HU213273B - Process for producing racem and optically active 1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid - Google Patents
Process for producing racem and optically active 1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid Download PDFInfo
- Publication number
- HU213273B HU213273B HU9200231A HU9200231A HU213273B HU 213273 B HU213273 B HU 213273B HU 9200231 A HU9200231 A HU 9200231A HU 9200231 A HU9200231 A HU 9200231A HU 213273 B HU213273 B HU 213273B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- acid
- compounds
- vhb
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 22
- BWKMGYQJPOAASG-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CNC(C(=O)O)CC2=C1 BWKMGYQJPOAASG-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 99
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 44
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 23
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 claims description 18
- NOOLISFMXDJSKH-KXUCPTDWSA-N (-)-Menthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O NOOLISFMXDJSKH-KXUCPTDWSA-N 0.000 claims description 16
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 10
- 238000007363 ring formation reaction Methods 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 9
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 claims description 8
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 229960004873 levomenthol Drugs 0.000 claims description 8
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- IWYDHOAUDWTVEP-SSDOTTSWSA-N (R)-mandelic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-SSDOTTSWSA-N 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 6
- 235000019445 benzyl alcohol Nutrition 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 238000007127 saponification reaction Methods 0.000 claims description 6
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 5
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 5
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 5
- 239000012312 sodium hydride Substances 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 238000001640 fractional crystallisation Methods 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 238000002955 isolation Methods 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 238000004440 column chromatography Methods 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 229960002510 mandelic acid Drugs 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- QRDZSRWEULKVNW-UHFFFAOYSA-N 6-hydroxy-2-oxo-1h-quinoline-4-carboxylic acid Chemical compound C1=C(O)C=C2C(C(=O)O)=CC(=O)NC2=C1 QRDZSRWEULKVNW-UHFFFAOYSA-N 0.000 claims 1
- 230000010933 acylation Effects 0.000 claims 1
- 238000005917 acylation reaction Methods 0.000 claims 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims 1
- 150000007514 bases Chemical class 0.000 claims 1
- 238000001704 evaporation Methods 0.000 claims 1
- 230000008020 evaporation Effects 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 238000010915 one-step procedure Methods 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 84
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 238000005160 1H NMR spectroscopy Methods 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- -1 dicarboxylic acid ester Chemical class 0.000 description 10
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 10
- 229910052938 sodium sulfate Inorganic materials 0.000 description 10
- 235000011152 sodium sulphate Nutrition 0.000 description 10
- 239000010410 layer Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- 238000001212 derivatisation Methods 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- 239000012452 mother liquor Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 4
- 238000006114 decarboxylation reaction Methods 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BWKMGYQJPOAASG-SECBINFHSA-N D-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CN[C@@H](C(=O)O)CC2=C1 BWKMGYQJPOAASG-SECBINFHSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- BWKMGYQJPOAASG-VIFPVBQESA-N (3s)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Chemical class C1=CC=C2CN[C@H](C(=O)O)CC2=C1 BWKMGYQJPOAASG-VIFPVBQESA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 230000000711 cancerogenic effect Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- HKYGSMOFSFOEIP-UHFFFAOYSA-N dichloro(dichloromethoxy)methane Chemical compound ClC(Cl)OC(Cl)Cl HKYGSMOFSFOEIP-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- 229960005190 phenylalanine Drugs 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- OXFGRWIKQDSSLY-VIFPVBQESA-N (1s)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid Chemical class C1=CC=C2[C@@H](C(=O)O)NCCC2=C1 OXFGRWIKQDSSLY-VIFPVBQESA-N 0.000 description 1
- KGKAYWMGPDWLQZ-UHFFFAOYSA-N 1,2-bis(bromomethyl)benzene Chemical group BrCC1=CC=CC=C1CBr KGKAYWMGPDWLQZ-UHFFFAOYSA-N 0.000 description 1
- FMGGHNGKHRCJLL-UHFFFAOYSA-N 1,2-bis(chloromethyl)benzene Chemical group ClCC1=CC=CC=C1CCl FMGGHNGKHRCJLL-UHFFFAOYSA-N 0.000 description 1
- UZPZYFDULMKDMB-UHFFFAOYSA-N 1,2-dichloro-3,4-dimethylbenzene Chemical group CC1=CC=C(Cl)C(Cl)=C1C UZPZYFDULMKDMB-UHFFFAOYSA-N 0.000 description 1
- FUVZDXDCPRQZSQ-UHFFFAOYSA-N 1,5,6,7-tetrahydroindazol-4-one Chemical compound O=C1CCCC2=C1C=NN2 FUVZDXDCPRQZSQ-UHFFFAOYSA-N 0.000 description 1
- RUSDWQNLKLRPPV-UHFFFAOYSA-N 2-(2-methylpropanoylamino)propanedioic acid Chemical compound CC(C)C(=O)NC(C(O)=O)C(O)=O RUSDWQNLKLRPPV-UHFFFAOYSA-N 0.000 description 1
- 239000005541 ACE inhibitor Substances 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000003109 Karl Fischer titration Methods 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000220304 Prunus dulcis Species 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- CAKWIRNQEKMHOR-MRXNPFEDSA-N benzyl (3r)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate Chemical compound O=C([C@@H]1NCC2=CC=CC=C2C1)OCC1=CC=CC=C1 CAKWIRNQEKMHOR-MRXNPFEDSA-N 0.000 description 1
- CAKWIRNQEKMHOR-INIZCTEOSA-N benzyl (3s)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate Chemical compound O=C([C@H]1NCC2=CC=CC=C2C1)OCC1=CC=CC=C1 CAKWIRNQEKMHOR-INIZCTEOSA-N 0.000 description 1
- CAKWIRNQEKMHOR-UHFFFAOYSA-N benzyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate Chemical compound C1C2=CC=CC=C2CNC1C(=O)OCC1=CC=CC=C1 CAKWIRNQEKMHOR-UHFFFAOYSA-N 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003152 bradykinin antagonist Substances 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical compound CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ISOLMABRZPQKOV-UHFFFAOYSA-N diethyl 2-acetamidopropanedioate Chemical compound CCOC(=O)C(NC(C)=O)C(=O)OCC ISOLMABRZPQKOV-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 238000003810 ethyl acetate extraction Methods 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- OAMZXMDZZWGPMH-UHFFFAOYSA-N ethyl acetate;toluene Chemical compound CCOC(C)=O.CC1=CC=CC=C1 OAMZXMDZZWGPMH-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- XDKQUSKHRIUJEO-UHFFFAOYSA-N magnesium;ethanolate Chemical compound [Mg+2].CC[O-].CC[O-] XDKQUSKHRIUJEO-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011403 purification operation Methods 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4102017 | 1991-01-24 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU9200231D0 HU9200231D0 (en) | 1992-04-28 |
| HUT63835A HUT63835A (en) | 1993-10-28 |
| HU213273B true HU213273B (en) | 1997-04-28 |
Family
ID=6423604
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9200231A HU213273B (en) | 1991-01-24 | 1992-01-24 | Process for producing racem and optically active 1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US5252738A (OSRAM) |
| EP (1) | EP0496369B1 (OSRAM) |
| JP (1) | JP3187905B2 (OSRAM) |
| KR (1) | KR100225829B1 (OSRAM) |
| AR (1) | AR247554A1 (OSRAM) |
| AT (1) | ATE136299T1 (OSRAM) |
| AU (1) | AU645654B2 (OSRAM) |
| CA (1) | CA2059908C (OSRAM) |
| DE (1) | DE59205884D1 (OSRAM) |
| DK (1) | DK0496369T3 (OSRAM) |
| ES (1) | ES2085497T3 (OSRAM) |
| FI (1) | FI101963B1 (OSRAM) |
| GR (1) | GR3019556T3 (OSRAM) |
| HU (1) | HU213273B (OSRAM) |
| IE (1) | IE74136B1 (OSRAM) |
| MX (1) | MX9200288A (OSRAM) |
| NO (1) | NO178763C (OSRAM) |
| TW (1) | TW224454B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW224454B (OSRAM) * | 1991-01-24 | 1994-06-01 | Hoechst Ag | |
| GB2266529A (en) * | 1992-05-01 | 1993-11-03 | Merck Sharp & Dohme | Tetrahydroisoquinoline derivatives |
| AU7724496A (en) * | 1995-11-09 | 1997-05-29 | Monsanto Company | An improved method for preparation of substituted tetrahydroisoquinolines |
| DE10320197A1 (de) * | 2002-12-20 | 2004-07-08 | Degussa Ag | Umhüllte Persauerstoffverbindungen mit kontrollierter Freisetzung, Verfahren zu ihrer Herstellung und ihrer Verwendung |
| FR3007751A1 (fr) | 2013-06-28 | 2015-01-02 | Solvay | Melanges de sels de sodium et de leur utilisation |
| CN111254170B (zh) * | 2018-11-30 | 2023-04-28 | 浙江大学 | 一种多酶耦合制备(s)-1,2,3,4-四氢异喹啉-3-甲酸的方法 |
| CN111254180B (zh) * | 2018-11-30 | 2023-04-28 | 浙江大学 | 一种酶法拆分制备(s)-1,2,3,4-四氢异喹啉-3-甲酸的方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5187290A (en) * | 1985-03-22 | 1993-02-16 | E. R. Squibb & Sons, Inc. | Acylaminoalkanoyl urethanes or thiourethanes |
| US4912221A (en) * | 1988-10-27 | 1990-03-27 | Occidental Chemical Corporation | Chiral 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid and precursors and preparation thereof |
| TW224454B (OSRAM) * | 1991-01-24 | 1994-06-01 | Hoechst Ag | |
| US5236934A (en) * | 1992-08-26 | 1993-08-17 | E. I. Du Pont De Nemours And Company | 1,2,3,4-tetrahydroisoquinolines useful in the treatment of CNS disorders |
-
1991
- 1991-08-13 TW TW080106363A patent/TW224454B/zh not_active IP Right Cessation
-
1992
- 1992-01-21 US US07/822,930 patent/US5252738A/en not_active Expired - Lifetime
- 1992-01-22 AR AR92321665A patent/AR247554A1/es active
- 1992-01-22 DE DE59205884T patent/DE59205884D1/de not_active Expired - Lifetime
- 1992-01-22 DK DK92100996.5T patent/DK0496369T3/da active
- 1992-01-22 ES ES92100996T patent/ES2085497T3/es not_active Expired - Lifetime
- 1992-01-22 AT AT92100996T patent/ATE136299T1/de not_active IP Right Cessation
- 1992-01-22 EP EP92100996A patent/EP0496369B1/de not_active Expired - Lifetime
- 1992-01-22 FI FI920269A patent/FI101963B1/fi active
- 1992-01-23 KR KR1019920000894A patent/KR100225829B1/ko not_active Expired - Lifetime
- 1992-01-23 IE IE920207A patent/IE74136B1/en not_active IP Right Cessation
- 1992-01-23 MX MX9200288A patent/MX9200288A/es unknown
- 1992-01-23 CA CA002059908A patent/CA2059908C/en not_active Expired - Lifetime
- 1992-01-23 NO NO920313A patent/NO178763C/no not_active IP Right Cessation
- 1992-01-23 AU AU10394/92A patent/AU645654B2/en not_active Expired
- 1992-01-23 JP JP00982592A patent/JP3187905B2/ja not_active Expired - Lifetime
- 1992-01-24 HU HU9200231A patent/HU213273B/hu unknown
-
1993
- 1993-06-15 US US08/076,772 patent/US5359074A/en not_active Expired - Lifetime
-
1996
- 1996-04-04 GR GR960400851T patent/GR3019556T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GR3019556T3 (en) | 1996-07-31 |
| AR247554A1 (es) | 1995-01-31 |
| IE920207A1 (en) | 1992-07-29 |
| IE74136B1 (en) | 1997-07-02 |
| ATE136299T1 (de) | 1996-04-15 |
| HU9200231D0 (en) | 1992-04-28 |
| AU645654B2 (en) | 1994-01-20 |
| CA2059908C (en) | 2002-09-10 |
| EP0496369B1 (de) | 1996-04-03 |
| HUT63835A (en) | 1993-10-28 |
| NO178763B (no) | 1996-02-19 |
| KR920014782A (ko) | 1992-08-25 |
| DK0496369T3 (da) | 1996-07-29 |
| DE59205884D1 (de) | 1996-05-09 |
| FI920269A0 (fi) | 1992-01-22 |
| NO920313L (no) | 1992-07-27 |
| ES2085497T3 (es) | 1996-06-01 |
| JPH04334370A (ja) | 1992-11-20 |
| NO920313D0 (no) | 1992-01-23 |
| US5252738A (en) | 1993-10-12 |
| TW224454B (OSRAM) | 1994-06-01 |
| JP3187905B2 (ja) | 2001-07-16 |
| NO178763C (no) | 1996-05-29 |
| EP0496369A1 (de) | 1992-07-29 |
| FI920269A7 (fi) | 1992-07-25 |
| FI101963B (fi) | 1998-09-30 |
| CA2059908A1 (en) | 1992-07-25 |
| FI101963B1 (fi) | 1998-09-30 |
| KR100225829B1 (ko) | 1999-10-15 |
| AU1039492A (en) | 1992-07-30 |
| MX9200288A (es) | 1992-07-01 |
| US5359074A (en) | 1994-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5281722A (en) | Preparation and use of salts of the pure enantiomers of alpha-lipoic acid | |
| US6492522B1 (en) | Process and intermediates for production of donepezil and related compounds | |
| PL201422B1 (pl) | Stabilna sól izomaślanu R-(+)-2-(3-(diizopropyloamino-1-fenylopropylo)-4-hydroksymetylofenylowego | |
| US20070197821A1 (en) | Process for the preparation of high purity perindopril | |
| KR860001549B1 (ko) | 엔케팔린아제 효소 억제 화합물의 제조 방법 | |
| CA2150355C (en) | Process of resolving phenylpropionic acids using alpha-methylbenzylamine | |
| Mori et al. | Synthesis of the enantiomers of 5-hexadecanolide, the pheromone of the queen of the oriental hornet, Vespa orientalis, employing enzymic resolution of (±)-2-aminotridecanoic acid as the key-step | |
| US4297282A (en) | Resolution of mercaptopropionic acids | |
| JPH05125051A (ja) | 立体構造の均一な置換された(キノリン−2−イル−メトキシ)−フエニル酢酸の合成方法 | |
| EP0309324B1 (fr) | Procédé de synthèse d'alpha amino N alkyles et de leurs esters. Application à la synthèse de carboxyalkyl dipeptides | |
| HU213273B (en) | Process for producing racem and optically active 1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid | |
| AU2003206055A1 (en) | Process for the preparation of high purity perindopril and intermediates useful in the synthesis | |
| US7915421B2 (en) | Method for preparing phenyl acetic acid derivatives | |
| JPH02306947A (ja) | キラルβ―アミノ酸の製造方法 | |
| EP0000035B1 (en) | Alpha-amino acids, compositions and process for preparing said compounds | |
| EP0710652B1 (en) | Process for preparing optically active piperazine derivatives and intermediates for preparation | |
| CS274502B2 (en) | Method of glutaramide's derivatives' s-enantiomers production | |
| US4559178A (en) | Resolution of 3-benzoylthio-2-methyl-propanoic acid with (+)-dehydroabietylamine | |
| EP0432898B1 (en) | Glutaric acid derivatives and preparation thereof | |
| US5840964A (en) | Process for the preparation of the enantiomers of 2-(2-fluoro-4-biphenyl)propionic acid | |
| KR0142428B1 (ko) | 1,4-가교된 시클로헥산 카르복실산 유도체의 제조방법 | |
| US5977391A (en) | (+)- and (-) -8-halogen-6- hydroxy-octanoic acid its salts and esters and process for making | |
| HUT70171A (en) | Novel isobutyl substituted amides of methanesulfonyl-quinolymethoxypnenyl-cycloalkylacetic acid, pharmaceutical compositions comprising them and process for producing thereof | |
| US20050065366A1 (en) | Method for producing optically active beta-phenylalanine compounds | |
| EP0500171B1 (en) | Improved process for the preparation of chiral 4-aryloxyazetidinones |