IL38496A - Basically substituted 4-benzyl phthalazone derivatives,acid salts thereof and process for the production thereof - Google Patents
Basically substituted 4-benzyl phthalazone derivatives,acid salts thereof and process for the production thereofInfo
- Publication number
- IL38496A IL38496A IL38496A IL3849672A IL38496A IL 38496 A IL38496 A IL 38496A IL 38496 A IL38496 A IL 38496A IL 3849672 A IL3849672 A IL 3849672A IL 38496 A IL38496 A IL 38496A
- Authority
- IL
- Israel
- Prior art keywords
- benzyl
- production
- acid salts
- basically substituted
- phthalazone derivatives
- Prior art date
Links
- JUCCMEHWBGPJKS-UHFFFAOYSA-N 4-benzyl-2h-phthalazin-1-one Chemical class C12=CC=CC=C2C(=O)NN=C1CC1=CC=CC=C1 JUCCMEHWBGPJKS-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Chemical class 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH101271A CH572914A5 (show.php) | 1971-01-22 | 1971-01-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL38496A0 IL38496A0 (en) | 1972-03-28 |
| IL38496A true IL38496A (en) | 1975-05-22 |
Family
ID=4200381
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL38496A IL38496A (en) | 1971-01-22 | 1972-01-03 | Basically substituted 4-benzyl phthalazone derivatives,acid salts thereof and process for the production thereof |
Country Status (21)
| Country | Link |
|---|---|
| AR (1) | AR197293A1 (show.php) |
| AT (1) | AT313288B (show.php) |
| AU (1) | AU3767472A (show.php) |
| BE (1) | BE778269A (show.php) |
| CA (1) | CA1010041A (show.php) |
| CH (1) | CH572914A5 (show.php) |
| DE (1) | DE2164058C3 (show.php) |
| DK (1) | DK136981B (show.php) |
| ES (1) | ES398949A1 (show.php) |
| FI (1) | FI53704C (show.php) |
| FR (1) | FR2122517B1 (show.php) |
| GB (1) | GB1377231A (show.php) |
| HK (1) | HK62577A (show.php) |
| HU (1) | HU163979B (show.php) |
| IL (1) | IL38496A (show.php) |
| NL (1) | NL177116C (show.php) |
| OA (1) | OA04087A (show.php) |
| PL (1) | PL88930B1 (show.php) |
| SE (1) | SE404604B (show.php) |
| YU (1) | YU35361B (show.php) |
| ZA (1) | ZA718712B (show.php) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE49205T1 (de) * | 1984-09-14 | 1990-01-15 | Asta Pharma Ag | Substituierte benzylphthalazinon-derivate. |
| PT88984B (pt) * | 1987-11-13 | 1993-01-29 | Asta Medica Ag | Processo para a preparação de embonato de azelastina e de composições earmacâutxcas que 0 contêm como ingrediente activo |
| DE3850044D1 (de) * | 1987-11-13 | 1994-07-14 | Asta Medica Ag | Azelastin-Embonat, Verfahren zu seiner Herstellung und pharmazeutische Zubereitungen, die als Wirkstoff Azelastin-Embonat enthalten. |
| DE3836579A1 (de) * | 1987-11-13 | 1989-05-24 | Asta Pharma Ag | Azelastin enthaltende arzneimittel zur anwendung in der nase und/oder am auge |
| ATE84968T1 (de) * | 1987-11-13 | 1993-02-15 | Asta Medica Ag | Azelastin enthaltende arzneimittel zur anwendung in der nase und/oder am auge. |
| DE3912292A1 (de) * | 1988-04-20 | 1989-11-09 | Asta Pharma Ag | Azelastin enthaltende arzneimittel mit kontrollierter wirkstoffabgabe |
| US5110814A (en) * | 1989-01-11 | 1992-05-05 | Asta Pharma Ag | Azelastine and its salts used to combat psoriasis |
| DE59006184D1 (de) * | 1989-05-05 | 1994-07-28 | Asta Medica Ag | Salze des Azelastins mit verbesserter Löslichkeit. |
| DE4207234A1 (de) * | 1992-03-07 | 1993-09-09 | Asta Medica Ag | Neue aminocarbonsaeure-derivate mit antiallergischer/antiasthmatischer wirkung und verfahren zu deren herstellung |
| DE4343409C2 (de) * | 1993-12-18 | 1997-03-20 | Asta Medica Ag | Verbessertes Verfahren zur Herstellung von Hexahydroazepinonen und Hexahydroazepinolen |
| DE4345224C2 (de) * | 1993-12-18 | 1999-07-01 | Asta Medica Ag | Verfahren zur Herstellung von Säureadditionssalzen des Azelastins und Flezelastins |
| GB2389530B (en) | 2002-06-14 | 2007-01-10 | Cipla Ltd | Pharmaceutical compositions |
| US20070020330A1 (en) | 2004-11-24 | 2007-01-25 | Medpointe Healthcare Inc. | Compositions comprising azelastine and methods of use thereof |
| US8758816B2 (en) | 2004-11-24 | 2014-06-24 | Meda Pharmaceuticals Inc. | Compositions comprising azelastine and methods of use thereof |
| ES2704482T3 (es) | 2004-11-24 | 2019-03-18 | Meda Pharmaceuticals Inc | Composiciones que comprenden azelastina y sus métodos de uso |
| CA2649029A1 (en) * | 2006-04-20 | 2007-11-01 | Glaxo Group Limited | 2-substituted 4-benzylphthalazinone derivatives as histamine h1 and h3 antagonists |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1046625B (de) * | 1957-08-15 | 1958-12-18 | Hydrierwerk Rodleben Veb | Verfahren zur Herstellung basisch substituierter Phthalazone |
| GB1100911A (en) * | 1963-08-20 | 1968-01-24 | Benger Lab Ltd | Phthalazine derivatives |
| DK119061B (da) * | 1966-10-28 | 1970-11-09 | Hydrierwerk Rodleben Veb | Fremgangsmåde til fremstilling af basisk substituerede phthalazoner eller salte eller kvaternære ammoniumforbindelser deraf. |
-
1971
- 1971-01-22 CH CH101271A patent/CH572914A5/xx not_active IP Right Cessation
- 1971-12-23 DE DE2164058A patent/DE2164058C3/de not_active Expired
- 1971-12-30 ZA ZA718712A patent/ZA718712B/xx unknown
-
1972
- 1972-01-03 IL IL38496A patent/IL38496A/xx unknown
- 1972-01-06 AU AU37674/72A patent/AU3767472A/en not_active Expired
- 1972-01-11 NL NLAANVRAGE7200400,A patent/NL177116C/xx not_active IP Right Cessation
- 1972-01-12 GB GB143372A patent/GB1377231A/en not_active Expired
- 1972-01-13 AT AT25672A patent/AT313288B/de active
- 1972-01-17 YU YU112/72A patent/YU35361B/xx unknown
- 1972-01-18 CA CA132,681A patent/CA1010041A/en not_active Expired
- 1972-01-18 ES ES398949A patent/ES398949A1/es not_active Expired
- 1972-01-19 FR FR7201729A patent/FR2122517B1/fr not_active Expired
- 1972-01-19 AR AR240139A patent/AR197293A1/es active
- 1972-01-20 PL PL1972153002A patent/PL88930B1/pl unknown
- 1972-01-20 BE BE778269A patent/BE778269A/xx not_active IP Right Cessation
- 1972-01-21 HU HUAA695A patent/HU163979B/hu unknown
- 1972-01-21 FI FI160/72A patent/FI53704C/fi active
- 1972-01-21 DK DK30272AA patent/DK136981B/da unknown
- 1972-01-21 SE SE7200722A patent/SE404604B/xx unknown
- 1972-05-15 OA OA54568A patent/OA04087A/xx unknown
-
1977
- 1977-12-22 HK HK625/77A patent/HK62577A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH572914A5 (show.php) | 1976-02-27 |
| FR2122517B1 (show.php) | 1975-08-01 |
| NL7200400A (show.php) | 1972-07-25 |
| AT313288B (de) | 1974-02-11 |
| HU163979B (show.php) | 1973-12-28 |
| IL38496A0 (en) | 1972-03-28 |
| OA04087A (fr) | 1979-10-30 |
| SE404604B (sv) | 1978-10-16 |
| AR197293A1 (es) | 1974-03-29 |
| FI53704B (show.php) | 1978-03-31 |
| DK136981C (show.php) | 1978-06-05 |
| NL177116C (nl) | 1985-08-01 |
| ZA718712B (en) | 1972-09-27 |
| BE778269A (fr) | 1972-07-19 |
| DE2164058A1 (de) | 1972-07-27 |
| ES398949A1 (es) | 1975-06-01 |
| CA1010041A (en) | 1977-05-10 |
| PL88930B1 (show.php) | 1976-10-30 |
| DK136981B (da) | 1977-12-27 |
| SU440838A3 (show.php) | 1974-08-25 |
| AU3767472A (en) | 1973-07-12 |
| FI53704C (fi) | 1978-07-10 |
| YU35361B (en) | 1980-12-31 |
| GB1377231A (en) | 1974-12-11 |
| YU11272A (en) | 1980-06-30 |
| DE2164058C3 (de) | 1981-08-13 |
| NL177116B (nl) | 1985-03-01 |
| FR2122517A1 (show.php) | 1972-09-01 |
| HK62577A (en) | 1977-12-30 |
| DE2164058B2 (de) | 1980-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH11670A (en) | 1,4-dihydro-4-oxo-7-pyridyl-3-quinoline carboxylic acid derivatives | |
| IL38496A (en) | Basically substituted 4-benzyl phthalazone derivatives,acid salts thereof and process for the production thereof | |
| CA973554A (en) | 2,3,5,6-tetraaminopyridine and its acid salts and processes for its preparation | |
| YU35876B (en) | Process for preparing prostanic acid derivatives | |
| IL38788A0 (en) | N-(furyl-methyl)-morphinanes,acid addition salts thereof and processes for their production | |
| IL39735A0 (en) | 3,20-dioxo-pregn-4-ene 21-carboxylic acid derivatives | |
| ZA711800B (en) | Process for the production of new aryloxy-and arylthioalkanoic acids,of their salts and functional derivatives | |
| IL36435A (en) | Methyl 7-o-methyl-6,8-dideoxy-6-(trans-1-methyl-4-propyl-l-2-pyrrolidinecarboxamido)-1-thio-l-threo-alpha-d-galacto-octopyranoside,the acid addition salts thereof and the production of these | |
| ZA725202B (en) | Process for producing 4-hydroxymethyl-1-keto-1,2-dihydrophthalazine and acid salts thereof,and pharmaceutical composition containing the same | |
| IL41815A0 (en) | Process for the production of 2,5-dichloro-3-nitro-benzoic acid | |
| AU473287B2 (en) | Substituted phenllimida zolidinones, the acid addition salts thereof and processes for their preparation | |
| ZA728821B (en) | 8,12-diisoprostanoic acid derivatives and process for their preparation | |
| IL39058A (en) | N-picolylalkanoyl-piperazine derivatives,their salts and process for the preparation thereof | |
| CA982593A (en) | Substituted 2-arylamino-imidazolines-(2) the acid addition salts and processes for the production thereof | |
| AU438472B2 (en) | Quinazolinone derivatives anda process for production thereof | |
| YU15871A (en) | Process for preparing 1,1-disubstituted-4,4-bipyridylium salts | |
| ZA738400B (en) | Terahydroindazole-5-carboxylic acid compounds,and metal salts thereof,and processes for their production | |
| YU15671A (en) | Process for preparing 1,1-disubstituted-4,4-bipyridylium salts | |
| CA938903A (en) | Hypotensive agent, oudenone, its salts and processes for production and preparation thereof | |
| YU62572A (en) | Process for preparing penicilloic acid derivatives | |
| CA888717A (en) | 1-isopropylamino-anthraquinone-5-sulphonic acid, its alkali metal salts and process for the production thereof | |
| CA919697A (en) | (3,4,5-trialkoxybenzoyl) amino-alkanoic acid, salts thereof and processes for producing same | |
| CA888202A (en) | Bis-imidazolyl-bisphenylmethane, salts thereof and processes for their production | |
| CA836982A (en) | Process for the manufacture of hydroxyl-ammonium salts | |
| YU110072A (en) | Process for preparing acetylamine derivatives of 2,4,6-tri-iodo-benzoic acid |