JPH0371701B2 - - Google Patents
Info
- Publication number
 - JPH0371701B2 JPH0371701B2 JP19449484A JP19449484A JPH0371701B2 JP H0371701 B2 JPH0371701 B2 JP H0371701B2 JP 19449484 A JP19449484 A JP 19449484A JP 19449484 A JP19449484 A JP 19449484A JP H0371701 B2 JPH0371701 B2 JP H0371701B2
 - Authority
 - JP
 - Japan
 - Prior art keywords
 - group
 - coupler
 - present
 - magenta
 - color
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Expired
 
Links
- -1 Silver halide Chemical class 0.000 claims description 78
 - 229910052709 silver Inorganic materials 0.000 claims description 34
 - 239000004332 silver Substances 0.000 claims description 34
 - 239000000463 material Substances 0.000 claims description 33
 - 125000000217 alkyl group Chemical group 0.000 claims description 27
 - 125000003118 aryl group Chemical group 0.000 claims description 22
 - 150000001875 compounds Chemical class 0.000 claims description 21
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
 - 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
 - 125000001931 aliphatic group Chemical group 0.000 claims description 5
 - FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical group C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 claims description 3
 - YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 2
 - 125000002632 imidazolidinyl group Chemical group 0.000 claims description 2
 - 125000004193 piperazinyl group Chemical group 0.000 claims description 2
 - BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical group C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 2
 - 239000000975 dye Substances 0.000 description 74
 - 239000010410 layer Substances 0.000 description 44
 - 239000003381 stabilizer Substances 0.000 description 29
 - 239000003795 chemical substances by application Substances 0.000 description 20
 - XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 16
 - 239000000839 emulsion Substances 0.000 description 15
 - 238000000034 method Methods 0.000 description 15
 - 150000003852 triazoles Chemical class 0.000 description 15
 - 238000012360 testing method Methods 0.000 description 14
 - 238000005562 fading Methods 0.000 description 13
 - 238000009835 boiling Methods 0.000 description 12
 - 238000011161 development Methods 0.000 description 11
 - 238000002845 discoloration Methods 0.000 description 11
 - 239000003960 organic solvent Substances 0.000 description 11
 - 239000002243 precursor Substances 0.000 description 11
 - 239000000243 solution Substances 0.000 description 11
 - 230000000694 effects Effects 0.000 description 10
 - 125000001424 substituent group Chemical group 0.000 description 10
 - 239000002253 acid Substances 0.000 description 9
 - 125000000623 heterocyclic group Chemical group 0.000 description 9
 - 239000013078 crystal Substances 0.000 description 8
 - 108010010803 Gelatin Proteins 0.000 description 7
 - 229920000159 gelatin Polymers 0.000 description 7
 - 239000008273 gelatin Substances 0.000 description 7
 - 235000019322 gelatine Nutrition 0.000 description 7
 - 235000011852 gelatine desserts Nutrition 0.000 description 7
 - WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
 - 239000000654 additive Substances 0.000 description 6
 - 125000003545 alkoxy group Chemical group 0.000 description 6
 - 230000015572 biosynthetic process Effects 0.000 description 6
 - BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
 - 239000006096 absorbing agent Substances 0.000 description 5
 - 238000010521 absorption reaction Methods 0.000 description 5
 - 238000000576 coating method Methods 0.000 description 5
 - 239000000084 colloidal system Substances 0.000 description 5
 - 150000003014 phosphoric acid esters Chemical class 0.000 description 5
 - 238000012545 processing Methods 0.000 description 5
 - 238000003786 synthesis reaction Methods 0.000 description 5
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
 - GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
 - BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 4
 - SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 4
 - 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
 - 239000011248 coating agent Substances 0.000 description 4
 - 238000005859 coupling reaction Methods 0.000 description 4
 - DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 4
 - 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
 - 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
 - IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 4
 - 239000011241 protective layer Substances 0.000 description 4
 - ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 4
 - GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
 - UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
 - WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
 - MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 3
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
 - UDFSJHJKINSRFV-UHFFFAOYSA-N N1N=CN2N=CC=C21 Chemical compound N1N=CN2N=CC=C21 UDFSJHJKINSRFV-UHFFFAOYSA-N 0.000 description 3
 - 239000004698 Polyethylene Substances 0.000 description 3
 - ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
 - 125000004442 acylamino group Chemical group 0.000 description 3
 - 125000004414 alkyl thio group Chemical group 0.000 description 3
 - 238000004061 bleaching Methods 0.000 description 3
 - 239000007844 bleaching agent Substances 0.000 description 3
 - 230000008859 change Effects 0.000 description 3
 - 238000006243 chemical reaction Methods 0.000 description 3
 - MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
 - PTFYQSWHBLOXRZ-UHFFFAOYSA-N imidazo[4,5-e]indazole Chemical compound C1=CC2=NC=NC2=C2C=NN=C21 PTFYQSWHBLOXRZ-UHFFFAOYSA-N 0.000 description 3
 - 239000003112 inhibitor Substances 0.000 description 3
 - DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 3
 - 238000002156 mixing Methods 0.000 description 3
 - 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
 - ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
 - 229920000573 polyethylene Polymers 0.000 description 3
 - 229920000642 polymer Polymers 0.000 description 3
 - 229910052700 potassium Inorganic materials 0.000 description 3
 - 239000011591 potassium Substances 0.000 description 3
 - 229910000027 potassium carbonate Inorganic materials 0.000 description 3
 - 239000000047 product Substances 0.000 description 3
 - 238000011160 research Methods 0.000 description 3
 - 150000003839 salts Chemical class 0.000 description 3
 - 230000001235 sensitizing effect Effects 0.000 description 3
 - 230000003595 spectral effect Effects 0.000 description 3
 - ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 3
 - 239000006097 ultraviolet radiation absorber Substances 0.000 description 3
 - KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
 - CLDZVCMRASJQFO-UHFFFAOYSA-N 2,5-bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol Chemical compound CC(C)(C)CC(C)(C)C1=CC(O)=C(C(C)(C)CC(C)(C)C)C=C1O CLDZVCMRASJQFO-UHFFFAOYSA-N 0.000 description 2
 - XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 2
 - QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
 - OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
 - QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
 - XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
 - CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
 - OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
 - FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
 - CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
 - YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
 - XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
 - 150000007513 acids Chemical class 0.000 description 2
 - 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
 - 150000001412 amines Chemical class 0.000 description 2
 - 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
 - XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 2
 - 229940101006 anhydrous sodium sulfite Drugs 0.000 description 2
 - 125000005110 aryl thio group Chemical group 0.000 description 2
 - 125000004104 aryloxy group Chemical group 0.000 description 2
 - 150000001565 benzotriazoles Chemical group 0.000 description 2
 - WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
 - DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 2
 - 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
 - 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
 - 239000003086 colorant Substances 0.000 description 2
 - USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
 - 239000006185 dispersion Substances 0.000 description 2
 - 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
 - 238000001035 drying Methods 0.000 description 2
 - 150000002148 esters Chemical class 0.000 description 2
 - FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
 - 125000005843 halogen group Chemical group 0.000 description 2
 - LOCAIGRSOJUCTB-UHFFFAOYSA-N indazol-3-one Chemical compound C1=CC=C2C(=O)N=NC2=C1 LOCAIGRSOJUCTB-UHFFFAOYSA-N 0.000 description 2
 - 238000002844 melting Methods 0.000 description 2
 - 230000008018 melting Effects 0.000 description 2
 - 239000000203 mixture Substances 0.000 description 2
 - 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
 - 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
 - 230000003287 optical effect Effects 0.000 description 2
 - 125000000962 organic group Chemical group 0.000 description 2
 - 150000002989 phenols Chemical class 0.000 description 2
 - JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
 - MCSKRVKAXABJLX-UHFFFAOYSA-N pyrazolo[3,4-d]triazole Chemical class N1=NN=C2N=NC=C21 MCSKRVKAXABJLX-UHFFFAOYSA-N 0.000 description 2
 - 229910052708 sodium Inorganic materials 0.000 description 2
 - 239000011734 sodium Substances 0.000 description 2
 - JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
 - 238000010189 synthetic method Methods 0.000 description 2
 - XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 2
 - 125000004417 unsaturated alkyl group Chemical group 0.000 description 2
 - 229910052724 xenon Inorganic materials 0.000 description 2
 - FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
 - BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
 - ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 1
 - 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
 - CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
 - KOFZTCSTGIWCQG-UHFFFAOYSA-N 1-bromotetradecane Chemical compound CCCCCCCCCCCCCCBr KOFZTCSTGIWCQG-UHFFFAOYSA-N 0.000 description 1
 - HRBLHUVHOWWBEN-UHFFFAOYSA-N 1-n,4-n-diethylbenzene-1,4-diamine;hydrochloride Chemical compound Cl.CCNC1=CC=C(NCC)C=C1 HRBLHUVHOWWBEN-UHFFFAOYSA-N 0.000 description 1
 - PXJHVKRLFWZUNV-UHFFFAOYSA-N 1-n,4-n-dimethylbenzene-1,4-diamine;hydron;dichloride Chemical compound Cl.Cl.CNC1=CC=C(NC)C=C1 PXJHVKRLFWZUNV-UHFFFAOYSA-N 0.000 description 1
 - YGDWUQFZMXWDKE-UHFFFAOYSA-N 1-oxido-1,3-thiazole Chemical class [O-]S1=CN=C=C1 YGDWUQFZMXWDKE-UHFFFAOYSA-N 0.000 description 1
 - TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
 - KPVMVJXYXFUVLR-UHFFFAOYSA-N 12-ethyltetradecan-1-amine Chemical compound CCC(CC)CCCCCCCCCCCN KPVMVJXYXFUVLR-UHFFFAOYSA-N 0.000 description 1
 - VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
 - WFXLRLQSHRNHCE-UHFFFAOYSA-N 2-(4-amino-n-ethylanilino)ethanol Chemical compound OCCN(CC)C1=CC=C(N)C=C1 WFXLRLQSHRNHCE-UHFFFAOYSA-N 0.000 description 1
 - RTNVDKBRTXEWQE-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-6-butan-2-yl-4-tert-butylphenol Chemical compound CCC(C)C1=CC(C(C)(C)C)=CC(N2N=C3C=CC=CC3=N2)=C1O RTNVDKBRTXEWQE-UHFFFAOYSA-N 0.000 description 1
 - DLLMHEDYJQACRM-UHFFFAOYSA-N 2-(carboxymethyldisulfanyl)acetic acid Chemical compound OC(=O)CSSCC(O)=O DLLMHEDYJQACRM-UHFFFAOYSA-N 0.000 description 1
 - CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
 - SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
 - GCABLKFGYPIVFC-UHFFFAOYSA-N 3-(1-benzofuran-2-yl)-3-oxopropanenitrile Chemical compound C1=CC=C2OC(C(CC#N)=O)=CC2=C1 GCABLKFGYPIVFC-UHFFFAOYSA-N 0.000 description 1
 - GUEMJXTXXMUOQM-UHFFFAOYSA-N 3-(3-pentadecylphenoxy)butan-1-amine Chemical group CCCCCCCCCCCCCCCC1=CC=CC(OC(C)CCN)=C1 GUEMJXTXXMUOQM-UHFFFAOYSA-N 0.000 description 1
 - NRBCZSJDTOBHTI-UHFFFAOYSA-N 3-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-1-amine Chemical group CCC(C)(C)C1=CC=C(OC(C)CCN)C(C(C)(C)CC)=C1 NRBCZSJDTOBHTI-UHFFFAOYSA-N 0.000 description 1
 - XRZDIHADHZSFBB-UHFFFAOYSA-N 3-oxo-n,3-diphenylpropanamide Chemical class C=1C=CC=CC=1NC(=O)CC(=O)C1=CC=CC=C1 XRZDIHADHZSFBB-UHFFFAOYSA-N 0.000 description 1
 - XVEPKNMOJLPFCN-UHFFFAOYSA-N 4,4-dimethyl-3-oxo-n-phenylpentanamide Chemical compound CC(C)(C)C(=O)CC(=O)NC1=CC=CC=C1 XVEPKNMOJLPFCN-UHFFFAOYSA-N 0.000 description 1
 - YLNKRLLYLJYWEN-UHFFFAOYSA-N 4-(2,2-dibutoxyethoxy)-4-oxobutanoic acid Chemical compound CCCCOC(OCCCC)COC(=O)CCC(O)=O YLNKRLLYLJYWEN-UHFFFAOYSA-N 0.000 description 1
 - ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 1
 - 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
 - PHNDZBFLOPIMSM-UHFFFAOYSA-N 4-morpholin-4-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCOCC1 PHNDZBFLOPIMSM-UHFFFAOYSA-N 0.000 description 1
 - QZHXKQKKEBXYRG-UHFFFAOYSA-N 4-n-(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C=C1 QZHXKQKKEBXYRG-UHFFFAOYSA-N 0.000 description 1
 - MTOCKMVNXPZCJW-UHFFFAOYSA-N 4-n-dodecyl-4-n-ethyl-2-methylbenzene-1,4-diamine Chemical compound CCCCCCCCCCCCN(CC)C1=CC=C(N)C(C)=C1 MTOCKMVNXPZCJW-UHFFFAOYSA-N 0.000 description 1
 - IJJSFSXLZYFTKV-UHFFFAOYSA-N 4-n-methylbenzene-1,4-diamine;hydrochloride Chemical compound Cl.CNC1=CC=C(N)C=C1 IJJSFSXLZYFTKV-UHFFFAOYSA-N 0.000 description 1
 - NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
 - BYHCBLSQLHOONI-UHFFFAOYSA-N 5-anilino-2-phenyl-4h-pyrazol-3-one Chemical group N=1N(C=2C=CC=CC=2)C(=O)CC=1NC1=CC=CC=C1 BYHCBLSQLHOONI-UHFFFAOYSA-N 0.000 description 1
 - UJUCBOIXAMPUQL-UHFFFAOYSA-N 7-aminothieno[2,3-b]pyrazine-6-carboxylic acid Chemical compound C1=CN=C2C(N)=C(C(O)=O)SC2=N1 UJUCBOIXAMPUQL-UHFFFAOYSA-N 0.000 description 1
 - QZCLKYGREBVARF-UHFFFAOYSA-N Acetyl tributyl citrate Chemical compound CCCCOC(=O)CC(C(=O)OCCCC)(OC(C)=O)CC(=O)OCCCC QZCLKYGREBVARF-UHFFFAOYSA-N 0.000 description 1
 - QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
 - VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
 - KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical group NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
 - LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
 - KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical class C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 1
 - LEVWYRKDKASIDU-QWWZWVQMSA-N D-cystine Chemical compound OC(=O)[C@H](N)CSSC[C@@H](N)C(O)=O LEVWYRKDKASIDU-QWWZWVQMSA-N 0.000 description 1
 - FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
 - QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
 - KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
 - JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
 - YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
 - DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
 - NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
 - UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
 - 239000000020 Nitrocellulose Substances 0.000 description 1
 - PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
 - 206010034972 Photosensitivity reaction Diseases 0.000 description 1
 - 239000004952 Polyamide Substances 0.000 description 1
 - 239000004743 Polypropylene Substances 0.000 description 1
 - 239000004793 Polystyrene Substances 0.000 description 1
 - KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
 - 239000002262 Schiff base Substances 0.000 description 1
 - 150000004753 Schiff bases Chemical class 0.000 description 1
 - BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
 - 206010070834 Sensitisation Diseases 0.000 description 1
 - 229910021607 Silver chloride Inorganic materials 0.000 description 1
 - QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
 - NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
 - FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
 - ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
 - FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
 - MPLZNPZPPXERDA-UHFFFAOYSA-N [4-(diethylamino)-2-methylphenyl]azanium;chloride Chemical compound [Cl-].CC[NH+](CC)C1=CC=C(N)C(C)=C1 MPLZNPZPPXERDA-UHFFFAOYSA-N 0.000 description 1
 - XCFIVNQHHFZRNR-UHFFFAOYSA-N [Ag].Cl[IH]Br Chemical compound [Ag].Cl[IH]Br XCFIVNQHHFZRNR-UHFFFAOYSA-N 0.000 description 1
 - BYJLMFIYVGGRLA-UHFFFAOYSA-L [Na+].[Na+].C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.C(CN(CCC(=O)O)CCC(=O)O)N(CCC(=O)O)CCC(=O)O Chemical compound [Na+].[Na+].C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.C(CN(CCC(=O)O)CCC(=O)O)N(CCC(=O)O)CCC(=O)O BYJLMFIYVGGRLA-UHFFFAOYSA-L 0.000 description 1
 - 239000002250 absorbent Substances 0.000 description 1
 - 230000002745 absorbent Effects 0.000 description 1
 - 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
 - 229960001413 acetanilide Drugs 0.000 description 1
 - 230000002378 acidificating effect Effects 0.000 description 1
 - 125000002252 acyl group Chemical group 0.000 description 1
 - 125000004423 acyloxy group Chemical group 0.000 description 1
 - 230000000996 additive effect Effects 0.000 description 1
 - 229910001508 alkali metal halide Inorganic materials 0.000 description 1
 - 150000008045 alkali metal halides Chemical class 0.000 description 1
 - 125000003282 alkyl amino group Chemical group 0.000 description 1
 - 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
 - BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
 - 229910021529 ammonia Inorganic materials 0.000 description 1
 - 239000000908 ammonium hydroxide Substances 0.000 description 1
 - 239000002518 antifoaming agent Substances 0.000 description 1
 - 239000002216 antistatic agent Substances 0.000 description 1
 - 239000007864 aqueous solution Substances 0.000 description 1
 - 150000003934 aromatic aldehydes Chemical class 0.000 description 1
 - 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
 - 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
 - 125000003289 ascorbyl group Chemical class [H]O[C@@]([H])(C([H])([H])O*)[C@@]1([H])OC(=O)C(O*)=C1O* 0.000 description 1
 - 239000012298 atmosphere Substances 0.000 description 1
 - XNSQZBOCSSMHSZ-UHFFFAOYSA-K azane;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate;iron(3+) Chemical class [NH4+].[Fe+3].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O XNSQZBOCSSMHSZ-UHFFFAOYSA-K 0.000 description 1
 - 239000000987 azo dye Substances 0.000 description 1
 - QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
 - 229910001864 baryta Inorganic materials 0.000 description 1
 - 230000008901 benefit Effects 0.000 description 1
 - 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
 - 150000008366 benzophenones Chemical class 0.000 description 1
 - QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
 - 239000012964 benzotriazole Substances 0.000 description 1
 - 235000019445 benzyl alcohol Nutrition 0.000 description 1
 - BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
 - 239000000872 buffer Substances 0.000 description 1
 - BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
 - DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical group CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
 - COPHVUDURPSYBO-UHFFFAOYSA-N butyl dioctyl phosphate Chemical compound CCCCCCCCOP(=O)(OCCCC)OCCCCCCCC COPHVUDURPSYBO-UHFFFAOYSA-N 0.000 description 1
 - 125000002837 carbocyclic group Chemical group 0.000 description 1
 - 125000004432 carbon atom Chemical group C* 0.000 description 1
 - 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
 - 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
 - 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
 - 150000001768 cations Chemical class 0.000 description 1
 - 229920002301 cellulose acetate Polymers 0.000 description 1
 - 239000002738 chelating agent Substances 0.000 description 1
 - 239000007795 chemical reaction product Substances 0.000 description 1
 - NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
 - 229940114081 cinnamate Drugs 0.000 description 1
 - 229910017052 cobalt Inorganic materials 0.000 description 1
 - 239000010941 cobalt Substances 0.000 description 1
 - GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
 - 239000002131 composite material Substances 0.000 description 1
 - 238000007796 conventional method Methods 0.000 description 1
 - 238000001816 cooling Methods 0.000 description 1
 - 238000012937 correction Methods 0.000 description 1
 - 230000008878 coupling Effects 0.000 description 1
 - 238000010168 coupling process Methods 0.000 description 1
 - 238000007766 curtain coating Methods 0.000 description 1
 - 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
 - 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
 - 229960003067 cystine Drugs 0.000 description 1
 - SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
 - 235000014113 dietary fatty acids Nutrition 0.000 description 1
 - 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
 - DROMNWUQASBTFM-UHFFFAOYSA-N dinonyl benzene-1,2-dicarboxylate Chemical compound CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC DROMNWUQASBTFM-UHFFFAOYSA-N 0.000 description 1
 - 238000003618 dip coating Methods 0.000 description 1
 - ASMQGLCHMVWBQR-UHFFFAOYSA-M diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)([O-])OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-M 0.000 description 1
 - 238000009826 distribution Methods 0.000 description 1
 - 230000001804 emulsifying effect Effects 0.000 description 1
 - 238000011156 evaluation Methods 0.000 description 1
 - 239000000194 fatty acid Substances 0.000 description 1
 - 229930195729 fatty acid Natural products 0.000 description 1
 - 238000001914 filtration Methods 0.000 description 1
 - LNTHITQWFMADLM-UHFFFAOYSA-N gallic acid Chemical class OC(=O)C1=CC(O)=C(O)C(O)=C1 LNTHITQWFMADLM-UHFFFAOYSA-N 0.000 description 1
 - 239000011521 glass Substances 0.000 description 1
 - PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
 - 229910052737 gold Inorganic materials 0.000 description 1
 - 239000010931 gold Substances 0.000 description 1
 - 229940093915 gynecological organic acid Drugs 0.000 description 1
 - 150000002366 halogen compounds Chemical class 0.000 description 1
 - 150000004050 homopiperazines Chemical class 0.000 description 1
 - 125000001165 hydrophobic group Chemical group 0.000 description 1
 - 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 1
 - 238000005470 impregnation Methods 0.000 description 1
 - RSAZYXZUJROYKR-UHFFFAOYSA-N indophenol Chemical compound C1=CC(O)=CC=C1N=C1C=CC(=O)C=C1 RSAZYXZUJROYKR-UHFFFAOYSA-N 0.000 description 1
 - 229910052741 iridium Inorganic materials 0.000 description 1
 - GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
 - 229910052742 iron Inorganic materials 0.000 description 1
 - 239000004816 latex Substances 0.000 description 1
 - 229920000126 latex Polymers 0.000 description 1
 - 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
 - 235000019341 magnesium sulphate Nutrition 0.000 description 1
 - 239000001630 malic acid Substances 0.000 description 1
 - 235000011090 malic acid Nutrition 0.000 description 1
 - 229910052751 metal Inorganic materials 0.000 description 1
 - 239000002184 metal Substances 0.000 description 1
 - 150000002736 metal compounds Chemical class 0.000 description 1
 - 229910021645 metal ion Inorganic materials 0.000 description 1
 - 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
 - 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
 - 125000005699 methyleneoxy group Chemical group [H]C([H])([*:1])O[*:2] 0.000 description 1
 - QEALYLRSRQDCRA-UHFFFAOYSA-N myristamide Chemical compound CCCCCCCCCCCCCC(N)=O QEALYLRSRQDCRA-UHFFFAOYSA-N 0.000 description 1
 - CLJDCQWROXMJAZ-UHFFFAOYSA-N n-[2-(4-amino-n-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfuric acid Chemical compound OS(O)(=O)=O.CS(=O)(=O)NCCN(CC)C1=CC=C(N)C(C)=C1 CLJDCQWROXMJAZ-UHFFFAOYSA-N 0.000 description 1
 - CWPNUVRPRDFMNR-UHFFFAOYSA-N n-[2-(4-amino-n-ethylanilino)ethyl]methanesulfonamide Chemical compound CS(=O)(=O)NCCN(CC)C1=CC=C(N)C=C1 CWPNUVRPRDFMNR-UHFFFAOYSA-N 0.000 description 1
 - 125000001624 naphthyl group Chemical group 0.000 description 1
 - 230000007935 neutral effect Effects 0.000 description 1
 - MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
 - 229920001220 nitrocellulos Polymers 0.000 description 1
 - 229910052757 nitrogen Inorganic materials 0.000 description 1
 - 125000004433 nitrogen atom Chemical group N* 0.000 description 1
 - 229910000510 noble metal Inorganic materials 0.000 description 1
 - XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
 - VECVSKFWRQYTAL-UHFFFAOYSA-N octyl benzoate Chemical compound CCCCCCCCOC(=O)C1=CC=CC=C1 VECVSKFWRQYTAL-UHFFFAOYSA-N 0.000 description 1
 - 150000007524 organic acids Chemical class 0.000 description 1
 - 235000005985 organic acids Nutrition 0.000 description 1
 - 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
 - LQPLDXQVILYOOL-UHFFFAOYSA-I pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC(=O)[O-])CCN(CC([O-])=O)CC([O-])=O LQPLDXQVILYOOL-UHFFFAOYSA-I 0.000 description 1
 - 229960003330 pentetic acid Drugs 0.000 description 1
 - 150000004986 phenylenediamines Chemical class 0.000 description 1
 - 150000003012 phosphoric acid amides Chemical class 0.000 description 1
 - 230000036211 photosensitivity Effects 0.000 description 1
 - XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
 - 239000000049 pigment Substances 0.000 description 1
 - 150000004885 piperazines Chemical class 0.000 description 1
 - 239000004014 plasticizer Substances 0.000 description 1
 - 229920002647 polyamide Polymers 0.000 description 1
 - 229920000768 polyamine Polymers 0.000 description 1
 - 229920006289 polycarbonate film Polymers 0.000 description 1
 - 229920000728 polyester Polymers 0.000 description 1
 - 229920006267 polyester film Polymers 0.000 description 1
 - 229920000139 polyethylene terephthalate Polymers 0.000 description 1
 - 239000005020 polyethylene terephthalate Substances 0.000 description 1
 - 239000004848 polyfunctional curative Substances 0.000 description 1
 - 229920001155 polypropylene Polymers 0.000 description 1
 - 229920002223 polystyrene Polymers 0.000 description 1
 - ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
 - 229940116357 potassium thiocyanate Drugs 0.000 description 1
 - 239000000843 powder Substances 0.000 description 1
 - 239000003755 preservative agent Substances 0.000 description 1
 - 230000008569 process Effects 0.000 description 1
 - 238000003672 processing method Methods 0.000 description 1
 - 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
 - 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
 - 125000004076 pyridyl group Chemical group 0.000 description 1
 - 125000005493 quinolyl group Chemical group 0.000 description 1
 - 239000000376 reactant Substances 0.000 description 1
 - 230000009467 reduction Effects 0.000 description 1
 - 229910052703 rhodium Inorganic materials 0.000 description 1
 - 239000010948 rhodium Substances 0.000 description 1
 - MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
 - 229910052707 ruthenium Inorganic materials 0.000 description 1
 - 229910052711 selenium Inorganic materials 0.000 description 1
 - 239000011669 selenium Substances 0.000 description 1
 - 230000008313 sensitization Effects 0.000 description 1
 - 150000003378 silver Chemical class 0.000 description 1
 - ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
 - HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
 - 229910000029 sodium carbonate Inorganic materials 0.000 description 1
 - HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
 - 229940001584 sodium metabisulfite Drugs 0.000 description 1
 - 235000010262 sodium metabisulphite Nutrition 0.000 description 1
 - 229940001482 sodium sulfite Drugs 0.000 description 1
 - 235000010265 sodium sulphite Nutrition 0.000 description 1
 - VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
 - AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
 - 235000019345 sodium thiosulphate Nutrition 0.000 description 1
 - 239000002904 solvent Substances 0.000 description 1
 - 230000000087 stabilizing effect Effects 0.000 description 1
 - 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
 - 238000003756 stirring Methods 0.000 description 1
 - 238000003860 storage Methods 0.000 description 1
 - 125000005504 styryl group Chemical group 0.000 description 1
 - 239000000126 substance Substances 0.000 description 1
 - 125000000565 sulfonamide group Chemical group 0.000 description 1
 - 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
 - 229910052717 sulfur Inorganic materials 0.000 description 1
 - 239000011593 sulfur Substances 0.000 description 1
 - 239000004094 surface-active agent Substances 0.000 description 1
 - 238000001308 synthesis method Methods 0.000 description 1
 - 239000011975 tartaric acid Substances 0.000 description 1
 - 235000002906 tartaric acid Nutrition 0.000 description 1
 - 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
 - 125000001544 thienyl group Chemical group 0.000 description 1
 - 125000004149 thio group Chemical group *S* 0.000 description 1
 - 150000003568 thioethers Chemical class 0.000 description 1
 - 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
 - 238000005406 washing Methods 0.000 description 1
 - 239000000080 wetting agent Substances 0.000 description 1
 
Classifications
- 
        
- G—PHYSICS
 - G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
 - G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
 - G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
 - G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
 - G03C7/3003—Materials characterised by the use of combinations of photographic compounds known as such, or by a particular location in the photographic element
 - G03C7/3005—Combinations of couplers and photographic additives
 - G03C7/3008—Combinations of couplers having the coupling site in rings of cyclic compounds and photographic additives
 - G03C7/301—Combinations of couplers having the coupling site in pyrazoloazole rings and photographic additives
 
 
Landscapes
- Physics & Mathematics (AREA)
 - General Physics & Mathematics (AREA)
 - Silver Salt Photography Or Processing Solution Therefor (AREA)
 
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| JP19449484A JPS6172246A (ja) | 1984-09-17 | 1984-09-17 | ハロゲン化銀カラ−写真感光材料 | 
| US06/776,442 US4639415A (en) | 1984-09-17 | 1985-09-16 | Silver halide color photographic material containing a magenta color image-forming coupler | 
| DE8585306621T DE3576002D1 (de) | 1984-09-17 | 1985-09-17 | Farbphotographisches silberhalogenidmaterial. | 
| EP19850306621 EP0178794B1 (en) | 1984-09-17 | 1985-09-17 | Silver halide color photographic material | 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| JP19449484A JPS6172246A (ja) | 1984-09-17 | 1984-09-17 | ハロゲン化銀カラ−写真感光材料 | 
Publications (2)
| Publication Number | Publication Date | 
|---|---|
| JPS6172246A JPS6172246A (ja) | 1986-04-14 | 
| JPH0371701B2 true JPH0371701B2 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1991-11-14 | 
Family
ID=16325452
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| JP19449484A Granted JPS6172246A (ja) | 1984-09-17 | 1984-09-17 | ハロゲン化銀カラ−写真感光材料 | 
Country Status (1)
| Country | Link | 
|---|---|
| JP (1) | JPS6172246A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| JPH0827508B2 (ja) * | 1986-12-27 | 1996-03-21 | コニカ株式会社 | 色素画像の保存性および色再現性が改良されたハロゲン化銀写真感光材料 | 
| JPS63101849A (ja) * | 1986-10-17 | 1988-05-06 | Konica Corp | ハロゲン化銀写真感光材料 | 
| JPS63115167A (ja) * | 1986-10-31 | 1988-05-19 | Konica Corp | ハロゲン化銀写真感光材料 | 
| JPS63148260A (ja) * | 1986-12-12 | 1988-06-21 | Konica Corp | ハロゲン化銀写真感光材料 | 
| JPH0830875B2 (ja) * | 1986-12-25 | 1996-03-27 | コニカ株式会社 | 色素画像の光堅牢性が改良されたハロゲン化銀写真感光材料 | 
| JPH0830876B2 (ja) * | 1986-12-25 | 1996-03-27 | コニカ株式会社 | 色素画像の堅牢性が改良されたハロゲン化銀写真感光材料 | 
| DE3871062D1 (de) * | 1987-09-30 | 1992-06-17 | Ciba Geigy Ag | Stabilisatoren fuer farbphotographische aufzeichnungsmaterialien. | 
- 
        1984
        
- 1984-09-17 JP JP19449484A patent/JPS6172246A/ja active Granted
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| JPS6172246A (ja) | 1986-04-14 |