IE43065B1 - Process for the preparation of esters of dihalovinyl-cyclopropanecarboxylic acids - Google Patents
Process for the preparation of esters of dihalovinyl-cyclopropanecarboxylic acidsInfo
- Publication number
- IE43065B1 IE43065B1 IE1891/75A IE189175A IE43065B1 IE 43065 B1 IE43065 B1 IE 43065B1 IE 1891/75 A IE1891/75 A IE 1891/75A IE 189175 A IE189175 A IE 189175A IE 43065 B1 IE43065 B1 IE 43065B1
- Authority
- IE
- Ireland
- Prior art keywords
- ethyl
- preparing
- compound
- dimethyl
- dimethylhexanoate
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 153
- 239000002253 acid Substances 0.000 title claims description 14
- 150000002148 esters Chemical class 0.000 title claims description 12
- 230000008569 process Effects 0.000 title abstract description 39
- 238000002360 preparation method Methods 0.000 title description 7
- 150000007513 acids Chemical class 0.000 title description 5
- 238000006243 chemical reaction Methods 0.000 claims abstract description 52
- 150000007942 carboxylates Chemical class 0.000 claims abstract description 26
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 21
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 18
- 150000002905 orthoesters Chemical class 0.000 claims abstract description 18
- 238000006704 dehydrohalogenation reaction Methods 0.000 claims abstract description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 76
- 150000001875 compounds Chemical class 0.000 claims description 74
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 62
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 52
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 50
- -1 polymethylene chain Polymers 0.000 claims description 46
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 239000002904 solvent Substances 0.000 claims description 32
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 28
- 239000007858 starting material Substances 0.000 claims description 25
- ZLDOMUPTDYCDBS-UHFFFAOYSA-N ethyl 3,3-dimethylpent-4-enoate Chemical compound CCOC(=O)CC(C)(C)C=C ZLDOMUPTDYCDBS-UHFFFAOYSA-N 0.000 claims description 23
- 239000000460 chlorine Chemical group 0.000 claims description 19
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 claims description 19
- IKYLWHDWLWHILP-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)Cl IKYLWHDWLWHILP-UHFFFAOYSA-N 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 13
- 229910052708 sodium Inorganic materials 0.000 claims description 13
- 239000011734 sodium Substances 0.000 claims description 13
- ASUAYTHWZCLXAN-UHFFFAOYSA-N prenol Chemical compound CC(C)=CCO ASUAYTHWZCLXAN-UHFFFAOYSA-N 0.000 claims description 12
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical group [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 11
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 claims description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 10
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 claims description 10
- PIUGWHOPZWEXQQ-UHFFFAOYSA-N ethyl 4,6,6-trichloro-3,3-dimethylhex-5-enoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)C=C(Cl)Cl PIUGWHOPZWEXQQ-UHFFFAOYSA-N 0.000 claims description 10
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims description 10
- YMXLOSPLQMWDAI-UHFFFAOYSA-N ethyl 6,6,6-trichloro-3,3-dimethylhex-4-enoate Chemical compound CCOC(=O)CC(C)(C)C=CC(Cl)(Cl)Cl YMXLOSPLQMWDAI-UHFFFAOYSA-N 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 229910052723 transition metal Inorganic materials 0.000 claims description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 8
- 239000003377 acid catalyst Substances 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 229910052700 potassium Inorganic materials 0.000 claims description 8
- 239000011591 potassium Substances 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- CWEYEQLAGICWNF-UHFFFAOYSA-N ethyl 4,6,6,6-tetrabromo-3,3-dimethylhexanoate Chemical compound CCOC(=O)CC(C)(C)C(Br)CC(Br)(Br)Br CWEYEQLAGICWNF-UHFFFAOYSA-N 0.000 claims description 7
- XASJSFQFRFTHAL-UHFFFAOYSA-N ethyl 4-bromo-6,6,6-trichloro-3,3-dimethylhexanoate Chemical compound CCOC(=O)CC(C)(C)C(Br)CC(Cl)(Cl)Cl XASJSFQFRFTHAL-UHFFFAOYSA-N 0.000 claims description 7
- RFLYIDKGXZKFMV-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate Chemical compound ClC(Cl)(Cl)CC(Cl)C(C)(C)CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RFLYIDKGXZKFMV-UHFFFAOYSA-N 0.000 claims description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003435 aroyl group Chemical group 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 6
- 125000001589 carboacyl group Chemical group 0.000 claims description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 6
- JUDQCEYIKMNPPP-UHFFFAOYSA-N ethyl 4,6,6-tribromo-3,3-dimethylhex-5-enoate Chemical compound CCOC(=O)CC(C)(C)C(Br)C=C(Br)Br JUDQCEYIKMNPPP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- RUYFMTUASPQEFD-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 3,3-dimethylpent-4-enoate Chemical compound C=CC(C)(C)CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RUYFMTUASPQEFD-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 150000004696 coordination complex Chemical class 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 4
- AYAONHNAKOKNNJ-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-2,3,3-trimethylhexanoate Chemical compound CCOC(=O)C(C)C(C)(C)C(Cl)CC(Cl)(Cl)Cl AYAONHNAKOKNNJ-UHFFFAOYSA-N 0.000 claims description 4
- DQXFSJSZHGLPEF-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-methylhexanoate Chemical compound CCOC(=O)CC(C)C(Cl)CC(Cl)(Cl)Cl DQXFSJSZHGLPEF-UHFFFAOYSA-N 0.000 claims description 4
- DDFJIALOXWLNSA-UHFFFAOYSA-N ethyl 4,6,6-trichloro-2,3,3-trimethylhex-5-enoate Chemical compound CCOC(=O)C(C)C(C)(C)C(Cl)C=C(Cl)Cl DDFJIALOXWLNSA-UHFFFAOYSA-N 0.000 claims description 4
- KNFSAYWTBCWRER-UHFFFAOYSA-N ethyl 4-bromo-6,6,6-trichloro-3-methylhexanoate Chemical compound CCOC(=O)CC(C)C(Br)CC(Cl)(Cl)Cl KNFSAYWTBCWRER-UHFFFAOYSA-N 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 239000003999 initiator Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- MJMLXRUWGPKFLN-UHFFFAOYSA-N benzyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate Chemical compound ClC(Cl)(Cl)CC(Cl)C(C)(C)CC(=O)OCC1=CC=CC=C1 MJMLXRUWGPKFLN-UHFFFAOYSA-N 0.000 claims description 3
- 150000001721 carbon Chemical group 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- XZJCFWCRVAGWSC-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-phenylhexanoate Chemical compound CCOC(=O)CC(C(Cl)CC(Cl)(Cl)Cl)C1=CC=CC=C1 XZJCFWCRVAGWSC-UHFFFAOYSA-N 0.000 claims description 3
- JIDJIFVBZCETIU-UHFFFAOYSA-N ethyl 4-bromo-6,6,6-trichloro-2,3,3-trimethylhexanoate Chemical compound CCOC(=O)C(C)C(C)(C)C(Br)CC(Cl)(Cl)Cl JIDJIFVBZCETIU-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 150000003624 transition metals Chemical class 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 150000004703 alkoxides Chemical class 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- BFRKWUSVYDWEBX-UHFFFAOYSA-N ethyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate Chemical compound CCOC(=O)C1C(CC(Cl)(Cl)Cl)C1(C)C BFRKWUSVYDWEBX-UHFFFAOYSA-N 0.000 claims description 2
- GJXGKWYBESOKEC-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-2,3-dimethylhexanoate Chemical compound CCOC(=O)C(C)C(C)C(Cl)CC(Cl)(Cl)Cl GJXGKWYBESOKEC-UHFFFAOYSA-N 0.000 claims description 2
- XFIUHPVIZFWOIS-UHFFFAOYSA-N ethyl 6,6,6-trichloro-2,3,3-trimethylhex-4-enoate Chemical compound CCOC(=O)C(C)C(C)(C)C=CC(Cl)(Cl)Cl XFIUHPVIZFWOIS-UHFFFAOYSA-N 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 239000011630 iodine Chemical group 0.000 claims description 2
- SUSVBMKNBCIVRI-UHFFFAOYSA-N methyl 4,6,6,6-tetrachloro-2-ethyl-3,3-dimethylhexanoate Chemical compound COC(=O)C(CC)C(C)(C)C(Cl)CC(Cl)(Cl)Cl SUSVBMKNBCIVRI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 239000003880 polar aprotic solvent Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- BRLVWWWHNQKITJ-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 4-bromo-6,6,6-trichloro-3,3-dimethylhexanoate Chemical compound ClC(Cl)(Cl)CC(Br)C(C)(C)CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 BRLVWWWHNQKITJ-UHFFFAOYSA-N 0.000 claims 2
- HWJYQRRYPISAAK-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 6,6,6-trichloro-3,3-dimethylhex-4-enoate Chemical group ClC(Cl)(Cl)C=CC(C)(C)CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 HWJYQRRYPISAAK-UHFFFAOYSA-N 0.000 claims 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 claims 1
- RXGNLXFTAIDOBZ-UHFFFAOYSA-N 3,3-dimethylhexanoic acid Chemical compound CCCC(C)(C)CC(O)=O RXGNLXFTAIDOBZ-UHFFFAOYSA-N 0.000 claims 1
- QBVACVVFGLPZCQ-UHFFFAOYSA-N 6,6,6-trichloro-3,3-dimethylhex-4-enoic acid Chemical compound OC(=O)CC(C)(C)C=CC(Cl)(Cl)Cl QBVACVVFGLPZCQ-UHFFFAOYSA-N 0.000 claims 1
- UCPFCVJPJAENSD-UHFFFAOYSA-N 6,6,6-trichloro-3,3-dimethylhexanoic acid Chemical compound CC(C)(CCC(Cl)(Cl)Cl)CC(=O)O UCPFCVJPJAENSD-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims 1
- HOADQNLSMQWCPD-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-2-methyl-3-phenylhexanoate Chemical compound CCOC(=O)C(C)C(C(Cl)CC(Cl)(Cl)Cl)C1=CC=CC=C1 HOADQNLSMQWCPD-UHFFFAOYSA-N 0.000 claims 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 claims 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 abstract description 16
- 239000002917 insecticide Substances 0.000 abstract description 12
- 125000001559 cyclopropyl group Chemical class [H]C1([H])C([H])([H])C1([H])* 0.000 abstract description 7
- 230000003389 potentiating effect Effects 0.000 abstract description 3
- 239000000203 mixture Substances 0.000 description 77
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 66
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 42
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 238000004458 analytical method Methods 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 238000007792 addition Methods 0.000 description 23
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 22
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 21
- 235000019341 magnesium sulphate Nutrition 0.000 description 21
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 21
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 16
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 16
- 239000004342 Benzoyl peroxide Substances 0.000 description 15
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 235000019400 benzoyl peroxide Nutrition 0.000 description 15
- 230000015572 biosynthetic process Effects 0.000 description 15
- 229960003328 benzoyl peroxide Drugs 0.000 description 14
- 239000003054 catalyst Substances 0.000 description 14
- 239000000543 intermediate Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000284 extract Substances 0.000 description 13
- 229920006395 saturated elastomer Polymers 0.000 description 13
- 239000002585 base Substances 0.000 description 12
- 239000002728 pyrethroid Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 10
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 10
- 239000005457 ice water Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 239000007789 gas Substances 0.000 description 9
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 8
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 8
- XNNQFQFUQLJSQT-UHFFFAOYSA-N bromo(trichloro)methane Chemical compound ClC(Cl)(Cl)Br XNNQFQFUQLJSQT-UHFFFAOYSA-N 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 229940032296 ferric chloride Drugs 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 8
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 125000003158 alcohol group Chemical group 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 6
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000011953 free-radical catalyst Substances 0.000 description 6
- ROVGZAWFACYCSP-VUMXUWRFSA-N pyrethrin I Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-VUMXUWRFSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 6
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 5
- 229940044631 ferric chloride hexahydrate Drugs 0.000 description 5
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 5
- NQXWGWZJXJUMQB-UHFFFAOYSA-K iron trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].Cl[Fe+]Cl NQXWGWZJXJUMQB-UHFFFAOYSA-K 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 230000002411 adverse Effects 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000006317 isomerization reaction Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-dimethylbenzene Natural products CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 3
- 101100347605 Arabidopsis thaliana VIII-A gene Proteins 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000007033 dehydrochlorination reaction Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229930014626 natural product Natural products 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- OOCCDEMITAIZTP-QPJJXVBHSA-N (E)-cinnamyl alcohol Chemical compound OC\C=C\C1=CC=CC=C1 OOCCDEMITAIZTP-QPJJXVBHSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N 1,3-Dimethylbenzene Natural products CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 2
- PFEFOYRSMXVNEL-UHFFFAOYSA-N 2,4,6-tritert-butylphenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 PFEFOYRSMXVNEL-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WSNMPAVSZJSIMT-UHFFFAOYSA-N COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 Chemical compound COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 WSNMPAVSZJSIMT-UHFFFAOYSA-N 0.000 description 2
- GATVIKZLVQHOMN-UHFFFAOYSA-N Chlorodibromomethane Chemical compound ClC(Br)Br GATVIKZLVQHOMN-UHFFFAOYSA-N 0.000 description 2
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 description 2
- LTNDZDRYUXNFCU-NEWSRXKRSA-N Cinerin II Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]2[C@@H](C=C(C)OC(=O)C)C2(C)C LTNDZDRYUXNFCU-NEWSRXKRSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 238000003747 Grignard reaction Methods 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000250966 Tanacetum cinerariifolium Species 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000006065 biodegradation reaction Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 2
- SHCRDCOTRILILT-WOBDGSLYSA-N cinerin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C)C(=O)C1 SHCRDCOTRILILT-WOBDGSLYSA-N 0.000 description 2
- ONCCWDRMOZMNSM-FBCQKBJTSA-N compound Z Chemical compound N1=C2C(=O)NC(N)=NC2=NC=C1C(=O)[C@H]1OP(O)(=O)OC[C@H]1O ONCCWDRMOZMNSM-FBCQKBJTSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 229940045803 cuprous chloride Drugs 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 238000007269 dehydrobromination reaction Methods 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- VIMXTGUGWLAOFZ-UHFFFAOYSA-N ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical group CCOC(=O)C1C(C=C(C)C)C1(C)C VIMXTGUGWLAOFZ-UHFFFAOYSA-N 0.000 description 2
- JMPOBIJJBNUTAV-UHFFFAOYSA-N ethyl 2,3,3-trimethylpent-4-enoate Chemical compound CCOC(=O)C(C)C(C)(C)C=C JMPOBIJJBNUTAV-UHFFFAOYSA-N 0.000 description 2
- AUAKFHKYJDJBKI-UHFFFAOYSA-N ethyl 3-methylpent-4-enoate Chemical compound CCOC(=O)CC(C)C=C AUAKFHKYJDJBKI-UHFFFAOYSA-N 0.000 description 2
- 229960002089 ferrous chloride Drugs 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- WKNSDDMJXANVMK-UHFFFAOYSA-N jasmolin II Natural products C1C(=O)C(CC=CCC)=C(C)C1OC(=O)C1C(C)(C)C1C=C(C)C(=O)OC WKNSDDMJXANVMK-UHFFFAOYSA-N 0.000 description 2
- WKNSDDMJXANVMK-XIGJTORUSA-N jasmolin II Chemical compound C1C(=O)C(C\C=C/CC)=C(C)[C@H]1OC(=O)[C@H]1C(C)(C)[C@@H]1\C=C(/C)C(=O)OC WKNSDDMJXANVMK-XIGJTORUSA-N 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- LHTVMBMETNGEAN-UHFFFAOYSA-N pent-1-en-1-ol Chemical class CCCC=CO LHTVMBMETNGEAN-UHFFFAOYSA-N 0.000 description 2
- 229960005235 piperonyl butoxide Drugs 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 2
- QYAPHLRPFNSDNH-MRFRVZCGSA-N (4s,4as,5as,6s,12ar)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O QYAPHLRPFNSDNH-MRFRVZCGSA-N 0.000 description 1
- FGWYWKIOMUZSQF-UHFFFAOYSA-N 1,1,1-triethoxypropane Chemical compound CCOC(CC)(OCC)OCC FGWYWKIOMUZSQF-UHFFFAOYSA-N 0.000 description 1
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- VEKLTXYACZJTCK-UHFFFAOYSA-N 1-cyclopentyl-3-methylbut-2-en-1-ol Chemical compound CC(C)=CC(O)C1CCCC1 VEKLTXYACZJTCK-UHFFFAOYSA-N 0.000 description 1
- CRPVVWTWIYWQKS-UHFFFAOYSA-N 1-o-ethyl 3-o-methyl 2-(2,4,4,4-tetrachlorobutyl)propanedioate Chemical compound CCOC(=O)C(C(=O)OC)CC(Cl)CC(Cl)(Cl)Cl CRPVVWTWIYWQKS-UHFFFAOYSA-N 0.000 description 1
- FMTFEIJHMMQUJI-NJAFHUGGSA-N 102130-98-3 Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]1[C@@H](C=C(C)C)C1(C)C FMTFEIJHMMQUJI-NJAFHUGGSA-N 0.000 description 1
- ZQDDFKMLOJICSL-UHFFFAOYSA-N 2,2-dichloroethenyl cyclopropanecarboxylate Chemical compound ClC(Cl)=COC(=O)C1CC1 ZQDDFKMLOJICSL-UHFFFAOYSA-N 0.000 description 1
- PCFLZEMUEOSJPS-UHFFFAOYSA-N 2,4-dimethylpent-3-en-2-ol Chemical compound CC(C)=CC(C)(C)O PCFLZEMUEOSJPS-UHFFFAOYSA-N 0.000 description 1
- DZPCYXCBXGQBRN-UHFFFAOYSA-N 2,5-Dimethyl-2,4-hexadiene Chemical compound CC(C)=CC=C(C)C DZPCYXCBXGQBRN-UHFFFAOYSA-N 0.000 description 1
- WCASXYBKJHWFMY-NSCUHMNNSA-N 2-Buten-1-ol Chemical compound C\C=C\CO WCASXYBKJHWFMY-NSCUHMNNSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- IQKNRIBGGLJNJN-UHFFFAOYSA-N 2-methylhept-2-en-4-ol Chemical compound CCCC(O)C=C(C)C IQKNRIBGGLJNJN-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- SMNGQGWPUVVORF-UHFFFAOYSA-N 3,5-ditert-butyl-4-methylphenol Chemical compound CC1=C(C(C)(C)C)C=C(O)C=C1C(C)(C)C SMNGQGWPUVVORF-UHFFFAOYSA-N 0.000 description 1
- ZYZKNKOQNHVSSD-UHFFFAOYSA-N 4-bromo-6,6,6-trichloro-3,3-dimethylhexanoic acid Chemical compound OC(=O)CC(C)(C)C(Br)CC(Cl)(Cl)Cl ZYZKNKOQNHVSSD-UHFFFAOYSA-N 0.000 description 1
- XLWZVNCHAJDCOS-UHFFFAOYSA-N 4-methyl-1-phenylpent-3-en-2-ol Chemical compound CC(C)=CC(O)CC1=CC=CC=C1 XLWZVNCHAJDCOS-UHFFFAOYSA-N 0.000 description 1
- SAOXPNBHKSWHGW-UHFFFAOYSA-N 4-methylpent-3-en-2-ol Chemical compound CC(O)C=C(C)C SAOXPNBHKSWHGW-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- IEBXZRQOXHLIGF-UHFFFAOYSA-N 5,5-dimethyl-4-(2-methylprop-1-enyl)oxolan-2-one Chemical compound CC(C)=CC1CC(=O)OC1(C)C IEBXZRQOXHLIGF-UHFFFAOYSA-N 0.000 description 1
- GGBXJDKSEHTBLW-UHFFFAOYSA-N 5-methylhex-4-en-2-one Chemical compound CC(C)=CCC(C)=O GGBXJDKSEHTBLW-UHFFFAOYSA-N 0.000 description 1
- SMKXEJCDVREDQY-UHFFFAOYSA-N 5-methylhex-4-en-3-ol Chemical compound CCC(O)C=C(C)C SMKXEJCDVREDQY-UHFFFAOYSA-N 0.000 description 1
- HCCNBKFJYUWLEX-UHFFFAOYSA-N 7-(6-methoxypyridin-3-yl)-1-(2-propoxyethyl)-3-(pyrazin-2-ylmethylamino)pyrido[3,4-b]pyrazin-2-one Chemical compound O=C1N(CCOCCC)C2=CC(C=3C=NC(OC)=CC=3)=NC=C2N=C1NCC1=CN=CC=N1 HCCNBKFJYUWLEX-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- FMTFEIJHMMQUJI-UHFFFAOYSA-N Cinerin I Natural products C1C(=O)C(CC=CC)=C(C)C1OC(=O)C1C(C)(C)C1C=C(C)C FMTFEIJHMMQUJI-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- 229930182984 Jasmolin Natural products 0.000 description 1
- NZKIRHFOLVYKFT-UHFFFAOYSA-N Jasmolin I Natural products C1C(=O)C(CC=CCC)=C(C)C1OC(=O)C1C(C)(C)C1C=C(C)C NZKIRHFOLVYKFT-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- 235000017372 Piretro di Dalmazia Nutrition 0.000 description 1
- VMORCWYWLVLMDG-YZGWKJHDSA-N Pyrethrin-II Natural products CC(=O)OC(=C[C@@H]1[C@H](C(=O)O[C@H]2CC(=O)C(=C2C)CC=CC=C)C1(C)C)C VMORCWYWLVLMDG-YZGWKJHDSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 238000007032 Staudinger Ketene cycloaddition reaction Methods 0.000 description 1
- ROVGZAWFACYCSP-MQBLHHJJSA-N [2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-MQBLHHJJSA-N 0.000 description 1
- IUHFWCGCSVTMPG-UHFFFAOYSA-N [C].[C] Chemical class [C].[C] IUHFWCGCSVTMPG-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- OOCCDEMITAIZTP-UHFFFAOYSA-N allylic benzylic alcohol Natural products OCC=CC1=CC=CC=C1 OOCCDEMITAIZTP-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- MEXUFEQDCXZEON-UHFFFAOYSA-N bromochlorodifluoromethane Chemical compound FC(F)(Cl)Br MEXUFEQDCXZEON-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229940068911 chloride hexahydrate Drugs 0.000 description 1
- 229930193529 cinerin Natural products 0.000 description 1
- FMTFEIJHMMQUJI-DFKXKMKHSA-N cinerin I Chemical compound C1C(=O)C(C\C=C/C)=C(C)[C@H]1OC(=O)[C@H]1C(C)(C)[C@@H]1C=C(C)C FMTFEIJHMMQUJI-DFKXKMKHSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229940126545 compound 53 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- XXZXGDFLKRDJFP-UHFFFAOYSA-N copper;cyano thiocyanate Chemical compound [Cu].N#CSC#N XXZXGDFLKRDJFP-UHFFFAOYSA-N 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 229950011148 cyclopropane Drugs 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 150000001942 cyclopropanes Chemical class 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HLHKUPHDJBANAX-UHFFFAOYSA-N diethyl 2-(1,3,3,3-tetrachloropropyl)butanedioate Chemical compound CCOC(=O)CC(C(Cl)CC(Cl)(Cl)Cl)C(=O)OCC HLHKUPHDJBANAX-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- USPVNSDVCUTNJN-UHFFFAOYSA-N ethenyl cyclopropanecarboxylate Chemical class C=COC(=O)C1CC1 USPVNSDVCUTNJN-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- LUYBVZXZTKSVAW-UHFFFAOYSA-N ethyl 2-[1-(1,3,3,3-tetrachloropropyl)cyclohexyl]acetate Chemical compound CCOC(=O)CC1(C(Cl)CC(Cl)(Cl)Cl)CCCCC1 LUYBVZXZTKSVAW-UHFFFAOYSA-N 0.000 description 1
- FIPTXPFAVMAGMA-UHFFFAOYSA-N ethyl 2-acetyl-4,6,6,6-tetrachloro-3,3-dimethylhexanoate Chemical compound CCOC(=O)C(C(C)=O)C(C)(C)C(Cl)CC(Cl)(Cl)Cl FIPTXPFAVMAGMA-UHFFFAOYSA-N 0.000 description 1
- NGKHKAKWDOBGFK-UHFFFAOYSA-N ethyl 2-benzoyl-4-bromo-6,6,6-trichlorohexanoate Chemical compound C(C1=CC=CC=C1)(=O)C(C(=O)OCC)CC(CC(Cl)(Cl)Cl)Br NGKHKAKWDOBGFK-UHFFFAOYSA-N 0.000 description 1
- RSJXAFREAHAUFM-UHFFFAOYSA-N ethyl 2-benzyl-3-(2-bromoethyl)-4,6,6,6-tetrachlorohexanoate Chemical compound ClC(Cl)(Cl)CC(Cl)C(CCBr)C(C(=O)OCC)CC1=CC=CC=C1 RSJXAFREAHAUFM-UHFFFAOYSA-N 0.000 description 1
- NZJNDBLDSYLYLM-UHFFFAOYSA-N ethyl 2-butanoyl-4,6,6,6-tetrachloro-3,3-dimethylhexanoate Chemical compound CCCC(=O)C(C(=O)OCC)C(C)(C)C(Cl)CC(Cl)(Cl)Cl NZJNDBLDSYLYLM-UHFFFAOYSA-N 0.000 description 1
- HWWZAPZBQITLIC-UHFFFAOYSA-N ethyl 3-acetyl-4,6,6,6-tetrachlorohexanoate Chemical compound CCOC(=O)CC(C(C)=O)C(Cl)CC(Cl)(Cl)Cl HWWZAPZBQITLIC-UHFFFAOYSA-N 0.000 description 1
- KHNCHSYHHNUEOR-UHFFFAOYSA-N ethyl 3-tert-butyl-4,6,6,6-tetrachloro-3-propylhexanoate Chemical compound ClC(Cl)(Cl)CC(Cl)C(C(C)(C)C)(CCC)CC(=O)OCC KHNCHSYHHNUEOR-UHFFFAOYSA-N 0.000 description 1
- SEEXNCXSBYMJEH-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3,3-diphenylhexanoate Chemical compound C=1C=CC=CC=1C(C(Cl)CC(Cl)(Cl)Cl)(CC(=O)OCC)C1=CC=CC=C1 SEEXNCXSBYMJEH-UHFFFAOYSA-N 0.000 description 1
- UHKBOEHATRJBOK-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-(chloromethyl)hexanoate Chemical compound CCOC(=O)CC(CCl)C(Cl)CC(Cl)(Cl)Cl UHKBOEHATRJBOK-UHFFFAOYSA-N 0.000 description 1
- IOZLACDXFFAIPQ-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-cyanohexanoate Chemical compound CCOC(=O)CC(C#N)C(Cl)CC(Cl)(Cl)Cl IOZLACDXFFAIPQ-UHFFFAOYSA-N 0.000 description 1
- HZZVHPDMTVZFNU-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-cyclobutylhexanoate Chemical compound CCOC(=O)CC(C(Cl)CC(Cl)(Cl)Cl)C1CCC1 HZZVHPDMTVZFNU-UHFFFAOYSA-N 0.000 description 1
- MZLXYHZVCCPQGM-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-ethyl-3-methylhexanoate Chemical compound CCOC(=O)CC(C)(CC)C(Cl)CC(Cl)(Cl)Cl MZLXYHZVCCPQGM-UHFFFAOYSA-N 0.000 description 1
- ZZTOYLBZPKGVGW-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-ethyl-3-propan-2-ylhexanoate Chemical compound CCOC(=O)CC(CC)(C(C)C)C(Cl)CC(Cl)(Cl)Cl ZZTOYLBZPKGVGW-UHFFFAOYSA-N 0.000 description 1
- HGBKSXQEXIUOAR-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachlorohexanoate Chemical compound CCOC(=O)CCC(Cl)CC(Cl)(Cl)Cl HGBKSXQEXIUOAR-UHFFFAOYSA-N 0.000 description 1
- WAACQJRYBJRIQM-UHFFFAOYSA-N ethyl 4,6-dichloro-6,6-difluorohexanoate Chemical compound CCOC(=O)CCC(Cl)CC(F)(F)Cl WAACQJRYBJRIQM-UHFFFAOYSA-N 0.000 description 1
- MIMSSQVLQSQHIH-UHFFFAOYSA-N ethyl 6,6,6-trichloro-3-methylhex-4-enoate Chemical compound CCOC(=O)CC(C)C=CC(Cl)(Cl)Cl MIMSSQVLQSQHIH-UHFFFAOYSA-N 0.000 description 1
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- WCASXYBKJHWFMY-UHFFFAOYSA-N gamma-methylallyl alcohol Natural products CC=CCO WCASXYBKJHWFMY-UHFFFAOYSA-N 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- VOAPTKOANCCNFV-UHFFFAOYSA-N hexahydrate;hydrochloride Chemical compound O.O.O.O.O.O.Cl VOAPTKOANCCNFV-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 229910000358 iron sulfate Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- PVFSDGKDKFSOTB-UHFFFAOYSA-K iron(3+);triacetate Chemical compound [Fe+3].CC([O-])=O.CC([O-])=O.CC([O-])=O PVFSDGKDKFSOTB-UHFFFAOYSA-K 0.000 description 1
- NPFOYSMITVOQOS-UHFFFAOYSA-K iron(III) citrate Chemical compound [Fe+3].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NPFOYSMITVOQOS-UHFFFAOYSA-K 0.000 description 1
- LZKLAOYSENRNKR-LNTINUHCSA-N iron;(z)-4-oxoniumylidenepent-2-en-2-olate Chemical compound [Fe].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O LZKLAOYSENRNKR-LNTINUHCSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NZKIRHFOLVYKFT-VUMXUWRFSA-N jasmolin I Chemical compound C1C(=O)C(C\C=C/CC)=C(C)[C@H]1OC(=O)[C@H]1C(C)(C)[C@@H]1C=C(C)C NZKIRHFOLVYKFT-VUMXUWRFSA-N 0.000 description 1
- 150000002560 ketene acetals Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- DQKFQTFTMFNJDB-UHFFFAOYSA-N methyl 3-benzyl-4,6,6,6-tetrachlorohexanoate Chemical compound COC(=O)CC(C(Cl)CC(Cl)(Cl)Cl)CC1=CC=CC=C1 DQKFQTFTMFNJDB-UHFFFAOYSA-N 0.000 description 1
- DKMASOJRDOIYBT-UHFFFAOYSA-N methyl 4-bromo-6,6,6-trichloro-2,2,3,3-tetramethylhexanoate Chemical compound COC(=O)C(C)(C)C(C)(C)C(Br)CC(Cl)(Cl)Cl DKMASOJRDOIYBT-UHFFFAOYSA-N 0.000 description 1
- PAFZHJWYHPGMGD-UHFFFAOYSA-N methyl 4-bromo-6,6,6-trichloro-2,3,3-trimethyl-2-propan-2-ylhexanoate Chemical compound COC(=O)C(C)(C(C)C)C(C)(C)C(Br)CC(Cl)(Cl)Cl PAFZHJWYHPGMGD-UHFFFAOYSA-N 0.000 description 1
- JNTGYTPFSRNYQS-UHFFFAOYSA-N methyl 6,6,6-trichloro-2-cyclohexyl-4-iodohexanoate Chemical compound ClC(Cl)(Cl)CC(I)CC(C(=O)OC)C1CCCCC1 JNTGYTPFSRNYQS-UHFFFAOYSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- URXNVXOMQQCBHS-UHFFFAOYSA-N naphthalene;sodium Chemical compound [Na].C1=CC=CC2=CC=CC=C21 URXNVXOMQQCBHS-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 238000005949 ozonolysis reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- CBPYOHALYYGNOE-UHFFFAOYSA-M potassium;3,5-dinitrobenzoate Chemical compound [K+].[O-]C(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 CBPYOHALYYGNOE-UHFFFAOYSA-M 0.000 description 1
- ZXLWYPJERUAXBX-UHFFFAOYSA-N propan-2-yl 3-benzoyl-4,6,6,6-tetrabromohexanoate Chemical compound C(C1=CC=CC=C1)(=O)C(CC(=O)OC(C)C)C(CC(Br)(Br)Br)Br ZXLWYPJERUAXBX-UHFFFAOYSA-N 0.000 description 1
- CXTPYAYPSWLOGP-UHFFFAOYSA-N propan-2-yl 6,6,6-trichloro-4-iodo-2-phenylhexanoate Chemical compound ClC(Cl)(Cl)CC(I)CC(C(=O)OC(C)C)C1=CC=CC=C1 CXTPYAYPSWLOGP-UHFFFAOYSA-N 0.000 description 1
- ZHCQJEGVHOVGDY-UHFFFAOYSA-N propan-2-yl 6,6-dichloro-6-fluoro-4-iodo-3-methyl-2,2-diphenylhexanoate Chemical compound C=1C=CC=CC=1C(C(C)C(I)CC(F)(Cl)Cl)(C(=O)OC(C)C)C1=CC=CC=C1 ZHCQJEGVHOVGDY-UHFFFAOYSA-N 0.000 description 1
- FKRCODPIKNYEAC-UHFFFAOYSA-N propionic acid ethyl ester Natural products CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 1
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 1
- 229940015367 pyrethrum Drugs 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- SFLKZLQXODICBP-UHFFFAOYSA-N trichloro(iodo)methane Chemical compound ClC(Cl)(Cl)I SFLKZLQXODICBP-UHFFFAOYSA-N 0.000 description 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/32—Compounds having groups or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/03—Preparation of carboxylic acid esters by reacting an ester group with a hydroxy group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/27—Preparation of carboxylic acid esters from ortho-esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/317—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by splitting-off hydrogen or functional groups; by hydrogenolysis of functional groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/333—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton
- C07C67/343—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (18)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10352074A JPS5545062B2 (OSRAM) | 1974-09-10 | 1974-09-10 | |
| JP10352174A JPS5141316A (en) | 1974-09-10 | 1974-09-10 | Ganmaa harokarubonsanesuterunoseizohoho |
| JP10997574A JPS5545063B2 (OSRAM) | 1974-09-26 | 1974-09-26 | |
| JP10997674A JPS5139624A (en) | 1974-09-26 | 1974-09-26 | Ganmaa fuhowa epushiron harokarubonsanesuteru no seizoho |
| JP13663174A JPS5165734A (ja) | 1974-11-30 | 1974-11-30 | Shikuropuropankarubonsanesuteruo seizosuru hoho |
| JP13663274A JPS5165710A (en) | 1974-11-30 | 1974-11-30 | Ganma fuhowakarubonsanesuteruno seizohoho |
| JP13702674A JPS5165735A (ja) | 1974-12-02 | 1974-12-02 | Shikuropuropankarubonsanesuteruo seizosuru hoho |
| JP13775274A JPS5165714A (en) | 1974-12-03 | 1974-12-03 | Ganma fuhowa ipushiron harokarubonsanesuteruo seizosuru hoho |
| JP50006429A JPS5182216A (en) | 1975-01-16 | 1975-01-16 | Ganma harokarubonsanesuteruno seizoho |
| JP50008673A JPS5817735B2 (ja) | 1975-01-22 | 1975-01-22 | ガンマ − フホウワカルボンサンエステルノセイホウ |
| JP1238975A JPS5821901B2 (ja) | 1975-01-31 | 1975-01-31 | 2−(2,2−ジクロルビニル)−3,3−ジメチルシクロプロパンカルボン酸エステルの製造方法 |
| JP50019918A JPS5198213A (en) | 1975-02-19 | 1975-02-19 | arufua chikan ganma harokarubonsanesuteruno seizohoho |
| JP1991775A JPS5821902B2 (ja) | 1975-02-19 | 1975-02-19 | アルフア− チカンシクロプロパンカルボンサンエステルノ セイゾウホウホウ |
| JP50021857A JPS5198248A (OSRAM) | 1975-02-24 | 1975-02-24 | |
| JP50028607A JPS5822463B2 (ja) | 1975-03-11 | 1975-03-11 | チカンビニルキオユウスル シクロプロパンカルボンサンユウドウタイノセイホウ |
| JP50028606A JPS5817451B2 (ja) | 1975-03-11 | 1975-03-11 | γ↓−クロル↓−δ↓−不飽和カルボン酸エステルの製法 |
| JP50066592A JPS5819661B2 (ja) | 1975-06-04 | 1975-06-04 | ガンマ− − ハロ−カルボンサンエステルノ セイゾウホウホウ |
| JP6659375A JPS5828263B2 (ja) | 1975-06-04 | 1975-06-04 | 3 3− ジメチル −2−(2 2− ジハロビニル ) シクロプロパンカルボンサンエステルノ セイゾウホウホウ |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43065L IE43065L (en) | 1976-03-10 |
| IE43065B1 true IE43065B1 (en) | 1980-12-17 |
Family
ID=27586099
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1891/75A IE43065B1 (en) | 1974-09-10 | 1975-08-28 | Process for the preparation of esters of dihalovinyl-cyclopropanecarboxylic acids |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4833266A (OSRAM) |
| BE (1) | BE833278A (OSRAM) |
| CA (1) | CA1212685A (OSRAM) |
| CH (1) | CH630891A5 (OSRAM) |
| DD (5) | DD122678A5 (OSRAM) |
| DE (1) | DE2539895C2 (OSRAM) |
| DK (1) | DK158614C (OSRAM) |
| FR (3) | FR2318143A1 (OSRAM) |
| IE (1) | IE43065B1 (OSRAM) |
| IN (1) | IN142702B (OSRAM) |
| NL (1) | NL185513C (OSRAM) |
| NO (1) | NO147792C (OSRAM) |
| NZ (1) | NZ178641A (OSRAM) |
| SE (1) | SE435618B (OSRAM) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN142702B (OSRAM) * | 1974-09-10 | 1977-08-20 | Sagami Chem Res | |
| DE2544150A1 (de) * | 1974-10-03 | 1976-04-15 | Kuraray Co | Verfahren zur herstellung von substituierten cyclopropancarbonsaeuren und ihren estern |
| MX3200E (es) * | 1975-04-07 | 1980-07-03 | Ciba Geigy Ag | Procedimiento para la preparacion de esteres de acido ciclo propan carboxilico |
| US4198347A (en) | 1975-05-16 | 1980-04-15 | Imperial Chemical Industries Limited | 2(2,2-Dichlorovinyl)-3,3-dimethyl-cyclopropane carboxylates |
| US4195033A (en) | 1975-05-16 | 1980-03-25 | Imperial Chemical Industries Limited | 1-Acetyl or 1-cyano-2(2,2-dichlorovinyl)-3,3-dimethyl cyclopropane |
| AU511383B2 (en) | 1975-05-16 | 1980-08-14 | Imperial Chemical Industries Ltd | Intermediates inthe preparation of cyclopropanoid insecticides |
| GB1561502A (en) * | 1975-07-22 | 1980-02-20 | Kuraray Co | Y-lactone derivatives |
| JPS5912103B2 (ja) * | 1975-12-26 | 1984-03-21 | ザイダンホウジン サガミチユウオウカガクケンキユウシヨ | カルボンサンエステルノセイゾウホウホウ |
| DE2606635A1 (de) * | 1976-02-19 | 1977-08-25 | Bayer Ag | Verfahren zur herstellung von 2,2-dimethyl-3-(2',2'-dichlorvinyl) -cyclopropan-1-carbonsaeure |
| GB1503857A (en) * | 1976-05-25 | 1978-03-15 | Cheminova As | Production of chrysanthemic acid esters and homologues thereof |
| GB1580204A (en) * | 1976-07-07 | 1980-11-26 | Shell Int Research | 2-cyanohexanoic acid derivatives |
| DE2638356A1 (de) * | 1976-08-26 | 1978-03-02 | Bayer Ag | Verfahren zur herstellung vinylsubstituierter cyclopropancarbonsaeureester |
| DE2730515A1 (de) * | 1977-07-06 | 1979-01-18 | Bayer Ag | Substituierte phenoxybenzyloxycarbonylderivate, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
| US4166064A (en) * | 1978-02-13 | 1979-08-28 | Fmc Corporation | Process for preparing high cis 3-(2,2,2-trichloroethyl)-2,2-dimethylcyclopropane-1-carboxylates |
| AU526817B2 (en) * | 1978-06-21 | 1983-02-03 | Ici Australia Limited | Pesticides |
| US4532258A (en) * | 1978-07-11 | 1985-07-30 | Kuraray Co., Ltd. | Certain cyclopropane carboxylic acid esters and their pesticidal use |
| US4390547A (en) * | 1978-07-11 | 1983-06-28 | Kuraray Co., Ltd. | 2,2-Dimethyl-3-(substituted ethyl)cyclopropane carboxylate pesticidal compositions and methods |
| US4299839A (en) | 1978-07-11 | 1981-11-10 | Kuraray Co., Ltd. | Novel pesticides and pesticidal compositions cyclopropanecarboxylates and pesticidal method |
| DE2916401A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 3-(2-arylvinyl)-2,2-dimethyl-cyclopropan-1-carbon- saeureestern und neue zwischenprodukte dafuer |
| DE2916321A1 (de) | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von styryl- cyclopropan-carbonsaeureestern und neue zwischenprodukte dafuer |
| DE2916375A1 (de) | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von styryl-cyclopropan-carbonsaeureestern und neue zwischenprodukte dafuer |
| DE2916417A1 (de) | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 3-(aryl- vinyl)-2,2-dimethyl-cyclopropan-1-carbonsaeureestern und neue zwischenprodukte dafuer |
| EP0343812B1 (en) * | 1988-05-26 | 1993-01-07 | Sumitomo Chemical Company, Limited | Process for preparing trans-2,2-dimethyl-3-(2,2-dihalovinyl)-cyclopropane carboxylic acid esters |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2561516A (en) * | 1948-02-20 | 1951-07-24 | Us Rubber Co | Trichloromethylalkenes |
| US2554533A (en) * | 1949-02-08 | 1951-05-29 | Us Rubber Co | Bromo-trichloro butenyl acetate |
| FR1356949A (fr) * | 1962-12-13 | 1964-04-03 | Rhone Poulenc Sa | Procédé de préparation de dérivés de l'acide cyclopropanecarboxylique |
| US3652652A (en) * | 1962-12-21 | 1972-03-28 | Rhone Poulenc Sa | 3-methallyllevulinates and preparation thereof |
| US3471579A (en) * | 1967-01-20 | 1969-10-07 | Phillips Petroleum Co | Addition of polyhalogenated compounds to olefinic compounds |
| US3862978A (en) * | 1967-08-24 | 1975-01-28 | Dow Chemical Co | Catalytic synthesis of organic halogen compounds from an ethylenically unsaturated compound and a halogenated organic compound |
| US3666789A (en) * | 1969-05-21 | 1972-05-30 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters |
| BE818811R (en) * | 1973-08-15 | 1974-12-02 | Insecticidal stereoisomeric esters - of 2,2-dimethyl-3-(2,2-di-halovinyl) cyclopropane carboxylic acid which are very toxic to houseflies | |
| US3907718A (en) * | 1974-07-22 | 1975-09-23 | Int Flavors & Fragrances Inc | 2-Methyl-4-pentenoic acid ester fragrance |
| JPS5198248A (OSRAM) * | 1975-02-24 | 1976-08-30 | ||
| IN142702B (OSRAM) * | 1974-09-10 | 1977-08-20 | Sagami Chem Res |
-
1975
- 1975-08-20 IN IN1621/CAL/75A patent/IN142702B/en unknown
- 1975-08-28 IE IE1891/75A patent/IE43065B1/en unknown
- 1975-08-29 CA CA000234464A patent/CA1212685A/en not_active Expired
- 1975-09-05 NL NLAANVRAGE7510479,A patent/NL185513C/xx not_active IP Right Cessation
- 1975-09-08 DE DE2539895A patent/DE2539895C2/de not_active Expired
- 1975-09-08 CH CH1161375A patent/CH630891A5/de not_active IP Right Cessation
- 1975-09-09 FR FR7527596A patent/FR2318143A1/fr active Granted
- 1975-09-09 NO NO75753085A patent/NO147792C/no unknown
- 1975-09-09 SE SE7510042A patent/SE435618B/xx not_active IP Right Cessation
- 1975-09-09 DK DK402075A patent/DK158614C/da not_active IP Right Cessation
- 1975-09-09 NZ NZ178641A patent/NZ178641A/xx unknown
- 1975-09-10 DD DD188270A patent/DD122678A5/xx unknown
- 1975-09-10 DD DD7500196142A patent/DD128297A5/xx unknown
- 1975-09-10 BE BE159921A patent/BE833278A/xx not_active IP Right Cessation
- 1975-09-10 DD DD7500196141A patent/DD128351A5/xx unknown
- 1975-09-10 DD DD7500196143A patent/DD128298A5/xx unknown
- 1975-09-10 DD DD7500196145A patent/DD128352A5/xx unknown
-
1976
- 1976-07-13 FR FR7621448A patent/FR2333774A1/fr active Granted
- 1976-07-13 FR FR7621447A patent/FR2318144A1/fr active Granted
-
1983
- 1983-06-27 US US06/507,998 patent/US4833266A/en not_active Expired - Lifetime
-
1989
- 1989-04-26 US US07/343,318 patent/US4999451A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2539895C2 (de) | 1983-10-20 |
| NL7510479A (nl) | 1976-03-12 |
| NO753085L (OSRAM) | 1976-03-11 |
| NL185513C (nl) | 1990-05-01 |
| CH630891A5 (de) | 1982-07-15 |
| DD128351A5 (de) | 1977-11-16 |
| SE435618B (sv) | 1984-10-08 |
| FR2318144A1 (fr) | 1977-02-11 |
| FR2333774A1 (fr) | 1977-07-01 |
| DD128297A5 (de) | 1977-11-09 |
| NO147792B (no) | 1983-03-07 |
| DK158614C (da) | 1990-11-19 |
| FR2333774B1 (OSRAM) | 1981-08-21 |
| US4833266A (en) | 1989-05-23 |
| DE2539895A1 (de) | 1976-03-18 |
| NO147792C (no) | 1983-06-15 |
| CA1212685A (en) | 1986-10-14 |
| NZ178641A (en) | 1978-04-03 |
| FR2318144B1 (OSRAM) | 1979-04-06 |
| IN142702B (OSRAM) | 1977-08-20 |
| NL185513B (nl) | 1989-12-01 |
| SE7510042L (sv) | 1976-05-07 |
| DD128298A5 (de) | 1977-11-09 |
| DD128352A5 (de) | 1977-11-16 |
| DK402075A (da) | 1976-03-11 |
| BE833278A (fr) | 1976-03-10 |
| IE43065L (en) | 1976-03-10 |
| US4999451A (en) | 1991-03-12 |
| FR2318143B1 (OSRAM) | 1980-02-22 |
| FR2318143A1 (fr) | 1977-02-11 |
| AU8425675A (en) | 1977-03-03 |
| DK158614B (da) | 1990-06-18 |
| DD122678A5 (OSRAM) | 1976-10-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE43065B1 (en) | Process for the preparation of esters of dihalovinyl-cyclopropanecarboxylic acids | |
| CS207554B2 (en) | Insecticide and/or acaricide means | |
| US4113968A (en) | Process for preparation of substituted cyclopropane carboxylic acids and esters thereof and intermediates of said acids and esters | |
| US4214097A (en) | Process for preparing dihalovinylcyclopropanecarboxylates | |
| SU1075972A3 (ru) | Способ получени производных @ -дигалоидвинилциклопропана | |
| US4454343A (en) | Intermediates in a process for preparing dihalovinylcyclopropanecarboxylates | |
| Miyano et al. | Carbon-carbon bond formation by the use of chloroiodomethane as a C1 unit. II. The preparation and synthetic application of 1-chloro-3-iodoheptane. | |
| US4681953A (en) | Process for preparing dihalovinylcyclopropanecarboxylates | |
| CA1210776A (en) | Process for the preparation of esters of dihalovinylcyclopropanecarboxylic acids | |
| US4237058A (en) | Bicyclic lactone derivatives | |
| GB2026483A (en) | Cyclopropane derivatives | |
| JPS5922694B2 (ja) | ジハロビニルシクロプロパンカルボン酸エステルの製造方法 | |
| EP0085095A4 (en) | INTERMEDIATE PRODUCTS AND PROCESS FOR SYNTHETIC INSECTICIDE PYRETHROIDS. | |
| DE2560240C2 (de) | Hexansäure-, Hexensäure- und Cyclopropancarbonsäureester | |
| US3462482A (en) | Fluoroperhaloisopropyl benzene carboxylic acids | |
| JPS6020372B2 (ja) | 置換シクロプロパンカルボン酸エステルの製造方法 | |
| US4255351A (en) | Sulfonic acid esters of 2,2,2-trichloroethylhydroxycyclobutanones | |
| US4281203A (en) | (Cyclopropyl)vinyl alkyl ether derivatives | |
| CS212300B2 (cs) | Způsob přípravy esterů dihalogenvinyfcyklopropankarboxylové kyseliny | |
| CA2162895C (en) | Preparation of cyclopropane esters | |
| EP0473110A1 (en) | Method for preparing isoprenoid cyclopropane 1,1-dicarboxylates and derivatives thereof and novel intermediates | |
| GB2065118A (en) | 2-(2',2'-dichloro-3',3',3'-trifluoropropyl)- and 2-(2',2',3'-trichloro-3',3'-difluoropropyl)-4-chlorocyclobutan-1-ones | |
| Suzuki et al. | Synthesis of (±)-8, 16, 26, 34-Tetrahydroxy-6, 10, 14, 18, 24, 28, 32, 36-octaoxohentetracontane as a Potent Synthetic Analog of Race T Toxin Produced by Helminthosporium maydis | |
| US4387233A (en) | Derivatives of 2H-pyran-2-one | |
| EP0022607A1 (en) | Process for the preparation of halogenated hydrocarbons |