JP2001510831A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2001510831A5 JP2001510831A5 JP2000504120A JP2000504120A JP2001510831A5 JP 2001510831 A5 JP2001510831 A5 JP 2001510831A5 JP 2000504120 A JP2000504120 A JP 2000504120A JP 2000504120 A JP2000504120 A JP 2000504120A JP 2001510831 A5 JP2001510831 A5 JP 2001510831A5
- Authority
- JP
- Japan
- Prior art keywords
- piperazinyl
- methoxypyrimidine
- methoxy
- pyrimidine
- chlorohydrate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 amino, acetamido, nitro, methyl Chemical group 0.000 description 52
- 150000001875 compounds Chemical class 0.000 description 21
- 125000001424 substituent group Chemical group 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 8
- 125000004430 oxygen atom Chemical group O* 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 6
- 125000001072 heteroaryl group Chemical group 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 229910052717 sulfur Chemical group 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- XAEAFOPJORAPHJ-UHFFFAOYSA-N (2-hydroxyphenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)O)=N1 XAEAFOPJORAPHJ-UHFFFAOYSA-N 0.000 description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- FTZPBBKANJNASG-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-phenylmethanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC=CC=2)=N1 FTZPBBKANJNASG-UHFFFAOYSA-N 0.000 description 2
- ACNPUFRLGXYSCY-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-thiophen-3-ylmethanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C2=CSC=C2)=N1 ACNPUFRLGXYSCY-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- NGWLNKFLKBEANP-UHFFFAOYSA-N furan-2-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2OC=CC=2)=N1 NGWLNKFLKBEANP-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- XEHFVPPGVYDARR-UHFFFAOYSA-N (2-aminophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)N)=N1 XEHFVPPGVYDARR-UHFFFAOYSA-N 0.000 description 1
- MMGIZPLGTZIQIX-UHFFFAOYSA-N (2-aminophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)N)=N1 MMGIZPLGTZIQIX-UHFFFAOYSA-N 0.000 description 1
- GGSGOXASLBKDOX-UHFFFAOYSA-N (2-chlorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)Cl)=N1 GGSGOXASLBKDOX-UHFFFAOYSA-N 0.000 description 1
- HOBCYLLZHTXYMO-UHFFFAOYSA-N (2-chlorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone hypochlorous acid Chemical compound ClO.ClC1=C(C(=O)N2CCN(CC2)C2=NC=CC(=N2)OC)C=CC=C1 HOBCYLLZHTXYMO-UHFFFAOYSA-N 0.000 description 1
- QUKFWFGKFSRPQY-UHFFFAOYSA-N (2-fluorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)F)=N1 QUKFWFGKFSRPQY-UHFFFAOYSA-N 0.000 description 1
- YUIMKLQZNGROIQ-UHFFFAOYSA-N (2-methoxyphenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)OC)=N1 YUIMKLQZNGROIQ-UHFFFAOYSA-N 0.000 description 1
- SYKJCEFDKJRZRV-UHFFFAOYSA-N (3-chloro-1-benzothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C3=CC=CC=C3S2)Cl)=N1 SYKJCEFDKJRZRV-UHFFFAOYSA-N 0.000 description 1
- BCXZYTKAHHILHR-UHFFFAOYSA-N (3-chloro-1-benzothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C3=CC=CC=C3S2)Cl)=N1 BCXZYTKAHHILHR-UHFFFAOYSA-N 0.000 description 1
- UQRULFYBKXBQAL-UHFFFAOYSA-N (3-chlorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=C(Cl)C=CC=2)=N1 UQRULFYBKXBQAL-UHFFFAOYSA-N 0.000 description 1
- AYTJYGWCGZPRQH-UHFFFAOYSA-N (3-chlorothiophen-2-yl)-[4-(4-ethoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound CCOC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)Cl)=N1 AYTJYGWCGZPRQH-UHFFFAOYSA-N 0.000 description 1
- WSXQBJJKNDACFV-UHFFFAOYSA-N (3-chlorothiophen-2-yl)-[4-(4-ethoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.CCOC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)Cl)=N1 WSXQBJJKNDACFV-UHFFFAOYSA-N 0.000 description 1
- IKPTYEDWQZPHHD-UHFFFAOYSA-N (3-chlorothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)Cl)=N1 IKPTYEDWQZPHHD-UHFFFAOYSA-N 0.000 description 1
- IEKZYCVMHLVDDC-UHFFFAOYSA-N (3-chlorothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)Cl)=N1 IEKZYCVMHLVDDC-UHFFFAOYSA-N 0.000 description 1
- QFVRBMCQVTUKJK-UHFFFAOYSA-N (3-chlorothiophen-2-yl)-[4-(4-propan-2-yloxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound CC(C)OC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)Cl)=N1 QFVRBMCQVTUKJK-UHFFFAOYSA-N 0.000 description 1
- XZRDDFNJOXKMSD-UHFFFAOYSA-N (3-chlorothiophen-2-yl)-[4-(4-propan-2-yloxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.CC(C)OC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)Cl)=N1 XZRDDFNJOXKMSD-UHFFFAOYSA-N 0.000 description 1
- UWODUYCDZAOEKF-UHFFFAOYSA-N (3-fluorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=C(F)C=CC=2)=N1 UWODUYCDZAOEKF-UHFFFAOYSA-N 0.000 description 1
- OTWCOUGCRXGZAO-UHFFFAOYSA-N (3-fluorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=C(F)C=CC=2)=N1 OTWCOUGCRXGZAO-UHFFFAOYSA-N 0.000 description 1
- OOVZVMGFQBXADV-UHFFFAOYSA-N (3-fluorothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)F)=N1 OOVZVMGFQBXADV-UHFFFAOYSA-N 0.000 description 1
- XKPICPMDOYQGLN-UHFFFAOYSA-N (3-fluorothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)F)=N1 XKPICPMDOYQGLN-UHFFFAOYSA-N 0.000 description 1
- GIOFVHWSBGMPJT-UHFFFAOYSA-N (3-methoxyphenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=CC(C(=O)N2CCN(CC2)C=2N=C(OC)C=CN=2)=C1 GIOFVHWSBGMPJT-UHFFFAOYSA-N 0.000 description 1
- WHWQXBUXEZELSM-UHFFFAOYSA-N (4-chlorophenyl)-[4-(4,4-dimethoxy-1h-pyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound C1=CC(OC)(OC)NC(N2CCN(CC2)C(=O)C=2C=CC(Cl)=CC=2)=N1 WHWQXBUXEZELSM-UHFFFAOYSA-N 0.000 description 1
- APLKSROKOVCWND-UHFFFAOYSA-N (4-chlorophenyl)-[4-(4,4-dimethoxy-1h-pyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.C1=CC(OC)(OC)NC(N2CCN(CC2)C(=O)C=2C=CC(Cl)=CC=2)=N1 APLKSROKOVCWND-UHFFFAOYSA-N 0.000 description 1
- COZIABXQRYUDTN-UHFFFAOYSA-N (4-chlorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(Cl)=CC=2)=N1 COZIABXQRYUDTN-UHFFFAOYSA-N 0.000 description 1
- ZVBNPNXVAJUCCS-UHFFFAOYSA-N (4-chlorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(Cl)=CC=2)=N1 ZVBNPNXVAJUCCS-UHFFFAOYSA-N 0.000 description 1
- YGFKQKNWPIFDAT-UHFFFAOYSA-N (4-fluorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(F)=CC=2)=N1 YGFKQKNWPIFDAT-UHFFFAOYSA-N 0.000 description 1
- MCXVRWDYRKMOGQ-UHFFFAOYSA-N (4-fluorophenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(F)=CC=2)=N1 MCXVRWDYRKMOGQ-UHFFFAOYSA-N 0.000 description 1
- GWOPRVSTEXYZKZ-UHFFFAOYSA-N (4-fluorophenyl)-[4-(4-propan-2-yloxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound CC(C)OC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(F)=CC=2)=N1 GWOPRVSTEXYZKZ-UHFFFAOYSA-N 0.000 description 1
- AWXPEJQUKNPBCE-UHFFFAOYSA-N (4-fluorophenyl)-[4-(4-propan-2-yloxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.CC(C)OC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(F)=CC=2)=N1 AWXPEJQUKNPBCE-UHFFFAOYSA-N 0.000 description 1
- CVTVGRRTTYVCTR-UHFFFAOYSA-N (5-chlorothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2SC(Cl)=CC=2)=N1 CVTVGRRTTYVCTR-UHFFFAOYSA-N 0.000 description 1
- SBVQPYBMEXWNHB-UHFFFAOYSA-N (5-chlorothiophen-2-yl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2SC(Cl)=CC=2)=N1 SBVQPYBMEXWNHB-UHFFFAOYSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- SZFDVODFRHIJMU-UHFFFAOYSA-N 1-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-2-thiophen-2-ylethanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)CC=2SC=CC=2)=N1 SZFDVODFRHIJMU-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- HTMSBDOORJXZBE-UHFFFAOYSA-N 1h-indol-2-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2NC3=CC=CC=C3C=2)=N1 HTMSBDOORJXZBE-UHFFFAOYSA-N 0.000 description 1
- UQVWWXFAOMCPEW-UHFFFAOYSA-N 1h-indol-3-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C3=CC=CC=C3NC=2)=N1 UQVWWXFAOMCPEW-UHFFFAOYSA-N 0.000 description 1
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- AHBRLJHXVMDVPT-UHFFFAOYSA-N 2-(1-benzothiophen-3-yl)-1-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]ethanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)CC=2C3=CC=CC=C3SC=2)=N1 AHBRLJHXVMDVPT-UHFFFAOYSA-N 0.000 description 1
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 1
- LNGCZSUOQHOGAY-UHFFFAOYSA-N 2-[4-(4-methoxypyrimidin-2-yl)piperazine-1-carbonyl]benzoic acid Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C(O)=O)=N1 LNGCZSUOQHOGAY-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 208000024827 Alzheimer disease Diseases 0.000 description 1
- OEUHMSCHOUIVDY-UHFFFAOYSA-N ClO.FC1=C(C(=O)N2CCN(CC2)C2=NC=CC(=N2)OC)C=CC=C1 Chemical compound ClO.FC1=C(C(=O)N2CCN(CC2)C2=NC=CC(=N2)OC)C=CC=C1 OEUHMSCHOUIVDY-UHFFFAOYSA-N 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 description 1
- OYYNOSNMCSATCG-UHFFFAOYSA-N [2-[4-(4-methoxypyrimidin-2-yl)piperazine-1-carbonyl]phenyl] acetate Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)OC(C)=O)=N1 OYYNOSNMCSATCG-UHFFFAOYSA-N 0.000 description 1
- XPQBOJVXVCTARQ-UHFFFAOYSA-N [4-(4,4-dimethoxy-1h-pyrimidin-2-yl)piperazin-1-yl]-(2-methoxyphenyl)methanone Chemical compound COC1=CC=CC=C1C(=O)N1CCN(C=2NC(C=CN=2)(OC)OC)CC1 XPQBOJVXVCTARQ-UHFFFAOYSA-N 0.000 description 1
- FYXLAHNBRAKYBH-UHFFFAOYSA-N [4-(4-ethoxypyrimidin-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone Chemical compound CCOC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 FYXLAHNBRAKYBH-UHFFFAOYSA-N 0.000 description 1
- AHWKPVWHSRZRPS-UHFFFAOYSA-N [4-(4-ethoxypyrimidin-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone;hypochlorous acid Chemical compound ClO.CCOC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 AHWKPVWHSRZRPS-UHFFFAOYSA-N 0.000 description 1
- OSJQFTZRLHOORX-UHFFFAOYSA-N [4-(4-ethoxypyrimidin-2-yl)piperazin-1-yl]-pyridin-2-ylmethanone Chemical compound CCOC1=CC=NC(N2CCN(CC2)C(=O)C=2N=CC=CC=2)=N1 OSJQFTZRLHOORX-UHFFFAOYSA-N 0.000 description 1
- SDPJPFHCPZGSJA-UHFFFAOYSA-N [4-(4-ethoxypyrimidin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone Chemical compound CCOC1=CC=NC(N2CCN(CC2)C(=O)C=2SC=CC=2)=N1 SDPJPFHCPZGSJA-UHFFFAOYSA-N 0.000 description 1
- PSFUUQIFXVZAEU-UHFFFAOYSA-N [4-(4-ethoxypyrimidin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone;hypochlorous acid Chemical compound ClO.CCOC1=CC=NC(N2CCN(CC2)C(=O)C=2SC=CC=2)=N1 PSFUUQIFXVZAEU-UHFFFAOYSA-N 0.000 description 1
- VWIITCYUQQLPGR-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(1,3-thiazol-2-yl)methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2SC=CN=2)=N1 VWIITCYUQQLPGR-UHFFFAOYSA-N 0.000 description 1
- GJGJOHPAKLZBKR-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(1h-pyrrol-2-yl)methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2NC=CC=2)=N1 GJGJOHPAKLZBKR-UHFFFAOYSA-N 0.000 description 1
- WWEMTGZUYMPMMP-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(2-methylphenyl)methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C)=N1 WWEMTGZUYMPMMP-UHFFFAOYSA-N 0.000 description 1
- WXLGMERILCDMDP-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(3-methylthiophen-2-yl)methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C2=C(C=CS2)C)=N1 WXLGMERILCDMDP-UHFFFAOYSA-N 0.000 description 1
- NQELHAAPESACKB-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C2OCCC2)=N1 NQELHAAPESACKB-UHFFFAOYSA-N 0.000 description 1
- ARAOQRKKQXNWBE-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 ARAOQRKKQXNWBE-UHFFFAOYSA-N 0.000 description 1
- MWJNWHVWYWXHLK-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=C(C=CC=2)C(F)(F)F)=N1 MWJNWHVWYWXHLK-UHFFFAOYSA-N 0.000 description 1
- MYFPANWXCSKCTN-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(=CC=2)C(F)(F)F)=N1 MYFPANWXCSKCTN-UHFFFAOYSA-N 0.000 description 1
- OSLQMALCAFWODX-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-phenylmethanethione Chemical compound COC1=CC=NC(N2CCN(CC2)C(=S)C=2C=CC=CC=2)=N1 OSLQMALCAFWODX-UHFFFAOYSA-N 0.000 description 1
- HBLIWHCJAXRHBK-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-pyridin-3-ylmethanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=NC=CC=2)=N1 HBLIWHCJAXRHBK-UHFFFAOYSA-N 0.000 description 1
- NPWZFZBCNVGVJT-UHFFFAOYSA-N [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-pyridin-4-ylmethanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CN=CC=2)=N1 NPWZFZBCNVGVJT-UHFFFAOYSA-N 0.000 description 1
- AUVXEDVMZLXJLF-UHFFFAOYSA-N [4-(4-propan-2-yloxypyrimidin-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone Chemical compound CC(C)OC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 AUVXEDVMZLXJLF-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000002460 anti-migrenic effect Effects 0.000 description 1
- 230000000561 anti-psychotic effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- SNSXJKMXVJXPHM-UHFFFAOYSA-N chloro hypochlorite;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-pyridin-4-ylmethanone Chemical compound ClOCl.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CN=CC=2)=N1 SNSXJKMXVJXPHM-UHFFFAOYSA-N 0.000 description 1
- 150000005698 chloropyrimidines Chemical class 0.000 description 1
- 208000010877 cognitive disease Diseases 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- BZUCEZDSIXZHCI-UHFFFAOYSA-N cyclohexyl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)C2CCCCC2)=N1 BZUCEZDSIXZHCI-UHFFFAOYSA-N 0.000 description 1
- GQACUWKHPJOQES-UHFFFAOYSA-N cyclohexyl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone;hypochlorous acid Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C2CCCCC2)=N1 GQACUWKHPJOQES-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000003193 general anesthetic agent Substances 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LWVKWPKGQXNRNS-UHFFFAOYSA-N hypochlorous acid [4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(3-methylthiophen-2-yl)methanone Chemical compound ClO.CC1=C(SC=C1)C(=O)N1CCN(CC1)C1=NC=CC(=N1)OC LWVKWPKGQXNRNS-UHFFFAOYSA-N 0.000 description 1
- YZUJEGUKSRPVLD-UHFFFAOYSA-N hypochlorous acid;(2-methoxyphenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)OC)=N1 YZUJEGUKSRPVLD-UHFFFAOYSA-N 0.000 description 1
- WQXGYHRMQIOWJG-UHFFFAOYSA-N hypochlorous acid;(3-methoxyphenyl)-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound ClO.COC1=CC=CC(C(=O)N2CCN(CC2)C=2N=C(OC)C=CN=2)=C1 WQXGYHRMQIOWJG-UHFFFAOYSA-N 0.000 description 1
- ZKWDQYRVKGESBA-UHFFFAOYSA-N hypochlorous acid;1-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-2-thiophen-2-ylethanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)CC=2SC=CC=2)=N1 ZKWDQYRVKGESBA-UHFFFAOYSA-N 0.000 description 1
- HMBXHXZNOYPGMA-UHFFFAOYSA-N hypochlorous acid;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(1h-pyrrol-2-yl)methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2NC=CC=2)=N1 HMBXHXZNOYPGMA-UHFFFAOYSA-N 0.000 description 1
- HIITVUJRVSWUBQ-UHFFFAOYSA-N hypochlorous acid;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(2-methylphenyl)methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C)=N1 HIITVUJRVSWUBQ-UHFFFAOYSA-N 0.000 description 1
- HQAPDPSFBKBEGV-UHFFFAOYSA-N hypochlorous acid;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C2OCCC2)=N1 HQAPDPSFBKBEGV-UHFFFAOYSA-N 0.000 description 1
- YGYSONQYSJZYJP-UHFFFAOYSA-N hypochlorous acid;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 YGYSONQYSJZYJP-UHFFFAOYSA-N 0.000 description 1
- QVBOAQOPYXIGOA-UHFFFAOYSA-N hypochlorous acid;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=C(C=CC=2)C(F)(F)F)=N1 QVBOAQOPYXIGOA-UHFFFAOYSA-N 0.000 description 1
- VUSFSNTXKUGRIA-UHFFFAOYSA-N hypochlorous acid;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)C=2C=CC(=CC=2)C(F)(F)F)=N1 VUSFSNTXKUGRIA-UHFFFAOYSA-N 0.000 description 1
- PMCCCXBDVOQIGK-UHFFFAOYSA-N hypochlorous acid;[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-phenylmethanethione Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=S)C=2C=CC=CC=2)=N1 PMCCCXBDVOQIGK-UHFFFAOYSA-N 0.000 description 1
- TYDOCRLSFPJDRI-UHFFFAOYSA-N hypochlorous acid;[4-(4-propan-2-yloxypyrimidin-2-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone Chemical compound ClO.CC(C)OC1=CC=NC(N2CCN(CC2)C(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 TYDOCRLSFPJDRI-UHFFFAOYSA-N 0.000 description 1
- ICJGLNAILQRSEX-UHFFFAOYSA-N hypochlorous acid;imidazol-1-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound ClO.COC1=CC=NC(N2CCN(CC2)C(=O)N2C=NC=C2)=N1 ICJGLNAILQRSEX-UHFFFAOYSA-N 0.000 description 1
- FMXQNQUPVNOKMS-UHFFFAOYSA-N hypochlorous acid;pyridin-3-yl-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone Chemical compound ClO.FC(F)(F)C1=CC=NC(N2CCN(CC2)C(=O)C=2C=NC=CC=2)=N1 FMXQNQUPVNOKMS-UHFFFAOYSA-N 0.000 description 1
- FYQWQMORSZRLBE-UHFFFAOYSA-N imidazol-1-yl-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone Chemical compound COC1=CC=NC(N2CCN(CC2)C(=O)N2C=NC=C2)=N1 FYQWQMORSZRLBE-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 230000036640 muscle relaxation Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- YWBIHJNGIRKAME-UHFFFAOYSA-N pyridin-3-yl-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone Chemical compound FC(F)(F)C1=CC=NC(N2CCN(CC2)C(=O)C=2C=NC=CC=2)=N1 YWBIHJNGIRKAME-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 208000019116 sleep disease Diseases 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES9701627 | 1997-07-21 | ||
| ES009701627A ES2125206B1 (es) | 1997-07-21 | 1997-07-21 | Derivados de acil-piperazinil-pirimidinas, su preparacion y su aplicacion como medicamentos. |
| PCT/ES1998/000212 WO1999005121A1 (es) | 1997-07-21 | 1998-07-21 | Derivados de acil-piperazinil-pirimidinas, su preparacion y su aplicacion como medicamentos |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2001510831A JP2001510831A (ja) | 2001-08-07 |
| JP2001510831A5 true JP2001510831A5 (https=) | 2006-01-05 |
Family
ID=8300152
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000504120A Pending JP2001510831A (ja) | 1997-07-21 | 1998-07-21 | アシル−ピペラジニル−ピリミジン誘導体、その製法および医薬としての応用 |
Country Status (33)
| Country | Link |
|---|---|
| US (1) | US6372746B1 (https=) |
| EP (1) | EP1006110B8 (https=) |
| JP (1) | JP2001510831A (https=) |
| KR (1) | KR100514148B1 (https=) |
| CN (1) | CN1202087C (https=) |
| AR (1) | AR017254A1 (https=) |
| AT (1) | ATE259357T1 (https=) |
| AU (1) | AU744633B2 (https=) |
| BG (1) | BG64849B1 (https=) |
| BR (1) | BR9810772A (https=) |
| CA (1) | CA2297417C (https=) |
| CO (1) | CO5011090A1 (https=) |
| DE (1) | DE69821623T2 (https=) |
| DK (1) | DK1006110T3 (https=) |
| EE (1) | EE04151B1 (https=) |
| ES (2) | ES2125206B1 (https=) |
| GE (1) | GEP20033090B (https=) |
| HU (1) | HUP0002517A3 (https=) |
| IN (1) | IN183820B (https=) |
| IS (1) | IS2076B (https=) |
| LT (1) | LT4728B (https=) |
| LV (1) | LV12457B (https=) |
| NO (1) | NO314996B1 (https=) |
| NZ (1) | NZ502400A (https=) |
| PL (1) | PL195632B1 (https=) |
| PT (1) | PT1006110E (https=) |
| RU (1) | RU2205827C2 (https=) |
| SI (1) | SI20269B (https=) |
| SK (1) | SK284675B6 (https=) |
| TW (1) | TW530056B (https=) |
| UA (1) | UA59403C2 (https=) |
| WO (1) | WO1999005121A1 (https=) |
| ZA (1) | ZA986437B (https=) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10035908A1 (de) | 2000-07-21 | 2002-03-07 | Asta Medica Ag | Neue Heteroaryl-Derivate und deren Verwendung als Arzneimittel |
| ES2167276B1 (es) * | 2000-10-20 | 2003-04-01 | Esteve Labor Dr | Nuevos derivados de cianoaril (o cianoheteroaril)-carbonil-piperazinil-pirimidinas, su preparacion y su aplicacion como medicamentos. |
| EP1373204B1 (en) | 2001-03-09 | 2016-10-26 | Janssen Pharmaceuticals, Inc. | Heterocyclic compounds |
| US7390813B1 (en) * | 2001-12-21 | 2008-06-24 | Xenon Pharmaceuticals Inc. | Pyridylpiperazines and aminonicotinamides and their use as therapeutic agents |
| US20050119251A1 (en) * | 2001-12-21 | 2005-06-02 | Jian-Min Fu | Nicotinamide derivatives and their use as therapeutic agents |
| US7842693B2 (en) * | 2002-06-12 | 2010-11-30 | Chemocentryx, Inc. | Substituted piperazines |
| US7589199B2 (en) | 2002-06-12 | 2009-09-15 | Chemocentryx, Inc. | Substituted piperazines |
| EP1531822B1 (en) | 2002-06-12 | 2009-08-05 | ChemoCentryx Inc | 1-aryl-4-substituted piperazine derivatives for use as ccr1 antagonists for the treatment of inflammation and immune disorders |
| UA79286C2 (en) * | 2002-06-29 | 2007-06-11 | Zentaris Gmbh | Arylcarbonylpipererazines and heteroarylcarbonylpiperazines and their use in the treatment of benign and malignant tumors |
| US20040127395A1 (en) * | 2002-09-06 | 2004-07-01 | Desai Pragnya J. | Use of histamine H4 receptor modulators for the treatment of allergy and asthma |
| US7435831B2 (en) | 2004-03-03 | 2008-10-14 | Chemocentryx, Inc. | Bicyclic and bridged nitrogen heterocycles |
| US7435830B2 (en) | 2004-03-03 | 2008-10-14 | Chemocentryx, Inc. | Bicyclic and bridged nitrogen heterocycles |
| EP1827438B2 (en) * | 2004-09-20 | 2014-12-10 | Xenon Pharmaceuticals Inc. | Piperazin derivatives for inhibiting human stearoyl-coa-desaturase |
| AU2005286790A1 (en) * | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Bicyclic heterocyclic derivatives and their use as inhibitors of stearoyl-CoA-desaturase (SCD) |
| MX2007003318A (es) | 2004-09-20 | 2007-05-18 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como agentes terapeuticos. |
| BRPI0515500A (pt) * | 2004-09-20 | 2008-07-29 | Xenon Pharmaceuticals Inc | derivados piridazina para inibição de estearoil-coa-desaturase |
| CN101084211A (zh) * | 2004-09-20 | 2007-12-05 | 泽农医药公司 | 杂环衍生物及其作为治疗剂的用途 |
| BRPI0515482A (pt) * | 2004-09-20 | 2008-07-22 | Xenon Pharmaceuticals Inc | derivados heterocìclicos e seus usos como agentes terapêuticos |
| AU2005286728A1 (en) * | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as mediators of stearoyl-CoA desaturase |
| AU2005286647A1 (en) | 2004-09-20 | 2006-03-30 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| MX2007003332A (es) * | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como inhibidores de estearoil-coa-desaturasa. |
| CA2618646A1 (en) * | 2005-06-03 | 2007-11-15 | Xenon Pharmaceuticals Inc. | Aminothiazole derivatives as human stearoyl-coa desaturase inhibitors |
| EP2392571A3 (en) * | 2005-07-29 | 2012-03-14 | F. Hoffmann-La Roche AG | Indol-3-yl-carbonyl-piperidin and piperazin derivatives |
| US8609672B2 (en) | 2010-08-27 | 2013-12-17 | University Of The Pacific | Piperazinylpyrimidine analogues as protein kinase inhibitors |
| GB2497476B (en) | 2010-09-06 | 2018-01-10 | Guangzhou Inst Biomed & Health | Amide Compounds |
| CN105263910A (zh) * | 2013-02-18 | 2016-01-20 | 斯克利普斯研究所 | 具有治疗潜力的血管加压素受体调节剂 |
| JP2018012645A (ja) * | 2014-11-26 | 2018-01-25 | 持田製薬株式会社 | 新規ジアザビシクロ誘導体 |
| PE20241304A1 (es) * | 2021-07-30 | 2024-06-24 | Confo Therapeutics N V | Compuestos para el tratamiento del dolor, en particular el dolor neuropatico, y/u otras enfermedades o trastornos que se asocian con at2r y/o senalizacion mediada por at2r |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2535718A1 (fr) * | 1982-11-09 | 1984-05-11 | Sanofi Sa | (piperazinyl-1)-2 pyrimidines, leurs sels, procede pour leur preparation et compositions pharmaceutiques en contenant |
| US4547505A (en) * | 1983-03-25 | 1985-10-15 | Degussa Aktiengesellschaft | N-Phenyl-N-'-cycloalkylalkanoylpiperazine useful as analgetics and process for its production |
| WO1987004928A1 (fr) * | 1986-02-24 | 1987-08-27 | Mitsui Petrochemical Industries, Ltd. | Agents therapeutiques de la neuropathie |
| FR2642759B1 (fr) * | 1989-02-09 | 1991-05-17 | Laboratorios Esteve Sa | Derives de pyrimidyl-piperazinyl-alkyl azoles avec activite anxiolytique et/ou tranquillisante |
| FR2672052B1 (fr) * | 1991-01-28 | 1995-05-24 | Esteve Labor Dr | Derives d'aryl (ou heteroaryl)-piperazinyl-alkyl-azoles, leur preparation et leur application en tant que medicaments. |
| GB9226610D0 (en) * | 1992-12-21 | 1993-02-17 | Smithkline Beecham Plc | Compounds |
-
1997
- 1997-07-21 ES ES009701627A patent/ES2125206B1/es not_active Expired - Fee Related
-
1998
- 1998-07-16 AR ARP980103475A patent/AR017254A1/es active IP Right Grant
- 1998-07-17 TW TW087111649A patent/TW530056B/zh not_active IP Right Cessation
- 1998-07-17 CO CO98040807A patent/CO5011090A1/es unknown
- 1998-07-20 ZA ZA986437A patent/ZA986437B/xx unknown
- 1998-07-21 RU RU2000104007/04A patent/RU2205827C2/ru not_active IP Right Cessation
- 1998-07-21 UA UA2000010370A patent/UA59403C2/uk unknown
- 1998-07-21 DE DE69821623T patent/DE69821623T2/de not_active Expired - Fee Related
- 1998-07-21 PT PT98933660T patent/PT1006110E/pt unknown
- 1998-07-21 HU HU0002517A patent/HUP0002517A3/hu unknown
- 1998-07-21 CA CA002297417A patent/CA2297417C/en not_active Expired - Fee Related
- 1998-07-21 KR KR10-2000-7000602A patent/KR100514148B1/ko not_active Expired - Fee Related
- 1998-07-21 AU AU83403/98A patent/AU744633B2/en not_active Ceased
- 1998-07-21 ES ES98933660T patent/ES2216297T3/es not_active Expired - Lifetime
- 1998-07-21 US US09/462,880 patent/US6372746B1/en not_active Expired - Fee Related
- 1998-07-21 BR BR9810772-0A patent/BR9810772A/pt not_active Application Discontinuation
- 1998-07-21 NZ NZ502400A patent/NZ502400A/en unknown
- 1998-07-21 CN CNB988084589A patent/CN1202087C/zh not_active Expired - Fee Related
- 1998-07-21 WO PCT/ES1998/000212 patent/WO1999005121A1/es not_active Ceased
- 1998-07-21 DK DK98933660T patent/DK1006110T3/da active
- 1998-07-21 EE EEP200000037A patent/EE04151B1/xx not_active IP Right Cessation
- 1998-07-21 GE GEAP19985226A patent/GEP20033090B/en unknown
- 1998-07-21 PL PL98338143A patent/PL195632B1/pl unknown
- 1998-07-21 IN IN1272CA1998 patent/IN183820B/en unknown
- 1998-07-21 SK SK72-2000A patent/SK284675B6/sk unknown
- 1998-07-21 JP JP2000504120A patent/JP2001510831A/ja active Pending
- 1998-07-21 EP EP98933660A patent/EP1006110B8/en not_active Expired - Lifetime
- 1998-07-21 SI SI9820053A patent/SI20269B/sl not_active IP Right Cessation
- 1998-07-21 AT AT98933660T patent/ATE259357T1/de not_active IP Right Cessation
-
2000
- 2000-01-18 LT LT2000004A patent/LT4728B/lt unknown
- 2000-01-19 IS IS5353A patent/IS2076B/is unknown
- 2000-01-20 NO NO20000294A patent/NO314996B1/no unknown
- 2000-01-21 BG BG104100A patent/BG64849B1/bg unknown
- 2000-01-21 LV LVP-00-08A patent/LV12457B/en unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2001510831A5 (https=) | ||
| RU2205827C2 (ru) | Производное ацилпиперазинилпиримидина, способы его получения, фармацевтическая композиция | |
| RU2000104007A (ru) | Производные ацилпиперазинилпиримидинов, их получение и применение в качестве лекарственных средств | |
| RU2386620C2 (ru) | Производные пиридазин-3(2н)-она и их применение в качестве ингибиторов фдэ4 | |
| KR100521735B1 (ko) | 아데노신 수용체 조절인자 | |
| KR100659428B1 (ko) | Npy 길항제로서의 퀴놀린 유도체 | |
| JP2006514942A5 (https=) | ||
| BG107959A (bg) | Заместени производни на триазол диамин като киназни инхибитори | |
| JP2005526723A5 (https=) | ||
| JPH11193281A (ja) | アデノシンa3受容体拮抗剤およびチアゾール化合物 | |
| CA2401241A1 (en) | 2-amino-3-(alkyl)-pyrimidone derivatives as gsk3.beta. inhibitors | |
| JP2003528095A5 (https=) | ||
| JP2012510989A5 (https=) | ||
| RU2005133994A (ru) | Оксимные производные и их применение в качестве фармацевтически активных агентов | |
| JP2004532240A5 (https=) | ||
| JP2005505583A5 (https=) | ||
| JP2004525184A5 (https=) | ||
| JP2000302680A (ja) | 脳保護剤 | |
| JP4523289B2 (ja) | 脳虚血障害又はcns障害の処置のための薬剤としてのピペラジンベンゾチアゾール | |
| RU2005111983A (ru) | Производные 4-(фенил-пиперазинил-метил)бензамида и их применение для лечения боли или желудочно-кишечных расстройств | |
| CZ2000143A3 (cs) | Deriváty acylpiperazinylpyrimidinů, způsob jejich výroby a farmaceutická kompozice na jejich bázi | |
| MXPA00000835A (en) | Derivatives of acyl-piperazinil-pyrimidins, preparation thereof and application as medicaments | |
| HK1032958B (en) | Derivatives of acyl-piperazinil-pyrimidins, preparation thereof and application as medicaments | |
| RU2006125155A (ru) | Производные n-{(1, 5-дифенил-1h-пиразол-3-ил)метил}сульфонамида, их получение и их применение в терапии | |
| JP2000063277A (ja) | Crf受容体拮抗薬 |