HU189152B - Fungicides containing derivatives of 1,2,4-triazol and imidazol and process for production of the derivatives of 1,2,4-triazol and imidazol - Google Patents
Fungicides containing derivatives of 1,2,4-triazol and imidazol and process for production of the derivatives of 1,2,4-triazol and imidazol Download PDFInfo
- Publication number
- HU189152B HU189152B HU823039A HU203982A HU189152B HU 189152 B HU189152 B HU 189152B HU 823039 A HU823039 A HU 823039A HU 203982 A HU203982 A HU 203982A HU 189152 B HU189152 B HU 189152B
- Authority
- HU
- Hungary
- Prior art keywords
- phenyl
- formula
- chj
- chlorophenyl
- alkyl
- Prior art date
Links
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 title claims abstract description 44
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 title claims abstract description 16
- 238000000034 method Methods 0.000 title claims description 35
- 230000008569 process Effects 0.000 title claims description 12
- 239000000417 fungicide Substances 0.000 title abstract 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 252
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 76
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 11
- AZFVLHQDIIJLJG-UHFFFAOYSA-N chloromethylsilane Chemical compound [SiH3]CCl AZFVLHQDIIJLJG-UHFFFAOYSA-N 0.000 claims abstract description 10
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 8
- -1 trifluoromethoxy, methylthio, methylsulfonyl Chemical group 0.000 claims description 836
- 229910000077 silane Inorganic materials 0.000 claims description 344
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims description 265
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 107
- 239000000203 mixture Substances 0.000 claims description 93
- 229910052739 hydrogen Inorganic materials 0.000 claims description 82
- 238000002360 preparation method Methods 0.000 claims description 67
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 64
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 47
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 43
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 42
- 239000007788 liquid Substances 0.000 claims description 41
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 41
- 239000001257 hydrogen Substances 0.000 claims description 34
- 239000004480 active ingredient Substances 0.000 claims description 31
- 239000000460 chlorine Substances 0.000 claims description 31
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 30
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 26
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 25
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 25
- 230000000855 fungicidal effect Effects 0.000 claims description 23
- 239000007787 solid Substances 0.000 claims description 23
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims description 22
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 19
- 239000004094 surface-active agent Substances 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 150000002431 hydrogen Chemical class 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 239000002904 solvent Substances 0.000 claims description 15
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 14
- 235000005074 zinc chloride Nutrition 0.000 claims description 14
- 239000011592 zinc chloride Substances 0.000 claims description 14
- UIUXUFNYAYAMOE-UHFFFAOYSA-N methylsilane Chemical compound [SiH3]C UIUXUFNYAYAMOE-UHFFFAOYSA-N 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 12
- 239000005046 Chlorosilane Substances 0.000 claims description 11
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 9
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 claims description 9
- 239000008096 xylene Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 150000003852 triazoles Chemical class 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 7
- 229910052744 lithium Inorganic materials 0.000 claims description 7
- 229910000357 manganese(II) sulfate Inorganic materials 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- SWTJWBFIVRJAKX-UHFFFAOYSA-N (2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical group C=1C=C(Cl)C=C(Cl)C=1[Si](C)(C)CN1C=CN=C1 SWTJWBFIVRJAKX-UHFFFAOYSA-N 0.000 claims description 6
- KWXICGTUELOLSQ-UHFFFAOYSA-N 4-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=C(S(O)(=O)=O)C=C1 KWXICGTUELOLSQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000005909 Kieselgur Substances 0.000 claims description 6
- LNBIIQACZWDXMO-UHFFFAOYSA-N [SiH3]CC1=CNN=N1 Chemical group [SiH3]CC1=CNN=N1 LNBIIQACZWDXMO-UHFFFAOYSA-N 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000000951 phenoxy group Chemical class [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 claims description 5
- 150000002576 ketones Chemical class 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 239000003880 polar aprotic solvent Substances 0.000 claims description 5
- 239000000377 silicon dioxide Substances 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- WVETUMYGGDVHEJ-UHFFFAOYSA-N 1H-imidazol-2-ylmethylsilane Chemical class [SiH3]CC=1NC=CN=1 WVETUMYGGDVHEJ-UHFFFAOYSA-N 0.000 claims description 4
- ZDDUSDYMEXVQNJ-UHFFFAOYSA-N 1H-imidazole silane Chemical class [SiH4].N1C=NC=C1 ZDDUSDYMEXVQNJ-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 150000004696 coordination complex Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 150000002641 lithium Chemical group 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- 239000011572 manganese Substances 0.000 claims description 2
- SQQWBSBBCSFQGC-JLHYYAGUSA-N ubiquinone-2 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CCC=C(C)C)=C(C)C1=O SQQWBSBBCSFQGC-JLHYYAGUSA-N 0.000 claims description 2
- 239000000378 calcium silicate Substances 0.000 claims 3
- 229910052918 calcium silicate Inorganic materials 0.000 claims 3
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 claims 3
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 claims 3
- YHAIUSTWZPMYGG-UHFFFAOYSA-L disodium;2,2-dioctyl-3-sulfobutanedioate Chemical compound [Na+].[Na+].CCCCCCCCC(C([O-])=O)(C(C([O-])=O)S(O)(=O)=O)CCCCCCCC YHAIUSTWZPMYGG-UHFFFAOYSA-L 0.000 claims 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 claims 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims 1
- 206010029897 Obsessive thoughts Diseases 0.000 claims 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 claims 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 241000233866 Fungi Species 0.000 abstract description 12
- 150000002460 imidazoles Chemical class 0.000 abstract description 5
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 abstract description 3
- 125000006519 CCH3 Chemical group 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 130
- 239000000243 solution Substances 0.000 description 91
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 82
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 69
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 58
- 241000196324 Embryophyta Species 0.000 description 52
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 48
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 45
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 44
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 44
- 230000005764 inhibitory process Effects 0.000 description 42
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 38
- 239000003921 oil Substances 0.000 description 37
- 235000019198 oils Nutrition 0.000 description 37
- 229910052799 carbon Inorganic materials 0.000 description 36
- 229910052757 nitrogen Inorganic materials 0.000 description 32
- 239000000725 suspension Substances 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 30
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 27
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 25
- 238000003756 stirring Methods 0.000 description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- 201000010099 disease Diseases 0.000 description 24
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 24
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 21
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 21
- 239000012267 brine Substances 0.000 description 19
- 239000004615 ingredient Substances 0.000 description 19
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 19
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 17
- 150000002148 esters Chemical class 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 238000002329 infrared spectrum Methods 0.000 description 16
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 15
- UEGISICPFLTSGM-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-(4-phenylphenyl)silane Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1[Si](C)(C)CN1C=CN=C1 UEGISICPFLTSGM-UHFFFAOYSA-N 0.000 description 15
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000000463 material Substances 0.000 description 14
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 12
- 239000004495 emulsifiable concentrate Substances 0.000 description 12
- 239000008187 granular material Substances 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 11
- 239000008213 purified water Substances 0.000 description 11
- 229920006395 saturated elastomer Polymers 0.000 description 11
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 10
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 229940125904 compound 1 Drugs 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- 239000002002 slurry Substances 0.000 description 10
- 150000005846 sugar alcohols Polymers 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 240000007594 Oryza sativa Species 0.000 description 9
- 235000007164 Oryza sativa Nutrition 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- 235000009566 rice Nutrition 0.000 description 9
- MDUSUFIKBUMDTJ-UHFFFAOYSA-N sodium;1h-1,2,4-triazole Chemical compound [Na].C=1N=CNN=1 MDUSUFIKBUMDTJ-UHFFFAOYSA-N 0.000 description 9
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 8
- 241000221785 Erysiphales Species 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 8
- 240000008042 Zea mays Species 0.000 description 8
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 8
- JAYBZWYBCUJLNQ-UHFFFAOYSA-N dichloro-(chloromethyl)-methylsilane Chemical compound C[Si](Cl)(Cl)CCl JAYBZWYBCUJLNQ-UHFFFAOYSA-N 0.000 description 8
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 8
- 239000002245 particle Substances 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 241000220225 Malus Species 0.000 description 7
- 206010039509 Scab Diseases 0.000 description 7
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- ITKVLPYNJQOCPW-UHFFFAOYSA-N chloro-(chloromethyl)-dimethylsilane Chemical compound C[Si](C)(Cl)CCl ITKVLPYNJQOCPW-UHFFFAOYSA-N 0.000 description 7
- 235000005822 corn Nutrition 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- IRXCADLSSLAOHC-UHFFFAOYSA-N (4-fluorophenyl)-(imidazol-1-ylmethyl)-methyl-phenylsilane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC(F)=CC=1)(C)CN1C=CN=C1 IRXCADLSSLAOHC-UHFFFAOYSA-N 0.000 description 6
- 244000105624 Arachis hypogaea Species 0.000 description 6
- 240000008067 Cucumis sativus Species 0.000 description 6
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- FYTPGBJPTDQJCG-UHFFFAOYSA-N Trichloro(chloromethyl)silane Chemical compound ClC[Si](Cl)(Cl)Cl FYTPGBJPTDQJCG-UHFFFAOYSA-N 0.000 description 6
- ZKJRGLZZZYNOCS-UHFFFAOYSA-N bis(4-fluorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound C=1C=C(F)C=CC=1[Si](C=1C=CC(F)=CC=1)(C)CN1C=CN=C1 ZKJRGLZZZYNOCS-UHFFFAOYSA-N 0.000 description 6
- LMOCOVGVKLBLGB-UHFFFAOYSA-N dimethyl-(4-phenylphenyl)-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1[Si](C)(C)CN1C=NC=N1 LMOCOVGVKLBLGB-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 6
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 6
- 235000020232 peanut Nutrition 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- 239000011148 porous material Substances 0.000 description 6
- BXAMLBWLMNHXBT-UHFFFAOYSA-N (2-chlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound ClC1=C(C=CC=C1)[Si](C)(C)CN1C=NC=C1 BXAMLBWLMNHXBT-UHFFFAOYSA-N 0.000 description 5
- DNLGASPJIKCPHF-UHFFFAOYSA-N (3,4-dichlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound ClC=1C=C(C=CC1Cl)[Si](C)(C)CN1C=NC=C1 DNLGASPJIKCPHF-UHFFFAOYSA-N 0.000 description 5
- XPHIPWCAAHKPPM-UHFFFAOYSA-N (4-chlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound C=1C=C(Cl)C=CC=1[Si](C)(C)CN1C=CN=C1 XPHIPWCAAHKPPM-UHFFFAOYSA-N 0.000 description 5
- NHDODQWIKUYWMW-UHFFFAOYSA-N 1-bromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1 NHDODQWIKUYWMW-UHFFFAOYSA-N 0.000 description 5
- PKJBWOWQJHHAHG-UHFFFAOYSA-N 1-bromo-4-phenylbenzene Chemical group C1=CC(Br)=CC=C1C1=CC=CC=C1 PKJBWOWQJHHAHG-UHFFFAOYSA-N 0.000 description 5
- YNCPXBIZAPNQIJ-UHFFFAOYSA-N 1h-imidazole;sodium Chemical compound [Na].C1=CNC=N1 YNCPXBIZAPNQIJ-UHFFFAOYSA-N 0.000 description 5
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 5
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 5
- 239000005947 Dimethoate Substances 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- UYCRZJCNDDMRSL-UHFFFAOYSA-N bis(2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound C=1C=C(Cl)C=C(Cl)C=1[Si](C=1C(=CC(Cl)=CC=1)Cl)(C)CN1C=CN=C1 UYCRZJCNDDMRSL-UHFFFAOYSA-N 0.000 description 5
- 238000004090 dissolution Methods 0.000 description 5
- 150000004795 grignard reagents Chemical class 0.000 description 5
- APKZRWOYEQIPIO-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-[4-(trifluoromethoxy)phenyl]silane Chemical compound C[Si](C1=CC=C(C=C1)OC(F)(F)F)(CN1C=NC=C1)C APKZRWOYEQIPIO-UHFFFAOYSA-N 0.000 description 5
- PLTQATWSYJDZIH-UHFFFAOYSA-N imidazol-1-ylmethyl-methyl-phenyl-(4-phenylphenyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC(=CC=1)C=1C=CC=CC=1)(C)CN1C=CN=C1 PLTQATWSYJDZIH-UHFFFAOYSA-N 0.000 description 5
- 239000012535 impurity Substances 0.000 description 5
- 150000002642 lithium compounds Chemical class 0.000 description 5
- QRLBICHXRCOJDU-UHFFFAOYSA-N methyl(phenyl)silane Chemical compound C[SiH2]C1=CC=CC=C1 QRLBICHXRCOJDU-UHFFFAOYSA-N 0.000 description 5
- 150000002902 organometallic compounds Chemical class 0.000 description 5
- 244000052769 pathogen Species 0.000 description 5
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 5
- 229920000056 polyoxyethylene ether Polymers 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 150000003871 sulfonates Chemical class 0.000 description 5
- 239000004563 wettable powder Substances 0.000 description 5
- VHOWJOXFSASSDA-UHFFFAOYSA-N (4-chlorophenyl)-(imidazol-1-ylmethyl)-methyl-phenylsilane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC(Cl)=CC=1)(C)CN1C=CN=C1 VHOWJOXFSASSDA-UHFFFAOYSA-N 0.000 description 4
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical group COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- 240000005979 Hordeum vulgare Species 0.000 description 4
- 235000007340 Hordeum vulgare Nutrition 0.000 description 4
- 238000000023 Kugelrohr distillation Methods 0.000 description 4
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- 241000233614 Phytophthora Species 0.000 description 4
- 231100000674 Phytotoxicity Toxicity 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 241000233639 Pythium Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 240000003768 Solanum lycopersicum Species 0.000 description 4
- 239000007983 Tris buffer Substances 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- USWHRYNGZBMJLT-UHFFFAOYSA-N [SiH3]CN1C=NC=N1 Chemical compound [SiH3]CN1C=NC=N1 USWHRYNGZBMJLT-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 235000010290 biphenyl Nutrition 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- IDNHCCMQGIDRSB-UHFFFAOYSA-N butyl-(2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound C=1C=C(Cl)C=C(Cl)C=1[Si](C)(CCCC)CN1C=CN=C1 IDNHCCMQGIDRSB-UHFFFAOYSA-N 0.000 description 4
- RUWMNVZSORIUHH-UHFFFAOYSA-N butyl-(4-chlorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound C=1C=C(Cl)C=CC=1[Si](C)(CCCC)CN1C=CN=C1 RUWMNVZSORIUHH-UHFFFAOYSA-N 0.000 description 4
- NODYWLVSRLVQPF-UHFFFAOYSA-N chloromethyl-dimethyl-(4-phenylphenyl)silane Chemical compound C1=CC([Si](C)(CCl)C)=CC=C1C1=CC=CC=C1 NODYWLVSRLVQPF-UHFFFAOYSA-N 0.000 description 4
- 229940125782 compound 2 Drugs 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 235000013399 edible fruits Nutrition 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- RHOIGZKUOQZRQF-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-(4-phenoxyphenyl)silane Chemical compound N1(C=NC=C1)C[Si](C1=CC=C(C=C1)OC1=CC=CC=C1)(C)C RHOIGZKUOQZRQF-UHFFFAOYSA-N 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- IASIJDXUZOLTAH-UHFFFAOYSA-N n-cyclopropylbenzamide Chemical compound C=1C=CC=CC=1C(=O)NC1CC1 IASIJDXUZOLTAH-UHFFFAOYSA-N 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 230000001717 pathogenic effect Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000004576 sand Substances 0.000 description 4
- 239000001587 sorbitan monostearate Substances 0.000 description 4
- 229940035048 sorbitan monostearate Drugs 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- ONAFIORJXKXDLT-UHFFFAOYSA-N (2-chlorophenyl)-(4-chlorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound ClC1=C(C=CC=C1)[Si](C)(CN1C=NC=C1)C1=CC=C(C=C1)Cl ONAFIORJXKXDLT-UHFFFAOYSA-N 0.000 description 3
- LCKJZBHNMRKRMA-UHFFFAOYSA-N (3-chlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound ClC=1C=C(C=CC1)[Si](CN1C=NC=C1)(C)C LCKJZBHNMRKRMA-UHFFFAOYSA-N 0.000 description 3
- KFDWIOTZDVXXKG-UHFFFAOYSA-N (4-bromophenyl)-(imidazol-1-ylmethyl)-methyl-phenylsilane Chemical compound BrC1=CC=C(C=C1)[Si](C1=CC=CC=C1)(C)CN1C=NC=C1 KFDWIOTZDVXXKG-UHFFFAOYSA-N 0.000 description 3
- CBNWEXXKBDWRPE-UHFFFAOYSA-N (4-chlorophenyl)-dimethyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(Cl)C=CC=1[Si](C)(C)CN1C=NC=N1 CBNWEXXKBDWRPE-UHFFFAOYSA-N 0.000 description 3
- QWECWFPOKSATSW-UHFFFAOYSA-N (4-fluorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound C=1C=C(F)C=CC=1[Si](C)(C)CN1C=CN=C1 QWECWFPOKSATSW-UHFFFAOYSA-N 0.000 description 3
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 3
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 3
- 244000144730 Amygdalus persica Species 0.000 description 3
- 235000017060 Arachis glabrata Nutrition 0.000 description 3
- 235000010777 Arachis hypogaea Nutrition 0.000 description 3
- 235000018262 Arachis monticola Nutrition 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- QZFDASJWLZHSKW-UHFFFAOYSA-N C[Si](C)(CN1C=NC=C1)C(C=C1)=CC=C1C(C=C1)=CC=C1Br Chemical compound C[Si](C)(CN1C=NC=C1)C(C=C1)=CC=C1C(C=C1)=CC=C1Br QZFDASJWLZHSKW-UHFFFAOYSA-N 0.000 description 3
- IHJOOIZGFYLOJB-UHFFFAOYSA-N C[Si](CN1C=NC=C1)(C(C=C1)=CC=C1C1=CC=CC=C1)C(C=C1)=CC=C1F Chemical compound C[Si](CN1C=NC=C1)(C(C=C1)=CC=C1C1=CC=CC=C1)C(C=C1)=CC=C1F IHJOOIZGFYLOJB-UHFFFAOYSA-N 0.000 description 3
- 208000031888 Mycoses Diseases 0.000 description 3
- 241000233622 Phytophthora infestans Species 0.000 description 3
- 235000006040 Prunus persica var persica Nutrition 0.000 description 3
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 description 3
- 238000006136 alcoholysis reaction Methods 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 229960000892 attapulgite Drugs 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- PRSYERPADPVLTR-UHFFFAOYSA-N bis(2-chlorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound ClC1=C(C=CC=C1)[Si](C)(CN1C=NC=C1)C1=C(C=CC=C1)Cl PRSYERPADPVLTR-UHFFFAOYSA-N 0.000 description 3
- PHLXURISQYZEQC-UHFFFAOYSA-N bis(4-chlorophenyl)-hydroxy-(1,2,4-triazol-4-ylmethyl)silane Chemical compound C=1C=C(Cl)C=CC=1[Si](C=1C=CC(Cl)=CC=1)(O)CN1C=NN=C1 PHLXURISQYZEQC-UHFFFAOYSA-N 0.000 description 3
- GYLOGHQSDDNAKW-UHFFFAOYSA-N bis(4-chlorophenyl)-hydroxy-(imidazol-1-ylmethyl)silane Chemical compound C=1C=C(Cl)C=CC=1[Si](C=1C=CC(Cl)=CC=1)(O)CN1C=CN=C1 GYLOGHQSDDNAKW-UHFFFAOYSA-N 0.000 description 3
- OOFPQCKKTYIVHB-UHFFFAOYSA-N butyl-(imidazol-1-ylmethyl)-methyl-(4-phenylphenyl)silane Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1[Si](C)(CCCC)CN1C=CN=C1 OOFPQCKKTYIVHB-UHFFFAOYSA-N 0.000 description 3
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 3
- ODDGQWBZRBYNBU-UHFFFAOYSA-N chloro-(chloromethyl)-methyl-phenylsilane Chemical compound ClC[Si](Cl)(C)C1=CC=CC=C1 ODDGQWBZRBYNBU-UHFFFAOYSA-N 0.000 description 3
- DCJXNQCTJCBSRT-UHFFFAOYSA-N chloromethyl-(2,4-dichlorophenyl)-dimethylsilane Chemical compound ClC[Si](C)(C)C1=CC=C(Cl)C=C1Cl DCJXNQCTJCBSRT-UHFFFAOYSA-N 0.000 description 3
- FWDXLPVOTHYLAA-UHFFFAOYSA-N chloromethyl-(4-chlorophenyl)-dimethylsilane Chemical compound ClC[Si](C)(C)C1=CC=C(Cl)C=C1 FWDXLPVOTHYLAA-UHFFFAOYSA-N 0.000 description 3
- IKDFAPHTXUQMBG-UHFFFAOYSA-N chloromethyl-phenyl-di(propan-2-yloxy)silane Chemical compound CC(C)O[Si](CCl)(OC(C)C)C1=CC=CC=C1 IKDFAPHTXUQMBG-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- OEQIEAZLCJWDRM-UHFFFAOYSA-N dichloro-(chloromethyl)-phenylsilane Chemical compound ClC[Si](Cl)(Cl)C1=CC=CC=C1 OEQIEAZLCJWDRM-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- GKWWZJFMFWLEDN-UHFFFAOYSA-N dimethyl-(4-phenylphenyl)-(1,2,4-triazol-4-ylmethyl)silane Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1[Si](C)(C)CN1C=NN=C1 GKWWZJFMFWLEDN-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 235000013312 flour Nutrition 0.000 description 3
- FQKUGOMFVDPBIZ-UHFFFAOYSA-N flusilazole Chemical compound C=1C=C(F)C=CC=1[Si](C=1C=CC(F)=CC=1)(C)CN1C=NC=N1 FQKUGOMFVDPBIZ-UHFFFAOYSA-N 0.000 description 3
- ZRALSGWEFCBTJO-UHFFFAOYSA-N guanidine group Chemical group NC(=N)N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- XVUSZJIQEFJMBH-UHFFFAOYSA-N imidazol-1-ylmethyl(dimethyl)silane Chemical compound C[SiH](CN1C=NC=C1)C XVUSZJIQEFJMBH-UHFFFAOYSA-N 0.000 description 3
- MIHMRSCKMDXHRK-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-naphthalen-1-ylsilane Chemical compound N1(C=NC=C1)C[Si](C1=CC=CC2=CC=CC=C12)(C)C MIHMRSCKMDXHRK-UHFFFAOYSA-N 0.000 description 3
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 3
- 229920005610 lignin Polymers 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 238000004806 packaging method and process Methods 0.000 description 3
- 229910052625 palygorskite Inorganic materials 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 235000011076 sorbitan monostearate Nutrition 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- DQNLETIADSEOTB-UHFFFAOYSA-N (2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-methyl-phenylsilane Chemical compound C=1C=CC=CC=1[Si](C=1C(=CC(Cl)=CC=1)Cl)(C)CN1C=CN=C1 DQNLETIADSEOTB-UHFFFAOYSA-N 0.000 description 2
- AJYDRPCDJOMQDM-UHFFFAOYSA-N (2,4-dichlorophenyl)-dimethyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(Cl)C=C(Cl)C=1[Si](C)(C)CN1C=NC=N1 AJYDRPCDJOMQDM-UHFFFAOYSA-N 0.000 description 2
- HZGQHGMJRAYWRK-UHFFFAOYSA-N (2-chlorophenyl)-(imidazol-1-ylmethyl)-methyl-phenylsilane Chemical compound ClC1=C(C=CC=C1)[Si](C1=CC=CC=C1)(C)CN1C=NC=C1 HZGQHGMJRAYWRK-UHFFFAOYSA-N 0.000 description 2
- WUTRUMPCTDSJOV-UHFFFAOYSA-N (2-chlorophenyl)-methyl-phenyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C(=CC=CC=1)Cl)(C)CN1C=NC=N1 WUTRUMPCTDSJOV-UHFFFAOYSA-N 0.000 description 2
- FAOGZKHWVYMCSM-UHFFFAOYSA-N (3,5-dichlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound ClC=1C=C(C=C(C1)Cl)[Si](CN1C=NC=C1)(C)C FAOGZKHWVYMCSM-UHFFFAOYSA-N 0.000 description 2
- ISHYFWKKWKXXPL-UHFFFAOYSA-N 1-bromo-2,4-dichlorobenzene Chemical compound ClC1=CC=C(Br)C(Cl)=C1 ISHYFWKKWKXXPL-UHFFFAOYSA-N 0.000 description 2
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 2
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- LLPKQRMDOFYSGZ-UHFFFAOYSA-N 2,5-dimethyl-1h-imidazole Chemical class CC1=CN=C(C)N1 LLPKQRMDOFYSGZ-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- FSCWZHGZWWDELK-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione Chemical compound O=C1C(C)(C=C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FSCWZHGZWWDELK-UHFFFAOYSA-N 0.000 description 2
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- 241001480061 Blumeria graminis Species 0.000 description 2
- LWLJUMBEZJHXHV-UHFFFAOYSA-N Dienochlor Chemical group ClC1=C(Cl)C(Cl)=C(Cl)C1(Cl)C1(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LWLJUMBEZJHXHV-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical group [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 241001330975 Magnaporthe oryzae Species 0.000 description 2
- 241001518731 Monilinia fructicola Species 0.000 description 2
- 241001123569 Puccinia recondita Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000813090 Rhizoctonia solani Species 0.000 description 2
- 239000004965 Silica aerogel Substances 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 241000228452 Venturia inaequalis Species 0.000 description 2
- SQHZCCVZEFNMDT-UHFFFAOYSA-N [4-(4-chlorophenoxy)phenyl]-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound ClC1=CC=C(OC2=CC=C(C=C2)[Si](CN2C=NC=C2)(C)C)C=C1 SQHZCCVZEFNMDT-UHFFFAOYSA-N 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 150000001499 aryl bromides Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 2
- IBQOEVLBWMJYRI-UHFFFAOYSA-N bis(4-bromophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound BrC1=CC=C(C=C1)[Si](C)(CN1C=NC=C1)C1=CC=C(C=C1)Br IBQOEVLBWMJYRI-UHFFFAOYSA-N 0.000 description 2
- OIYQSEZOWVWFRY-UHFFFAOYSA-N bis(4-fluorophenyl)-hydroxy-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(F)C=CC=1[Si](C=1C=CC(F)=CC=1)(O)CN1C=NC=N1 OIYQSEZOWVWFRY-UHFFFAOYSA-N 0.000 description 2
- FIEQFXQSKWPXIE-UHFFFAOYSA-N bis(4-fluorophenyl)-hydroxy-(imidazol-1-ylmethyl)silane Chemical compound C=1C=C(F)C=CC=1[Si](C=1C=CC(F)=CC=1)(O)CN1C=CN=C1 FIEQFXQSKWPXIE-UHFFFAOYSA-N 0.000 description 2
- QUQDQRSFNMHNED-UHFFFAOYSA-N butyl-(4-fluorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound C=1C=C(F)C=CC=1[Si](C)(CCCC)CN1C=CN=C1 QUQDQRSFNMHNED-UHFFFAOYSA-N 0.000 description 2
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- UZYROSQHTXHLEU-UHFFFAOYSA-N chloromethyl(diethoxymethyl)silane Chemical compound CCOC(OCC)[SiH2]CCl UZYROSQHTXHLEU-UHFFFAOYSA-N 0.000 description 2
- CUXGUIGQNYXWNZ-UHFFFAOYSA-N chloromethyl-bis(4-chlorophenyl)-propan-2-yloxysilane Chemical compound C=1C=C(Cl)C=CC=1[Si](CCl)(OC(C)C)C1=CC=C(Cl)C=C1 CUXGUIGQNYXWNZ-UHFFFAOYSA-N 0.000 description 2
- SPFTYBCGSWVBBX-UHFFFAOYSA-N chloromethyl-bis(4-fluorophenyl)-methylsilane Chemical compound C=1C=C(F)C=CC=1[Si](CCl)(C)C1=CC=C(F)C=C1 SPFTYBCGSWVBBX-UHFFFAOYSA-N 0.000 description 2
- BTHRKRFBCGODJD-UHFFFAOYSA-N chloromethyl-bis(4-fluorophenyl)-propan-2-yloxysilane Chemical compound C=1C=C(F)C=CC=1[Si](CCl)(OC(C)C)C1=CC=C(F)C=C1 BTHRKRFBCGODJD-UHFFFAOYSA-N 0.000 description 2
- SANZAVBIGLGYIV-UHFFFAOYSA-N chloromethyl-methyl-(4-phenylphenyl)-propan-2-yloxysilane Chemical compound C1=CC([Si](C)(CCl)OC(C)C)=CC=C1C1=CC=CC=C1 SANZAVBIGLGYIV-UHFFFAOYSA-N 0.000 description 2
- UFNFZICFSWKUBV-UHFFFAOYSA-N chloromethyl-methyl-[(2-methylpropan-2-yl)oxy]-phenylsilane Chemical compound CC(C)(C)O[Si](C)(CCl)C1=CC=CC=C1 UFNFZICFSWKUBV-UHFFFAOYSA-N 0.000 description 2
- PFIADAMVCJPXSF-UHFFFAOYSA-N chloroneb Chemical compound COC1=CC(Cl)=C(OC)C=C1Cl PFIADAMVCJPXSF-UHFFFAOYSA-N 0.000 description 2
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 2
- SBPBAQFWLVIOKP-UHFFFAOYSA-N chlorpyrifos Chemical compound CCOP(=S)(OCC)OC1=NC(Cl)=C(Cl)C=C1Cl SBPBAQFWLVIOKP-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 235000012343 cottonseed oil Nutrition 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 description 2
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 2
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical compound Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 2
- UOAMTSKGCBMZTC-UHFFFAOYSA-N dicofol Chemical compound C=1C=C(Cl)C=CC=1C(C(Cl)(Cl)Cl)(O)C1=CC=C(Cl)C=C1 UOAMTSKGCBMZTC-UHFFFAOYSA-N 0.000 description 2
- SJBYRTSLDOLKSW-UHFFFAOYSA-N dimethyl(1,2,4-triazol-1-ylmethyl)silane Chemical compound C[SiH](CN1N=CN=C1)C SJBYRTSLDOLKSW-UHFFFAOYSA-N 0.000 description 2
- VDGCPNKYYHJHPX-UHFFFAOYSA-N dimethyl-phenyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=CC=CC=1[Si](C)(C)CN1C=NC=N1 VDGCPNKYYHJHPX-UHFFFAOYSA-N 0.000 description 2
- UBHZUDXTHNMNLD-UHFFFAOYSA-N dimethylsilane Chemical compound C[SiH2]C UBHZUDXTHNMNLD-UHFFFAOYSA-N 0.000 description 2
- 231100000676 disease causative agent Toxicity 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- ZHQOBRBFIPYJDV-UHFFFAOYSA-N dodecyl-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound C(CCCCCCCCCCC)[Si](CN1C=NC=C1)(C)C ZHQOBRBFIPYJDV-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- NYPJDWWKZLNGGM-UHFFFAOYSA-N fenvalerate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 2
- 239000010440 gypsum Substances 0.000 description 2
- 229910052602 gypsum Inorganic materials 0.000 description 2
- 230000003054 hormonal effect Effects 0.000 description 2
- CSBFCGYXQVPIAG-UHFFFAOYSA-N imidazol-1-ylmethyl(methyl)silane Chemical compound C[SiH2]CN1C=CN=C1 CSBFCGYXQVPIAG-UHFFFAOYSA-N 0.000 description 2
- MUBLROVYVCBHMA-UHFFFAOYSA-N imidazol-1-ylmethyl-(2-methoxyphenyl)-dimethylsilane Chemical compound N1(C=NC=C1)C[Si](C)(C)C1=C(C=CC=C1)OC MUBLROVYVCBHMA-UHFFFAOYSA-N 0.000 description 2
- VXVKPUDMOPVVIB-UHFFFAOYSA-N imidazol-1-ylmethyl-(4-methoxyphenyl)-dimethylsilane Chemical compound C[Si](C1=CC=C(C=C1)OC)(CN1C=NC=C1)C VXVKPUDMOPVVIB-UHFFFAOYSA-N 0.000 description 2
- XPOOYXIWBVIBID-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-(2-phenylphenyl)silane Chemical compound C1(=C(C=CC=C1)[Si](CN1C=NC=C1)(C)C)C1=CC=CC=C1 XPOOYXIWBVIBID-UHFFFAOYSA-N 0.000 description 2
- DKHLHQNANAHEHE-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-[4-(trifluoromethyl)phenyl]silane Chemical compound C[Si](C1=CC=C(C=C1)C(F)(F)F)(CN1C=NC=C1)C DKHLHQNANAHEHE-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 229910052740 iodine Chemical group 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- FPWIOZYGMQJYQR-UHFFFAOYSA-N methyl-[(2-methylpropan-2-yl)oxy]-phenyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=CC=CC=1[Si](C)(OC(C)(C)C)CN1C=NC=N1 FPWIOZYGMQJYQR-UHFFFAOYSA-N 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- PARWUHTVGZSQPD-UHFFFAOYSA-N phenylsilane Chemical compound [SiH3]C1=CC=CC=C1 PARWUHTVGZSQPD-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 2
- 229910052939 potassium sulfate Inorganic materials 0.000 description 2
- 239000001120 potassium sulphate Substances 0.000 description 2
- 235000011151 potassium sulphates Nutrition 0.000 description 2
- 229910052903 pyrophyllite Inorganic materials 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 150000004756 silanes Chemical class 0.000 description 2
- 150000003377 silicon compounds Chemical class 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 2
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 2
- 229960002447 thiram Drugs 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- XERJKGMBORTKEO-VZUCSPMQSA-N (1e)-2-(ethylcarbamoylamino)-n-methoxy-2-oxoethanimidoyl cyanide Chemical compound CCNC(=O)NC(=O)C(\C#N)=N\OC XERJKGMBORTKEO-VZUCSPMQSA-N 0.000 description 1
- NJVRICHPXIZRBT-UHFFFAOYSA-N (2,3-dimethoxyphenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound COC1=C(C=CC=C1OC)[Si](C)(C)CN1C=NC=C1 NJVRICHPXIZRBT-UHFFFAOYSA-N 0.000 description 1
- SMVSAGVAYXULKT-UHFFFAOYSA-N (2,6-dimethoxyphenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound COC1=C(C(=CC=C1)OC)[Si](CN1C=NC=C1)(C)C SMVSAGVAYXULKT-UHFFFAOYSA-N 0.000 description 1
- HJTIQCYTXZBDGU-UHFFFAOYSA-N (2-chlorophenyl)-dimethyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=CC=C(Cl)C=1[Si](C)(C)CN1C=NC=N1 HJTIQCYTXZBDGU-UHFFFAOYSA-N 0.000 description 1
- YOLVBJUSDXESQT-LSLKUGRBSA-N (2S)-2-amino-N-(1-diphenoxyphosphorylethyl)propanamide Chemical compound C=1C=CC=CC=1OP(=O)(C(C)NC(=O)[C@@H](N)C)OC1=CC=CC=C1 YOLVBJUSDXESQT-LSLKUGRBSA-N 0.000 description 1
- DCKMLTZRJPQNBU-UHFFFAOYSA-N (3,4-dichlorophenyl)-dimethyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(Cl)C(Cl)=CC=1[Si](C)(C)CN1C=NC=N1 DCKMLTZRJPQNBU-UHFFFAOYSA-N 0.000 description 1
- OMOURLPPGDKFMZ-UHFFFAOYSA-N (3,5-dimethyl-1,2,4-triazol-1-yl)methyl-bis(4-fluorophenyl)-methylsilane Chemical compound N1=C(C)N=C(C)N1C[Si](C)(C=1C=CC(F)=CC=1)C1=CC=C(F)C=C1 OMOURLPPGDKFMZ-UHFFFAOYSA-N 0.000 description 1
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- FHPKWQGOQVYTBY-UHFFFAOYSA-N (4-bromophenyl)-(chloromethyl)-dimethylsilane Chemical compound ClC[Si](C)(C)C1=CC=C(Br)C=C1 FHPKWQGOQVYTBY-UHFFFAOYSA-N 0.000 description 1
- SEUGTULZDSBCLB-UHFFFAOYSA-N (4-bromophenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound BrC1=CC=C(C=C1)[Si](C)(C)CN1C=NC=C1 SEUGTULZDSBCLB-UHFFFAOYSA-N 0.000 description 1
- DOKJLVMGSDMFDO-UHFFFAOYSA-N (4-bromophenyl)-dimethyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(Br)C=CC=1[Si](C)(C)CN1C=NC=N1 DOKJLVMGSDMFDO-UHFFFAOYSA-N 0.000 description 1
- AFHZBEICQRBFAC-UHFFFAOYSA-N (4-bromophenyl)-methyl-phenyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound BrC1=CC=C(C=C1)[Si](CN1N=CN=C1)(C1=CC=CC=C1)C AFHZBEICQRBFAC-UHFFFAOYSA-N 0.000 description 1
- ULLXMTBSPPHVTB-UHFFFAOYSA-N (4-methoxyphenyl)-dimethyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C1=CC(OC)=CC=C1[Si](C)(C)CN1N=CN=C1 ULLXMTBSPPHVTB-UHFFFAOYSA-N 0.000 description 1
- RRZIWENZSDIKBF-UHFFFAOYSA-N (4-tert-butylphenyl)-(imidazol-1-ylmethyl)-dimethylsilane Chemical compound CC(C)(C)C1=CC=C(C=C1)[Si](C)(C)CN1C=NC=C1 RRZIWENZSDIKBF-UHFFFAOYSA-N 0.000 description 1
- GQXHLFBSLLQYCJ-UHFFFAOYSA-N (diphenyl-lambda4-sulfanylidene)-ethoxy-dihydroxy-lambda5-phosphane Chemical compound CCOP(=S(C1=CC=CC=C1)C2=CC=CC=C2)(O)O GQXHLFBSLLQYCJ-UHFFFAOYSA-N 0.000 description 1
- AQKJHZKWTDKLJH-UHFFFAOYSA-N (propan-2-ylamino)phosphonic acid Chemical compound CC(C)NP(O)(O)=O AQKJHZKWTDKLJH-UHFFFAOYSA-N 0.000 description 1
- CDASTHKGLSHGJZ-ARJAWSKDSA-N (z)-3-hydroxy-n-methylbut-2-enamide Chemical compound CNC(=O)\C=C(\C)O CDASTHKGLSHGJZ-ARJAWSKDSA-N 0.000 description 1
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 1
- 125000001401 1,2,4-triazol-4-yl group Chemical group N=1N=C([H])N([*])C=1[H] 0.000 description 1
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 description 1
- OJAWOLWHEQUTDE-UHFFFAOYSA-N 1,4-dimethyltriazole Chemical class CC1=CN(C)N=N1 OJAWOLWHEQUTDE-UHFFFAOYSA-N 0.000 description 1
- VGPIBGGRCVEHQZ-UHFFFAOYSA-N 1-(biphenyl-4-yloxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)OC(C=C1)=CC=C1C1=CC=CC=C1 VGPIBGGRCVEHQZ-UHFFFAOYSA-N 0.000 description 1
- QBELEDRHMPMKHP-UHFFFAOYSA-N 1-bromo-2-chlorobenzene Chemical compound ClC1=CC=CC=C1Br QBELEDRHMPMKHP-UHFFFAOYSA-N 0.000 description 1
- AITNMTXHTIIIBB-UHFFFAOYSA-N 1-bromo-4-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1 AITNMTXHTIIIBB-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- MHMCELLJRUQCBR-UHFFFAOYSA-N 1H-imidazole methylsilane Chemical class C[SiH3].N1C=NC=C1 MHMCELLJRUQCBR-UHFFFAOYSA-N 0.000 description 1
- OUXRTBCXTRSPDD-UHFFFAOYSA-N 1h-pyrrole;sodium Chemical compound [Na].C=1C=CNC=1 OUXRTBCXTRSPDD-UHFFFAOYSA-N 0.000 description 1
- PTBPTNCGZUOCBK-UHFFFAOYSA-N 2,4,5-trimethyl-1h-imidazole Chemical class CC1=NC(C)=C(C)N1 PTBPTNCGZUOCBK-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- WYFBFQVQWJOPHB-UHFFFAOYSA-N 2,6-dichloro-4-nitroaniline;molecular chlorine Chemical compound ClCl.NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl WYFBFQVQWJOPHB-UHFFFAOYSA-N 0.000 description 1
- WEEMDRWIKYCTQM-UHFFFAOYSA-N 2,6-dimethoxybenzenecarbothioamide Chemical compound COC1=CC=CC(OC)=C1C(N)=S WEEMDRWIKYCTQM-UHFFFAOYSA-N 0.000 description 1
- UPTVJAJPBGIRLZ-UHFFFAOYSA-N 2-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical compound C1CC=CC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 UPTVJAJPBGIRLZ-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- BVLNZSXJDSJRAH-UHFFFAOYSA-N 2-methyl-1h-imidazole;sodium Chemical compound [Na].CC1=NC=CN1 BVLNZSXJDSJRAH-UHFFFAOYSA-N 0.000 description 1
- ZRDUSMYWDRPZRM-UHFFFAOYSA-N 2-sec-butyl-4,6-dinitrophenyl 3-methylbut-2-enoate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C=C(C)C ZRDUSMYWDRPZRM-UHFFFAOYSA-N 0.000 description 1
- AEDKVRCTAMEXHJ-UHFFFAOYSA-N 3-chloro-5-methyl-1h-1,2,4-triazole Chemical compound CC1=NC(Cl)=NN1 AEDKVRCTAMEXHJ-UHFFFAOYSA-N 0.000 description 1
- YYPNJNDODFVZLE-UHFFFAOYSA-N 3-methylbut-2-enoic acid Chemical compound CC(C)=CC(O)=O YYPNJNDODFVZLE-UHFFFAOYSA-N 0.000 description 1
- YSWBFLWKAIRHEI-UHFFFAOYSA-N 4,5-dimethyl-1h-imidazole Chemical class CC=1N=CNC=1C YSWBFLWKAIRHEI-UHFFFAOYSA-N 0.000 description 1
- VALUMXGSLBMNES-UHFFFAOYSA-N 4,5-dimethyl-2h-triazole Chemical class CC=1N=NNC=1C VALUMXGSLBMNES-UHFFFAOYSA-N 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- PZKFSRWSQOQYNR-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazole Chemical class CC1=NC=NN1 PZKFSRWSQOQYNR-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical group NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 241000228438 Bipolaris maydis Species 0.000 description 1
- BYZGQSWHDBMVOV-UHFFFAOYSA-N CC1=C(C=CN1)[SiH3] Chemical class CC1=C(C=CN1)[SiH3] BYZGQSWHDBMVOV-UHFFFAOYSA-N 0.000 description 1
- JAAICTSYEIBHTG-UHFFFAOYSA-N CCC(NC=C1)=C1[SiH3] Chemical class CCC(NC=C1)=C1[SiH3] JAAICTSYEIBHTG-UHFFFAOYSA-N 0.000 description 1
- JEJJPHKCGDJASG-UHFFFAOYSA-N CN(C)C1=NC(C)=C(C)C(CN(C)C(O)=O)=N1 Chemical compound CN(C)C1=NC(C)=C(C)C(CN(C)C(O)=O)=N1 JEJJPHKCGDJASG-UHFFFAOYSA-N 0.000 description 1
- DVUXYTKCSCFAEB-UHFFFAOYSA-N CO[Si](C)(CN1C=NC=N1)C2=CC=C(C=C2)C3=CC=CC=C3 Chemical compound CO[Si](C)(CN1C=NC=N1)C2=CC=C(C=C2)C3=CC=CC=C3 DVUXYTKCSCFAEB-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000005747 Chlorothalonil Substances 0.000 description 1
- 239000005944 Chlorpyrifos Substances 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- RWAADBZWQGAKMD-UHFFFAOYSA-K Cl[Zn](Cl)Cl Chemical compound Cl[Zn](Cl)Cl RWAADBZWQGAKMD-UHFFFAOYSA-K 0.000 description 1
- 240000009226 Corylus americana Species 0.000 description 1
- 235000001543 Corylus americana Nutrition 0.000 description 1
- 235000007466 Corylus avellana Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- 239000005946 Cypermethrin Substances 0.000 description 1
- 239000005892 Deltamethrin Substances 0.000 description 1
- 239000005766 Dodine Substances 0.000 description 1
- 239000005958 Fenamiphos (aka phenamiphos) Substances 0.000 description 1
- 239000005789 Folpet Substances 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- SSMBXPJYHMZLOJ-UHFFFAOYSA-N Isopropyl phenylacetate Chemical compound CC(C)OC(=O)CC1=CC=CC=C1 SSMBXPJYHMZLOJ-UHFFFAOYSA-N 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 1
- 239000005807 Metalaxyl Substances 0.000 description 1
- 239000005916 Methomyl Substances 0.000 description 1
- ZRIKZVLHMGYCIR-NSHDSACASA-N N-(2,6-Dimethylphenyl)-N-(methoxyacetyl) alanine Chemical compound COCC(=O)N([C@@H](C)C(O)=O)C1=C(C)C=CC=C1C ZRIKZVLHMGYCIR-NSHDSACASA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 241000346285 Ostrinia furnacalis Species 0.000 description 1
- 239000005950 Oxamyl Substances 0.000 description 1
- 239000004100 Oxytetracycline Substances 0.000 description 1
- 241000315044 Passalora arachidicola Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241001149949 Phytophthora cactorum Species 0.000 description 1
- 241000233645 Phytophthora nicotianae Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 239000005842 Thiophanate-methyl Substances 0.000 description 1
- CRPUJAZIXJMDBK-UHFFFAOYSA-N Toxaphene Natural products C1CC2C(=C)C(C)(C)C1C2 CRPUJAZIXJMDBK-UHFFFAOYSA-N 0.000 description 1
- 241000221577 Uromyces appendiculatus Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- GQGJLSZBEQFHFN-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]silane Chemical compound FC(F)(F)C1=CC=CC=C1[SiH3] GQGJLSZBEQFHFN-UHFFFAOYSA-N 0.000 description 1
- FCVVKZBSXSRCNM-UHFFFAOYSA-N [2-chloro-1-(2,4,5-trichlorophenyl)ethyl] dihydrogen phosphate Chemical compound OP(O)(=O)OC(CCl)C1=CC(Cl)=C(Cl)C=C1Cl FCVVKZBSXSRCNM-UHFFFAOYSA-N 0.000 description 1
- ANHANWPLIUVLOS-UHFFFAOYSA-N [4-(4-chlorophenoxy)phenyl]-dimethyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(OC=2C=CC(Cl)=CC=2)C=CC=1[Si](C)(C)CN1C=NC=N1 ANHANWPLIUVLOS-UHFFFAOYSA-N 0.000 description 1
- INISTDXBRIBGOC-CGAIIQECSA-N [cyano-(3-phenoxyphenyl)methyl] (2s)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoate Chemical compound N([C@@H](C(C)C)C(=O)OC(C#N)C=1C=C(OC=2C=CC=CC=2)C=CC=1)C1=CC=C(C(F)(F)F)C=C1Cl INISTDXBRIBGOC-CGAIIQECSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052789 astatine Inorganic materials 0.000 description 1
- CJJOSEISRRTUQB-UHFFFAOYSA-N azinphos-methyl Chemical group C1=CC=C2C(=O)N(CSP(=S)(OC)OC)N=NC2=C1 CJJOSEISRRTUQB-UHFFFAOYSA-N 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- DFYXTJDLWUOYQC-UHFFFAOYSA-N bis(2-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound FC1=C(C=CC=C1)[Si](CN1N=CN=C1)(C)C1=C(C=CC=C1)F DFYXTJDLWUOYQC-UHFFFAOYSA-N 0.000 description 1
- XPXCGUHFIIYMNZ-UHFFFAOYSA-N bis(4-chlorophenyl)-(imidazol-1-ylmethyl)-methylsilane Chemical compound C=1C=C(Cl)C=CC=1[Si](C=1C=CC(Cl)=CC=1)(C)CN1C=CN=C1 XPXCGUHFIIYMNZ-UHFFFAOYSA-N 0.000 description 1
- PFBGYJBPQPUERL-UHFFFAOYSA-N bis(4-chlorophenyl)-hydroxy-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(Cl)C=CC=1[Si](C=1C=CC(Cl)=CC=1)(O)CN1C=NC=N1 PFBGYJBPQPUERL-UHFFFAOYSA-N 0.000 description 1
- GTVJTVNOGXNWGR-UHFFFAOYSA-N bis(4-chlorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(Cl)C=CC=1[Si](C=1C=CC(Cl)=CC=1)(C)CN1C=NC=N1 GTVJTVNOGXNWGR-UHFFFAOYSA-N 0.000 description 1
- ALRBSLUQPNZWNH-UHFFFAOYSA-N bis(4-fluorophenyl)methyl-(chloromethyl)silane Chemical compound C1=CC(F)=CC=C1C([SiH2]CCl)C1=CC=C(F)C=C1 ALRBSLUQPNZWNH-UHFFFAOYSA-N 0.000 description 1
- OIPMQULDKWSNGX-UHFFFAOYSA-N bis[[ethoxy(oxo)phosphaniumyl]oxy]alumanyloxy-ethoxy-oxophosphanium Chemical compound [Al+3].CCO[P+]([O-])=O.CCO[P+]([O-])=O.CCO[P+]([O-])=O OIPMQULDKWSNGX-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- XEYDTPFVYTVHTI-UHFFFAOYSA-N bromomethylsilane Chemical class [SiH3]CBr XEYDTPFVYTVHTI-UHFFFAOYSA-N 0.000 description 1
- VQPFDLRNOCQMSN-UHFFFAOYSA-N bromosilane Chemical class Br[SiH3] VQPFDLRNOCQMSN-UHFFFAOYSA-N 0.000 description 1
- AHTAYUKSDBGYDS-UHFFFAOYSA-N butyl-(chloromethyl)-(4-chlorophenyl)-methylsilane Chemical compound CCCC[Si](C)(CCl)C1=CC=C(Cl)C=C1 AHTAYUKSDBGYDS-UHFFFAOYSA-N 0.000 description 1
- WEERWSVMQUNJFG-UHFFFAOYSA-N butyl-(chloromethyl)-methyl-(4-phenylphenyl)silane Chemical compound C1=CC([Si](C)(CCl)CCCC)=CC=C1C1=CC=CC=C1 WEERWSVMQUNJFG-UHFFFAOYSA-N 0.000 description 1
- IHSNNSQIGITTGP-UHFFFAOYSA-N butyl-chloro-(chloromethyl)-methylsilane Chemical compound CCCC[Si](C)(Cl)CCl IHSNNSQIGITTGP-UHFFFAOYSA-N 0.000 description 1
- PTFUQMVBXATCHZ-UHFFFAOYSA-N butyl-methyl-(4-phenylphenyl)-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1[Si](C)(CCCC)CN1C=NC=N1 PTFUQMVBXATCHZ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-L calcium bis(dihydrogenphosphate) Chemical compound [Ca+2].OP(O)([O-])=O.OP(O)([O-])=O YYRMJZQKEFZXMX-UHFFFAOYSA-L 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- 229960005286 carbaryl Drugs 0.000 description 1
- 239000006013 carbendazim Substances 0.000 description 1
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- BWROMPNXPAWQEP-UHFFFAOYSA-N chloro(chloromethyl)silane Chemical compound ClC[SiH2]Cl BWROMPNXPAWQEP-UHFFFAOYSA-N 0.000 description 1
- PQUOVFXWJWTLSC-UHFFFAOYSA-N chloro-(chloromethyl)-diethylsilane Chemical compound CC[Si](Cl)(CC)CCl PQUOVFXWJWTLSC-UHFFFAOYSA-N 0.000 description 1
- WWFQYKQQJYQONI-UHFFFAOYSA-N chloro-(chloromethyl)-methyl-(4-phenylphenyl)silane Chemical compound C1=CC([Si](Cl)(CCl)C)=CC=C1C1=CC=CC=C1 WWFQYKQQJYQONI-UHFFFAOYSA-N 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- HZWZGJQFUHYQOD-UHFFFAOYSA-N chloromethyl(dichloromethyl)silane Chemical compound ClC[SiH2]C(Cl)Cl HZWZGJQFUHYQOD-UHFFFAOYSA-N 0.000 description 1
- LVHAZMHLTAPPSM-UHFFFAOYSA-N chloromethyl(diethyl)silane Chemical compound CC[SiH](CC)CCl LVHAZMHLTAPPSM-UHFFFAOYSA-N 0.000 description 1
- TWLQFXVRXFUAMZ-UHFFFAOYSA-N chloromethyl(triphenyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(CCl)C1=CC=CC=C1 TWLQFXVRXFUAMZ-UHFFFAOYSA-N 0.000 description 1
- HYVOGAHMTCHMJR-UHFFFAOYSA-N chloromethyl-(2,4-dichlorophenyl)-methyl-phenylsilane Chemical compound C=1C=C(Cl)C=C(Cl)C=1[Si](CCl)(C)C1=CC=CC=C1 HYVOGAHMTCHMJR-UHFFFAOYSA-N 0.000 description 1
- QQGGWWRJMUZNLI-UHFFFAOYSA-N chloromethyl-(2,6-dimethoxyphenyl)-dimethylsilane Chemical compound COC1=CC=CC(OC)=C1[Si](C)(C)CCl QQGGWWRJMUZNLI-UHFFFAOYSA-N 0.000 description 1
- BMNXBAMJHBGHBZ-UHFFFAOYSA-N chloromethyl-(2-chlorophenyl)-[(4-chlorophenyl)methyl]silane Chemical compound C=1C=CC=C(Cl)C=1[SiH](CCl)CC1=CC=C(Cl)C=C1 BMNXBAMJHBGHBZ-UHFFFAOYSA-N 0.000 description 1
- KWFFBEGXPBVOCN-UHFFFAOYSA-N chloromethyl-bis(4-chlorophenyl)-methylsilane Chemical compound C=1C=C(Cl)C=CC=1[Si](CCl)(C)C1=CC=C(Cl)C=C1 KWFFBEGXPBVOCN-UHFFFAOYSA-N 0.000 description 1
- QMBUWQNAJVPKHS-UHFFFAOYSA-N chloromethyl-dimethoxy-phenylsilane Chemical compound CO[Si](CCl)(OC)C1=CC=CC=C1 QMBUWQNAJVPKHS-UHFFFAOYSA-N 0.000 description 1
- RJCTVFQQNCNBHG-UHFFFAOYSA-N chloromethyl-dimethyl-phenylsilane Chemical compound ClC[Si](C)(C)C1=CC=CC=C1 RJCTVFQQNCNBHG-UHFFFAOYSA-N 0.000 description 1
- WSKSTGFRMBBCEL-UHFFFAOYSA-N chloromethyl-ethoxy-methyl-phenylsilane Chemical compound CCO[Si](C)(CCl)C1=CC=CC=C1 WSKSTGFRMBBCEL-UHFFFAOYSA-N 0.000 description 1
- SSQOSTRUDOUBJZ-UHFFFAOYSA-N chloromethyl-methyl-diphenylsilane Chemical compound C=1C=CC=CC=1[Si](CCl)(C)C1=CC=CC=C1 SSQOSTRUDOUBJZ-UHFFFAOYSA-N 0.000 description 1
- MDIQXIJPQWLFSD-NJGYIYPDSA-N cis-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(O)=O MDIQXIJPQWLFSD-NJGYIYPDSA-N 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 229960005424 cypermethrin Drugs 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 229960002483 decamethrin Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- OWZREIFADZCYQD-NSHGMRRFSA-N deltamethrin Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-NSHGMRRFSA-N 0.000 description 1
- WEBQKRLKWNIYKK-UHFFFAOYSA-N demeton-S-methyl Chemical compound CCSCCSP(=O)(OC)OC WEBQKRLKWNIYKK-UHFFFAOYSA-N 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- DUQONQNLRDLMEN-UHFFFAOYSA-N dibutyl-(chloromethyl)-methylsilane Chemical compound CCCC[Si](C)(CCl)CCCC DUQONQNLRDLMEN-UHFFFAOYSA-N 0.000 description 1
- NPYRNNDTSBRCSK-UHFFFAOYSA-N dichloro(chloromethyl)silane Chemical class ClC[SiH](Cl)Cl NPYRNNDTSBRCSK-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- KLXFSKITMRWDPM-UHFFFAOYSA-N diethyl 2-sulfanylbutanedioate Chemical compound CCOC(=O)CC(S)C(=O)OCC KLXFSKITMRWDPM-UHFFFAOYSA-N 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- WWJJVKAEQGGYHJ-UHFFFAOYSA-N dimethyl thiophosphate Chemical compound COP(O)(=S)OC WWJJVKAEQGGYHJ-UHFFFAOYSA-N 0.000 description 1
- WAPLPCNKWBKIRZ-UHFFFAOYSA-N dimethyl-(1,2,4-triazol-1-ylmethyl)-[4-(trifluoromethyl)phenyl]silane Chemical compound C=1C=C(C(F)(F)F)C=CC=1[Si](C)(C)CN1C=NC=N1 WAPLPCNKWBKIRZ-UHFFFAOYSA-N 0.000 description 1
- SLCJQIBAFJDZBP-UHFFFAOYSA-N dimethyl-(4-methylphenyl)silane Chemical compound C[SiH](C)C1=CC=C(C)C=C1 SLCJQIBAFJDZBP-UHFFFAOYSA-N 0.000 description 1
- TZMAWNIPMMOYJU-UHFFFAOYSA-N dimethyl-(4-methylsulfanylphenyl)-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C1=CC(SC)=CC=C1[Si](C)(C)CN1N=CN=C1 TZMAWNIPMMOYJU-UHFFFAOYSA-N 0.000 description 1
- OFTIJJTZXOSDDW-UHFFFAOYSA-N dimethyl-[(3-methyl-1,2,4-triazol-1-yl)methyl]silane Chemical compound C[SiH](CN1N=C(N=C1)C)C OFTIJJTZXOSDDW-UHFFFAOYSA-N 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- AARJUIWTWZTQBC-UHFFFAOYSA-L dithiocarboxyazanide ethene manganese(2+) Chemical compound C=C.SC(=S)N[Mn]NC(S)=S AARJUIWTWZTQBC-UHFFFAOYSA-L 0.000 description 1
- KWKXNDCHNDYVRT-UHFFFAOYSA-N dodecylbenzene Chemical compound CCCCCCCCCCCCC1=CC=CC=C1 KWKXNDCHNDYVRT-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- AWZOLILCOUMRDG-UHFFFAOYSA-N edifenphos Chemical compound C=1C=CC=CC=1SP(=O)(OCC)SC1=CC=CC=C1 AWZOLILCOUMRDG-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- ZCJPOPBZHLUFHF-UHFFFAOYSA-N fenamiphos Chemical compound CCOP(=O)(NC(C)C)OC1=CC=C(SC)C(C)=C1 ZCJPOPBZHLUFHF-UHFFFAOYSA-N 0.000 description 1
- 239000010248 fenbid Substances 0.000 description 1
- HOXINJBQVZWYGZ-UHFFFAOYSA-N fenbutatin oxide Chemical compound C=1C=CC=CC=1C(C)(C)C[Sn](O[Sn](CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C1=CC=CC=C1 HOXINJBQVZWYGZ-UHFFFAOYSA-N 0.000 description 1
- 244000037666 field crops Species 0.000 description 1
- GBIHOLCMZGAKNG-UHFFFAOYSA-N flucythrinate Chemical compound C=1C=C(OC(F)F)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 GBIHOLCMZGAKNG-UHFFFAOYSA-N 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 231100000508 hormonal effect Toxicity 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
- IJMBMNUSLCKPRO-UHFFFAOYSA-N imidazol-1-ylmethyl-(methoxymethyl)-(4-phenylphenyl)silane Chemical compound C1(=CC=C(C=C1)[SiH](COC)CN1C=NC=C1)C1=CC=CC=C1 IJMBMNUSLCKPRO-UHFFFAOYSA-N 0.000 description 1
- JMEDZQACNCIYSW-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-(4-methylphenyl)silane Chemical compound N1(C=NC=C1)C[Si](C1=CC=C(C=C1)C)(C)C JMEDZQACNCIYSW-UHFFFAOYSA-N 0.000 description 1
- VBLNIRIZQMSENI-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-[2-(trifluoromethyl)phenyl]silane Chemical compound N1(C=NC=C1)C[Si](C1=C(C=CC=C1)C(F)(F)F)(C)C VBLNIRIZQMSENI-UHFFFAOYSA-N 0.000 description 1
- CVKYMPVJDLWMLM-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-[3-(trifluoromethyl)phenyl]silane Chemical compound C[Si](C1=CC(=CC=C1)C(F)(F)F)(CN1C=NC=C1)C CVKYMPVJDLWMLM-UHFFFAOYSA-N 0.000 description 1
- XYVAGFZCUMABSE-UHFFFAOYSA-N imidazol-1-ylmethyl-dimethyl-octadecylsilane Chemical compound C[Si](CCCCCCCCCCCCCCCCCC)(CN1C=NC=C1)C XYVAGFZCUMABSE-UHFFFAOYSA-N 0.000 description 1
- SVNBKGBEYVYGCP-UHFFFAOYSA-N imidazol-1-ylmethyl-methyl-[(2-methylpropan-2-yl)oxy]-phenylsilane Chemical compound C=1C=CC=CC=1[Si](C)(OC(C)(C)C)CN1C=CN=C1 SVNBKGBEYVYGCP-UHFFFAOYSA-N 0.000 description 1
- OWRHKCDFUCQSOV-UHFFFAOYSA-N imidazol-1-ylmethyl-methyl-bis(4-phenylphenyl)silane Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1[Si](C=1C=CC(=CC=1)C=1C=CC=CC=1)(C)CN1C=CN=C1 OWRHKCDFUCQSOV-UHFFFAOYSA-N 0.000 description 1
- HVCDWKOWRHOYAK-UHFFFAOYSA-N imidazol-1-ylmethyl-methyl-diphenylsilane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C)CN1C=CN=C1 HVCDWKOWRHOYAK-UHFFFAOYSA-N 0.000 description 1
- HBVWFNZGHNESMH-UHFFFAOYSA-N imidazol-1-ylmethyl-phenyl-di(propan-2-yloxy)silane Chemical compound C=1C=CC=CC=1[Si](OC(C)C)(OC(C)C)CN1C=CN=C1 HBVWFNZGHNESMH-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- MSCBHMOMMNLZQC-UHFFFAOYSA-N iodomethylsilane Chemical class [SiH3]CI MSCBHMOMMNLZQC-UHFFFAOYSA-N 0.000 description 1
- IDIOJRGTRFRIJL-UHFFFAOYSA-N iodosilane Chemical class I[SiH3] IDIOJRGTRFRIJL-UHFFFAOYSA-N 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 235000011147 magnesium chloride Nutrition 0.000 description 1
- 229910001641 magnesium iodide Inorganic materials 0.000 description 1
- YXLVGINZBGVEHL-UHFFFAOYSA-M magnesium;bromobenzene;bromide Chemical compound [Mg+2].[Br-].BrC1=CC=[C-]C=C1 YXLVGINZBGVEHL-UHFFFAOYSA-M 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 1
- 229920000940 maneb Polymers 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910021645 metal ion Chemical class 0.000 description 1
- UHXUZOCRWCRNSJ-UHFFFAOYSA-N methomyl Chemical compound CNC(=O)ON=C(C)SC UHXUZOCRWCRNSJ-UHFFFAOYSA-N 0.000 description 1
- UHXUZOCRWCRNSJ-QPJJXVBHSA-N methomyl Chemical compound CNC(=O)O\N=C(/C)SC UHXUZOCRWCRNSJ-QPJJXVBHSA-N 0.000 description 1
- ZQEIXNIJLIKNTD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate Chemical compound COCC(=O)N(C(C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-UHFFFAOYSA-N 0.000 description 1
- QJIPXFYXKMCJDF-UHFFFAOYSA-N methyl-(4-phenylphenyl)-propan-2-yloxy-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1[Si](C)(OC(C)C)CN1C=NC=N1 QJIPXFYXKMCJDF-UHFFFAOYSA-N 0.000 description 1
- PTZXZTPYGVSPQQ-UHFFFAOYSA-N methyl-phenyl-(4-phenylphenyl)-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC(=CC=1)C=1C=CC=CC=1)(C)CN1C=NC=N1 PTZXZTPYGVSPQQ-UHFFFAOYSA-N 0.000 description 1
- QBJJCMPDBOIZTM-UHFFFAOYSA-N methyl-propan-2-yloxy-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C[SiH](CN1N=CN=C1)OC(C)C QBJJCMPDBOIZTM-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 238000004452 microanalysis Methods 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000002991 molded plastic Substances 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- KRTSDMXIXPKRQR-AATRIKPKSA-N monocrotophos Chemical compound CNC(=O)\C=C(/C)OP(=O)(OC)OC KRTSDMXIXPKRQR-AATRIKPKSA-N 0.000 description 1
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- YTJSFYQNRXLOIC-UHFFFAOYSA-N octadecylsilane Chemical compound CCCCCCCCCCCCCCCCCC[SiH3] YTJSFYQNRXLOIC-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000002900 organolithium compounds Chemical class 0.000 description 1
- KZAUOCCYDRDERY-UHFFFAOYSA-N oxamyl Chemical compound CNC(=O)ON=C(SC)C(=O)N(C)C KZAUOCCYDRDERY-UHFFFAOYSA-N 0.000 description 1
- IWVCMVBTMGNXQD-PXOLEDIWSA-N oxytetracycline Chemical compound C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-PXOLEDIWSA-N 0.000 description 1
- 229960000625 oxytetracycline Drugs 0.000 description 1
- 235000019366 oxytetracycline Nutrition 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- RLBIQVVOMOPOHC-UHFFFAOYSA-N parathion-methyl Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C=C1 RLBIQVVOMOPOHC-UHFFFAOYSA-N 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- XOFFTKJDVQWEKS-UHFFFAOYSA-N phenyl-di(propan-2-yloxy)-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=CC=CC=1[Si](OC(C)C)(OC(C)C)CN1C=NC=N1 XOFFTKJDVQWEKS-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- WVQCDOLBWQGTMX-UHFFFAOYSA-N potassium;1h-pyrrole Chemical class [K].C=1C=CNC=1 WVQCDOLBWQGTMX-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000013630 prepared media Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000010058 rubber compounding Methods 0.000 description 1
- LOQKVDFAJZBDGI-UHFFFAOYSA-N silane zinc Chemical compound [SiH4].[Zn] LOQKVDFAJZBDGI-UHFFFAOYSA-N 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229960002385 streptomycin sulfate Drugs 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- JXHJNEJVUNHLKO-UHFFFAOYSA-N sulprofos Chemical compound CCCSP(=S)(OCC)OC1=CC=C(SC)C=C1 JXHJNEJVUNHLKO-UHFFFAOYSA-N 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 1
- IWVCMVBTMGNXQD-UHFFFAOYSA-N terramycin dehydrate Natural products C1=CC=C2C(O)(C)C3C(O)C4C(N(C)C)C(O)=C(C(N)=O)C(=O)C4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-UHFFFAOYSA-N 0.000 description 1
- UBCKGWBNUIFUST-YHYXMXQVSA-N tetrachlorvinphos Chemical compound COP(=O)(OC)O\C(=C/Cl)C1=CC(Cl)=C(Cl)C=C1Cl UBCKGWBNUIFUST-YHYXMXQVSA-N 0.000 description 1
- 239000004308 thiabendazole Substances 0.000 description 1
- 235000010296 thiabendazole Nutrition 0.000 description 1
- 229960004546 thiabendazole Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- BAKXBZPQTXCKRR-UHFFFAOYSA-N thiodicarb Chemical compound CSC(C)=NOC(=O)NSNC(=O)ON=C(C)SC BAKXBZPQTXCKRR-UHFFFAOYSA-N 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- OEJNXTAZZBRGDN-UHFFFAOYSA-N toxaphene Chemical compound ClC1C(Cl)C2(Cl)C(CCl)(CCl)C(=C)C1(Cl)C2(Cl)Cl OEJNXTAZZBRGDN-UHFFFAOYSA-N 0.000 description 1
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 description 1
- 239000005052 trichlorosilane Substances 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- PVHISGAUGANDDX-UHFFFAOYSA-N triphenyl(1,2,4-triazol-1-ylmethyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)CN1C=NC=N1 PVHISGAUGANDDX-UHFFFAOYSA-N 0.000 description 1
- OMYRNEQBPXJBQG-UHFFFAOYSA-N tris(4-chlorophenyl)-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C1=CC(Cl)=CC=C1[Si](C=1C=CC(Cl)=CC=1)(C=1C=CC(Cl)=CC=1)CN1N=CN=C1 OMYRNEQBPXJBQG-UHFFFAOYSA-N 0.000 description 1
- LNZYCPQSRRJFDV-UHFFFAOYSA-N tris(4-fluorophenyl)-(1,2,4-triazol-1-ylmethyl)silane Chemical compound C1=CC(F)=CC=C1[Si](C=1C=CC(F)=CC=1)(C=1C=CC(F)=CC=1)CN1N=CN=C1 LNZYCPQSRRJFDV-UHFFFAOYSA-N 0.000 description 1
- YPRRPWYSYWKAQL-UHFFFAOYSA-N tris(4-fluorophenyl)-(imidazol-1-ylmethyl)silane Chemical compound FC1=CC=C(C=C1)[Si](CN1C=NC=C1)(C1=CC=C(C=C1)F)C1=CC=C(C=C1)F YPRRPWYSYWKAQL-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0803—Compounds with Si-C or Si-Si linkages
- C07F7/081—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te
- C07F7/0812—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te comprising a heterocyclic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N55/00—Biocides, pest repellants or attractants, or plant growth regulators, containing organic compounds containing elements other than carbon, hydrogen, halogen, oxygen, nitrogen and sulfur
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0834—Compounds having one or more O-Si linkage
- C07F7/0838—Compounds with one or more Si-O-Si sequences
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27698681A | 1981-06-24 | 1981-06-24 | |
| US27698781A | 1981-06-24 | 1981-06-24 | |
| US34926182A | 1982-02-16 | 1982-02-16 | |
| US34926282A | 1982-02-16 | 1982-02-16 | |
| US37712182A | 1982-05-12 | 1982-05-12 | |
| US37712282A | 1982-05-12 | 1982-05-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189152B true HU189152B (en) | 1986-06-30 |
Family
ID=27559521
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU823039A HU189152B (en) | 1981-06-24 | 1982-06-23 | Fungicides containing derivatives of 1,2,4-triazol and imidazol and process for production of the derivatives of 1,2,4-triazol and imidazol |
Country Status (12)
| Country | Link |
|---|---|
| EP (1) | EP0068813B1 (show.php) |
| KR (1) | KR880002604B1 (show.php) |
| AU (1) | AU553808B2 (show.php) |
| BR (1) | BR8203631A (show.php) |
| CA (1) | CA1176258A (show.php) |
| DE (1) | DE3266532D1 (show.php) |
| DK (3) | DK160364C (show.php) |
| GR (1) | GR76497B (show.php) |
| HU (1) | HU189152B (show.php) |
| IL (1) | IL66114A (show.php) |
| NZ (1) | NZ201061A (show.php) |
| PL (1) | PL133929B1 (show.php) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR8307089A (pt) * | 1982-12-27 | 1984-07-31 | Union Carbide Corp | Novo silano organofuncional,agente ligante para materiais de oxido inorganico ou carga,e composicao deste agente ligante |
| US4530922A (en) * | 1984-01-03 | 1985-07-23 | E. I. Du Pont De Nemours And Company | Fungicidal imidazoles and triazoles containing silicon |
| ATE53998T1 (de) * | 1985-10-26 | 1990-07-15 | Hoechst Ag | Neue silanderivate, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung als schaedlingsbekaempfungsmittel. |
| DE3539993A1 (de) * | 1985-11-12 | 1987-05-14 | Bayer Ag | Verfahren zur herstellung von (beta)-hydroxyethyl-azol-derivaten |
| ATE115140T1 (de) * | 1987-06-16 | 1994-12-15 | Du Pont | Verfahren zur isomerierung von symmetrischen triazolen zu unsymmetrischen triazolen. |
| DE3723246A1 (de) * | 1987-07-14 | 1989-01-26 | Lentia Gmbh | Neue thienyl-azolylmethyl-silane |
| AT389702B (de) * | 1988-02-01 | 1990-01-25 | Agrolinz Agrarchemikalien | Neue azolylmethylsilane |
| GB2269100A (en) * | 1992-07-31 | 1994-02-02 | Shell Int Research | Plant fungicidal compositions |
| DE19617461A1 (de) * | 1996-05-02 | 1997-11-06 | Bayer Ag | Acylmercapto-triazolyl-Derivate |
| KR100480666B1 (ko) * | 2001-08-14 | 2005-04-06 | 한국화학연구원 | 기능기를 갖는 규소 화합물 및 이를 이용하여 무기 고체의표면을 개질하는 방법 |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| US7960576B2 (en) | 2004-08-13 | 2011-06-14 | Momentive Performance Materials Inc. | Diol-derived organofunctional silane and compositions containing same |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| CA2916460C (en) | 2005-06-09 | 2017-10-03 | Klaus Stenzel | Combinations comprising prothioconazole and gulfosinate |
| DE102005035300A1 (de) | 2005-07-28 | 2007-02-01 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| EP2000028A1 (de) | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| US7816435B2 (en) | 2007-10-31 | 2010-10-19 | Momentive Performance Materials Inc. | Halo-functional silane, process for its preparation, rubber composition containing same and articles manufactured therefrom |
| AU2009342807B2 (en) | 2009-03-25 | 2015-04-02 | Bayer Cropscience Aktiengesellschaft | Synergistic combinations of active ingredients |
| JP5642786B2 (ja) | 2009-07-16 | 2014-12-17 | バイエル・クロップサイエンス・アーゲーBayer Cropscience Ag | フェニルトリアゾール類を含む相乗的活性化合物組み合わせ |
| CN101824045B (zh) * | 2010-04-01 | 2012-03-14 | 天津久日化学股份有限公司 | 双(4-氟苯基)-(1h-1,2,4-三唑-1-基甲基)甲硅烷的制备方法 |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1360395A (fr) * | 1963-04-01 | 1964-05-08 | Dow Corning | Composés organosiliciques contenant de l'azote et leur préparation |
| US3692798A (en) * | 1971-05-07 | 1972-09-19 | Sandor Barcza | Substituted silylmethyl imidazoles |
| IT1035489B (it) * | 1974-04-30 | 1979-10-20 | Dynamit Nobel Ag | Silani organo funzionali con struttura ad anello contenente azoto e procedimento per la loro produzione |
-
1982
- 1982-06-22 BR BR8203631A patent/BR8203631A/pt not_active IP Right Cessation
- 1982-06-22 AU AU85099/82A patent/AU553808B2/en not_active Ceased
- 1982-06-22 CA CA000405708A patent/CA1176258A/en not_active Expired
- 1982-06-23 DK DK282782A patent/DK160364C/da not_active IP Right Cessation
- 1982-06-23 EP EP82303281A patent/EP0068813B1/en not_active Expired
- 1982-06-23 DE DE8282303281T patent/DE3266532D1/de not_active Expired
- 1982-06-23 HU HU823039A patent/HU189152B/hu not_active IP Right Cessation
- 1982-06-23 KR KR8202808A patent/KR880002604B1/ko not_active Expired
- 1982-06-23 NZ NZ201061A patent/NZ201061A/xx unknown
- 1982-06-23 GR GR68538A patent/GR76497B/el unknown
- 1982-06-23 IL IL66114A patent/IL66114A/xx unknown
- 1982-06-24 PL PL1982237088A patent/PL133929B1/pl unknown
-
1990
- 1990-05-22 DK DK126490A patent/DK126490A/da not_active Application Discontinuation
- 1990-05-22 DK DK126790A patent/DK126790D0/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| EP0068813A3 (en) | 1983-03-16 |
| GR76497B (show.php) | 1984-08-10 |
| DK126490D0 (da) | 1990-05-22 |
| DK160364C (da) | 1991-08-12 |
| DK160364B (da) | 1991-03-04 |
| EP0068813A2 (en) | 1983-01-05 |
| DE3266532D1 (en) | 1985-10-31 |
| AU8509982A (en) | 1983-01-06 |
| IL66114A0 (en) | 1982-09-30 |
| IL66114A (en) | 1987-11-30 |
| EP0068813B1 (en) | 1985-09-25 |
| KR840000570A (ko) | 1984-02-25 |
| KR880002604B1 (ko) | 1988-12-04 |
| BR8203631A (pt) | 1983-06-14 |
| NZ201061A (en) | 1985-03-20 |
| DK126790A (da) | 1990-05-22 |
| CA1176258A (en) | 1984-10-16 |
| PL237088A1 (en) | 1983-10-24 |
| PL133929B1 (en) | 1985-07-31 |
| DK282782A (da) | 1982-12-25 |
| DK126790D0 (da) | 1990-05-22 |
| AU553808B2 (en) | 1986-07-31 |
| DK126490A (da) | 1990-05-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU189152B (en) | Fungicides containing derivatives of 1,2,4-triazol and imidazol and process for production of the derivatives of 1,2,4-triazol and imidazol | |
| US4510136A (en) | Fungicidal 1,2,4-triazole derivatives | |
| EP0234242B1 (en) | Fungicidal azolyl-derivatives | |
| US4530922A (en) | Fungicidal imidazoles and triazoles containing silicon | |
| RO109648B1 (ro) | Derivati 1 h-1,2,4-triazol,procedee pentru prepararea acestora,intermediari pentru realizarea procedeelor si metoda pentru tratarea sau prevenirea infectiei fungice | |
| EP0122693A1 (en) | Antifungal di(azolyl)propanol derivatives | |
| HU188833B (en) | Fungicidal and plant growth regulating compositions comprising ether derivatives of substituted 1-(hydroxy-alkyl)-azoles as active substance and process for preparing the active substances | |
| HU189639B (en) | Fungicidal and plant growth regulating compositions comprising substituted 1-(hydroxy-alkyl)-azoles as active substance and process for preparing substituted 1-(hydroxy-alkyl)-azoles | |
| JPH0133467B2 (show.php) | ||
| US4210657A (en) | Aryl imidazolyl vinyl ethers and processes for using same | |
| EP0174769A1 (en) | Antifungal azole compounds | |
| US4496551A (en) | Fungicidal imidazole derivatives | |
| EP0207590A2 (en) | Substituted azolyl ethanol derivatives as plant growth regulators | |
| HU176915B (hu) | Fungicidnye kompozicii soderzhahhie zamehhennye fenoksi-triazolil-butil-slozhnykh efirov,i sposob poluchenija aktivnykh agentov | |
| EP0431968B1 (en) | Oxetane derivatives, their preparation and their use as anti-fungal or fungicidal agents | |
| EP0061910B1 (en) | Novel substituted imidazoles and triazoles, fungicidal compositions containing them, the use thereof for combating fungi and processes for the preparation of intermediates for making the imidazoles and triazoles | |
| HU179670B (en) | Fungicide compositions containing metal-salt-complexes of i-phenyl-2-triasoly-ethen derivatives and process for producing the active agents | |
| JPS6026111B2 (ja) | 新規な1−アゾリル−4−ヒドロキシ−ブタン誘導体,その製造方法およびそれを活性成分として含有する殺菌剤組成物 | |
| US5512551A (en) | Benzohydroxymoylazole derivatives and insecticide including the same | |
| EP0165775A1 (en) | Antifungal azole compounds | |
| HU181853B (en) | Fungicide compositions containing azolyl-alkyl-pyridinyl-ether derivatives and process for preparing azolyl-alkyl-pyridinyl-ether derivatives | |
| JPH0819109B2 (ja) | 殺菌剤アゾリル誘導体 | |
| CA1241961A (en) | Antifungal triazole compound | |
| JPS6253515B2 (show.php) | ||
| US5455356A (en) | Fungicidal 1-aryl-1-[α-(triazolyl)alkyl]-1-silacycloalkanes and their preparation methods |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |