JP2010523477A - 線維芽細胞活性化タンパク質の阻害剤、およびそれを使用する方法 - Google Patents
線維芽細胞活性化タンパク質の阻害剤、およびそれを使用する方法 Download PDFInfo
- Publication number
- JP2010523477A JP2010523477A JP2009554735A JP2009554735A JP2010523477A JP 2010523477 A JP2010523477 A JP 2010523477A JP 2009554735 A JP2009554735 A JP 2009554735A JP 2009554735 A JP2009554735 A JP 2009554735A JP 2010523477 A JP2010523477 A JP 2010523477A
- Authority
- JP
- Japan
- Prior art keywords
- amino acid
- compound according
- carbonyl
- side chain
- acid residue
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 238000000034 method Methods 0.000 title claims abstract description 50
- 239000003112 inhibitor Substances 0.000 title description 12
- 102000004169 proteins and genes Human genes 0.000 title description 6
- 108090000623 proteins and genes Proteins 0.000 title description 6
- 210000002950 fibroblast Anatomy 0.000 title description 4
- 230000004913 activation Effects 0.000 title 1
- 241000124008 Mammalia Species 0.000 claims abstract description 17
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 16
- 201000011510 cancer Diseases 0.000 claims abstract description 15
- 150000001875 compounds Chemical class 0.000 claims description 179
- -1 5-tetrazolyl Chemical group 0.000 claims description 172
- 125000000217 alkyl group Chemical group 0.000 claims description 59
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 53
- 150000001413 amino acids Chemical class 0.000 claims description 45
- 125000000539 amino acid group Chemical group 0.000 claims description 44
- 125000003118 aryl group Chemical group 0.000 claims description 42
- 150000003839 salts Chemical class 0.000 claims description 41
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 claims description 34
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 claims description 34
- 125000006239 protecting group Chemical group 0.000 claims description 31
- 125000003342 alkenyl group Chemical group 0.000 claims description 27
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 23
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 22
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 21
- 125000001072 heteroaryl group Chemical group 0.000 claims description 17
- 125000001691 aryl alkyl amino group Chemical group 0.000 claims description 16
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 16
- 125000001769 aryl amino group Chemical group 0.000 claims description 16
- 125000004104 aryloxy group Chemical group 0.000 claims description 16
- 125000002252 acyl group Chemical group 0.000 claims description 15
- 125000000304 alkynyl group Chemical group 0.000 claims description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- 125000004414 alkyl thio group Chemical group 0.000 claims description 14
- 229910052760 oxygen Inorganic materials 0.000 claims description 14
- 229910052717 sulfur Inorganic materials 0.000 claims description 14
- 125000003282 alkyl amino group Chemical group 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 11
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 11
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 10
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 10
- 150000008574 D-amino acids Chemical group 0.000 claims description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 8
- 125000004659 aryl alkyl thio group Chemical group 0.000 claims description 8
- 125000005110 aryl thio group Chemical group 0.000 claims description 8
- DYMRYCZRMAHYKE-UHFFFAOYSA-N n-diazonitramide Chemical compound [O-][N+](=O)N=[N+]=[N-] DYMRYCZRMAHYKE-UHFFFAOYSA-N 0.000 claims description 8
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 claims description 8
- 150000008575 L-amino acids Chemical group 0.000 claims description 6
- 206010006007 bone sarcoma Diseases 0.000 claims description 5
- 201000001441 melanoma Diseases 0.000 claims description 5
- 241000283690 Bos taurus Species 0.000 claims description 4
- 206010006187 Breast cancer Diseases 0.000 claims description 4
- 208000026310 Breast neoplasm Diseases 0.000 claims description 4
- 206010009944 Colon cancer Diseases 0.000 claims description 4
- 201000008808 Fibrosarcoma Diseases 0.000 claims description 4
- 208000008999 Giant Cell Carcinoma Diseases 0.000 claims description 4
- 208000008839 Kidney Neoplasms Diseases 0.000 claims description 4
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 4
- 206010033128 Ovarian cancer Diseases 0.000 claims description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 4
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 4
- 241001494479 Pecora Species 0.000 claims description 4
- 241000288906 Primates Species 0.000 claims description 4
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 claims description 4
- 206010060862 Prostate cancer Diseases 0.000 claims description 4
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 4
- 206010038389 Renal cancer Diseases 0.000 claims description 4
- 208000006265 Renal cell carcinoma Diseases 0.000 claims description 4
- 208000021712 Soft tissue sarcoma Diseases 0.000 claims description 4
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 4
- 208000029742 colonic neoplasm Diseases 0.000 claims description 4
- 125000004475 heteroaralkyl group Chemical group 0.000 claims description 4
- 201000010982 kidney cancer Diseases 0.000 claims description 4
- 201000005202 lung cancer Diseases 0.000 claims description 4
- 201000000014 lung giant cell carcinoma Diseases 0.000 claims description 4
- 208000020816 lung neoplasm Diseases 0.000 claims description 4
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 4
- 201000002528 pancreatic cancer Diseases 0.000 claims description 4
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 4
- 241000283073 Equus caballus Species 0.000 claims description 3
- 241000282326 Felis catus Species 0.000 claims description 3
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 claims description 3
- 241000009328 Perro Species 0.000 claims description 3
- 241000283984 Rodentia Species 0.000 claims description 3
- 241000282898 Sus scrofa Species 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- 206010041823 squamous cell carcinoma Diseases 0.000 claims description 3
- ONIBWKKTOPOVIA-SCSAIBSYSA-N D-Proline Chemical compound OC(=O)[C@H]1CCCN1 ONIBWKKTOPOVIA-SCSAIBSYSA-N 0.000 claims description 2
- 229930182820 D-proline Natural products 0.000 claims description 2
- 230000000762 glandular Effects 0.000 claims 2
- 108090000765 processed proteins & peptides Proteins 0.000 abstract description 54
- 230000000694 effects Effects 0.000 abstract description 13
- 102100023832 Prolyl endopeptidase FAP Human genes 0.000 abstract description 4
- 108010072257 fibroblast activation protein alpha Proteins 0.000 abstract description 4
- 239000000203 mixture Substances 0.000 description 54
- 229940024606 amino acid Drugs 0.000 description 41
- 235000001014 amino acid Nutrition 0.000 description 41
- 229920000642 polymer Polymers 0.000 description 38
- 239000002253 acid Chemical group 0.000 description 23
- 239000000693 micelle Substances 0.000 description 22
- 239000000126 substance Substances 0.000 description 21
- 102000004196 processed proteins & peptides Human genes 0.000 description 20
- 229910052739 hydrogen Inorganic materials 0.000 description 19
- 239000001257 hydrogen Substances 0.000 description 19
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 19
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 239000003814 drug Substances 0.000 description 17
- 239000002245 particle Substances 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- 125000001424 substituent group Chemical group 0.000 description 17
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 16
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 15
- 210000004899 c-terminal region Anatomy 0.000 description 15
- 239000000839 emulsion Substances 0.000 description 15
- 238000009472 formulation Methods 0.000 description 15
- 239000008194 pharmaceutical composition Substances 0.000 description 15
- 239000000758 substrate Substances 0.000 description 15
- 125000000524 functional group Chemical group 0.000 description 14
- 125000000623 heterocyclic group Chemical group 0.000 description 14
- 229920001577 copolymer Polymers 0.000 description 13
- 239000000463 material Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 12
- 239000000969 carrier Substances 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 229940079593 drug Drugs 0.000 description 12
- 229920000728 polyester Polymers 0.000 description 12
- 238000006467 substitution reaction Methods 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- 229920001223 polyethylene glycol Polymers 0.000 description 11
- 238000010521 absorption reaction Methods 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- 239000002552 dosage form Substances 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical group CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- 230000002441 reversible effect Effects 0.000 description 10
- 239000012265 solid product Substances 0.000 description 10
- 239000004094 surface-active agent Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 125000003275 alpha amino acid group Chemical group 0.000 description 9
- 125000003277 amino group Chemical group 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 229920000578 graft copolymer Polymers 0.000 description 9
- 239000002502 liposome Substances 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 231100000252 nontoxic Toxicity 0.000 description 9
- 230000003000 nontoxic effect Effects 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 102000016622 Dipeptidyl Peptidase 4 Human genes 0.000 description 8
- 101000930822 Giardia intestinalis Dipeptidyl-peptidase 4 Proteins 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000003937 drug carrier Substances 0.000 description 8
- 239000002674 ointment Substances 0.000 description 8
- 239000001301 oxygen Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000011593 sulfur Substances 0.000 description 8
- 230000001225 therapeutic effect Effects 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 7
- 125000001931 aliphatic group Chemical group 0.000 description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 230000008901 benefit Effects 0.000 description 7
- 125000005842 heteroatom Chemical group 0.000 description 7
- 150000007522 mineralic acids Chemical class 0.000 description 7
- 150000007524 organic acids Chemical class 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- 239000000546 pharmaceutical excipient Substances 0.000 description 7
- 239000007921 spray Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 108010010803 Gelatin Proteins 0.000 description 6
- 239000004472 Lysine Substances 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- 239000002202 Polyethylene glycol Substances 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 229920001400 block copolymer Polymers 0.000 description 6
- 229920002678 cellulose Chemical class 0.000 description 6
- 239000001913 cellulose Chemical class 0.000 description 6
- 235000010980 cellulose Nutrition 0.000 description 6
- 125000004122 cyclic group Chemical group 0.000 description 6
- 239000000499 gel Substances 0.000 description 6
- 239000008273 gelatin Substances 0.000 description 6
- 229920000159 gelatin Polymers 0.000 description 6
- 235000019322 gelatine Nutrition 0.000 description 6
- 235000011852 gelatine desserts Nutrition 0.000 description 6
- 235000011187 glycerol Nutrition 0.000 description 6
- 239000000017 hydrogel Substances 0.000 description 6
- 230000002209 hydrophobic effect Effects 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000004530 micro-emulsion Substances 0.000 description 6
- 150000002894 organic compounds Chemical class 0.000 description 6
- 239000003755 preservative agent Substances 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 5
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 229910019142 PO4 Inorganic materials 0.000 description 5
- 102000035195 Peptidases Human genes 0.000 description 5
- 108091005804 Peptidases Proteins 0.000 description 5
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 5
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 5
- 229930006000 Sucrose Natural products 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 125000002947 alkylene group Chemical group 0.000 description 5
- 239000003963 antioxidant agent Substances 0.000 description 5
- 235000006708 antioxidants Nutrition 0.000 description 5
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 239000006071 cream Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 150000002576 ketones Chemical group 0.000 description 5
- 239000004310 lactic acid Substances 0.000 description 5
- 235000014655 lactic acid Nutrition 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 239000011859 microparticle Substances 0.000 description 5
- 239000004005 microsphere Substances 0.000 description 5
- 238000007911 parenteral administration Methods 0.000 description 5
- 239000006072 paste Substances 0.000 description 5
- 239000000816 peptidomimetic Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000010452 phosphate Substances 0.000 description 5
- 229920001308 poly(aminoacid) Polymers 0.000 description 5
- 125000003367 polycyclic group Chemical group 0.000 description 5
- 229920001282 polysaccharide Polymers 0.000 description 5
- 239000005017 polysaccharide Substances 0.000 description 5
- 150000004804 polysaccharides Chemical class 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 235000018102 proteins Nutrition 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000005720 sucrose Substances 0.000 description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 5
- 239000000829 suppository Substances 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- 230000000699 topical effect Effects 0.000 description 5
- 239000000080 wetting agent Substances 0.000 description 5
- FUOOLUPWFVMBKG-UHFFFAOYSA-N 2-Aminoisobutyric acid Chemical compound CC(C)(N)C(O)=O FUOOLUPWFVMBKG-UHFFFAOYSA-N 0.000 description 4
- PECYZEOJVXMISF-UHFFFAOYSA-N 3-aminoalanine Chemical compound [NH3+]CC(N)C([O-])=O PECYZEOJVXMISF-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- 241000416162 Astragalus gummifer Species 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 4
- 229920001732 Lignosulfonate Polymers 0.000 description 4
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 229920002732 Polyanhydride Polymers 0.000 description 4
- 229920000954 Polyglycolide Polymers 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 229920001615 Tragacanth Polymers 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000002671 adjuvant Substances 0.000 description 4
- 150000001299 aldehydes Chemical group 0.000 description 4
- 235000010443 alginic acid Nutrition 0.000 description 4
- 229920000615 alginic acid Polymers 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000011324 bead Substances 0.000 description 4
- 229920002988 biodegradable polymer Polymers 0.000 description 4
- 239000004621 biodegradable polymer Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 235000015165 citric acid Nutrition 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 229940117927 ethylene oxide Drugs 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 239000000796 flavoring agent Substances 0.000 description 4
- 230000006870 function Effects 0.000 description 4
- 229940093915 gynecological organic acid Drugs 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 230000033001 locomotion Effects 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000002105 nanoparticle Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- 229920001542 oligosaccharide Chemical class 0.000 description 4
- 150000002482 oligosaccharides Chemical class 0.000 description 4
- 235000005985 organic acids Nutrition 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 4
- 239000006187 pill Substances 0.000 description 4
- 229920000747 poly(lactic acid) Polymers 0.000 description 4
- 229920001184 polypeptide Polymers 0.000 description 4
- 235000013772 propylene glycol Nutrition 0.000 description 4
- 229960004063 propylene glycol Drugs 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical compound [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- 238000007920 subcutaneous administration Methods 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 235000010487 tragacanth Nutrition 0.000 description 4
- 239000000196 tragacanth Substances 0.000 description 4
- 229940116362 tragacanth Drugs 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- 239000001993 wax Substances 0.000 description 4
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 3
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 3
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 3
- 244000215068 Acacia senegal Species 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- QNAYBMKLOCPYGJ-UWTATZPHSA-N D-alanine Chemical compound C[C@@H](N)C(O)=O QNAYBMKLOCPYGJ-UWTATZPHSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 229920000084 Gum arabic Polymers 0.000 description 3
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 108010031394 PLAL-lysine Proteins 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- 229920002873 Polyethylenimine Polymers 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 229940124639 Selective inhibitor Drugs 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 235000010489 acacia gum Nutrition 0.000 description 3
- 239000000205 acacia gum Substances 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 235000010419 agar Nutrition 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000000783 alginic acid Substances 0.000 description 3
- 229960001126 alginic acid Drugs 0.000 description 3
- 150000004781 alginic acids Chemical class 0.000 description 3
- 210000003484 anatomy Anatomy 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229960005261 aspartic acid Drugs 0.000 description 3
- 235000012216 bentonite Nutrition 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 3
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 150000007942 carboxylates Chemical group 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 3
- 125000006575 electron-withdrawing group Chemical group 0.000 description 3
- 230000003628 erosive effect Effects 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 230000009969 flowable effect Effects 0.000 description 3
- 125000003709 fluoroalkyl group Chemical group 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 238000007913 intrathecal administration Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 235000010445 lecithin Nutrition 0.000 description 3
- 239000000787 lecithin Substances 0.000 description 3
- 229940067606 lecithin Drugs 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- 150000007527 lewis bases Chemical class 0.000 description 3
- 239000006210 lotion Substances 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 210000005036 nerve Anatomy 0.000 description 3
- 239000012457 nonaqueous media Substances 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 229940049964 oleate Drugs 0.000 description 3
- 239000004006 olive oil Substances 0.000 description 3
- 235000008390 olive oil Nutrition 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000004584 polyacrylic acid Substances 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 150000003077 polyols Chemical class 0.000 description 3
- 235000019419 proteases Nutrition 0.000 description 3
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 3
- 210000003491 skin Anatomy 0.000 description 3
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical group 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 238000011191 terminal modification Methods 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 230000004614 tumor growth Effects 0.000 description 3
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 3
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 3
- 239000006216 vaginal suppository Substances 0.000 description 3
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical class OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- BWKMGYQJPOAASG-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CNC(C(=O)O)CC2=C1 BWKMGYQJPOAASG-UHFFFAOYSA-N 0.000 description 2
- GHMNEBMXJVXEPL-UHFFFAOYSA-N 1-(oxiran-2-yl)-3-phenylpropan-1-amine Chemical compound C1OC1C(N)CCC1=CC=CC=C1 GHMNEBMXJVXEPL-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- 125000001433 C-terminal amino-acid group Chemical group 0.000 description 2
- 0 CS(N(*)*)(=O)=O Chemical compound CS(N(*)*)(=O)=O 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229930186147 Cephalosporin Natural products 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- SRBFZHDQGSBBOR-IOVATXLUSA-N D-xylopyranose Chemical compound O[C@@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-IOVATXLUSA-N 0.000 description 2
- 229920002307 Dextran Polymers 0.000 description 2
- 108010016626 Dipeptides Proteins 0.000 description 2
- 102000003779 Dipeptidyl-peptidases and tripeptidyl-peptidases Human genes 0.000 description 2
- 108090000194 Dipeptidyl-peptidases and tripeptidyl-peptidases Proteins 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 2
- 108010059378 Endopeptidases Proteins 0.000 description 2
- 102000005593 Endopeptidases Human genes 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical class CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- 239000001856 Ethyl cellulose Chemical class 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 2
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 2
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 2
- QEFRNWWLZKMPFJ-ZXPFJRLXSA-N L-methionine (R)-S-oxide Chemical compound C[S@@](=O)CC[C@H]([NH3+])C([O-])=O QEFRNWWLZKMPFJ-ZXPFJRLXSA-N 0.000 description 2
- QEFRNWWLZKMPFJ-UHFFFAOYSA-N L-methionine sulphoxide Natural products CS(=O)CCC(N)C(O)=O QEFRNWWLZKMPFJ-UHFFFAOYSA-N 0.000 description 2
- SNDPXSYFESPGGJ-UHFFFAOYSA-N L-norVal-OH Natural products CCCC(N)C(O)=O SNDPXSYFESPGGJ-UHFFFAOYSA-N 0.000 description 2
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- 239000002879 Lewis base Substances 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- 235000019483 Peanut oil Nutrition 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 2
- 108090000708 Proteasome Endopeptidase Complex Proteins 0.000 description 2
- 102000004245 Proteasome Endopeptidase Complex Human genes 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- 206010039491 Sarcoma Diseases 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 208000009956 adenocarcinoma Diseases 0.000 description 2
- 235000004279 alanine Nutrition 0.000 description 2
- 125000002723 alicyclic group Chemical group 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 239000002518 antifoaming agent Substances 0.000 description 2
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 235000003704 aspartic acid Nutrition 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 2
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000036760 body temperature Effects 0.000 description 2
- 125000005620 boronic acid group Chemical group 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 229940124587 cephalosporin Drugs 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- 238000007385 chemical modification Methods 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 238000013270 controlled release Methods 0.000 description 2
- 235000005687 corn oil Nutrition 0.000 description 2
- 239000002285 corn oil Substances 0.000 description 2
- 235000012343 cottonseed oil Nutrition 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- XVOYSCVBGLVSOL-UHFFFAOYSA-N cysteic acid Chemical compound OC(=O)C(N)CS(O)(=O)=O XVOYSCVBGLVSOL-UHFFFAOYSA-N 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 238000001212 derivatisation Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000007884 disintegrant Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 238000012377 drug delivery Methods 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 230000007071 enzymatic hydrolysis Effects 0.000 description 2
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 229920001249 ethyl cellulose Chemical class 0.000 description 2
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 2
- 229940093471 ethyl oleate Drugs 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229920005570 flexible polymer Polymers 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 2
- 229930182830 galactose Natural products 0.000 description 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 238000005227 gel permeation chromatography Methods 0.000 description 2
- 235000021472 generally recognized as safe Nutrition 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 235000013922 glutamic acid Nutrition 0.000 description 2
- 239000004220 glutamic acid Substances 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000010255 intramuscular injection Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 239000002655 kraft paper Substances 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 229940070765 laurate Drugs 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 239000008297 liquid dosage form Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- SQDFHQJTAWCFIB-UHFFFAOYSA-N n-methylidenehydroxylamine Chemical compound ON=C SQDFHQJTAWCFIB-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000005151 nonafluorobutanesulfonyl group Chemical group FC(C(C(S(=O)(=O)*)(F)F)(F)F)(C(F)(F)F)F 0.000 description 2
- 231100000956 nontoxicity Toxicity 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 2
- 229920000962 poly(amidoamine) Polymers 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 239000004626 polylactic acid Substances 0.000 description 2
- 229920000656 polylysine Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229920001592 potato starch Polymers 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 235000003441 saturated fatty acids Nutrition 0.000 description 2
- 150000004671 saturated fatty acids Chemical class 0.000 description 2
- 239000008159 sesame oil Substances 0.000 description 2
- 235000011803 sesame oil Nutrition 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 125000005624 silicic acid group Chemical class 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 229940032147 starch Drugs 0.000 description 2
- 239000008174 sterile solution Substances 0.000 description 2
- 238000012916 structural analysis Methods 0.000 description 2
- 238000010254 subcutaneous injection Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 2
- 150000008163 sugars Chemical class 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- 238000013268 sustained release Methods 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 2
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 2
- 235000002374 tyrosine Nutrition 0.000 description 2
- 229940044959 vaginal cream Drugs 0.000 description 2
- 239000000522 vaginal cream Substances 0.000 description 2
- 229940044952 vaginal foam Drugs 0.000 description 2
- 239000000259 vaginal foam Substances 0.000 description 2
- 229940120293 vaginal suppository Drugs 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 2
- QIJRTFXNRTXDIP-UHFFFAOYSA-N (1-carboxy-2-sulfanylethyl)azanium;chloride;hydrate Chemical compound O.Cl.SCC(N)C(O)=O QIJRTFXNRTXDIP-UHFFFAOYSA-N 0.000 description 1
- RJNDLSVXEAOAIQ-ACGXKRRESA-N (2S)-4-(1-benzothiophen-3-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound S1C=C(C2=C1C=CC=C2)CC1C[C@H](NC1)C(=O)O RJNDLSVXEAOAIQ-ACGXKRRESA-N 0.000 description 1
- BTEOPQVSZPLYIX-LYNSQETBSA-N (2S)-4-[(3,4-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CC(Cc2ccc(F)c(F)c2)CN1 BTEOPQVSZPLYIX-LYNSQETBSA-N 0.000 description 1
- OZNJNIZYLUDCFQ-KIYNQFGBSA-N (2S)-4-[(3-methylphenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound Cc1cccc(CC2CN[C@@H](C2)C(O)=O)c1 OZNJNIZYLUDCFQ-KIYNQFGBSA-N 0.000 description 1
- MCVCNZBZJWWNLR-LYNSQETBSA-N (2S)-4-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CC(Cc2ccccc2C(F)(F)F)CN1 MCVCNZBZJWWNLR-LYNSQETBSA-N 0.000 description 1
- VAUPLMCGEOBTBB-UMJHXOGRSA-N (2S)-4-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CC(Cc2ccc(cc2)C(F)(F)F)CN1 VAUPLMCGEOBTBB-UMJHXOGRSA-N 0.000 description 1
- KIUKXJAPPMFGSW-DNGZLQJQSA-N (2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-Acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-DNGZLQJQSA-N 0.000 description 1
- HDQQHFFBCOTHJD-SECBINFHSA-N (2r)-2-(1,3-thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1SC=NC=1C[C@@]1(C(=O)O)CCCN1 HDQQHFFBCOTHJD-SECBINFHSA-N 0.000 description 1
- UZSKEZVGMIUIDY-SNVBAGLBSA-N (2r)-2-(furan-2-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=COC=1C[C@@]1(C(=O)O)CCCN1 UZSKEZVGMIUIDY-SNVBAGLBSA-N 0.000 description 1
- XUIISGXVNJTYLV-MRXNPFEDSA-N (2r)-2-(naphthalen-1-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC2=CC=CC=C2C=1C[C@@]1(C(=O)O)CCCN1 XUIISGXVNJTYLV-MRXNPFEDSA-N 0.000 description 1
- UQBLBPPJSSMFIP-MRXNPFEDSA-N (2r)-2-(naphthalen-2-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=C2C=CC=CC2=CC=1C[C@@]1(C(=O)O)CCCN1 UQBLBPPJSSMFIP-MRXNPFEDSA-N 0.000 description 1
- WQLOHNORKALADI-LLVKDONJSA-N (2r)-2-(pyridin-2-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=NC=1C[C@@]1(C(=O)O)CCCN1 WQLOHNORKALADI-LLVKDONJSA-N 0.000 description 1
- DZNCHXYDYRQSFD-LLVKDONJSA-N (2r)-2-(pyridin-3-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=CN=CC=1C[C@@]1(C(=O)O)CCCN1 DZNCHXYDYRQSFD-LLVKDONJSA-N 0.000 description 1
- JKNDDGIOXJCWBM-LLVKDONJSA-N (2r)-2-(pyridin-4-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=NC=CC=1C[C@@]1(C(=O)O)CCCN1 JKNDDGIOXJCWBM-LLVKDONJSA-N 0.000 description 1
- WGTWXXCXKFNJAN-SNVBAGLBSA-N (2r)-2-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=CSC=1C[C@@]1(C(=O)O)CCCN1 WGTWXXCXKFNJAN-SNVBAGLBSA-N 0.000 description 1
- PCTJHIHRDWVCGP-SNVBAGLBSA-N (2r)-2-(thiophen-3-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C1=CSC=C1C[C@@]1(C(=O)O)CCCN1 PCTJHIHRDWVCGP-SNVBAGLBSA-N 0.000 description 1
- QUXISNJROHBEGT-GFCCVEGCSA-N (2r)-2-[(2,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(Cl)C=C(Cl)C=1C[C@@]1(C(=O)O)CCCN1 QUXISNJROHBEGT-GFCCVEGCSA-N 0.000 description 1
- SBRRTKZQYIULEQ-GFCCVEGCSA-N (2r)-2-[(2-bromophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=C(Br)C=1C[C@@]1(C(=O)O)CCCN1 SBRRTKZQYIULEQ-GFCCVEGCSA-N 0.000 description 1
- NXLJDEBGXLSVPT-CYBMUJFWSA-N (2r)-2-[(2-cyanophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=C(C#N)C=1C[C@@]1(C(=O)O)CCCN1 NXLJDEBGXLSVPT-CYBMUJFWSA-N 0.000 description 1
- BWPBAGONMSRISC-GFCCVEGCSA-N (2r)-2-[(2-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=C(F)C=1C[C@@]1(C(=O)O)CCCN1 BWPBAGONMSRISC-GFCCVEGCSA-N 0.000 description 1
- IMLACNKYARHFMP-CYBMUJFWSA-N (2r)-2-[(2-methylphenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound CC1=CC=CC=C1C[C@]1(C(O)=O)NCCC1 IMLACNKYARHFMP-CYBMUJFWSA-N 0.000 description 1
- ZRZRSTPZRDZVOH-GFCCVEGCSA-N (2r)-2-[(2-nitrophenyl)methyl]pyrrolidin-1-ium-2-carboxylate Chemical compound C=1C=CC=C([N+]([O-])=O)C=1C[C@@]1(C(=O)O)CCCN1 ZRZRSTPZRDZVOH-GFCCVEGCSA-N 0.000 description 1
- PHFNAHUCOIATCH-GFCCVEGCSA-N (2r)-2-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(Cl)C(Cl)=CC=1C[C@@]1(C(=O)O)CCCN1 PHFNAHUCOIATCH-GFCCVEGCSA-N 0.000 description 1
- RBDKUPICBQPHRF-GFCCVEGCSA-N (2r)-2-[(3-bromophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC(Br)=CC=1C[C@@]1(C(=O)O)CCCN1 RBDKUPICBQPHRF-GFCCVEGCSA-N 0.000 description 1
- QILPJGLDWUAYCI-CYBMUJFWSA-N (2r)-2-[(3-cyanophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC(C#N)=CC=1C[C@@]1(C(=O)O)CCCN1 QILPJGLDWUAYCI-CYBMUJFWSA-N 0.000 description 1
- GVPJGVXMPHPURT-GFCCVEGCSA-N (2r)-2-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC(F)=CC=1C[C@@]1(C(=O)O)CCCN1 GVPJGVXMPHPURT-GFCCVEGCSA-N 0.000 description 1
- VVINXXDRWMSRRT-CYBMUJFWSA-N (2r)-2-[(3-methylphenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound CC1=CC=CC(C[C@@]2(NCCC2)C(O)=O)=C1 VVINXXDRWMSRRT-CYBMUJFWSA-N 0.000 description 1
- OKQSSUZDNQXGEZ-GFCCVEGCSA-N (2r)-2-[(3-nitrophenyl)methyl]pyrrolidin-1-ium-2-carboxylate Chemical compound C=1C=CC([N+]([O-])=O)=CC=1C[C@@]1(C(=O)O)CCCN1 OKQSSUZDNQXGEZ-GFCCVEGCSA-N 0.000 description 1
- WNODPTSLFFXSOF-GFCCVEGCSA-N (2r)-2-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(Br)C=CC=1C[C@@]1(C(=O)O)CCCN1 WNODPTSLFFXSOF-GFCCVEGCSA-N 0.000 description 1
- DUUJMFUJPCIUHO-GFCCVEGCSA-N (2r)-2-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(Cl)C=CC=1C[C@@]1(C(=O)O)CCCN1 DUUJMFUJPCIUHO-GFCCVEGCSA-N 0.000 description 1
- WADTXUILLZVMPF-CYBMUJFWSA-N (2r)-2-[(4-cyanophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(C#N)C=CC=1C[C@@]1(C(=O)O)CCCN1 WADTXUILLZVMPF-CYBMUJFWSA-N 0.000 description 1
- ZEZRGYZCUMIHIY-GFCCVEGCSA-N (2r)-2-[(4-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(F)C=CC=1C[C@@]1(C(=O)O)CCCN1 ZEZRGYZCUMIHIY-GFCCVEGCSA-N 0.000 description 1
- CLNWOXRWDCFVOR-GFCCVEGCSA-N (2r)-2-[(4-iodophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(I)C=CC=1C[C@@]1(C(=O)O)CCCN1 CLNWOXRWDCFVOR-GFCCVEGCSA-N 0.000 description 1
- SBPRAVICAMGXQI-CYBMUJFWSA-N (2r)-2-[(4-methylphenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1C[C@]1(C(O)=O)NCCC1 SBPRAVICAMGXQI-CYBMUJFWSA-N 0.000 description 1
- LNRKMGJPHYUDQH-GFCCVEGCSA-N (2r)-2-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-2-carboxylate Chemical compound C=1C=C([N+]([O-])=O)C=CC=1C[C@@]1(C(=O)O)CCCN1 LNRKMGJPHYUDQH-GFCCVEGCSA-N 0.000 description 1
- RKCRARCUFNVFEL-SNVBAGLBSA-N (2r)-2-[(5-bromothiophen-2-yl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(Br)SC=1C[C@@]1(C(=O)O)CCCN1 RKCRARCUFNVFEL-SNVBAGLBSA-N 0.000 description 1
- RZFFSFLYGNAIMG-GFCCVEGCSA-N (2r)-2-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=C(C(F)(F)F)C=1C[C@@]1(C(=O)O)CCCN1 RZFFSFLYGNAIMG-GFCCVEGCSA-N 0.000 description 1
- VHZMEWAJAYHKRY-GFCCVEGCSA-N (2r)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC(C(F)(F)F)=CC=1C[C@@]1(C(=O)O)CCCN1 VHZMEWAJAYHKRY-GFCCVEGCSA-N 0.000 description 1
- LIMDUEXRPQAYJT-GFCCVEGCSA-N (2r)-2-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid Chemical compound C=1C=C(C(F)(F)F)C=CC=1C[C@@]1(C(=O)O)CCCN1 LIMDUEXRPQAYJT-GFCCVEGCSA-N 0.000 description 1
- CDKYHCAPTJLVRS-GOSISDBHSA-N (2r)-2-benzhydrylpyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)[C@@]1(C(=O)O)CCCN1 CDKYHCAPTJLVRS-GOSISDBHSA-N 0.000 description 1
- LIHLFIASPODZOB-GFCCVEGCSA-N (2r)-2-benzylpyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=CC=1C[C@@]1(C(=O)O)CCCN1 LIHLFIASPODZOB-GFCCVEGCSA-N 0.000 description 1
- LBXWHVGFCUFRNN-QMMMGPOBSA-N (2r)-2-prop-1-ynylpyrrolidine-2-carboxylic acid Chemical compound CC#C[C@@]1(C(O)=O)CCCN1 LBXWHVGFCUFRNN-QMMMGPOBSA-N 0.000 description 1
- WUQVGKNYSGCODM-KFJBMODSSA-N (2s)-1-(1-phenylethyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=CC=1C(C)N1CCC[C@H]1C(O)=O WUQVGKNYSGCODM-KFJBMODSSA-N 0.000 description 1
- FQRURPFZTFUXEZ-MRVPVSSYSA-N (2s)-2,3,3,3-tetrafluoro-2-(n-fluoroanilino)propanoic acid Chemical compound OC(=O)[C@](F)(C(F)(F)F)N(F)C1=CC=CC=C1 FQRURPFZTFUXEZ-MRVPVSSYSA-N 0.000 description 1
- AALYNABLSOHPQK-BYPYZUCNSA-N (2s)-2-(1,3-thiazol-4-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CSC=N1 AALYNABLSOHPQK-BYPYZUCNSA-N 0.000 description 1
- YPJJGMCMOHDOFZ-ZETCQYMHSA-N (2s)-2-(1-benzothiophen-3-ylamino)propanoic acid Chemical compound C1=CC=C2C(N[C@@H](C)C(O)=O)=CSC2=C1 YPJJGMCMOHDOFZ-ZETCQYMHSA-N 0.000 description 1
- ZHHDZLMQFQRYMD-AWEZNQCLSA-N (2s)-2-(3-phenylpropyl)pyrrolidine-2-carboxylic acid Chemical compound C=1C=CC=CC=1CCC[C@@]1(C(=O)O)CCCN1 ZHHDZLMQFQRYMD-AWEZNQCLSA-N 0.000 description 1
- FDEWJJWPQXUJDU-NSHDSACASA-N (2s)-2-(anthracen-9-ylamino)propanoic acid Chemical compound C1=CC=C2C(N[C@@H](C)C(O)=O)=C(C=CC=C3)C3=CC2=C1 FDEWJJWPQXUJDU-NSHDSACASA-N 0.000 description 1
- BVAUMRCGVHUWOZ-ZETCQYMHSA-N (2s)-2-(cyclohexylazaniumyl)propanoate Chemical compound OC(=O)[C@H](C)NC1CCCCC1 BVAUMRCGVHUWOZ-ZETCQYMHSA-N 0.000 description 1
- VVDBQHCKPZBJPG-YFKPBYRVSA-N (2s)-2-(furan-2-ylazaniumyl)propanoate Chemical compound OC(=O)[C@H](C)NC1=CC=CO1 VVDBQHCKPZBJPG-YFKPBYRVSA-N 0.000 description 1
- IYKLZBIWFXPUCS-VIFPVBQESA-N (2s)-2-(naphthalen-1-ylamino)propanoic acid Chemical compound C1=CC=C2C(N[C@@H](C)C(O)=O)=CC=CC2=C1 IYKLZBIWFXPUCS-VIFPVBQESA-N 0.000 description 1
- RWLSBXBFZHDHHX-VIFPVBQESA-N (2s)-2-(naphthalen-2-ylamino)propanoic acid Chemical compound C1=CC=CC2=CC(N[C@@H](C)C(O)=O)=CC=C21 RWLSBXBFZHDHHX-VIFPVBQESA-N 0.000 description 1
- HKUAWRVNDCVEHT-NSHDSACASA-N (2s)-2-(pyren-4-ylamino)propanoic acid Chemical compound C1=CC=C2C(N[C@@H](C)C(O)=O)=CC3=CC=CC4=CC=C1C2=C34 HKUAWRVNDCVEHT-NSHDSACASA-N 0.000 description 1
- CNMAQBJBWQQZFZ-LURJTMIESA-N (2s)-2-(pyridin-2-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC=CC=N1 CNMAQBJBWQQZFZ-LURJTMIESA-N 0.000 description 1
- WTKYBFQVZPCGAO-LURJTMIESA-N (2s)-2-(pyridin-3-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC=CN=C1 WTKYBFQVZPCGAO-LURJTMIESA-N 0.000 description 1
- SAAQPSNNIOGFSQ-LURJTMIESA-N (2s)-2-(pyridin-4-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC=NC=C1 SAAQPSNNIOGFSQ-LURJTMIESA-N 0.000 description 1
- MRTPISKDZDHEQI-YFKPBYRVSA-N (2s)-2-(tert-butylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC(C)(C)C MRTPISKDZDHEQI-YFKPBYRVSA-N 0.000 description 1
- WRQSUCJAKAMYMQ-YFKPBYRVSA-N (2s)-2-(thiophen-3-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC=1C=CSC=1 WRQSUCJAKAMYMQ-YFKPBYRVSA-N 0.000 description 1
- DAHQWPGIWOKABN-SSDOTTSWSA-N (2s)-2-amino-2-(5-bromothiophen-2-yl)propanoic acid Chemical compound OC(=O)[C@@](N)(C)C1=CC=C(Br)S1 DAHQWPGIWOKABN-SSDOTTSWSA-N 0.000 description 1
- NPDBDJFLKKQMCM-SCSAIBSYSA-N (2s)-2-amino-3,3-dimethylbutanoic acid Chemical compound CC(C)(C)[C@H](N)C(O)=O NPDBDJFLKKQMCM-SCSAIBSYSA-N 0.000 description 1
- PECGVEGMRUZOML-AWEZNQCLSA-N (2s)-2-amino-3,3-diphenylpropanoic acid Chemical compound C=1C=CC=CC=1C([C@H](N)C(O)=O)C1=CC=CC=C1 PECGVEGMRUZOML-AWEZNQCLSA-N 0.000 description 1
- SWJFYJHCOWRRLR-QMMMGPOBSA-N (2s)-2-amino-3-(2,4,5-trifluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(F)=C(F)C=C1F SWJFYJHCOWRRLR-QMMMGPOBSA-N 0.000 description 1
- ZEWXVRJSLTXWON-JTQLQIEISA-N (2s)-2-amino-3-(2,4-dimethylphenyl)propanoic acid Chemical compound CC1=CC=C(C[C@H](N)C(O)=O)C(C)=C1 ZEWXVRJSLTXWON-JTQLQIEISA-N 0.000 description 1
- JFVLNTLXEZDFHW-QMMMGPOBSA-N (2s)-2-amino-3-(2-bromophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1Br JFVLNTLXEZDFHW-QMMMGPOBSA-N 0.000 description 1
- QDQWGGPXZQIUPR-QMMMGPOBSA-N (2s)-2-amino-3-(2-carbamoylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1C(N)=O QDQWGGPXZQIUPR-QMMMGPOBSA-N 0.000 description 1
- NHBKDLSKDKUGSB-VIFPVBQESA-N (2s)-2-amino-3-(2-methylphenyl)propanoic acid Chemical compound CC1=CC=CC=C1C[C@H](N)C(O)=O NHBKDLSKDKUGSB-VIFPVBQESA-N 0.000 description 1
- NRCSJHVDTAAISV-QMMMGPOBSA-N (2s)-2-amino-3-(3,4-dichlorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(Cl)C(Cl)=C1 NRCSJHVDTAAISV-QMMMGPOBSA-N 0.000 description 1
- GDMOHOYNMWWBAU-QMMMGPOBSA-N (2s)-2-amino-3-(3-bromophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(Br)=C1 GDMOHOYNMWWBAU-QMMMGPOBSA-N 0.000 description 1
- NUHHYFSZGZXEGU-QMMMGPOBSA-N (2s)-2-amino-3-(3-carbamoylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(C(N)=O)=C1 NUHHYFSZGZXEGU-QMMMGPOBSA-N 0.000 description 1
- ZHUOMTMPTNZOJE-VIFPVBQESA-N (2s)-2-amino-3-(3-cyanophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(C#N)=C1 ZHUOMTMPTNZOJE-VIFPVBQESA-N 0.000 description 1
- BABTYIKKTLTNRX-QMMMGPOBSA-N (2s)-2-amino-3-(3-iodophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(I)=C1 BABTYIKKTLTNRX-QMMMGPOBSA-N 0.000 description 1
- PEMUHKUIQHFMTH-QMMMGPOBSA-N (2s)-2-amino-3-(4-bromophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(Br)C=C1 PEMUHKUIQHFMTH-QMMMGPOBSA-N 0.000 description 1
- OZVAXCWACWDNIQ-QMMMGPOBSA-N (2s)-2-amino-3-(4-carbamoylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(N)=O)C=C1 OZVAXCWACWDNIQ-QMMMGPOBSA-N 0.000 description 1
- KWIPUXXIFQQMKN-VIFPVBQESA-N (2s)-2-amino-3-(4-cyanophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C#N)C=C1 KWIPUXXIFQQMKN-VIFPVBQESA-N 0.000 description 1
- DQLHSFUMICQIMB-VIFPVBQESA-N (2s)-2-amino-3-(4-methylphenyl)propanoic acid Chemical compound CC1=CC=C(C[C@H](N)C(O)=O)C=C1 DQLHSFUMICQIMB-VIFPVBQESA-N 0.000 description 1
- CSJZKSXYLTYFPU-NSHDSACASA-N (2s)-2-amino-3-(4-tert-butylphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC=C(C[C@H](N)C(O)=O)C=C1 CSJZKSXYLTYFPU-NSHDSACASA-N 0.000 description 1
- IOABLDGLYOGEHY-QMMMGPOBSA-N (2s)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1C(F)(F)F IOABLDGLYOGEHY-QMMMGPOBSA-N 0.000 description 1
- YBVDQQQEPCEKPR-VIFPVBQESA-N (2s)-2-amino-3-[3-(aminomethyl)phenyl]propanoic acid Chemical compound NCC1=CC=CC(C[C@H](N)C(O)=O)=C1 YBVDQQQEPCEKPR-VIFPVBQESA-N 0.000 description 1
- BURBNIPKSRJAIQ-QMMMGPOBSA-N (2s)-2-amino-3-[3-(trifluoromethyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(C(F)(F)F)=C1 BURBNIPKSRJAIQ-QMMMGPOBSA-N 0.000 description 1
- GNVNKFUEUXUWDV-VIFPVBQESA-N (2s)-2-amino-3-[4-(aminomethyl)phenyl]propanoic acid Chemical compound NCC1=CC=C(C[C@H](N)C(O)=O)C=C1 GNVNKFUEUXUWDV-VIFPVBQESA-N 0.000 description 1
- SAQLLHDEEMZENJ-VIFPVBQESA-N (2s)-2-amino-3-[4-(phosphonomethyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(CP(O)(O)=O)C=C1 SAQLLHDEEMZENJ-VIFPVBQESA-N 0.000 description 1
- CRFFPDBJLGAGQL-QMMMGPOBSA-N (2s)-2-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(F)(F)F)C=C1 CRFFPDBJLGAGQL-QMMMGPOBSA-N 0.000 description 1
- VOIZSAUUYAGTMS-LURJTMIESA-N (2s)-2-amino-3-thiophen-3-ylpropanoic acid Chemical compound OC(=O)[C@@H](N)CC=1C=CSC=1 VOIZSAUUYAGTMS-LURJTMIESA-N 0.000 description 1
- LLVUHQYJZJUDAM-ZETCQYMHSA-N (2s)-2-azaniumyl-3-(2,4-dinitrophenyl)propanoate Chemical compound OC(=O)[C@@H](N)CC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LLVUHQYJZJUDAM-ZETCQYMHSA-N 0.000 description 1
- BKXVGLPBXYBDDM-QMMMGPOBSA-N (2s)-2-azaniumyl-3-(2-iodophenyl)propanoate Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1I BKXVGLPBXYBDDM-QMMMGPOBSA-N 0.000 description 1
- SDZGVFSSLGTJAJ-ZETCQYMHSA-N (2s)-2-azaniumyl-3-(2-nitrophenyl)propanoate Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1[N+]([O-])=O SDZGVFSSLGTJAJ-ZETCQYMHSA-N 0.000 description 1
- YTHDRUZHNYKZGF-QMMMGPOBSA-N (2s)-2-azaniumyl-3-(3-nitrophenyl)propanoate Chemical compound OC(=O)[C@@H](N)CC1=CC=CC([N+]([O-])=O)=C1 YTHDRUZHNYKZGF-QMMMGPOBSA-N 0.000 description 1
- BBRMBENCQBOTHY-JTQLQIEISA-N (2s)-2-azaniumyl-3-(4-fluorophenyl)-2-methylpropanoate Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(F)C=C1 BBRMBENCQBOTHY-JTQLQIEISA-N 0.000 description 1
- XGUXJMWPVJQIHI-YFKPBYRVSA-N (2s)-2-azaniumyl-3-cyclopropylpropanoate Chemical compound [O-]C(=O)[C@@H]([NH3+])CC1CC1 XGUXJMWPVJQIHI-YFKPBYRVSA-N 0.000 description 1
- WMOPDYHAXAWSRC-AXDSSHIGSA-N (2s)-4-(pyridin-4-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=NC=C1 WMOPDYHAXAWSRC-AXDSSHIGSA-N 0.000 description 1
- AAMQQBXBFQNULK-NETXQHHPSA-N (2s)-4-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=CS1 AAMQQBXBFQNULK-NETXQHHPSA-N 0.000 description 1
- NNVHLHOKPAPADH-GKAPJAKFSA-N (2s)-4-(thiophen-3-ylmethyl)pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CSC=C1 NNVHLHOKPAPADH-GKAPJAKFSA-N 0.000 description 1
- RGFRGRZSMVXTLF-UMJHXOGRSA-N (2s)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=CC(F)=C1 RGFRGRZSMVXTLF-UMJHXOGRSA-N 0.000 description 1
- KBZRUYGFVGXOBD-UMJHXOGRSA-N (2s)-4-[(4-bromophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=C(Br)C=C1 KBZRUYGFVGXOBD-UMJHXOGRSA-N 0.000 description 1
- BQRKLZOSDYHVMW-UMJHXOGRSA-N (2s)-4-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=C(Cl)C=C1 BQRKLZOSDYHVMW-UMJHXOGRSA-N 0.000 description 1
- WXRWCYJRYYTPQO-UMJHXOGRSA-N (2s)-4-[(4-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=C(F)C=C1 WXRWCYJRYYTPQO-UMJHXOGRSA-N 0.000 description 1
- HYIWWGWRALFBGE-KIYNQFGBSA-N (2s)-4-[(4-methylphenyl)methyl]pyrrolidine-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1CC1C[C@@H](C(O)=O)NC1 HYIWWGWRALFBGE-KIYNQFGBSA-N 0.000 description 1
- KKADPQPSLBFPHI-UMJHXOGRSA-N (2s)-4-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=CC(C(F)(F)F)=C1 KKADPQPSLBFPHI-UMJHXOGRSA-N 0.000 description 1
- JQVMMZMKXGQVGQ-DTIOYNMSSA-N (2s)-4-benzylpyrrolidine-2-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC1CC1=CC=CC=C1 JQVMMZMKXGQVGQ-DTIOYNMSSA-N 0.000 description 1
- ASKGBBKGACJSEL-SCZZXKLOSA-N (2s,3r)-2-(benzylamino)-3-phosphonooxybutanoic acid Chemical compound OP(=O)(O)O[C@H](C)[C@@H](C(O)=O)NCC1=CC=CC=C1 ASKGBBKGACJSEL-SCZZXKLOSA-N 0.000 description 1
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 1
- RYNQKSJRFHJZTK-UHFFFAOYSA-N (3-methoxy-3-methylbutyl) acetate Chemical compound COC(C)(C)CCOC(C)=O RYNQKSJRFHJZTK-UHFFFAOYSA-N 0.000 description 1
- XTJDGOQYFKHEJR-ZJUUUORDSA-N (3r,4s)-4-phenylpyrrolidine-3-carboxylic acid Chemical compound OC(=O)[C@H]1CNC[C@@H]1C1=CC=CC=C1 XTJDGOQYFKHEJR-ZJUUUORDSA-N 0.000 description 1
- VRYALKFFQXWPIH-PBXRRBTRSA-N (3r,4s,5r)-3,4,5,6-tetrahydroxyhexanal Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)CC=O VRYALKFFQXWPIH-PBXRRBTRSA-N 0.000 description 1
- OKWXYXBTTNSUBY-JGVFFNPUSA-N (3s,4r)-4-(2,3-dichlorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC(Cl)=C1Cl OKWXYXBTTNSUBY-JGVFFNPUSA-N 0.000 description 1
- HNZCOZZIPXDYED-VHSXEESVSA-N (3s,4r)-4-(2,3-dimethoxyphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound COC1=CC=CC([C@H]2[C@@H](CNC2)C(O)=O)=C1OC HNZCOZZIPXDYED-VHSXEESVSA-N 0.000 description 1
- VKDXYQPZUWSCKU-DTWKUNHWSA-N (3s,4r)-4-(2,5-dichlorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC(Cl)=CC=C1Cl VKDXYQPZUWSCKU-DTWKUNHWSA-N 0.000 description 1
- YRGSCRAWFNNSIP-DTWKUNHWSA-N (3s,4r)-4-(2-bromophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=C1Br YRGSCRAWFNNSIP-DTWKUNHWSA-N 0.000 description 1
- JGQMSOHBYCXLNS-DTWKUNHWSA-N (3s,4r)-4-(2-chlorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=C1Cl JGQMSOHBYCXLNS-DTWKUNHWSA-N 0.000 description 1
- IHZBMIWAIOOPFC-WDEREUQCSA-N (3s,4r)-4-(2-cyanophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=C1C#N IHZBMIWAIOOPFC-WDEREUQCSA-N 0.000 description 1
- YVTADGCUSGBFIQ-DTWKUNHWSA-N (3s,4r)-4-(2-fluorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=C1F YVTADGCUSGBFIQ-DTWKUNHWSA-N 0.000 description 1
- IFIKXMUAZCUXJB-DTWKUNHWSA-N (3s,4r)-4-(2-hydroxyphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=C1O IFIKXMUAZCUXJB-DTWKUNHWSA-N 0.000 description 1
- PLUOWDZCCZMKBL-WDEREUQCSA-N (3s,4r)-4-(2-methylphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound CC1=CC=CC=C1[C@H]1[C@H](C(O)=O)CNC1 PLUOWDZCCZMKBL-WDEREUQCSA-N 0.000 description 1
- UAPQUOMPLVHDJP-DTWKUNHWSA-N (3s,4r)-4-(2-nitrophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=C1[N+]([O-])=O UAPQUOMPLVHDJP-DTWKUNHWSA-N 0.000 description 1
- ZBPIXKKRVLZQIU-VHSXEESVSA-N (3s,4r)-4-(3,4-dimethoxyphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound C1=C(OC)C(OC)=CC=C1[C@H]1[C@H](C(O)=O)CNC1 ZBPIXKKRVLZQIU-VHSXEESVSA-N 0.000 description 1
- IETUAIGPGMFFRV-VHSXEESVSA-N (3s,4r)-4-(3-bromophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC(Br)=C1 IETUAIGPGMFFRV-VHSXEESVSA-N 0.000 description 1
- BJGWYFRCQPUPCO-VHSXEESVSA-N (3s,4r)-4-(3-chlorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC(Cl)=C1 BJGWYFRCQPUPCO-VHSXEESVSA-N 0.000 description 1
- VJUVSFBFNRDUCR-WDEREUQCSA-N (3s,4r)-4-(3-cyanophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC(C#N)=C1 VJUVSFBFNRDUCR-WDEREUQCSA-N 0.000 description 1
- NKGQZNWWPOLORG-VHSXEESVSA-N (3s,4r)-4-(3-fluorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC(F)=C1 NKGQZNWWPOLORG-VHSXEESVSA-N 0.000 description 1
- PVSZHVAUFQAERY-VHSXEESVSA-N (3s,4r)-4-(3-hydroxyphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC(O)=C1 PVSZHVAUFQAERY-VHSXEESVSA-N 0.000 description 1
- DPBJZZNRRNSKIH-WDEREUQCSA-N (3s,4r)-4-(3-methoxyphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound COC1=CC=CC([C@H]2[C@@H](CNC2)C(O)=O)=C1 DPBJZZNRRNSKIH-WDEREUQCSA-N 0.000 description 1
- UDNDGSKOCKZZPN-WDEREUQCSA-N (3s,4r)-4-(3-methylphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound CC1=CC=CC([C@H]2[C@@H](CNC2)C(O)=O)=C1 UDNDGSKOCKZZPN-WDEREUQCSA-N 0.000 description 1
- FQRPQUABFIUZMG-VHSXEESVSA-N (3s,4r)-4-(3-nitrophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC([N+]([O-])=O)=C1 FQRPQUABFIUZMG-VHSXEESVSA-N 0.000 description 1
- XXAATEOPXCAIIN-VHSXEESVSA-N (3s,4r)-4-(4-bromophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C(Br)C=C1 XXAATEOPXCAIIN-VHSXEESVSA-N 0.000 description 1
- UOAQYJHCQPXLOP-VHSXEESVSA-N (3s,4r)-4-(4-chlorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C(Cl)C=C1 UOAQYJHCQPXLOP-VHSXEESVSA-N 0.000 description 1
- NSAIUTIMXGDOKA-WDEREUQCSA-N (3s,4r)-4-(4-cyanophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C(C#N)C=C1 NSAIUTIMXGDOKA-WDEREUQCSA-N 0.000 description 1
- YXKAESVIGMPPNB-VHSXEESVSA-N (3s,4r)-4-(4-fluorophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C(F)C=C1 YXKAESVIGMPPNB-VHSXEESVSA-N 0.000 description 1
- IJVDKAOETNQRCC-VHSXEESVSA-N (3s,4r)-4-(4-hydroxyphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C(O)C=C1 IJVDKAOETNQRCC-VHSXEESVSA-N 0.000 description 1
- FQHFMERRNRYSDS-WDEREUQCSA-N (3s,4r)-4-(4-methoxyphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@H](C(O)=O)CNC1 FQHFMERRNRYSDS-WDEREUQCSA-N 0.000 description 1
- HOMQPSPEVRFBRQ-WDEREUQCSA-N (3s,4r)-4-(4-methylphenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound C1=CC(C)=CC=C1[C@H]1[C@H](C(O)=O)CNC1 HOMQPSPEVRFBRQ-WDEREUQCSA-N 0.000 description 1
- UHORFZASTCWSKS-VHSXEESVSA-N (3s,4r)-4-(4-nitrophenyl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C([N+]([O-])=O)C=C1 UHORFZASTCWSKS-VHSXEESVSA-N 0.000 description 1
- PJMXSRWOACCNPD-DTWKUNHWSA-N (3s,4r)-4-(6-methoxypyridin-3-yl)pyrrolidin-1-ium-3-carboxylate Chemical compound C1=NC(OC)=CC=C1[C@H]1[C@H](C(O)=O)CNC1 PJMXSRWOACCNPD-DTWKUNHWSA-N 0.000 description 1
- CDBDQHBPLLUGEZ-DTWKUNHWSA-N (3s,4r)-4-[2-(trifluoromethyl)phenyl]pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=C1C(F)(F)F CDBDQHBPLLUGEZ-DTWKUNHWSA-N 0.000 description 1
- UMJACUAPLJFIAQ-VHSXEESVSA-N (3s,4r)-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC(C(F)(F)F)=C1 UMJACUAPLJFIAQ-VHSXEESVSA-N 0.000 description 1
- MFKDNBMRBWNZTH-VHSXEESVSA-N (3s,4r)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C(C(F)(F)F)C=C1 MFKDNBMRBWNZTH-VHSXEESVSA-N 0.000 description 1
- NLVXTQPLGJBYLL-UONOGXRCSA-N (3s,4r)-4-naphthalen-1-ylpyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC2=CC=CC=C12 NLVXTQPLGJBYLL-UONOGXRCSA-N 0.000 description 1
- FXFJYUXPFQIPNN-UONOGXRCSA-N (3s,4r)-4-naphthalen-2-ylpyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=C(C=CC=C2)C2=C1 FXFJYUXPFQIPNN-UONOGXRCSA-N 0.000 description 1
- BKFWMNFJNGQFKR-DTWKUNHWSA-N (3s,4r)-4-pyridin-3-ylpyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CN=C1 BKFWMNFJNGQFKR-DTWKUNHWSA-N 0.000 description 1
- HALDKXLCWGGLRJ-DTWKUNHWSA-N (3s,4r)-4-pyridin-4-ylpyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=NC=C1 HALDKXLCWGGLRJ-DTWKUNHWSA-N 0.000 description 1
- QJBJLPGQLUJIES-JGVFFNPUSA-N (3s,4r)-4-thiophen-3-ylpyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CSC=C1 QJBJLPGQLUJIES-JGVFFNPUSA-N 0.000 description 1
- KMTSLALPZKTAJM-RNFRBKRXSA-N (3s,4s)-4-(furan-2-yl)pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CO1 KMTSLALPZKTAJM-RNFRBKRXSA-N 0.000 description 1
- NQULSPPHDFWDLL-NKWVEPMBSA-N (3s,4s)-4-propan-2-ylpyrrolidin-1-ium-3-carboxylate Chemical compound CC(C)[C@@H]1CNC[C@H]1C(O)=O NQULSPPHDFWDLL-NKWVEPMBSA-N 0.000 description 1
- PINZELCBMJAACE-HTQZYQBOSA-N (3s,4s)-4-pyridin-2-ylpyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CC=N1 PINZELCBMJAACE-HTQZYQBOSA-N 0.000 description 1
- DZRMEYBMQAOZAY-RNFRBKRXSA-N (3s,4s)-4-thiophen-2-ylpyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)[C@@H]1CNC[C@H]1C1=CC=CS1 DZRMEYBMQAOZAY-RNFRBKRXSA-N 0.000 description 1
- GVJHHUAWPYXKBD-IEOSBIPESA-N (R)-alpha-Tocopherol Natural products OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-IEOSBIPESA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (e)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 1
- 229940058015 1,3-butylene glycol Drugs 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- QWOZZTWBWQMEPD-UHFFFAOYSA-N 1-(2-ethoxypropoxy)propan-2-ol Chemical compound CCOC(C)COCC(C)O QWOZZTWBWQMEPD-UHFFFAOYSA-N 0.000 description 1
- OJDUHLJOZRYLPW-UHFFFAOYSA-N 1-(3,5-dimethoxyphenyl)pyrrolidine-3-carboxylic acid Chemical compound COC1=CC(OC)=CC(N2CC(CC2)C(O)=O)=C1 OJDUHLJOZRYLPW-UHFFFAOYSA-N 0.000 description 1
- QOSOOKJVDRMBEP-UHFFFAOYSA-N 1-(oxiran-2-yl)-2-(4-phenylmethoxyphenyl)ethanamine Chemical compound C1OC1C(N)CC(C=C1)=CC=C1OCC1=CC=CC=C1 QOSOOKJVDRMBEP-UHFFFAOYSA-N 0.000 description 1
- CXNVJKVOLRRZLP-UHFFFAOYSA-N 1-(oxiran-2-yl)-2-phenylethanamine Chemical compound C1OC1C(N)CC1=CC=CC=C1 CXNVJKVOLRRZLP-UHFFFAOYSA-N 0.000 description 1
- ZFPGARUNNKGOBB-UHFFFAOYSA-N 1-Ethyl-2-pyrrolidinone Chemical compound CCN1CCCC1=O ZFPGARUNNKGOBB-UHFFFAOYSA-N 0.000 description 1
- JRLOEMCOOZSCQP-UHFFFAOYSA-N 1-[3-(2-quinolinylmethoxy)phenyl]-1-hexanol Chemical compound CCCCCC(O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 JRLOEMCOOZSCQP-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
- WNWHHMBRJJOGFJ-UHFFFAOYSA-N 16-methylheptadecan-1-ol Chemical class CC(C)CCCCCCCCCCCCCCCO WNWHHMBRJJOGFJ-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- OGNSCSPNOLGXSM-UHFFFAOYSA-N 2,4-diaminobutyric acid Chemical compound NCCC(N)C(O)=O OGNSCSPNOLGXSM-UHFFFAOYSA-N 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- QNLJZHVCGHSLIJ-UHFFFAOYSA-N 2-(3,5-difluorophenyl)-1-(oxiran-2-yl)ethanamine Chemical compound C1OC1C(N)CC1=CC(F)=CC(F)=C1 QNLJZHVCGHSLIJ-UHFFFAOYSA-N 0.000 description 1
- SMHRZXLAAGVEFO-UHFFFAOYSA-N 2-(4-nitrophenyl)-1-(oxiran-2-yl)ethanamine Chemical compound C1OC1C(N)CC1=CC=C([N+]([O-])=O)C=C1 SMHRZXLAAGVEFO-UHFFFAOYSA-N 0.000 description 1
- DXQCCQKRNWMECV-UHFFFAOYSA-N 2-(cyclopropylazaniumyl)acetate Chemical compound OC(=O)CNC1CC1 DXQCCQKRNWMECV-UHFFFAOYSA-N 0.000 description 1
- UNQHGXLQKSZYQU-UHFFFAOYSA-N 2-(thiophen-2-ylamino)acetic acid Chemical compound OC(=O)CNC1=CC=CS1 UNQHGXLQKSZYQU-UHFFFAOYSA-N 0.000 description 1
- VJQOUHZVZWHSNW-UHFFFAOYSA-N 2-(thiophen-3-ylamino)acetic acid Chemical compound OC(=O)CNC=1C=CSC=1 VJQOUHZVZWHSNW-UHFFFAOYSA-N 0.000 description 1
- CVZZNRXMDCOHBG-QMMMGPOBSA-N 2-Chloro-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1Cl CVZZNRXMDCOHBG-QMMMGPOBSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- OIQOAYVCKAHSEJ-UHFFFAOYSA-N 2-[2,3-bis(2-hydroxyethoxy)propoxy]ethanol;hexadecanoic acid;octadecanoic acid Chemical compound OCCOCC(OCCO)COCCO.CCCCCCCCCCCCCCCC(O)=O.CCCCCCCCCCCCCCCCCC(O)=O OIQOAYVCKAHSEJ-UHFFFAOYSA-N 0.000 description 1
- WFSMVVDJSNMRAR-UHFFFAOYSA-N 2-[2-(2-ethoxyethoxy)ethoxy]ethanol Chemical compound CCOCCOCCOCCO WFSMVVDJSNMRAR-UHFFFAOYSA-N 0.000 description 1
- OVBRGKZTKQSNRM-JTRKXDDTSA-N 2-[[(9s,12s,15s,21s,30s,33s)-9-[(3-amino-4-hydroxyphenyl)methyl]-33-(2-amino-2-oxoethyl)-21-carbamoyl-12-(2-methylpropyl)-8,11,14,17,19,23,29,32,35-nonaoxo-30-propan-2-yl-19$l^{4}-thia-7,10,13,16,22,28,31,34-octazaspiro[5.29]pentatriacontan-15-yl]methyl]p Chemical compound N([C@@H](CC(N)=O)C(=O)N[C@H](C(=O)NCCCCC(=O)N[C@H](C[S+]([O-])CC(=O)N[C@@H](CC(C(O)=O)C(O)=O)C(=O)N[C@H](C(N[C@@H](CC=1C=C(N)C(O)=CC=1)C(=O)N1)=O)CC(C)C)C(N)=O)C(C)C)C(=O)C21CCCCC2 OVBRGKZTKQSNRM-JTRKXDDTSA-N 0.000 description 1
- CZHCGMZJLLOYJW-UHFFFAOYSA-N 2-amino-2-propylpentanoic acid Chemical compound CCCC(N)(C(O)=O)CCC CZHCGMZJLLOYJW-UHFFFAOYSA-N 0.000 description 1
- DQSACLYOIBPCJU-UHFFFAOYSA-N 2-azaniumyl-2-(2-methoxyphenyl)acetate Chemical compound COC1=CC=CC=C1C(N)C(O)=O DQSACLYOIBPCJU-UHFFFAOYSA-N 0.000 description 1
- GWHQTNKPTXDNRM-UHFFFAOYSA-N 2-azaniumyl-3-(2,4-dichlorophenyl)propanoate Chemical compound OC(=O)C(N)CC1=CC=C(Cl)C=C1Cl GWHQTNKPTXDNRM-UHFFFAOYSA-N 0.000 description 1
- OCDHPLVCNWBKJN-UHFFFAOYSA-N 2-azaniumyl-3-(2-cyanophenyl)propanoate Chemical compound OC(=O)C(N)CC1=CC=CC=C1C#N OCDHPLVCNWBKJN-UHFFFAOYSA-N 0.000 description 1
- PRAWYXDDKCVZTL-UHFFFAOYSA-N 2-azaniumyl-3-(3,4-difluorophenyl)propanoate Chemical compound OC(=O)C(N)CC1=CC=C(F)C(F)=C1 PRAWYXDDKCVZTL-UHFFFAOYSA-N 0.000 description 1
- QFGMPXZFCIHYIR-UHFFFAOYSA-N 2-azaniumyl-3-(3,5-difluorophenyl)propanoate Chemical compound OC(=O)C(N)CC1=CC(F)=CC(F)=C1 QFGMPXZFCIHYIR-UHFFFAOYSA-N 0.000 description 1
- WTOFYLAWDLQMBZ-UHFFFAOYSA-N 2-azaniumyl-3-thiophen-2-ylpropanoate Chemical compound OC(=O)C(N)CC1=CC=CS1 WTOFYLAWDLQMBZ-UHFFFAOYSA-N 0.000 description 1
- YTCSGBSYHNQHFD-UHFFFAOYSA-N 2-azaniumyl-4-bromopent-4-enoate Chemical compound OC(=O)C(N)CC(Br)=C YTCSGBSYHNQHFD-UHFFFAOYSA-N 0.000 description 1
- XOQZTHUXZWQXOK-UHFFFAOYSA-N 2-azaniumyl-5-phenylpentanoate Chemical compound OC(=O)C(N)CCCC1=CC=CC=C1 XOQZTHUXZWQXOK-UHFFFAOYSA-N 0.000 description 1
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
- ASJSAQIRZKANQN-CRCLSJGQSA-N 2-deoxy-D-ribose Chemical compound OC[C@@H](O)[C@@H](O)CC=O ASJSAQIRZKANQN-CRCLSJGQSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- LWLRMRFJCCMNML-UHFFFAOYSA-N 2-ethylhexyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OCC(CC)CCCC LWLRMRFJCCMNML-UHFFFAOYSA-N 0.000 description 1
- NYCRCTMDYITATC-UHFFFAOYSA-N 2-fluorophenylalanine Chemical compound OC(=O)C(N)CC1=CC=CC=C1F NYCRCTMDYITATC-UHFFFAOYSA-N 0.000 description 1
- JNODDICFTDYODH-UHFFFAOYSA-N 2-hydroxytetrahydrofuran Chemical compound OC1CCCO1 JNODDICFTDYODH-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- ILXONIKEXCMURX-UHFFFAOYSA-N 3,4-diamino-2-(2-aminoethyl)-4-oxobutanoic acid Chemical compound NCCC(C(O)=O)C(N)C(N)=O ILXONIKEXCMURX-UHFFFAOYSA-N 0.000 description 1
- MLLSSTJTARJLHK-UHFFFAOYSA-N 3-aminocyclopentane-1-carboxylic acid Chemical compound NC1CCC(C(O)=O)C1 MLLSSTJTARJLHK-UHFFFAOYSA-N 0.000 description 1
- UOQHWNPVNXSDDO-UHFFFAOYSA-N 3-bromoimidazo[1,2-a]pyridine-6-carbonitrile Chemical class C1=CC(C#N)=CN2C(Br)=CN=C21 UOQHWNPVNXSDDO-UHFFFAOYSA-N 0.000 description 1
- JJDJLFDGCUYZMN-QMMMGPOBSA-N 3-chloro-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(Cl)=C1 JJDJLFDGCUYZMN-QMMMGPOBSA-N 0.000 description 1
- BXRLWGXPSRYJDZ-UHFFFAOYSA-N 3-cyanoalanine Chemical compound OC(=O)C(N)CC#N BXRLWGXPSRYJDZ-UHFFFAOYSA-N 0.000 description 1
- JZRBSTONIYRNRI-VIFPVBQESA-N 3-methylphenylalanine Chemical compound CC1=CC=CC(C[C@H](N)C(O)=O)=C1 JZRBSTONIYRNRI-VIFPVBQESA-N 0.000 description 1
- IRZQDMYEJPNDEN-UHFFFAOYSA-N 3-phenyl-2-aminobutanoic acid Natural products OC(=O)C(N)C(C)C1=CC=CC=C1 IRZQDMYEJPNDEN-UHFFFAOYSA-N 0.000 description 1
- CMUHFUGDYMFHEI-QMMMGPOBSA-N 4-amino-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N)C=C1 CMUHFUGDYMFHEI-QMMMGPOBSA-N 0.000 description 1
- VTCHZFWYUPZZKL-UHFFFAOYSA-N 4-azaniumylcyclopent-2-ene-1-carboxylate Chemical compound NC1CC(C(O)=O)C=C1 VTCHZFWYUPZZKL-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- XWHHYOYVRVGJJY-QMMMGPOBSA-N 4-fluoro-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(F)C=C1 XWHHYOYVRVGJJY-QMMMGPOBSA-N 0.000 description 1
- PZNQZSRPDOEBMS-QMMMGPOBSA-N 4-iodo-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(I)C=C1 PZNQZSRPDOEBMS-QMMMGPOBSA-N 0.000 description 1
- GTVVZTAFGPQSPC-UHFFFAOYSA-N 4-nitrophenylalanine Chemical compound OC(=O)C(N)CC1=CC=C([N+]([O-])=O)C=C1 GTVVZTAFGPQSPC-UHFFFAOYSA-N 0.000 description 1
- VMAJRFCXVOIAAS-UHFFFAOYSA-N 4-phenyl-1,3-dioxol-2-one Chemical compound O1C(=O)OC=C1C1=CC=CC=C1 VMAJRFCXVOIAAS-UHFFFAOYSA-N 0.000 description 1
- OBKXEAXTFZPCHS-UHFFFAOYSA-N 4-phenylbutyric acid Chemical compound OC(=O)CCCC1=CC=CC=C1 OBKXEAXTFZPCHS-UHFFFAOYSA-N 0.000 description 1
- HERXOXLYNRDHGU-UHFFFAOYSA-N 5-methyl-2H-1,3-oxazol-2-id-4-one Chemical compound CC1C(N=[C-]O1)=O HERXOXLYNRDHGU-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- XDOLZJYETYVRKV-UHFFFAOYSA-N 7-Aminoheptanoic acid Chemical compound NCCCCCCC(O)=O XDOLZJYETYVRKV-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 235000007173 Abies balsamea Nutrition 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 229920000936 Agarose Polymers 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 239000004857 Balsam Substances 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FVGQEMXBYINNEU-GFCCVEGCSA-N C=1C=CC(I)=CC=1C[C@@]1(C(=O)O)CCCN1 Chemical compound C=1C=CC(I)=CC=1C[C@@]1(C(=O)O)CCCN1 FVGQEMXBYINNEU-GFCCVEGCSA-N 0.000 description 1
- CVXMZURBISMECQ-GFCCVEGCSA-N C=1C=CC=C(I)C=1C[C@@]1(C(=O)O)CCCN1 Chemical compound C=1C=CC=C(I)C=1C[C@@]1(C(=O)O)CCCN1 CVXMZURBISMECQ-GFCCVEGCSA-N 0.000 description 1
- OZJMJEXZZUREBC-MLWJPKLSSA-N CC#CC1CN[C@@H](C1)C(O)=O Chemical compound CC#CC1CN[C@@H](C1)C(O)=O OZJMJEXZZUREBC-MLWJPKLSSA-N 0.000 description 1
- JAAMSIHVMRHWTQ-PYMCNQPYSA-N CC(C)(C)c1ccc(CC2CN[C@@H](C2)C(O)=O)cc1 Chemical compound CC(C)(C)c1ccc(CC2CN[C@@H](C2)C(O)=O)cc1 JAAMSIHVMRHWTQ-PYMCNQPYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- UGWHKXCVUWCXIU-KFJBMODSSA-N Cc1ccccc1CC1CN[C@@H](C1)C(O)=O Chemical compound Cc1ccccc1CC1CN[C@@H](C1)C(O)=O UGWHKXCVUWCXIU-KFJBMODSSA-N 0.000 description 1
- 229920002101 Chitin Polymers 0.000 description 1
- 229920001661 Chitosan Polymers 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 102000012422 Collagen Type I Human genes 0.000 description 1
- 108010022452 Collagen Type I Proteins 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920002785 Croscarmellose sodium Polymers 0.000 description 1
- 108010069514 Cyclic Peptides Proteins 0.000 description 1
- 102000001189 Cyclic Peptides Human genes 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- MTCFGRXMJLQNBG-UWTATZPHSA-N D-Serine Chemical compound OC[C@@H](N)C(O)=O MTCFGRXMJLQNBG-UWTATZPHSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N D-alpha-Ala Natural products CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-RXMQYKEDSA-N D-lysine Chemical compound NCCCC[C@@H](N)C(O)=O KDXKERNSBIXSRK-RXMQYKEDSA-N 0.000 description 1
- SHZGCJCMOBCMKK-UHFFFAOYSA-N D-mannomethylose Natural products CC1OC(O)C(O)C(O)C1O SHZGCJCMOBCMKK-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-VANFPWTGSA-N D-mannopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@@H]1O AEMOLEFTQBMNLQ-VANFPWTGSA-N 0.000 description 1
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 1
- ZAQJHHRNXZUBTE-NQXXGFSBSA-N D-ribulose Chemical compound OC[C@@H](O)[C@@H](O)C(=O)CO ZAQJHHRNXZUBTE-NQXXGFSBSA-N 0.000 description 1
- ZAQJHHRNXZUBTE-UHFFFAOYSA-N D-threo-2-Pentulose Natural products OCC(O)C(O)C(=O)CO ZAQJHHRNXZUBTE-UHFFFAOYSA-N 0.000 description 1
- QIVBCDIJIAJPQS-SECBINFHSA-N D-tryptophane Chemical compound C1=CC=C2C(C[C@@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-SECBINFHSA-N 0.000 description 1
- ZAQJHHRNXZUBTE-WUJLRWPWSA-N D-xylulose Chemical compound OC[C@@H](O)[C@H](O)C(=O)CO ZAQJHHRNXZUBTE-WUJLRWPWSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 1
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 1
- NIGWMJHCCYYCSF-UHFFFAOYSA-N Fenclonine Chemical compound OC(=O)C(N)CC1=CC=C(Cl)C=C1 NIGWMJHCCYYCSF-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229920002670 Fructan Polymers 0.000 description 1
- 229920000855 Fucoidan Polymers 0.000 description 1
- PNNNRSAQSRJVSB-SLPGGIOYSA-N Fucose Natural products C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C=O PNNNRSAQSRJVSB-SLPGGIOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- 108010015899 Glycopeptides Proteins 0.000 description 1
- 102000002068 Glycopeptides Human genes 0.000 description 1
- 239000004705 High-molecular-weight polyethylene Substances 0.000 description 1
- 101000851976 Homo sapiens Nucleoside diphosphate phosphatase ENTPD5 Proteins 0.000 description 1
- 101001095266 Homo sapiens Prolyl endopeptidase Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 244000018716 Impatiens biflora Species 0.000 description 1
- SNDPXSYFESPGGJ-BYPYZUCNSA-N L-2-aminopentanoic acid Chemical compound CCC[C@H](N)C(O)=O SNDPXSYFESPGGJ-BYPYZUCNSA-N 0.000 description 1
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- RHGKLRLOHDJJDR-BYPYZUCNSA-N L-citrulline Chemical compound NC(=O)NCCC[C@H]([NH3+])C([O-])=O RHGKLRLOHDJJDR-BYPYZUCNSA-N 0.000 description 1
- SHZGCJCMOBCMKK-DHVFOXMCSA-N L-fucopyranose Chemical compound C[C@@H]1OC(O)[C@@H](O)[C@H](O)[C@@H]1O SHZGCJCMOBCMKK-DHVFOXMCSA-N 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- JTTHKOPSMAVJFE-VIFPVBQESA-N L-homophenylalanine Chemical compound OC(=O)[C@@H](N)CCC1=CC=CC=C1 JTTHKOPSMAVJFE-VIFPVBQESA-N 0.000 description 1
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- JZKXXXDKRQWDET-QMMMGPOBSA-N L-m-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(O)=C1 JZKXXXDKRQWDET-QMMMGPOBSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-norleucine Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 1
- HXEACLLIILLPRG-YFKPBYRVSA-N L-pipecolic acid Chemical compound [O-]C(=O)[C@@H]1CCCC[NH2+]1 HXEACLLIILLPRG-YFKPBYRVSA-N 0.000 description 1
- DGYHPLMPMRKMPD-UHFFFAOYSA-N L-propargyl glycine Natural products OC(=O)C(N)CC#C DGYHPLMPMRKMPD-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 239000004907 Macro-emulsion Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 229920000057 Mannan Polymers 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- NPKISZUVEBESJI-AWEZNQCLSA-N N-benzoyl-L-phenylalanine Chemical compound C([C@@H](C(=O)O)NC(=O)C=1C=CC=CC=1)C1=CC=CC=C1 NPKISZUVEBESJI-AWEZNQCLSA-N 0.000 description 1
- 230000004988 N-glycosylation Effects 0.000 description 1
- 125000001429 N-terminal alpha-amino-acid group Chemical group 0.000 description 1
- 125000000729 N-terminal amino-acid group Chemical group 0.000 description 1
- NPKISZUVEBESJI-UHFFFAOYSA-N Nalpha-benzoyl-L-phenylalanine Natural products C=1C=CC=CC=1C(=O)NC(C(=O)O)CC1=CC=CC=C1 NPKISZUVEBESJI-UHFFFAOYSA-N 0.000 description 1
- RHGKLRLOHDJJDR-UHFFFAOYSA-N Ndelta-carbamoyl-DL-ornithine Natural products OC(=O)C(N)CCCNC(N)=O RHGKLRLOHDJJDR-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 102100036518 Nucleoside diphosphate phosphatase ENTPD5 Human genes 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- GEYBMYRBIABFTA-UHFFFAOYSA-N O-methyltyrosine Chemical compound COC1=CC=C(CC(N)C(O)=O)C=C1 GEYBMYRBIABFTA-UHFFFAOYSA-N 0.000 description 1
- UKXISCNLQNZOKM-MHJFOBGBSA-N OC(=O)[C@@H]1CC(CN1)C(CCCc1ccccc1)c1ccccc1 Chemical compound OC(=O)[C@@H]1CC(CN1)C(CCCc1ccccc1)c1ccccc1 UKXISCNLQNZOKM-MHJFOBGBSA-N 0.000 description 1
- XNJSBRAUNMMJTO-LYKKTTPLSA-N OC(=O)[C@@H]1CC(CN1)C(c1ccccc1)c1ccccc1 Chemical compound OC(=O)[C@@H]1CC(CN1)C(c1ccccc1)c1ccccc1 XNJSBRAUNMMJTO-LYKKTTPLSA-N 0.000 description 1
- UELMJLOCNYHTQH-LYNSQETBSA-N OC(=O)[C@@H]1CC(Cc2ccc(Cl)c(Cl)c2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccc(Cl)c(Cl)c2)CN1 UELMJLOCNYHTQH-LYNSQETBSA-N 0.000 description 1
- ORFGAWLZIPJNIU-QRIDDKLISA-N OC(=O)[C@@H]1CC(Cc2ccc(Cl)cc2Cl)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccc(Cl)cc2Cl)CN1 ORFGAWLZIPJNIU-QRIDDKLISA-N 0.000 description 1
- BMPUITLSTMSGDE-UMJHXOGRSA-N OC(=O)[C@@H]1CC(Cc2ccc(I)cc2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccc(I)cc2)CN1 BMPUITLSTMSGDE-UMJHXOGRSA-N 0.000 description 1
- XTGWBSMJMPPTAC-KIYNQFGBSA-N OC(=O)[C@@H]1CC(Cc2ccc(cc2)C#N)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccc(cc2)C#N)CN1 XTGWBSMJMPPTAC-KIYNQFGBSA-N 0.000 description 1
- OMUVMRKMUCNUGA-UMJHXOGRSA-N OC(=O)[C@@H]1CC(Cc2ccc(cc2)[N+]([O-])=O)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccc(cc2)[N+]([O-])=O)CN1 OMUVMRKMUCNUGA-UMJHXOGRSA-N 0.000 description 1
- ZZHAJMVCKZUYEK-CVRLYYSRSA-N OC(=O)[C@@H]1CC(Cc2ccc3ccccc3c2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccc3ccccc3c2)CN1 ZZHAJMVCKZUYEK-CVRLYYSRSA-N 0.000 description 1
- LWYGQQGSMMEYSJ-UMJHXOGRSA-N OC(=O)[C@@H]1CC(Cc2cccc(I)c2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2cccc(I)c2)CN1 LWYGQQGSMMEYSJ-UMJHXOGRSA-N 0.000 description 1
- MVEGCQJPRBWNLO-KIYNQFGBSA-N OC(=O)[C@@H]1CC(Cc2cccc(c2)C#N)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2cccc(c2)C#N)CN1 MVEGCQJPRBWNLO-KIYNQFGBSA-N 0.000 description 1
- LGBDRRRFTLQEHU-UMJHXOGRSA-N OC(=O)[C@@H]1CC(Cc2cccc(c2)[N+]([O-])=O)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2cccc(c2)[N+]([O-])=O)CN1 LGBDRRRFTLQEHU-UMJHXOGRSA-N 0.000 description 1
- XNYGRLNTFFUDFS-MHTVFEQDSA-N OC(=O)[C@@H]1CC(Cc2cccc3ccccc23)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2cccc3ccccc23)CN1 XNYGRLNTFFUDFS-MHTVFEQDSA-N 0.000 description 1
- PFTKFCZQFGMJRB-LYNSQETBSA-N OC(=O)[C@@H]1CC(Cc2ccccc2Br)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccccc2Br)CN1 PFTKFCZQFGMJRB-LYNSQETBSA-N 0.000 description 1
- LMXYNNZXNRORJH-ACGXKRRESA-N OC(=O)[C@@H]1CC(Cc2ccccc2C#N)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccccc2C#N)CN1 LMXYNNZXNRORJH-ACGXKRRESA-N 0.000 description 1
- QZSBJCALHMABRX-LYNSQETBSA-N OC(=O)[C@@H]1CC(Cc2ccccc2Cl)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccccc2Cl)CN1 QZSBJCALHMABRX-LYNSQETBSA-N 0.000 description 1
- YBSCAHGEMRXWBQ-LYNSQETBSA-N OC(=O)[C@@H]1CC(Cc2ccccc2F)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccccc2F)CN1 YBSCAHGEMRXWBQ-LYNSQETBSA-N 0.000 description 1
- SPVPXOBVPBKCBX-LYNSQETBSA-N OC(=O)[C@@H]1CC(Cc2ccccc2I)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccccc2I)CN1 SPVPXOBVPBKCBX-LYNSQETBSA-N 0.000 description 1
- OETHXWXQNOKWOM-HTLJXXAVSA-N OC(=O)[C@@H]1CC(Cc2ccccc2[N+]([O-])=O)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccccc2[N+]([O-])=O)CN1 OETHXWXQNOKWOM-HTLJXXAVSA-N 0.000 description 1
- WVELEQPWTAAECY-HTLJXXAVSA-N OC(=O)[C@@H]1CC(Cc2ccccn2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccccn2)CN1 WVELEQPWTAAECY-HTLJXXAVSA-N 0.000 description 1
- BGIXKHYNFLDHDA-AXDSSHIGSA-N OC(=O)[C@@H]1CC(Cc2cccnc2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2cccnc2)CN1 BGIXKHYNFLDHDA-AXDSSHIGSA-N 0.000 description 1
- LFMONIVZGAORJX-NETXQHHPSA-N OC(=O)[C@@H]1CC(Cc2ccco2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2ccco2)CN1 LFMONIVZGAORJX-NETXQHHPSA-N 0.000 description 1
- UDEHZRASWYDPBH-XDKWHASVSA-N OC(=O)[C@@H]1CC(Cc2cscn2)CN1 Chemical compound OC(=O)[C@@H]1CC(Cc2cscn2)CN1 UDEHZRASWYDPBH-XDKWHASVSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229920002230 Pectic acid Polymers 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- 229920000805 Polyaspartic acid Polymers 0.000 description 1
- 108010020346 Polyglutamic Acid Proteins 0.000 description 1
- 108010039918 Polylysine Proteins 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 102000056251 Prolyl Oligopeptidases Human genes 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- MLHOXUWWKVQEJB-UHFFFAOYSA-N Propyleneglycol diacetate Chemical compound CC(=O)OC(C)COC(C)=O MLHOXUWWKVQEJB-UHFFFAOYSA-N 0.000 description 1
- 239000004373 Pullulan Substances 0.000 description 1
- 229920001218 Pullulan Polymers 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 1
- 108010077895 Sarcosine Proteins 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 235000019486 Sunflower oil Nutrition 0.000 description 1
- 206010048669 Terminal state Diseases 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 1
- 239000003875 Wang resin Substances 0.000 description 1
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical compound CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 1
- UUOZISWTWURDGU-SSDOTTSWSA-N [(2S)-1-(2-acetamidoacetyl)pyrrolidin-2-yl]boronic acid Chemical compound CC(=O)NCC(=O)N1CCC[C@@H]1B(O)O UUOZISWTWURDGU-SSDOTTSWSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- NERFNHBZJXXFGY-UHFFFAOYSA-N [4-[(4-methylphenyl)methoxy]phenyl]methanol Chemical compound C1=CC(C)=CC=C1COC1=CC=C(CO)C=C1 NERFNHBZJXXFGY-UHFFFAOYSA-N 0.000 description 1
- DSODRWWHAUGSGD-UHFFFAOYSA-N [5-(carbamimidoylsulfanylmethyl)thiophen-2-yl]methyl carbamimidothioate;dihydrochloride Chemical compound Cl.Cl.NC(=N)SCC1=CC=C(CSC(N)=N)S1 DSODRWWHAUGSGD-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical class C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 210000002187 accessory nerve Anatomy 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical class [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-L acetylenedicarboxylate(2-) Chemical compound [O-]C(=O)C#CC([O-])=O YTIVTFGABIZHHX-UHFFFAOYSA-L 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005076 adamantyloxycarbonyl group Chemical group C12(CC3CC(CC(C1)C3)C2)OC(=O)* 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- IAJILQKETJEXLJ-RSJOWCBRSA-N aldehydo-D-galacturonic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-RSJOWCBRSA-N 0.000 description 1
- IAJILQKETJEXLJ-QTBDOELSSA-N aldehydo-D-glucuronic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-QTBDOELSSA-N 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical group 0.000 description 1
- 125000006307 alkoxy benzyl group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000005205 alkoxycarbonyloxyalkyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- WNNNWFKQCKFSDK-UHFFFAOYSA-N allylglycine Chemical compound OC(=O)C(N)CC=C WNNNWFKQCKFSDK-UHFFFAOYSA-N 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- 229940087168 alpha tocopherol Drugs 0.000 description 1
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- HYOWVAAEQCNGLE-JTQLQIEISA-N alpha-methyl-L-phenylalanine Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC=C1 HYOWVAAEQCNGLE-JTQLQIEISA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000001668 ameliorated effect Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000003862 amino acid derivatives Chemical class 0.000 description 1
- 125000005021 aminoalkenyl group Chemical group 0.000 description 1
- 125000005014 aminoalkynyl group Chemical group 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 229940126575 aminoglycoside Drugs 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000001195 anabolic effect Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000033115 angiogenesis Effects 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 125000003289 ascorbyl group Chemical group [H]O[C@@]([H])(C([H])([H])O*)[C@@]1([H])OC(=O)C(O*)=C1O* 0.000 description 1
- 235000009582 asparagine Nutrition 0.000 description 1
- 229960001230 asparagine Drugs 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical class O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- GFZWHAAOIVMHOI-UHFFFAOYSA-N azetidine-3-carboxylic acid Chemical compound OC(=O)C1CNC1 GFZWHAAOIVMHOI-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 239000000022 bacteriostatic agent Substances 0.000 description 1
- 229940049706 benzodiazepine Drugs 0.000 description 1
- 125000003310 benzodiazepinyl group Chemical group N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- WTOFYLAWDLQMBZ-LURJTMIESA-N beta(2-thienyl)alanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CS1 WTOFYLAWDLQMBZ-LURJTMIESA-N 0.000 description 1
- 229940000635 beta-alanine Drugs 0.000 description 1
- 239000003613 bile acid Substances 0.000 description 1
- 239000004623 biodegradable polyanhydride Substances 0.000 description 1
- 229920000229 biodegradable polyester Polymers 0.000 description 1
- 239000004622 biodegradable polyester Substances 0.000 description 1
- 239000012620 biological material Substances 0.000 description 1
- 125000004057 biotinyl group Chemical group [H]N1C(=O)N([H])[C@]2([H])[C@@]([H])(SC([H])([H])[C@]12[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- FATUQANACHZLRT-KMRXSBRUSA-L calcium glucoheptonate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O FATUQANACHZLRT-KMRXSBRUSA-L 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- 230000009400 cancer invasion Effects 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 230000001925 catabolic effect Effects 0.000 description 1
- 230000006652 catabolic pathway Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- KVSASDOGYIBWTA-UHFFFAOYSA-N chloro benzoate Chemical compound ClOC(=O)C1=CC=CC=C1 KVSASDOGYIBWTA-UHFFFAOYSA-N 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 150000005827 chlorofluoro hydrocarbons Chemical class 0.000 description 1
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 229960002173 citrulline Drugs 0.000 description 1
- 235000013477 citrulline Nutrition 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 239000005289 controlled pore glass Substances 0.000 description 1
- 239000000599 controlled substance Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 229960000913 crospovidone Drugs 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 1
- 239000001767 crosslinked sodium carboxy methyl cellulose Substances 0.000 description 1
- 238000002447 crystallographic data Methods 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- 229960002433 cysteine Drugs 0.000 description 1
- 229960001305 cysteine hydrochloride Drugs 0.000 description 1
- 210000005220 cytoplasmic tail Anatomy 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000001295 dansyl group Chemical group [H]C1=C([H])C(N(C([H])([H])[H])C([H])([H])[H])=C2C([H])=C([H])C([H])=C(C2=C1[H])S(*)(=O)=O 0.000 description 1
- 230000009615 deamination Effects 0.000 description 1
- 238000006481 deamination reaction Methods 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- UGMCXQCYOVCMTB-UHFFFAOYSA-K dihydroxy(stearato)aluminium Chemical compound CCCCCCCCCCCCCCCCCC(=O)O[Al](O)O UGMCXQCYOVCMTB-UHFFFAOYSA-K 0.000 description 1
- SPCNPOWOBZQWJK-UHFFFAOYSA-N dimethoxy-(2-propan-2-ylsulfanylethylsulfanyl)-sulfanylidene-$l^{5}-phosphane Chemical compound COP(=S)(OC)SCCSC(C)C SPCNPOWOBZQWJK-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 230000007515 enzymatic degradation Effects 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 229940125532 enzyme inhibitor Drugs 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 210000000981 epithelium Anatomy 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 229940093499 ethyl acetate Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 210000002744 extracellular matrix Anatomy 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 230000005714 functional activity Effects 0.000 description 1
- 150000002244 furazanes Chemical class 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000010353 genetic engineering Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229940097043 glucuronic acid Drugs 0.000 description 1
- 229960002989 glutamic acid Drugs 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 235000004554 glutamine Nutrition 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- YQEMORVAKMFKLG-UHFFFAOYSA-N glycerine monostearate Natural products CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO YQEMORVAKMFKLG-UHFFFAOYSA-N 0.000 description 1
- SVUQHVRAGMNPLW-UHFFFAOYSA-N glycerol monostearate Natural products CCCCCCCCCCCCCCCCC(=O)OCC(O)CO SVUQHVRAGMNPLW-UHFFFAOYSA-N 0.000 description 1
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000013595 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 210000003494 hepatocyte Anatomy 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 229920000140 heteropolymer Polymers 0.000 description 1
- KKLGDUSGQMHBPB-UHFFFAOYSA-N hex-2-ynedioic acid Chemical compound OC(=O)CCC#CC(O)=O KKLGDUSGQMHBPB-UHFFFAOYSA-N 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 229920002674 hyaluronan Polymers 0.000 description 1
- 229960003160 hyaluronic acid Drugs 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229960002591 hydroxyproline Drugs 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000005847 immunogenicity Effects 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000000185 intracerebroventricular administration Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229960000310 isoleucine Drugs 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- BQINXKOTJQCISL-GRCPKETISA-N keto-neuraminic acid Chemical compound OC(=O)C(=O)C[C@H](O)[C@@H](N)[C@@H](O)[C@H](O)[C@H](O)CO BQINXKOTJQCISL-GRCPKETISA-N 0.000 description 1
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 description 1
- AIHDCSAXVMAMJH-GFBKWZILSA-N levan Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)OC[C@@H]1[C@@H](O)[C@H](O)[C@](CO)(CO[C@@H]2[C@H]([C@H](O)[C@@](O)(CO)O2)O)O1 AIHDCSAXVMAMJH-GFBKWZILSA-N 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 230000001926 lymphatic effect Effects 0.000 description 1
- 230000002101 lytic effect Effects 0.000 description 1
- VWHRYODZTDMVSS-QMMMGPOBSA-N m-fluoro-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(F)=C1 VWHRYODZTDMVSS-QMMMGPOBSA-N 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- JZKXXXDKRQWDET-UHFFFAOYSA-N meta-tyrosine Natural products OC(=O)C(N)CC1=CC=CC(O)=C1 JZKXXXDKRQWDET-UHFFFAOYSA-N 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- IZYBEMGNIUSSAX-UHFFFAOYSA-N methyl benzenecarboperoxoate Chemical compound COOC(=O)C1=CC=CC=C1 IZYBEMGNIUSSAX-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 230000009456 molecular mechanism Effects 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- NKAAEMMYHLFEFN-UHFFFAOYSA-M monosodium tartrate Chemical compound [Na+].OC(=O)C(O)C(O)C([O-])=O NKAAEMMYHLFEFN-UHFFFAOYSA-M 0.000 description 1
- 239000002324 mouth wash Substances 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 description 1
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- QNILTEGFHQSKFF-UHFFFAOYSA-N n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C=C QNILTEGFHQSKFF-UHFFFAOYSA-N 0.000 description 1
- 125000005487 naphthalate group Chemical group 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 230000001613 neoplastic effect Effects 0.000 description 1
- CERZMXAJYMMUDR-UHFFFAOYSA-N neuraminic acid Natural products NC1C(O)CC(O)(C(O)=O)OC1C(O)C(O)CO CERZMXAJYMMUDR-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000006502 nitrobenzyl group Chemical group 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-M oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC([O-])=O ZQPPMHVWECSIRJ-KTKRTIGZSA-M 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 210000003463 organelle Anatomy 0.000 description 1
- 150000002891 organic anions Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- LCLHHZYHLXDRQG-ZNKJPWOQSA-N pectic acid Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)O[C@H](C(O)=O)[C@@H]1OC1[C@H](O)[C@@H](O)[C@@H](OC2[C@@H]([C@@H](O)[C@@H](O)[C@H](O2)C(O)=O)O)[C@@H](C(O)=O)O1 LCLHHZYHLXDRQG-ZNKJPWOQSA-N 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001151 peptidyl group Chemical group 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- DYUMLJSJISTVPV-UHFFFAOYSA-N phenyl propanoate Chemical compound CCC(=O)OC1=CC=CC=C1 DYUMLJSJISTVPV-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 229950009215 phenylbutanoic acid Drugs 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- PETXWIMJICIQTQ-UHFFFAOYSA-N phenylmethoxymethanol Chemical group OCOCC1=CC=CC=C1 PETXWIMJICIQTQ-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 150000008300 phosphoramidites Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229960000502 poloxamer Drugs 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 229920002432 poly(vinyl methyl ether) polymer Polymers 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 108010064470 polyaspartate Proteins 0.000 description 1
- 239000010318 polygalacturonic acid Substances 0.000 description 1
- 229920002643 polyglutamic acid Polymers 0.000 description 1
- 239000004633 polyglycolic acid Substances 0.000 description 1
- 238000012667 polymer degradation Methods 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940068968 polysorbate 80 Drugs 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229940005642 polystyrene sulfonic acid Drugs 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 229920001289 polyvinyl ether Polymers 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000473 propyl gallate Substances 0.000 description 1
- 235000010388 propyl gallate Nutrition 0.000 description 1
- 229940075579 propyl gallate Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-M propynoate Chemical compound [O-]C(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-M 0.000 description 1
- 235000019833 protease Nutrition 0.000 description 1
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 1
- 235000019423 pullulan Nutrition 0.000 description 1
- 230000000541 pulsatile effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000004040 pyrrolidinones Chemical class 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000010188 recombinant method Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 208000015347 renal cell adenocarcinoma Diseases 0.000 description 1
- 230000003252 repetitive effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229940071089 sarcosinate Drugs 0.000 description 1
- 229940043230 sarcosine Drugs 0.000 description 1
- 235000021003 saturated fats Nutrition 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 150000003346 selenoethers Chemical class 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 238000002864 sequence alignment Methods 0.000 description 1
- 235000004400 serine Nutrition 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229940100996 sodium bisulfate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical group O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- CSMWJXBSXGUPGY-UHFFFAOYSA-L sodium dithionate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)S([O-])(=O)=O CSMWJXBSXGUPGY-UHFFFAOYSA-L 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 238000003980 solgel method Methods 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- TYFQFVWCELRYAO-UHFFFAOYSA-L suberate(2-) Chemical compound [O-]C(=O)CCCCCCC([O-])=O TYFQFVWCELRYAO-UHFFFAOYSA-L 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000008053 sultones Chemical class 0.000 description 1
- 239000002600 sunflower oil Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 235000007586 terpenes Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000004797 therapeutic response Effects 0.000 description 1
- 238000002207 thermal evaporation Methods 0.000 description 1
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 150000003564 thiocarbonyl compounds Chemical class 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 229950006389 thiodiglycol Drugs 0.000 description 1
- 150000007944 thiolates Chemical group 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
- 235000008521 threonine Nutrition 0.000 description 1
- 230000000451 tissue damage Effects 0.000 description 1
- 231100000827 tissue damage Toxicity 0.000 description 1
- AOBORMOPSGHCAX-DGHZZKTQSA-N tocofersolan Chemical compound OCCOC(=O)CCC(=O)OC1=C(C)C(C)=C2O[C@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C AOBORMOPSGHCAX-DGHZZKTQSA-N 0.000 description 1
- 229960000984 tocofersolan Drugs 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- JLGLQAWTXXGVEM-UHFFFAOYSA-N triethylene glycol monomethyl ether Chemical compound COCCOCCOCCO JLGLQAWTXXGVEM-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229940070710 valerate Drugs 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 239000004474 valine Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
- 229920001221 xylan Polymers 0.000 description 1
- 150000004823 xylans Chemical class 0.000 description 1
- 229940071104 xylenesulfonate Drugs 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
- 239000002076 α-tocopherol Substances 0.000 description 1
- 235000004835 α-tocopherol Nutrition 0.000 description 1
- JPZXHKDZASGCLU-LBPRGKRZSA-N β-(2-naphthyl)-alanine Chemical compound C1=CC=CC2=CC(C[C@H](N)C(O)=O)=CC=C21 JPZXHKDZASGCLU-LBPRGKRZSA-N 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06139—Dipeptides with the first amino acid being heterocyclic
- C07K5/06156—Dipeptides with the first amino acid being heterocyclic and Trp-amino acid; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Biochemistry (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Molecular Biology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Biophysics (AREA)
- Genetics & Genomics (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Peptides Or Proteins (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US89578707P | 2007-03-20 | 2007-03-20 | |
| PCT/US2008/057636 WO2008116054A1 (en) | 2007-03-20 | 2008-03-20 | Inhibitors of fibroblast activation protein, and methods of use thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2010523477A true JP2010523477A (ja) | 2010-07-15 |
| JP2010523477A5 JP2010523477A5 (enExample) | 2011-05-12 |
Family
ID=39766448
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2009554735A Abandoned JP2010523477A (ja) | 2007-03-20 | 2008-03-20 | 線維芽細胞活性化タンパク質の阻害剤、およびそれを使用する方法 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US20100105753A1 (enExample) |
| EP (1) | EP2139337A4 (enExample) |
| JP (1) | JP2010523477A (enExample) |
| AU (1) | AU2008228863A1 (enExample) |
| CA (1) | CA2681351A1 (enExample) |
| WO (1) | WO2008116054A1 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2014508116A (ja) * | 2010-12-14 | 2014-04-03 | メルク・シャープ・アンド・ドーム・コーポレーション | 大環状ラクタムの調製のための方法および中間体 |
| JP2014527070A (ja) * | 2011-08-30 | 2014-10-09 | トラスティーズ オブ タフツ カレッジ | 固形腫瘍を治療するためのfap活性化プロテアソーム阻害剤 |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20120053222A1 (en) * | 2009-01-23 | 2012-03-01 | Mark Gorrell | Novel Metabolic Disease Therapy |
| AU2012340887A1 (en) | 2011-11-22 | 2014-07-03 | Trustees Of Tufts College | Small molecule enhancer for dendritic cell cancer vaccines |
| US20200237936A1 (en) | 2016-12-14 | 2020-07-30 | Purdue Research Foundation | Fibroblast activation protein (fap)-targeted imaging and therapy |
| EP3763726A1 (en) | 2019-07-08 | 2021-01-13 | 3B Pharmaceuticals GmbH | Compounds comprising a fibroblast activation protein ligand and use thereof |
| KR20220032078A (ko) | 2019-07-08 | 2022-03-15 | 쓰리비 파마슈티컬스 게엠베하 | 섬유모세포 활성화 단백질 리간드를 포함하는 화합물 및 그의 용도 |
| EP3997103B9 (en) | 2019-07-08 | 2025-02-26 | 3B Pharmaceuticals GmbH | Compounds comprising a fibroblast activation protein ligand and use thereof |
| EP4147053B1 (en) | 2020-05-07 | 2026-01-28 | Institut Curie | Antxr1 as a biomarker of immunosuppressive fibroblast populations and its use for predicting response to immunotherapy |
| EP4050018A1 (en) | 2021-01-07 | 2022-08-31 | 3B Pharmaceuticals GmbH | Compounds comprising a fibroblast activation protein ligand and use thereof |
| JP2024503637A (ja) | 2021-01-07 | 2024-01-26 | 3ベー ファーマシューティカルズ ゲーエムベーハー | 線維芽細胞活性化タンパク質リガンドを含む化合物およびその使用 |
| CN114316136B (zh) * | 2022-01-13 | 2023-01-31 | 西华师范大学 | 一种氢键增强型水合物抑制剂及其制备方法 |
| KR20250057810A (ko) * | 2022-08-25 | 2025-04-29 | 더 리젠츠 오브 더 유니버시티 오브 캘리포니아 | 섬유아세포 활성화 단백질 알파-절단가능 프로-펩티드 및 사용 방법 |
| AU2024334645A1 (en) | 2023-08-31 | 2026-02-26 | Stichting Radboud Universitair Medisch Centrum | Endometriosis tracer |
| US20250186630A1 (en) | 2023-12-12 | 2025-06-12 | Viewpoint Molecular Targeting, Inc. | Fibroblast activation protein targeting peptides |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1520582A3 (en) * | 1998-02-02 | 2009-07-01 | Trustees Of Tufts College | Use of dipeptidylpetidase inhibitors to regulate glucose metabolism |
| US6890904B1 (en) * | 1999-05-25 | 2005-05-10 | Point Therapeutics, Inc. | Anti-tumor agents |
| US7041696B2 (en) * | 2002-06-17 | 2006-05-09 | The Procter & Gamble Company | Interleukin-1β converting enzyme inhibitors |
| KR20150003157A (ko) * | 2005-12-19 | 2015-01-08 | 트러스티즈 오브 터프츠 칼리지 | 소프트 단백질분해효소 억제자 및 이의 프로-소프트 폼 |
-
2008
- 2008-03-20 EP EP08732547A patent/EP2139337A4/en not_active Withdrawn
- 2008-03-20 US US12/532,274 patent/US20100105753A1/en not_active Abandoned
- 2008-03-20 AU AU2008228863A patent/AU2008228863A1/en not_active Abandoned
- 2008-03-20 JP JP2009554735A patent/JP2010523477A/ja not_active Abandoned
- 2008-03-20 CA CA002681351A patent/CA2681351A1/en not_active Abandoned
- 2008-03-20 WO PCT/US2008/057636 patent/WO2008116054A1/en not_active Ceased
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2014508116A (ja) * | 2010-12-14 | 2014-04-03 | メルク・シャープ・アンド・ドーム・コーポレーション | 大環状ラクタムの調製のための方法および中間体 |
| JP2014527070A (ja) * | 2011-08-30 | 2014-10-09 | トラスティーズ オブ タフツ カレッジ | 固形腫瘍を治療するためのfap活性化プロテアソーム阻害剤 |
| JP2018016629A (ja) * | 2011-08-30 | 2018-02-01 | トラスティーズ オブ タフツ カレッジ | 固形腫瘍を治療するためのfap活性化プロテアソーム阻害剤 |
| US10517955B2 (en) | 2011-08-30 | 2019-12-31 | Trustees Of Tufts College | FAP-activated proteasome inhibitors for treating solid tumors |
| US11065339B2 (en) | 2011-08-30 | 2021-07-20 | Trustees Of Tufts College | FAP-activated proteasome inhibitors for treating solid tumors |
| US12214047B2 (en) | 2011-08-30 | 2025-02-04 | Trustees Of Tufts College | FAP-activated proteasome inhibitors for treating solid tumors |
Also Published As
| Publication number | Publication date |
|---|---|
| EP2139337A4 (en) | 2012-09-19 |
| AU2008228863A1 (en) | 2008-09-25 |
| WO2008116054A1 (en) | 2008-09-25 |
| CA2681351A1 (en) | 2008-09-25 |
| EP2139337A1 (en) | 2010-01-06 |
| US20100105753A1 (en) | 2010-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2010523477A (ja) | 線維芽細胞活性化タンパク質の阻害剤、およびそれを使用する方法 | |
| US20100184706A1 (en) | Fap-activated chemotherapeutic compounds, and methods of use thereof | |
| WO2009006473A2 (en) | Pro-soft polypeptide proteasome inhibitors, and methods of use thereof | |
| JP4778519B2 (ja) | インクレチンホルモン活性を持つペプチドの経上皮送達 | |
| JP6223377B2 (ja) | 長期間作用性ペプチド類似体のための組成物 | |
| JP2020183448A (ja) | Fap活性化治療剤及びそれに関連する使用 | |
| US7323542B2 (en) | Bone targeting peptides | |
| WO2008022015A2 (en) | Retro-inverso incretin analogues, and methods of use thereof | |
| CN101268102B (zh) | 用于治疗癌症和皮肤损伤的与糖基磷脂酰肌醇(gpi)锚相连的金属蛋白酶组织抑制剂(timp) | |
| JP5701375B2 (ja) | 血管新生促進用ペプチド及びその使用 | |
| CN116041551A (zh) | 白介素-4受体结合融合蛋白及其应用 | |
| WO2010128672A1 (ja) | 遺伝子組み換えゼラチンを含む血管新生誘導剤 | |
| WO2010147109A1 (ja) | 遺伝子組み換えゼラチン及び塩基性線維芽細胞増殖因子を含む血管新生誘導剤 | |
| KR20140042796A (ko) | 항종양 및 항혈관생성 활성을 갖는 사이클릭 펩타이드 | |
| JP5752782B2 (ja) | 血管新生促進用ペプチド及びその使用 | |
| CN111494642B (zh) | 一种原位构筑人造细胞外基质的自组装材料及其制备方法和应用 | |
| KR102532557B1 (ko) | Dsg2 유래 펩타이드 | |
| WO2008128064A2 (en) | Truncated analogs of peptide and polypeptide therapeutics | |
| JPWO2006046569A1 (ja) | 神経分化促進ペプチド | |
| HK1220397A1 (zh) | 用於在活体中递送rnai触发子至肿瘤细胞的聚偶联物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20110322 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20110322 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20111228 |
|
| A762 | Written abandonment of application |
Free format text: JAPANESE INTERMEDIATE CODE: A762 Effective date: 20121119 |