JP2001519328A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2001519328A5 JP2001519328A5 JP2000514883A JP2000514883A JP2001519328A5 JP 2001519328 A5 JP2001519328 A5 JP 2001519328A5 JP 2000514883 A JP2000514883 A JP 2000514883A JP 2000514883 A JP2000514883 A JP 2000514883A JP 2001519328 A5 JP2001519328 A5 JP 2001519328A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- phenyl
- het
- formula
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 125000000217 alkyl group Chemical group 0.000 description 75
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 38
- -1 Het Chemical group 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 19
- 229910052736 halogen Inorganic materials 0.000 description 11
- 150000002367 halogens Chemical group 0.000 description 11
- 125000003545 alkoxy group Chemical group 0.000 description 10
- 125000003118 aryl group Chemical group 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- 229910052717 sulfur Inorganic materials 0.000 description 7
- 125000004093 cyano group Chemical group *C#N 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 108010016626 Dipeptides Chemical class 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 229940024606 amino acid Drugs 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- ZJAOAACCNHFJAH-UHFFFAOYSA-N phosphonoformic acid Chemical compound OC(=O)P(O)(O)=O ZJAOAACCNHFJAH-UHFFFAOYSA-N 0.000 description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- 125000000979 2-amino-2-oxoethyl group Chemical group [H]C([*])([H])C(=O)N([H])[H] 0.000 description 1
- VWFCHDSQECPREK-LURJTMIESA-N Cidofovir Chemical compound NC=1C=CN(C[C@@H](CO)OCP(O)(O)=O)C(=O)N=1 VWFCHDSQECPREK-LURJTMIESA-N 0.000 description 1
- 206010011831 Cytomegalovirus infection Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- JNTOCHDNEULJHD-UHFFFAOYSA-N Penciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(CCC(CO)CO)C=N2 JNTOCHDNEULJHD-UHFFFAOYSA-N 0.000 description 1
- HDOVUKNUBWVHOX-QMMMGPOBSA-N Valacyclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCOC(=O)[C@@H](N)C(C)C)C=N2 HDOVUKNUBWVHOX-QMMMGPOBSA-N 0.000 description 1
- 229960004150 aciclovir Drugs 0.000 description 1
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000003602 anti-herpes Effects 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960000724 cidofovir Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 229960004396 famciclovir Drugs 0.000 description 1
- GGXKWVWZWMLJEH-UHFFFAOYSA-N famcyclovir Chemical compound N1=C(N)N=C2N(CCC(COC(=O)C)COC(C)=O)C=NC2=C1 GGXKWVWZWMLJEH-UHFFFAOYSA-N 0.000 description 1
- 229960005102 foscarnet Drugs 0.000 description 1
- 229960002963 ganciclovir Drugs 0.000 description 1
- IRSCQMHQWWYFCW-UHFFFAOYSA-N ganciclovir Chemical compound O=C1NC(N)=NC2=C1N=CN2COC(CO)CO IRSCQMHQWWYFCW-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229960001179 penciclovir Drugs 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001177 retroviral effect Effects 0.000 description 1
- 239000003419 rna directed dna polymerase inhibitor Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000005505 thiomorpholino group Chemical group 0.000 description 1
- 229940093257 valacyclovir Drugs 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US6155097P | 1997-10-07 | 1997-10-07 | |
| US60/061,550 | 1997-10-07 | ||
| PCT/CA1998/000952 WO1999018071A1 (en) | 1997-10-07 | 1998-10-06 | Azetidinone derivatives for the treatment of hcmv infections |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2001519328A JP2001519328A (ja) | 2001-10-23 |
| JP2001519328A5 true JP2001519328A5 (https=) | 2006-01-05 |
Family
ID=22036487
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000514883A Ceased JP2001519328A (ja) | 1997-10-07 | 1998-10-06 | Hcmv感染症治療のためのアゼチジノン誘導体 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US6239125B1 (https=) |
| EP (1) | EP1021404B1 (https=) |
| JP (1) | JP2001519328A (https=) |
| AT (1) | ATE230725T1 (https=) |
| AU (1) | AU9425998A (https=) |
| CA (1) | CA2301548C (https=) |
| DE (1) | DE69810651T2 (https=) |
| DK (1) | DK1021404T3 (https=) |
| ES (1) | ES2187063T3 (https=) |
| PT (1) | PT1021404E (https=) |
| WO (1) | WO1999018071A1 (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ552397A (en) | 2004-07-15 | 2011-04-29 | Amr Technology Inc | Aryl-and heteroaryl-substituted tetrahydroisoquinolines and use thereof to block reuptake of norepinephrine, dopamine, and serotonin |
| KR100599876B1 (ko) * | 2004-08-31 | 2006-07-13 | 한국화학연구원 | 2-아릴메틸아제티딘 카바페넴 유도체 및 그의 제조방법 |
| US9156812B2 (en) | 2008-06-04 | 2015-10-13 | Bristol-Myers Squibb Company | Crystalline form of 6-[(4S)-2-methyl-4-(2-naphthyl)-1,2,3,4-tetrahydroisoquinolin-7-yl]pyridazin-3-amine |
| WO2010132437A1 (en) | 2009-05-12 | 2010-11-18 | Albany Molecular Research, Inc. | Aryl, heteroaryl, and heterocycle substituted tetrahydroisoquinolines and use thereof |
| AU2010247763B2 (en) * | 2009-05-12 | 2015-12-24 | Albany Molecular Research, Inc. | 7-([1,2,4,]triazolo[1,5,-a]pyridin-6-yl)-4-(3,4-dichlorophenyl)-1,2,3,4- tetrahydroisoquinoline and use thereof |
| AU2010247735B2 (en) | 2009-05-12 | 2015-07-16 | Albany Molecular Research, Inc. | Crystalline forms of (S)-7-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(3,4-dichlorophenyl)- 1,2,3,4-tetrahydroisoquinoline and use thereof |
| CA3112326A1 (en) | 2018-09-12 | 2020-03-19 | Novartis Ag | Antiviral pyridopyrazinedione compounds |
| KR20250127350A (ko) | 2019-09-26 | 2025-08-26 | 노파르티스 아게 | 항바이러스성 피라졸로피리디논 화합물 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4680391A (en) | 1983-12-01 | 1987-07-14 | Merck & Co., Inc. | Substituted azetidinones as anti-inflammatory and antidegenerative agents |
| US5229381A (en) * | 1983-12-01 | 1993-07-20 | Merck & Co., Inc. | Substituted azetidinones as anti-inflammatory and antidegenerative agents |
| NZ228600A (en) * | 1988-04-11 | 1992-02-25 | Merck & Co Inc | 1-(benzylaminocarbonyl)-4-phenoxy-azetidin-2-one derivatives |
| DE69032810T2 (de) | 1989-01-03 | 1999-06-17 | Marcos Y Kleinerman | Fernmessung physikalischer Variablen mit faseroptischen Systemen |
| US5104862A (en) | 1991-03-20 | 1992-04-14 | Merck & Co., Inc. | Bethalactam elastase inhibitors containing phosphorous acid derivatives at the 4-position of the 2-azetidinone |
| US5100880A (en) | 1991-03-20 | 1992-03-31 | Merck & Co., Inc. | Novel betalactam elastase inhibitors containing phosphorous acid derivatives at the 4-position of the 2-azetidinone |
| GB2266527A (en) | 1992-03-17 | 1993-11-03 | Merck & Co Inc | Substituted azetidinones useful in the treatment of leukemia |
| GB9314350D0 (en) * | 1993-07-12 | 1993-08-25 | Zeneca Ltd | Armide derivatives |
| FI963753L (fi) * | 1994-03-23 | 1996-09-20 | Tokyo Tanabe Co | Uusi lääke hengitysteiden virustaudin hoitamiseksi |
| EP0883402A4 (en) * | 1996-01-11 | 1999-08-11 | Smithkline Beecham Corp | NEW CYCLOALKYL-SUBSTITUTED IMIDAZOLES |
| CA2241891A1 (en) * | 1996-02-21 | 1997-08-21 | Darwin Discovery Limited | Quinolones and their therapeutic use |
| JPH09255547A (ja) * | 1996-03-22 | 1997-09-30 | Kao Corp | 皮膚外用剤 |
-
1998
- 1998-10-06 CA CA002301548A patent/CA2301548C/en not_active Expired - Fee Related
- 1998-10-06 DE DE69810651T patent/DE69810651T2/de not_active Expired - Lifetime
- 1998-10-06 AT AT98947255T patent/ATE230725T1/de active
- 1998-10-06 JP JP2000514883A patent/JP2001519328A/ja not_active Ceased
- 1998-10-06 EP EP98947255A patent/EP1021404B1/en not_active Expired - Lifetime
- 1998-10-06 PT PT98947255T patent/PT1021404E/pt unknown
- 1998-10-06 US US09/167,142 patent/US6239125B1/en not_active Expired - Lifetime
- 1998-10-06 ES ES98947255T patent/ES2187063T3/es not_active Expired - Lifetime
- 1998-10-06 WO PCT/CA1998/000952 patent/WO1999018071A1/en not_active Ceased
- 1998-10-06 DK DK98947255T patent/DK1021404T3/da active
- 1998-10-06 AU AU94259/98A patent/AU9425998A/en not_active Abandoned
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU98113300A (ru) | Производные хиназолина | |
| RU2002121645A (ru) | Производные 2-аминоникотинамида и их применение в качестве ингибиторов vegf-рецептора тирозинкиназы | |
| KR920021514A (ko) | 피리딘 유도체, 이의 제법 및 용도 | |
| JP2005501796A5 (https=) | ||
| KR940021063A (ko) | 퀴놀론카르복실산 유도체, 이의 제조방법 및 용도 | |
| JP2007530459A5 (https=) | ||
| NO970308L (no) | Heterosykliske forbindelser som er anvendbare som allosteriske effektorer ved muskarinske reseptorer | |
| JP2005507918A5 (https=) | ||
| EP0368640A3 (en) | Heterocyclic compounds | |
| JP2001519328A5 (https=) | ||
| JP2004512281A5 (https=) | ||
| SE8301412L (sv) | Substituerade 1h-pyrazolo(1,5)pyrimidiner och forfarande for deras framstellning | |
| EP0096517A3 (en) | Aryl pyrazinones | |
| JP2005503435A5 (https=) | ||
| JP2001519330A5 (https=) | ||
| JO1185B1 (en) | Pyrimidine derivatives aprocess for their preparation and compositions containing them and their use as histamine h1-antagonists | |
| RU92016234A (ru) | Производные 3(2н)-пиридазинона, способ их получения, применение, фармацевтическая композиция, способ лечения | |
| DK1256581T3 (da) | Forebyggende eller terapeutiske midler til gastrisk eller ösofageal regurgitation | |
| KR950025039A (ko) | 신규의 치환된 피리딘 이미다졸 유도체 및 그의 제조방법 | |
| EP0205299A3 (en) | Isatin derivatives, compositions containing the same, and the use thereof for ulcer diseases | |
| ATE27818T1 (de) | Pyrimidonderivate. | |
| SE8300580L (sv) | Substituerade 1,3,4-tiadiazolo (3,2-a)pyrimidiner och forfarande for deras framstellning | |
| FI830940L (fi) | Guanidino-heterocykliskafenylamidiner, foerfarande foer deras framstaellning och deras farmaceutiskanvaendning | |
| FI842432A0 (fi) | Amidinderivat av 2-substituerad 4-fenyl-imidazoler, foerfarande foer deras framstaellning och deras farmaceutiska anvaendning. | |
| RU2002101136A (ru) | Средства для лечения и профилактики неоплазм |