IL28351A - Unsaturated polyester resinous compositions - Google Patents
Unsaturated polyester resinous compositionsInfo
- Publication number
- IL28351A IL28351A IL28351A IL2835167A IL28351A IL 28351 A IL28351 A IL 28351A IL 28351 A IL28351 A IL 28351A IL 2835167 A IL2835167 A IL 2835167A IL 28351 A IL28351 A IL 28351A
- Authority
- IL
- Israel
- Prior art keywords
- composition
- weight
- unsaturated
- resin
- parts
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 92
- 229920006305 unsaturated polyester Polymers 0.000 title claims description 32
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 61
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 37
- 229920001169 thermoplastic Polymers 0.000 claims description 37
- 229920000728 polyester Polymers 0.000 claims description 32
- 239000007788 liquid Substances 0.000 claims description 30
- 239000004416 thermosoftening plastic Substances 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 17
- 239000000178 monomer Substances 0.000 claims description 17
- 229920000642 polymer Polymers 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 6
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 claims description 6
- -1 saturated dicarboxylic acid ester Chemical class 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 230000000694 effects Effects 0.000 claims description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 229920006217 cellulose acetate butyrate Polymers 0.000 claims description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 3
- 229920002301 cellulose acetate Polymers 0.000 claims description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims 3
- 229920008347 Cellulose acetate propionate Polymers 0.000 claims 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Substances OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims 2
- 101000623895 Bos taurus Mucin-15 Proteins 0.000 claims 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Natural products OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims 1
- 239000007859 condensation product Substances 0.000 claims 1
- 239000001530 fumaric acid Substances 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims 1
- 239000011347 resin Substances 0.000 description 86
- 229920005989 resin Polymers 0.000 description 86
- 238000000465 moulding Methods 0.000 description 24
- 239000011521 glass Substances 0.000 description 21
- 230000003746 surface roughness Effects 0.000 description 14
- 239000000945 filler Substances 0.000 description 12
- 239000003365 glass fiber Substances 0.000 description 11
- 235000013772 propylene glycol Nutrition 0.000 description 11
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000004132 cross linking Methods 0.000 description 6
- 239000000835 fiber Substances 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000003999 initiator Substances 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 239000012530 fluid Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 150000003440 styrenes Chemical class 0.000 description 5
- 239000005977 Ethylene Substances 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000003505 polymerization initiator Substances 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- OOCCDEMITAIZTP-QPJJXVBHSA-N (E)-cinnamyl alcohol Chemical compound OC\C=C\C1=CC=CC=C1 OOCCDEMITAIZTP-QPJJXVBHSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000001747 exhibiting effect Effects 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 239000005340 laminated glass Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000005395 methacrylic acid group Chemical group 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 230000002787 reinforcement Effects 0.000 description 3
- 239000012783 reinforcing fiber Substances 0.000 description 3
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- HLLSOEKIMZEGFV-UHFFFAOYSA-N 4-(dibutylsulfamoyl)benzoic acid Chemical compound CCCCN(CCCC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 HLLSOEKIMZEGFV-UHFFFAOYSA-N 0.000 description 2
- WTIKCZXEDHAYEZ-UHFFFAOYSA-N C=C.C=CC.C=C.C=CC.C=CC Chemical group C=C.C=CC.C=C.C=CC.C=CC WTIKCZXEDHAYEZ-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- DQEFEBPAPFSJLV-UHFFFAOYSA-N Cellulose propionate Chemical compound CCC(=O)OCC1OC(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C1OC1C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(COC(=O)CC)O1 DQEFEBPAPFSJLV-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 229920006218 cellulose propionate Polymers 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- 238000010422 painting Methods 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 230000003014 reinforcing effect Effects 0.000 description 2
- 239000012779 reinforcing material Substances 0.000 description 2
- 239000011342 resin composition Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- ZQHJVIHCDHJVII-OWOJBTEDSA-N (e)-2-chlorobut-2-enedioic acid Chemical class OC(=O)\C=C(\Cl)C(O)=O ZQHJVIHCDHJVII-OWOJBTEDSA-N 0.000 description 1
- 244000283070 Abies balsamea Species 0.000 description 1
- 235000007173 Abies balsamea Nutrition 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000357297 Atypichthys strigatus Species 0.000 description 1
- 239000004858 Canada balsam Substances 0.000 description 1
- 241000065675 Cyclops Species 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- JGEMYUOFGVHXKV-UPHRSURJSA-N malealdehyde Chemical compound O=C\C=C/C=O JGEMYUOFGVHXKV-UPHRSURJSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F291/00—Macromolecular compounds obtained by polymerising monomers on to macromolecular compounds according to more than one of the groups C08F251/00 - C08F289/00
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/06—Unsaturated polyesters
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Closures For Containers (AREA)
- Reinforced Plastic Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US56658066A | 1966-07-20 | 1966-07-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28351A true IL28351A (en) | 1971-08-25 |
Family
ID=24263487
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28351A IL28351A (en) | 1966-07-20 | 1967-07-19 | Unsaturated polyester resinous compositions |
| IL36440A IL36440A (en) | 1966-07-20 | 1967-07-19 | Fibre reinforced unsaturated polyester resinous compositions |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL36440A IL36440A (en) | 1966-07-20 | 1967-07-19 | Fibre reinforced unsaturated polyester resinous compositions |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3701748A (Direct) |
| JP (1) | JPS5120077B1 (Direct) |
| BE (1) | BE700910A (Direct) |
| BR (1) | BR6791225D0 (Direct) |
| CH (1) | CH490446A (Direct) |
| DE (2) | DE1794323B2 (Direct) |
| DK (1) | DK129418B (Direct) |
| ES (1) | ES343032A1 (Direct) |
| GB (2) | GB1201087A (Direct) |
| GR (1) | GR34922B (Direct) |
| IL (2) | IL28351A (Direct) |
| NO (1) | NO131681C (Direct) |
| SE (4) | SE341859B (Direct) |
| TR (1) | TR19514A (Direct) |
Families Citing this family (84)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1176223B (de) * | 1959-06-16 | 1964-08-20 | Josef Rech | Weidezaun-Isolator |
| GB1276198A (en) * | 1968-10-23 | 1972-06-01 | Rohm & Haas | Moulding compositions |
| USRE31975E (en) * | 1970-02-02 | 1985-08-27 | Union Carbide Corp. | Polyester compositions |
| DE2104575B2 (de) * | 1970-02-02 | 1980-04-10 | Union Carbide Corp., New York, N.Y. (V.St.A.) | Schwundarm härtbare ungesättigte Polyestermassen |
| DE2044168C3 (de) * | 1970-09-05 | 1981-03-12 | Bayer Ag, 5090 Leverkusen | Kolloide Gemische |
| US4288571A (en) * | 1971-01-18 | 1981-09-08 | Union Carbide Corporation | Polyester compositions |
| US4284736A (en) * | 1971-01-18 | 1981-08-18 | Union Carbide Corporation | Unsaturated polyester compositions |
| GB1382244A (en) * | 1971-04-06 | 1975-01-29 | Bp Chem Int Ltd | Moulding process |
| US3862412A (en) * | 1971-09-24 | 1975-01-21 | Lucas Electrical Co Ltd | Lamp reflectors |
| DE2219837C3 (de) * | 1972-04-22 | 1981-06-25 | Basf Farben + Fasern Ag, 2000 Hamburg | Herstellen von undurchsichtigen Formstoffen aus polymerisierbaren Formmassen ohne deckende Pigmente |
| DE2246105C3 (de) * | 1972-09-20 | 1981-09-03 | Bayer Ag, 5090 Leverkusen | Schwundarm härtbare Formmassen auf Basis ungesättigter Polyester |
| US4118366A (en) * | 1972-12-27 | 1978-10-03 | Basf Farben & Fasern Ag | Compositions for the production of opaque coatings by radiation |
| DE2263459C3 (de) * | 1972-12-27 | 1978-11-02 | Basf Farben + Fasern Ag, 2000 Hamburg | Verfahren zum Herstellen von undurchsichtigen Überzügen oder Beschichtungen mit hohem Deckvermögen durch Strahlungshärtung von Kunstharzmassen und Überzugsmittel zur Durchführung des Verfahrens |
| US3959209A (en) * | 1973-04-11 | 1976-05-25 | Koppers Company, Inc. | Curable solid polyester resins |
| DE2324061C3 (de) * | 1973-05-12 | 1982-04-15 | Chemische Werke Hüls AG, 4370 Marl | Heißhärtende, ungesättigte Polyesterformmassen |
| US3891596A (en) * | 1973-05-18 | 1975-06-24 | Owens Corning Fiberglass Corp | Thermoplastic ingredient for molding compounds |
| US3974124A (en) * | 1973-06-06 | 1976-08-10 | Woodall Industries Inc. | Energy absorbing vehicle body material |
| US3997627A (en) * | 1973-08-29 | 1976-12-14 | Mitsubishi Rayon Co., Ltd. | Polyester molding compositions containing hydroxy containing vinyl monomers and coated molded articles thereof |
| US4009225A (en) * | 1973-10-05 | 1977-02-22 | Armco Steel Corporation | Low profile pigmented sheet molding process and product |
| US3925299A (en) * | 1973-12-17 | 1975-12-09 | Du Pont | Anhydride acrylic copolymers as additives for unsaturated polyester molding compositions |
| US4003368A (en) * | 1974-06-27 | 1977-01-18 | Armco Steel Corporation | Article transparent to microwaves and process for making same |
| US4005244A (en) * | 1974-09-30 | 1977-01-25 | Ppg Industries, Inc. | Ultraviolet light curable opacifying compositions |
| DE2448929C2 (de) * | 1974-10-15 | 1983-06-23 | Bayer Ag, 5090 Leverkusen | Wärmehärtbare Formmassen |
| US4141929A (en) * | 1974-11-07 | 1979-02-27 | Armco Inc. | Unidirectional sheet molding composition and process of preparing same |
| US4008294A (en) * | 1974-11-27 | 1977-02-15 | W. R. Grace & Co. | Thickened polyester composition containing ultrafine polypropylene fibers |
| US4015154A (en) * | 1974-12-23 | 1977-03-29 | Sony Corporation | Motor and method for making same |
| US4054561A (en) * | 1975-01-27 | 1977-10-18 | Owens-Corning Fiberglas Corporation | Thermoplastic additives for molding compounds |
| US4096102A (en) * | 1975-01-27 | 1978-06-20 | Owens-Corning Fiberglas Corporation | Moldable compositions comprising thermosetting polyester resin and thermoplastic resin |
| US3988291A (en) * | 1975-05-27 | 1976-10-26 | Rostone Corporation | Precision-moldable abrasion-resistant molding composition and moldings |
| US4043988A (en) | 1976-01-02 | 1977-08-23 | Hooker Chemicals & Plastics Corporation | Low profile polyester molding composition |
| GB1592352A (en) * | 1976-10-16 | 1981-07-08 | British Industrial Plastics | Preparation of polyester resin/fibre laminates and compositions for use therein |
| DE2657808C2 (de) * | 1976-12-21 | 1984-05-30 | Basf Ag, 6700 Ludwigshafen | Schrumpfarm härtbare Polyesterformmassen und Verfahren zu ihrer Herstellung |
| US4187274A (en) * | 1977-05-31 | 1980-02-05 | The General Tire & Rubber Company | Method for forming sheets having reduced surface imperfections |
| US4191718A (en) * | 1977-12-19 | 1980-03-04 | Ford Motor Company | Thick section compression molded composites |
| US4245068A (en) * | 1977-12-27 | 1981-01-13 | The Dow Chemical Company | Low profile additives for unsaturated polyester resins |
| US4172059A (en) * | 1978-02-08 | 1979-10-23 | Union Carbide Corporation | Low shrinking thermosetting molding compositions having reduced initial viscosity |
| US4246210A (en) * | 1978-08-04 | 1981-01-20 | Owens-Corning Fiberglas Corporation | Low temperature maturation of sheet molding compositions |
| US4568505A (en) * | 1979-10-10 | 1986-02-04 | Allied Corporation | Process to produce sheet molding compound using a polyamide release film |
| US4374215A (en) * | 1979-11-13 | 1983-02-15 | Union Carbide Corporation | Polyester moldings |
| US4320045A (en) * | 1979-12-17 | 1982-03-16 | Owens-Corning Fiberglas Corporation | Polyester-based molding compositions |
| US4298711A (en) * | 1980-04-09 | 1981-11-03 | Cargill Incorporated | Low shrink unsaturated polyester resinous composition |
| US4409344A (en) * | 1980-04-09 | 1983-10-11 | Cargill Incorporated | Low shrink unsaturated polyester resinous composition |
| US4529757A (en) * | 1980-05-16 | 1985-07-16 | The Budd Company | Thermosetting resin patching compound |
| MX157866A (es) * | 1980-05-16 | 1988-12-19 | Budd Co | Composicion mejorada para parchar plastico y metal |
| US4673706A (en) * | 1981-02-24 | 1987-06-16 | Union Carbide Corporation | Polyester molding compositions |
| US4555534A (en) * | 1981-03-26 | 1985-11-26 | Union Carbide Corporation | Uniformly pigmented, low shrinking polyester molding compositions |
| US4491642A (en) * | 1982-09-20 | 1985-01-01 | Union Carbide Corporation | Uniformly pigmented, low shrinking polyester molding compositions |
| DE3418190A1 (de) * | 1984-05-16 | 1985-11-21 | Ernst Leitz Wetzlar Gmbh, 6330 Wetzlar | Verfahren zur datenspeicherung in und datenauslesung aus resistschichten |
| FR2589473B1 (fr) * | 1985-10-30 | 1988-09-16 | Saint Gobain Vetrotex | Composition de resines polymerisables renforcee par des fils coupes |
| DE3625184A1 (de) * | 1986-07-25 | 1988-01-28 | Bayer Ag | Schwundarm haertbare polyesterharzmassen |
| US4877832A (en) * | 1986-10-29 | 1989-10-31 | Polysar Limited | Thermoset resin compositions |
| US4767806A (en) * | 1987-01-05 | 1988-08-30 | Uniroyal Chemical Company, Inc. | Carboxyl modified olefinic copolymer composition |
| WO1989003407A1 (en) * | 1987-10-16 | 1989-04-20 | The Swan Corporation | Composition of matter for wear surfaces and method for producing same |
| ATE120771T1 (de) * | 1989-03-31 | 1995-04-15 | Union Carbide Chem Plastic | Polyvinylether als schrumpfungskontrollmittel. |
| US4942066A (en) * | 1989-04-21 | 1990-07-17 | E. I. Du Pont De Nemours And Company | Solid imaging method using photohardenable materials of self limiting thickness |
| US5128235A (en) * | 1989-04-21 | 1992-07-07 | E. I. Du Pont De Nemours And Company | Method of forming a three-dimensional object comprising additives imparting reduction of shrinkage to photohardenable compositions |
| US4942060A (en) * | 1989-04-21 | 1990-07-17 | E. I. Du Pont De Nemours And Company | Solid imaging method utilizing photohardenable compositions of self limiting thickness by phase separation |
| US5326516A (en) * | 1989-10-03 | 1994-07-05 | Plasticolors, Inc. | Method of preparing a cured pigmented thermosetting polymer composition exhibiting improved color values and reduced haze |
| US5162401A (en) * | 1989-10-30 | 1992-11-10 | Owens-Corning Fiberglas Corporation | Unsaturated polyester resin compositions containing compatible compounds |
| US5089544A (en) * | 1989-10-30 | 1992-02-18 | Owens-Corning Fiberglas Corporation | Unsaturated polyester resin compositions containing compatible compounds |
| US5102926A (en) * | 1990-10-30 | 1992-04-07 | Owens-Corning Fiberglas Corporation | Citrate ester compounds and processes for their preparation |
| FR2661682B1 (fr) * | 1990-05-04 | 1993-12-10 | Norsolor | Nouvelles compositions resineuses a base de resines polyesters non saturees et de nouveaux additifs anti-retrait. |
| US5290854A (en) * | 1990-07-23 | 1994-03-01 | Owens-Corning Fiberglas Technology Inc. | Thermoplastic low-profile additives and use thereof in unsaturated polyester resin compositions |
| US5256708A (en) * | 1991-07-22 | 1993-10-26 | Owens-Corning Fiberglas Technology, Inc. | Unsaturated polyester resin compositions containing compatible compounds having sulfur-containing substituents |
| US5256709A (en) * | 1991-07-22 | 1993-10-26 | Owens-Corning Fiberglas Technology, Inc. | Unsaturated polyester resin compositions containing compatible compounds having aromatic substituents |
| US5213747A (en) * | 1991-08-27 | 1993-05-25 | William Lippert | Methods of making fiber-reinforced resin molds |
| FR2682393B1 (fr) * | 1991-10-14 | 1994-07-08 | Cray Valley Sa | Compositions de polyesters insatures pour stratifies et leur procede de mise en óoeuvre. |
| US5443775A (en) * | 1992-05-08 | 1995-08-22 | Plasticolors, Inc. | Process for preparing pigmented thermoplastic polymer compositions and low shrinking thermosetting resin molding composition |
| US5616449A (en) * | 1993-11-01 | 1997-04-01 | Polaroid Corporation | Lithographic printing plates with dispersed rubber additives |
| US5900311A (en) * | 1994-03-23 | 1999-05-04 | Cook Composites And Polymers Co. | Thermosetting polyester composites prepared via vacuum-assisted technique with smooth surface appearance |
| US5731035A (en) * | 1995-09-22 | 1998-03-24 | Cook Composites And Polymers | Process for making a paintable polymer article |
| US5756554A (en) * | 1996-02-02 | 1998-05-26 | Ashland Inc. | Low profile additives for polyester resin systems based on asymmetric glycols and aromatic diacids |
| US5741448A (en) * | 1996-03-14 | 1998-04-21 | Reichhold Chemicals, Inc. | Shrink-controlled resin composition |
| US5925409A (en) * | 1997-08-27 | 1999-07-20 | Reichhold, Inc. | Resins for lining surfaces |
| US6692802B1 (en) | 1997-08-27 | 2004-02-17 | Reichhold, Inc. | Resins for lining surfaces |
| WO1999019403A1 (en) | 1997-10-10 | 1999-04-22 | Cook Composites And Polymers Company | Water resistant unsaturated polyester resin compositions |
| CA2257029A1 (en) | 1997-12-24 | 1999-06-24 | Frederic Bauchet | Polyester resin-based compositions having improved thickening behavior |
| ZA9962B (en) * | 1998-01-20 | 1999-07-06 | Cook Composites & Polymers | Aromatic polyol end-capped unsaturated polyetherester resins and resin compositions containing the same having improved chemical and/or water resistance. |
| US6124373A (en) | 1998-04-10 | 2000-09-26 | Wm. Marsh Rice University | Bone replacement compound comprising poly(polypropylene fumarate) |
| KR100696407B1 (ko) * | 1999-04-16 | 2007-03-19 | 더블유엠. 마쉬 라이스 유니버시티 | 폴리(프로필렌 푸마레이트)-디아크릴레이트 마크로머와가교결합된 생분해성 폴리(프로필렌 푸마레이트) 네트워크 |
| US7629388B2 (en) * | 2001-11-20 | 2009-12-08 | William Marsh Rice University | Synthesis and characterization of biodegradable cationic poly(propylene fumarate-co-ethylene glycol) copolymer hydrogels modified with agmatine for enhanced cell adhesion |
| CN101253213A (zh) * | 2005-08-29 | 2008-08-27 | 国际壳牌研究有限公司 | 制备聚酯树脂的整合方法 |
| CN101253214A (zh) * | 2005-08-29 | 2008-08-27 | 国际壳牌研究有限公司 | 制备聚酯树脂的整合方法 |
| LU92421B1 (en) | 2012-08-03 | 2014-09-01 | Kordsa Global Endustriyel Iplik Ve Kord Bezi Sanayi Ve Ticaret As | A method for producing fiber reinforced rubber unsaturated bonds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1008487B (de) * | 1954-10-21 | 1957-05-16 | Steuler Industriewerke Gmbh | Verfahren zur Herstellung von Formkoerpern |
| GB797442A (en) * | 1955-07-21 | 1958-07-02 | Helmuth Weber | A process for filling in cavities or dents in objects |
| NL120401C (Direct) * | 1959-03-05 | |||
| NL120820C (Direct) * | 1960-04-26 | |||
| DE1179368B (de) * | 1962-03-10 | 1964-10-08 | Phoenix Gummiwerke Ag | Verfahren zum Herstellen von Formteilen aus Polyesterformmassen, die Polyaethylen enthalten |
-
1966
- 1966-07-20 US US566580A patent/US3701748A/en not_active Expired - Lifetime
-
1967
- 1967-06-26 GR GR670134922A patent/GR34922B/el unknown
- 1967-07-04 BE BE700910D patent/BE700910A/xx not_active IP Right Cessation
- 1967-07-06 CH CH964267A patent/CH490446A/fr not_active IP Right Cessation
- 1967-07-13 BR BR191225/67A patent/BR6791225D0/pt unknown
- 1967-07-14 ES ES343032A patent/ES343032A1/es not_active Expired
- 1967-07-18 GB GB33045/67A patent/GB1201087A/en not_active Expired
- 1967-07-18 SE SE10665/67*A patent/SE341859B/xx unknown
- 1967-07-18 GB GB9849/70A patent/GB1201088A/en not_active Expired
- 1967-07-19 IL IL28351A patent/IL28351A/en unknown
- 1967-07-19 DE DE19671794323 patent/DE1794323B2/de not_active Withdrawn
- 1967-07-19 NO NO169108A patent/NO131681C/no unknown
- 1967-07-19 IL IL36440A patent/IL36440A/en unknown
- 1967-07-19 DE DE1694857A patent/DE1694857C3/de not_active Expired
- 1967-07-20 DK DK374167AA patent/DK129418B/da unknown
- 1967-08-14 TR TR19514A patent/TR19514A/xx unknown
-
1970
- 1970-04-22 SE SE7005584A patent/SE414037B/sv unknown
-
1972
- 1972-10-11 JP JP47101195A patent/JPS5120077B1/ja active Pending
- 1972-12-11 SE SE7216144A patent/SE415103B/xx unknown
-
1980
- 1980-03-14 SE SE8002036A patent/SE417212B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE341859B (Direct) | 1972-01-17 |
| SE8002036L (sv) | 1980-03-14 |
| CH490446A (fr) | 1970-05-15 |
| DK129418B (da) | 1974-10-07 |
| DE1794323B2 (de) | 1977-12-22 |
| DK129418C (Direct) | 1975-03-10 |
| ES343032A1 (es) | 1968-10-16 |
| US3701748A (en) | 1972-10-31 |
| GR34922B (el) | 1968-07-22 |
| GB1201087A (en) | 1970-08-05 |
| BE700910A (Direct) | 1968-01-04 |
| TR19514A (tr) | 1979-03-29 |
| SE414037B (sv) | 1980-07-07 |
| DE1694857C3 (de) | 1983-03-10 |
| NO131681C (Direct) | 1975-07-09 |
| IL36440A (en) | 1971-08-25 |
| NO131681B (Direct) | 1975-04-01 |
| DE1694857A1 (de) | 1970-12-17 |
| DE1694857B2 (de) | 1974-11-21 |
| SE415103B (sv) | 1980-09-08 |
| SE417212B (sv) | 1981-03-02 |
| JPS5120077B1 (Direct) | 1976-06-22 |
| DE1794323A1 (de) | 1972-02-17 |
| GB1201088A (en) | 1970-08-05 |
| BR6791225D0 (pt) | 1973-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL28351A (en) | Unsaturated polyester resinous compositions | |
| US3772241A (en) | Unsaturated polyester resinous compositions | |
| US5900311A (en) | Thermosetting polyester composites prepared via vacuum-assisted technique with smooth surface appearance | |
| US3642672A (en) | Unsaturated polyester resinous compositions containing cellulose esters and molded articles therefrom | |
| NO169108B (no) | Temperatur-resistente slipelegemer av polykrystallinsk diamant | |
| IL33222A (en) | Moulding compositions | |
| CS128891A3 (en) | Compositions on the base of unsaturated polyester resins and a novel anti-contraction additive | |
| EP0751184B1 (fr) | Compositions thermodurcissables moulables et pigmentables utiles pour obtenir des articles moulés avec retrait nul ou faible expansion | |
| US3810863A (en) | Polymerizable unsaturated polyester resin compositions and articles made therefrom | |
| US5869557A (en) | Moldable and pigmentable heat-curable compositions capable of being used for obtaining molded articles with zero shrinkage or small expansion | |
| US3665055A (en) | Polymerizable unsaturated polyester resin compositions and articles made therefrom | |
| US4283326A (en) | PBT Molding compositions containing mica and a composite polymer | |
| FR2682117A1 (fr) | Matiere a mouler a base de resine thermodurcissable, de charges minerales et de fibres de renforcement, leurs procedes de preparation et fabrication d'articles moules renforces. | |
| US4043988A (en) | Low profile polyester molding composition | |
| USRE29915E (en) | Unsaturated polyester resins containing cellulose ester and molded articles therefrom | |
| US5401803A (en) | Ethylene-vinyl acetate copolymer additives for molding compositions | |
| US4320045A (en) | Polyester-based molding compositions | |
| CA1130945A (en) | Reinforced polybutylene therephthalate molding composition | |
| US3830772A (en) | Thermo-setting moulding compositions and processes for their manufacture | |
| JP2000510190A (ja) | 着色充填材および無機充填材の均一な分布を有する熱成形可能なアクリルシート | |
| US4049749A (en) | Pigmentable low-profile polyester molding compositions | |
| US4230813A (en) | Low profile polyester molding composition | |
| CA1039450A (en) | Unsaturated monomer composition with polyunsaturated crosslinker | |
| IL34576A (en) | Thermosetting powder compositions based on bulk polymerized polyvinyl chloride and polyacrylate plasticizer and process of producing them | |
| JPH0653844B2 (ja) | 不飽和ポリエステル樹脂組成物 |