned to, magazines; Magazines therefor
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Mirrors, Picture Frames, Photograph Stands, And Related Fastening Devices (AREA)
- Sheet Holders (AREA)
- Sheets, Magazines, And Separation Thereof (AREA)
- Displays For Variable Information Using Movable Means (AREA)
- Telephone Set Structure (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3246103 | 1982-12-13 | ||
| DE3246103.8 | 1982-12-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS59131309A JPS59131309A (ja) | 1984-07-28 |
| JPH0475155B2 true JPH0475155B2 (enExample) | 1992-11-30 |
Family
ID=6180545
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58235997A Granted JPS59131309A (ja) | 1982-12-13 | 1983-12-13 | ピクチヤ−ビユア |
Country Status (5)
| Country | Link |
|---|---|
| US (3) | US4550516A (enExample) |
| JP (1) | JPS59131309A (enExample) |
| GB (2) | GB2131570B (enExample) |
| HK (1) | HK24488A (enExample) |
| SG (1) | SG100587G (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3441482A1 (de) * | 1984-11-13 | 1986-08-21 | Licinvest Ag, Chur | Vorrichtung zum zyklischen umschichten eines blattstapels |
| US4939860A (en) * | 1984-11-13 | 1990-07-10 | Licinvest Ag | Cyclic rearrangement device for stacked rectangular sheets |
| DE3441454A1 (de) * | 1984-11-13 | 1986-10-02 | Licinvest Ag, Chur | Vorrichtung zum zyklischen umschichten eines blattstapels |
| DE3441448A1 (de) * | 1984-11-13 | 1986-08-28 | Licinvest Ag, Chur | Vorrichtung zum zyklischen umschichten eines blattstapels |
| DE3441464A1 (de) * | 1984-11-13 | 1986-10-02 | Licinvest Ag, Chur | Vorrichtung zum zyklischen umschichten eines blattstapels |
| DE3441488A1 (de) * | 1984-11-13 | 1986-08-21 | Licinvest Ag, Chur | Vorrichtung zum zyklischen umschichten eines blattstapels |
| DE3441481A1 (de) * | 1984-11-13 | 1986-08-28 | Licinvest Ag, Chur | Vorrichtung zum zyklischen umschichten eines blattstapels |
| DE3441456A1 (de) * | 1984-11-13 | 1986-09-04 | Licinvest Ag, Chur | Vorrichtung zum zyklischen umschichten eines blattstapels |
| DE3539339A1 (de) * | 1985-11-06 | 1987-05-07 | Licinvest Ag | Behaelter fuer einen bilderstapel |
| AU100541S (en) | 1986-08-25 | 1988-06-16 | Showbox System A G | Picture exchange mechanism |
| AU99702S (en) | 1986-10-10 | 1988-02-25 | Licinvest Ag | A picture frame |
| JPS6421667U (enExample) * | 1987-07-30 | 1989-02-03 | ||
| JPH0179985U (enExample) * | 1987-11-18 | 1989-05-29 | ||
| AU104670S (en) | 1988-05-26 | 1989-08-17 | Licinvest Ag | Picture frame |
| GB2243457A (en) * | 1990-04-27 | 1991-10-30 | Brilliant Enterprise Corp | A picture display frame |
| USD333574S (en) | 1990-10-17 | 1993-03-02 | Showbox-System AG | Photo organizer |
| JPH0677625U (ja) * | 1992-11-27 | 1994-11-01 | 利夫 高橋 | 額 縁 |
| USD510196S1 (en) | 2004-01-09 | 2005-10-04 | Brookstone Purchasing, Inc. | Frame |
| US20050185103A1 (en) * | 2004-02-19 | 2005-08-25 | Rudy Woodard | System and method for displaying an image and playing an associated message |
| HUP1500599A2 (en) | 2015-12-07 | 2017-06-28 | Jozsef Bognar | Device for storing photographs |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US535635A (en) * | 1895-03-12 | Message and card receiver | ||
| US2919509A (en) * | 1958-01-31 | 1960-01-05 | Carl H Strandberg | Film frame or slide packaging box and viewer |
| US2867051A (en) * | 1958-04-28 | 1959-01-06 | Donald J Taylor | Self-prompter |
| GB1059689A (en) * | 1964-05-26 | 1967-02-22 | Robert Fisher | Improvements in or relating to ticket holders |
| US3377727A (en) * | 1966-06-01 | 1968-04-16 | John H. Weggeland | Picture viewer |
| FR2134724A5 (enExample) * | 1971-04-19 | 1972-12-08 | Naguet Pierre | |
| SE369783B (enExample) * | 1972-08-17 | 1974-09-16 | Pettersson S | |
| US3797144A (en) * | 1972-09-07 | 1974-03-19 | Wml | Display-type picture viewer |
| DE2457759A1 (de) * | 1974-12-06 | 1976-06-16 | Beermann | Wechselrahmen |
| US4057920A (en) * | 1975-11-24 | 1977-11-15 | Weggeland John H | Picture viewer with successive feed means |
| GR66050B (enExample) * | 1977-09-20 | 1981-01-14 | Licinvest Ag | |
| DE2742347C2 (de) * | 1977-09-20 | 1984-01-26 | Licinvest AG, 7002 Chur | Behälter für Fotoabzüge |
| DE2742350C3 (de) * | 1977-09-20 | 1981-06-25 | Licinvest Ag, Chur | Bildbetrachtungsgerät |
| US4413435A (en) * | 1977-09-20 | 1983-11-08 | Licinvest Ag | Picture viewer |
| DE2745214C3 (de) * | 1977-10-07 | 1984-07-26 | Licinvest Ag, Chur | Vorrichtung zum wechselweisen Exponieren einzelner Blätter aus einem Blattstapel, insbesondere Photobetrachtungswechsler |
| DE2742349C3 (de) * | 1977-09-20 | 1981-06-25 | Licinvest Ag, Chur | Bildbetrachtungsgerät |
| DE2742345C3 (de) * | 1977-09-20 | 1981-08-06 | Licinvest Ag, Chur | Bildbetrachtungsgerät mit Wechselmechanik |
| US4173838A (en) * | 1978-04-28 | 1979-11-13 | Joseph Antos | Compact repeating slide viewer |
| DE2914351A1 (de) * | 1979-04-09 | 1980-10-30 | Licinvest Ag | Bildbetrachtungsgeraet |
| US4242817A (en) * | 1979-01-08 | 1981-01-06 | Ballard Donald M | Holder |
| DE3246101A1 (de) * | 1982-12-13 | 1984-06-14 | Licinvest Ag, Chur | Bildwechsler |
-
1983
- 1983-12-12 US US06/560,385 patent/US4550516A/en not_active Ceased
- 1983-12-12 GB GB08333060A patent/GB2131570B/en not_active Expired
- 1983-12-13 JP JP58235997A patent/JPS59131309A/ja active Granted
-
1985
- 1985-09-16 US US06/776,401 patent/US4674209A/en not_active Expired - Fee Related
- 1985-12-06 GB GB08530148A patent/GB2167207B/en not_active Expired
-
1987
- 1987-10-29 US US07/114,233 patent/USRE32738E/en not_active Expired - Fee Related
- 1987-11-16 SG SG1005/87A patent/SG100587G/en unknown
-
1988
- 1988-04-07 HK HK244/88A patent/HK24488A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SG100587G (en) | 1988-09-23 |
| GB2131570B (en) | 1987-06-17 |
| US4550516A (en) | 1985-11-05 |
| US4674209A (en) | 1987-06-23 |
| GB2167207B (en) | 1987-06-17 |
| GB8333060D0 (en) | 1984-01-18 |
| USRE32738E (en) | 1988-08-30 |
| HK24488A (en) | 1988-04-15 |
| JPS59131309A (ja) | 1984-07-28 |
| GB2167207A (en) | 1986-05-21 |
| GB2131570A (en) | 1984-06-20 |
| GB8530148D0 (en) | 1986-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0475155B2 (enExample) | ||
| US4242820A (en) | Container for photographic prints | |
| CA1116445A (en) | Viewer for photographic prints | |
| CA1106662A (en) | Viewer for photographic prints | |
| CA1258972A (en) | Container for accommodating a pile of pictures | |
| JPS5987196A (ja) | 書画束用貯蔵容器 | |
| IE47880B1 (en) | Picture storage box and viewer device | |
| US2617218A (en) | Slide viewer having two compartments, one for storing and the other for viewing slides | |
| US20150282580A1 (en) | Card holder | |
| US4981386A (en) | Notebook with internal easel stand | |
| JPS6085712A (ja) | ピクチヤ−ビユア | |
| US5120044A (en) | Supply magazine for a sheet stack | |
| US4473154A (en) | Container for photographic prints | |
| US4902193A (en) | Device for the rearrangement of a pile of pictures | |
| US5475453A (en) | Manually-operated tray assembly for dispensing and receiving overhead projector transparencies | |
| JPS62500818A (ja) | 長方形または正方形のシ−トの束の循環再配列装置 | |
| US4759142A (en) | Cyclic rearrangement apparatus for stacked rectangular sheets | |
| US4993178A (en) | Device for the cyclic rearrangement of a pile of rectangular or square sheets | |
| US5103580A (en) | Device for the cyclic rearrangement of a pile of sheets | |
| JPH0219803Y2 (enExample) | ||
| US4171906A (en) | Device for holding down a document | |
| US4317619A (en) | Microfiche apparatus | |
| US2896821A (en) | Glass slide dispenser | |
| FR2403574A1 (fr) | Appareil de visionnement d'images | |
| US4777748A (en) | Device for the cyclic rearrangement of a pile of rectangular or square sheets |