JP2013520466A - 二量体iap阻害剤 - Google Patents
二量体iap阻害剤 Download PDFInfo
- Publication number
- JP2013520466A JP2013520466A JP2012554332A JP2012554332A JP2013520466A JP 2013520466 A JP2013520466 A JP 2013520466A JP 2012554332 A JP2012554332 A JP 2012554332A JP 2012554332 A JP2012554332 A JP 2012554332A JP 2013520466 A JP2013520466 A JP 2013520466A
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- alkylene
- pyridin
- pyrrolidin
- oxo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003112 inhibitor Substances 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 183
- 230000006907 apoptotic process Effects 0.000 claims abstract description 16
- 230000001737 promoting effect Effects 0.000 claims abstract description 7
- -1 optionally Chemical group 0.000 claims description 142
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 109
- 150000003839 salts Chemical class 0.000 claims description 88
- 229910052757 nitrogen Inorganic materials 0.000 claims description 71
- 125000002947 alkylene group Chemical group 0.000 claims description 66
- 238000000034 method Methods 0.000 claims description 61
- 229910052717 sulfur Inorganic materials 0.000 claims description 59
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 58
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 57
- 125000005842 heteroatom Chemical group 0.000 claims description 55
- 125000000623 heterocyclic group Chemical group 0.000 claims description 53
- 229910052760 oxygen Inorganic materials 0.000 claims description 51
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 239000001257 hydrogen Substances 0.000 claims description 39
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 39
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 34
- 239000000203 mixture Substances 0.000 claims description 33
- 239000003795 chemical substances by application Substances 0.000 claims description 32
- 201000010099 disease Diseases 0.000 claims description 31
- 239000003814 drug Substances 0.000 claims description 29
- 125000005843 halogen group Chemical group 0.000 claims description 28
- 208000035475 disorder Diseases 0.000 claims description 27
- 125000001424 substituent group Chemical group 0.000 claims description 27
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 claims description 27
- 229930012538 Paclitaxel Natural products 0.000 claims description 26
- 125000004450 alkenylene group Chemical group 0.000 claims description 26
- 229960001592 paclitaxel Drugs 0.000 claims description 26
- 125000006832 (C1-C10) alkylene group Chemical group 0.000 claims description 24
- 206010028980 Neoplasm Diseases 0.000 claims description 23
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 22
- 125000005549 heteroarylene group Chemical group 0.000 claims description 22
- 239000008194 pharmaceutical composition Substances 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 21
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 21
- 125000001072 heteroaryl group Chemical group 0.000 claims description 21
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 20
- 229920006395 saturated elastomer Polymers 0.000 claims description 18
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 16
- 230000001404 mediated effect Effects 0.000 claims description 16
- 101100369993 Mus musculus Tnfsf10 gene Proteins 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 201000011510 cancer Diseases 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 13
- 125000004957 naphthylene group Chemical group 0.000 claims description 13
- 108091007065 BIRCs Proteins 0.000 claims description 12
- 125000004043 oxo group Chemical group O=* 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 239000012828 PI3K inhibitor Substances 0.000 claims description 10
- 239000000178 monomer Substances 0.000 claims description 10
- 125000001624 naphthyl group Chemical group 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- 229940043441 phosphoinositide 3-kinase inhibitor Drugs 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 239000003937 drug carrier Substances 0.000 claims description 9
- 125000005647 linker group Chemical group 0.000 claims description 9
- 125000005913 (C3-C6) cycloalkyl group Chemical class 0.000 claims description 8
- 229940123369 TRAIL receptor agonist Drugs 0.000 claims description 8
- 125000004419 alkynylene group Chemical group 0.000 claims description 8
- 125000004429 atom Chemical group 0.000 claims description 8
- 239000003534 dna topoisomerase inhibitor Substances 0.000 claims description 8
- 229940044693 topoisomerase inhibitor Drugs 0.000 claims description 8
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 7
- 125000002393 azetidinyl group Chemical group 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 230000002018 overexpression Effects 0.000 claims description 7
- 125000006590 (C2-C6) alkenylene group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000004069 aziridinyl group Chemical group 0.000 claims description 5
- RMVIHZORKYEQIR-RFAGEVQHSA-N n,n'-bis[(5s)-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-5-[[(2s)-2-(methylamino)propanoyl]amino]-6-oxohexyl]nonanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CCCCNC(=O)CCCCCCCC(=O)NCCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 RMVIHZORKYEQIR-RFAGEVQHSA-N 0.000 claims description 5
- XKJHTKTZGFFEKP-ZEYHMCSCSA-N n,n'-bis[4-[(2s)-3-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-2-[[(2s)-2-(methylamino)propanoyl]amino]-3-oxopropyl]phenyl]heptanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CC2=CC=C(C=C2)NC(=O)CCCCCC(=O)NC2=CC=C(C=C2)C[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 XKJHTKTZGFFEKP-ZEYHMCSCSA-N 0.000 claims description 5
- LXVDXQJERJIFJQ-HNWXVATNSA-N n,n'-bis[4-[(2s)-3-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-2-[[(2s)-2-(methylamino)propanoyl]amino]-3-oxopropyl]phenyl]nonanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CC2=CC=C(C=C2)NC(=O)CCCCCCCC(=O)NC2=CC=C(C=C2)C[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 LXVDXQJERJIFJQ-HNWXVATNSA-N 0.000 claims description 5
- KLADKEUPPHQHDN-HDUJCMOOSA-N n-[(5s)-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-5-[[(2s)-2-(methylamino)propanoyl]amino]-6-oxohexyl]-4-[4-[[(5s)-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-5-[[(2s)-2-(methylamino)propanoyl]amino]-6-oxohexyl]carbamoyl] Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CCCCNC(=O)C2=CC=C(C=C2)C2=CC=C(C=C2)C(=O)NCCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 KLADKEUPPHQHDN-HDUJCMOOSA-N 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000003386 piperidinyl group Chemical group 0.000 claims description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 5
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 claims description 4
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 4
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 4
- UDSAJFSYJMHNFI-UHFFFAOYSA-N 2,6-diazaspiro[3.3]heptane Chemical compound C1NCC11CNC1 UDSAJFSYJMHNFI-UHFFFAOYSA-N 0.000 claims description 4
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 4
- 125000005567 fluorenylene group Chemical group 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 4
- XWPQDZHURSCQNV-BMFARTNFSA-N (2s)-n-[(2s)-6-[[4-[4-[[(5s)-5-[[(2s)-azetidine-2-carbonyl]amino]-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-6-oxohexyl]carbamoyl]phenyl]benzoyl]amino]-1-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-1-oxohexan-2-yl]azetidine- Chemical compound C1=CC(F)=CC=C1C(=O)C1=CN=CC([C@H]2N(CCC2)C(=O)[C@H](CCCCNC(=O)C=2C=CC(=CC=2)C=2C=CC(=CC=2)C(=O)NCCCC[C@H](NC(=O)[C@H]2NCC2)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)NC(=O)[C@H]2NCC2)=C1 XWPQDZHURSCQNV-BMFARTNFSA-N 0.000 claims description 3
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 3
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 claims description 3
- TVQGQDPHQNIVPP-ANQDZLGGSA-N 1-n,3-n-bis[(5s)-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-5-[[(2s)-2-(methylamino)propanoyl]amino]-6-oxohexyl]benzene-1,3-dicarboxamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CCCCNC(=O)C=2C=CC=C(C=2)C(=O)NCCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 TVQGQDPHQNIVPP-ANQDZLGGSA-N 0.000 claims description 3
- KPOLERISENSJJN-ANQDZLGGSA-N 1-n,4-n-bis[(5s)-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-5-[[(2s)-2-(methylamino)propanoyl]amino]-6-oxohexyl]benzene-1,4-dicarboxamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CCCCNC(=O)C2=CC=C(C=C2)C(=O)NCCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 KPOLERISENSJJN-ANQDZLGGSA-N 0.000 claims description 3
- 125000004959 2,6-naphthylene group Chemical group [H]C1=C([H])C2=C([H])C([*:1])=C([H])C([H])=C2C([H])=C1[*:2] 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 230000000996 additive effect Effects 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 230000001939 inductive effect Effects 0.000 claims description 3
- MFWKSSPEWCJQJK-GSBNDYOUSA-N n,n'-bis[(5s)-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-5-[[(2s)-2-(methylamino)propanoyl]amino]-6-oxohexyl]heptanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CCCCNC(=O)CCCCCC(=O)NCCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 MFWKSSPEWCJQJK-GSBNDYOUSA-N 0.000 claims description 3
- 125000000160 oxazolidinyl group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 3
- 125000004607 1,2,3,4-tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 2
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims description 2
- DGYDDYXFCQZXIE-BQDLXYDNSA-N 1-n,3-n-bis[4-[(2s)-3-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-2-[[(2s)-2-(methylamino)propanoyl]amino]-3-oxopropyl]phenyl]benzene-1,3-dicarboxamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CC2=CC=C(C=C2)NC(=O)C=2C=CC=C(C=2)C(=O)NC2=CC=C(C=C2)C[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 DGYDDYXFCQZXIE-BQDLXYDNSA-N 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims 1
- WCDWBPCFGJXFJZ-UHFFFAOYSA-N etanidazole Chemical group OCCNC(=O)CN1C=CN=C1[N+]([O-])=O WCDWBPCFGJXFJZ-UHFFFAOYSA-N 0.000 claims 1
- PNBHWOVWFRZWCV-SHGOGIJKSA-N n,n'-bis[4-[(2s)-3-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-2-[[(2s)-2-(methylamino)propanoyl]amino]-3-oxopropyl]phenyl]hexanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CC2=CC=C(C=C2)NC(=O)CCCCC(=O)NC2=CC=C(C=C2)C[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 PNBHWOVWFRZWCV-SHGOGIJKSA-N 0.000 claims 1
- PFXHMWKREFIWAE-HKGOYKQQSA-N n,n'-bis[4-[(2s)-3-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-2-[[(2s)-2-(methylamino)propanoyl]amino]-3-oxopropyl]phenyl]pentanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CC2=CC=C(C=C2)NC(=O)CCCC(=O)NC2=CC=C(C=C2)C[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 PFXHMWKREFIWAE-HKGOYKQQSA-N 0.000 claims 1
- 239000008096 xylene Substances 0.000 claims 1
- 239000000539 dimer Substances 0.000 abstract description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 51
- 210000004027 cell Anatomy 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 23
- 238000002360 preparation method Methods 0.000 description 23
- 239000000543 intermediate Substances 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 229910052805 deuterium Inorganic materials 0.000 description 18
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 16
- 239000007858 starting material Substances 0.000 description 16
- 125000006239 protecting group Chemical group 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000012267 brine Substances 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 238000004128 high performance liquid chromatography Methods 0.000 description 12
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 12
- 125000003118 aryl group Chemical group 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 229940124597 therapeutic agent Drugs 0.000 description 10
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- 108700012411 TNFSF10 Proteins 0.000 description 9
- 229940079593 drug Drugs 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- 102100024598 Tumor necrosis factor ligand superfamily member 10 Human genes 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- UUVWYPNAQBNQJQ-UHFFFAOYSA-N hexamethylmelamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 108090000765 processed proteins & peptides Proteins 0.000 description 8
- 101100369992 Homo sapiens TNFSF10 gene Proteins 0.000 description 7
- 241000124008 Mammalia Species 0.000 description 7
- 239000002246 antineoplastic agent Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 102000011727 Caspases Human genes 0.000 description 6
- 108010076667 Caspases Proteins 0.000 description 6
- 102100033189 Diablo IAP-binding mitochondrial protein Human genes 0.000 description 6
- 229960000473 altretamine Drugs 0.000 description 6
- 125000002619 bicyclic group Chemical group 0.000 description 6
- 235000018102 proteins Nutrition 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 108090000623 proteins and genes Proteins 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 5
- 101710101225 Diablo IAP-binding mitochondrial protein Proteins 0.000 description 5
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 5
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 5
- 235000008206 alpha-amino acids Nutrition 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 238000012054 celltiter-glo Methods 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical compound ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 208000024891 symptom Diseases 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- AQTQHPDCURKLKT-JKDPCDLQSA-N vincristine sulfate Chemical compound OS(O)(=O)=O.C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C=O)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 AQTQHPDCURKLKT-JKDPCDLQSA-N 0.000 description 5
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 4
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 102100037024 E3 ubiquitin-protein ligase XIAP Human genes 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 4
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 4
- 108700031544 X-Linked Inhibitor of Apoptosis Proteins 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- JOGKUKXHTYWRGZ-UHFFFAOYSA-N dactolisib Chemical compound O=C1N(C)C2=CN=C3C=CC(C=4C=C5C=CC=CC5=NC=4)=CC3=C2N1C1=CC=C(C(C)(C)C#N)C=C1 JOGKUKXHTYWRGZ-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- JFCQEDHGNNZCLN-UHFFFAOYSA-N glutaric acid Chemical compound OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 JYGXADMDTFJGBT-VWUMJDOOSA-N 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 230000003993 interaction Effects 0.000 description 4
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 4
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 4
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000004007 reversed phase HPLC Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000012453 solvate Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 210000004881 tumor cell Anatomy 0.000 description 4
- 230000004614 tumor growth Effects 0.000 description 4
- FFTZUISSQVHYJU-LURJTMIESA-N (2s)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoic acid Chemical compound OC(=O)[C@H](C)NCC(=O)OC(C)(C)C FFTZUISSQVHYJU-LURJTMIESA-N 0.000 description 3
- OCGPLIFCGRTVSR-HNNXBMFYSA-N (4-fluorophenyl)-[5-[(2s)-pyrrolidin-2-yl]pyridin-3-yl]methanone Chemical compound C1=CC(F)=CC=C1C(=O)C1=CN=CC([C@H]2NCCC2)=C1 OCGPLIFCGRTVSR-HNNXBMFYSA-N 0.000 description 3
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 3
- YCWRFIYBUQBHJI-UHFFFAOYSA-N 2-(4-aminophenyl)acetonitrile Chemical group NC1=CC=C(CC#N)C=C1 YCWRFIYBUQBHJI-UHFFFAOYSA-N 0.000 description 3
- VHRSUDSXCMQTMA-PJHHCJLFSA-N 6alpha-methylprednisolone Chemical compound C([C@@]12C)=CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)[C@@](O)(C(=O)CO)CC[C@H]21 VHRSUDSXCMQTMA-PJHHCJLFSA-N 0.000 description 3
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 3
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 3
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 3
- JUQLUIFNNFIIKC-UHFFFAOYSA-N D-alpha-Aminopimelic acid Natural products OC(=O)C(N)CCCCC(O)=O JUQLUIFNNFIIKC-UHFFFAOYSA-N 0.000 description 3
- 108010092160 Dactinomycin Proteins 0.000 description 3
- GUGHGUXZJWAIAS-QQYBVWGSSA-N Daunorubicin hydrochloride Chemical compound Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 GUGHGUXZJWAIAS-QQYBVWGSSA-N 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 102000055031 Inhibitor of Apoptosis Proteins Human genes 0.000 description 3
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 3
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000000732 arylene group Chemical group 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- UBPYILGKFZZVDX-UHFFFAOYSA-N bosutinib Chemical compound C1=C(Cl)C(OC)=CC(NC=2C3=CC(OC)=C(OCCCN4CCN(C)CC4)C=C3N=CC=2C#N)=C1Cl UBPYILGKFZZVDX-UHFFFAOYSA-N 0.000 description 3
- LTEJRLHKIYCEOX-OCCSQVGLSA-N brivanib alaninate Chemical compound C1=C2NC(C)=CC2=C(F)C(OC2=NC=NN3C=C(C(=C32)C)OC[C@@H](C)OC(=O)[C@H](C)N)=C1 LTEJRLHKIYCEOX-OCCSQVGLSA-N 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 230000030833 cell death Effects 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- MPVGZUGXCQEXTM-UHFFFAOYSA-N linifanib Chemical compound CC1=CC=C(F)C(NC(=O)NC=2C=CC(=CC=2)C=2C=3C(N)=NNC=3C=CC=2)=C1 MPVGZUGXCQEXTM-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 229960004961 mechlorethamine Drugs 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 3
- IXOXBSCIXZEQEQ-UHTZMRCNSA-N nelarabine Chemical compound C1=NC=2C(OC)=NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O IXOXBSCIXZEQEQ-UHTZMRCNSA-N 0.000 description 3
- 229960001972 panitumumab Drugs 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 102000004196 processed proteins & peptides Human genes 0.000 description 3
- 125000003003 spiro group Chemical group 0.000 description 3
- 238000002198 surface plasmon resonance spectroscopy Methods 0.000 description 3
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 3
- JXLYSJRDGCGARV-CFWMRBGOSA-N vinblastine Chemical compound C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-CFWMRBGOSA-N 0.000 description 3
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 3
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 2
- VNTHYLVDGVBPOU-QQYBVWGSSA-N (7s,9s)-9-acetyl-7-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7h-tetracene-5,12-dione;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 VNTHYLVDGVBPOU-QQYBVWGSSA-N 0.000 description 2
- DGHHQBMTXTWTJV-BQAIUKQQSA-N 119413-54-6 Chemical compound Cl.C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 DGHHQBMTXTWTJV-BQAIUKQQSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- XNMQEEKYCVKGBD-UHFFFAOYSA-N 2-butyne Chemical compound CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 2
- FMACOGSACRRIMK-UHFFFAOYSA-N 2-carbonochloridoyloxyethyl carbonochloridate Chemical compound ClC(=O)OCCOC(Cl)=O FMACOGSACRRIMK-UHFFFAOYSA-N 0.000 description 2
- YCBPQSYLYYBPDW-UHFFFAOYSA-N 4-methyl-n-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide;hydrate;hydrochloride Chemical compound O.Cl.C1=NC(C)=CN1C1=CC(NC(=O)C=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)=CC(C(F)(F)F)=C1 YCBPQSYLYYBPDW-UHFFFAOYSA-N 0.000 description 2
- PGFJLKBMWYYHQI-UHFFFAOYSA-N 6-oxohexylcarbamic acid Chemical compound OC(=O)NCCCCCC=O PGFJLKBMWYYHQI-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 108700003785 Baculoviral IAP Repeat-Containing 3 Proteins 0.000 description 2
- 102100021662 Baculoviral IAP repeat-containing protein 3 Human genes 0.000 description 2
- 229940045513 CTLA4 antagonist Drugs 0.000 description 2
- 0 C[C@@](C(N[C@@](Cc(cc1)ccc1NC(CCCCCC(Nc1ccc(C[C@@](C(N(CCC2)[C@@]2C(C2C)C=NC=C2C(c(cc2)ccc2F)=O)=O)NC([C@](*)NC)=O)cc1)O)=O)C(N(CCC1)[C@@]1c1cc(C(c(cc2)ccc2F)=O)cnc1)=O)=O)NC Chemical compound C[C@@](C(N[C@@](Cc(cc1)ccc1NC(CCCCCC(Nc1ccc(C[C@@](C(N(CCC2)[C@@]2C(C2C)C=NC=C2C(c(cc2)ccc2F)=O)=O)NC([C@](*)NC)=O)cc1)O)=O)C(N(CCC1)[C@@]1c1cc(C(c(cc2)ccc2F)=O)cnc1)=O)=O)NC 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 2
- 102000004039 Caspase-9 Human genes 0.000 description 2
- 108090000566 Caspase-9 Proteins 0.000 description 2
- ZBNZXTGUTAYRHI-UHFFFAOYSA-N Dasatinib Chemical compound C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1Cl ZBNZXTGUTAYRHI-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 2
- 102000001301 EGF receptor Human genes 0.000 description 2
- 108060006698 EGF receptor Proteins 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 241000713321 Intracisternal A-particles Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 102100027670 Islet amyloid polypeptide Human genes 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 2
- 239000003798 L01XE11 - Pazopanib Substances 0.000 description 2
- FQISKWAFAHGMGT-SGJOWKDISA-M Methylprednisolone sodium succinate Chemical compound [Na+].C([C@@]12C)=CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)[C@@](O)(C(=O)COC(=O)CCC([O-])=O)CC[C@H]21 FQISKWAFAHGMGT-SGJOWKDISA-M 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- SLTGLTLBIVDQKE-BYPYZUCNSA-N O-(2-aminoethyl)-L-serine Chemical compound NCCOC[C@H](N)C(O)=O SLTGLTLBIVDQKE-BYPYZUCNSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 2
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 2
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 238000009098 adjuvant therapy Methods 0.000 description 2
- 150000001335 aliphatic alkanes Chemical group 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 230000000259 anti-tumor effect Effects 0.000 description 2
- 229940034982 antineoplastic agent Drugs 0.000 description 2
- 238000003782 apoptosis assay Methods 0.000 description 2
- 230000005756 apoptotic signaling Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- RITAVMQDGBJQJZ-FMIVXFBMSA-N axitinib Chemical compound CNC(=O)C1=CC=CC=C1SC1=CC=C(C(\C=C\C=2N=CC=CC=2)=NN2)C2=C1 RITAVMQDGBJQJZ-FMIVXFBMSA-N 0.000 description 2
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 2
- 229960002255 azelaic acid Drugs 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229960002685 biotin Drugs 0.000 description 2
- 239000011616 biotin Substances 0.000 description 2
- GXJABQQUPOEUTA-RDJZCZTQSA-N bortezomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)C=1N=CC=NC=1)C1=CC=CC=C1 GXJABQQUPOEUTA-RDJZCZTQSA-N 0.000 description 2
- 229960003736 bosutinib Drugs 0.000 description 2
- 229950005993 brivanib alaninate Drugs 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 235000015165 citric acid Nutrition 0.000 description 2
- 150000001860 citric acid derivatives Chemical class 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- BGSOJVFOEQLVMH-VWUMJDOOSA-N cortisol phosphate Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)COP(O)(O)=O)[C@@H]4[C@@H]3CCC2=C1 BGSOJVFOEQLVMH-VWUMJDOOSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 229960000640 dactinomycin Drugs 0.000 description 2
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 2
- 150000001975 deuterium Chemical group 0.000 description 2
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- GTTBEUCJPZQMDZ-UHFFFAOYSA-N erlotinib hydrochloride Chemical compound [H+].[Cl-].C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 GTTBEUCJPZQMDZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229960005420 etoposide Drugs 0.000 description 2
- LIQODXNTTZAGID-OCBXBXKTSA-N etoposide phosphate Chemical compound COC1=C(OP(O)(O)=O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 LIQODXNTTZAGID-OCBXBXKTSA-N 0.000 description 2
- 229960000752 etoposide phosphate Drugs 0.000 description 2
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 2
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- LVIMBOHJGMDKEJ-UHFFFAOYSA-N heptanedioyl dichloride Chemical compound ClC(=O)CCCCCC(Cl)=O LVIMBOHJGMDKEJ-UHFFFAOYSA-N 0.000 description 2
- 229940003183 hexalen Drugs 0.000 description 2
- 229940121372 histone deacetylase inhibitor Drugs 0.000 description 2
- 239000003276 histone deacetylase inhibitor Substances 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 230000001965 increasing effect Effects 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 238000012482 interaction analysis Methods 0.000 description 2
- 229960005386 ipilimumab Drugs 0.000 description 2
- GURKHSYORGJETM-WAQYZQTGSA-N irinotecan hydrochloride (anhydrous) Chemical compound Cl.C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 GURKHSYORGJETM-WAQYZQTGSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000004020 luminiscence type Methods 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 229960001924 melphalan Drugs 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- 229960004584 methylprednisolone Drugs 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229960004857 mitomycin Drugs 0.000 description 2
- RAHBGWKEPAQNFF-UHFFFAOYSA-N motesanib Chemical compound C=1C=C2C(C)(C)CNC2=CC=1NC(=O)C1=CC=CN=C1NCC1=CC=NC=C1 RAHBGWKEPAQNFF-UHFFFAOYSA-N 0.000 description 2
- LBWFXVZLPYTWQI-IPOVEDGCSA-N n-[2-(diethylamino)ethyl]-5-[(z)-(5-fluoro-2-oxo-1h-indol-3-ylidene)methyl]-2,4-dimethyl-1h-pyrrole-3-carboxamide;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C LBWFXVZLPYTWQI-IPOVEDGCSA-N 0.000 description 2
- 229960000801 nelarabine Drugs 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- FPOHNWQLNRZRFC-ZHACJKMWSA-N panobinostat Chemical compound CC=1NC2=CC=CC=C2C=1CCNCC1=CC=C(\C=C\C(=O)NO)C=C1 FPOHNWQLNRZRFC-ZHACJKMWSA-N 0.000 description 2
- 229960005415 pasireotide Drugs 0.000 description 2
- 108700017947 pasireotide Proteins 0.000 description 2
- MQHIQUBXFFAOMK-UHFFFAOYSA-N pazopanib hydrochloride Chemical compound Cl.C1=CC2=C(C)N(C)N=C2C=C1N(C)C(N=1)=CC=NC=1NC1=CC=C(C)C(S(N)(=O)=O)=C1 MQHIQUBXFFAOMK-UHFFFAOYSA-N 0.000 description 2
- 238000003359 percent control normalization Methods 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- LHNIIDJUOCFXAP-UHFFFAOYSA-N pictrelisib Chemical compound C1CN(S(=O)(=O)C)CCN1CC1=CC2=NC(C=3C=4C=NNC=4C=CC=3)=NC(N3CCOCC3)=C2S1 LHNIIDJUOCFXAP-UHFFFAOYSA-N 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 229960005141 piperazine Drugs 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 229940068977 polysorbate 20 Drugs 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 2
- VJZLQIPZNBPASX-OJJGEMKLSA-L prednisolone sodium phosphate Chemical compound [Na+].[Na+].O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)COP([O-])([O-])=O)[C@@H]4[C@@H]3CCC2=C1 VJZLQIPZNBPASX-OJJGEMKLSA-L 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 229950009904 pritumumab Drugs 0.000 description 2
- 230000000861 pro-apoptotic effect Effects 0.000 description 2
- 230000005522 programmed cell death Effects 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 238000000159 protein binding assay Methods 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 229940044601 receptor agonist Drugs 0.000 description 2
- 239000000018 receptor agonist Substances 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000012146 running buffer Substances 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000002603 single-photon emission computed tomography Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 229960004964 temozolomide Drugs 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- KDQAABAKXDWYSZ-PNYVAJAMSA-N vinblastine sulfate Chemical compound OS(O)(=O)=O.C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 KDQAABAKXDWYSZ-PNYVAJAMSA-N 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- WAEXFXRVDQXREF-UHFFFAOYSA-N vorinostat Chemical compound ONC(=O)CCCCCCC(=O)NC1=CC=CC=C1 WAEXFXRVDQXREF-UHFFFAOYSA-N 0.000 description 2
- KANQIAARVSWKKG-DDUDGIQNSA-N (1r,3s,4s)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride Chemical compound C1[C@]2([H])C=C[C@@]1([H])[C@H](C(Cl)=O)C2C(Cl)=O KANQIAARVSWKKG-DDUDGIQNSA-N 0.000 description 1
- GZOVEPYOCJWRFC-HZLVTQRSSA-N (1s,2s)-2-[(s)-amino(carboxy)methyl]cyclopropane-1-carboxylic acid Chemical compound OC(=O)[C@@H](N)[C@H]1C[C@@H]1C(O)=O GZOVEPYOCJWRFC-HZLVTQRSSA-N 0.000 description 1
- KANQIAARVSWKKG-VZFHVOOUSA-N (1s,2s,3s,4r)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride Chemical compound C1[C@]2([H])C=C[C@@]1([H])[C@H](C(Cl)=O)[C@H]2C(Cl)=O KANQIAARVSWKKG-VZFHVOOUSA-N 0.000 description 1
- WAAOLVVQWSHZNT-ZPAAKOCQSA-N (1s,3s)-3-[(s)-amino(carboxy)methyl]-2,2-difluorocyclopropane-1-carboxylic acid Chemical compound OC(=O)[C@@H](N)[C@@H]1[C@@H](C(O)=O)C1(F)F WAAOLVVQWSHZNT-ZPAAKOCQSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- KRKRAOXTGDJWNI-UHFFFAOYSA-N (2R,4S)-4-Methyl glutamic acid Natural products OC(=O)C(C)CC(N)C(O)=O KRKRAOXTGDJWNI-UHFFFAOYSA-N 0.000 description 1
- DDLYNVBJVVOUGB-MRVPVSSYSA-N (2r)-2-amino-3-(3-aminophenyl)propanoic acid Chemical compound OC(=O)[C@H](N)CC1=CC=CC(N)=C1 DDLYNVBJVVOUGB-MRVPVSSYSA-N 0.000 description 1
- WKTWOKOOUAZXQP-ASHVXDOASA-N (2r)-2-amino-3-fluorobutanedioic acid Chemical compound OC(=O)[C@@H](N)C(F)C(O)=O WKTWOKOOUAZXQP-ASHVXDOASA-N 0.000 description 1
- SPBWCBIQZFYDOE-SSDOTTSWSA-N (2r)-2-amino-6-(2-carboxyethylamino)hexanoic acid Chemical compound OC(=O)[C@H](N)CCCCNCCC(O)=O SPBWCBIQZFYDOE-SSDOTTSWSA-N 0.000 description 1
- QHFWIZMMKPGTRI-GFCCVEGCSA-N (2r)-2-amino-6-(benzylamino)hexanoic acid Chemical compound OC(=O)[C@H](N)CCCCNCC1=CC=CC=C1 QHFWIZMMKPGTRI-GFCCVEGCSA-N 0.000 description 1
- YOFPFYYTUIARDI-ZCFIWIBFSA-N (2r)-2-aminooctanedioic acid Chemical compound OC(=O)[C@H](N)CCCCCC(O)=O YOFPFYYTUIARDI-ZCFIWIBFSA-N 0.000 description 1
- AOHJOMMDDJHIJH-GSVOUGTGSA-N (2r)-propane-1,2-diamine Chemical compound C[C@@H](N)CN AOHJOMMDDJHIJH-GSVOUGTGSA-N 0.000 description 1
- SXGMVGOVILIERA-PWNYCUMCSA-N (2r,3r)-2,3-diaminobutanoic acid Chemical compound C[C@@H](N)[C@@H](N)C(O)=O SXGMVGOVILIERA-PWNYCUMCSA-N 0.000 description 1
- ZHXBCPSYEAQEHB-PSASIEDQSA-N (2r,3r)-2-amino-3-(4-chlorophenyl)pentanedioic acid Chemical compound OC(=O)[C@H](N)[C@H](CC(O)=O)C1=CC=C(Cl)C=C1 ZHXBCPSYEAQEHB-PSASIEDQSA-N 0.000 description 1
- LXRUAYBIUSUULX-PWNYCUMCSA-N (2r,3r)-2-amino-3-methylbutanedioic acid Chemical compound OC(=O)[C@H](C)[C@@H](N)C(O)=O LXRUAYBIUSUULX-PWNYCUMCSA-N 0.000 description 1
- IXOXBSCIXZEQEQ-XJCFNFQFSA-N (2r,3s,4r,5r)-2-(2-amino-6-methoxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(OC)=NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@H](O)[C@@H]1O IXOXBSCIXZEQEQ-XJCFNFQFSA-N 0.000 description 1
- DTPMRVNZZVDEES-RKDXNWHRSA-N (2r,4r)-2-amino-4-(oxan-4-ylmethyl)pentanedioic acid Chemical compound OC(=O)[C@H](N)C[C@H](C(O)=O)CC1CCOCC1 DTPMRVNZZVDEES-RKDXNWHRSA-N 0.000 description 1
- OFXDKSSZYVHWQA-QWWZWVQMSA-N (2r,5r)-2,5-diamino-6,6,6-trifluorohexanoic acid Chemical compound OC(=O)[C@H](N)CC[C@@H](N)C(F)(F)F OFXDKSSZYVHWQA-QWWZWVQMSA-N 0.000 description 1
- UMKVHRBXXOWEPJ-BYPYZUCNSA-N (2s)-2,6-diamino-5,5-difluorohexanoic acid Chemical compound NCC(F)(F)CC[C@H](N)C(O)=O UMKVHRBXXOWEPJ-BYPYZUCNSA-N 0.000 description 1
- NMDDZEVVQDPECF-LURJTMIESA-N (2s)-2,7-diaminoheptanoic acid Chemical compound NCCCCC[C@H](N)C(O)=O NMDDZEVVQDPECF-LURJTMIESA-N 0.000 description 1
- VLHQXRIIQSTJCQ-CTJQVZHFSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonyl-(trideuteriomethyl)amino]propanoic acid Chemical compound OC(=O)[C@H](C)N(C([2H])([2H])[2H])C(=O)OC(C)(C)C VLHQXRIIQSTJCQ-CTJQVZHFSA-N 0.000 description 1
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 1
- IMYWDADMTBVYCJ-YFKPBYRVSA-N (2s)-2-amino-2-(1h-pyrrol-3-yl)acetic acid Chemical compound OC(=O)[C@@H](N)C=1C=CNC=1 IMYWDADMTBVYCJ-YFKPBYRVSA-N 0.000 description 1
- OOASNXLDNAKYSG-ZETCQYMHSA-N (2s)-2-amino-2-(4-aminophenyl)acetic acid Chemical compound OC(=O)[C@@H](N)C1=CC=C(N)C=C1 OOASNXLDNAKYSG-ZETCQYMHSA-N 0.000 description 1
- JVXMAIIBPJZWKA-BYPYZUCNSA-N (2s)-2-amino-2-(azetidin-3-yl)acetic acid Chemical compound OC(=O)[C@@H](N)C1CNC1 JVXMAIIBPJZWKA-BYPYZUCNSA-N 0.000 description 1
- FHCFEIKJIYXGFM-WDSKDSINSA-N (2s)-2-amino-2-[(3s)-piperidin-3-yl]acetic acid Chemical compound OC(=O)[C@@H](N)[C@H]1CCCNC1 FHCFEIKJIYXGFM-WDSKDSINSA-N 0.000 description 1
- SRMWKNUAAAAUED-LURJTMIESA-N (2s)-2-amino-2-piperidin-4-ylacetic acid Chemical compound OC(=O)[C@@H](N)C1CCNCC1 SRMWKNUAAAAUED-LURJTMIESA-N 0.000 description 1
- SPHNJDOWMOXSMT-NETXQHHPSA-N (2s)-2-amino-3-(2,3-dihydro-1h-indol-3-yl)propanoic acid Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)CNC2=C1 SPHNJDOWMOXSMT-NETXQHHPSA-N 0.000 description 1
- DJZAVKNBQZFEAL-QMMMGPOBSA-N (2s)-2-amino-3-(2-aminophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1N DJZAVKNBQZFEAL-QMMMGPOBSA-N 0.000 description 1
- MZFWWNYCFLLGAR-YFKPBYRVSA-N (2s)-2-amino-3-(azetidin-3-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1CNC1 MZFWWNYCFLLGAR-YFKPBYRVSA-N 0.000 description 1
- QRYWLXOBFZDEAD-VKHMYHEASA-N (2s)-2-amino-3-[(2-aminooxyacetyl)amino]propanoic acid Chemical compound NOCC(=O)NC[C@H](N)C(O)=O QRYWLXOBFZDEAD-VKHMYHEASA-N 0.000 description 1
- FSWHIERXACOOSM-WDSKDSINSA-N (2s)-2-amino-3-[(2s)-2,3-dihydro-1h-pyrrol-2-yl]propanoic acid Chemical compound OC(=O)[C@@H](N)C[C@@H]1CC=CN1 FSWHIERXACOOSM-WDSKDSINSA-N 0.000 description 1
- YISMMIVRQJEASU-WHFBIAKZSA-N (2s)-2-amino-3-[(2s)-azetidin-2-yl]propanoic acid Chemical compound OC(=O)[C@@H](N)C[C@@H]1CCN1 YISMMIVRQJEASU-WHFBIAKZSA-N 0.000 description 1
- HKVRLGJVXIAYOT-IMJSIDKUSA-N (2s)-2-amino-3-[(2s)-aziridin-2-yl]propanoic acid Chemical compound OC(=O)[C@@H](N)C[C@H]1CN1 HKVRLGJVXIAYOT-IMJSIDKUSA-N 0.000 description 1
- CNSSCDOMOBISKK-WDSKDSINSA-N (2s)-2-amino-3-[(2s)-pyrrolidin-2-yl]propanoic acid Chemical compound OC(=O)[C@@H](N)C[C@@H]1CCCN1 CNSSCDOMOBISKK-WDSKDSINSA-N 0.000 description 1
- XVRDLFLCLRVZCJ-QWRGUYRKSA-N (2s)-2-amino-3-[(3s)-1,2,3,4-tetrahydroisoquinolin-3-yl]propanoic acid Chemical compound C1=CC=C2CN[C@H](C[C@H](N)C(O)=O)CC2=C1 XVRDLFLCLRVZCJ-QWRGUYRKSA-N 0.000 description 1
- UJGNCYAOIKEUNK-WDSKDSINSA-N (2s)-2-amino-3-[(3s)-pyrrolidin-3-yl]propanoic acid Chemical compound OC(=O)[C@@H](N)C[C@@H]1CCNC1 UJGNCYAOIKEUNK-WDSKDSINSA-N 0.000 description 1
- YBVDQQQEPCEKPR-VIFPVBQESA-N (2s)-2-amino-3-[3-(aminomethyl)phenyl]propanoic acid Chemical compound NCC1=CC=CC(C[C@H](N)C(O)=O)=C1 YBVDQQQEPCEKPR-VIFPVBQESA-N 0.000 description 1
- QDAIIHDTILEIDU-JTQLQIEISA-N (2s)-2-amino-3-[4-(1h-imidazol-2-yl)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](N)C(O)=O)=CC=C1C1=NC=CN1 QDAIIHDTILEIDU-JTQLQIEISA-N 0.000 description 1
- GNVNKFUEUXUWDV-VIFPVBQESA-N (2s)-2-amino-3-[4-(aminomethyl)phenyl]propanoic acid Chemical compound NCC1=CC=C(C[C@H](N)C(O)=O)C=C1 GNVNKFUEUXUWDV-VIFPVBQESA-N 0.000 description 1
- INEFDHFFQSAUCG-VIFPVBQESA-N (2s)-2-amino-3-[4-(aminooxymethyl)phenyl]propanoic acid Chemical compound NOCC1=CC=C(C[C@H](N)C(O)=O)C=C1 INEFDHFFQSAUCG-VIFPVBQESA-N 0.000 description 1
- SMQMVYPLQGWEGE-REOHCLBHSA-N (2s)-2-amino-3-aminooxypropanoic acid Chemical compound NOC[C@H](N)C(O)=O SMQMVYPLQGWEGE-REOHCLBHSA-N 0.000 description 1
- RIXVIYNHAZQUJF-LURJTMIESA-N (2s)-2-amino-4-(2-aminopyrimidin-4-yl)butanoic acid Chemical compound OC(=O)[C@@H](N)CCC1=CC=NC(N)=N1 RIXVIYNHAZQUJF-LURJTMIESA-N 0.000 description 1
- DMEAAXLCIDNUHT-RQJHMYQMSA-N (2s)-2-amino-4-[(5r)-2,2-dimethyl-1,3-oxazolidin-5-yl]butanoic acid Chemical compound CC1(C)NC[C@@H](CC[C@H](N)C(O)=O)O1 DMEAAXLCIDNUHT-RQJHMYQMSA-N 0.000 description 1
- JPSHPWJJSVEEAX-NFJMKROFSA-N (2s)-2-amino-4-fluoropentanedioic acid Chemical compound OC(=O)[C@@H](N)CC(F)C(O)=O JPSHPWJJSVEEAX-NFJMKROFSA-N 0.000 description 1
- DQDVAFSXZUTHSG-ZETCQYMHSA-N (2s)-2-amino-4-piperazin-1-ylbutanoic acid Chemical compound OC(=O)[C@@H](N)CCN1CCNCC1 DQDVAFSXZUTHSG-ZETCQYMHSA-N 0.000 description 1
- CYFQLLSFGZHOMC-QMMMGPOBSA-N (2s)-2-amino-4-piperidin-4-ylbutanoic acid Chemical compound OC(=O)[C@@H](N)CCC1CCNCC1 CYFQLLSFGZHOMC-QMMMGPOBSA-N 0.000 description 1
- GFOZTGXHZSBIOB-BYPYZUCNSA-N (2s)-2-amino-5-aminooxypentanoic acid Chemical compound NOCCC[C@H](N)C(O)=O GFOZTGXHZSBIOB-BYPYZUCNSA-N 0.000 description 1
- PVSCEBQLSKNNAT-NSHDSACASA-N (2s)-2-amino-6-(cyclohexylamino)hexanoic acid Chemical compound OC(=O)[C@@H](N)CCCCNC1CCCCC1 PVSCEBQLSKNNAT-NSHDSACASA-N 0.000 description 1
- CBAWNLIZBXJSFS-QMMMGPOBSA-N (2s)-2-amino-6-(propan-2-ylamino)hexanoic acid Chemical compound CC(C)NCCCC[C@H](N)C(O)=O CBAWNLIZBXJSFS-QMMMGPOBSA-N 0.000 description 1
- UYEGXSNFZXWSDV-BYPYZUCNSA-N (2s)-3-(2-amino-1h-imidazol-5-yl)-2-azaniumylpropanoate Chemical compound OC(=O)[C@@H](N)CC1=CNC(N)=N1 UYEGXSNFZXWSDV-BYPYZUCNSA-N 0.000 description 1
- ZKSJJSOHPQQZHC-VWLOTQADSA-N (2s)-3-[4-(9h-fluoren-9-ylmethoxycarbonylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C1NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C21 ZKSJJSOHPQQZHC-VWLOTQADSA-N 0.000 description 1
- IFLWVSHRWAIVQF-AJDMCEKOSA-N (2s,3r)-2-[(s)-amino(carboxy)methyl]-3-phenylcyclopropane-1-carboxylic acid Chemical compound OC(=O)[C@@H](N)[C@@H]1C(C(O)=O)[C@@H]1C1=CC=CC=C1 IFLWVSHRWAIVQF-AJDMCEKOSA-N 0.000 description 1
- MIYOEFIPPDFVIH-WUJLRWPWSA-N (2s,3r)-2-amino-3-(2-aminoacetyl)oxybutanoic acid Chemical compound OC(=O)[C@@H](N)[C@@H](C)OC(=O)CN MIYOEFIPPDFVIH-WUJLRWPWSA-N 0.000 description 1
- FHJNAFIJPFGZRI-UCORVYFPSA-N (2s,3s)-2-amino-3-methylpentanedioic acid Chemical compound OC(=O)C[C@H](C)[C@H](N)C(O)=O FHJNAFIJPFGZRI-UCORVYFPSA-N 0.000 description 1
- QPCTVZJQDKALPA-XPUUQOCRSA-N (2s,4r)-2-amino-4-(thiophen-2-ylmethyl)pentanedioic acid Chemical compound OC(=O)[C@@H](N)C[C@@H](C(O)=O)CC1=CC=CS1 QPCTVZJQDKALPA-XPUUQOCRSA-N 0.000 description 1
- RRUCUUPGLZWNQN-BQBZGAKWSA-N (2s,4s)-2-amino-4-(2-methylpropyl)pentanedioic acid Chemical compound CC(C)C[C@H](C(O)=O)C[C@H](N)C(O)=O RRUCUUPGLZWNQN-BQBZGAKWSA-N 0.000 description 1
- YYECNQZSIZUXAI-SVRRBLITSA-N (2s,4s)-2-amino-4-(furan-2-ylmethyl)pentanedioic acid Chemical compound OC(=O)[C@@H](N)C[C@H](C(O)=O)CC1=CC=CO1 YYECNQZSIZUXAI-SVRRBLITSA-N 0.000 description 1
- YDWIUFASTTZKNI-KBPBESRZSA-N (2s,4s)-2-amino-4-(naphthalen-2-ylmethyl)pentanedioic acid Chemical compound C1=CC=CC2=CC(C[C@@H](C[C@H](N)C(O)=O)C(O)=O)=CC=C21 YDWIUFASTTZKNI-KBPBESRZSA-N 0.000 description 1
- RJUNCMAQAGYVHI-IUCAKERBSA-N (2s,4s)-2-amino-4-(pyridin-4-ylmethyl)pentanedioic acid Chemical compound OC(=O)[C@@H](N)C[C@@H](C(O)=O)CC1=CC=NC=C1 RJUNCMAQAGYVHI-IUCAKERBSA-N 0.000 description 1
- SYKFASMHVYADIW-ONGXEEELSA-N (2s,4s)-2-amino-4-[(4-methoxyphenyl)methyl]pentanedioic acid Chemical compound COC1=CC=C(C[C@@H](C[C@H](N)C(O)=O)C(O)=O)C=C1 SYKFASMHVYADIW-ONGXEEELSA-N 0.000 description 1
- ATCFYQUZTYQTJN-UWVGGRQHSA-N (2s,4s)-2-amino-4-benzylpentanedioic acid Chemical compound OC(=O)[C@@H](N)C[C@@H](C(O)=O)CC1=CC=CC=C1 ATCFYQUZTYQTJN-UWVGGRQHSA-N 0.000 description 1
- IMGQZBSGZRAKSV-BQBZGAKWSA-N (2s,4s)-2-amino-4-butylpentanedioic acid Chemical compound CCCC[C@H](C(O)=O)C[C@H](N)C(O)=O IMGQZBSGZRAKSV-BQBZGAKWSA-N 0.000 description 1
- KRKRAOXTGDJWNI-IMJSIDKUSA-N (2s,4s)-2-amino-4-methylpentanedioic acid Chemical compound OC(=O)[C@@H](C)C[C@H](N)C(O)=O KRKRAOXTGDJWNI-IMJSIDKUSA-N 0.000 description 1
- NAALWFYYHHJEFQ-ZASNTINBSA-N (2s,5r,6r)-6-[[(2r)-2-[[6-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]-2-oxo-1h-pyridine-3-carbonyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@@H](C(=O)N[C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C=1C=CC(O)=CC=1)C(=O)C(C(N1)=O)=CC=C1C1=CC=C(S(=O)(=O)N(CCO)CCO)C=C1 NAALWFYYHHJEFQ-ZASNTINBSA-N 0.000 description 1
- PVSUXIJGHWZIJA-UHFFFAOYSA-N (4-carbonochloridoyloxyphenyl) carbonochloridate Chemical compound ClC(=O)OC1=CC=C(OC(Cl)=O)C=C1 PVSUXIJGHWZIJA-UHFFFAOYSA-N 0.000 description 1
- OISWSEUSVGRNBE-UHFFFAOYSA-N (4-fluorophenyl)-pyridin-3-ylmethanone Chemical compound C1=CC(F)=CC=C1C(=O)C1=CC=CN=C1 OISWSEUSVGRNBE-UHFFFAOYSA-N 0.000 description 1
- HDVPVAJBJJYYBO-BYPYZUCNSA-N (4s)-4-amino-2,2-dimethylpentanedioic acid Chemical compound OC(=O)C(C)(C)C[C@H](N)C(O)=O HDVPVAJBJJYYBO-BYPYZUCNSA-N 0.000 description 1
- NMDLEWKKKQGPCX-BUHFOSPRSA-N (E)-2,3-diphenylbut-2-enedioyl dichloride Chemical compound C=1C=CC=CC=1/C(C(=O)Cl)=C(\C(Cl)=O)C1=CC=CC=C1 NMDLEWKKKQGPCX-BUHFOSPRSA-N 0.000 description 1
- XDEFUBWPXAOAME-OWOJBTEDSA-N (e)-2,6-diaminohex-4-enoic acid Chemical compound NC\C=C\CC(N)C(O)=O XDEFUBWPXAOAME-OWOJBTEDSA-N 0.000 description 1
- BDFLKCVQYHNFGZ-OWOJBTEDSA-N (e)-2-amino-4-piperidin-4-ylbut-3-enoic acid Chemical compound OC(=O)C(N)\C=C\C1CCNCC1 BDFLKCVQYHNFGZ-OWOJBTEDSA-N 0.000 description 1
- WQZLRZFBCIUDFL-KQQUZDAGSA-N (e)-3-[4-[(e)-3-chloro-3-oxoprop-1-enyl]phenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=C(\C=C\C(Cl)=O)C=C1 WQZLRZFBCIUDFL-KQQUZDAGSA-N 0.000 description 1
- ZLYYJUJDFKGVKB-OWOJBTEDSA-N (e)-but-2-enedioyl dichloride Chemical compound ClC(=O)\C=C\C(Cl)=O ZLYYJUJDFKGVKB-OWOJBTEDSA-N 0.000 description 1
- DAUYJKPALFCOPR-OWOJBTEDSA-N (e)-oct-4-enedioyl dichloride Chemical compound ClC(=O)CC\C=C\CCC(Cl)=O DAUYJKPALFCOPR-OWOJBTEDSA-N 0.000 description 1
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 1
- CMUHFUGDYMFHEI-UHFFFAOYSA-N -2-Amino-3-94-aminophenyl)propanoic acid Natural products OC(=O)C(N)CC1=CC=C(N)C=C1 CMUHFUGDYMFHEI-UHFFFAOYSA-N 0.000 description 1
- KNVMLYXDZUGCQJ-UHFFFAOYSA-N 1,1,2,2-tetrafluoroethanesulfonyl chloride Chemical compound FC(F)C(F)(F)S(Cl)(=O)=O KNVMLYXDZUGCQJ-UHFFFAOYSA-N 0.000 description 1
- QFCMBRXRVQRSSF-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole Chemical compound C1NCC2CNCC21 QFCMBRXRVQRSSF-UHFFFAOYSA-N 0.000 description 1
- XVBWSIVJQVABMM-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydro-2,7-naphthyridine Chemical compound C1CNCC2CNCCC21 XVBWSIVJQVABMM-UHFFFAOYSA-N 0.000 description 1
- ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- 125000004958 1,4-naphthylene group Chemical group 0.000 description 1
- VQFZKDXSJZVGDA-UHFFFAOYSA-N 1,5,9-triazacyclododecane Chemical compound C1CNCCCNCCCNC1 VQFZKDXSJZVGDA-UHFFFAOYSA-N 0.000 description 1
- HTSQWLLKIZBMEO-UHFFFAOYSA-N 1,5-diazocane Chemical compound C1CNCCCNC1 HTSQWLLKIZBMEO-UHFFFAOYSA-N 0.000 description 1
- BOGILKOPDDCGBY-UHFFFAOYSA-N 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-ol Chemical compound C1NCC2(C)CNCC1(C)C2O BOGILKOPDDCGBY-UHFFFAOYSA-N 0.000 description 1
- VAXDAORNOMZREO-UHFFFAOYSA-N 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one Chemical compound C1NCC2(C)CNCC1(C)C2=O VAXDAORNOMZREO-UHFFFAOYSA-N 0.000 description 1
- PWJHXHMUGFXPSN-UHFFFAOYSA-N 1,7-dioxa-4,10-diazacyclododecane Chemical compound C1COCCNCCOCCN1 PWJHXHMUGFXPSN-UHFFFAOYSA-N 0.000 description 1
- MINRBGSAWNFXPX-UHFFFAOYSA-N 1-(2-carbonochloridoylnaphthalen-1-yl)naphthalene-2-carbonyl chloride Chemical compound C1=CC=C2C(C3=C4C=CC=CC4=CC=C3C(=O)Cl)=C(C(Cl)=O)C=CC2=C1 MINRBGSAWNFXPX-UHFFFAOYSA-N 0.000 description 1
- XDHVNMPVLPEHND-UHFFFAOYSA-N 1-(2-piperazin-1-ylethyl)piperazine Chemical compound C1CNCCN1CCN1CCNCC1 XDHVNMPVLPEHND-UHFFFAOYSA-N 0.000 description 1
- RUZHGFVEMQGCAW-UHFFFAOYSA-N 1-(azetidin-3-yl)-n-methylmethanamine Chemical compound CNCC1CNC1 RUZHGFVEMQGCAW-UHFFFAOYSA-N 0.000 description 1
- KNSHLWJBSDBBRH-VPRNBBMASA-N 1-[(r)-amino(carboxy)methyl]bicyclo[1.1.1]pentane-3-carboxylic acid Chemical compound C1C2(C(O)=O)CC1([C@H](C(O)=O)N)C2 KNSHLWJBSDBBRH-VPRNBBMASA-N 0.000 description 1
- HKIAQNGTVHKSQI-UHFFFAOYSA-N 1-benzylpyrazole-3,5-dicarbonyl chloride Chemical compound N1=C(C(=O)Cl)C=C(C(Cl)=O)N1CC1=CC=CC=C1 HKIAQNGTVHKSQI-UHFFFAOYSA-N 0.000 description 1
- FXHRAKUEZPSMLJ-UHFFFAOYSA-N 1-methyl-1,4-diazepane Chemical compound CN1CCCNCC1 FXHRAKUEZPSMLJ-UHFFFAOYSA-N 0.000 description 1
- WZTRWLPTZOWHGR-UHFFFAOYSA-N 1-methylpyrazole-3,4-dicarbonyl chloride Chemical compound CN1C=C(C(Cl)=O)C(C(Cl)=O)=N1 WZTRWLPTZOWHGR-UHFFFAOYSA-N 0.000 description 1
- VHRSUDSXCMQTMA-UHFFFAOYSA-N 11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthren-3-one Chemical compound CC12C=CC(=O)C=C1C(C)CC1C2C(O)CC2(C)C(O)(C(=O)CO)CCC21 VHRSUDSXCMQTMA-UHFFFAOYSA-N 0.000 description 1
- FUFLCEKSBBHCMO-UHFFFAOYSA-N 11-dehydrocorticosterone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 FUFLCEKSBBHCMO-UHFFFAOYSA-N 0.000 description 1
- NMIZONYLXCOHEF-UHFFFAOYSA-N 1h-imidazole-2-carboxamide Chemical compound NC(=O)C1=NC=CN1 NMIZONYLXCOHEF-UHFFFAOYSA-N 0.000 description 1
- LWKAJCQFOSUAQQ-UHFFFAOYSA-N 1h-indole-3,5-dicarbonyl chloride Chemical compound C1=C(C(Cl)=O)C=C2C(C(=O)Cl)=CNC2=C1 LWKAJCQFOSUAQQ-UHFFFAOYSA-N 0.000 description 1
- WMMMGSYFLSOOIK-UHFFFAOYSA-N 1h-pyrazole-3,5-dicarbonyl chloride Chemical compound ClC(=O)C=1C=C(C(Cl)=O)NN=1 WMMMGSYFLSOOIK-UHFFFAOYSA-N 0.000 description 1
- COEFVLAKIGYGHD-UHFFFAOYSA-N 1h-pyrazole-4,5-dicarbonyl chloride Chemical compound ClC(=O)C=1C=NNC=1C(Cl)=O COEFVLAKIGYGHD-UHFFFAOYSA-N 0.000 description 1
- QHMPADKXXHRBCB-UHFFFAOYSA-N 2,2,2-trifluoro-n-(pyrrolidin-3-ylmethyl)ethanamine Chemical compound FC(F)(F)CNCC1CCNC1 QHMPADKXXHRBCB-UHFFFAOYSA-N 0.000 description 1
- QOLALWJWCONGMG-UHFFFAOYSA-N 2,2,3,3,4,4-hexafluoropentanedioyl dichloride Chemical compound ClC(=O)C(F)(F)C(F)(F)C(F)(F)C(Cl)=O QOLALWJWCONGMG-UHFFFAOYSA-N 0.000 description 1
- XCSFZFHJQXODPO-UHFFFAOYSA-N 2,2,3,3-tetrafluorobutanedioyl dichloride Chemical compound ClC(=O)C(F)(F)C(F)(F)C(Cl)=O XCSFZFHJQXODPO-UHFFFAOYSA-N 0.000 description 1
- MAEDLSNGVQYGPK-UHFFFAOYSA-N 2,2-diaminoacetic acid Chemical compound NC(N)C(O)=O MAEDLSNGVQYGPK-UHFFFAOYSA-N 0.000 description 1
- WBKXOLKOAFPWRR-UHFFFAOYSA-N 2,2-dimethylpentanedioyl dichloride Chemical compound ClC(=O)C(C)(C)CCC(Cl)=O WBKXOLKOAFPWRR-UHFFFAOYSA-N 0.000 description 1
- DDHUNHGZUHZNKB-UHFFFAOYSA-N 2,2-dimethylpropane-1,3-diamine Chemical compound NCC(C)(C)CN DDHUNHGZUHZNKB-UHFFFAOYSA-N 0.000 description 1
- CJXQAYQWVNXIQE-UHFFFAOYSA-N 2,2-dimethylpropanedioyl dichloride Chemical compound ClC(=O)C(C)(C)C(Cl)=O CJXQAYQWVNXIQE-UHFFFAOYSA-N 0.000 description 1
- YJIRZJAZKDWEIJ-UHFFFAOYSA-N 2,3,5,6-tetrachlorobenzene-1,4-dicarbonyl chloride Chemical compound ClC(=O)C1=C(Cl)C(Cl)=C(C(Cl)=O)C(Cl)=C1Cl YJIRZJAZKDWEIJ-UHFFFAOYSA-N 0.000 description 1
- UXKJBCJIXQSFLK-UHFFFAOYSA-N 2,3-dihydro-1h-indene-4,6-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC(S(=O)(=O)Cl)=CC2=C1CCC2 UXKJBCJIXQSFLK-UHFFFAOYSA-N 0.000 description 1
- GIXSAEKHVBJLRY-UHFFFAOYSA-N 2,3-dihydro-1h-pyrrolo[2,3-b]pyridin-5-ylmethanamine Chemical compound NCC1=CN=C2NCCC2=C1 GIXSAEKHVBJLRY-UHFFFAOYSA-N 0.000 description 1
- YEYQIYAYJJXKFB-UHFFFAOYSA-N 2,4,5,6-tetramethylbenzene-1,3-disulfonyl chloride Chemical compound CC1=C(C)C(S(Cl)(=O)=O)=C(C)C(S(Cl)(=O)=O)=C1C YEYQIYAYJJXKFB-UHFFFAOYSA-N 0.000 description 1
- LNXKRGBQKLXFTB-UHFFFAOYSA-N 2,4,6-trimethylbenzene-1,3-disulfonyl chloride Chemical compound CC1=CC(C)=C(S(Cl)(=O)=O)C(C)=C1S(Cl)(=O)=O LNXKRGBQKLXFTB-UHFFFAOYSA-N 0.000 description 1
- HILHCIBEZCWKBD-UHFFFAOYSA-N 2,6-diamino-5-fluorohexanoic acid Chemical compound NCC(F)CCC(N)C(O)=O HILHCIBEZCWKBD-UHFFFAOYSA-N 0.000 description 1
- BCDGPDCQBUYTMH-UHFFFAOYSA-N 2,8-diazaspiro[5.5]undecane Chemical compound C1CCNCC21CNCCC2 BCDGPDCQBUYTMH-UHFFFAOYSA-N 0.000 description 1
- XFSAZBKSWGOXRH-UHFFFAOYSA-N 2-(2-carbonochloridoyloxyethoxy)ethyl carbonochloridate Chemical compound ClC(=O)OCCOCCOC(Cl)=O XFSAZBKSWGOXRH-UHFFFAOYSA-N 0.000 description 1
- UJWRDCOHQICLFL-UHFFFAOYSA-N 2-(2-carbonochloridoylphenyl)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C1=CC=CC=C1C(Cl)=O UJWRDCOHQICLFL-UHFFFAOYSA-N 0.000 description 1
- GTZXSBQCNBNWPK-UHFFFAOYSA-N 2-(2-chloro-2-oxoethoxy)acetyl chloride Chemical compound ClC(=O)COCC(Cl)=O GTZXSBQCNBNWPK-UHFFFAOYSA-N 0.000 description 1
- OYIFNHCXNCRBQI-UHFFFAOYSA-N 2-Aminohexanedioic acid Natural products OC(=O)C(N)CCCC(O)=O OYIFNHCXNCRBQI-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- LUZDVETZMCFYMR-QMMMGPOBSA-N 2-[(2s)-2-amino-2-carboxyethyl]indazole-6-carboxylic acid Chemical compound C1=CC(C(O)=O)=CC2=NN(C[C@H](N)C(O)=O)C=C21 LUZDVETZMCFYMR-QMMMGPOBSA-N 0.000 description 1
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 1
- CQWXKASOCUAEOW-UHFFFAOYSA-N 2-[2-(carboxymethoxy)ethoxy]acetic acid Chemical compound OC(=O)COCCOCC(O)=O CQWXKASOCUAEOW-UHFFFAOYSA-N 0.000 description 1
- HJZZQNLKBWJYPD-UHFFFAOYSA-N 2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]acetic acid Chemical compound OC(=O)COCCOCCOCC(O)=O HJZZQNLKBWJYPD-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- JZPGURKWXUBQLP-UHFFFAOYSA-N 2-[[2-(2-methylpropylsulfanyl)-1,3-benzothiazol-6-yl]iminomethyl]phenol Chemical compound CC(C)CSC1=NC2=C(S1)C=C(C=C2)N=CC3=CC=CC=C3O JZPGURKWXUBQLP-UHFFFAOYSA-N 0.000 description 1
- UUIYULWYHDSXHL-NSHDSACASA-N 2-[[3-[(2s)-2-amino-2-carboxyethyl]-2,6-dioxopyrimidin-1-yl]methyl]benzoic acid Chemical compound O=C1N(C[C@H](N)C(O)=O)C=CC(=O)N1CC1=CC=CC=C1C(O)=O UUIYULWYHDSXHL-NSHDSACASA-N 0.000 description 1
- HZEJBGVIAXRMKT-NSHDSACASA-N 2-[[3-[(2s)-2-amino-2-carboxyethyl]-5-iodo-2,6-dioxopyrimidin-1-yl]methyl]benzoic acid Chemical compound O=C1N(C[C@H](N)C(O)=O)C=C(I)C(=O)N1CC1=CC=CC=C1C(O)=O HZEJBGVIAXRMKT-NSHDSACASA-N 0.000 description 1
- WXHLLJAMBQLULT-UHFFFAOYSA-N 2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-n-(2-methyl-6-sulfanylphenyl)-1,3-thiazole-5-carboxamide;hydrate Chemical compound O.C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1S WXHLLJAMBQLULT-UHFFFAOYSA-N 0.000 description 1
- CDCVEEXKOMDRGS-UHFFFAOYSA-N 2-[amino(carboxy)methyl]benzoic acid Chemical compound OC(=O)C(N)C1=CC=CC=C1C(O)=O CDCVEEXKOMDRGS-UHFFFAOYSA-N 0.000 description 1
- ORPZZYZKWRXDCT-UHFFFAOYSA-N 2-amino-2-piperidin-2-ylacetic acid Chemical compound OC(=O)C(N)C1CCCCN1 ORPZZYZKWRXDCT-UHFFFAOYSA-N 0.000 description 1
- BGFDMHHFMROQOA-UHFFFAOYSA-N 2-amino-2-pyrrolidin-2-ylacetic acid Chemical compound OC(=O)C(N)C1CCCN1 BGFDMHHFMROQOA-UHFFFAOYSA-N 0.000 description 1
- AFCSEXJCAXIMJK-UHFFFAOYSA-N 2-amino-2-pyrrolidin-3-ylacetic acid Chemical compound OC(=O)C(N)C1CCNC1 AFCSEXJCAXIMJK-UHFFFAOYSA-N 0.000 description 1
- AGMLJNZIOWDFTD-UHFFFAOYSA-N 2-amino-3-(1-aminopyrrolidin-2-yl)propanoic acid Chemical compound OC(=O)C(N)CC1CCCN1N AGMLJNZIOWDFTD-UHFFFAOYSA-N 0.000 description 1
- RQSLVUXFEBDNKW-UHFFFAOYSA-N 2-amino-3-(2,3-dihydro-1h-indol-7-yl)propanoic acid Chemical compound OC(=O)C(N)CC1=CC=CC2=C1NCC2 RQSLVUXFEBDNKW-UHFFFAOYSA-N 0.000 description 1
- MMFFNBUNVIZDKW-UHFFFAOYSA-N 2-amino-3-(2-amino-1h-indol-3-yl)propanoic acid Chemical compound C1=CC=C2C(CC(N)C(O)=O)=C(N)NC2=C1 MMFFNBUNVIZDKW-UHFFFAOYSA-N 0.000 description 1
- IMOMDHQIWDULSX-UHFFFAOYSA-N 2-amino-3-(2-amino-5-chlorophenyl)propanoic acid Chemical compound OC(=O)C(N)CC1=CC(Cl)=CC=C1N IMOMDHQIWDULSX-UHFFFAOYSA-N 0.000 description 1
- QRDYVVJFGUOGFA-UHFFFAOYSA-N 2-amino-3-(2-amino-5-iodopyridin-3-yl)propanoic acid Chemical compound OC(=O)C(N)CC1=CC(I)=CN=C1N QRDYVVJFGUOGFA-UHFFFAOYSA-N 0.000 description 1
- YHPRKRDBTQXGSQ-UHFFFAOYSA-N 2-amino-3-(2-aminopyridin-3-yl)propanoic acid Chemical compound OC(=O)C(N)CC1=CC=CN=C1N YHPRKRDBTQXGSQ-UHFFFAOYSA-N 0.000 description 1
- FTJNUKPPWFTTBK-UHFFFAOYSA-N 2-amino-3-(2-aminopyrimidin-5-yl)propanoic acid Chemical compound OC(=O)C(N)CC1=CN=C(N)N=C1 FTJNUKPPWFTTBK-UHFFFAOYSA-N 0.000 description 1
- KZTTXYUSWAKOOM-UHFFFAOYSA-N 2-amino-3-(2-piperazin-1-ylphenyl)propanoic acid Chemical compound OC(=O)C(N)CC1=CC=CC=C1N1CCNCC1 KZTTXYUSWAKOOM-UHFFFAOYSA-N 0.000 description 1
- KEKQBWDMEBAYNY-UHFFFAOYSA-N 2-amino-3-(3-aminonaphthalen-2-yl)propanoic acid Chemical compound C1=CC=C2C=C(N)C(CC(N)C(O)=O)=CC2=C1 KEKQBWDMEBAYNY-UHFFFAOYSA-N 0.000 description 1
- VZNMTPFGOBFUJM-UHFFFAOYSA-N 2-amino-3-(4-amino-2,6-dichlorophenyl)propanoic acid Chemical compound OC(=O)C(N)CC1=C(Cl)C=C(N)C=C1Cl VZNMTPFGOBFUJM-UHFFFAOYSA-N 0.000 description 1
- GXXBFBQEFJPZRY-UHFFFAOYSA-N 2-amino-3-(4-amino-5-methylpyridin-3-yl)propanoic acid Chemical compound CC1=CN=CC(CC(N)C(O)=O)=C1N GXXBFBQEFJPZRY-UHFFFAOYSA-N 0.000 description 1
- MAKIXRNAHYESGF-UHFFFAOYSA-N 2-amino-3-(4-aminopyridin-3-yl)propanoic acid Chemical compound OC(=O)C(N)CC1=CN=CC=C1N MAKIXRNAHYESGF-UHFFFAOYSA-N 0.000 description 1
- IIDQBUPOQMTSDY-UHFFFAOYSA-N 2-amino-3-(4-piperazin-1-ylphenyl)propanoic acid Chemical compound C1=CC(CC(N)C(O)=O)=CC=C1N1CCNCC1 IIDQBUPOQMTSDY-UHFFFAOYSA-N 0.000 description 1
- ZYPGSVLZOKMZDE-UHFFFAOYSA-N 2-amino-3-[4-(aminomethyl)cyclohexyl]propanoic acid Chemical compound NCC1CCC(CC(N)C(O)=O)CC1 ZYPGSVLZOKMZDE-UHFFFAOYSA-N 0.000 description 1
- GCKHCMMDWJZKBQ-UHFFFAOYSA-N 2-amino-3-piperazin-1-ylpropanoic acid Chemical compound OC(=O)C(N)CN1CCNCC1 GCKHCMMDWJZKBQ-UHFFFAOYSA-N 0.000 description 1
- AILXJKZQVKUGKI-UHFFFAOYSA-N 2-amino-3-piperidin-2-ylpropanoic acid Chemical compound OC(=O)C(N)CC1CCCCN1 AILXJKZQVKUGKI-UHFFFAOYSA-N 0.000 description 1
- BKQGYYLJOJLDMS-UHFFFAOYSA-N 2-amino-3-piperidin-3-ylpropanoic acid Chemical compound OC(=O)C(N)CC1CCCNC1 BKQGYYLJOJLDMS-UHFFFAOYSA-N 0.000 description 1
- VVDNQYDGDFYGMM-UHFFFAOYSA-N 2-amino-3-piperidin-4-ylpropanoic acid Chemical compound OC(=O)C(N)CC1CCNCC1 VVDNQYDGDFYGMM-UHFFFAOYSA-N 0.000 description 1
- OITHYNKCAWXFRR-UHFFFAOYSA-N 2-benzylbutanedioyl dichloride Chemical compound ClC(=O)CC(C(Cl)=O)CC1=CC=CC=C1 OITHYNKCAWXFRR-UHFFFAOYSA-N 0.000 description 1
- ZGKHHCNVAMHURP-UHFFFAOYSA-N 2-bromobenzene-1,4-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C(Br)=C1 ZGKHHCNVAMHURP-UHFFFAOYSA-N 0.000 description 1
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 1
- IPOVOSHRRIJKBR-UHFFFAOYSA-N 2-ethylpropanedioyl dichloride Chemical compound CCC(C(Cl)=O)C(Cl)=O IPOVOSHRRIJKBR-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000000850 2H-chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001698 2H-pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- BKIVSMMFLXICDE-UHFFFAOYSA-N 2h-triazole-4,5-dicarbonyl chloride Chemical compound ClC(=O)C=1N=NNC=1C(Cl)=O BKIVSMMFLXICDE-UHFFFAOYSA-N 0.000 description 1
- XVHVEMJNJDESBO-UHFFFAOYSA-N 3,7-dimethyl-3,7-diazabicyclo[3.3.1]nonane Chemical compound C1C2CN(C)CC1CN(C)C2 XVHVEMJNJDESBO-UHFFFAOYSA-N 0.000 description 1
- ZGNWRMCXFGIMCP-UHFFFAOYSA-N 3-(2-amino-2-carboxyethyl)pyrrolidine-1-carboxylic acid Chemical compound OC(=O)C(N)CC1CCN(C(O)=O)C1 ZGNWRMCXFGIMCP-UHFFFAOYSA-N 0.000 description 1
- KRPRVQWGKLEFKN-UHFFFAOYSA-N 3-(3-aminopropoxy)propan-1-amine Chemical compound NCCCOCCCN KRPRVQWGKLEFKN-UHFFFAOYSA-N 0.000 description 1
- JCIFZSCARAOKME-UHFFFAOYSA-N 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(S(=O)(=O)C=2C=C(C=CC=2)S(Cl)(=O)=O)=C1 JCIFZSCARAOKME-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- ZNLYVNWXRJEZDN-UHFFFAOYSA-N 3-(6-aminopurin-9-yl)-2-azaniumylpropanoate Chemical compound N1=CN=C2N(CC(N)C(O)=O)C=NC2=C1N ZNLYVNWXRJEZDN-UHFFFAOYSA-N 0.000 description 1
- USJGCZUFFGVFMY-UHFFFAOYSA-N 3-(pentylamino)propanenitrile Chemical compound CCCCCNCCC#N USJGCZUFFGVFMY-UHFFFAOYSA-N 0.000 description 1
- JMWHYRPOCSZQQH-QMMMGPOBSA-N 3-[(2s)-2-amino-2-carboxyethyl]-1h-indole-4-carboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(C[C@H](N)C(O)=O)=CNC2=C1 JMWHYRPOCSZQQH-QMMMGPOBSA-N 0.000 description 1
- JANONUPBHGWOBP-QMMMGPOBSA-N 3-[(2s)-2-amino-2-carboxyethyl]benzoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(C(O)=O)=C1 JANONUPBHGWOBP-QMMMGPOBSA-N 0.000 description 1
- POTQBGGWSWSMCX-UHFFFAOYSA-N 3-[2-(3-aminopropoxy)ethoxy]propan-1-amine Chemical compound NCCCOCCOCCCN POTQBGGWSWSMCX-UHFFFAOYSA-N 0.000 description 1
- ACQBZZRBYWWWTC-UHFFFAOYSA-N 3-[2-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]propan-1-amine Chemical compound NCCCOCCOCCOCCOCCOCCCN ACQBZZRBYWWWTC-UHFFFAOYSA-N 0.000 description 1
- FMZHYPYMCCZVCA-UHFFFAOYSA-N 3-[4-(3-aminophenyl)buta-1,3-diynyl]aniline Chemical compound NC1=CC=CC(C#CC#CC=2C=C(N)C=CC=2)=C1 FMZHYPYMCCZVCA-UHFFFAOYSA-N 0.000 description 1
- XAIAPTZFAFAHGA-UHFFFAOYSA-N 3-[amino(carboxy)methyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid Chemical compound CC1(C)C(C(N)C(O)=O)CCC1(C)C(O)=O XAIAPTZFAFAHGA-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 1
- CLBYHEINQDKWJN-UHFFFAOYSA-N 4,5-dibromobenzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC(Br)=C(Br)C=C1C(Cl)=O CLBYHEINQDKWJN-UHFFFAOYSA-N 0.000 description 1
- DELKNGSNILXDSN-UHFFFAOYSA-N 4,5-dichlorobenzene-1,3-disulfonyl chloride Chemical compound ClC1=CC(S(Cl)(=O)=O)=CC(S(Cl)(=O)=O)=C1Cl DELKNGSNILXDSN-UHFFFAOYSA-N 0.000 description 1
- SDKJJAKGOABBBD-UHFFFAOYSA-N 4,6-dimethoxybenzene-1,3-disulfonyl chloride Chemical compound COC1=CC(OC)=C(S(Cl)(=O)=O)C=C1S(Cl)(=O)=O SDKJJAKGOABBBD-UHFFFAOYSA-N 0.000 description 1
- OSUWBBMPVXVSOA-UHFFFAOYSA-N 4-(4-carbonochloridoylphenoxy)benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1OC1=CC=C(C(Cl)=O)C=C1 OSUWBBMPVXVSOA-UHFFFAOYSA-N 0.000 description 1
- QDBOAKPEXMMQFO-UHFFFAOYSA-N 4-(4-carbonochloridoylphenyl)benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=CC=C(C(Cl)=O)C=C1 QDBOAKPEXMMQFO-UHFFFAOYSA-N 0.000 description 1
- HJKXLQIPODSWMB-UHFFFAOYSA-N 4-(4-chlorosulfonylphenoxy)benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1OC1=CC=C(S(Cl)(=O)=O)C=C1 HJKXLQIPODSWMB-UHFFFAOYSA-N 0.000 description 1
- OTFAWEIFBPUXOH-UHFFFAOYSA-N 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1C1=CC=C(S(Cl)(=O)=O)C=C1 OTFAWEIFBPUXOH-UHFFFAOYSA-N 0.000 description 1
- YXDGRBPZVQPESQ-QMMMGPOBSA-N 4-[(2s)-2-amino-2-carboxyethyl]benzoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(O)=O)C=C1 YXDGRBPZVQPESQ-QMMMGPOBSA-N 0.000 description 1
- ASOXKYGOZZTVHL-UHFFFAOYSA-N 4-[(4-carbonochloridoylphenyl)diazenyl]benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1N=NC1=CC=C(C(Cl)=O)C=C1 ASOXKYGOZZTVHL-UHFFFAOYSA-N 0.000 description 1
- VUKZJNCBRXLCAA-UHFFFAOYSA-N 4-[(4-chlorosulfonylphenyl)disulfanyl]benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1SSC1=CC=C(S(Cl)(=O)=O)C=C1 VUKZJNCBRXLCAA-UHFFFAOYSA-N 0.000 description 1
- YKMMQCFZCFAHOU-UHFFFAOYSA-N 4-[(4-chlorosulfonylphenyl)methyl]benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1CC1=CC=C(S(Cl)(=O)=O)C=C1 YKMMQCFZCFAHOU-UHFFFAOYSA-N 0.000 description 1
- MTWIGIULKNYUBS-VIFPVBQESA-N 4-[(4s)-4-amino-4-carboxybutanoyl]oxybenzoic acid Chemical compound OC(=O)[C@@H](N)CCC(=O)OC1=CC=C(C(O)=O)C=C1 MTWIGIULKNYUBS-VIFPVBQESA-N 0.000 description 1
- RXWNCPQKMXQDHN-LBPRGKRZSA-N 4-[(isopropylamino)methyl]phenylalanine Chemical compound CC(C)NCC1=CC=C(C[C@H](N)C(O)=O)C=C1 RXWNCPQKMXQDHN-LBPRGKRZSA-N 0.000 description 1
- SGIKDIUCJAUSRD-MRVPVSSYSA-N 4-[(r)-amino(carboxy)methyl]-3-methylbenzoic acid Chemical compound CC1=CC(C(O)=O)=CC=C1[C@@H](N)C(O)=O SGIKDIUCJAUSRD-MRVPVSSYSA-N 0.000 description 1
- VTMJKPGFERYGJF-ZETCQYMHSA-N 4-[(s)-amino(carboxy)methyl]benzoic acid Chemical compound OC(=O)[C@@H](N)C1=CC=C(C(O)=O)C=C1 VTMJKPGFERYGJF-ZETCQYMHSA-N 0.000 description 1
- WAUKJWLKPXRNKT-UHFFFAOYSA-N 4-[2-(4-aminophenyl)ethynyl]aniline Chemical compound C1=CC(N)=CC=C1C#CC1=CC=C(N)C=C1 WAUKJWLKPXRNKT-UHFFFAOYSA-N 0.000 description 1
- UDMCJPZFZOSZSL-UHFFFAOYSA-N 4-[2-(bromomethyl)-5-(4-chlorosulfonylphenyl)-1,3-oxazol-4-yl]benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1C1=C(C=2C=CC(=CC=2)S(Cl)(=O)=O)OC(CBr)=N1 UDMCJPZFZOSZSL-UHFFFAOYSA-N 0.000 description 1
- FIRWMVTUTOVUMQ-UHFFFAOYSA-N 4-[5-(4-chlorosulfonylphenyl)-2-methyl-1,3-oxazol-4-yl]benzenesulfonyl chloride Chemical compound O1C(C)=NC(C=2C=CC(=CC=2)S(Cl)(=O)=O)=C1C1=CC=C(S(Cl)(=O)=O)C=C1 FIRWMVTUTOVUMQ-UHFFFAOYSA-N 0.000 description 1
- ZHSKUOZOLHMKEA-UHFFFAOYSA-N 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid;hydron;chloride Chemical compound Cl.ClCCN(CCCl)C1=CC=C2N(C)C(CCCC(O)=O)=NC2=C1 ZHSKUOZOLHMKEA-UHFFFAOYSA-N 0.000 description 1
- LLRDKDQMMRICLM-UHFFFAOYSA-N 4-amino-2,2-difluoropentanedioic acid Chemical compound OC(=O)C(N)CC(F)(F)C(O)=O LLRDKDQMMRICLM-UHFFFAOYSA-N 0.000 description 1
- YIZXGHNDQUYDDF-UHFFFAOYSA-N 4-amino-6-chlorobenzene-1,3-disulfonyl chloride Chemical compound NC1=CC(Cl)=C(S(Cl)(=O)=O)C=C1S(Cl)(=O)=O YIZXGHNDQUYDDF-UHFFFAOYSA-N 0.000 description 1
- CMUHFUGDYMFHEI-QMMMGPOBSA-N 4-amino-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N)C=C1 CMUHFUGDYMFHEI-QMMMGPOBSA-N 0.000 description 1
- MSEOVNVYIVMELF-UHFFFAOYSA-N 4-bromobenzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=C(Br)C(C(Cl)=O)=C1 MSEOVNVYIVMELF-UHFFFAOYSA-N 0.000 description 1
- AUKORMQZRYQYGI-UHFFFAOYSA-N 4-carbonochloridoyloxybutyl carbonochloridate Chemical compound ClC(=O)OCCCCOC(Cl)=O AUKORMQZRYQYGI-UHFFFAOYSA-N 0.000 description 1
- MBJBMJXGDNPADH-UHFFFAOYSA-N 4-chloro-6-hydroxybenzene-1,3-disulfonyl chloride Chemical compound OC1=CC(Cl)=C(S(Cl)(=O)=O)C=C1S(Cl)(=O)=O MBJBMJXGDNPADH-UHFFFAOYSA-N 0.000 description 1
- FKPCRVTXBLUQBV-UHFFFAOYSA-N 4-methoxybenzene-1,3-dicarbonyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1C(Cl)=O FKPCRVTXBLUQBV-UHFFFAOYSA-N 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- SYYWIJFVJZJQMX-UHFFFAOYSA-N 4-methyl-1,3-thiazole-2,5-dicarbonyl chloride Chemical compound CC=1N=C(C(Cl)=O)SC=1C(Cl)=O SYYWIJFVJZJQMX-UHFFFAOYSA-N 0.000 description 1
- CLMMQDZNOXYEBU-UHFFFAOYSA-N 4-methylbenzene-1,3-disulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1S(Cl)(=O)=O CLMMQDZNOXYEBU-UHFFFAOYSA-N 0.000 description 1
- QTQGHKVYLQBJLO-UHFFFAOYSA-N 4-methylbenzenesulfonate;(4-methyl-1-oxo-1-phenylmethoxypentan-2-yl)azanium Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.CC(C)CC(N)C(=O)OCC1=CC=CC=C1 QTQGHKVYLQBJLO-UHFFFAOYSA-N 0.000 description 1
- PRNRUOJLUPUJDN-UHFFFAOYSA-N 4-piperidin-4-ylpiperidine Chemical compound C1CNCCC1C1CCNCC1 PRNRUOJLUPUJDN-UHFFFAOYSA-N 0.000 description 1
- 125000001826 4H-pyranyl group Chemical group O1C(=CCC=C1)* 0.000 description 1
- KOMWRBFEDDEWEP-UHFFFAOYSA-N 5-[amino(carboxy)methyl]-4-methyl-2-thiophenecarboxylic acid Chemical compound CC=1C=C(C(O)=O)SC=1C(N)C(O)=O KOMWRBFEDDEWEP-UHFFFAOYSA-N 0.000 description 1
- FBJVWRITWDYUAC-UHFFFAOYSA-N 5-amino-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I FBJVWRITWDYUAC-UHFFFAOYSA-N 0.000 description 1
- WJXXCTSBMNYHHS-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarbonyl chloride Chemical compound NC1=CC(C(Cl)=O)=CC(C(Cl)=O)=C1 WJXXCTSBMNYHHS-UHFFFAOYSA-N 0.000 description 1
- RJMGUEXGQXNUBI-UHFFFAOYSA-N 5-chloro-4-hydroxybenzene-1,3-disulfonyl chloride Chemical compound OC1=C(Cl)C=C(S(Cl)(=O)=O)C=C1S(Cl)(=O)=O RJMGUEXGQXNUBI-UHFFFAOYSA-N 0.000 description 1
- SLYNWPBNJOHZEQ-UHFFFAOYSA-N 6-carbonochloridoyloxyhexyl carbonochloridate Chemical compound ClC(=O)OCCCCCCOC(Cl)=O SLYNWPBNJOHZEQ-UHFFFAOYSA-N 0.000 description 1
- VHRSUDSXCMQTMA-UWKORSIYSA-N 6-methylprednisolone Chemical compound C([C@@]12C)=CC(=O)C=C1C(C)C[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)[C@@](O)(C(=O)CO)CC[C@H]21 VHRSUDSXCMQTMA-UWKORSIYSA-N 0.000 description 1
- CZNYYPMFWGMKRC-UHFFFAOYSA-N 9,10-dioxoanthracene-2,6-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C2C(=O)C3=CC(S(=O)(=O)Cl)=CC=C3C(=O)C2=C1 CZNYYPMFWGMKRC-UHFFFAOYSA-N 0.000 description 1
- FDAGIURIANMEOD-UHFFFAOYSA-N 9,10-dioxoanthracene-2,7-disulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C2C(=O)C3=CC(S(=O)(=O)Cl)=CC=C3C(=O)C2=C1 FDAGIURIANMEOD-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 229940088872 Apoptosis inhibitor Drugs 0.000 description 1
- 101100452478 Arabidopsis thaliana DHAD gene Proteins 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 1
- 239000012664 BCL-2-inhibitor Substances 0.000 description 1
- 229940123711 Bcl2 inhibitor Drugs 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- MMWCQWOKHLEYSP-UHFFFAOYSA-N BisPhenol A bis(chloroformate) Chemical compound C=1C=C(OC(Cl)=O)C=CC=1C(C)(C)C1=CC=C(OC(Cl)=O)C=C1 MMWCQWOKHLEYSP-UHFFFAOYSA-N 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- SFFHYSZLKLVUSO-VAWYXSNFSA-N CCC(C(Cl)=O)\N=N\C(CC)C(Cl)=O Chemical compound CCC(C(Cl)=O)\N=N\C(CC)C(Cl)=O SFFHYSZLKLVUSO-VAWYXSNFSA-N 0.000 description 1
- 102000008203 CTLA-4 Antigen Human genes 0.000 description 1
- 108010021064 CTLA-4 Antigen Proteins 0.000 description 1
- 239000012275 CTLA-4 inhibitor Substances 0.000 description 1
- DSUPJAUMRSNUNV-WRQRQDGMSA-N C[C@@H](C(N[C@@H](Cc(cc1)ccc1NC(OCC1c2ccccc2-c2ccccc12)=O)C(N(CCC1)[C@@H]1c1cncc(C(C(C(C)C2)=CC=C2F)=O)c1)=O)=O)N(C)C(OC(C)(C)C)=O Chemical compound C[C@@H](C(N[C@@H](Cc(cc1)ccc1NC(OCC1c2ccccc2-c2ccccc12)=O)C(N(CCC1)[C@@H]1c1cncc(C(C(C(C)C2)=CC=C2F)=O)c1)=O)=O)N(C)C(OC(C)(C)C)=O DSUPJAUMRSNUNV-WRQRQDGMSA-N 0.000 description 1
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102000003952 Caspase 3 Human genes 0.000 description 1
- 108090000397 Caspase 3 Proteins 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- AMEHWVVXBLLBOO-ISLYRVAYSA-N ClC(=O)C1=CC=CC=C1\N=N\C1=CC=CC=C1C(Cl)=O Chemical compound ClC(=O)C1=CC=CC=C1\N=N\C1=CC=CC=C1C(Cl)=O AMEHWVVXBLLBOO-ISLYRVAYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 description 1
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 description 1
- 102100021906 Cyclin-O Human genes 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- KDXKERNSBIXSRK-RXMQYKEDSA-N D-lysine Chemical compound NCCCC[C@@H](N)C(O)=O KDXKERNSBIXSRK-RXMQYKEDSA-N 0.000 description 1
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 1
- 229940124087 DNA topoisomerase II inhibitor Drugs 0.000 description 1
- WEAHRLBPCANXCN-UHFFFAOYSA-N Daunomycin Natural products CCC1(O)CC(OC2CC(N)C(O)C(C)O2)c3cc4C(=O)c5c(OC)cccc5C(=O)c4c(O)c3C1 WEAHRLBPCANXCN-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 206010061818 Disease progression Diseases 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 102100021239 G protein-activated inward rectifier potassium channel 2 Human genes 0.000 description 1
- 101710158550 G protein-activated inward rectifier potassium channel 2 Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000897441 Homo sapiens Cyclin-O Proteins 0.000 description 1
- 101000871228 Homo sapiens Diablo IAP-binding mitochondrial protein Proteins 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- BGSOJVFOEQLVMH-UHFFFAOYSA-N Hydrocortisone phosphate Natural products O=C1CCC2(C)C3C(O)CC(C)(C(CC4)(O)C(=O)COP(O)(O)=O)C4C3CCC2=C1 BGSOJVFOEQLVMH-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229940083346 IAP antagonist Drugs 0.000 description 1
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 1
- OGNSCSPNOLGXSM-VKHMYHEASA-N L-2,4-diaminobutyric acid Chemical compound NCC[C@H](N)C(O)=O OGNSCSPNOLGXSM-VKHMYHEASA-N 0.000 description 1
- OYIFNHCXNCRBQI-BYPYZUCNSA-N L-2-aminoadipic acid Chemical compound OC(=O)[C@@H](N)CCCC(O)=O OYIFNHCXNCRBQI-BYPYZUCNSA-N 0.000 description 1
- JUQLUIFNNFIIKC-YFKPBYRVSA-N L-2-aminopimelic acid Chemical compound OC(=O)[C@@H](N)CCCCC(O)=O JUQLUIFNNFIIKC-YFKPBYRVSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- FQPGMQABJNQLLF-VKHMYHEASA-N L-canaline Chemical compound NOCC[C@H](N)C(O)=O FQPGMQABJNQLLF-VKHMYHEASA-N 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 1
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 1
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 1
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 1
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 1
- 239000002067 L01XE06 - Dasatinib Substances 0.000 description 1
- 239000005536 L01XE08 - Nilotinib Substances 0.000 description 1
- 239000002145 L01XE14 - Bosutinib Substances 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- LPGWZGMPDKDHEP-HLTPFJCJSA-N Leurosine Chemical compound C([C@]1([C@@H]2O1)CC)N(CCC=1C3=CC=CC=C3NC=11)C[C@H]2C[C@]1(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC LPGWZGMPDKDHEP-HLTPFJCJSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 108010058682 Mitochondrial Proteins Proteins 0.000 description 1
- 102000006404 Mitochondrial Proteins Human genes 0.000 description 1
- PQNASZJZHFPQLE-LURJTMIESA-N N(6)-methyl-L-lysine Chemical compound CNCCCC[C@H](N)C(O)=O PQNASZJZHFPQLE-LURJTMIESA-N 0.000 description 1
- QIAFMBKCNZACKA-UHFFFAOYSA-N N-benzoylglycine Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1 QIAFMBKCNZACKA-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229920000305 Nylon 6,10 Polymers 0.000 description 1
- FQPGMQABJNQLLF-UHFFFAOYSA-N O-amino-L-homoserine Natural products NOCCC(N)C(O)=O FQPGMQABJNQLLF-UHFFFAOYSA-N 0.000 description 1
- GNISQJGXJIDKDJ-YFKPBYRVSA-N O-succinyl-L-homoserine Chemical compound OC(=O)[C@@H](N)CCOC(=O)CCC(O)=O GNISQJGXJIDKDJ-YFKPBYRVSA-N 0.000 description 1
- JMIVKHMHPDFOGR-GQNXIQCSSA-N OC([ClH][C@H](COC12)C1OC[C@H]2[ClH]C(O)=O)=O Chemical compound OC([ClH][C@H](COC12)C1OC[C@H]2[ClH]C(O)=O)=O JMIVKHMHPDFOGR-GQNXIQCSSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 229940079156 Proteasome inhibitor Drugs 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 108010090804 Streptavidin Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229940123237 Taxane Drugs 0.000 description 1
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 1
- 239000000317 Topoisomerase II Inhibitor Substances 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 1
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229940028652 abraxane Drugs 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 229950009084 adecatumumab Drugs 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229940009456 adriamycin Drugs 0.000 description 1
- ULXXDDBFHOBEHA-CWDCEQMOSA-N afatinib Chemical compound N1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC1=CC=C(F)C(Cl)=C1 ULXXDDBFHOBEHA-CWDCEQMOSA-N 0.000 description 1
- 229960001686 afatinib Drugs 0.000 description 1
- 229940060236 ala-cort Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 229940098174 alkeran Drugs 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000005466 alkylenyl group Chemical group 0.000 description 1
- 125000005282 allenyl group Chemical group 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- HRRYYCWYCMJNGA-ZETCQYMHSA-N alpha-methyl-L-histidine Chemical compound OC(=O)[C@](N)(C)CC1=CN=CN1 HRRYYCWYCMJNGA-ZETCQYMHSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000003080 antimitotic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000001640 apoptogenic effect Effects 0.000 description 1
- 239000000158 apoptosis inhibitor Substances 0.000 description 1
- 230000005775 apoptotic pathway Effects 0.000 description 1
- 229940014583 arranon Drugs 0.000 description 1
- 229960001230 asparagine Drugs 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 238000002820 assay format Methods 0.000 description 1
- 229940120638 avastin Drugs 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 229960003270 belimumab Drugs 0.000 description 1
- 229960002707 bendamustine Drugs 0.000 description 1
- YTKUWDBFDASYHO-UHFFFAOYSA-N bendamustine Chemical compound ClCCN(CCCl)C1=CC=C2N(C)C(CCCC(O)=O)=NC2=C1 YTKUWDBFDASYHO-UHFFFAOYSA-N 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- FYXKZNLBZKRYSS-UHFFFAOYSA-N benzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)=O FYXKZNLBZKRYSS-UHFFFAOYSA-N 0.000 description 1
- YBGQXNZTVFEKEN-UHFFFAOYSA-N benzene-1,2-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1S(Cl)(=O)=O YBGQXNZTVFEKEN-UHFFFAOYSA-N 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- ALIQZUMMPOYCIS-UHFFFAOYSA-N benzene-1,3-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 ALIQZUMMPOYCIS-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 229960000397 bevacizumab Drugs 0.000 description 1
- 229940108502 bicnu Drugs 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000012620 biological material Substances 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 235000020958 biotin Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 229960001467 bortezomib Drugs 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229960002092 busulfan Drugs 0.000 description 1
- 229940112133 busulfex Drugs 0.000 description 1
- FDOWWCFFWMGFGQ-UHFFFAOYSA-N but-3-enoic acid Chemical compound OC(=O)CC=C.OC(=O)CC=C FDOWWCFFWMGFGQ-UHFFFAOYSA-N 0.000 description 1
- VZHRPLJULARYDO-UHFFFAOYSA-N butane-1,4-disulfonyl chloride Chemical compound ClS(=O)(=O)CCCCS(Cl)(=O)=O VZHRPLJULARYDO-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- IRXBNHGNHKNOJI-UHFFFAOYSA-N butanedioyl dichloride Chemical compound ClC(=O)CCC(Cl)=O IRXBNHGNHKNOJI-UHFFFAOYSA-N 0.000 description 1
- 229960001573 cabazitaxel Drugs 0.000 description 1
- BMQGVNUXMIRLCK-OAGWZNDDSA-N cabazitaxel Chemical compound O([C@H]1[C@@H]2[C@]3(OC(C)=O)CO[C@@H]3C[C@@H]([C@]2(C(=O)[C@H](OC)C2=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=3C=CC=CC=3)C[C@]1(O)C2(C)C)C)OC)C(=O)C1=CC=CC=C1 BMQGVNUXMIRLCK-OAGWZNDDSA-N 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 229940088954 camptosar Drugs 0.000 description 1
- FQPGMQABJNQLLF-GSVOUGTGSA-N canaline Chemical compound NOCC[C@@H](N)C(O)=O FQPGMQABJNQLLF-GSVOUGTGSA-N 0.000 description 1
- 229960004117 capecitabine Drugs 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 229960005243 carmustine Drugs 0.000 description 1
- 238000000423 cell based assay Methods 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 230000003833 cell viability Effects 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 229950006647 cixutumumab Drugs 0.000 description 1
- 238000003181 co-melting Methods 0.000 description 1
- 239000013066 combination product Substances 0.000 description 1
- 229940127555 combination product Drugs 0.000 description 1
- 238000012875 competitive assay Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 229950007276 conatumumab Drugs 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- ALEXXDVDDISNDU-JZYPGELDSA-N cortisol 21-acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)COC(=O)C)(O)[C@@]1(C)C[C@@H]2O ALEXXDVDDISNDU-JZYPGELDSA-N 0.000 description 1
- 229960004544 cortisone Drugs 0.000 description 1
- 229940088547 cosmegen Drugs 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002100 cyclohexa-1,3-dienyl group Chemical group [H]C1([*])C([H])=C([H])C([H])=C([H])C1([H])[H] 0.000 description 1
- 125000002150 cyclohexa-1,4-dienyl group Chemical group [H]C1=C([H])C([H])(*)C([H])=C([H])C1([H])[H] 0.000 description 1
- HXTYZWJVMWWWDK-UHFFFAOYSA-N cyclohexane-1,4-dicarbonyl chloride Chemical compound ClC(=O)C1CCC(C(Cl)=O)CC1 HXTYZWJVMWWWDK-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 229960003901 dacarbazine Drugs 0.000 description 1
- 229950006418 dactolisib Drugs 0.000 description 1
- 229960002448 dasatinib Drugs 0.000 description 1
- 238000007405 data analysis Methods 0.000 description 1
- 229960000975 daunorubicin Drugs 0.000 description 1
- 229940052372 daunorubicin citrate liposome Drugs 0.000 description 1
- 229960003109 daunorubicin hydrochloride Drugs 0.000 description 1
- 229940041983 daunorubicin liposomal Drugs 0.000 description 1
- 229940107841 daunoxome Drugs 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 229940027008 deltasone Drugs 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 230000005750 disease progression Effects 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- NNTJKSMVNWGFTB-UHFFFAOYSA-N disulfuryl chloride Chemical compound ClS(=O)(=O)OS(Cl)(=O)=O NNTJKSMVNWGFTB-UHFFFAOYSA-N 0.000 description 1
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 229940088679 drug related substance Drugs 0.000 description 1
- 229940120655 eloxatin Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 229960001904 epirubicin Drugs 0.000 description 1
- 229940082789 erbitux Drugs 0.000 description 1
- 229960005073 erlotinib hydrochloride Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-L ethane-1,2-disulfonate Chemical compound [O-]S(=O)(=O)CCS([O-])(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-L 0.000 description 1
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 1
- MUANZYIPCHDGJH-UHFFFAOYSA-N ethyl 2-(2-chlorophenyl)acetate Chemical compound CCOC(=O)CC1=CC=CC=C1Cl MUANZYIPCHDGJH-UHFFFAOYSA-N 0.000 description 1
- IWBOPFCKHIJFMS-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl) ether Chemical compound NCCOCCOCCN IWBOPFCKHIJFMS-UHFFFAOYSA-N 0.000 description 1
- 229950008085 figitumumab Drugs 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 229960002584 gefitinib Drugs 0.000 description 1
- OKKDEIYWILRZIA-OSZBKLCCSA-N gemcitabine hydrochloride Chemical compound [H+].[Cl-].O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 OKKDEIYWILRZIA-OSZBKLCCSA-N 0.000 description 1
- 229960005144 gemcitabine hydrochloride Drugs 0.000 description 1
- 229940020967 gemzar Drugs 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 229940080856 gleevec Drugs 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229940097042 glucuronate Drugs 0.000 description 1
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- NVDLDFBUDJQFJA-UHFFFAOYSA-N hex-3-yne-2,5-diamine Chemical compound CC(N)C#CC(C)N NVDLDFBUDJQFJA-UHFFFAOYSA-N 0.000 description 1
- AIYPMVLGZIAKRM-UHFFFAOYSA-N hexa-2,4-diyne-1,6-diamine Chemical compound NCC#CC#CCN AIYPMVLGZIAKRM-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- YAQPZDICKJDHTR-UHFFFAOYSA-N hexylcarbamic acid Chemical compound CCCCCCNC(O)=O YAQPZDICKJDHTR-UHFFFAOYSA-N 0.000 description 1
- 229940088013 hycamtin Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229960000890 hydrocortisone Drugs 0.000 description 1
- 229950000785 hydrocortisone phosphate Drugs 0.000 description 1
- 229960004204 hydrocortisone sodium phosphate Drugs 0.000 description 1
- 229960001401 hydrocortisone sodium succinate Drugs 0.000 description 1
- VWQWXZAWFPZJDA-CGVGKPPMSA-N hydrocortisone succinate Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)COC(=O)CCC(O)=O)[C@@H]4[C@@H]3CCC2=C1 VWQWXZAWFPZJDA-CGVGKPPMSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229940099279 idamycin Drugs 0.000 description 1
- 229960000908 idarubicin Drugs 0.000 description 1
- 229940090411 ifex Drugs 0.000 description 1
- 229960001101 ifosfamide Drugs 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 1
- 229960002411 imatinib Drugs 0.000 description 1
- 229960003685 imatinib mesylate Drugs 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 108091006086 inhibitor proteins Proteins 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229950010939 iratumumab Drugs 0.000 description 1
- 229940084651 iressa Drugs 0.000 description 1
- 229960004768 irinotecan Drugs 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 229940001447 lactate Drugs 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940099584 lactobionate Drugs 0.000 description 1
- JYTUSYBCFIZPBE-AMTLMPIISA-N lactobionic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O JYTUSYBCFIZPBE-AMTLMPIISA-N 0.000 description 1
- 229950005692 larotaxel Drugs 0.000 description 1
- SEFGUGYLLVNFIJ-QDRLFVHASA-N larotaxel dihydrate Chemical compound O.O.O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@@]23[C@H]1[C@@]1(CO[C@@H]1C[C@@H]2C3)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 SEFGUGYLLVNFIJ-QDRLFVHASA-N 0.000 description 1
- 229950002884 lexatumumab Drugs 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 229950002216 linifanib Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229960002247 lomustine Drugs 0.000 description 1
- 229950004563 lucatumumab Drugs 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229940087732 matulane Drugs 0.000 description 1
- 229940064748 medrol Drugs 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- DKZQZHQHDMVGHE-UHFFFAOYSA-N methanedisulfonyl chloride Chemical compound ClS(=O)(=O)CS(Cl)(=O)=O DKZQZHQHDMVGHE-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 229960001293 methylprednisolone acetate Drugs 0.000 description 1
- PLBHSZGDDKCEHR-LFYFAGGJSA-N methylprednisolone acetate Chemical compound C([C@@]12C)=CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)[C@@](O)(C(=O)COC(C)=O)CC[C@H]21 PLBHSZGDDKCEHR-LFYFAGGJSA-N 0.000 description 1
- 229960000334 methylprednisolone sodium succinate Drugs 0.000 description 1
- 230000002438 mitochondrial effect Effects 0.000 description 1
- 229960001156 mitoxantrone Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 230000009456 molecular mechanism Effects 0.000 description 1
- 229950003968 motesanib Drugs 0.000 description 1
- 229940087004 mustargen Drugs 0.000 description 1
- 229940090009 myleran Drugs 0.000 description 1
- NAEDVTLYYRRDTF-XIYFKRPFSA-N n,n'-bis[(5s)-6-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-5-[[(2s)-2-(methylamino)propanoyl]amino]-6-oxohexyl]decanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CCCCNC(=O)CCCCCCCCC(=O)NCCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 NAEDVTLYYRRDTF-XIYFKRPFSA-N 0.000 description 1
- TWRJLKDJHRWECB-UYNGVSIFSA-N n,n'-bis[4-[(2s)-3-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-2-[[(2s)-2-(methylamino)propanoyl]amino]-3-oxopropyl]phenyl]decanediamide Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](C)NC)CC2=CC=C(C=C2)NC(=O)CCCCCCCCC(=O)NC2=CC=C(C=C2)C[C@H](NC(=O)[C@H](C)NC)C(=O)N2[C@@H](CCC2)C=2C=C(C=NC=2)C(=O)C=2C=CC(F)=CC=2)=CN=CC=1C(=O)C1=CC=C(F)C=C1 TWRJLKDJHRWECB-UYNGVSIFSA-N 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- DLNHSNNDIIJVDE-UHFFFAOYSA-N n-(morpholin-2-ylmethyl)ethanamine Chemical compound CCNCC1CNCCO1 DLNHSNNDIIJVDE-UHFFFAOYSA-N 0.000 description 1
- BUQMHUKZYMREQT-UHFFFAOYSA-N n-(pyrrolidin-3-ylmethyl)ethanamine Chemical compound CCNCC1CCNC1 BUQMHUKZYMREQT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZCLVKRFCNWGTIS-UHFFFAOYSA-N n-carbonochloridoyl-n-methylcarbamoyl chloride Chemical compound ClC(=O)N(C)C(Cl)=O ZCLVKRFCNWGTIS-UHFFFAOYSA-N 0.000 description 1
- HMIOFHWVBNNKPR-UHFFFAOYSA-N n-methyl-1-morpholin-2-ylmethanamine Chemical compound CNCC1CNCCO1 HMIOFHWVBNNKPR-UHFFFAOYSA-N 0.000 description 1
- RNUCZCMDLWNCFD-UHFFFAOYSA-N n-methyl-1-piperidin-4-ylmethanamine Chemical compound CNCC1CCNCC1 RNUCZCMDLWNCFD-UHFFFAOYSA-N 0.000 description 1
- JVODWNWKCOVKTO-UHFFFAOYSA-N n-methyl-1-pyrrolidin-3-ylmethanamine Chemical compound CNCC1CCNC1 JVODWNWKCOVKTO-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005487 naphthalate group Chemical group 0.000 description 1
- NZZGQZMNFCTNAM-UHFFFAOYSA-N naphthalene-2,6-dicarbonyl chloride Chemical compound C1=C(C(Cl)=O)C=CC2=CC(C(=O)Cl)=CC=C21 NZZGQZMNFCTNAM-UHFFFAOYSA-N 0.000 description 1
- VPLHHUICIOEESV-UHFFFAOYSA-N naphthalene-2,6-disulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=CC2=CC(S(=O)(=O)Cl)=CC=C21 VPLHHUICIOEESV-UHFFFAOYSA-N 0.000 description 1
- 239000006225 natural substrate Substances 0.000 description 1
- 229940086322 navelbine Drugs 0.000 description 1
- 230000006654 negative regulation of apoptotic process Effects 0.000 description 1
- 230000018791 negative regulation of catalytic activity Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229940030721 nilotinib hydrochloride Drugs 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- GYHFUZHODSMOHU-UHFFFAOYSA-N nonanal Chemical compound CCCCCCCCC=O GYHFUZHODSMOHU-UHFFFAOYSA-N 0.000 description 1
- HGEVGSTXQGZPCL-UHFFFAOYSA-N nonanedioyl dichloride Chemical compound ClC(=O)CCCCCCCC(Cl)=O HGEVGSTXQGZPCL-UHFFFAOYSA-N 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 239000003865 nucleic acid synthesis inhibitor Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-M octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC([O-])=O QIQXTHQIDYTFRH-UHFFFAOYSA-M 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229940003515 orapred Drugs 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229960001756 oxaliplatin Drugs 0.000 description 1
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- 229960005184 panobinostat Drugs 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- VMZMNAABQBOLAK-DBILLSOUSA-N pasireotide Chemical compound C([C@H]1C(=O)N2C[C@@H](C[C@H]2C(=O)N[C@H](C(=O)N[C@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@H](C(N[C@@H](CC=2C=CC(OCC=3C=CC=CC=3)=CC=2)C(=O)N1)=O)CCCCN)C=1C=CC=CC=1)OC(=O)NCCN)C1=CC=CC=C1 VMZMNAABQBOLAK-DBILLSOUSA-N 0.000 description 1
- NEEFMPSSNFRRNC-HQUONIRXSA-N pasireotide aspartate Chemical compound OC(=O)[C@@H](N)CC(O)=O.OC(=O)[C@@H](N)CC(O)=O.C([C@H]1C(=O)N2C[C@@H](C[C@H]2C(=O)N[C@H](C(=O)N[C@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@H](C(N[C@@H](CC=2C=CC(OCC=3C=CC=CC=3)=CC=2)C(=O)N1)=O)CCCCN)C=1C=CC=CC=1)OC(=O)NCCN)C1=CC=CC=C1 NEEFMPSSNFRRNC-HQUONIRXSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- CUIHSIWYWATEQL-UHFFFAOYSA-N pazopanib Chemical compound C1=CC2=C(C)N(C)N=C2C=C1N(C)C(N=1)=CC=NC=1NC1=CC=C(C)C(S(N)(=O)=O)=C1 CUIHSIWYWATEQL-UHFFFAOYSA-N 0.000 description 1
- 229960000639 pazopanib Drugs 0.000 description 1
- 229940097097 pediapred Drugs 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- YVOFTMXWTWHRBH-UHFFFAOYSA-N pentanedioyl dichloride Chemical compound ClC(=O)CCCC(Cl)=O YVOFTMXWTWHRBH-UHFFFAOYSA-N 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000008823 permeabilization Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- COIOMSXMIRZRKR-UHFFFAOYSA-N piperazine-1,4-disulfonyl chloride Chemical compound ClS(=O)(=O)N1CCN(S(Cl)(=O)=O)CC1 COIOMSXMIRZRKR-UHFFFAOYSA-N 0.000 description 1
- 238000002600 positron emission tomography Methods 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- 229960004618 prednisone Drugs 0.000 description 1
- 229940096111 prelone Drugs 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- CPTBDICYNRMXFX-UHFFFAOYSA-N procarbazine Chemical compound CNNCC1=CC=C(C(=O)NC(C)C)C=C1 CPTBDICYNRMXFX-UHFFFAOYSA-N 0.000 description 1
- 229960000624 procarbazine Drugs 0.000 description 1
- DERJYEZSLHIUKF-UHFFFAOYSA-N procarbazine hydrochloride Chemical compound Cl.CNNCC1=CC=C(C(=O)NC(C)C)C=C1 DERJYEZSLHIUKF-UHFFFAOYSA-N 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003207 proteasome inhibitor Substances 0.000 description 1
- 230000004952 protein activity Effects 0.000 description 1
- 229940121649 protein inhibitor Drugs 0.000 description 1
- 239000012268 protein inhibitor Substances 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 1
- ZRCHWSFIGKSJTJ-UHFFFAOYSA-N pyrazine-2,3-dicarbonyl chloride Chemical compound ClC(=O)C1=NC=CN=C1C(Cl)=O ZRCHWSFIGKSJTJ-UHFFFAOYSA-N 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- LBVLFXJMODAWMN-UHFFFAOYSA-N pyridine-2,4-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=NC(C(Cl)=O)=C1 LBVLFXJMODAWMN-UHFFFAOYSA-N 0.000 description 1
- GWHOGODUVLQCEB-UHFFFAOYSA-N pyridine-2,6-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=N1 GWHOGODUVLQCEB-UHFFFAOYSA-N 0.000 description 1
- HUIAQNXMBCJOCK-UHFFFAOYSA-N pyridine-3,4-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=NC=C1C(Cl)=O HUIAQNXMBCJOCK-UHFFFAOYSA-N 0.000 description 1
- SBKBDFUOZKKFRK-UHFFFAOYSA-N pyridine-3,5-dicarbonyl chloride Chemical compound ClC(=O)C1=CN=CC(C(Cl)=O)=C1 SBKBDFUOZKKFRK-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 108091006082 receptor inhibitors Proteins 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229950001808 robatumumab Drugs 0.000 description 1
- MOODSJOROWROTO-UHFFFAOYSA-N salicylsulfuric acid Chemical compound OC(=O)C1=CC=CC=C1OS(O)(=O)=O MOODSJOROWROTO-UHFFFAOYSA-N 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical class O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 229940088542 solu-cortef Drugs 0.000 description 1
- 229940087854 solu-medrol Drugs 0.000 description 1
- 229960003787 sorafenib Drugs 0.000 description 1
- IVDHYUQIDRJSTI-UHFFFAOYSA-N sorafenib tosylate Chemical compound [H+].CC1=CC=C(S([O-])(=O)=O)C=C1.C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 IVDHYUQIDRJSTI-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 229940114926 stearate Drugs 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 229960001052 streptozocin Drugs 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229940071103 sulfosalicylate Drugs 0.000 description 1
- 229960002812 sunitinib malate Drugs 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229940034785 sutent Drugs 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229940120982 tarceva Drugs 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 229940069905 tasigna Drugs 0.000 description 1
- DKPFODGZWDEEBT-QFIAKTPHSA-N taxane Chemical class C([C@]1(C)CCC[C@@H](C)[C@H]1C1)C[C@H]2[C@H](C)CC[C@@H]1C2(C)C DKPFODGZWDEEBT-QFIAKTPHSA-N 0.000 description 1
- 229940063683 taxotere Drugs 0.000 description 1
- 229940061353 temodar Drugs 0.000 description 1
- 229960001278 teniposide Drugs 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- UHOGFJCKMPUSLN-XZZVZQAVSA-N tert-butyl n-[(2s)-1-[[(2s)-6-amino-1-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C1=CN=CC(C(=O)C=2C=CC(F)=CC=2)=C1 UHOGFJCKMPUSLN-XZZVZQAVSA-N 0.000 description 1
- BZPITRBIKDZMBJ-ZAQUEYBZSA-N tert-butyl n-[(2s)-3-[4-(9h-fluoren-9-ylmethoxycarbonylamino)phenyl]-1-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@H](CC=2C=CC(NC(=O)OCC3C4=CC=CC=C4C4=CC=CC=C43)=CC=2)NC(=O)OC(C)(C)C)=CN=CC=1C(=O)C1=CC=C(F)C=C1 BZPITRBIKDZMBJ-ZAQUEYBZSA-N 0.000 description 1
- UEJQBVABYTZJLX-BCRBLDSWSA-N tert-butyl n-[(2s)-6-(9h-fluoren-9-ylmethoxycarbonylamino)-1-[(2s)-2-[5-(4-fluorobenzoyl)pyridin-3-yl]pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate Chemical compound C=1C([C@@H]2CCCN2C(=O)[C@H](CCCCNC(=O)OCC2C3=CC=CC=C3C3=CC=CC=C32)NC(=O)OC(C)(C)C)=CN=CC=1C(=O)C1=CC=C(F)C=C1 UEJQBVABYTZJLX-BCRBLDSWSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- UCRQTPGCFCBLOX-UHFFFAOYSA-N thiophene-2,5-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)S1 UCRQTPGCFCBLOX-UHFFFAOYSA-N 0.000 description 1
- 229960001196 thiotepa Drugs 0.000 description 1
- 230000036962 time dependent Effects 0.000 description 1
- 238000003354 tissue distribution assay Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 229940035307 toposar Drugs 0.000 description 1
- 229960002190 topotecan hydrochloride Drugs 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 229940066958 treanda Drugs 0.000 description 1
- 229950007217 tremelimumab Drugs 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- INQOMBQAUSQDDS-FIBGUPNXSA-N trideuterio(iodo)methane Chemical compound [2H]C([2H])([2H])I INQOMBQAUSQDDS-FIBGUPNXSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 1
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 1
- XGOYIMQSIKSOBS-UHFFFAOYSA-N vadimezan Chemical compound C1=CC=C2C(=O)C3=CC=C(C)C(C)=C3OC2=C1CC(O)=O XGOYIMQSIKSOBS-UHFFFAOYSA-N 0.000 description 1
- 239000004066 vascular targeting agent Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 229940099039 velcade Drugs 0.000 description 1
- 229960004982 vinblastine sulfate Drugs 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- 229960002110 vincristine sulfate Drugs 0.000 description 1
- GBABOYUKABKIAF-IELIFDKJSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-IELIFDKJSA-N 0.000 description 1
- 229960002066 vinorelbine Drugs 0.000 description 1
- CILBMBUYJCWATM-PYGJLNRPSA-N vinorelbine ditartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.OC(=O)[C@H](O)[C@@H](O)C(O)=O.C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC CILBMBUYJCWATM-PYGJLNRPSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229960000237 vorinostat Drugs 0.000 description 1
- 229940069559 votrient Drugs 0.000 description 1
- 229950003511 votumumab Drugs 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940053867 xeloda Drugs 0.000 description 1
- 229940053890 zanosar Drugs 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229940061261 zolinza Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/4439—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. omeprazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06008—Dipeptides with the first amino acid being neutral
- C07K5/06017—Dipeptides with the first amino acid being neutral and aliphatic
- C07K5/06026—Dipeptides with the first amino acid being neutral and aliphatic the side chain containing 0 or 1 carbon atom, i.e. Gly or Ala
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- General Chemical & Material Sciences (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- Genetics & Genomics (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US30811410P | 2010-02-25 | 2010-02-25 | |
| US61/308,114 | 2010-02-25 | ||
| US33392710P | 2010-05-12 | 2010-05-12 | |
| US61/333,927 | 2010-05-12 | ||
| US38841010P | 2010-09-30 | 2010-09-30 | |
| US61/388,410 | 2010-09-30 | ||
| PCT/EP2011/052662 WO2011104266A1 (en) | 2010-02-25 | 2011-02-23 | Dimeric iap inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2013520466A true JP2013520466A (ja) | 2013-06-06 |
| JP2013520466A5 JP2013520466A5 (enExample) | 2014-03-20 |
Family
ID=44476672
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2012554332A Pending JP2013520466A (ja) | 2010-02-25 | 2011-02-23 | 二量体iap阻害剤 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US8445440B2 (enExample) |
| EP (1) | EP2539333A1 (enExample) |
| JP (1) | JP2013520466A (enExample) |
| KR (1) | KR20130010894A (enExample) |
| CN (1) | CN102834389A (enExample) |
| AR (1) | AR080253A1 (enExample) |
| BR (1) | BR112012021291A2 (enExample) |
| CA (1) | CA2790302A1 (enExample) |
| EA (1) | EA201201177A1 (enExample) |
| MX (1) | MX2012009894A (enExample) |
| TW (1) | TW201141846A (enExample) |
| UY (1) | UY33236A (enExample) |
| WO (1) | WO2011104266A1 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20100317593A1 (en) * | 2009-06-12 | 2010-12-16 | Astrazeneca Ab | 2,3-dihydro-1h-indene compounds |
| UY33794A (es) * | 2010-12-13 | 2012-07-31 | Novartis Ag | Inhibidores diméricos de las iap |
| US20140243276A1 (en) | 2011-09-30 | 2014-08-28 | Tetralogic Pharmaceuticals Corporation | Smac mimetic (birinapant) for use in the treatment of proliferative diseases (cancer) |
| US9453048B2 (en) | 2012-08-09 | 2016-09-27 | Bristol-Myers Squibb Company | IAP antagonists |
| EP2917218B1 (en) * | 2012-11-09 | 2017-01-04 | Ensemble Therapeutics Corporation | Macrocyclic compounds for inhibition of inhibitors of apoptosis |
| ES2982449T3 (es) | 2013-06-25 | 2024-10-16 | Walter & Eliza Hall Inst Medical Res | Miméticos Smac para su uso en el tratamiento de una infección persistente por VIH |
| WO2016079527A1 (en) | 2014-11-19 | 2016-05-26 | Tetralogic Birinapant Uk Ltd | Combination therapy |
| WO2016097773A1 (en) | 2014-12-19 | 2016-06-23 | Children's Cancer Institute | Therapeutic iap antagonists for treating proliferative disorders |
| CN109705191B (zh) * | 2017-10-25 | 2022-04-29 | 广东东阳光药业有限公司 | Iap抑制剂及其在药物中的应用 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2008014236A1 (en) * | 2006-07-24 | 2008-01-31 | Tetralogic Pharmaceuticals Corporation | Dimeric iap inhibitors |
| JP2009512719A (ja) * | 2005-10-25 | 2009-03-26 | アエゲラ セラピューティクス インコーポレイテッド | Iapbirドメイン結合化合物 |
| JP2009545613A (ja) * | 2006-08-02 | 2009-12-24 | ノバルティス アクチエンゲゼルシャフト | Iap阻害剤として有用なsmacペプチド模倣物 |
Family Cites Families (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6041077B2 (ja) | 1976-09-06 | 1985-09-13 | 喜徳 喜谷 | 1,2‐ジアミノシクロヘキサン異性体のシス白金(2)錯体 |
| US5281620A (en) | 1986-12-23 | 1994-01-25 | Cancer Research Campaign Technology Limited | Compounds having antitumor and antibacterial properties |
| PE20010306A1 (es) | 1999-07-02 | 2001-03-29 | Agouron Pharma | Compuestos de indazol y composiciones farmaceuticas que los contienen utiles para la inhibicion de proteina kinasa |
| GB0018891D0 (en) | 2000-08-01 | 2000-09-20 | Novartis Ag | Organic compounds |
| JP2002037626A (ja) | 2000-07-27 | 2002-02-06 | Internatl Superconductivity Technology Center | ビスマス系高温超電導体の製造方法。 |
| PE20020354A1 (es) | 2000-09-01 | 2002-06-12 | Novartis Ag | Compuestos de hidroxamato como inhibidores de histona-desacetilasa (hda) |
| US6995162B2 (en) | 2001-01-12 | 2006-02-07 | Amgen Inc. | Substituted alkylamine derivatives and methods of use |
| TWI275390B (en) | 2002-04-30 | 2007-03-11 | Wyeth Corp | Process for the preparation of 7-substituted-3- quinolinecarbonitriles |
| DE60334247D1 (de) | 2002-11-27 | 2010-10-28 | Irm Llc | Verfahren und zusammensetzungen zur apoptoseinduktion in krebszellen |
| CA2514733A1 (en) | 2003-02-28 | 2004-09-16 | Transform Pharmaceuticals, Inc. | Pharmaceutical co-crystal compositions of drugs such as carbamazepine, celecoxib, olanzapine, itraconazole, topiramate, modafinil, 5-fluorouracil, hydrochlorothiazide, acetaminophen, aspirin, flurbiprofen, phenytoin and ibuprofen |
| JP2007520522A (ja) | 2004-02-05 | 2007-07-26 | ノバルティス アクチエンゲゼルシャフト | (a)DNAトポイソメラーゼ阻害剤および(b)IAP阻害剤の組み合わせ剤 |
| AU2005218555B2 (en) * | 2004-03-01 | 2008-01-03 | Board Of Regents, The University Of Texas System | Dimeric small molecule potentiators of apoptosis |
| JP5230865B2 (ja) | 2004-07-15 | 2013-07-10 | テトラロジック ファーマシューティカルズ コーポレーション | Iap結合性化合物 |
| DK1851200T3 (da) | 2005-02-25 | 2014-04-14 | Tetralogic Pharm Corp | Dimere iap-inhibitorer |
| CA2607940C (en) | 2005-05-18 | 2009-12-15 | Aegera Therapeutics Inc. | Bir domain binding compounds |
| GB0510390D0 (en) | 2005-05-20 | 2005-06-29 | Novartis Ag | Organic compounds |
| AU2006279929A1 (en) | 2005-08-09 | 2007-02-22 | Tetralogic Pharmaceuticals Corporation | Treatment of proliferative disorders |
| CN101340947B (zh) * | 2005-12-20 | 2012-09-05 | 诺瓦提斯公司 | Iap-抑制剂和紫杉烷7的组合 |
| TWI543988B (zh) | 2006-03-16 | 2016-08-01 | 科學製藥股份有限公司 | 結合於細胞凋亡抑制蛋白(iap)之桿狀病毒iap重複序列(bir)區域之化合物 |
| BRPI0708942A2 (pt) | 2006-03-21 | 2011-06-14 | Joyant Pharmaceuticals Inc | composto promotor de apoptose, uso e mÉtodo de produÇço do mesmo e composiÇço farmacÊutica |
| US8202902B2 (en) * | 2006-05-05 | 2012-06-19 | The Regents Of The University Of Michigan | Bivalent SMAC mimetics and the uses thereof |
| MY159563A (en) * | 2006-05-16 | 2017-01-13 | Pharmascience Inc | Iap bir domain binding compounds |
| WO2008014238A2 (en) | 2006-07-24 | 2008-01-31 | Tetralogic Pharmaceuticals Corporation | Dimeric iap inhibitors |
| JP5452223B2 (ja) * | 2006-07-24 | 2014-03-26 | テトラロジック ファーマシューティカルズ コーポレーション | Iap阻害剤 |
| US20100113326A1 (en) | 2006-07-24 | 2010-05-06 | Tetralogic Pharmaceuticals Corporation | Dimeric iap inhibitors |
| US20100144650A1 (en) | 2006-07-24 | 2010-06-10 | Tetralogic Pharmaceuticals Corporation | Dimeric iap inhibitors |
| EP2049563B1 (en) | 2006-07-24 | 2014-03-12 | Tetralogic Pharmaceuticals Corporation | Dimeric iap antagonists |
| KR20090082221A (ko) * | 2006-10-19 | 2009-07-29 | 노파르티스 아게 | 유기 화합물 |
| MX2009005551A (es) | 2006-11-28 | 2009-06-08 | Novartis Ag | Uso de inhibidores de iap para el tratamiento de leucemia mieloide aguda. |
| WO2008066854A2 (en) | 2006-11-28 | 2008-06-05 | Novartis Ag | Methods and compositions for inducing apoptosis in cancer cells |
| KR101149449B1 (ko) | 2007-03-20 | 2012-05-25 | 삼성전자주식회사 | 오디오 신호의 인코딩 방법 및 장치, 그리고 오디오 신호의디코딩 방법 및 장치 |
| EP2079309B1 (en) * | 2007-04-12 | 2015-11-11 | Joyant Pharmaceuticals Inc | SMAC MIMEE DIMERS AND TRIMERS USEFUL AS ANTICANCER AGENTS |
| AR066348A1 (es) | 2007-04-30 | 2009-08-12 | Genentech Inc | Inhibidores de las iap |
| JP2010528587A (ja) | 2007-05-07 | 2010-08-26 | テトラロジック ファーマシューティカルズ コーポレーション | アポトーシス阻害タンパク質のアンタゴニストに対する感受性のバイオマーカーとしてTNFα遺伝子の発現を用いる方法 |
| TWI471134B (zh) | 2007-09-12 | 2015-02-01 | Genentech Inc | 肌醇磷脂3-激酶抑制劑化合物及化療劑之組合及使用方法 |
| CA2701292C (en) | 2007-10-25 | 2015-03-24 | Genentech, Inc. | Process for making thienopyrimidine compounds |
| EP2058312A1 (en) | 2007-11-09 | 2009-05-13 | Universita' degli Studi di Milano | SMAC mimetic compounds as apoptosis inducers |
| PL2240506T3 (pl) | 2008-01-11 | 2013-05-31 | Genentech Inc | Inhibitory IAP |
| BRPI0906785A2 (pt) | 2008-01-24 | 2015-07-14 | Tetralogic Pharm Corp | Composto, composição farmacêutica, e, métodos para induzir a apoptose em uma célula, para tratar câncer e uma doença autoimune |
| WO2009136290A1 (en) | 2008-05-05 | 2009-11-12 | Aegera Therapeutics, Inc. | Functionalized pyrrolidines and use thereof as iap inhibitors |
| US8168784B2 (en) | 2008-06-20 | 2012-05-01 | Abbott Laboratories | Processes to make apoptosis promoters |
| EP2310402A1 (en) | 2008-06-27 | 2011-04-20 | Aegera Therapeutics Inc. | Bridged secondary amines and use thereof as iap bir domain binding compounds |
| NZ590550A (en) | 2008-08-02 | 2013-05-31 | Genentech Inc | Inhibitors of Apoptosis (IAP) for treating cancer |
| WO2010015090A1 (en) | 2008-08-07 | 2010-02-11 | Aegera Therapeutics Inc. | Functionalized pyrrolidines and use thereof as iap inhibitors |
| AU2009293403A1 (en) | 2008-09-17 | 2010-03-25 | Tetralogic Pharmaceuticals Corp. | IAP inhibitors |
| JP2012502994A (ja) | 2008-09-22 | 2012-02-02 | アムジエン・インコーポレーテツド | 治療方法 |
| US8283372B2 (en) * | 2009-07-02 | 2012-10-09 | Tetralogic Pharmaceuticals Corp. | 2-(1H-indol-3-ylmethyl)-pyrrolidine dimer as a SMAC mimetic |
-
2011
- 2011-02-21 UY UY0001033236A patent/UY33236A/es not_active Application Discontinuation
- 2011-02-23 CA CA2790302A patent/CA2790302A1/en not_active Abandoned
- 2011-02-23 US US13/033,463 patent/US8445440B2/en not_active Expired - Fee Related
- 2011-02-23 EP EP11705532A patent/EP2539333A1/en not_active Withdrawn
- 2011-02-23 BR BR112012021291A patent/BR112012021291A2/pt not_active IP Right Cessation
- 2011-02-23 CN CN2011800177078A patent/CN102834389A/zh active Pending
- 2011-02-23 KR KR1020127024875A patent/KR20130010894A/ko not_active Withdrawn
- 2011-02-23 EA EA201201177A patent/EA201201177A1/ru unknown
- 2011-02-23 MX MX2012009894A patent/MX2012009894A/es active IP Right Grant
- 2011-02-23 JP JP2012554332A patent/JP2013520466A/ja active Pending
- 2011-02-23 AR ARP110100547A patent/AR080253A1/es unknown
- 2011-02-23 WO PCT/EP2011/052662 patent/WO2011104266A1/en not_active Ceased
- 2011-02-24 TW TW100106289A patent/TW201141846A/zh unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2009512719A (ja) * | 2005-10-25 | 2009-03-26 | アエゲラ セラピューティクス インコーポレイテッド | Iapbirドメイン結合化合物 |
| WO2008014236A1 (en) * | 2006-07-24 | 2008-01-31 | Tetralogic Pharmaceuticals Corporation | Dimeric iap inhibitors |
| JP2009545613A (ja) * | 2006-08-02 | 2009-12-24 | ノバルティス アクチエンゲゼルシャフト | Iap阻害剤として有用なsmacペプチド模倣物 |
Also Published As
| Publication number | Publication date |
|---|---|
| UY33236A (es) | 2011-09-30 |
| KR20130010894A (ko) | 2013-01-29 |
| US20110206690A1 (en) | 2011-08-25 |
| BR112012021291A2 (pt) | 2016-10-25 |
| US8445440B2 (en) | 2013-05-21 |
| MX2012009894A (es) | 2012-09-12 |
| WO2011104266A1 (en) | 2011-09-01 |
| AR080253A1 (es) | 2012-03-21 |
| AU2011219862A1 (en) | 2012-09-06 |
| TW201141846A (en) | 2011-12-01 |
| CA2790302A1 (en) | 2011-09-01 |
| EA201201177A1 (ru) | 2013-04-30 |
| EP2539333A1 (en) | 2013-01-02 |
| CN102834389A (zh) | 2012-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US8445440B2 (en) | Dimeric IAP inhibitors | |
| JP7032583B2 (ja) | アルギナーゼ活性を阻害する組成物及び方法 | |
| US8993523B2 (en) | Dimeric IAP inhibitors | |
| JP6388991B2 (ja) | キナーゼ阻害剤としてのアミノヘテロアリールベンズアミド | |
| TWI820077B (zh) | 治療涉及酸性或缺氧性患病組織之疾病之化合物、組合物及方法 | |
| KR20220047810A (ko) | 알키닐 퀴나졸린 화합물 | |
| EA030539B1 (ru) | Производные 1-амино-2-циклобутилэтилбороновой кислоты | |
| CN117642416A (zh) | 分拣蛋白活性调节剂 | |
| WO2021060453A1 (ja) | 架橋型光学活性2級アミン誘導体 | |
| TW202116356A (zh) | 作為治療劑之微管靶向藥劑之肽結合物 | |
| US20130266590A1 (en) | Dimeric iap inhibitors | |
| CN102325768A (zh) | 治疗疼痛和其他疾病的化合物和方法 | |
| AU2020201109A1 (en) | NMDA receptor modulators and prodrugs, salts, and uses thereof | |
| CN103373997B (zh) | 含有锌结合基的吡啶并萘啶类HDAC和mTOR抑制剂 | |
| AU2011219862B2 (en) | Dimeric IAP inhibitors | |
| CA3106548A1 (en) | Histone demethylase 5 inhibitors and uses thereof | |
| JP2025506445A (ja) | Klf2の誘導物質およびその使用方法 | |
| WO2014150252A1 (en) | Methods of treatment associated with the granulocyte colony-stimulating factor receptor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20140127 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20140127 |
|
| RD03 | Notification of appointment of power of attorney |
Free format text: JAPANESE INTERMEDIATE CODE: A7423 Effective date: 20140820 |
|
| RD04 | Notification of resignation of power of attorney |
Free format text: JAPANESE INTERMEDIATE CODE: A7424 Effective date: 20140902 |
|
| A977 | Report on retrieval |
Free format text: JAPANESE INTERMEDIATE CODE: A971007 Effective date: 20150127 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20150203 |
|
| A02 | Decision of refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A02 Effective date: 20150630 |