HU200763B - Process for producing new, substituted benzimidazole derivatives and pharmaceutical compositions comprising same - Google Patents
Process for producing new, substituted benzimidazole derivatives and pharmaceutical compositions comprising same Download PDFInfo
- Publication number
- HU200763B HU200763B HU854204A HU420485A HU200763B HU 200763 B HU200763 B HU 200763B HU 854204 A HU854204 A HU 854204A HU 420485 A HU420485 A HU 420485A HU 200763 B HU200763 B HU 200763B
- Authority
- HU
- Hungary
- Prior art keywords
- chloro
- methyl
- benzimidazole
- methoxy
- piperidino
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 40
- 239000008194 pharmaceutical composition Chemical class 0.000 title claims description 7
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 title description 3
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 105
- 238000002360 preparation method Methods 0.000 claims description 90
- -1 difluoromethylenedioxy group Chemical group 0.000 claims description 78
- 150000003839 salts Chemical class 0.000 claims description 33
- 239000000460 chlorine Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 9
- ILMHAGCURJPNRZ-UHFFFAOYSA-N 6-methoxy-1h-benzimidazole Chemical compound COC1=CC=C2N=CNC2=C1 ILMHAGCURJPNRZ-UHFFFAOYSA-N 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- 230000027119 gastric acid secretion Effects 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 5
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- HKHVGSFRFKTMRS-UHFFFAOYSA-N 2-[(5-bromo-4-pyrrolidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1[S+]([O-])CC(N=CC=1Br)=CC=1N1CCCC1 HKHVGSFRFKTMRS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- WMXSKTKPJVQGIW-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-5,6-difluoro-8,10-dioxa-1,3-diazatricyclo[5.3.2.04,11]dodeca-2,4,6,11-tetraene Chemical compound CC1=CN=C(CS(=O)C=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)C(Cl)=C1N1CCCCC1 WMXSKTKPJVQGIW-UHFFFAOYSA-N 0.000 claims description 2
- 239000002702 enteric coating Substances 0.000 claims description 2
- 238000009505 enteric coating Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims 4
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- 239000000463 material Substances 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- 239000000243 solution Substances 0.000 description 63
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 61
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 50
- 239000003153 chemical reaction reagent Substances 0.000 description 45
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 239000003921 oil Substances 0.000 description 18
- 235000019198 oils Nutrition 0.000 description 18
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000000284 extract Substances 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- TWUUUBWBMOSBKE-UHFFFAOYSA-N (3-chloro-4-morpholin-4-ylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC(N2CCOCC2)=C1Cl TWUUUBWBMOSBKE-UHFFFAOYSA-N 0.000 description 9
- PYLXNWKUFQTPTQ-UHFFFAOYSA-N 4-[3-chloro-2-(chloromethyl)pyridin-1-ium-4-yl]morpholine;chloride Chemical compound [Cl-].ClCC1=[NH+]C=CC(N2CCOCC2)=C1Cl PYLXNWKUFQTPTQ-UHFFFAOYSA-N 0.000 description 9
- CZRYJFFARPJRPV-UHFFFAOYSA-N 4-[3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfanylmethyl]pyridin-4-yl]morpholine Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=CC=1N1CCOCC1 CZRYJFFARPJRPV-UHFFFAOYSA-N 0.000 description 9
- 108091006112 ATPases Proteins 0.000 description 9
- 102000057290 Adenosine Triphosphatases Human genes 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 229960000212 aminophenazone Drugs 0.000 description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 8
- 229910052794 bromium Inorganic materials 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 230000002829 reductive effect Effects 0.000 description 8
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 8
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-Lutidine Substances CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 7
- RMMXTBMQSGEXHJ-UHFFFAOYSA-N Aminophenazone Chemical compound O=C1C(N(C)C)=C(C)N(C)N1C1=CC=CC=C1 RMMXTBMQSGEXHJ-UHFFFAOYSA-N 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 238000004587 chromatography analysis Methods 0.000 description 7
- 230000002496 gastric effect Effects 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- XFHVRZUGLAROJP-UHFFFAOYSA-N (3,4-dichloropyridin-2-yl)methanol Chemical compound OCC1=NC=CC(Cl)=C1Cl XFHVRZUGLAROJP-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- ZAIQFLZYGDWOEI-UHFFFAOYSA-N 5-bromo-2-methyl-4-piperidin-1-ylpyridine Chemical compound C1=NC(C)=CC(N2CCCCC2)=C1Br ZAIQFLZYGDWOEI-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 210000001156 gastric mucosa Anatomy 0.000 description 5
- 210000004907 gland Anatomy 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- UWUIYVLZNYZKSU-UHFFFAOYSA-N (3-chloro-5-methyl-4-morpholin-4-ylpyridin-2-yl)methanol Chemical compound CC1=CN=C(CO)C(Cl)=C1N1CCOCC1 UWUIYVLZNYZKSU-UHFFFAOYSA-N 0.000 description 4
- CCPAJOONEPOBLS-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-5-methyl-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.CC1=CN=C(CCl)C(Cl)=C1N1CCCCC1 CCPAJOONEPOBLS-UHFFFAOYSA-N 0.000 description 4
- AGWBEYQZGBQXLL-UHFFFAOYSA-N 3-chloro-2-methylpyridin-4-amine Chemical compound CC1=NC=CC(N)=C1Cl AGWBEYQZGBQXLL-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- CHFVGTTVCFOOQD-UHFFFAOYSA-N 4-[3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfanylmethyl]-5-methylpyridin-4-yl]morpholine Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=C(C)C=1N1CCOCC1 CHFVGTTVCFOOQD-UHFFFAOYSA-N 0.000 description 4
- RRNCSVMXQYFXLW-UHFFFAOYSA-N 5-bromo-2-methyl-1-oxido-4-piperidin-1-ylpyridin-1-ium Chemical compound C1=[N+]([O-])C(C)=CC(N2CCCCC2)=C1Br RRNCSVMXQYFXLW-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 235000015320 potassium carbonate Nutrition 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- QGKYTDJYIYERGS-UHFFFAOYSA-N (3,4-dichloro-5-methylpyridin-2-yl)methanol Chemical compound CC1=CN=C(CO)C(Cl)=C1Cl QGKYTDJYIYERGS-UHFFFAOYSA-N 0.000 description 3
- ROPABKFSNANDGJ-UHFFFAOYSA-N (3-chloro-4-pyrrolidin-1-ylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC(N2CCCC2)=C1Cl ROPABKFSNANDGJ-UHFFFAOYSA-N 0.000 description 3
- VHJAYXVYESKMOX-UHFFFAOYSA-N (3-chloro-5-methyl-4-pyrrolidin-1-ylpyridin-2-yl)methanol Chemical compound CC1=CN=C(CO)C(Cl)=C1N1CCCC1 VHJAYXVYESKMOX-UHFFFAOYSA-N 0.000 description 3
- RBGGMTQEVZWWLW-UHFFFAOYSA-N 1-methoxybenzimidazole Chemical compound C1=CC=C2N(OC)C=NC2=C1 RBGGMTQEVZWWLW-UHFFFAOYSA-N 0.000 description 3
- IBKGSZATXCWQOT-UHFFFAOYSA-N 2-methyl-4-piperidin-1-ylpyridine Chemical compound C1=NC(C)=CC(N2CCCCC2)=C1 IBKGSZATXCWQOT-UHFFFAOYSA-N 0.000 description 3
- RKTIAZVXWYFNJG-UHFFFAOYSA-N 3,4-dichloro-2-methylpyridine Chemical compound CC1=NC=CC(Cl)=C1Cl RKTIAZVXWYFNJG-UHFFFAOYSA-N 0.000 description 3
- OUVKCXCGLFTNKP-UHFFFAOYSA-N 3-bromo-2-methyl-1-oxido-4-piperidin-1-ylpyridin-1-ium Chemical compound C1=[N+]([O-])C(C)=C(Br)C(N2CCCCC2)=C1 OUVKCXCGLFTNKP-UHFFFAOYSA-N 0.000 description 3
- LHFOSVHQCUPVHK-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.ClCC1=NC=CC(N2CCCCC2)=C1Cl LHFOSVHQCUPVHK-UHFFFAOYSA-N 0.000 description 3
- KGFNSPQDTPEMRZ-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-n,n,5-trimethylpyridin-4-amine;hydrochloride Chemical compound Cl.CN(C)C1=C(C)C=NC(CCl)=C1Cl KGFNSPQDTPEMRZ-UHFFFAOYSA-N 0.000 description 3
- KPUDVWQAYFTOER-UHFFFAOYSA-N 5-bromo-2-(chloromethyl)-3-methyl-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.CC1=C(CCl)N=CC(Br)=C1N1CCCCC1 KPUDVWQAYFTOER-UHFFFAOYSA-N 0.000 description 3
- IJBBWAYELLJQNE-UHFFFAOYSA-N 5-bromo-2-(chloromethyl)-n,n-dimethylpyridin-4-amine;hydrochloride Chemical compound Cl.CN(C)C1=CC(CCl)=NC=C1Br IJBBWAYELLJQNE-UHFFFAOYSA-N 0.000 description 3
- ZSOLYCKLZKSFJZ-UHFFFAOYSA-N 5-bromo-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfanylmethyl]pyridin-4-amine Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC1=CC(N)=C(Br)C=N1 ZSOLYCKLZKSFJZ-UHFFFAOYSA-N 0.000 description 3
- IZXSYVQEPYNCMC-UHFFFAOYSA-N 5-bromo-4-chloro-2-methyl-1-oxidopyridin-1-ium Chemical compound CC1=CC(Cl)=C(Br)C=[N+]1[O-] IZXSYVQEPYNCMC-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 102100026450 POU domain, class 3, transcription factor 4 Human genes 0.000 description 3
- 101710133389 POU domain, class 3, transcription factor 4 Proteins 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- ZEMJDCGDDDMDHY-UHFFFAOYSA-N [3-chloro-4-(dimethylamino)-5-methylpyridin-2-yl]methanol Chemical compound CN(C)C1=C(C)C=NC(CO)=C1Cl ZEMJDCGDDDMDHY-UHFFFAOYSA-N 0.000 description 3
- QMSAAMKZUZLPSH-UHFFFAOYSA-N [5-bromo-4-(dimethylamino)pyridin-2-yl]methanol Chemical compound CN(C)C1=CC(CO)=NC=C1Br QMSAAMKZUZLPSH-UHFFFAOYSA-N 0.000 description 3
- 238000009825 accumulation Methods 0.000 description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000001556 benzimidazoles Chemical class 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- PWSNYRUGVHMGRC-UHFFFAOYSA-N (3-bromo-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC(N2CCCCC2)=C1Br PWSNYRUGVHMGRC-UHFFFAOYSA-N 0.000 description 2
- WDLXVLGKXIXOES-UHFFFAOYSA-N (3-chloro-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC(N2CCCCC2)=C1Cl WDLXVLGKXIXOES-UHFFFAOYSA-N 0.000 description 2
- BTYCKDRWPXPNSB-UHFFFAOYSA-N (3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound CC1=CN=C(CO)C(Cl)=C1N1CCCCC1 BTYCKDRWPXPNSB-UHFFFAOYSA-N 0.000 description 2
- HUPJQFKJORLSOE-UHFFFAOYSA-N (4-amino-5-bromopyridin-2-yl)methanol Chemical compound NC1=CC(CO)=NC=C1Br HUPJQFKJORLSOE-UHFFFAOYSA-N 0.000 description 2
- GYZILYPKQZEUGO-UHFFFAOYSA-N (5-bromo-3-methyl-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound CC1=C(CO)N=CC(Br)=C1N1CCCCC1 GYZILYPKQZEUGO-UHFFFAOYSA-N 0.000 description 2
- QMPZJKMTLSPODU-UHFFFAOYSA-N (5-bromo-4-chloropyridin-2-yl)methanol Chemical compound OCC1=CC(Cl)=C(Br)C=N1 QMPZJKMTLSPODU-UHFFFAOYSA-N 0.000 description 2
- VRPLVCJRLDUGAI-UHFFFAOYSA-N (5-bromo-4-piperidin-1-ylpyridin-2-yl)methanol Chemical compound C1=NC(CO)=CC(N2CCCCC2)=C1Br VRPLVCJRLDUGAI-UHFFFAOYSA-N 0.000 description 2
- HEICJPSLDFCXIL-UHFFFAOYSA-N (5-bromo-4-pyrrolidin-1-ylpyridin-2-yl)methanol Chemical compound C1=NC(CO)=CC(N2CCCC2)=C1Br HEICJPSLDFCXIL-UHFFFAOYSA-N 0.000 description 2
- ZFOWOWQBRONGLV-UHFFFAOYSA-N 2-[(3-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Br)=NC=CC=1N1CCCCC1 ZFOWOWQBRONGLV-UHFFFAOYSA-N 0.000 description 2
- VFCKEQUOAZFXGU-UHFFFAOYSA-N 2-[(3-chloro-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=CC=1N1CCCCC1 VFCKEQUOAZFXGU-UHFFFAOYSA-N 0.000 description 2
- BWWWXFGSYQGHPZ-UHFFFAOYSA-N 2-[(3-chloro-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC(C=1Cl)=NC=CC=1N1CCCCC1 BWWWXFGSYQGHPZ-UHFFFAOYSA-N 0.000 description 2
- PGAOTQLYNLHQJT-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-(1,1,2,2-tetrafluoroethoxy)-1h-benzimidazole Chemical compound CC1=CN=C(CSC=2NC3=CC=C(OC(F)(F)C(F)F)C=C3N=2)C(Cl)=C1N1CCCCC1 PGAOTQLYNLHQJT-UHFFFAOYSA-N 0.000 description 2
- REMOEVBLPGHDOR-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=C(C)C=1N1CCCCC1 REMOEVBLPGHDOR-UHFFFAOYSA-N 0.000 description 2
- GEIUIROSXAJZMB-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-pyrrolidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC(C=1Cl)=NC=C(C)C=1N1CCCC1 GEIUIROSXAJZMB-UHFFFAOYSA-N 0.000 description 2
- JHBWVIDNVCIRMJ-UHFFFAOYSA-N 2-[(5-bromo-3-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N1C2=CC(OC)=CC=C2N=C1SCC(C=1C)=NC=C(Br)C=1N1CCCCC1 JHBWVIDNVCIRMJ-UHFFFAOYSA-N 0.000 description 2
- ZUCIATQKHDWAJZ-UHFFFAOYSA-N 2-[(5-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(N=CC=1Br)=CC=1N1CCCCC1 ZUCIATQKHDWAJZ-UHFFFAOYSA-N 0.000 description 2
- ISYYOUSNEZSMAL-UHFFFAOYSA-N 2-[(5-bromo-4-pyrrolidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(N=CC=1Br)=CC=1N1CCCC1 ISYYOUSNEZSMAL-UHFFFAOYSA-N 0.000 description 2
- GNCLPNMQEGMNTG-UHFFFAOYSA-N 2-methylpyridin-4-amine Chemical compound CC1=CC(N)=CC=N1 GNCLPNMQEGMNTG-UHFFFAOYSA-N 0.000 description 2
- GMMPXILOTHOBQJ-UHFFFAOYSA-N 3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfanylmethyl]-n,n,5-trimethylpyridin-4-amine Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC1=NC=C(C)C(N(C)C)=C1Cl GMMPXILOTHOBQJ-UHFFFAOYSA-N 0.000 description 2
- DQKFANBULVIYFT-UHFFFAOYSA-N 4-[3-chloro-2-(chloromethyl)-5-methylpyridin-4-yl]morpholine;hydrochloride Chemical compound Cl.CC1=CN=C(CCl)C(Cl)=C1N1CCOCC1 DQKFANBULVIYFT-UHFFFAOYSA-N 0.000 description 2
- ZGRVCVASDCAMLG-UHFFFAOYSA-N 4-[3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfinylmethyl]-5-methylpyridin-4-yl]morpholine Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC(C=1Cl)=NC=C(C)C=1N1CCOCC1 ZGRVCVASDCAMLG-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- JTHURIIQMPMBFU-UHFFFAOYSA-N 5-bromo-2,3-dimethyl-1-oxidopyridin-1-ium Chemical compound CC1=CC(Br)=C[N+]([O-])=C1C JTHURIIQMPMBFU-UHFFFAOYSA-N 0.000 description 2
- NRYCZYOFAHEKLJ-UHFFFAOYSA-N 5-bromo-2-(chloromethyl)-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.C1=NC(CCl)=CC(N2CCCCC2)=C1Br NRYCZYOFAHEKLJ-UHFFFAOYSA-N 0.000 description 2
- HXVWILJHRZSASZ-UHFFFAOYSA-N 5-bromo-2-(chloromethyl)-4-pyrrolidin-1-ylpyridine;hydrochloride Chemical compound Cl.C1=NC(CCl)=CC(N2CCCC2)=C1Br HXVWILJHRZSASZ-UHFFFAOYSA-N 0.000 description 2
- ZUEJMGSUNZEVTL-UHFFFAOYSA-N 5-bromo-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfanylmethyl]-n,n-dimethylpyridin-4-amine Chemical compound N1C2=CC(OC)=CC=C2N=C1SCC1=CC(N(C)C)=C(Br)C=N1 ZUEJMGSUNZEVTL-UHFFFAOYSA-N 0.000 description 2
- RLVQTVNHGGZCNH-UHFFFAOYSA-N 5-bromo-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfinylmethyl]pyridin-4-amine Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=CC(N)=C(Br)C=N1 RLVQTVNHGGZCNH-UHFFFAOYSA-N 0.000 description 2
- ZXBHWFBOEKPCCN-UHFFFAOYSA-N 5-bromo-2-methyl-4-nitro-1-oxidopyridin-1-ium Chemical compound CC1=CC([N+]([O-])=O)=C(Br)C=[N+]1[O-] ZXBHWFBOEKPCCN-UHFFFAOYSA-N 0.000 description 2
- MZWNGLQAOUQLHF-UHFFFAOYSA-N 5-bromo-4-chloro-2,3-dimethylpyridine Chemical compound CC1=NC=C(Br)C(Cl)=C1C MZWNGLQAOUQLHF-UHFFFAOYSA-N 0.000 description 2
- KOFBRZWVWJCLGM-UHFFFAOYSA-N 5-methoxy-1,3-dihydrobenzimidazole-2-thione Chemical compound COC1=CC=C2NC(S)=NC2=C1 KOFBRZWVWJCLGM-UHFFFAOYSA-N 0.000 description 2
- 208000007848 Alcoholism Diseases 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 208000007882 Gastritis Diseases 0.000 description 2
- 208000018522 Gastrointestinal disease Diseases 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 208000007107 Stomach Ulcer Diseases 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 235000011148 calcium chloride Nutrition 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- DANUORFCFTYTSZ-UHFFFAOYSA-N epinigericin Natural products O1C2(C(CC(C)(O2)C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)C)C(C)C(OC)CC1CC1CCC(C)C(C(C)C(O)=O)O1 DANUORFCFTYTSZ-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- DANUORFCFTYTSZ-BIBFWWMMSA-N nigericin Chemical compound C([C@@H]1C[C@H]([C@H]([C@]2([C@@H](C[C@](C)(O2)C2O[C@@](C)(CC2)C2[C@H](CC(O2)[C@@H]2[C@H](C[C@@H](C)[C@](O)(CO)O2)C)C)C)O1)C)OC)[C@H]1CC[C@H](C)C([C@@H](C)C(O)=O)O1 DANUORFCFTYTSZ-BIBFWWMMSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 239000012457 nonaqueous media Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- 238000011533 pre-incubation Methods 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- INOGLHRUEYDAHX-UHFFFAOYSA-N 1-chlorobenzotriazole Chemical compound C1=CC=C2N(Cl)N=NC2=C1 INOGLHRUEYDAHX-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- QAOBBBBDJSWHMU-WMBBNPMCSA-N 16,16-dimethylprostaglandin E2 Chemical compound CCCCC(C)(C)[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O QAOBBBBDJSWHMU-WMBBNPMCSA-N 0.000 description 1
- QOYHOHVBDOFRJP-UHFFFAOYSA-N 2,3-dichlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1Cl QOYHOHVBDOFRJP-UHFFFAOYSA-N 0.000 description 1
- KQCWCIYVDIVYAB-UHFFFAOYSA-N 2,5-dimethylpyridin-4-amine Chemical compound CC1=CC(N)=C(C)C=N1 KQCWCIYVDIVYAB-UHFFFAOYSA-N 0.000 description 1
- UFQKYPSVDWPNTH-UHFFFAOYSA-N 2-[(3-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1h-benzimidazole Chemical compound N=1C2=CC(OC(F)(F)C(F)F)=CC=C2NC=1S(=O)CC(C=1Br)=NC=CC=1N1CCCCC1 UFQKYPSVDWPNTH-UHFFFAOYSA-N 0.000 description 1
- LKZKGFZJFXNYPO-UHFFFAOYSA-N 2-[(3-chloro-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1h-benzimidazole Chemical compound N1C2=CC(OC(F)(F)C(F)F)=CC=C2N=C1S(=O)CC(C=1Cl)=NC=CC=1N1CCCCC1 LKZKGFZJFXNYPO-UHFFFAOYSA-N 0.000 description 1
- VLSRVDFXIZCCEW-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1h-benzimidazole Chemical compound CC1=CN=C(CS(=O)C=2NC3=CC=C(OC(F)(F)C(F)F)C=C3N=2)C(Cl)=C1N1CCCCC1 VLSRVDFXIZCCEW-UHFFFAOYSA-N 0.000 description 1
- XCNBZFNYBJKAQW-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC(C=1Cl)=NC=C(C)C=1N1CCCCC1 XCNBZFNYBJKAQW-UHFFFAOYSA-N 0.000 description 1
- BLMVKJYSBQPCTE-UHFFFAOYSA-N 2-[(3-chloro-5-methyl-4-pyrrolidin-1-ylpyridin-2-yl)methylsulfanyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1SCC(C=1Cl)=NC=C(C)C=1N1CCCC1 BLMVKJYSBQPCTE-UHFFFAOYSA-N 0.000 description 1
- SXZBQCDDTFEDOQ-UHFFFAOYSA-N 2-[(5-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1h-benzimidazole Chemical compound N=1C2=CC(OC(F)(F)C(F)F)=CC=C2NC=1S(=O)CC(N=CC=1Br)=CC=1N1CCCCC1 SXZBQCDDTFEDOQ-UHFFFAOYSA-N 0.000 description 1
- CMKNCJBRUHFRKG-UHFFFAOYSA-N 2-[(5-bromo-4-piperidin-1-ylpyridin-2-yl)methylsulfinyl]-6-methoxy-1h-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC(N=CC=1Br)=CC=1N1CCCCC1 CMKNCJBRUHFRKG-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- HCTCICZZGMRJRZ-UHFFFAOYSA-N 3,4-dichloro-1h-pyridin-2-one Chemical compound OC1=NC=CC(Cl)=C1Cl HCTCICZZGMRJRZ-UHFFFAOYSA-N 0.000 description 1
- MZSAMHOCTRNOIZ-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylaniline Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(NC2=CC=CC=C2)C=CC=1 MZSAMHOCTRNOIZ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- BYTAAJQQCAJNQX-UHFFFAOYSA-N 3-bromo-2-(chloromethyl)-4-piperidin-1-ylpyridine;hydrochloride Chemical compound Cl.ClCC1=NC=CC(N2CCCCC2)=C1Br BYTAAJQQCAJNQX-UHFFFAOYSA-N 0.000 description 1
- FRNWZAKNPBDLLD-UHFFFAOYSA-N 3-bromo-2-methyl-4-piperidin-1-ylpyridine Chemical compound CC1=NC=CC(N2CCCCC2)=C1Br FRNWZAKNPBDLLD-UHFFFAOYSA-N 0.000 description 1
- IZSZZJRPXUGYLY-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-4-pyrrolidin-1-ylpyridine;hydrochloride Chemical compound Cl.ClCC1=NC=CC(N2CCCC2)=C1Cl IZSZZJRPXUGYLY-UHFFFAOYSA-N 0.000 description 1
- NEGLQIGKZCGJFZ-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)-5-methyl-4-pyrrolidin-1-ylpyridine;hydrochloride Chemical compound Cl.CC1=CN=C(CCl)C(Cl)=C1N1CCCC1 NEGLQIGKZCGJFZ-UHFFFAOYSA-N 0.000 description 1
- BHDTYAWLJKYGDD-UHFFFAOYSA-N 3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfinylmethyl]-n,n-dimethylpyridin-4-amine Chemical compound N=1C2=CC(OC)=CC=C2NC=1[S+]([O-])CC1=NC=CC(N(C)C)=C1Cl BHDTYAWLJKYGDD-UHFFFAOYSA-N 0.000 description 1
- YVECRFPOTBFEGF-UHFFFAOYSA-N 4,5-difluoro-6,8-dihydro-[1,3]dioxolo[4,5-e]benzimidazole-7-thione Chemical compound FC1=C2OCOC2=C2N=C(S)NC2=C1F YVECRFPOTBFEGF-UHFFFAOYSA-N 0.000 description 1
- OGHHMBMLUJWHGH-UHFFFAOYSA-N 4-[3-chloro-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfinylmethyl]pyridin-4-yl]morpholine Chemical compound N1C2=CC(OC)=CC=C2N=C1S(=O)CC(C=1Cl)=NC=CC=1N1CCOCC1 OGHHMBMLUJWHGH-UHFFFAOYSA-N 0.000 description 1
- VIILQFLUOSAVNE-UHFFFAOYSA-N 4-[3-chloro-5-methyl-2-(pyridin-2-ylmethyl)pyridin-4-yl]morpholine;hydrochloride Chemical compound Cl.ClC1=C(N2CCOCC2)C(C)=CN=C1CC1=CC=CC=N1 VIILQFLUOSAVNE-UHFFFAOYSA-N 0.000 description 1
- DAOZBJCTEPJGES-UHFFFAOYSA-N 4-chloro-2-methylpyridine Chemical compound CC1=CC(Cl)=CC=N1 DAOZBJCTEPJGES-UHFFFAOYSA-N 0.000 description 1
- UIUCDMJOXYLFHF-UHFFFAOYSA-N 5-(1,1,2,2-tetrafluoroethoxy)-1,3-dihydrobenzimidazole-2-thione Chemical compound FC(F)C(F)(F)OC1=CC=C2NC(S)=NC2=C1 UIUCDMJOXYLFHF-UHFFFAOYSA-N 0.000 description 1
- FKVGZFPKNFGUGX-UHFFFAOYSA-N 5-bromo-2-[(6-methoxy-1h-benzimidazol-2-yl)sulfinylmethyl]-n,n-dimethylpyridin-4-amine Chemical compound N=1C2=CC(OC)=CC=C2NC=1[S+]([O-])CC1=CC(N(C)C)=C(Br)C=N1 FKVGZFPKNFGUGX-UHFFFAOYSA-N 0.000 description 1
- NEEHOROWKICRQK-UHFFFAOYSA-N 5-bromo-2-methyl-1-oxidopyridin-1-ium Chemical compound CC1=CC=C(Br)C=[N+]1[O-] NEEHOROWKICRQK-UHFFFAOYSA-N 0.000 description 1
- OFKWIQJLYCKDNY-UHFFFAOYSA-N 5-bromo-2-methylpyridine Chemical compound CC1=CC=C(Br)C=N1 OFKWIQJLYCKDNY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 238000006064 ATPase reaction Methods 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DFEOIPSPRDZJFS-UHFFFAOYSA-N CC1=CC(N)=C(Br)C=[N+]1[O-] Chemical compound CC1=CC(N)=C(Br)C=[N+]1[O-] DFEOIPSPRDZJFS-UHFFFAOYSA-N 0.000 description 1
- CQSXSQBOWQLXEI-UHFFFAOYSA-N CC1=CN=C(CSC=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)C(Cl)=C1N1CCCCC1 Chemical compound CC1=CN=C(CSC=2N3OCOC4=C(F)C(F)=C(C3=C4)N=2)C(Cl)=C1N1CCCCC1 CQSXSQBOWQLXEI-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010017943 Gastrointestinal conditions Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 206010028103 Mucosa vesicle Diseases 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- KKYCGPIXSKAXHU-UHFFFAOYSA-N N=1C(C2=C3)=C(F)C(F)=C3OCON2C=1S(=O)CC(N=CC=1Br)=CC=1N1CCCCC1 Chemical compound N=1C(C2=C3)=C(F)C(F)=C3OCON2C=1S(=O)CC(N=CC=1Br)=CC=1N1CCCCC1 KKYCGPIXSKAXHU-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 1
- 206010046274 Upper gastrointestinal haemorrhage Diseases 0.000 description 1
- 241000860832 Yoda Species 0.000 description 1
- 201000008629 Zollinger-Ellison syndrome Diseases 0.000 description 1
- GKULEHOYWKQEQE-UHFFFAOYSA-N [Br].C1CC2CCN1NC2 Chemical compound [Br].C1CC2CCN1NC2 GKULEHOYWKQEQE-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 206010001584 alcohol abuse Diseases 0.000 description 1
- 208000025746 alcohol use disease Diseases 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000001262 anti-secretory effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- CJGYSWNGNKCJSB-YVLZZHOMSA-N bucladesine Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](OC(=O)CCC)[C@@H]2N1C(N=CN=C2NC(=O)CCC)=C2N=C1 CJGYSWNGNKCJSB-YVLZZHOMSA-N 0.000 description 1
- 229960005263 bucladesine Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 1
- 229960001380 cimetidine Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000011340 continuous therapy Methods 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 229960000913 crospovidone Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 201000005917 gastric ulcer Diseases 0.000 description 1
- 201000000052 gastrinoma Diseases 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- JYJVVHFRSFVEJM-UHFFFAOYSA-N iodosobenzene Chemical compound O=IC1=CC=CC=C1 JYJVVHFRSFVEJM-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004712 monophosphates Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 238000005453 pelletization Methods 0.000 description 1
- 208000011906 peptic ulcer disease Diseases 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 231100000161 signs of toxicity Toxicity 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB848427836A GB8427836D0 (en) | 1984-11-02 | 1984-11-02 | Chemical compounds |
| GB848432515A GB8432515D0 (en) | 1984-12-21 | 1984-12-21 | Heterocyclic compounds |
| GB858518043A GB8518043D0 (en) | 1985-07-17 | 1985-07-17 | Heterocyclic compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT39176A HUT39176A (en) | 1986-08-28 |
| HU200763B true HU200763B (en) | 1990-08-28 |
Family
ID=27262502
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU854204A HU200763B (en) | 1984-11-02 | 1985-11-01 | Process for producing new, substituted benzimidazole derivatives and pharmaceutical compositions comprising same |
Country Status (19)
| Country | Link |
|---|---|
| EP (1) | EP0184322B1 (enExample) |
| KR (1) | KR930001410B1 (enExample) |
| CN (1) | CN1013445B (enExample) |
| AR (1) | AR241592A1 (enExample) |
| AU (1) | AU576634B2 (enExample) |
| CA (1) | CA1253150A (enExample) |
| DE (1) | DE3574873D1 (enExample) |
| DK (1) | DK501085A (enExample) |
| ES (1) | ES8701752A1 (enExample) |
| FI (1) | FI84718C (enExample) |
| GR (1) | GR852643B (enExample) |
| HU (1) | HU200763B (enExample) |
| IE (1) | IE58587B1 (enExample) |
| JO (1) | JO1406B1 (enExample) |
| NO (1) | NO164541C (enExample) |
| NZ (1) | NZ214024A (enExample) |
| PH (1) | PH22303A (enExample) |
| PT (1) | PT81420B (enExample) |
| ZW (1) | ZW19185A1 (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2161160B (en) * | 1984-07-06 | 1989-05-24 | Fisons Plc | Heterocyclic sulphinyl compounds |
| EP0174717B1 (en) * | 1984-07-06 | 1992-01-22 | FISONS plc | Benzimidazoles, and their production formulation and use as gastric acid secretion inhibitors |
| GB8610607D0 (en) * | 1986-04-30 | 1986-06-04 | Smith Kline French Lab | Chemical compounds |
| GB8621425D0 (en) * | 1986-09-05 | 1986-10-15 | Smith Kline French Lab | Compounds |
| DE3722810A1 (de) * | 1987-07-10 | 1989-01-19 | Hoechst Ag | Substituierte benzimidazole, verfahren zu deren herstellung, diese enthaltende pharmazeutische zubereitungen und deren verwendung |
| NZ276412A (en) * | 1993-12-01 | 1998-02-26 | Byk Gulden Lomberg Chem Fab | Aminoalkylamino pyridines and medicaments |
| KR100833633B1 (ko) | 1999-06-07 | 2008-05-30 | 니코메드 게엠베하 | 산에 불안정한 활성 화합물을 포함하는 신규 제제 및 투여형태 |
| EP2336133A1 (en) | 2001-10-30 | 2011-06-22 | Conforma Therapeutics Corporation | Purine analogs having HSP90-inhibiting activity |
| CA2529984C (en) | 2003-06-26 | 2012-09-25 | Isa Odidi | Oral multi-functional pharmaceutical capsule preparations of proton pump inhibitors |
| EA010160B1 (ru) | 2003-09-18 | 2008-06-30 | Конформа Терапьютикс Корпорейшн | Новые гетероциклические соединения - ингибиторы hsp90 и способы их получения |
| US8394409B2 (en) | 2004-07-01 | 2013-03-12 | Intellipharmaceutics Corp. | Controlled extended drug release technology |
| US10624858B2 (en) | 2004-08-23 | 2020-04-21 | Intellipharmaceutics Corp | Controlled release composition using transition coating, and method of preparing same |
| NZ561939A (en) * | 2005-03-30 | 2011-03-31 | Conforma Therapeutics Corp | Alkynyl pyrrolopyrimidines and related analogs as HSP90-inhibitors |
| US10064828B1 (en) | 2005-12-23 | 2018-09-04 | Intellipharmaceutics Corp. | Pulsed extended-pulsed and extended-pulsed pulsed drug delivery systems |
| JP5457830B2 (ja) | 2006-04-03 | 2014-04-02 | オディディ,イサ | オルガノゾル被膜を含む制御放出送達デバイス |
| US10960077B2 (en) | 2006-05-12 | 2021-03-30 | Intellipharmaceutics Corp. | Abuse and alcohol resistant drug composition |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL66340A (en) * | 1981-08-13 | 1986-08-31 | Haessle Ab | Pharmaceutical compositions comprising pyridylmethyl-thiobenzimidazole derivatives,certain such novel derivatives and their preparation |
| US4575554A (en) * | 1983-12-05 | 1986-03-11 | The Upjohn Company | Substituted 2-pyridylmethylthio- and sulfinyl-benzimidazoles as gastric antisecretory agents |
| EP0174717B1 (en) * | 1984-07-06 | 1992-01-22 | FISONS plc | Benzimidazoles, and their production formulation and use as gastric acid secretion inhibitors |
| EP0178438A1 (en) * | 1984-09-19 | 1986-04-23 | Beecham Group Plc | Novel compounds |
| AU568441B2 (en) * | 1984-09-24 | 1987-12-24 | Upjohn Company, The | 2-(pyridylalkenesulfinyl) benzimidazole derivatives |
| IL76837A0 (en) * | 1984-10-31 | 1986-02-28 | Byk Gulden Lomberg Chem Fab | Benzimidazole derivatives,processes for the preparation thereof and pharmaceutical compositions containing them |
| US4851419A (en) * | 1985-10-16 | 1989-07-25 | Fisons Plc | Certain 2-pyridinyl-phenylsulfinyl-benzoxazoles, the corresponding benzothiazoles or benzimidazoles having anti-inflammatory or gastric acid secretion inhibition activity |
| EP0806002A1 (en) * | 1995-11-24 | 1997-11-12 | Koninklijke Philips Electronics N.V. | A method for presenting virtual reality enhanced with tactile stimuli, and a system for executing the method |
-
1985
- 1985-10-24 JO JO19851406A patent/JO1406B1/en active
- 1985-10-28 PH PH32987A patent/PH22303A/en unknown
- 1985-10-28 CA CA000493978A patent/CA1253150A/en not_active Expired
- 1985-10-30 ZW ZW191/85A patent/ZW19185A1/xx unknown
- 1985-10-30 AR AR85302116A patent/AR241592A1/es active
- 1985-10-30 AU AU49207/85A patent/AU576634B2/en not_active Ceased
- 1985-10-30 FI FI854267A patent/FI84718C/fi not_active IP Right Cessation
- 1985-10-31 DK DK501085A patent/DK501085A/da not_active Application Discontinuation
- 1985-10-31 EP EP85307928A patent/EP0184322B1/en not_active Expired
- 1985-10-31 ES ES548409A patent/ES8701752A1/es not_active Expired
- 1985-10-31 DE DE8585307928T patent/DE3574873D1/de not_active Expired - Lifetime
- 1985-10-31 NZ NZ214024A patent/NZ214024A/xx unknown
- 1985-10-31 PT PT81420A patent/PT81420B/pt not_active IP Right Cessation
- 1985-11-01 KR KR1019850008129A patent/KR930001410B1/ko not_active Expired - Fee Related
- 1985-11-01 HU HU854204A patent/HU200763B/hu not_active IP Right Cessation
- 1985-11-01 IE IE268485A patent/IE58587B1/en not_active IP Right Cessation
- 1985-11-01 NO NO854369A patent/NO164541C/no unknown
- 1985-11-02 CN CN85108133A patent/CN1013445B/zh not_active Expired
- 1985-11-04 GR GR852643A patent/GR852643B/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE852684L (en) | 1986-05-02 |
| EP0184322B1 (en) | 1989-12-20 |
| DE3574873D1 (en) | 1990-01-25 |
| ES8701752A1 (es) | 1986-12-01 |
| IE58587B1 (en) | 1993-10-06 |
| HUT39176A (en) | 1986-08-28 |
| NO854369L (no) | 1986-05-05 |
| NO164541C (no) | 1990-10-17 |
| NO164541B (no) | 1990-07-09 |
| DK501085D0 (da) | 1985-10-31 |
| ES548409A0 (es) | 1986-12-01 |
| CN85108133A (zh) | 1986-04-10 |
| CA1253150A (en) | 1989-04-25 |
| GR852643B (enExample) | 1986-03-05 |
| FI84718C (fi) | 1992-01-10 |
| JO1406B1 (en) | 1986-11-30 |
| ZW19185A1 (en) | 1986-05-21 |
| DK501085A (da) | 1986-05-03 |
| AR241592A1 (es) | 1992-09-30 |
| CN1013445B (zh) | 1991-08-07 |
| AU576634B2 (en) | 1988-09-01 |
| NZ214024A (en) | 1989-08-29 |
| AU4920785A (en) | 1986-05-08 |
| PT81420A (en) | 1985-11-01 |
| KR860004050A (ko) | 1986-06-16 |
| KR930001410B1 (ko) | 1993-02-27 |
| PH22303A (en) | 1988-07-22 |
| FI854267L (fi) | 1986-05-03 |
| FI854267A0 (fi) | 1985-10-30 |
| PT81420B (pt) | 1988-05-27 |
| FI84718B (fi) | 1991-09-30 |
| EP0184322A1 (en) | 1986-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU200763B (en) | Process for producing new, substituted benzimidazole derivatives and pharmaceutical compositions comprising same | |
| EP0654471B1 (en) | Pyridine derivatives, pharmaceutical compositions comprising the same, the use of the same for the manufacture of medicaments having therapeutic or preventative value, and process for preparing the same | |
| CS187391A3 (en) | Heterocyclic derivatives, process for their preparation and their use as medicaments | |
| AU8024487A (en) | Pyridinylphenylthio and pyridinylphenylsulphinyl benzimidazone derivatives | |
| US4820708A (en) | Pyrimidylalkylthio benzimidazole compounds, pharmaceutical compositions and use | |
| WO1987005021A1 (en) | Benzimidazoles and their pharmaceutical use | |
| US4859679A (en) | Antiulcer (alkyldithio) quinoline derivatives | |
| US5250527A (en) | Pyridyl containing benzimidazoles, compositions and use | |
| EP0246774A1 (en) | Chemical compounds | |
| EP0139270A2 (en) | Thiatriazine dioxides and pharmaceutical compositions containing them | |
| HU193362B (en) | Process for preparing imidazole derivatives | |
| FI80458C (fi) | Foerfarande foer framstaellning av . terapeutiskt anvaendbara tiazolo/3,2-a/bensimidazoler och 2,3-dihydroanaloger daerav. | |
| EP0194458B1 (en) | New indole derivatives, the production and uses thereof | |
| CA1339369C (en) | Antiulcer 1-benzimidazolyl-pyridinium salt and pharmacological composition containing the same | |
| US4873237A (en) | 2,3-dihydro- thiazolo- and thiazino- benzimidazoles as atni-hyper secretion agents | |
| US4179512A (en) | 4-Substituted-2-arylimidazoles | |
| US4725605A (en) | Thiazolo- and thiazino-benzimidazoles, and their use as anti-ulcer/hypersecretion agents | |
| US4567191A (en) | Amino-phenyl-thiadiazoledioxides as gastric secretion inhibitors | |
| JPS61109788A (ja) | 複素環式化合物 | |
| KR810000633B1 (ko) | 이미다졸 유도체의 제조방법 | |
| US4786636A (en) | Thiazino-benzimidazoles and their use as antiulcer agents | |
| JPH0449555B2 (enExample) | ||
| JPS61205276A (ja) | 複素環式化合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |