IL28188A - Reactive dyestuffs - Google Patents
Reactive dyestuffsInfo
- Publication number
- IL28188A IL28188A IL28188A IL2818867A IL28188A IL 28188 A IL28188 A IL 28188A IL 28188 A IL28188 A IL 28188A IL 2818867 A IL2818867 A IL 2818867A IL 28188 A IL28188 A IL 28188A
- Authority
- IL
- Israel
- Prior art keywords
- stands
- hydrogen
- dyestuffs
- reactive
- parts
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 68
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 37
- -1 halogen radicals Chemical class 0.000 claims description 31
- 238000004043 dyeing Methods 0.000 claims description 23
- 239000000463 material Substances 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 21
- 230000008878 coupling Effects 0.000 claims description 18
- 238000010168 coupling process Methods 0.000 claims description 18
- 238000005859 coupling reaction Methods 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 17
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims description 11
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 10
- 239000000543 intermediate Substances 0.000 claims description 10
- 125000001153 fluoro group Chemical group F* 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 238000009833 condensation Methods 0.000 claims description 7
- 230000005494 condensation Effects 0.000 claims description 7
- 210000002268 wool Anatomy 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 239000004952 Polyamide Substances 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 229910052804 chromium Inorganic materials 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 5
- 229920002647 polyamide Polymers 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003368 amide group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 230000007935 neutral effect Effects 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 6
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims 4
- 239000000460 chlorine Substances 0.000 claims 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- 125000004442 acylamino group Chemical group 0.000 claims 2
- 125000003342 alkenyl group Chemical group 0.000 claims 2
- 150000005840 aryl radicals Chemical class 0.000 claims 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 2
- 125000003262 carboxylic acid ester group Chemical class [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 claims 2
- 229910052801 chlorine Inorganic materials 0.000 claims 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 2
- 150000003254 radicals Chemical class 0.000 claims 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims 1
- 230000002378 acidificating effect Effects 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 125000002843 carboxylic acid group Chemical group 0.000 claims 1
- 239000004627 regenerated cellulose Substances 0.000 claims 1
- 239000002253 acid Substances 0.000 description 49
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 18
- 239000011734 sodium Substances 0.000 description 18
- 229910052708 sodium Inorganic materials 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 13
- 235000002639 sodium chloride Nutrition 0.000 description 11
- 229920000742 Cotton Polymers 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 229920002678 cellulose Polymers 0.000 description 5
- 239000001913 cellulose Substances 0.000 description 5
- 239000011651 chromium Substances 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 229940072056 alginate Drugs 0.000 description 3
- 235000010443 alginic acid Nutrition 0.000 description 3
- 229920000615 alginic acid Polymers 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 238000006149 azo coupling reaction Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 230000008719 thickening Effects 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 2
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 150000004696 coordination complex Chemical group 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- FPVGTPBMTFTMRT-NSKUCRDLSA-L fast yellow Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-NSKUCRDLSA-L 0.000 description 2
- 235000019233 fast yellow AB Nutrition 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 125000001117 oleyl group Polymers [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000010025 steaming Methods 0.000 description 2
- 125000000565 sulfonamide group Chemical group 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- VAYOSLLFUXYJDT-RDTXWAMCSA-N Lysergic acid diethylamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N(CC)CC)C2)=C3C2=CNC3=C1 VAYOSLLFUXYJDT-RDTXWAMCSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 101100014660 Rattus norvegicus Gimap8 gene Proteins 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- DGOBMKYRQHEFGQ-UHFFFAOYSA-L acid green 5 Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C=CC(=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 DGOBMKYRQHEFGQ-UHFFFAOYSA-L 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- WLDHEUZGFKACJH-UHFFFAOYSA-K amaranth Chemical compound [Na+].[Na+].[Na+].C12=CC=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=C1N=NC1=CC=C(S([O-])(=O)=O)C2=CC=CC=C12 WLDHEUZGFKACJH-UHFFFAOYSA-K 0.000 description 1
- 125000005001 aminoaryl group Chemical group 0.000 description 1
- SQISUZWPWJHTEP-UHFFFAOYSA-N aniline Chemical compound NC1=CC=CC=C1.NC1=CC=CC=C1 SQISUZWPWJHTEP-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 101150010487 are gene Proteins 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- BDRTVPCFKSUHCJ-UHFFFAOYSA-N molecular hydrogen;potassium Chemical compound [K].[H][H] BDRTVPCFKSUHCJ-UHFFFAOYSA-N 0.000 description 1
- 229940075566 naphthalene Drugs 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000009183 running Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/20—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a pyrimidine ring
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S8/00—Bleaching and dyeing; fluid treatment and chemical modification of textiles and fibers
- Y10S8/916—Natural fiber dyeing
- Y10S8/918—Cellulose textile
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Air Bags (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DEF0050181 | 1966-09-10 | ||
DE1644204A DE1644204C3 (de) | 1966-09-10 | 1967-03-25 | Reaktivfarbstoffe und deren Verwendung |
Publications (1)
Publication Number | Publication Date |
---|---|
IL28188A true IL28188A (en) | 1970-10-30 |
Family
ID=25977412
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
IL28188A IL28188A (en) | 1966-09-10 | 1967-06-23 | Reactive dyestuffs |
Country Status (17)
Families Citing this family (44)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4115378A (en) * | 1967-04-19 | 1978-09-19 | Bayer Aktiengesellschaft | Water soluble reactive axodyestuffs containing a fluorotriazinyl group attached via a nitrogen bridge to the dyestuff molecule |
US4206306A (en) * | 1967-04-19 | 1980-06-03 | Bayer Aktiengesellschaft | Reactive phthalocyanine dyestuffs containing a fluorotriazinyl group attached via a nitrogen bridge to the dyestuff molecule |
CH515315A (de) * | 1968-01-29 | 1971-11-15 | Ciba Geigy Ag | Verfahren zur Herstellung von faserreaktiven, schwermetallhaltigen Formazanfarbstoffen |
US4118382A (en) * | 1971-03-19 | 1978-10-03 | Bayer Aktiengesellschaft | Reactive mono-azo dyestuffs having a 4-amino-3,5(or-6)-disulfoacetic acid coupling component and a reactive group attached to the diazo component |
DE2114158A1 (de) * | 1971-03-24 | 1972-09-28 | Bayer Ag | Reaktivfarbstoffe |
US4128544A (en) * | 1971-08-16 | 1978-12-05 | Sandoz Ltd. | Copper complexes of substituted sulfophenyl-azo-phenyl-azo-naphthalene sulfonic acids containing a heterocyclic fiber-reactive group |
BE792588A (fr) * | 1971-12-13 | 1973-06-12 | Hoechst Ag | Colorants azoiques reactifs et preparation de ces colorants |
BE794591A (fr) * | 1972-01-27 | 1973-07-26 | Ciba Geigy | Composes monoazoiques, leur preparation et leur utilisation |
US3989692A (en) * | 1972-02-23 | 1976-11-02 | Bayer Aktiengesellschaft | Reactive dyestuffs |
GB1515030A (en) * | 1976-02-11 | 1978-06-21 | Ici Ltd | Fibre reactive disazo dyestuffs |
US4043997A (en) * | 1976-05-28 | 1977-08-23 | Cutter Laboratories, Inc. | Method for isolating albumin using insoluble supports coupled to a dye |
DE2634497C2 (de) * | 1976-07-31 | 1986-09-25 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe und deren Verwendung |
DE2655625C2 (de) * | 1976-12-08 | 1986-04-10 | Bayer Ag, 5090 Leverkusen | Metallkomplexfarbstoffe |
LU77288A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1977-05-09 | 1979-01-18 | ||
US4325869A (en) * | 1977-05-09 | 1982-04-20 | Ciba-Geigy Corporation | Novel dyes, their preparation and use |
LU77286A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1977-05-09 | 1979-01-18 | ||
DE2817780C2 (de) * | 1978-04-22 | 1984-09-20 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
CH635860A5 (de) * | 1978-06-16 | 1983-04-29 | Ciba Geigy Ag | Reaktivfarbstoffe und deren herstellung. |
DE2838274A1 (de) | 1978-09-01 | 1980-03-13 | Bayer Ag | Verfahren zum faerben und bedrucken von cellulosefasern mit reaktivfarbstoffen |
DE2853823A1 (de) * | 1978-12-13 | 1980-07-03 | Bayer Ag | Verfahren zur herstellung von phthalocyanin-reaktivfarbstoffen |
DE2906191A1 (de) * | 1979-02-17 | 1980-08-28 | Bayer Ag | Azoreaktivfarbstoffe |
CH643583A5 (de) | 1979-08-16 | 1984-06-15 | Sandoz Ag | Reaktivfarbstoffe sowie deren herstellung. |
DE3010161A1 (de) * | 1980-03-17 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Farbstoffe, verfahren zu ihrer herstellung sowie ihre verwendung zum faerben hydroxylgruppen- oder stickstoffhaltiger materialien |
DE3118657A1 (de) * | 1981-05-11 | 1982-11-25 | Basf Ag, 6700 Ludwigshafen | Reaktivfarbstoffe |
DE3270744D1 (en) * | 1981-07-07 | 1986-05-28 | Ciba Geigy Ag | Reactive dyestuffs, their preparation and their use |
DE3139315A1 (de) * | 1981-10-02 | 1983-04-21 | Bayer Ag, 5090 Leverkusen | Anthrachinon-reaktivfarbstoffe |
DE3472681D1 (en) * | 1983-06-14 | 1988-08-18 | Ciba Geigy Ag | Reactive dyes, their preparation and their use |
DE3400412A1 (de) * | 1984-01-07 | 1985-07-18 | Bayer Ag, 5090 Leverkusen | Lagerstabile loesungen von reaktivfarbstoffen |
DE3542025A1 (de) * | 1985-11-28 | 1987-06-11 | Hoechst Ag | Mischungen wasserloeslicher faserreaktiver farbstoffe und ihre verwendung zum faerben |
DE3943286A1 (de) * | 1989-12-29 | 1991-07-04 | Hoechst Ag | Azoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstofe |
DE4122866A1 (de) * | 1991-07-11 | 1993-01-14 | Bayer Ag | Monoreaktive mono- und disazoreaktivfarbstoffe |
DE4125266A1 (de) * | 1991-07-31 | 1993-02-04 | Bayer Ag | Reaktivfarbstoffe |
DE4125754A1 (de) * | 1991-08-03 | 1993-02-04 | Bayer Ag | Fluorpyrimidin-reaktivfarbstoffe |
EP0531968A1 (de) * | 1991-09-13 | 1993-03-17 | Hoechst Aktiengesellschaft | Mischung wasserlöslicher faserreaktiver Farbstoffe und ihre Verwendung |
DE4142766C1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1991-12-04 | 1993-02-18 | Bayer Ag, 5090 Leverkusen, De | |
BR9303283A (pt) * | 1992-08-14 | 1994-03-08 | Sandoz Ag | Compostos e seus sais,ou uma mistura de tais compostos ou sais;processo para sua preparacao,e processo para tingimento ou estampagem de um substrato organico |
BR9303266A (pt) * | 1992-08-14 | 1994-03-08 | Sandoz Ag | Compostos e seus sais ou misturas de fais compostos ou sais,processos para sua preparacao,e processo para tingimento ou estampagem de um substrato organico |
CH685762A5 (de) * | 1992-09-17 | 1995-09-29 | Sandoz Ag | Faserreaktive Monoazofarbstoffe. |
GB2270923B (en) * | 1992-09-24 | 1995-11-08 | Sandoz Ltd | Fibre-reactive monoazo copper complexes |
JP3657627B2 (ja) * | 1992-10-12 | 2005-06-08 | クラリアント ファイナンス (ビーブイアイ) リミティド | 繊維反応性アゾ染料化合物およびその製造法 |
GB9509159D0 (en) * | 1995-05-05 | 1995-06-28 | Sandoz Ltd | Organic compounds |
DE19918160A1 (de) | 1999-04-22 | 2000-10-26 | Dystar Textilfarben Gmbh & Co | Reaktivfarbstoffmischungen für salzarmes Färben |
PL368380A1 (en) * | 2001-10-08 | 2005-03-21 | Clariant Finance (Bvi) Limited | Organic compounds |
US9078786B1 (en) | 2012-10-19 | 2015-07-14 | Denise H. Miller | Methods and devices for collecting body fluids |
Family Cites Families (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3262923A (en) * | 1966-07-26 | Monoazo stilbene dyestuffs containing a halopyrimibing radical | ||
DE1644366B1 (de) * | 1957-11-29 | 1971-07-29 | Sandoz Ag | Verfahren zur Herstellung von metallhaltigen wasserloeslichen Pyrimidinreaktiv-Azofarbstoffen |
CH420414A (de) * | 1959-04-29 | 1966-09-15 | Sandoz Ag | Verfahren zur Herstellung von Pyrimidinfarbstoffen |
CH366611A (de) * | 1958-05-23 | 1963-01-15 | Geigy Ag J R | Verfahren zur Herstellung von Azofarbstoffen |
DE1252824B (de) * | 1963-03-01 | 1967-10-26 | J. R. Geigy A.G., Basel (Schweiz) | Verfahren zur Herstellung von reaktiven Farbstoffen |
NL129732C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1963-09-12 |
-
1966
- 1966-09-10 DE DE19661644171 patent/DE1644171A1/de active Pending
-
1967
- 1967-03-25 DE DE1644204A patent/DE1644204C3/de not_active Expired
- 1967-06-21 CH CH594668D patent/CH594668A4/xx unknown
- 1967-06-21 CH CH878567A patent/CH495463A/de not_active IP Right Cessation
- 1967-06-21 CH CH878567D patent/CH878567A4/xx unknown
- 1967-06-23 IL IL28188A patent/IL28188A/en unknown
- 1967-07-19 BG BG6700008364A patent/BG25101A3/xx unknown
- 1967-08-22 NO NO169459A patent/NO133369C/no unknown
- 1967-08-29 FI FI672318A patent/FI44650C/fi active
- 1967-09-01 US US664943A patent/US3669951A/en not_active Expired - Lifetime
- 1967-09-06 GB GB40774/67A patent/GB1169254A/en not_active Expired
- 1967-09-07 BE BE703598D patent/BE703598A/xx not_active IP Right Cessation
- 1967-09-08 FR FR120518A patent/FR1563661A/fr not_active Expired
- 1967-09-08 NL NL676712369A patent/NL150839B/xx not_active IP Right Cessation
- 1967-09-08 DK DK452467AA patent/DK128168B/da not_active IP Right Cessation
- 1967-09-09 PL PL1967122526A patent/PL72556B1/pl unknown
- 1967-09-09 ES ES344891A patent/ES344891A1/es not_active Expired
- 1967-09-11 AT AT829967A patent/AT284774B/de active
- 1967-09-11 AT AT829867A patent/AT274983B/de active
- 1967-09-11 AT AT1013968A patent/AT291180B/de active
- 1967-09-11 SE SE12517/67A patent/SE334203B/xx unknown
-
1969
- 1969-09-27 JP JP44076845A patent/JPS4930502B1/ja active Pending
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
IL28188A (en) | Reactive dyestuffs | |
US3391134A (en) | Anthraquinone and anthraquinoneazo dyestuffs | |
US3910758A (en) | Dyeing wool with fluorine substituted pyrimidine containing azo reactive dyestuff | |
US5958086A (en) | Dye mixtures, process for their preparation and the use thereof | |
US5092903A (en) | Process for dyeing or printing blends of cellulosic fibre materials and silk with dihalo-propionamido or halo-acryl amido reactive dyes | |
US3788801A (en) | Process for the preparation of fast dyeings and prints on fibrous matprocess for the preparation of fast dyeings and prints on fibrous material containing hydroxyl groups or nitrogen | |
US5059681A (en) | Bis-azotriazinyl reactive dyes having an n-alkyl-phenylenediamine link | |
US4446067A (en) | Azo reactive dyestuffs | |
JPS61247760A (ja) | ヒドロキシ基を含有する繊維材料の染色又は捺染法 | |
GB1577497A (en) | Reactive dyestuffs | |
US4474696A (en) | Reactive disazo dyestuffs containing triazines | |
US3096340A (en) | New phthalocyanine dyes | |
US5667534A (en) | Dye mixtures comprising 1:2 chromium complex dyes, and 1:2 chromium complex dyes | |
US3082052A (en) | Process for the coloration of cellulose textile materials with reactive dyestuffs | |
US4052386A (en) | Reactive phthalocyanine dyestuffs containing a fluoropyrimidinyl group | |
EP0013996B1 (en) | Reactive azo compounds, processes for their preparation and their use for dyeing fibers and textiles | |
KR100539284B1 (ko) | 섬유-반응성 디스아조 염료 | |
US4113719A (en) | 1:2-Cobalt-complex azo dyestuffs having an acetoacetylamino diphenylamino coupler | |
US3360524A (en) | Water-soluble dyestuffs containing halogenated cyclobutene or cyclobutane carboxamide groups | |
US3939141A (en) | Water-soluble copper complex phenyl azo naphthalene reactive dyestuffs | |
US3132129A (en) | Azo phthalocyanine dyestuffs | |
US3126377A (en) | Pyridazonyl-phthalocyanines | |
KR0148686B1 (ko) | 수용성 프탈로시아닌 화합물, 이의 제조방법 및 이의 용도 | |
US3112304A (en) | Disperse azo dyestuffs | |
US3063779A (en) | Process for the manufacture of dyestuffs |