HU197322B - Process for producing pyridyl and quinolyl imidazolinones - Google Patents
Process for producing pyridyl and quinolyl imidazolinones Download PDFInfo
- Publication number
- HU197322B HU197322B HU832690A HU269083A HU197322B HU 197322 B HU197322 B HU 197322B HU 832690 A HU832690 A HU 832690A HU 269083 A HU269083 A HU 269083A HU 197322 B HU197322 B HU 197322B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- methyl
- isopropyl
- hydrogen
- preparation
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 21
- -1 quinolyl imidazolinones Chemical class 0.000 title claims abstract description 8
- 125000004076 pyridyl group Chemical group 0.000 title abstract description 4
- 238000002360 preparation method Methods 0.000 claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical compound O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 239000011593 sulfur Substances 0.000 claims description 8
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 7
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 150000002642 lithium compounds Chemical class 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- VNMXIHKQNXHCMP-UHFFFAOYSA-N 5-ethoxy-2-methylpyridine Chemical compound CCOC1=CC=C(C)N=C1 VNMXIHKQNXHCMP-UHFFFAOYSA-N 0.000 description 4
- DHLUJPLHLZJUBW-UHFFFAOYSA-N 6-methylpyridin-3-ol Chemical compound CC1=CC=C(O)C=N1 DHLUJPLHLZJUBW-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 230000002363 herbicidal effect Effects 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- 238000005672 Willgerodt-Kindler rearrangement reaction Methods 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- CLQMBPJKHLGMQK-UHFFFAOYSA-N 2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)nicotinic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=CC=C1C(O)=O CLQMBPJKHLGMQK-UHFFFAOYSA-N 0.000 description 2
- LGEXSBVSBJTZRZ-UHFFFAOYSA-N 2-(5-ethoxypyridin-2-yl)-4-methyl-4-propan-2-yl-1h-imidazol-5-one Chemical compound N1=CC(OCC)=CC=C1C1=NC(=O)C(C)(C(C)C)N1 LGEXSBVSBJTZRZ-UHFFFAOYSA-N 0.000 description 2
- YCPQUHCGFDFLSI-UHFFFAOYSA-N 2-amino-2,3-dimethylbutanamide Chemical compound CC(C)C(C)(N)C(N)=O YCPQUHCGFDFLSI-UHFFFAOYSA-N 0.000 description 2
- WHXCIRYFEDTNKZ-UHFFFAOYSA-N 2-methyl-5-propan-2-yloxypyridine Chemical compound CC(C)OC1=CC=C(C)N=C1 WHXCIRYFEDTNKZ-UHFFFAOYSA-N 0.000 description 2
- NTSLROIKFLNUIJ-UHFFFAOYSA-N 5-Ethyl-2-methylpyridine Chemical compound CCC1=CC=C(C)N=C1 NTSLROIKFLNUIJ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 1
- VJPWANUEKPAZNG-UHFFFAOYSA-N 2-(5-ethylpyridin-2-yl)-4-methyl-4-propan-2-yl-1h-imidazol-5-one Chemical compound N1=CC(CC)=CC=C1C1=NC(C)(C(C)C)C(=O)N1 VJPWANUEKPAZNG-UHFFFAOYSA-N 0.000 description 1
- LISKAOIANGDBTB-UHFFFAOYSA-N 2-ethoxypyridine Chemical class CCOC1=CC=CC=N1 LISKAOIANGDBTB-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- JDUFVOBDYJLABK-UHFFFAOYSA-N 4-methyl-4-propan-2-yl-2-(5-propan-2-yloxypyridin-2-yl)-1h-imidazol-5-one Chemical compound N1=CC(OC(C)C)=CC=C1C1=NC(=O)C(C)(C(C)C)N1 JDUFVOBDYJLABK-UHFFFAOYSA-N 0.000 description 1
- RAHNAFFWINHVGY-UHFFFAOYSA-N 4-methyl-4-propan-2-yl-2-pyridin-2-yl-1h-imidazol-5-one Chemical compound O=C1C(C(C)C)(C)NC(C=2N=CC=CC=2)=N1 RAHNAFFWINHVGY-UHFFFAOYSA-N 0.000 description 1
- 241001480079 Corymbia calophylla Species 0.000 description 1
- 235000006552 Liquidambar styraciflua Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- QVPQZDWEAQFKSC-UHFFFAOYSA-N ethyl 2-(4-methyl-5-oxo-4-propan-2-yl-1h-imidazol-2-yl)quinoline-3-carboxylate Chemical compound CCOC(=O)C1=CC2=CC=CC=C2N=C1C1=NC(C)(C(C)C)C(=O)N1 QVPQZDWEAQFKSC-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical class C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003556 thioamides Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US38181782A | 1982-05-25 | 1982-05-25 | |
| PCT/US1983/000722 WO1983004252A1 (en) | 1982-05-25 | 1983-05-12 | Process for the preparation of pyridyl and quinolyl imidazolinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU197322B true HU197322B (en) | 1989-03-28 |
Family
ID=23506493
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU832690A HU197322B (en) | 1982-05-25 | 1983-05-12 | Process for producing pyridyl and quinolyl imidazolinones |
Country Status (11)
| Country | Link |
|---|---|
| EP (1) | EP0095104B1 (OSRAM) |
| CA (1) | CA1256879A (OSRAM) |
| DE (1) | DE3368415D1 (OSRAM) |
| DK (1) | DK154427C (OSRAM) |
| ES (1) | ES8504764A1 (OSRAM) |
| HK (1) | HK70990A (OSRAM) |
| HU (1) | HU197322B (OSRAM) |
| IL (1) | IL68785A (OSRAM) |
| IN (1) | IN155352B (OSRAM) |
| WO (1) | WO1983004252A1 (OSRAM) |
| ZA (1) | ZA833547B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4562257A (en) * | 1983-11-07 | 1985-12-31 | American Cyanamid Company | Preparation of substituted and unsubstituted 2-carbamoyl nicotinic and 3-quinolinecarboxylic acids |
| US4748244A (en) * | 1984-05-11 | 1988-05-31 | Ciba-Geigy Corporation | Process for the preparation of pyridine-2-3-dicarboxylic acid derivatives, and novel 1-amino-1,4-dihydropyridine-2-3-diarboxylic acid derivatives |
| EP0166907A3 (en) * | 1984-06-04 | 1988-09-14 | American Cyanamid Company | Herbicidal 2-(2-imidazolin-2-yl)-fluoroalkoxy-, alkenyloxy- and alkynyloxypyridines and quinolines |
| US4709036A (en) * | 1985-06-13 | 1987-11-24 | American Cyanamid Company | Process for the preparation of herbicidal 2-(4,4-disubstituted-5-oxo-2-imidazolin-2-yl)benzoic, nicotinic and quinoline-3-carboxylic acids, esters and salts |
| CN86106435A (zh) * | 1985-09-24 | 1987-05-27 | 舍林股份公司 | 咪唑啉基衍生物,其制备方法和含有这类化合物的具有除草作用的制剂 |
| EP0227932B1 (en) * | 1985-12-13 | 1993-01-13 | American Cyanamid Company | Novel fused pyridine compounds, intermediates for the preparation of, and use of said compounds as herbicidal agents |
| GB2174395A (en) * | 1986-05-09 | 1986-11-05 | American Cyanimid Co | Herbicidal 2-(2-imidazolin-2-yl)pyridine derivatives |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL62794A0 (en) * | 1980-06-02 | 1981-07-31 | American Cyanamid Co | Substituted nicotinic acid esters and salts thereof and their use as herbicidal agents |
-
1983
- 1983-05-12 WO PCT/US1983/000722 patent/WO1983004252A1/en not_active Ceased
- 1983-05-12 HU HU832690A patent/HU197322B/hu unknown
- 1983-05-13 EP EP83104716A patent/EP0095104B1/en not_active Expired
- 1983-05-13 DE DE8383104716T patent/DE3368415D1/de not_active Expired
- 1983-05-17 ZA ZA833547A patent/ZA833547B/xx unknown
- 1983-05-20 CA CA000428596A patent/CA1256879A/en not_active Expired
- 1983-05-24 IN IN646/CAL/83A patent/IN155352B/en unknown
- 1983-05-24 ES ES522662A patent/ES8504764A1/es not_active Expired
- 1983-05-25 IL IL68785A patent/IL68785A/xx not_active IP Right Cessation
- 1983-09-08 DK DK408283A patent/DK154427C/da not_active IP Right Cessation
-
1990
- 1990-09-06 HK HK709/90A patent/HK70990A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| EP0095104B1 (en) | 1986-12-17 |
| IL68785A (en) | 1986-09-30 |
| CA1256879A (en) | 1989-07-04 |
| EP0095104A3 (en) | 1984-08-29 |
| ES522662A0 (es) | 1985-05-01 |
| ZA833547B (en) | 1984-02-29 |
| IN155352B (OSRAM) | 1985-01-19 |
| ES8504764A1 (es) | 1985-05-01 |
| IL68785A0 (en) | 1983-09-30 |
| WO1983004252A1 (en) | 1983-12-08 |
| DK154427B (da) | 1988-11-14 |
| EP0095104A2 (en) | 1983-11-30 |
| HK70990A (en) | 1990-09-14 |
| DE3368415D1 (en) | 1987-01-29 |
| DK408283D0 (da) | 1983-09-08 |
| DK154427C (da) | 1989-04-10 |
| DK408283A (da) | 1983-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69303191T2 (de) | Naphthalinderivate, ihre Herstellungsverfahren und synthetische Zwischenprodukte dafür | |
| HU195182B (en) | Process for production of /z/-1-phenil-1-diethil-amino-carbonil-2-amino-methil-cyclopropan hcl | |
| EP0249950B1 (en) | Aromatic compounds | |
| CA1066711A (en) | Thiophene derivatives | |
| DD280320A5 (de) | Herstellung von zwischenprodukten der oxophthalazinyl-essigsaeuren mit benzothiazol oder anderen heterocyclischen seitenketten | |
| HU197322B (en) | Process for producing pyridyl and quinolyl imidazolinones | |
| EP0095105B1 (en) | Process for the preparation of 2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl)-nicotinic acids, quinoline-3-carboxylic acids, and benzoic acids | |
| US6197976B1 (en) | Preparation of ketorolac | |
| NO885117L (no) | Substituerte hydroksylaminer. | |
| US3201406A (en) | Pyridylcoumarins | |
| EP0323881A1 (en) | Cyano-Dienes, Halopyridines, intermediates and a process for their preparation | |
| US4703123A (en) | Process for producing 2,3,5,6-tetrachloropyridine | |
| KR900003399B1 (ko) | 피리딜 및 퀴놀릴 이미다졸리논류의 제법 | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines | |
| US7528256B2 (en) | Process for the preparation of nicotinaldehydes | |
| DE60313124T2 (de) | Verfahren zur herstellung einer 1,2,3-triazolverbindung | |
| EP0199485B1 (en) | Intermediates and process | |
| US4526974A (en) | Synthesis of 2-pyridylalkylamines | |
| JPH06199798A (ja) | 2,3−ピリジン−ジカルボン酸の3−(2−イミダゾリン−2−イル)−ピコリン酸からの製法 | |
| CA2098982A1 (en) | Indolizine derivatives, process of preparation and use for the preparation of aminoalkoxybenzenesulphonylindolizine compounds with pharmaceutical activity | |
| JPH0665213A (ja) | ジシアノピラジン誘導体及びその製造方法 | |
| KR790001653B1 (ko) | S-트리아졸로[3, 4-b] 벤조티아졸류의 제조방법 | |
| US4804764A (en) | Process for producing 2,3,5,6-tetrachloropyridine | |
| EP0016978B1 (de) | Verfahren zur Herstellung von Nitrilen | |
| JPH06774B2 (ja) | ピロ−ル誘導体の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |