IE48715B1 - New galencial forms for administration of medicaments by oral route,with programmed release and processes for preparing same - Google Patents
New galencial forms for administration of medicaments by oral route,with programmed release and processes for preparing sameInfo
- Publication number
- IE48715B1 IE48715B1 IE2452/79A IE245279A IE48715B1 IE 48715 B1 IE48715 B1 IE 48715B1 IE 2452/79 A IE2452/79 A IE 2452/79A IE 245279 A IE245279 A IE 245279A IE 48715 B1 IE48715 B1 IE 48715B1
- Authority
- IE
- Ireland
- Prior art keywords
- granules
- miniaturized
- active ingredient
- galenical form
- form according
- Prior art date
Links
- 239000003814 drug Substances 0.000 title claims abstract description 50
- 238000000034 method Methods 0.000 title description 6
- 239000008187 granular material Substances 0.000 claims abstract description 65
- 239000000546 pharmaceutical excipient Substances 0.000 claims abstract description 26
- 238000010521 absorption reaction Methods 0.000 claims abstract description 18
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 15
- 238000007906 compression Methods 0.000 claims abstract description 15
- 230000006835 compression Effects 0.000 claims abstract description 15
- 150000002632 lipids Chemical class 0.000 claims abstract description 12
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims abstract description 10
- 239000008103 glucose Substances 0.000 claims abstract description 10
- 239000004480 active ingredient Substances 0.000 claims description 35
- 239000002245 particle Substances 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 21
- 239000011248 coating agent Substances 0.000 claims description 13
- 238000000576 coating method Methods 0.000 claims description 13
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 12
- 238000000227 grinding Methods 0.000 claims description 12
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 11
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 11
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 11
- 210000001035 gastrointestinal tract Anatomy 0.000 claims description 8
- 238000002156 mixing Methods 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 7
- 238000001035 drying Methods 0.000 claims description 7
- 150000007524 organic acids Chemical class 0.000 claims description 7
- 235000005985 organic acids Nutrition 0.000 claims description 7
- 239000001530 fumaric acid Substances 0.000 claims description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 229920001800 Shellac Polymers 0.000 claims description 5
- 238000004090 dissolution Methods 0.000 claims description 5
- 239000004208 shellac Substances 0.000 claims description 5
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 claims description 5
- 229940113147 shellac Drugs 0.000 claims description 5
- 235000013874 shellac Nutrition 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000001856 Ethyl cellulose Substances 0.000 claims description 4
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 4
- -1 alkali metal salts Chemical class 0.000 claims description 4
- 239000001913 cellulose Substances 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 4
- 235000010980 cellulose Nutrition 0.000 claims description 4
- 230000007423 decrease Effects 0.000 claims description 4
- 229920001249 ethyl cellulose Polymers 0.000 claims description 4
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 150000002734 metacrylic acid derivatives Chemical class 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 235000002906 tartaric acid Nutrition 0.000 claims description 3
- 239000011975 tartaric acid Substances 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 2
- 239000000159 acid neutralizing agent Substances 0.000 claims description 2
- 150000007530 organic bases Chemical class 0.000 claims description 2
- 230000002093 peripheral effect Effects 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims 1
- 150000008041 alkali metal carbonates Chemical class 0.000 claims 1
- 230000003111 delayed effect Effects 0.000 abstract description 5
- 230000001079 digestive effect Effects 0.000 abstract description 2
- 239000007788 liquid Substances 0.000 abstract description 2
- 230000035515 penetration Effects 0.000 abstract description 2
- 230000036765 blood level Effects 0.000 description 22
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 17
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 description 16
- 229930182555 Penicillin Natural products 0.000 description 10
- IZEKFCXSFNUWAM-UHFFFAOYSA-N dipyridamole Chemical compound C=12N=C(N(CCO)CCO)N=C(N3CCCCC3)C2=NC(N(CCO)CCO)=NC=1N1CCCCC1 IZEKFCXSFNUWAM-UHFFFAOYSA-N 0.000 description 10
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical group N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 8
- 239000008280 blood Substances 0.000 description 8
- 210000004369 blood Anatomy 0.000 description 8
- 229960002768 dipyridamole Drugs 0.000 description 8
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 description 8
- 229940049954 penicillin Drugs 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 229960002726 vincamine Drugs 0.000 description 8
- 229920002261 Corn starch Polymers 0.000 description 5
- 235000019759 Maize starch Nutrition 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 239000000470 constituent Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000011144 upstream manufacturing Methods 0.000 description 4
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 description 3
- BPLBGHOLXOTWMN-UHFFFAOYSA-N 3,3-dimethyl-7-oxo-6-[(1-oxo-2-phenoxyethyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-UHFFFAOYSA-N 0.000 description 3
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 3
- 239000011872 intimate mixture Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 210000001198 duodenum Anatomy 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000003094 microcapsule Substances 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 210000000813 small intestine Anatomy 0.000 description 2
- 239000001509 sodium citrate Substances 0.000 description 2
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 2
- BGRJTUBHPOOWDU-NSHDSACASA-N (S)-(-)-sulpiride Chemical compound CCN1CCC[C@H]1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-NSHDSACASA-N 0.000 description 1
- XUGISPSHIFXEHZ-UHFFFAOYSA-N 3beta-acetoxy-cholest-5-ene Natural products C1C=C2CC(OC(C)=O)CCC2(C)C2C1C1CCC(C(C)CCCC(C)C)C1(C)CC2 XUGISPSHIFXEHZ-UHFFFAOYSA-N 0.000 description 1
- YEYCQJVCAMFWCO-UHFFFAOYSA-N 3beta-cholesteryl formate Natural products C1C=C2CC(OC=O)CCC2(C)C2C1C1CCC(C(C)CCCC(C)C)C1(C)CC2 YEYCQJVCAMFWCO-UHFFFAOYSA-N 0.000 description 1
- 101100275299 Caenorhabditis elegans col-10 gene Proteins 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 1
- CEAZRRDELHUEMR-URQXQFDESA-N Gentamicin Chemical compound O1[C@H](C(C)NC)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](NC)[C@@](C)(O)CO2)O)[C@H](N)C[C@@H]1N CEAZRRDELHUEMR-URQXQFDESA-N 0.000 description 1
- 229930182566 Gentamicin Natural products 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- OJMMVQQUTAEWLP-UHFFFAOYSA-N Lincomycin Natural products CN1CC(CCC)CC1C(=O)NC(C(C)O)C1C(O)C(O)C(O)C(SC)O1 OJMMVQQUTAEWLP-UHFFFAOYSA-N 0.000 description 1
- 101150034428 MED30 gene Proteins 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- 229930189077 Rifamycin Natural products 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229960003459 allopurinol Drugs 0.000 description 1
- OFCNXPDARWKPPY-UHFFFAOYSA-N allopurinol Chemical compound OC1=NC=NC2=C1C=NN2 OFCNXPDARWKPPY-UHFFFAOYSA-N 0.000 description 1
- 229960003022 amoxicillin Drugs 0.000 description 1
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- UREBDLICKHMUKA-DVTGEIKXSA-N betamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-DVTGEIKXSA-N 0.000 description 1
- 229960002537 betamethasone Drugs 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- XUGISPSHIFXEHZ-VEVYEIKRSA-N cholesteryl acetate Chemical compound C1C=C2C[C@@H](OC(C)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 XUGISPSHIFXEHZ-VEVYEIKRSA-N 0.000 description 1
- DGMZLCLHHVYDIS-UHFFFAOYSA-N clometacin Chemical compound CC=1N(CC(O)=O)C2=CC(OC)=CC=C2C=1C(=O)C1=CC=C(Cl)C=C1 DGMZLCLHHVYDIS-UHFFFAOYSA-N 0.000 description 1
- 229950001647 clometacin Drugs 0.000 description 1
- 229960002896 clonidine Drugs 0.000 description 1
- 229960004362 clorazepate Drugs 0.000 description 1
- XDDJGVMJFWAHJX-UHFFFAOYSA-M clorazepic acid anion Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(C(=O)[O-])N=C1C1=CC=CC=C1 XDDJGVMJFWAHJX-UHFFFAOYSA-M 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229960004193 dextropropoxyphene Drugs 0.000 description 1
- XLMALTXPSGQGBX-GCJKJVERSA-N dextropropoxyphene Chemical compound C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 XLMALTXPSGQGBX-GCJKJVERSA-N 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- 229960001259 diclofenac Drugs 0.000 description 1
- DCOPUUMXTXDBNB-UHFFFAOYSA-N diclofenac Chemical compound OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl DCOPUUMXTXDBNB-UHFFFAOYSA-N 0.000 description 1
- UVTNFZQICZKOEM-UHFFFAOYSA-N disopyramide Chemical compound C=1C=CC=NC=1C(C(N)=O)(CCN(C(C)C)C(C)C)C1=CC=CC=C1 UVTNFZQICZKOEM-UHFFFAOYSA-N 0.000 description 1
- 229960001066 disopyramide Drugs 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- JBIWCJUYHHGXTC-AKNGSSGZSA-N doxycycline Chemical compound O=C1C2=C(O)C=CC=C2[C@H](C)[C@@H]2C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@@H]1[C@H]2O JBIWCJUYHHGXTC-AKNGSSGZSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 229960003276 erythromycin Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960002518 gentamicin Drugs 0.000 description 1
- GWOFUCIGLDBNKM-UHFFFAOYSA-N glafenine Chemical compound OCC(O)COC(=O)C1=CC=CC=C1NC1=CC=NC2=CC(Cl)=CC=C12 GWOFUCIGLDBNKM-UHFFFAOYSA-N 0.000 description 1
- 229960001650 glafenine Drugs 0.000 description 1
- 229960004580 glibenclamide Drugs 0.000 description 1
- ZNNLBTZKUZBEKO-UHFFFAOYSA-N glyburide Chemical compound COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZNNLBTZKUZBEKO-UHFFFAOYSA-N 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000031891 intestinal absorption Effects 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 229960005287 lincomycin Drugs 0.000 description 1
- OJMMVQQUTAEWLP-KIDUDLJLSA-N lincomycin Chemical compound CN1C[C@H](CCC)C[C@H]1C(=O)N[C@H]([C@@H](C)O)[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](SC)O1 OJMMVQQUTAEWLP-KIDUDLJLSA-N 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229960000649 oxyphenbutazone Drugs 0.000 description 1
- HFHZKZSRXITVMK-UHFFFAOYSA-N oxyphenbutazone Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=C(O)C=C1 HFHZKZSRXITVMK-UHFFFAOYSA-N 0.000 description 1
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- 229940090007 persantine Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 1
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 1
- 229960003292 rifamycin Drugs 0.000 description 1
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical compound OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- LXMSZDCAJNLERA-ZHYRCANASA-N spironolactone Chemical compound C([C@@H]1[C@]2(C)CC[C@@H]3[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)SC(=O)C)C[C@@]21CCC(=O)O1 LXMSZDCAJNLERA-ZHYRCANASA-N 0.000 description 1
- 229960002256 spironolactone Drugs 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 229960005404 sulfamethoxazole Drugs 0.000 description 1
- MLKXDPUZXIRXEP-MFOYZWKCSA-N sulindac Chemical compound CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-MFOYZWKCSA-N 0.000 description 1
- 229960000894 sulindac Drugs 0.000 description 1
- JLKIGFTWXXRPMT-UHFFFAOYSA-N sulphamethoxazole Chemical compound O1C(C)=CC(NS(=O)(=O)C=2C=CC(N)=CC=2)=N1 JLKIGFTWXXRPMT-UHFFFAOYSA-N 0.000 description 1
- 229960004940 sulpiride Drugs 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 229960005041 troleandomycin Drugs 0.000 description 1
- LQCLVBQBTUVCEQ-QTFUVMRISA-N troleandomycin Chemical compound O1[C@@H](C)[C@H](OC(C)=O)[C@@H](OC)C[C@@H]1O[C@@H]1[C@@H](C)C(=O)O[C@H](C)[C@H](C)[C@H](OC(C)=O)[C@@H](C)C(=O)[C@@]2(OC2)C[C@H](C)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)OC(C)=O)[C@H]1C LQCLVBQBTUVCEQ-QTFUVMRISA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5005—Wall or coating material
- A61K9/5015—Organic compounds, e.g. fats, sugars
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61J—CONTAINERS SPECIALLY ADAPTED FOR MEDICAL OR PHARMACEUTICAL PURPOSES; DEVICES OR METHODS SPECIALLY ADAPTED FOR BRINGING PHARMACEUTICAL PRODUCTS INTO PARTICULAR PHYSICAL OR ADMINISTERING FORMS; DEVICES FOR ADMINISTERING FOOD OR MEDICINES ORALLY; BABY COMFORTERS; DEVICES FOR RECEIVING SPITTLE
- A61J3/00—Devices or methods specially adapted for bringing pharmaceutical products into particular physical or administering forms
- A61J3/10—Devices or methods specially adapted for bringing pharmaceutical products into particular physical or administering forms into the form of compressed tablets
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/14—Particulate form, e.g. powders, Processes for size reducing of pure drugs or the resulting products, Pure drug nanoparticles
- A61K9/16—Agglomerates; Granulates; Microbeadlets ; Microspheres; Pellets; Solid products obtained by spray drying, spray freeze drying, spray congealing,(multiple) emulsion solvent evaporation or extraction
- A61K9/1605—Excipients; Inactive ingredients
- A61K9/1617—Organic compounds, e.g. phospholipids, fats
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5073—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals having two or more different coatings optionally including drug-containing subcoatings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5084—Mixtures of one or more drugs in different galenical forms, at least one of which being granules, microcapsules or (coated) microparticles according to A61K9/16 or A61K9/50, e.g. for obtaining a specific release pattern or for combining different drugs
Landscapes
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Biophysics (AREA)
- Molecular Biology (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7836084A FR2444460A1 (fr) | 1978-12-22 | 1978-12-22 | Nouvelle forme galenique a usage oral, et son procede de preparation |
| FR7908181A FR2452923A2 (fr) | 1979-04-02 | 1979-04-02 | Nouvelle forme galenique d'administration de medicaments par voie orale, a liberation programmee |
| FR7908180A FR2452922A2 (fr) | 1979-04-02 | 1979-04-02 | Nouvelle forme galenique d'administration de medicaments par voie orale, a liberation programmee |
| FR7930041A FR2470600A2 (fr) | 1979-12-07 | 1979-12-07 | Nouvelle forme galenique d'administration de medicaments par voie orale, a liberation programmee |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE792452L IE792452L (en) | 1980-06-22 |
| IE48715B1 true IE48715B1 (en) | 1985-05-01 |
Family
ID=27446389
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2452/79A IE48715B1 (en) | 1978-12-22 | 1979-12-18 | New galencial forms for administration of medicaments by oral route,with programmed release and processes for preparing same |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US4609542A (OSRAM) |
| AR (1) | AR229346A1 (OSRAM) |
| AT (1) | AT376567B (OSRAM) |
| CH (1) | CH647676A5 (OSRAM) |
| DE (1) | DE2950977A1 (OSRAM) |
| ES (1) | ES487151A1 (OSRAM) |
| GB (1) | GB2039737B (OSRAM) |
| IE (1) | IE48715B1 (OSRAM) |
| IT (1) | IT1164548B (OSRAM) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH647676A5 (fr) * | 1978-12-22 | 1985-02-15 | Donald E Panoz | Formes galeniques a usage oral, a liberation programmee et leurs procedes de preparation. |
| FR2470599A1 (fr) * | 1979-12-07 | 1981-06-12 | Panoz Donald | Perfectionnements apportes aux procedes de preparation de formes galeniques a action retard et a liberation programmee et formes galeniques de medicaments ainsi obtenus |
| DE3000979A1 (de) * | 1980-01-12 | 1981-07-23 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue dipyridamol-retardformen und verfahren zu ihrer herstellung |
| DE3124090A1 (de) * | 1981-06-19 | 1983-01-05 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue orale dipyridamolformen |
| DE3127237A1 (de) * | 1981-07-10 | 1983-01-20 | Hoechst Ag, 6000 Frankfurt | Magenvertraegliche arzneiformen von xanthinderivaten und verfahren zu ihrer herstellung |
| EP0094123A3 (en) * | 1982-05-06 | 1984-07-25 | THE PROCTER & GAMBLE COMPANY | Therapeutic granules |
| EP0094116A3 (en) * | 1982-05-06 | 1984-08-01 | The Procter & Gamble Company | Therapeutic granules |
| EP0094117A3 (en) * | 1982-05-06 | 1984-08-01 | The Procter & Gamble Company | Therapeutic granules |
| PH18946A (en) * | 1983-04-21 | 1985-11-14 | Elan Corp Plc | Controlled absorption pharmaceutical composition |
| IE56459B1 (en) * | 1983-12-21 | 1991-08-14 | Elan Corp Ltd | Controlled absorption pharmaceutical formulation |
| IE56999B1 (en) * | 1983-12-22 | 1992-03-11 | Elan Corp Plc | Pharmaceutical formulation |
| US4917899A (en) * | 1983-12-22 | 1990-04-17 | Elan Corporation Plc | Controlled absorption diltiazem formulation |
| US4894240A (en) * | 1983-12-22 | 1990-01-16 | Elan Corporation Plc | Controlled absorption diltiazem formulation for once-daily administration |
| DE3572440D1 (en) * | 1984-06-19 | 1989-09-28 | Basf Ag | Gastro-resistant cylindrical pancreatine-microtablets |
| US4728512A (en) * | 1985-05-06 | 1988-03-01 | American Home Products Corporation | Formulations providing three distinct releases |
| JPS62103012A (ja) * | 1985-10-23 | 1987-05-13 | Eisai Co Ltd | 多重顆粒 |
| US4904476A (en) * | 1986-03-04 | 1990-02-27 | American Home Products Corporation | Formulations providing three distinct releases |
| US4794001A (en) * | 1986-03-04 | 1988-12-27 | American Home Products Corporation | Formulations providing three distinct releases |
| IT1204839B (it) * | 1986-03-14 | 1989-03-10 | Chiesi Farma Spa | Composizioni farmaceutiche contenenti vinburnina e loro procedimento di preparazione |
| NL193682C (nl) * | 1987-05-14 | 2000-07-04 | Glaxo Group Ltd | Beklede cefuroximaxetilsamenstelling. |
| JP2643222B2 (ja) * | 1988-02-03 | 1997-08-20 | エーザイ株式会社 | 多重層顆粒 |
| SE509029C2 (sv) * | 1988-08-16 | 1998-11-30 | Ss Pharmaceutical Co | Långtidsverkande diklofenak-natriumpreparat |
| US5122384A (en) * | 1989-05-05 | 1992-06-16 | Kv Pharmaceutical Company | Oral once-per-day organic nitrate formulation which does not induce tolerance |
| US5133974A (en) * | 1989-05-05 | 1992-07-28 | Kv Pharmaceutical Company | Extended release pharmaceutical formulations |
| EP0585355B1 (en) * | 1991-05-20 | 1995-03-22 | Marion Laboratories, Inc. | Multi-layered controlled release formulation |
| US5266331A (en) * | 1991-11-27 | 1993-11-30 | Euroceltique, S.A. | Controlled release oxycodone compositions |
| US5958459A (en) * | 1991-12-24 | 1999-09-28 | Purdue Pharma L.P. | Opioid formulations having extended controlled released |
| US5429822A (en) * | 1992-03-13 | 1995-07-04 | Cambridge Scientific, Inc. | Biodegradable bursting release system |
| US20080075781A1 (en) * | 1992-11-25 | 2008-03-27 | Purdue Pharma Lp | Controlled release oxycodone compositions |
| US20070275062A1 (en) * | 1993-06-18 | 2007-11-29 | Benjamin Oshlack | Controlled release oxycodone compositions |
| US7740881B1 (en) | 1993-07-01 | 2010-06-22 | Purdue Pharma Lp | Method of treating humans with opioid formulations having extended controlled release |
| IL110014A (en) * | 1993-07-01 | 1999-11-30 | Euro Celtique Sa | Solid controlled-release oral dosage forms of opioid analgesics |
| US5310961A (en) * | 1993-07-02 | 1994-05-10 | Affinity Biotech, Inc. | Neomorphic ibuprofen |
| US5464633A (en) * | 1994-05-24 | 1995-11-07 | Jagotec Ag | Pharmaceutical tablets releasing the active substance after a definite period of time |
| US5834024A (en) * | 1995-01-05 | 1998-11-10 | Fh Faulding & Co. Limited | Controlled absorption diltiazem pharmaceutical formulation |
| FR2733423B1 (fr) * | 1995-04-26 | 1997-06-20 | Virbac Lab | Compositions pulverulentes et solubles dans l'eau et leurs applications |
| GB9519363D0 (en) | 1995-09-22 | 1995-11-22 | Euro Celtique Sa | Pharmaceutical formulation |
| US5721229A (en) * | 1995-12-26 | 1998-02-24 | Veterinary Pharmacy Corporation | Soluble forms of cephalosporins and treatment of animals |
| US6312724B1 (en) | 1997-04-04 | 2001-11-06 | Isa Odidi | Sustained release pharmaceutical matrix tablet of pharmaceutically acceptable salts of diclofenac and process for preparation thereof |
| US6066339A (en) * | 1997-10-17 | 2000-05-23 | Elan Corporation, Plc | Oral morphine multiparticulate formulation |
| US6806294B2 (en) | 1998-10-15 | 2004-10-19 | Euro-Celtique S.A. | Opioid analgesic |
| US6225304B1 (en) | 1999-02-17 | 2001-05-01 | Pharmaceutical Solutions, Inc. | Soluble forms of amoxicillin and treatment of animals |
| US6596307B1 (en) * | 1999-06-15 | 2003-07-22 | Eli Lilly And Company | Process for preparing pharmaceutical bulk material having uniform dissolution |
| EP1135106B1 (en) * | 1999-09-30 | 2008-04-09 | Penwest Pharmaceuticals Co. | Sustained release matrix systems for highly soluble drugs |
| CN1407884B (zh) | 1999-10-29 | 2012-06-20 | 欧罗赛铁克股份有限公司 | 控释氢可酮制剂 |
| US10179130B2 (en) | 1999-10-29 | 2019-01-15 | Purdue Pharma L.P. | Controlled release hydrocodone formulations |
| WO2002036099A1 (en) | 2000-10-30 | 2002-05-10 | Euro-Celtique S.A. | Controlled release hydrocodone formulations |
| UA81224C2 (uk) * | 2001-05-02 | 2007-12-25 | Euro Celtic S A | Дозована форма оксикодону та її застосування |
| US8206741B2 (en) | 2001-06-01 | 2012-06-26 | Pozen Inc. | Pharmaceutical compositions for the coordinated delivery of NSAIDs |
| US20040029959A1 (en) * | 2002-08-08 | 2004-02-12 | John Devane | Isosorbide mononitrate compositions and methods of their use |
| US8865197B2 (en) * | 2005-09-06 | 2014-10-21 | Israel Oceanographic And Limnological Research Ltd. | Food formulation for aquatic animals with integrated targeted delivery of bioactive agents |
| BRPI0707325A2 (pt) * | 2006-01-27 | 2011-05-03 | Eurand Inc | formulação de dosagem de liberação multiparticulada e método para preparação da mesma |
| RU2490012C2 (ru) * | 2006-01-27 | 2013-08-20 | Апталис Фарматех Инк | Системы доставки лекарственного средства, содержащие слабощелочной селективный 5-ht3, серотониновый блокатор и органические кислоты |
| CN101365453A (zh) * | 2006-02-09 | 2009-02-11 | 特瓦制药工业有限公司 | 双嘧达莫缓释制剂及其制备方法 |
| EP2049087A2 (en) * | 2006-07-21 | 2009-04-22 | LAB International SRL | Hydrophilic abuse deterrent delivery system |
| EP2051696A2 (en) * | 2006-08-18 | 2009-04-29 | Morton Grove Pharmaceuticals, Inc. | Stable liquid levetiracetam compositions and methods |
| US8133506B2 (en) * | 2008-03-12 | 2012-03-13 | Aptalis Pharmatech, Inc. | Drug delivery systems comprising weakly basic drugs and organic acids |
| CN102209529A (zh) | 2008-09-09 | 2011-10-05 | 阿斯利康(瑞典)有限公司 | 将药物组合物递送至有需要的患者的方法 |
| WO2010036975A2 (en) * | 2008-09-25 | 2010-04-01 | Teva Pharmaceutical Industries Ltd. | Dipyridamole and acetylsalicylic acid formulations and process for preparing same |
| JP2012531430A (ja) * | 2009-06-25 | 2012-12-10 | ポーゼン インコーポレイテッド | アスピリン療法を必要とする患者を治療するための方法 |
| CN102481293A (zh) | 2009-06-25 | 2012-05-30 | 阿斯利康(瑞典)有限公司 | 治疗具有发展nsaid-相关的溃疡的风险的患者的方法 |
| US20110003005A1 (en) * | 2009-07-06 | 2011-01-06 | Gopi Venkatesh | Methods of Treating PDNV and PONV with Extended Release Ondansetron Compositions |
| UA115139C2 (uk) | 2011-12-28 | 2017-09-25 | Поузен Інк. | Спосіб доставки фармацевтичної композиції, яка містить омепразол й ацетилсаліцилову кислоту, пацієнту |
| CA2936746C (en) | 2014-10-31 | 2017-06-27 | Purdue Pharma | Methods and compositions particularly for treatment of attention deficit disorder |
| US10722473B2 (en) | 2018-11-19 | 2020-07-28 | Purdue Pharma L.P. | Methods and compositions particularly for treatment of attention deficit disorder |
Family Cites Families (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH283585A (de) * | 1950-03-15 | 1952-06-15 | Hoffmann La Roche | Zur Herstellung von Tablettenüberzügen geeignetes Gemisch. |
| US2953497A (en) * | 1953-06-03 | 1960-09-20 | Howard A Press | Therapeutic tablets |
| US2996431A (en) * | 1953-12-16 | 1961-08-15 | Barry Richard Henry | Friable tablet and process for manufacturing same |
| US3044938A (en) * | 1955-07-01 | 1962-07-17 | Sandoz Chemical Works Inc | Sustained action pharmaceutical tablets |
| GB785262A (en) * | 1955-09-23 | 1957-10-23 | Smith Kline & French Internat | Improvements in or relating to hypotensive and sedative preparations |
| US2809918A (en) * | 1955-10-17 | 1957-10-15 | Victor M Hermelin | Sustained release pharmaceutical preparations |
| US2809917A (en) * | 1955-10-17 | 1957-10-15 | Victor M Hermelin | Sustained release pharmaceutical tablets |
| US2853420A (en) * | 1956-01-25 | 1958-09-23 | Lowey Hans | Ethyl cellulose coatings for shaped medicinal preparations |
| US2897122A (en) * | 1956-10-04 | 1959-07-28 | Frosst & Co Charles E | Enteric coated product |
| GB831907A (en) * | 1957-09-12 | 1960-04-06 | Organon Labor Ltd | Suspensions of drugs destined for injection and process for the preparation thereof |
| US2918411A (en) * | 1957-11-01 | 1959-12-22 | Olin Mathieson | Pharmaceutical preparations |
| NL235736A (OSRAM) * | 1958-02-03 | |||
| DE1248863B (OSRAM) * | 1959-01-30 | |||
| US3096248A (en) * | 1959-04-06 | 1963-07-02 | Rexall Drug & Chemical Company | Method of making an encapsulated tablet |
| US2993837A (en) * | 1959-07-13 | 1961-07-25 | Frosst & Co Charles E | Enteric coated tablets |
| US3081233A (en) * | 1960-08-08 | 1963-03-12 | Upjohn Co | Enteric-coated pilules |
| NL122039C (OSRAM) * | 1960-10-20 | |||
| US3102845A (en) * | 1960-11-18 | 1963-09-03 | Mcneilab Inc | Pharmaceutical tablet |
| US3166476A (en) * | 1961-09-01 | 1965-01-19 | Lowey Hans | Powder based tablets |
| US3115441A (en) * | 1962-06-06 | 1963-12-24 | Victor M Hermelin | Timed release pharmaceutical preparations and method of making the same |
| FR1347413A (fr) * | 1963-01-29 | 1963-12-27 | Italnysco S P A | Sphérules ou globules à action étalée et procédé pour leur préparation |
| US3325365A (en) * | 1963-04-02 | 1967-06-13 | Ciba Geigy Corp | Enteric composition for tablet compression coating |
| NL297631A (OSRAM) * | 1963-06-03 | |||
| GB1204580A (en) * | 1968-10-05 | 1970-09-09 | Aspro Nicholas Ltd | Pharmaceutical dosage forms |
| US3538214A (en) * | 1969-04-22 | 1970-11-03 | Merck & Co Inc | Controlled release medicinal tablets |
| CH521313A (de) * | 1969-05-14 | 1972-04-15 | Hoffmann La Roche | Verfahren zur Herstellung von Phenylalaminderivaten |
| US3725470A (en) * | 1969-05-14 | 1973-04-03 | Hoffmann La Roche | Amino acid derivatives |
| US3629393A (en) * | 1969-09-11 | 1971-12-21 | Nikken Chemicals Co Ltd | Release-sustaining-tablet |
| DE2010116A1 (de) * | 1970-03-04 | 1971-09-16 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Mikrogranulaten |
| GB1359643A (en) * | 1970-09-28 | 1974-07-10 | Controlled Medications | Controlled release medicament |
| US4025613A (en) * | 1971-07-19 | 1977-05-24 | Richard G. Powers | Timed-release aspirin |
| US3828106A (en) * | 1972-01-03 | 1974-08-06 | Biolog Concepts Inc | Novel oral pharmaceutical dosage form |
| GB1443923A (en) * | 1972-05-02 | 1976-07-28 | Shepard M | Sustained release compositions |
| US3965256A (en) * | 1972-05-16 | 1976-06-22 | Synergistics | Slow release pharmaceutical compositions |
| US4016254A (en) * | 1972-05-19 | 1977-04-05 | Beecham Group Limited | Pharmaceutical formulations |
| GB1367608A (en) * | 1973-03-09 | 1974-09-18 | Biolog Concepts Inc | Oral pharmaceutical dosage form |
| US3954959A (en) * | 1973-03-28 | 1976-05-04 | A/S Alfred Benzon | Oral drug preparations |
| GB1422176A (en) * | 1973-05-05 | 1976-01-21 | Beecham Group Ltd | Pharmaceutical tablets |
| US4113816A (en) * | 1973-07-12 | 1978-09-12 | Choay S.A. | Process for the manufacture of layered tablets incorporating controlled-release microcapsules |
| US3961004A (en) * | 1974-04-11 | 1976-06-01 | Auburn Research Foundation | Method of tabletting using gluconolactone as the direct compression diluent |
| US4016744A (en) * | 1975-05-28 | 1977-04-12 | Hoffmann-La Roche Inc. | Applied instrumentation providing tabletting compression force |
| GB1551954A (en) * | 1975-05-28 | 1979-09-05 | Hoffmann La Roche | Standardization of a physiochemical parameter of a batch of formulation in tabletted form |
| FR2353285A1 (fr) * | 1975-09-17 | 1977-12-30 | Doms Laboratoires | Medicament vasodilatateur coronarien perfectionne |
| SE418247B (sv) * | 1975-11-17 | 1981-05-18 | Haessle Ab | Sett att framstella kroppar med reglerad frigoring av en aktiv komponent |
| GB1561301A (en) * | 1976-01-02 | 1980-02-20 | Beecham Group Ltd | Orally administrable pharmaceutical composition |
| US4137300A (en) * | 1976-08-20 | 1979-01-30 | Ciba-Geigy Corporation | Sustained action dosage forms |
| HU174057B (hu) * | 1976-09-17 | 1979-10-28 | Richter Gedeon Vegyeszet | Sostav dlja pokrytij obespechivajuhhij uregulirovannuju otdachy aktivnogo vehhestva biologicheski aktivnykh preparatov i sposob poluchenija takikh preparatov s uregulirovannoj otdachej aktivnogo vehhestva |
| FR2368272A1 (fr) * | 1976-10-20 | 1978-05-19 | Theramex | Compositions therapeutiques solides pour combattre l'agregation plaquettaire |
| LU77353A1 (OSRAM) * | 1977-05-16 | 1979-01-19 | ||
| CH647676A5 (fr) * | 1978-12-22 | 1985-02-15 | Donald E Panoz | Formes galeniques a usage oral, a liberation programmee et leurs procedes de preparation. |
| US4321253A (en) * | 1980-08-22 | 1982-03-23 | Beatty Morgan L | Suspension of microencapsulated bacampicillin acid addition salt for oral, especially pediatric, administration |
-
1979
- 1979-12-18 CH CH11224/79A patent/CH647676A5/fr not_active IP Right Cessation
- 1979-12-18 DE DE19792950977 patent/DE2950977A1/de active Granted
- 1979-12-18 IE IE2452/79A patent/IE48715B1/en not_active IP Right Cessation
- 1979-12-19 GB GB7943731A patent/GB2039737B/en not_active Expired
- 1979-12-20 ES ES487151A patent/ES487151A1/es not_active Expired
- 1979-12-21 AT AT0808179A patent/AT376567B/de not_active IP Right Cessation
- 1979-12-21 AR AR279420A patent/AR229346A1/es active
- 1979-12-21 IT IT28301/79A patent/IT1164548B/it active
-
1985
- 1985-07-01 US US06/750,980 patent/US4609542A/en not_active Expired - Lifetime
- 1985-07-01 US US06/750,934 patent/US4726951A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IT1164548B (it) | 1987-04-15 |
| AT376567B (de) | 1984-12-10 |
| ATA808179A (de) | 1984-05-15 |
| ES487151A1 (es) | 1980-09-16 |
| AR229346A1 (es) | 1983-07-29 |
| GB2039737A (en) | 1980-08-20 |
| DE2950977A1 (de) | 1980-07-10 |
| GB2039737B (en) | 1983-07-20 |
| CH647676A5 (fr) | 1985-02-15 |
| DE2950977C2 (OSRAM) | 1987-11-05 |
| IT7928301A0 (it) | 1979-12-21 |
| IE792452L (en) | 1980-06-22 |
| US4609542A (en) | 1986-09-02 |
| US4726951A (en) | 1988-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4609542A (en) | New pharmaceutical forms for administration of medicaments by oral route, with programmed release | |
| RU1836082C (ru) | Способ получени состава дл покрыти лекарственных средств | |
| US3538214A (en) | Controlled release medicinal tablets | |
| JP2740993B2 (ja) | 内服用新規医薬製剤 | |
| CA2299511C (en) | A pharmaceutical composition having two coating layers | |
| US4670247A (en) | Process for preparing fat-soluble vitamin active beadlets | |
| EP0285682B2 (en) | Process for the manufacture of vitamin preparations | |
| DK165670B (da) | Laegemidler indeholdende 9-desoxo-11-desoxy-9,11-(imino(2-(2-methoxyethoxy)ethyliden)oxy)-(9s)-erythromycin samt fremgangsmaade til fremstilling af saadanne laegemidler | |
| FI96095B (fi) | Menetelmä jatkuvavapautteisen lääkevalmisteen valmistamiseksi | |
| KR930008956B1 (ko) | 서방형 이부프로펜 제제의 제조방법 | |
| EP0222914A1 (en) | Stabilized composite granular antibiotic preparation | |
| EP1315481B1 (de) | Arzneimittel zur behandlung von darmerkrankungen | |
| US20050031687A1 (en) | Enteric-coated proliposomal formulations for poorly water soluble drugs | |
| DE69419281T2 (de) | Geschmacksmaskierte feste Zubereitung und Verfahren zur Herstellung | |
| EP0616802A1 (en) | Oral preparation for release in lower digestive tracts | |
| EP0425298B1 (en) | Sustained-release preparation of basic medical agent hydrochloride | |
| IE840146L (en) | Pinacidil preparation | |
| WO2008083561A1 (en) | Oral pharmaceutical composition of glycyrrhizin or its salts and the preparation method thereof | |
| CN1529587B (zh) | 含有粪便软化剂泊洛沙姆和包有肠溶衣的比沙可定颗粒的药物组合物 | |
| US4832955A (en) | Controlled release potassium chloride composition | |
| CA2193235C (en) | The preparation of fusidic acid tablets | |
| CA1334933C (en) | Pharmaceutical composition and process for its preparation | |
| JPH031288B2 (OSRAM) | ||
| JPH0147441B2 (OSRAM) | ||
| EP0381174B1 (de) | Verfahren zur Herstellung fester pharmazeutischer Zubereitungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |