IE55945B1 - Heterocyclic compounds,their preparation,compositions containing them and method of controlling unwanted plant growth - Google Patents
Heterocyclic compounds,their preparation,compositions containing them and method of controlling unwanted plant growthInfo
- Publication number
- IE55945B1 IE55945B1 IE2195/83A IE219583A IE55945B1 IE 55945 B1 IE55945 B1 IE 55945B1 IE 2195/83 A IE2195/83 A IE 2195/83A IE 219583 A IE219583 A IE 219583A IE 55945 B1 IE55945 B1 IE 55945B1
- Authority
- IE
- Ireland
- Prior art keywords
- preparation
- compositions containing
- plant growth
- heterocyclic compounds
- controlling unwanted
- Prior art date
Links
- 150000002391 heterocyclic compounds Chemical class 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- 230000008635 plant growth Effects 0.000 title 1
- -1 cyano, methyl Chemical group 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- 125000004970 halomethyl group Chemical group 0.000 abstract 1
- 239000004009 herbicide Substances 0.000 abstract 1
- 150000002500 ions Chemical class 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 abstract 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 abstract 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 abstract 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/18—Benzotriazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/08—Radicals containing only hydrogen and carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/419,860 US4452626A (en) | 1982-09-20 | 1982-09-20 | Herbicidal 4-(benzotriazol-1-yl)phenoxy)alkanoic acids, esters and salts |
| US06/419,865 US4439226A (en) | 1982-09-20 | 1982-09-20 | Herbicidal 4-((benzimidazol-1-yl)phenoxy)alkanoic acids, esters and salts |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE832195L IE832195L (en) | 1984-03-20 |
| IE55945B1 true IE55945B1 (en) | 1991-02-27 |
Family
ID=27024650
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2195/83A IE55945B1 (en) | 1982-09-20 | 1983-09-19 | Heterocyclic compounds,their preparation,compositions containing them and method of controlling unwanted plant growth |
Country Status (19)
| Country | Link |
|---|---|
| EP (1) | EP0107216B1 (OSRAM) |
| AU (1) | AU555945B2 (OSRAM) |
| BR (1) | BR8305090A (OSRAM) |
| CS (1) | CS244429B2 (OSRAM) |
| DD (1) | DD218828A5 (OSRAM) |
| DE (1) | DE3366608D1 (OSRAM) |
| DK (1) | DK160424C (OSRAM) |
| ES (2) | ES8606302A1 (OSRAM) |
| FI (1) | FI833337A7 (OSRAM) |
| GR (1) | GR79676B (OSRAM) |
| HU (1) | HU191635B (OSRAM) |
| IE (1) | IE55945B1 (OSRAM) |
| NO (1) | NO161854C (OSRAM) |
| NZ (1) | NZ205640A (OSRAM) |
| OA (1) | OA07532A (OSRAM) |
| PL (1) | PL140149B1 (OSRAM) |
| PT (1) | PT77346B (OSRAM) |
| TR (1) | TR21874A (OSRAM) |
| ZW (1) | ZW19983A1 (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4883901A (en) * | 1988-03-21 | 1989-11-28 | Hoechst Celanese Corporation | Synthesis of 2-(4-aminophenoxy)alkanoic acids and esters and their derivatives |
| IL91997A0 (en) * | 1988-11-03 | 1990-07-12 | American Cyanamid Co | Aryloxy benzotriazole herbicidal agents and methods for the preparation thereof |
| US5324711A (en) * | 1988-11-03 | 1994-06-28 | American Cyanamid Company | Aryloxy benzotriazole herbicidal agents and methods for the preparation thereof |
| US5786301A (en) * | 1993-04-28 | 1998-07-28 | Zeneca Limited | N-benzotriazoles |
| US5369086A (en) * | 1993-04-28 | 1994-11-29 | Zeneca Limited | N-benzotriazoles |
| RU2183628C1 (ru) * | 2001-06-22 | 2002-06-20 | Ярославский государственный технический университет | Гетероциклические о-дикарбонитрилы |
| RU2185378C1 (ru) * | 2001-06-22 | 2002-07-20 | Ярославский государственный технический университет | Гетероциклические о-дикарбонитрилы |
| RU2326873C1 (ru) * | 2006-12-18 | 2008-06-20 | Государственное образовательное учреждение высшего профессионального образования "Ивановский государственный химико-технологический университет" (ИГХТУ) | 4-(1-бензотриазолил)-5-(нафтокси)фталодинитрилы |
| CN110372618B (zh) * | 2019-08-30 | 2021-10-01 | 南通大学 | 一种含苯并三氮唑苯基单元的氰基丙烯酸酯化合物的制备方法及其应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3856812A (en) * | 1971-03-15 | 1974-12-24 | Merck Patent Gmbh | Pyrrole phenoxyacetic acid derivatives |
-
1983
- 1983-09-12 EP EP83201306A patent/EP0107216B1/en not_active Expired
- 1983-09-12 DE DE8383201306T patent/DE3366608D1/de not_active Expired
- 1983-09-16 DD DD83254887A patent/DD218828A5/de not_active IP Right Cessation
- 1983-09-16 PT PT77346A patent/PT77346B/pt not_active IP Right Cessation
- 1983-09-16 TR TR21874A patent/TR21874A/xx unknown
- 1983-09-19 AU AU19251/83A patent/AU555945B2/en not_active Ceased
- 1983-09-19 BR BR8305090A patent/BR8305090A/pt not_active IP Right Cessation
- 1983-09-19 NO NO833369A patent/NO161854C/no unknown
- 1983-09-19 DK DK426883A patent/DK160424C/da not_active IP Right Cessation
- 1983-09-19 IE IE2195/83A patent/IE55945B1/xx unknown
- 1983-09-19 ES ES525714A patent/ES8606302A1/es not_active Expired
- 1983-09-19 CS CS836831A patent/CS244429B2/cs unknown
- 1983-09-19 HU HU833234A patent/HU191635B/hu unknown
- 1983-09-19 NZ NZ205640A patent/NZ205640A/en unknown
- 1983-09-19 FI FI833337A patent/FI833337A7/fi not_active Application Discontinuation
- 1983-09-19 ZW ZW199/83A patent/ZW19983A1/xx unknown
- 1983-09-19 GR GR72472A patent/GR79676B/el unknown
- 1983-09-19 PL PL1983243818A patent/PL140149B1/pl unknown
- 1983-09-20 OA OA58101A patent/OA07532A/xx unknown
-
1985
- 1985-09-02 ES ES546650A patent/ES8606294A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU555945B2 (en) | 1986-10-16 |
| DE3366608D1 (en) | 1986-11-06 |
| NZ205640A (en) | 1985-08-30 |
| NO161854B (no) | 1989-06-26 |
| EP0107216B1 (en) | 1986-10-01 |
| AU1925183A (en) | 1984-03-29 |
| PL243818A1 (en) | 1985-01-16 |
| ES8606302A1 (es) | 1986-04-01 |
| TR21874A (tr) | 1985-10-03 |
| FI833337A0 (fi) | 1983-09-19 |
| CS244429B2 (en) | 1986-07-17 |
| IE832195L (en) | 1984-03-20 |
| EP0107216A1 (en) | 1984-05-02 |
| OA07532A (en) | 1985-03-31 |
| NO161854C (no) | 1989-10-04 |
| GR79676B (OSRAM) | 1984-10-31 |
| BR8305090A (pt) | 1984-05-08 |
| ZW19983A1 (en) | 1983-12-14 |
| NO833369L (no) | 1984-03-21 |
| ES525714A0 (es) | 1986-04-01 |
| ES546650A0 (es) | 1986-04-16 |
| DK160424B (da) | 1991-03-11 |
| DK160424C (da) | 1991-08-19 |
| DD218828A5 (de) | 1985-02-20 |
| PT77346B (pt) | 1986-04-21 |
| ES8606294A1 (es) | 1986-04-16 |
| DK426883D0 (da) | 1983-09-19 |
| PL140149B1 (en) | 1987-03-31 |
| DK426883A (da) | 1984-03-21 |
| FI833337A7 (fi) | 1984-03-21 |
| HU191635B (en) | 1987-03-30 |
| PT77346A (pt) | 1983-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES453089A1 (es) | Procedimiento para la preparacion de agentes para regular elcrecimiento y desarrollo de las plantas. | |
| HUT45368A (en) | Compositions regulating the growth of plants containing as active substance derivatives of phenil-pirasole-carbonic acid and process for production of the active substance | |
| MY108800A (en) | 5-aryl isoxazole derivatives, compositions containing them, process for their preparation and their use as herbicides | |
| HU905970D0 (en) | Process for producing pyrazol derivatives | |
| KR910002798A (ko) | 제초 활성을 갖는 시클로헥산디온, 이들을 함유하는 농약 조성물 및 그의 제조방법 | |
| EP0256503A3 (en) | Pyridinecarboxamide derivatives and their use as fungicide | |
| AU539399B2 (en) | Substituted oxonicotinates | |
| IE873531L (en) | 1H-imidazole-5-carboxylic acid derivatives | |
| HUT48572A (en) | Process for production of derivatives of aryl-hydroxamin acid and medical preparatives containing these substances and than compositions regulating the growth of plants and delaying withering of cut flowers | |
| IE55945B1 (en) | Heterocyclic compounds,their preparation,compositions containing them and method of controlling unwanted plant growth | |
| PT87578A (pt) | Process for the preparation of new alkanesulfonanilide derivatives and of pharmaceutical composition comprising the same | |
| ES8204720A1 (es) | Procedimiento para preparar derivados de dihidropiridina | |
| CA2022747A1 (en) | Carboxylic acid derivatives | |
| IE791490L (en) | Phenyl-alkanoic acids | |
| ES8306374A1 (es) | "procedimiento para la preparacion de nuevos derivados de acidos 4-fenoxialcarboxilicos sustituidos con radicales haterociclicos". | |
| PT77395B (en) | Process for the preparation of fungicidally active 3-(3-pyridyl)-propanoic acid derivatives and analogous salts thereof | |
| ES8305730A1 (es) | Un procedimiento para la preparacion de un derivado del imidazol. | |
| IL87873A0 (en) | Compositions comprising 1,5-diphenyl-1,2,4-triazole-3-carboxylic acid derivatives for the protection of cultivated plants from the phytotoxic action of herbicides,certain such novel compounds and their preparation | |
| ES8306733A1 (es) | Derivados de anilina y sus sales. | |
| CA2066641A1 (en) | Picolinic acid derivative, method for preparing the same and herbicidal composition | |
| TW353070B (en) | Chloropyridylcarbonyl derivatives | |
| DE3465988D1 (en) | Chloroacetanilides, their preparation, their use, compositions containing them, and method of combating undesired plant growth | |
| AU553765B2 (en) | Biologically active heterocyclic hydroximidates and thiolhydroximidates and carbamate ester derivatives thereof | |
| PT80949A (en) | Process for the preparation of 4-fluorthiocarbanilides substituted and herbicides therewith |