IE53802B1 - Carboxyalkyl dipertides, process for their production and pharmaceutical compositions containing them - Google Patents
Carboxyalkyl dipertides, process for their production and pharmaceutical compositions containing themInfo
- Publication number
- IE53802B1 IE53802B1 IE2475/81A IE247581A IE53802B1 IE 53802 B1 IE53802 B1 IE 53802B1 IE 2475/81 A IE2475/81 A IE 2475/81A IE 247581 A IE247581 A IE 247581A IE 53802 B1 IE53802 B1 IE 53802B1
- Authority
- IE
- Ireland
- Prior art keywords
- alanyl
- carboxylic acid
- phenylpropyl
- lower alkyl
- carboethoxy
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 42
- 230000008569 process Effects 0.000 title claims description 18
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 4
- 125000004181 carboxyalkyl group Chemical group 0.000 title abstract description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 143
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 73
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 28
- 239000001257 hydrogen Substances 0.000 claims abstract description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 150000001413 amino acids Chemical class 0.000 claims abstract description 14
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 13
- 108010016626 Dipeptides Proteins 0.000 claims abstract description 11
- 235000001014 amino acid Nutrition 0.000 claims abstract description 11
- 125000004104 aryloxy group Chemical group 0.000 claims abstract description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 11
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 8
- 238000009833 condensation Methods 0.000 claims abstract description 7
- 230000005494 condensation Effects 0.000 claims abstract description 7
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 5
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 4
- 229910052720 vanadium Inorganic materials 0.000 claims abstract description 4
- 229910052727 yttrium Inorganic materials 0.000 claims abstract description 4
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract 9
- -1 diloweralkylamino Chemical group 0.000 claims description 63
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 34
- 238000002360 preparation method Methods 0.000 claims description 30
- 125000004659 aryl alkyl thio group Chemical group 0.000 claims description 14
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 125000003282 alkyl amino group Chemical group 0.000 claims description 9
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 claims description 9
- 239000005977 Ethylene Substances 0.000 claims description 8
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 125000004442 acylamino group Chemical group 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000001769 aryl amino group Chemical group 0.000 claims description 6
- 125000005110 aryl thio group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 150000001735 carboxylic acids Chemical class 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000001041 indolyl group Chemical group 0.000 claims description 5
- 230000009467 reduction Effects 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 230000029936 alkylation Effects 0.000 claims description 4
- 238000005804 alkylation reaction Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 229910052721 tungsten Inorganic materials 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 3
- 206010020772 Hypertension Diseases 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- 125000001072 heteroaryl group Chemical group 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- PRRCQQGBVXMEKW-YFKPBYRVSA-N (8s)-1,4-dithia-7-azoniaspiro[4.4]nonane-8-carboxylate Chemical compound C1N[C@H](C(=O)O)CC21SCCS2 PRRCQQGBVXMEKW-YFKPBYRVSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 2
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 125000003107 substituted aryl group Chemical group 0.000 claims 1
- 229940030600 antihypertensive agent Drugs 0.000 abstract description 3
- 239000002220 antihypertensive agent Substances 0.000 abstract description 3
- 239000003112 inhibitor Substances 0.000 abstract description 3
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 abstract description 2
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 abstract description 2
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 abstract description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 abstract 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 156
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 84
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 73
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 65
- 239000000203 mixture Substances 0.000 description 64
- 239000012141 concentrate Substances 0.000 description 49
- 235000008504 concentrate Nutrition 0.000 description 49
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 45
- 239000002253 acid Substances 0.000 description 45
- 239000000243 solution Substances 0.000 description 36
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 31
- 238000003756 stirring Methods 0.000 description 30
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- 229960003767 alanine Drugs 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 235000019439 ethyl acetate Nutrition 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- 239000011347 resin Substances 0.000 description 20
- 229920005989 resin Polymers 0.000 description 20
- 239000000741 silica gel Substances 0.000 description 20
- 229910002027 silica gel Inorganic materials 0.000 description 20
- 125000004494 ethyl ester group Chemical group 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 150000004702 methyl esters Chemical class 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 239000003921 oil Substances 0.000 description 14
- 235000019198 oils Nutrition 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 229960000583 acetic acid Drugs 0.000 description 11
- 125000001980 alanyl group Chemical group 0.000 description 11
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000000908 ammonium hydroxide Substances 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000012230 colorless oil Substances 0.000 description 9
- 239000012362 glacial acetic acid Substances 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 7
- 229940024606 amino acid Drugs 0.000 description 7
- 125000004122 cyclic group Chemical group 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 229920002261 Corn starch Polymers 0.000 description 6
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 239000008120 corn starch Substances 0.000 description 6
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000002808 molecular sieve Substances 0.000 description 6
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- KUSYIGBGHPOWEL-VIFPVBQESA-N (2s)-2-methylnonanoic acid Chemical compound CCCCCCC[C@H](C)C(O)=O KUSYIGBGHPOWEL-VIFPVBQESA-N 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 229920002472 Starch Polymers 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- TYRGLVWXHJRKMT-QMMMGPOBSA-N n-benzyloxycarbonyl-l-serine-betalactone Chemical compound OC(=O)[C@H](C)NC(=O)OCC1=CC=CC=C1 TYRGLVWXHJRKMT-QMMMGPOBSA-N 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 235000019698 starch Nutrition 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N D-alpha-Ala Natural products CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 4
- 230000032050 esterification Effects 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- ULGUQTOELKSOAJ-UHFFFAOYSA-N ethyl 2,3,3a,4,5,6,7,7a-octahydro-1h-indole-2-carboxylate Chemical compound C1CCCC2NC(C(=O)OCC)CC21 ULGUQTOELKSOAJ-UHFFFAOYSA-N 0.000 description 4
- STPXIOGYOLJXMZ-UHFFFAOYSA-N ethyl 2-oxo-4-phenylbutanoate Chemical compound CCOC(=O)C(=O)CCC1=CC=CC=C1 STPXIOGYOLJXMZ-UHFFFAOYSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000001506 calcium phosphate Substances 0.000 description 3
- UOQACRNTVQWTFF-UHFFFAOYSA-N decane-1,10-dithiol Chemical compound SCCCCCCCCCCS UOQACRNTVQWTFF-UHFFFAOYSA-N 0.000 description 3
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 3
- YULCQASHDYTPMM-UHFFFAOYSA-N ethyl 2,3,3a,4,6,6a-hexahydro-1h-furo[3,4-b]pyrrole-2-carboxylate Chemical compound C1OCC2NC(C(=O)OCC)CC21 YULCQASHDYTPMM-UHFFFAOYSA-N 0.000 description 3
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229960002429 proline Drugs 0.000 description 3
- 229940107700 pyruvic acid Drugs 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- ZITOPJKFJBLAMM-LURJTMIESA-N (2s)-1-(2-oxopropanoyl)pyrrolidine-2-carboxylic acid Chemical compound CC(=O)C(=O)N1CCC[C@H]1C(O)=O ZITOPJKFJBLAMM-LURJTMIESA-N 0.000 description 2
- KEDYTOTWMPBSLG-JGWWNCMTSA-N (2s)-1-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2h-cyclopenta[b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2CCCC21)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 KEDYTOTWMPBSLG-JGWWNCMTSA-N 0.000 description 2
- SRCSNTPZUAEFEI-ZETCQYMHSA-N (2s)-2-(2,2-diethoxyethylamino)propanoic acid Chemical compound CCOC(OCC)CN[C@@H](C)C(O)=O SRCSNTPZUAEFEI-ZETCQYMHSA-N 0.000 description 2
- VHOVPEFSJKDBIQ-AKGZTFGVSA-N (2s)-4-formylpyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CC(C=O)CN1 VHOVPEFSJKDBIQ-AKGZTFGVSA-N 0.000 description 2
- MWOPNYRIFCCIKC-UUEFVBAFSA-N (8s)-2-thia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound C1N[C@H](C(=O)O)CC11CSCC1 MWOPNYRIFCCIKC-UUEFVBAFSA-N 0.000 description 2
- JZQMYZYHNUBBGW-FHNOQDHRSA-N (8s)-7-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2-thia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(CSCC2)C1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 JZQMYZYHNUBBGW-FHNOQDHRSA-N 0.000 description 2
- FQISISIMLFMVEY-DJNXLDHESA-N (8s)-7-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N1([C@@H](CC2(C1)SCCS2)C(O)=O)C(=O)CNC(C(=O)OCC)CCC1=CC=CC=C1 FQISISIMLFMVEY-DJNXLDHESA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 2
- SRXRBNCPSVMKIE-UHFFFAOYSA-N 2-azaspiro[4.4]nonane-3-carboxylic acid Chemical compound C1NC(C(=O)O)CC11CCCC1 SRXRBNCPSVMKIE-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- 241000478345 Afer Species 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 2
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 2
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 2
- 229930195722 L-methionine Natural products 0.000 description 2
- 229930182821 L-proline Natural products 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 229940030606 diuretics Drugs 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229940097258 other antihypertensives in atc Drugs 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- ZJLMKPKYJBQJNH-UHFFFAOYSA-N propane-1,3-dithiol Chemical compound SCCCS ZJLMKPKYJBQJNH-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- PHICBFWUYUCFKS-UHFFFAOYSA-N spiro[4.4]nonane Chemical compound C1CCCC21CCCC2 PHICBFWUYUCFKS-UHFFFAOYSA-N 0.000 description 2
- CTDQAGUNKPRERK-UHFFFAOYSA-N spirodecane Chemical compound C1CCCC21CCCCC2 CTDQAGUNKPRERK-UHFFFAOYSA-N 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- CWJNJELEEDZCTI-SPFPWHRZSA-N (10s)-9-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,5-dioxa-9-azaspiro[5.5]undecane-10-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(CC1)OCCCO2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 CWJNJELEEDZCTI-SPFPWHRZSA-N 0.000 description 1
- LQFCEJMYZZJAQP-ULWHTZQDSA-N (10s)-9-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2-oxa-9-azaspiro[5.5]undecane-10-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(COCCC2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 LQFCEJMYZZJAQP-ULWHTZQDSA-N 0.000 description 1
- OFQMLPFMHSGCGO-PNWOJRQDSA-N (1s)-1-[(2s)-2-[(1-carboxy-2-phenylethyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)[C@@]1(C2CCCCC2CN1)C(O)=O)C(C(O)=O)CC1=CC=CC=C1 OFQMLPFMHSGCGO-PNWOJRQDSA-N 0.000 description 1
- OLMPXRUAQBIBRA-ZKNZNYJQSA-N (1s)-2-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2CCCCC2C1)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 OLMPXRUAQBIBRA-ZKNZNYJQSA-N 0.000 description 1
- AYECQRAXWBGXSZ-WJGSZSDCSA-N (1s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2CCCCC2C1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 AYECQRAXWBGXSZ-WJGSZSDCSA-N 0.000 description 1
- ZPMLPGJPBCGJEE-DDPXNHEPSA-N (1s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-6,10-dioxa-2-azaspiro[4.5]decane-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2(OCCCO2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ZPMLPGJPBCGJEE-DDPXNHEPSA-N 0.000 description 1
- ZSVWLZABTMDGGY-NMBLWERJSA-N (1s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-6,10-dithia-2-azaspiro[4.5]decane-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@H](C2(SCCCS2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ZSVWLZABTMDGGY-NMBLWERJSA-N 0.000 description 1
- ZWYARZRADGJOSY-DGLPSNNLSA-N (1s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-7-oxa-2-azaspiro[4.4]nonane-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2(COCC2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ZWYARZRADGJOSY-DGLPSNNLSA-N 0.000 description 1
- ZNDSVVDQVJWXPU-NHVNWABUSA-N (1s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-8-oxa-2-azaspiro[5.5]undecane-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2(COCCC2)CCC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ZNDSVVDQVJWXPU-NHVNWABUSA-N 0.000 description 1
- DDKIPPYUPQTBSB-BJASNALYSA-N (1s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-9-thia-2-azaspiro[4.5]decane-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2(CSCCC2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 DDKIPPYUPQTBSB-BJASNALYSA-N 0.000 description 1
- AGTXRFGPDRZBSU-SOLGRHFHSA-N (1s)-3-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,2,3,3a,4,6,7,7a-octahydrothiopyrano[3,4-c]pyrrole-1-carboxylic acid Chemical compound N([C@@H](C)C(=O)C1C2CSCCC2[C@H](N1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 AGTXRFGPDRZBSU-SOLGRHFHSA-N 0.000 description 1
- DFIBNXVAHCBWNY-LYAPFXNSSA-N (2S)-1-[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-4-(dimethoxymethyl)pyrrolidine-2-carboxylic acid Chemical compound C(=O)(O)C(CCC1=CC=CC=C1)N[C@@H](C)C(=O)N1[C@H](C(=O)O)CC(C1)C(OC)OC DFIBNXVAHCBWNY-LYAPFXNSSA-N 0.000 description 1
- YBJMVTZCCQCBHN-FJSDZJTPSA-N (2S)-1-[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-4-(oxan-2-yl)pyrrolidine-2-carboxylic acid Chemical compound C(=O)(O)C(CCC1=CC=CC=C1)N[C@@H](C)C(=O)N1[C@H](C(=O)O)CC(C1)C1OCCCC1 YBJMVTZCCQCBHN-FJSDZJTPSA-N 0.000 description 1
- OUFSXRHCTCKMDW-MQFTVXPDSA-N (2S)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-4-(oxan-2-yl)pyrrolidine-2-carboxylic acid Chemical compound C(=O)(OCC)C(CCC1=CC=CC=C1)N[C@@H](C)C(=O)N1[C@H](C(=O)O)CC(C1)C1OCCCC1 OUFSXRHCTCKMDW-MQFTVXPDSA-N 0.000 description 1
- AAWISURHYKTGKD-XWAAWYQISA-N (2S)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-4-(oxolan-2-yl)pyrrolidine-2-carboxylic acid Chemical compound C(=O)(OCC)C(CCC1=CC=CC=C1)N[C@@H](C)C(=O)N1[C@H](C(=O)O)CC(C1)C1OCCC1 AAWISURHYKTGKD-XWAAWYQISA-N 0.000 description 1
- ZWUABRPGCONAIA-XRVVJQKQSA-N (2S)-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrole-2-carboxylic acid Chemical compound N1C2C(C[C@H]1C(=O)O)COC2 ZWUABRPGCONAIA-XRVVJQKQSA-N 0.000 description 1
- TUYBOIMEBPVOHZ-ACAXCVFMSA-N (2S)-4-(1,3-dioxan-2-yl)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC(C1)C1OCCCO1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 TUYBOIMEBPVOHZ-ACAXCVFMSA-N 0.000 description 1
- YSBGEWDPKVVBTF-RXQRSOPUSA-N (2S)-4-(1,3-dithiolan-2-yl)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC(C1)C1SCCS1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 YSBGEWDPKVVBTF-RXQRSOPUSA-N 0.000 description 1
- PCVPDXHZOGCZFY-RLHVNXBHSA-N (2S)-4-[bis(ethylsulfanyl)methyl]-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC(C1)C(SCC)SCC)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 PCVPDXHZOGCZFY-RLHVNXBHSA-N 0.000 description 1
- YZVYEXCSLONNSI-GOEBONIOSA-N (2r)-1-[(2s)-2-(phenylmethoxycarbonylamino)propanoyl]azocane-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@H](CCCCCC1)C(O)=O)C(=O)OCC1=CC=CC=C1 YZVYEXCSLONNSI-GOEBONIOSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- YTSYVKPZVVBZQW-HQSMGLLHSA-N (2s)-1-[(2s)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2COCC21)C(O)=O)C(=O)OCC1=CC=CC=C1 YTSYVKPZVVBZQW-HQSMGLLHSA-N 0.000 description 1
- YZVYEXCSLONNSI-HOCLYGCPSA-N (2s)-1-[(2s)-2-(phenylmethoxycarbonylamino)propanoyl]azocane-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCCCCC1)C(O)=O)C(=O)OCC1=CC=CC=C1 YZVYEXCSLONNSI-HOCLYGCPSA-N 0.000 description 1
- KUYZPVSKVPZRSB-ZBBQRLJZSA-N (2s)-1-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2h-quinoline-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2CCCCC21)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 KUYZPVSKVPZRSB-ZBBQRLJZSA-N 0.000 description 1
- WPVBIYSYVRRCBO-SPFPWHRZSA-N (2s)-1-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]azecane-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCCCCCCC1)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 WPVBIYSYVRRCBO-SPFPWHRZSA-N 0.000 description 1
- PGHXCKQBZHVDNP-NMBLWERJSA-N (2s)-1-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]azonane-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCCCCCC1)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 PGHXCKQBZHVDNP-NMBLWERJSA-N 0.000 description 1
- AHVSFLISGWKNPQ-QJQMAANRSA-N (2s)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1-azaspiro[4.5]decane-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1C2(CCCCC2)CC[C@H]1C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 AHVSFLISGWKNPQ-QJQMAANRSA-N 0.000 description 1
- QPPJXNUAKMKLBS-OTTZHXMRSA-N (2s)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2CSCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 QPPJXNUAKMKLBS-OTTZHXMRSA-N 0.000 description 1
- RMRFPJHLTBRSCV-XWAAWYQISA-N (2s)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,4,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2CCSCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 RMRFPJHLTBRSCV-XWAAWYQISA-N 0.000 description 1
- RCOUZSKNKNCSEK-DKKDMOBXSA-N (2s)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3-dimethoxypyrrolidine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C(OC)(OC)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 RCOUZSKNKNCSEK-DKKDMOBXSA-N 0.000 description 1
- ZWLYEPALGWWWHN-ZBBQRLJZSA-N (2s)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,6,7,7a-hexahydro-2h-pyrano[4,3-b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2COCCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ZWLYEPALGWWWHN-ZBBQRLJZSA-N 0.000 description 1
- IFTYGOMODVBUPL-ZBBQRLJZSA-N (2s)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,6,7,7a-hexahydro-2h-thiopyrano[4,3-b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2CSCCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 IFTYGOMODVBUPL-ZBBQRLJZSA-N 0.000 description 1
- LOSAGHGGOQMUDV-FJSDZJTPSA-N (2s)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,4,4a,5,7,7a-hexahydro-2h-thieno[3,4-b]pyridine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2CSCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 LOSAGHGGOQMUDV-FJSDZJTPSA-N 0.000 description 1
- BZUUFZKMSQKDNY-GSCOYNGXSA-N (2s)-1-[(2s)-2-[(1-methoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2COCC21)C(O)=O)C(C(=O)OC)CCC1=CC=CC=C1 BZUUFZKMSQKDNY-GSCOYNGXSA-N 0.000 description 1
- DBAQBRAQKYAQEO-ZKNZNYJQSA-N (2s)-1-[(2s)-2-[(1-methoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2h-cyclopenta[b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2CCCC21)C(O)=O)C(C(=O)OC)CCC1=CC=CC=C1 DBAQBRAQKYAQEO-ZKNZNYJQSA-N 0.000 description 1
- ITPIYTPAZKXJMW-WJGSZSDCSA-N (2s)-1-[(2s)-2-[(1-methoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2h-quinoline-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2CCCCC21)C(O)=O)C(C(=O)OC)CCC1=CC=CC=C1 ITPIYTPAZKXJMW-WJGSZSDCSA-N 0.000 description 1
- VINNCWIYGPLXOA-YYPSJVGGSA-N (2s)-1-[(2s)-2-[[4-(4-chlorophenyl)-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2COCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=C(Cl)C=C1 VINNCWIYGPLXOA-YYPSJVGGSA-N 0.000 description 1
- GWUUTVZHEFRRQG-DNBGNTRDSA-N (2s)-1-[(2s)-2-aminopropanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid Chemical compound C1OCC2C[C@@H](C(O)=O)N(C(=O)[C@@H](N)C)C21 GWUUTVZHEFRRQG-DNBGNTRDSA-N 0.000 description 1
- DATPFTPVGIHCCM-BYPYZUCNSA-N (2s)-2-(ethylamino)propanoic acid Chemical compound CCN[C@@H](C)C(O)=O DATPFTPVGIHCCM-BYPYZUCNSA-N 0.000 description 1
- NENGYTOAJHEGQH-YGYNJSFOSA-N (2s)-2-[1,3-dithian-2-ylmethyl-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]amino]propanoic acid Chemical compound N([C@@H](C)C(=O)N(CC1SCCCS1)[C@@H](C)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 NENGYTOAJHEGQH-YGYNJSFOSA-N 0.000 description 1
- SCJYBEPFUOGAME-PPHPATTJSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;6-chloro-1,1-dioxo-4h-1$l^{6},2,4-benzothiadiazine-7-sulfonamide Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NC=NS2(=O)=O SCJYBEPFUOGAME-PPHPATTJSA-N 0.000 description 1
- SAOSCTYRONNFTC-JTQLQIEISA-N (2s)-2-methyldecanoic acid Chemical compound CCCCCCCC[C@H](C)C(O)=O SAOSCTYRONNFTC-JTQLQIEISA-N 0.000 description 1
- YSEQNZOXHCKLOG-QMMMGPOBSA-N (2s)-2-methyloctanoic acid Chemical compound CCCCCC[C@H](C)C(O)=O YSEQNZOXHCKLOG-QMMMGPOBSA-N 0.000 description 1
- PFFITEZSYJIHHR-NSHDSACASA-N (2s)-2-methylundecanoic acid Chemical compound CCCCCCCCC[C@H](C)C(O)=O PFFITEZSYJIHHR-NSHDSACASA-N 0.000 description 1
- HWNGLKPRXKKTPK-ONQHYROSSA-N (2s)-3,4-dihydroxypyrrolidine-2-carboxylic acid Chemical compound OC1CN[C@H](C(O)=O)C1O HWNGLKPRXKKTPK-ONQHYROSSA-N 0.000 description 1
- WYHDGRLNWABGDP-RXQRSOPUSA-N (2s)-4-(dimethoxymethyl)-1-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC(C1)C(OC)OC)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 WYHDGRLNWABGDP-RXQRSOPUSA-N 0.000 description 1
- RKEYKDXXZCICFZ-AKGZTFGVSA-N (2s)-5-hydroxypiperidine-2-carboxylic acid Chemical compound OC1CC[C@@H](C(O)=O)NC1 RKEYKDXXZCICFZ-AKGZTFGVSA-N 0.000 description 1
- UAGFTQCWTTYZKO-WCCKRBBISA-N (2s)-pyrrolidine-2-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)[C@@H]1CCCN1 UAGFTQCWTTYZKO-WCCKRBBISA-N 0.000 description 1
- ODSNARDHJFFSRH-OCAPTIKFSA-N (3as,7ar)-2,3,3a,4,5,6,7,7a-octahydro-1h-isoindole Chemical compound C1CCC[C@@H]2CNC[C@@H]21 ODSNARDHJFFSRH-OCAPTIKFSA-N 0.000 description 1
- WLDMPODMCFGWAA-OLQVQODUSA-N (3as,7ar)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)NC(=O)[C@@H]21 WLDMPODMCFGWAA-OLQVQODUSA-N 0.000 description 1
- VGOXYUAJLNRRRS-AVHZRVKJSA-N (3s)-2-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-7-oxa-2-azaspiro[4.5]decane-3-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(C1)COCCC2)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 VGOXYUAJLNRRRS-AVHZRVKJSA-N 0.000 description 1
- JELSMELPOHWINJ-SPFPWHRZSA-N (3s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2-azaspiro[4.4]nonane-3-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(CCCC2)C1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 JELSMELPOHWINJ-SPFPWHRZSA-N 0.000 description 1
- SGEAGDRMRRRKCB-NMBLWERJSA-N (3s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-6,10-dioxa-2-azaspiro[4.5]decane-3-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(C1)OCCCO2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 SGEAGDRMRRRKCB-NMBLWERJSA-N 0.000 description 1
- JOTBUCPVWJSXBV-NMBLWERJSA-N (3s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(C1)SCCCS2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 JOTBUCPVWJSXBV-NMBLWERJSA-N 0.000 description 1
- CSCVAUQWBWCMOX-SPFPWHRZSA-N (3s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-8-thia-2-azaspiro[4.5]decane-3-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(C1)CCSCC2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 CSCVAUQWBWCMOX-SPFPWHRZSA-N 0.000 description 1
- CRHGLJLBPLFGHZ-NMBLWERJSA-N (3s)-2-[(2s)-2-[(1-methoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-8-thia-2-azaspiro[4.5]decane-3-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(C1)CCSCC2)C(O)=O)C(C(=O)OC)CCC1=CC=CC=C1 CRHGLJLBPLFGHZ-NMBLWERJSA-N 0.000 description 1
- XAZYXWARXCGTRD-LLLPINGXSA-N (4s)-3-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3-azaspiro[5.5]undecane-4-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(CCCCC2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 XAZYXWARXCGTRD-LLLPINGXSA-N 0.000 description 1
- ZUIYCYHOKOSLLL-IUCAKERBSA-N (5s)-4-[(2s)-2-aminopropanoyl]-1,4-thiazonane-5-carboxylic acid Chemical compound C[C@H](N)C(=O)N1CCSCCCC[C@H]1C(O)=O ZUIYCYHOKOSLLL-IUCAKERBSA-N 0.000 description 1
- DGYYJOWZRWLDNN-ZKNZNYJQSA-N (6s)-7-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine-6-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2CCOCC2C1)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 DGYYJOWZRWLDNN-ZKNZNYJQSA-N 0.000 description 1
- ZAJRYOBUCLQLIK-DKKDMOBXSA-N (6s)-7-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,4-dioxa-7-azaspiro[4.4]nonane-6-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2(OCCO2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ZAJRYOBUCLQLIK-DKKDMOBXSA-N 0.000 description 1
- XYCBWACIUMDNAI-YKOWGRMDSA-N (6s)-7-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-6-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@H](C2(SCCS2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 XYCBWACIUMDNAI-YKOWGRMDSA-N 0.000 description 1
- ZBGBJCQQOUPLAK-CJKWIIOHSA-N (7s)-2-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2-azaspiro[4.5]decane-7-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1CC2(CC1)C[C@H](CCC2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ZBGBJCQQOUPLAK-CJKWIIOHSA-N 0.000 description 1
- SIWPDOPZGDIFIM-WJGSZSDCSA-N (7s)-6-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,3,4,4a,5,7,8,8a-octahydropyrano[4,3-c]pyridine-7-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2COCCC2C1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 SIWPDOPZGDIFIM-WJGSZSDCSA-N 0.000 description 1
- TYMZNESRKPFSQX-WJGSZSDCSA-N (7s)-6-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,3,4,4a,5,7,8,8a-octahydrothiopyrano[4,3-c]pyridine-7-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2CSCCC2C1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 TYMZNESRKPFSQX-WJGSZSDCSA-N 0.000 description 1
- LLAOXLKYDOOLHH-JKXNBNTCSA-N (7s)-6-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2-oxa-6-azaspiro[4.5]decane-7-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1C2(COCC2)CCC[C@H]1C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 LLAOXLKYDOOLHH-JKXNBNTCSA-N 0.000 description 1
- MTLUOIASMAGAPX-JKXNBNTCSA-N (7s)-8-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1-oxa-8-azaspiro[4.5]decane-7-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(OCCC2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 MTLUOIASMAGAPX-JKXNBNTCSA-N 0.000 description 1
- SXJBVDKLTHFKFI-LLTTWOEGSA-N (8S)-7-[2-[(1-ethoxy-1-oxo-3-phenylbutan-2-yl)amino]acetyl]-2-thia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound C=1C=CC=CC=1C(C)C(C(=O)OCC)NCC(=O)N([C@@H](C1)C(O)=O)CC21CCSC2 SXJBVDKLTHFKFI-LLTTWOEGSA-N 0.000 description 1
- OZYDFNHNZMMLDH-JQCDREMPSA-N (8s)-3-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-7-azaspiro[4.5]decane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)C1CC2(CC1)CN[C@@H](CC2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 OZYDFNHNZMMLDH-JQCDREMPSA-N 0.000 description 1
- HZKJIRVHPFEEPF-ZETCQYMHSA-N (8s)-7-(2-oxopropanoyl)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound C1[C@@H](C(O)=O)N(C(=O)C(=O)C)CC21SCCS2 HZKJIRVHPFEEPF-ZETCQYMHSA-N 0.000 description 1
- NHRSVYAQPCAFDK-YMNIQAILSA-N (8s)-7-(2-oxopropanoyl)-2-thia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound C1[C@@H](C(O)=O)N(C(=O)C(=O)C)CC11CSCC1 NHRSVYAQPCAFDK-YMNIQAILSA-N 0.000 description 1
- DUJDRZPFIVUVNN-JSGCOSHPSA-N (8s)-7-[(2s)-2-(phenylmethoxycarbonylamino)propanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(C1)SCCS2)C(O)=O)C(=O)OCC1=CC=CC=C1 DUJDRZPFIVUVNN-JSGCOSHPSA-N 0.000 description 1
- CLCFKVWSQFNBOZ-GGXMVYKUSA-N (8s)-7-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2-thia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(CSCC2)C1)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 CLCFKVWSQFNBOZ-GGXMVYKUSA-N 0.000 description 1
- KDFAHXNYGFPCQQ-WJGSZSDCSA-N (8s)-7-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2COCCC2CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 KDFAHXNYGFPCQQ-WJGSZSDCSA-N 0.000 description 1
- BWDIZLMPBYAHGW-WJGSZSDCSA-N (8s)-7-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,3,4,4a,5,6,8,8a-octahydrothiopyrano[3,4-c]pyridine-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](C2CSCCC2CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 BWDIZLMPBYAHGW-WJGSZSDCSA-N 0.000 description 1
- HRWCVUIFMSZDJS-YKOWGRMDSA-N (8s)-7-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(C1)SCCS2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 HRWCVUIFMSZDJS-YKOWGRMDSA-N 0.000 description 1
- IXOLTUISSICXBZ-FHNOQDHRSA-N (8s)-7-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1-oxa-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(OCCC2)C1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 IXOLTUISSICXBZ-FHNOQDHRSA-N 0.000 description 1
- KKSQMTJMNALLFX-LOACHALJSA-N (8s)-7-[2-[(1-carboxy-3-phenylpropyl)amino]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N1([C@@H](CC2(C1)SCCS2)C(O)=O)C(=O)CNC(C(=O)O)CCC1=CC=CC=C1 KKSQMTJMNALLFX-LOACHALJSA-N 0.000 description 1
- QBRHHUXJSQBAGT-DKTYTTGXSA-N (8s)-7-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]acetyl]-2-thia-7-azaspiro[4.4]nonane-8-carboxylic acid Chemical compound N1([C@@H](CC2(CSCC2)C1)C(O)=O)C(=O)CNC(C(=O)OCC)CCC1=CC=CC=C1 QBRHHUXJSQBAGT-DKTYTTGXSA-N 0.000 description 1
- FHJYMEFAZOQJLH-NZEUDUFCSA-N (8s)-9-[(2s)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-1,4-dithia-9-azaspiro[4.5]decane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2(C1)SCCS2)C(O)=O)C(C(O)=O)CCC1=CC=CC=C1 FHJYMEFAZOQJLH-NZEUDUFCSA-N 0.000 description 1
- ADJKKZUIUDDEPY-NMBLWERJSA-N (8s)-9-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,4-dioxa-9-azaspiro[4.5]decane-8-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2(C1)OCCO2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 ADJKKZUIUDDEPY-NMBLWERJSA-N 0.000 description 1
- YNDSKPMAIBHSLN-SPFPWHRZSA-N (9s)-8-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1,5-dithia-8-azaspiro[5.5]undecane-9-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2(C1)SCCCS2)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 YNDSKPMAIBHSLN-SPFPWHRZSA-N 0.000 description 1
- KMQKVLVPFMFEID-QJQMAANRSA-N (9s)-8-[(2s)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-8-azaspiro[4.5]decane-9-carboxylic acid Chemical compound N([C@@H](C)C(=O)N1[C@@H](CC2(CCCC2)CC1)C(O)=O)C(C(=O)OCC)CCC1=CC=CC=C1 KMQKVLVPFMFEID-QJQMAANRSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- TWBNMYSKRDRHAT-RCWTXCDDSA-N (S)-timolol hemihydrate Chemical compound O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 TWBNMYSKRDRHAT-RCWTXCDDSA-N 0.000 description 1
- ADKDJHASTPQGEO-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole Chemical compound C1CNC2CCCC21 ADKDJHASTPQGEO-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- PIINXYKJQGMIOZ-UHFFFAOYSA-N 1,2-dipyridin-2-ylethane-1,2-dione Chemical compound C=1C=CC=NC=1C(=O)C(=O)C1=CC=CC=N1 PIINXYKJQGMIOZ-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- STNNRJFAZZAILC-UHFFFAOYSA-N 1,5-oxazocane-4-carboxylic acid Chemical compound OC(=O)C1CCOCCCN1 STNNRJFAZZAILC-UHFFFAOYSA-N 0.000 description 1
- REKCOCMOYWUZED-UHFFFAOYSA-N 1-(3,3-dimethoxypropyl)-1-nitrocyclopentane Chemical compound COC(OC)CCC1([N+]([O-])=O)CCCC1 REKCOCMOYWUZED-UHFFFAOYSA-N 0.000 description 1
- KWENTBKLBHHLNV-UHFFFAOYSA-N 1-(3,3-dimethoxypropyl)cyclopentan-1-amine Chemical compound COC(OC)CCC1(N)CCCC1 KWENTBKLBHHLNV-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- ZXMYUPJTDAGGFW-UHFFFAOYSA-N 1-azaspiro[4.4]nonane-2-carboxylic acid Chemical compound N1C(C(=O)O)CCC11CCCC1 ZXMYUPJTDAGGFW-UHFFFAOYSA-N 0.000 description 1
- UIOORSWZRBWXCD-ZDUSSCGKSA-N 1-o-benzyl 2-o-ethyl (2s)-4-oxopyrrolidine-1,2-dicarboxylate Chemical compound CCOC(=O)[C@@H]1CC(=O)CN1C(=O)OCC1=CC=CC=C1 UIOORSWZRBWXCD-ZDUSSCGKSA-N 0.000 description 1
- HCUARRIEZVDMPT-UHFFFAOYSA-M 1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)[O-])=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-M 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- ODSNARDHJFFSRH-UHFFFAOYSA-N 2,3,3a,4,5,6,7,7a-octahydro-1h-isoindole Chemical compound C1CCCC2CNCC21 ODSNARDHJFFSRH-UHFFFAOYSA-N 0.000 description 1
- QFKVQNJEBLYEAH-UHFFFAOYSA-N 2,3,3a,4,6,6a-hexahydro-1h-furo[3,4-b]pyrrole Chemical compound C1OCC2NCCC21 QFKVQNJEBLYEAH-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- PPKAIMDMNWBOKN-UHFFFAOYSA-N 2-Oxo-4-phenylbutyric acid Chemical compound OC(=O)C(=O)CCC1=CC=CC=C1 PPKAIMDMNWBOKN-UHFFFAOYSA-N 0.000 description 1
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 1
- TYEYBOSBBBHJIV-UHFFFAOYSA-N 2-oxobutanoic acid Chemical compound CCC(=O)C(O)=O TYEYBOSBBBHJIV-UHFFFAOYSA-N 0.000 description 1
- PNSAYTGWJPRUTD-UHFFFAOYSA-N 3-(1-nitrocyclopentyl)propanal Chemical compound O=CCCC1([N+](=O)[O-])CCCC1 PNSAYTGWJPRUTD-UHFFFAOYSA-N 0.000 description 1
- DRZCPHGVEATLFR-UHFFFAOYSA-N 4,4-diethoxybutanenitrile Chemical compound CCOC(OCC)CCC#N DRZCPHGVEATLFR-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 101100119767 Caenorhabditis elegans fat-4 gene Proteins 0.000 description 1
- 101100468762 Caenorhabditis elegans ric-3 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 239000001116 FEMA 4028 Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 239000003810 Jones reagent Substances 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 150000008575 L-amino acids Chemical class 0.000 description 1
- 239000004201 L-cysteine Substances 0.000 description 1
- 235000013878 L-cysteine Nutrition 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- CEXDJDXDWBWRSA-AWVGZIQVSA-N N([C@@H](C)C(=O)N1[C@@H](CCC2CCCCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=C(Cl)C=C1 Chemical compound N([C@@H](C)C(=O)N1[C@@H](CCC2CCCCC21)C(O)=O)C(C(=O)OCC)CCC1=CC=C(Cl)C=C1 CEXDJDXDWBWRSA-AWVGZIQVSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- CJUMAFVKTCBCJK-UHFFFAOYSA-N N-benzyloxycarbonylglycine Chemical compound OC(=O)CNC(=O)OCC1=CC=CC=C1 CJUMAFVKTCBCJK-UHFFFAOYSA-N 0.000 description 1
- GDFAOVXKHJXLEI-VKHMYHEASA-N N-methyl-L-alanine Chemical compound C[NH2+][C@@H](C)C([O-])=O GDFAOVXKHJXLEI-VKHMYHEASA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 description 1
- 229960002576 amiloride Drugs 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- LPHNXQDGAWZOCU-UHFFFAOYSA-N azocane-2-carboxylic acid hydrate Chemical compound O.N1C(CCCCCC1)C(=O)O LPHNXQDGAWZOCU-UHFFFAOYSA-N 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- WHGYBXFWUBPSRW-FOUAGVGXSA-N beta-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO WHGYBXFWUBPSRW-FOUAGVGXSA-N 0.000 description 1
- 235000011175 beta-cyclodextrine Nutrition 0.000 description 1
- 125000003460 beta-lactamyl group Chemical group 0.000 description 1
- 229960004853 betadex Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 229960002303 citric acid monohydrate Drugs 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- YSSSPARMOAYJTE-UHFFFAOYSA-N dibenzo-18-crown-6 Chemical compound O1CCOCCOC2=CC=CC=C2OCCOCCOC2=CC=CC=C21 YSSSPARMOAYJTE-UHFFFAOYSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- RDXABLXNTVBVML-UHFFFAOYSA-N diethoxyphosphanyl diethyl phosphite Chemical compound CCOP(OCC)OP(OCC)OCC RDXABLXNTVBVML-UHFFFAOYSA-N 0.000 description 1
- 125000002474 dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 229950010030 dl-alanine Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- AVOLMBLBETYQHX-UHFFFAOYSA-N etacrynic acid Chemical compound CCC(=C)C(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl AVOLMBLBETYQHX-UHFFFAOYSA-N 0.000 description 1
- 229960003199 etacrynic acid Drugs 0.000 description 1
- PGEVGMOTJUZUKY-MERQFXBCSA-N ethyl (2r)-2-amino-3-benzylsulfanylpropanoate;hydrochloride Chemical compound Cl.CCOC(=O)[C@@H](N)CSCC1=CC=CC=C1 PGEVGMOTJUZUKY-MERQFXBCSA-N 0.000 description 1
- GLOHKOSMRJUOTO-RXQRSOPUSA-N ethyl (2s)-1-[(2s)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate Chemical compound N([C@@H](C)C(=O)N1C2CCCCC2C[C@H]1C(=O)OCC)C(=O)OCC1=CC=CC=C1 GLOHKOSMRJUOTO-RXQRSOPUSA-N 0.000 description 1
- UVPOIPYHTOFDIB-MERQFXBCSA-N ethyl (2s)-2-amino-3-phenylmethoxypropanoate;hydrochloride Chemical compound Cl.CCOC(=O)[C@@H](N)COCC1=CC=CC=C1 UVPOIPYHTOFDIB-MERQFXBCSA-N 0.000 description 1
- RVMNHKXJDVRAPE-HNNXBMFYSA-N ethyl (8s)-7-[2-(phenylmethoxycarbonylamino)acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate Chemical compound C([C@H](N(C1)C(=O)CNC(=O)OCC=2C=CC=CC=2)C(=O)OCC)C21SCCS2 RVMNHKXJDVRAPE-HNNXBMFYSA-N 0.000 description 1
- WGXQJCFTGHCJJL-UHFFFAOYSA-N ethyl 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxylate Chemical compound C1CCCC2NC(C(=O)OCC)CCC21 WGXQJCFTGHCJJL-UHFFFAOYSA-N 0.000 description 1
- ZWKOTRNANCDLSE-UHFFFAOYSA-N ethyl 1,2,3,4,4a,5,7,7a-octahydrofuro[3,4-b]pyridine-2-carboxylate Chemical compound N1C(C(=O)OCC)CCC2COCC21 ZWKOTRNANCDLSE-UHFFFAOYSA-N 0.000 description 1
- SUWTYCOTEIUZTF-UHFFFAOYSA-N ethyl 1,4-thiazonane-5-carboxylate Chemical compound CCOC(=O)C1CCCCSCCN1 SUWTYCOTEIUZTF-UHFFFAOYSA-N 0.000 description 1
- QQXQAEWRSVZPJM-UHFFFAOYSA-N ethyl 1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OCC)=CC2=C1 QQXQAEWRSVZPJM-UHFFFAOYSA-N 0.000 description 1
- WNKOJUVNRGYDPP-UHFFFAOYSA-N ethyl 2,3,3a,4,6,6a-hexahydro-1h-thieno[3,4-b]pyrrole-2-carboxylate Chemical compound C1SCC2NC(C(=O)OCC)CC21 WNKOJUVNRGYDPP-UHFFFAOYSA-N 0.000 description 1
- DKWAALUXJAKCRQ-UHFFFAOYSA-N ethyl 2-oxo-3-phenylbutanoate Chemical compound CCOC(=O)C(=O)C(C)C1=CC=CC=C1 DKWAALUXJAKCRQ-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N ethyl butyrate Chemical compound CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 239000001761 ethyl methyl cellulose Substances 0.000 description 1
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229960002003 hydrochlorothiazide Drugs 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- KCUNTYMNJVXYKZ-JTQLQIEISA-N methyl (2s)-2-amino-3-(1h-indol-3-yl)propanoate Chemical compound C1=CC=C2C(C[C@H](N)C(=O)OC)=CNC2=C1 KCUNTYMNJVXYKZ-JTQLQIEISA-N 0.000 description 1
- IXKUPTBCNCVFCM-VIFPVBQESA-N methyl (4s)-5-(2-oxopropanoyl)-1,5-oxazocane-4-carboxylate Chemical compound COC(=O)[C@@H]1CCOCCCN1C(=O)C(C)=O IXKUPTBCNCVFCM-VIFPVBQESA-N 0.000 description 1
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- CJSZWOGCKKDSJG-UHFFFAOYSA-N nitrocyclopentane Chemical compound [O-][N+](=O)C1CCCC1 CJSZWOGCKKDSJG-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- DOYOPBSXEIZLRE-UHFFFAOYSA-N pyrrole-3-carboxylic acid Natural products OC(=O)C=1C=CNC=1 DOYOPBSXEIZLRE-UHFFFAOYSA-N 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 229960004605 timolol Drugs 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
- C07K5/0222—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2 with the first amino acid being heterocyclic, e.g. Pro, Trp
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Molecular Biology (AREA)
- Genetics & Genomics (AREA)
- Biophysics (AREA)
- Biochemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Saccharide Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Apparatus For Disinfection Or Sterilisation (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US19988680A | 1980-10-23 | 1980-10-23 | |
| US25848481A | 1981-04-28 | 1981-04-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE812475L IE812475L (en) | 1982-04-23 |
| IE53802B1 true IE53802B1 (en) | 1989-03-01 |
Family
ID=26895254
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2475/81A IE53802B1 (en) | 1980-10-23 | 1981-10-21 | Carboxyalkyl dipertides, process for their production and pharmaceutical compositions containing them |
Country Status (28)
| Country | Link |
|---|---|
| US (2) | US4818749A (en:Method) |
| EP (1) | EP0050800B2 (en:Method) |
| JP (1) | JPH01163197A (en:Method) |
| KR (1) | KR880001843B1 (en:Method) |
| AT (1) | ATE20469T1 (en:Method) |
| AU (1) | AU554362B2 (en:Method) |
| CA (1) | CA1341206C (en:Method) |
| CY (1) | CY1469A (en:Method) |
| DE (2) | DE3174844D1 (en:Method) |
| DK (1) | DK161523C (en:Method) |
| ES (1) | ES8308838A1 (en:Method) |
| FI (1) | FI83222C (en:Method) |
| GR (1) | GR75059B (en:Method) |
| HK (1) | HK36189A (en:Method) |
| HU (1) | HU193146B (en:Method) |
| IE (1) | IE53802B1 (en:Method) |
| IL (1) | IL64085A (en:Method) |
| KE (1) | KE3845A (en:Method) |
| LU (1) | LU88621I2 (en:Method) |
| MA (1) | MA19309A1 (en:Method) |
| MY (1) | MY8700683A (en:Method) |
| NL (1) | NL940001I2 (en:Method) |
| NO (2) | NO164983C (en:Method) |
| NZ (1) | NZ198702A (en:Method) |
| OA (1) | OA06929A (en:Method) |
| PH (1) | PH21916A (en:Method) |
| PT (1) | PT73861B (en:Method) |
| SG (1) | SG78188G (en:Method) |
Families Citing this family (144)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4595675A (en) * | 1979-09-19 | 1986-06-17 | Hoechst Aktiengesellschaft | Bicyclic α-iminocarboxylic acid compounds having hypotensive activity |
| US4644008A (en) * | 1979-12-07 | 1987-02-17 | Adir | Perhydroindole-2-carboxylic acids as antihypertensives |
| US4508729A (en) * | 1979-12-07 | 1985-04-02 | Adir | Substituted iminodiacids, their preparation and pharmaceutical compositions containing them |
| US4616029A (en) * | 1979-12-07 | 1986-10-07 | Adir | Perhydromdole-2-carboxylic acids as antihypertensives |
| US4616030A (en) * | 1979-12-07 | 1986-10-07 | Adir | Perhydroindole-2-carboxylic acids as antihypertensives |
| US4616031A (en) * | 1979-12-07 | 1986-10-07 | Adir | Perhydroindole-2-carboxylic acids as antihypertensives |
| US4350704A (en) * | 1980-10-06 | 1982-09-21 | Warner-Lambert Company | Substituted acyl derivatives of octahydro-1H-indole-2-carboxylic acids |
| EP0046953B1 (de) * | 1980-08-30 | 1989-12-06 | Hoechst Aktiengesellschaft | Aminosäurederivate, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und deren Verwendung |
| DE3174844D1 (en) * | 1980-10-23 | 1986-07-24 | Schering Corp | Carboxyalkyl dipeptides, processes for their production and pharmaceutical compositions containing them |
| US4906615A (en) * | 1980-12-18 | 1990-03-06 | Schering Corporation | Substituted dipeptides as inhibitors of enkephalinases |
| US4610816A (en) * | 1980-12-18 | 1986-09-09 | Schering Corporation | Substituted dipeptides as inhibitors of enkephalinases |
| DE3276311D1 (en) * | 1981-02-17 | 1987-06-19 | Warner Lambert Co | Octahydro-2-(omega-mercaptoalkanoyl)3-oxo-1h-isoindole-1-carboxylic acids and esters |
| US4496542A (en) * | 1981-03-30 | 1985-01-29 | Usv Pharmaceutical Corporation | N-substituted-amido-amino acids |
| US4766110A (en) * | 1981-08-21 | 1988-08-23 | Ryan James W | Novel complex amido and imido derivatives of carboxyalkyl peptides |
| DE3226768A1 (de) * | 1981-11-05 | 1983-05-26 | Hoechst Ag, 6230 Frankfurt | Derivate der cis, endo-2-azabicyclo-(3.3.0)-octan-3-carbonsaeure, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung |
| EP0081094A1 (en) * | 1981-11-12 | 1983-06-15 | Merck & Co. Inc. | Substituted omega-amino-carboxymethyldipeptide antihypertensive agents |
| US4503043A (en) * | 1981-12-07 | 1985-03-05 | Warner-Lambert Company | Substituted acyl derivatives of octahydro-1H-isoindole-1-carboxylic acids |
| ATE25244T1 (de) * | 1981-12-29 | 1987-02-15 | Hoechst Ag | Neue derivate bicyclischer aminosaeuren, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung sowie neue bicyclische aminosaeuren als zwischenstufen und verfahren zu deren herstellung. |
| CA1341296C (en) * | 1981-12-29 | 2001-09-25 | Hansjorg Urbach | 2-azabicycloalkane-3-carboxylic acid derivatives, processes for their preparation, agents containing these compounds and their use |
| DE3360065D1 (en) * | 1982-03-08 | 1985-03-28 | Schering Corp | Carboxyalkyl dipeptides, processes for their production and pharmaceutical compositions containing them |
| DE3211397A1 (de) * | 1982-03-27 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | Spiro (4.(3+n))-2-aza-3-carbonsaeure-derivate, verfahren zu ihrer herstellung, diese enthaltende mittel und ihre verwendung |
| DE3211676A1 (de) * | 1982-03-30 | 1983-10-06 | Hoechst Ag | Neue derivate von cycloalka (c) pyrrol-carbonsaeuren, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung sowie neue cycloalka (c) pyrrol-carbonsaeuren als zwischenstufen und verfahren zu deren herstellung |
| US4555503A (en) * | 1982-05-05 | 1985-11-26 | Merck & Co., Inc. | N2 -(Substituted)carboxymethyl-N6 -(substituted)-lysyl-and αε-aminoalkyl)glycyl amino acid antihypertensive agents |
| US4483850A (en) * | 1982-05-10 | 1984-11-20 | Merck & Co., Inc. | N-Terminal substituted oligopeptide converting enzyme inhibitors |
| DE3218540A1 (de) * | 1982-05-17 | 1983-11-24 | Hoechst Ag, 6230 Frankfurt | Spiro-2-aza-alkan-3-carbonitrile, verfahren zu ihrer herstellung und ihre verwendung |
| EP0103077B1 (en) * | 1982-06-17 | 1988-05-18 | Schering Corporation | Substituted dipeptides, methods for their production, pharmaceutical compositions containing them, method for making such pharmaceutical compositions |
| US4470973A (en) * | 1982-07-19 | 1984-09-11 | E. R. Squibb & Sons, Inc. | Substituted peptide compounds |
| AU1643283A (en) * | 1982-07-19 | 1984-01-26 | E.R. Squibb & Sons, Inc. | Substituted peptides |
| US4500713A (en) * | 1982-09-23 | 1985-02-19 | Usv Pharmaceutical Corporation | Therapeutic dipeptides |
| US4634716A (en) * | 1982-09-30 | 1987-01-06 | Merck & Co., Inc. | Substituted N-carboxymethyl-aminoacylaminoalkanoic acids useful as antihypertensive agents |
| DE3242151A1 (de) * | 1982-11-13 | 1984-05-17 | Hoechst Ag, 6230 Frankfurt | Neue derivate tricyclischer aminosaeuren, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung, sowie neue bicyclische aminosaeuren als zwischenstufen und verfahren zu deren herstellung |
| US4587234A (en) * | 1982-11-18 | 1986-05-06 | E. R. Squibb & Sons, Inc. | Carboxy and substituted carboxy alkanoyl and cycloalkanoyl peptides |
| US4642315A (en) * | 1982-11-18 | 1987-02-10 | E. R. Squibb & Sons, Inc. | Carboxy and substituted carboxy alkanoyl and cycloalkanoyl peptides |
| US4499079A (en) * | 1982-11-18 | 1985-02-12 | E. R. Squibb & Sons, Inc. | Carboxy and substituted carboxy alkanoyl and cycloalkanoyl peptides |
| DE3246503A1 (de) * | 1982-12-16 | 1984-06-20 | Hoechst Ag, 6230 Frankfurt | Derivate der cis, endo-2-azabicyclo-(5.3.0)-decan-3-carbonsaeure, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung |
| US4826812A (en) * | 1982-12-27 | 1989-05-02 | Schering Corporation | Antiglaucoma agent |
| EP0114333B1 (en) * | 1982-12-27 | 1990-08-29 | Schering Corporation | Pharmaceutical composition |
| DE3300774A1 (de) * | 1983-01-12 | 1984-07-12 | Hoechst Ag, 6230 Frankfurt | Neue spirocyclische aminosaeuren, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung sowie neue spirocyclische aminosaeuren als zwischenprodukte und verfahren zu deren herstellung |
| DE3302125A1 (de) * | 1983-01-22 | 1984-07-26 | Boehringer Ingelheim KG, 6507 Ingelheim | Aminosaeure-derivate, verfahren zu ihrer herstellung und verwendung |
| US5175306A (en) * | 1983-01-31 | 1992-12-29 | Hoechst Aktiengesellschaft | Process for the resolution of racemates of optically active bicyclic imino-α-carboxylic esters |
| DE3303344A1 (de) | 1983-02-02 | 1984-08-02 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von n-alkylierten aminosaeuren und deren estern |
| US4596791A (en) * | 1983-03-16 | 1986-06-24 | Usv Pharmaceutical Corp. | Compounds for treating hypertension |
| FI841052A7 (fi) * | 1983-03-16 | 1984-09-17 | Usv Pharma Corp | Foereningar foer behandling av blodtryckssjukdomar. |
| US4666906A (en) * | 1983-03-16 | 1987-05-19 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| GB8311286D0 (en) * | 1983-04-26 | 1983-06-02 | Searle & Co | Carboxyalkyl peptide derivatives |
| US4585758A (en) * | 1983-05-20 | 1986-04-29 | Usv Pharmaceutical Corp. | Angiotensin-converting enzyme inhibitors |
| US4783444A (en) * | 1984-09-17 | 1988-11-08 | Schering Corporation | Antiglaucoma compositions and methods |
| US4584285A (en) * | 1983-06-02 | 1986-04-22 | Schering Corporation | Antihypertensive agents |
| FR2546886B2 (fr) * | 1983-06-06 | 1986-05-16 | Adir | Derives d'acides isoindoledicarboxyliques, leur preparation et compositions pharmaceutiques les contenant |
| DE3322530A1 (de) * | 1983-06-23 | 1985-01-10 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von mono-, bi- und tricyclischen aminosaeuren |
| US4514391A (en) * | 1983-07-21 | 1985-04-30 | E. R. Squibb & Sons, Inc. | Hydroxy substituted peptide compounds |
| DE3333454A1 (de) * | 1983-09-16 | 1985-04-11 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von n-alkylierten dipeptiden und deren estern |
| DE3333455A1 (de) * | 1983-09-16 | 1985-04-11 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung n-alkylierter dipeptide und deren estern |
| US4642355A (en) * | 1984-02-24 | 1987-02-10 | Otsuka Pharmaceutical Factory, Inc. | Proline derivatives |
| US4555508A (en) * | 1984-03-02 | 1985-11-26 | Usv Pharmaceutical Corp. | Antihypertensive spiro-cyclic compounds |
| US4556652A (en) * | 1984-03-02 | 1985-12-03 | Usv Pharmaceutical Corp. | Antihypertensive spiro-amidoamino compounds |
| DE3408923A1 (de) * | 1984-03-12 | 1985-09-26 | Hoechst Ag, 6230 Frankfurt | Carboxyalkyldipeptidderivate, verfahren zu deren herstellung, diese enthaltende mittel und deren verwendung |
| US5684016A (en) * | 1984-04-12 | 1997-11-04 | Hoechst Aktiengesellschaft | Method of treating cardiac insufficiency |
| DE3413710A1 (de) * | 1984-04-12 | 1985-10-24 | Hoechst Ag, 6230 Frankfurt | Verfahren zur behandlung der herzinsuffizienz |
| US4500518A (en) * | 1984-04-19 | 1985-02-19 | E. R. Squibb & Sons, Inc. | Amino thiol dipeptides |
| US4558150A (en) * | 1984-04-19 | 1985-12-10 | E. R. Squibb & Sons, Inc. | Intermediates for preparing amino thiol dipeptides |
| AU569789B2 (en) * | 1984-05-03 | 1988-02-18 | Brigham And Women's Hospital | A.c.e. inhibitors to treat renal diseases |
| ZA855659B (en) * | 1984-07-30 | 1987-03-25 | Schering Corp | Novel process for the preparation of cis,endo-octahydrocyclopenta(b)pyrrole-2-carboxylate |
| DE3431541A1 (de) * | 1984-08-28 | 1986-03-06 | Hoechst Ag, 6230 Frankfurt | Cis,endo-2-azabicycloalkan-3-carbonsaeure-derivate, verfahren zu deren herstellung, deren verwendung sowie zwischenprodukte bei deren herstellung |
| IT1176983B (it) * | 1984-10-16 | 1987-08-26 | Zambon Spa | Dipeptidi ad attivita' farmacologica |
| CS250699B2 (en) * | 1984-12-21 | 1987-05-14 | Pfizer | Method of octahydro-6-azaindole's depetidic derivatives production |
| EP0187037A3 (en) * | 1984-12-21 | 1988-03-23 | Takeda Chemical Industries, Ltd. | Piperidine derivatives, their production and use |
| US4762821A (en) * | 1985-03-22 | 1988-08-09 | Syntex (U.S.A.) Inc. | N',N"-dialkylguanidino dipeptides |
| DE3529960A1 (de) * | 1985-08-22 | 1987-03-05 | Boehringer Ingelheim Kg | Aminosaeure-derivate, verfahren zu ihrer herstellung und verwendung |
| US5231080A (en) * | 1985-10-15 | 1993-07-27 | Hoechst Aktiengesellschaft | Method for the treatment of atherosclerosis, thrombosis, and peripheral vessel disease |
| GB2182938B (en) * | 1985-11-13 | 1989-11-08 | Otsuka Pharma Co Ltd | Antihypertensive proline peptides |
| JPH0662671B2 (ja) * | 1986-01-17 | 1994-08-17 | 株式会社大塚製薬工場 | プロリン誘導体 |
| DE3610391A1 (de) * | 1986-03-27 | 1987-10-08 | Hoechst Ag | Verbindungen mit nootroper wirkung, diese enthaltende mittel und deren verwendung bei der behandlung und prophylaxe cognitiver dysfunktionen |
| US5231084A (en) * | 1986-03-27 | 1993-07-27 | Hoechst Aktiengesellschaft | Compounds having a cognition adjuvant action, agents containing them, and the use thereof for the treatment and prophylaxis of cognitive dysfuncitons |
| EP0566157A1 (en) | 1986-06-20 | 1993-10-20 | Schering Corporation | Neutral metalloendopeptidase inhibitors in the treatment of hypertension |
| EP0254032A3 (en) * | 1986-06-20 | 1990-09-05 | Schering Corporation | Neutral metalloendopeptidase inhibitors in the treatment of hypertension |
| US5948939A (en) * | 1986-09-10 | 1999-09-07 | Syntex (U.S.A.) Inc. | Selective amidination of diamines |
| JP2579323B2 (ja) * | 1986-09-10 | 1997-02-05 | シンテックス(ユー・エス・エイ)インコーポレイテッド | ジアミン類の選択的アミジン化 |
| DE3633496A1 (de) * | 1986-10-02 | 1988-04-14 | Hoechst Ag | Kombination von angiotensin-converting-enzyme-hemmern mit calciumantagonisten sowie deren verwendung in arzneimitteln |
| DE3639879A1 (de) * | 1986-11-21 | 1988-06-01 | Hoechst Ag | Verfahren zur herstellung von mono-, bi- und tricyclischen aminosaeuren, zwischenprodukte dieses verfahrens sowie ein verfahren zu deren herstellung |
| DE3641451A1 (de) * | 1986-12-04 | 1988-06-16 | Hoechst Ag | Derivate bicyclischer aminocarbonsaeuren, verfahren und zwischenprodukte zu deren herstellung sowie deren verwendung |
| US5262436A (en) * | 1987-03-27 | 1993-11-16 | Schering Corporation | Acylamino acid antihypertensives in the treatment of congestive heart failure |
| DE3722007A1 (de) * | 1987-07-03 | 1989-01-12 | Hoechst Ag | Verfahren zur herstellung bicyclischer aminocarbonsaeuren, zwischenprodukte dieses verfahrens und deren verwendung |
| DE3739690A1 (de) * | 1987-11-24 | 1989-06-08 | Hoechst Ag | Stabilisierte arzneistoffe, verfahren zu ihrer herstellung sowie stabile arzneizubereitungen |
| DE3801587A1 (de) * | 1988-01-21 | 1989-08-03 | Hoechst Ag | Neue aminosaeureglyceride, verfahren zu ihrer herstellung, sie enthaltende arzneimittel und deren verwendung |
| DE3803225A1 (de) * | 1988-02-04 | 1989-08-17 | Hoechst Ag | Aminosaeureamide mit psychotroper wirkung, verfahren zu ihrer herstellung, sie enthaltende mittel und deren verwendung |
| HU904967D0 (en) * | 1988-04-22 | 1991-01-28 | Hoechst Ag | Process for producing new azabicyclo(3.3.o)octane-3-carboxylic acid-octylesther derivatives |
| DD284030A5 (de) | 1988-11-24 | 1990-10-31 | Hoechst Ag,De | Verfahren zur herstellung von peptiden mit bradykinin-antagonistischer wirkung |
| ZA902661B (en) * | 1989-04-10 | 1991-01-30 | Schering Corp | Mercapto-acyl amino acids |
| JPH075530B2 (ja) * | 1989-11-21 | 1995-01-25 | シェリング・コーポレーション | カルボキシアルキルカルボニルアミノ酸エンドペプチダーゼ阻害剤 |
| US5075302A (en) * | 1990-03-09 | 1991-12-24 | Schering Corporation | Mercaptoacyl aminolactam endopeptidase inhibitors |
| US5173506A (en) * | 1990-08-16 | 1992-12-22 | Schering Corporation | N-(mercaptoalkyl)ureas and carbamates |
| US5225401A (en) * | 1991-08-12 | 1993-07-06 | E. R. Squibb & Sons, Inc. | Treatment of congestive heart failure |
| LT3872B (en) | 1993-12-06 | 1996-04-25 | Hoechst Ag | Novel peptides and pharmaceutical compositions containing them |
| US7056935B2 (en) | 1995-06-07 | 2006-06-06 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US5859031A (en) * | 1995-06-07 | 1999-01-12 | Gpi Nil Holdings, Inc. | Small molecule inhibitors of rotamase enzyme activity |
| US20020042377A1 (en) * | 1995-06-07 | 2002-04-11 | Steiner Joseph P. | Rotamase enzyme activity inhibitors |
| US5801197A (en) * | 1995-10-31 | 1998-09-01 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| ES2171768T3 (es) | 1996-03-20 | 2002-09-16 | Hoechst Ag | Inhibidores de la resorcion osea y antagonistas de receptores de vitronectina. |
| FR2746394B1 (fr) | 1996-03-20 | 1998-05-29 | Roussel Uclaf | Nouveaux composes tricycliques, leur procede de preparation, et les intermediaires de ce procede, leur application a titre de medicaments et les compositions pharmaceutiques les renfermant |
| US5786378A (en) * | 1996-09-25 | 1998-07-28 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters |
| US6218424B1 (en) | 1996-09-25 | 2001-04-17 | Gpi Nil Holdings, Inc. | Heterocyclic ketone and thioester compounds and uses |
| US5801187A (en) | 1996-09-25 | 1998-09-01 | Gpi-Nil Holdings, Inc. | Heterocyclic esters and amides |
| DE19653647A1 (de) | 1996-12-20 | 1998-06-25 | Hoechst Ag | Vitronectin - Rezeptorantagonisten, deren Herstellung sowie deren Verwendung |
| US6274602B1 (en) * | 1998-06-03 | 2001-08-14 | Gpi Nil Holdings, Inc. | Heterocyclic thioester and ketone hair growth compositions and uses |
| US6187784B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Pipecolic acid derivative hair growth compositions and uses |
| US6187796B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Sulfone hair growth compositions and uses |
| US5945441A (en) * | 1997-06-04 | 1999-08-31 | Gpi Nil Holdings, Inc. | Pyrrolidine carboxylate hair revitalizing agents |
| US20010049381A1 (en) | 1997-06-04 | 2001-12-06 | Gpl Nil Holdings, Inc., | Pyrrolidine derivative hair growth compositions and uses |
| US6271244B1 (en) | 1998-06-03 | 2001-08-07 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioester hair growth compositions and uses |
| DE19741235A1 (de) | 1997-09-18 | 1999-03-25 | Hoechst Marion Roussel De Gmbh | Neue Imidazolidinderivate, ihre Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| DE19741873A1 (de) * | 1997-09-23 | 1999-03-25 | Hoechst Marion Roussel De Gmbh | Neue 5-Ring-Heterocyclen, ihre Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| DE19751251A1 (de) | 1997-11-19 | 1999-05-20 | Hoechst Marion Roussel De Gmbh | Substituierte Imidazolidinderivate, ihre Herstellung, ihre Verwendung und sie enthaltende pharmezeutische Präparate |
| DE19821483A1 (de) | 1998-05-14 | 1999-11-18 | Hoechst Marion Roussel De Gmbh | Imidazolidinderivate, ihre Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| US6331537B1 (en) | 1998-06-03 | 2001-12-18 | Gpi Nil Holdings, Inc. | Carboxylic acids and carboxylic acid isosteres of N-heterocyclic compounds |
| US6172087B1 (en) | 1998-06-03 | 2001-01-09 | Gpi Nil Holding, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| AU770459B2 (en) * | 1998-06-03 | 2004-02-19 | Gpi Nil Holdings, Inc. | Heterocyclic ester and amide hair growth compositions and uses |
| US6429215B1 (en) | 1998-06-03 | 2002-08-06 | Gpi Nil Holdings, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US6337340B1 (en) | 1998-08-14 | 2002-01-08 | Gpi Nil Holdings, Inc. | Carboxylic acids and isosteres of heterocyclic ring compounds having multiple heteroatoms for vision and memory disorders |
| US6506788B1 (en) | 1998-08-14 | 2003-01-14 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioesters for vision and memory disorders |
| US6395758B1 (en) | 1998-08-14 | 2002-05-28 | Gpi Nil Holdings, Inc. | Small molecule carbamates or ureas for vision and memory disorders |
| US6218423B1 (en) | 1998-08-14 | 2001-04-17 | Gpi Nil Holdings, Inc. | Pyrrolidine derivatives for vision and memory disorders |
| US6384056B1 (en) | 1998-08-14 | 2002-05-07 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters or ketones for vision and memory disorders |
| US6376517B1 (en) | 1998-08-14 | 2002-04-23 | Gpi Nil Holdings, Inc. | Pipecolic acid derivatives for vision and memory disorders |
| US6335348B1 (en) | 1998-08-14 | 2002-01-01 | Gpi Nil Holdings, Inc. | Nitrogen-containing linear and azepinyl/ compositions and uses for vision and memory disorders |
| US6339101B1 (en) | 1998-08-14 | 2002-01-15 | Gpi Nil Holdings, Inc. | N-linked sulfonamides of N-heterocyclic carboxylic acids or isosteres for vision and memory disorders |
| US6333340B1 (en) | 1998-08-14 | 2001-12-25 | Gpi Nil Holdings, Inc. | Small molecule sulfonamides for vision and memory disorders |
| US6399648B1 (en) | 1998-08-14 | 2002-06-04 | Gpi Nil Holdings, Inc. | N-oxides of heterocyclic ester, amide, thioester, or ketone for vision and memory disorders |
| US7338976B1 (en) | 1998-08-14 | 2008-03-04 | Gpi Nil Holdings, Inc. | Heterocyclic esters or amides for vision and memory disorders |
| US6462072B1 (en) | 1998-09-21 | 2002-10-08 | Gpi Nil Holdings, Inc. | Cyclic ester or amide derivatives |
| AR036187A1 (es) * | 2001-07-24 | 2004-08-18 | Adir | Un proceso para la preparacion de perindopril, compuestos analogos y sus sales, compuesto intermediario 2,5-dioxo-oxazolidina y proceso para preparar un intermediario |
| US6407262B1 (en) | 2001-11-21 | 2002-06-18 | Brantford Chemicals Inc. | Process for the preparation of Ramipril |
| CA2477391A1 (en) * | 2002-03-01 | 2003-09-12 | Denis Schrier | Method of treating osteoarthritis |
| WO2004092132A1 (en) * | 2003-04-15 | 2004-10-28 | Warner-Lambert Company Llc | [b]-fused bicyclic proline derivatives and their use for treating arthritic conditions |
| MXPA05010165A (es) * | 2003-04-15 | 2005-11-16 | Warner Lambert Co | Derivados de prolina biciclicos [c]-condensados y su uso para el tratamiento de estados artriticos. |
| JP2008519062A (ja) * | 2004-11-05 | 2008-06-05 | キング・ファーマシューティカルズ・リサーチ・アンド・デベロプメント・インコーポレイティッド | 個々に被覆された安定化ラミプリル粒子、組成物及び方法 |
| ATE409036T1 (de) * | 2005-01-06 | 2008-10-15 | Ipca Lab Ltd | Verfahren zur synthese von (2s,3as,7as)-1-(s)- alanyl-octahydro-1h-2-carbonsäurederivaten und verwendung in der synthese von perindopril |
| GB0624087D0 (en) * | 2006-12-01 | 2007-01-10 | Selamine Ltd | Ramipril combination salt |
| GB0624090D0 (en) * | 2006-12-01 | 2007-01-10 | Selamine Ltd | Ramipril amine salts |
| GB0624084D0 (en) * | 2006-12-01 | 2007-01-10 | Selamine Ltd | Ramipril amino acid salts |
| CA2728226A1 (en) * | 2008-06-24 | 2010-01-21 | Codexis, Inc. | Biocatalytic processes for the preparation of substantially stereomerically pure fused bicyclic proline compounds |
| CA2864456A1 (en) | 2012-02-17 | 2013-08-22 | Egis Gyogyszergyar Zrt. | Pharmaceutical formulation having improved stability |
| HUP1300496A2 (hu) | 2013-08-16 | 2015-03-02 | Egis Gyogyszergyar Nyilvanosan Muekoedoe Reszvenytarsasag | Stabil kombinációs gyógyszerkészítmény |
| US9605020B2 (en) | 2013-09-03 | 2017-03-28 | Nagase & Co., Ltd. | Method for producing dipeptide derivative containing disubstituted amino acid residue |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
| US4508729A (en) * | 1979-12-07 | 1985-04-02 | Adir | Substituted iminodiacids, their preparation and pharmaceutical compositions containing them |
| FR2503155A2 (fr) * | 1980-10-02 | 1982-10-08 | Science Union & Cie | Nouveaux imino diacides substitues, leurs procedes de preparation et leur emploi comme inhibiteur d'enzyme |
| IE52663B1 (en) * | 1980-04-02 | 1988-01-20 | Warner Lambert Co | Substituted acyl derivatives of octahydro-1h-indole-2-carboxylic acids |
| US4350704A (en) * | 1980-10-06 | 1982-09-21 | Warner-Lambert Company | Substituted acyl derivatives of octahydro-1H-indole-2-carboxylic acids |
| ZA811493B (en) * | 1980-04-02 | 1982-03-31 | Warner Lambert Co | Substituted acyl derivatives of octahydro-1h-indole-2-carboxylic acids |
| EP0046953B1 (de) * | 1980-08-30 | 1989-12-06 | Hoechst Aktiengesellschaft | Aminosäurederivate, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und deren Verwendung |
| ZA816292B (en) * | 1980-09-17 | 1983-01-26 | Univ Miami | Carboxyalkyl peptides and thioethers and ethers of peptides as antihypertensive agents |
| JPS5793943A (en) * | 1980-10-06 | 1982-06-11 | Merck & Co Inc | Antihypertensive dipeptide derivative |
| FR2492381A1 (fr) * | 1980-10-21 | 1982-04-23 | Science Union & Cie | Nouveaux acides aza bicyclo alcane carboxyliques substitues leurs procedes de preparation et leur emploi comme inhibiteur d'enzyme |
| DE3174844D1 (en) * | 1980-10-23 | 1986-07-24 | Schering Corp | Carboxyalkyl dipeptides, processes for their production and pharmaceutical compositions containing them |
| DE3226768A1 (de) * | 1981-11-05 | 1983-05-26 | Hoechst Ag, 6230 Frankfurt | Derivate der cis, endo-2-azabicyclo-(3.3.0)-octan-3-carbonsaeure, verfahren zu ihrer herstellung, diese enthaltende mittel und deren verwendung |
| CA1341296C (en) * | 1981-12-29 | 2001-09-25 | Hansjorg Urbach | 2-azabicycloalkane-3-carboxylic acid derivatives, processes for their preparation, agents containing these compounds and their use |
-
1981
- 1981-10-15 DE DE8181108348T patent/DE3174844D1/de not_active Expired
- 1981-10-15 LU LU88621C patent/LU88621I2/fr unknown
- 1981-10-15 AT AT81108348T patent/ATE20469T1/de active
- 1981-10-15 EP EP81108348A patent/EP0050800B2/en not_active Expired - Lifetime
- 1981-10-15 DE DE1995175012 patent/DE19575012I2/de active Active
- 1981-10-20 NZ NZ198702A patent/NZ198702A/en unknown
- 1981-10-20 CA CA000388336A patent/CA1341206C/en not_active Expired - Fee Related
- 1981-10-20 PH PH26366A patent/PH21916A/en unknown
- 1981-10-20 DK DK462581A patent/DK161523C/da not_active IP Right Cessation
- 1981-10-20 FI FI813283A patent/FI83222C/sv not_active IP Right Cessation
- 1981-10-20 AU AU76614/81A patent/AU554362B2/en not_active Expired
- 1981-10-20 MA MA19511A patent/MA19309A1/fr unknown
- 1981-10-20 OA OA57524A patent/OA06929A/xx unknown
- 1981-10-20 GR GR66307A patent/GR75059B/el unknown
- 1981-10-21 KR KR1019810004008A patent/KR880001843B1/ko not_active Expired
- 1981-10-21 IE IE2475/81A patent/IE53802B1/en not_active IP Right Cessation
- 1981-10-21 IL IL64085A patent/IL64085A/xx active IP Right Grant
- 1981-10-21 PT PT73861A patent/PT73861B/pt unknown
- 1981-10-21 ES ES506414A patent/ES8308838A1/es not_active Expired
- 1981-10-21 NO NO813546A patent/NO164983C/no not_active IP Right Cessation
- 1981-10-22 HU HU813078A patent/HU193146B/hu unknown
-
1987
- 1987-11-04 US US07/117,008 patent/US4818749A/en not_active Expired - Lifetime
- 1987-12-30 MY MY683/87A patent/MY8700683A/xx unknown
-
1988
- 1988-09-28 US US07/250,300 patent/US4831157A/en not_active Expired - Lifetime
- 1988-11-09 JP JP63283542A patent/JPH01163197A/ja active Pending
- 1988-11-18 KE KE3845A patent/KE3845A/xx unknown
- 1988-11-21 SG SG781/88A patent/SG78188G/en unknown
-
1989
- 1989-05-04 HK HK361/89A patent/HK36189A/en not_active IP Right Cessation
- 1989-07-21 CY CY1469A patent/CY1469A/xx unknown
-
1994
- 1994-01-26 NL NL940001C patent/NL940001I2/nl unknown
-
1995
- 1995-09-22 NO NO1995008C patent/NO1995008I1/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0050800B1 (en) | Carboxyalkyl dipeptides, processes for their production and pharmaceutical compositions containing them | |
| FI68405C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara kaboxialkyldipeptider | |
| JPH0132240B2 (en:Method) | ||
| EP0088350B1 (en) | Carboxyalkyl dipeptides, processes for their production and pharmaceutical compositions containing them | |
| US4562202A (en) | N-Acyl hexahydroindole-2-carboxylic acids and anti-hypertensive use thereof | |
| US4470972A (en) | 7-Carboxyalkylaminoacyl-1,4-dithia-7-azaspiro[4.4]-nonane-8-carboxylic acids | |
| CA1293589C (en) | Carboxyalkyl amino acid derivatives of various substituted prolines | |
| US4626545A (en) | Amino acid derivatives as enzyme inhibitors | |
| US4483850A (en) | N-Terminal substituted oligopeptide converting enzyme inhibitors | |
| EP0046291B1 (en) | Substituted caprolactam derivatives as antihypertensives, process for preparing them, pharmaceutical composition containing them, and intermediates | |
| US4468396A (en) | Antihypertensive benzothiadiazines | |
| HU185324B (en) | Process for preparing 1-carboxy-azaalkanoyl-indoline-2-carboxylic acid derivatives | |
| US4826855A (en) | Thieno pyridines and their use as anti-hypertensive agents | |
| US4680392A (en) | Substituted caprolactam derivatives as antihypertensives | |
| US5348944A (en) | Carboxyalkyl dipeptides | |
| AU592122B2 (en) | Difluorocyclostatine containing polypeptides | |
| CZ413891A3 (cs) | Karboxyalkyldipeptidy, způsoby jejich výroby a farmaceutické kompozice, které je obsahují | |
| EP0059966A1 (en) | Substituted thiazolidine carboxylic acid analogs and derivatives as antihypertensives | |
| AU581929B2 (en) | Antihypertensive agents, pharmaceutical compositions containing them and processes for the preparation of the agents and compositions | |
| EP0083923A2 (en) | Aminoacyl-containing dipeptide derivatives useful as antihypertensives | |
| WO1987001707A1 (en) | Antihypertensive agents, pharmaceutical compositions containing them and processes for the preparation of the agents and compositions | |
| CS237326B2 (cs) | Způsob přípravy karboxyalkyldipeptidů |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |