HU183263B - Process for preparing 9-chloro-prostaglandin derivatives - Google Patents
Process for preparing 9-chloro-prostaglandin derivatives Download PDFInfo
- Publication number
- HU183263B HU183263B HU802949A HU294980A HU183263B HU 183263 B HU183263 B HU 183263B HU 802949 A HU802949 A HU 802949A HU 294980 A HU294980 A HU 294980A HU 183263 B HU183263 B HU 183263B
- Authority
- HU
- Hungary
- Prior art keywords
- acid
- tetranor
- chloro
- hydroxy
- ester
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims 3
- -1 hydrocarbon carboxylic Chemical class 0.000 claims abstract description 93
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims abstract description 9
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 4
- 239000011737 fluorine Substances 0.000 claims abstract description 4
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 48
- 239000002253 acid Substances 0.000 claims description 40
- 238000002360 preparation method Methods 0.000 claims description 34
- 239000000243 solution Substances 0.000 claims description 32
- 239000007795 chemical reaction product Substances 0.000 claims description 24
- 150000004702 methyl esters Chemical class 0.000 claims description 21
- 150000001408 amides Chemical class 0.000 claims description 19
- 239000007858 starting material Substances 0.000 claims description 18
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 claims description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000006239 protecting group Chemical group 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- FMTLNTYFINAZQO-ABZYKWASSA-N (2r,3s)-1-chloro-2-heptyl-3-octylcyclopentane Chemical class CCCCCCCC[C@H]1CCC(Cl)[C@@H]1CCCCCCC FMTLNTYFINAZQO-ABZYKWASSA-N 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- BGCDBQOWUVYEAL-HHLXFHKQSA-N methyl 7-[(1r,2s)-2-oct-1-enylcyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate Chemical compound CCCCCCC=C[C@H]1CCC[C@@H]1CC=CCCC(C(=O)OC)OC1OCCCC1 BGCDBQOWUVYEAL-HHLXFHKQSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000008194 pharmaceutical composition Substances 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical class NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-M ethanimidate Chemical compound CC([O-])=N DLFVBJFMPXGRIB-UHFFFAOYSA-M 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 239000008298 dragée Substances 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- SJMCLWCCNYAWRQ-UHFFFAOYSA-N propane-2-sulfonamide Chemical compound CC(C)S(N)(=O)=O SJMCLWCCNYAWRQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- 239000000829 suppository Substances 0.000 claims description 2
- 239000003826 tablet Substances 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims 25
- MBEWYKUKSOUOCU-YPJRHXLCSA-N 2-methyl-7-[(1r,2s)-2-oct-1-enylcyclopentyl]hept-5-enoic acid Chemical compound CCCCCCC=C[C@H]1CCC[C@@H]1CC=CCCC(C)C(O)=O MBEWYKUKSOUOCU-YPJRHXLCSA-N 0.000 claims 2
- QLJCPRYAASBIGP-OALUTQOASA-N 7-[(1s,2s)-2-oct-1-enylcyclopentyl]heptanoic acid Chemical compound CCCCCCC=C[C@H]1CCC[C@@H]1CCCCCCC(O)=O QLJCPRYAASBIGP-OALUTQOASA-N 0.000 claims 2
- 239000007983 Tris buffer Substances 0.000 claims 2
- 238000010511 deprotection reaction Methods 0.000 claims 2
- 230000007062 hydrolysis Effects 0.000 claims 2
- 238000006460 hydrolysis reaction Methods 0.000 claims 2
- 230000003301 hydrolyzing effect Effects 0.000 claims 2
- YCQDGOHCBPHVLE-PMACEKPBSA-N (1r,2s)-1-hept-2-enyl-2-oct-1-enylcyclopentane Chemical compound CCCCCCC=C[C@H]1CCC[C@@H]1CC=CCCCC YCQDGOHCBPHVLE-PMACEKPBSA-N 0.000 claims 1
- HZOQSCXAEIEPOQ-TUHHRYBRSA-N CCCCCC(C)C=C[C@H]1CCC[C@@H]1CC=CCCC(C(=O)OC)OC2CCCCO2 Chemical compound CCCCCC(C)C=C[C@H]1CCC[C@@H]1CC=CCCC(C(=O)OC)OC2CCCCO2 HZOQSCXAEIEPOQ-TUHHRYBRSA-N 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 238000005660 chlorination reaction Methods 0.000 claims 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 48
- 125000002252 acyl group Chemical group 0.000 abstract description 2
- 125000001931 aliphatic group Chemical group 0.000 abstract description 2
- 125000002947 alkylene group Chemical group 0.000 abstract description 2
- 230000000144 pharmacologic effect Effects 0.000 abstract description 2
- 239000004215 Carbon black (E152) Substances 0.000 abstract 3
- 229930195733 hydrocarbon Natural products 0.000 abstract 3
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 125000003107 substituted aryl group Chemical group 0.000 abstract 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 abstract 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 abstract 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 150000002430 hydrocarbons Chemical group 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 abstract 1
- 229910052717 sulfur Chemical group 0.000 abstract 1
- 239000011593 sulfur Chemical group 0.000 abstract 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 63
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 39
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 32
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- 239000003921 oil Substances 0.000 description 28
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000012230 colorless oil Substances 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- 239000000741 silica gel Substances 0.000 description 17
- 229910002027 silica gel Inorganic materials 0.000 description 17
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 16
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 16
- 235000019341 magnesium sulphate Nutrition 0.000 description 16
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 13
- 235000011054 acetic acid Nutrition 0.000 description 13
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 12
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 150000003180 prostaglandins Chemical class 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 238000004587 chromatography analysis Methods 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000000284 extract Substances 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- 239000012267 brine Substances 0.000 description 7
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 7
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 6
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 238000007127 saponification reaction Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 206010000210 abortion Diseases 0.000 description 2
- 231100000176 abortion Toxicity 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 239000007979 citrate buffer Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UKVVPDHLUHAJNZ-PMACEKPBSA-N prostane Chemical group CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC UKVVPDHLUHAJNZ-PMACEKPBSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RLPGNHILYGVQDE-UHFFFAOYSA-N 2,3-dimethoxybutane Chemical compound COC(C)C(C)OC RLPGNHILYGVQDE-UHFFFAOYSA-N 0.000 description 1
- CJPNRCVBUKSNRL-JWDFLIAJSA-N 2-[7-[(1R,2S)-2-oct-1-enylcyclopentyl]hept-5-enoxy]oxane Chemical compound O1C(CCCC1)OCCCCC=CC[C@H]1CCC[C@@H]1C=CCCCCCC CJPNRCVBUKSNRL-JWDFLIAJSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- POKRQUNDSGAZIA-OALUTQOASA-N 7-[(1r,2s)-2-octylcyclopentyl]hepta-2,4-dienoic acid Chemical compound CCCCCCCC[C@H]1CCC[C@@H]1CCC=CC=CC(O)=O POKRQUNDSGAZIA-OALUTQOASA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- DQYAPJJSRBXEPZ-UHFFFAOYSA-N ClC(=O)O.C(C(C)C)OCC(C)C Chemical compound ClC(=O)O.C(C(C)C)OCC(C)C DQYAPJJSRBXEPZ-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 208000036029 Uterine contractions during pregnancy Diseases 0.000 description 1
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 1
- CEDLUJHGAQHWKL-UHFFFAOYSA-N [C].ClC(Cl)(Cl)Cl Chemical compound [C].ClC(Cl)(Cl)Cl CEDLUJHGAQHWKL-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- OCKPROYBCPQWJO-UHFFFAOYSA-N acetyl isocyanate Chemical compound CC(=O)N=C=O OCKPROYBCPQWJO-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000002009 alkene group Chemical group 0.000 description 1
- 229940006138 antiglaucoma drug and miotics prostaglandin analogues Drugs 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- QDHFHIQKOVNCNC-UHFFFAOYSA-N butane-1-sulfonic acid Chemical compound CCCCS(O)(=O)=O QDHFHIQKOVNCNC-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000001120 cytoprotective effect Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 230000010339 dilation Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940088679 drug related substance Drugs 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000035558 fertility Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 230000029860 luteolysis Effects 0.000 description 1
- 230000003529 luteolytic effect Effects 0.000 description 1
- 230000005906 menstruation Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- OUPLTJDZPQZRBW-UHFFFAOYSA-N n-(oxomethylidene)methanesulfonamide Chemical compound CS(=O)(=O)N=C=O OUPLTJDZPQZRBW-UHFFFAOYSA-N 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 210000002850 nasal mucosa Anatomy 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 description 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000004304 potassium nitrite Substances 0.000 description 1
- 235000010289 potassium nitrite Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- HNDXKIMMSFCCFW-UHFFFAOYSA-N propane-2-sulphonic acid Chemical compound CC(C)S(O)(=O)=O HNDXKIMMSFCCFW-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 230000001568 sexual effect Effects 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- QXIXKZNHXVNRQV-UHFFFAOYSA-N sodium sulfonylazanide Chemical compound [Na+].[N-]=S(=O)=O QXIXKZNHXVNRQV-UHFFFAOYSA-N 0.000 description 1
- QICWSAFHNDKQKS-UHFFFAOYSA-N sodium;methylsulfonylazanide Chemical compound [Na+].CS([NH-])(=O)=O QICWSAFHNDKQKS-UHFFFAOYSA-N 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 150000003429 steroid acids Chemical class 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
- C07C405/0008—Analogues having the carboxyl group in the side-chains replaced by other functional groups
- C07C405/0041—Analogues having the carboxyl group in the side-chains replaced by other functional groups containing nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792950027 DE2950027A1 (de) | 1979-12-10 | 1979-12-10 | 9-chlor-prostaglandinderivate, verfahren zur herstellung und verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU183263B true HU183263B (en) | 1984-04-28 |
Family
ID=6088285
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU802949A HU183263B (en) | 1979-12-10 | 1980-12-09 | Process for preparing 9-chloro-prostaglandin derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4444788A (show.php) |
| EP (1) | EP0030377B1 (show.php) |
| JP (1) | JPS5692860A (show.php) |
| AT (1) | ATE6364T1 (show.php) |
| AU (1) | AU543797B2 (show.php) |
| CA (1) | CA1196327A (show.php) |
| CS (1) | CS226419B2 (show.php) |
| DE (2) | DE2950027A1 (show.php) |
| DK (2) | DK153944C (show.php) |
| ES (1) | ES497589A0 (show.php) |
| HU (1) | HU183263B (show.php) |
| IE (1) | IE51212B1 (show.php) |
| IL (1) | IL61669A (show.php) |
| SU (1) | SU1026652A3 (show.php) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2950027A1 (de) * | 1979-12-10 | 1981-06-11 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | 9-chlor-prostaglandinderivate, verfahren zur herstellung und verwendung als arzneimittel |
| US5204371A (en) * | 1979-12-10 | 1993-04-20 | Schering Aktiengesellschaft | Pharmaceutically active 9-chloroprostaglandins |
| DE3126924A1 (de) * | 1981-07-03 | 1983-01-20 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 9-fluor-prostaglandinderivate, verfahren zur herstellung und verwendung als arzneimittel |
| DE3148743A1 (de) * | 1981-12-04 | 1983-06-09 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 9-brom-prostaglandinderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE3325175A1 (de) * | 1983-07-08 | 1985-01-17 | Schering AG, 1000 Berlin und 4709 Bergkamen | 11-halogen-prostanderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE3337450A1 (de) * | 1983-10-12 | 1985-04-25 | Schering AG, 1000 Berlin und 4709 Bergkamen | Prostaglandine und antigestagene fuer den schwangerschaftsabbruch |
| DE3347128A1 (de) * | 1983-12-22 | 1985-07-11 | Schering AG, 1000 Berlin und 4709 Bergkamen | 9-halogen-(delta)(pfeil hoch)2(pfeil hoch)-prostaglandinderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE3414509A1 (de) * | 1984-04-13 | 1985-10-24 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue 9-halogen-prostaglandine |
| DE3504044A1 (de) * | 1985-02-04 | 1986-08-07 | Schering AG, Berlin und Bergkamen, 1000 Berlin | 9-halogenprostaglandin-clathrate und ihre verwendung als arzneimittel |
| DE3510978A1 (de) * | 1985-03-22 | 1986-09-25 | Schering AG, Berlin und Bergkamen, 1000 Berlin | Neue 9-halogenprostaglandine, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE3608088C2 (de) * | 1986-03-07 | 1995-11-16 | Schering Ag | Pharmazeutische Präparate, enthaltend Cyclodextrinclathrate von Carbacyclinderivaten |
| US5891910A (en) * | 1987-07-17 | 1999-04-06 | Schering Aktiengesellschaft | 9-halogen-(Z) prostaglandin derivatives, process for their production and their use as pharmaceutical agents |
| AU624078B2 (en) * | 1987-07-17 | 1992-06-04 | Schering Aktiengesellschaft Berlin Und Bergkamen | 9-halogen-(z)-prostaglandin derivatives, process for manufacturing them, and their use as drugs |
| CA1322197C (en) | 1987-07-17 | 1993-09-14 | Bernd Buchmann | 9-halogen-(z) prostaglandin derivatives, process for their production and their use as pharmaceutical agents |
| DE3724190A1 (de) * | 1987-07-17 | 1989-01-26 | Schering Ag | 9-halogen-3-oxa-(z)-(delta)(pfeil hoch)5(pfeil hoch)-prostaglandinderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE3724189A1 (de) * | 1987-07-17 | 1989-01-26 | Schering Ag | 9-halogen-(z)-(delta)(pfeil hoch)4(pfeil hoch)-prostaglandinderivate, verfahren zu ihrer herstellung und ihrer verwendung als arzneimittel |
| DE4036140A1 (de) * | 1990-11-09 | 1992-05-14 | Schering Ag | 9-halogen-11ss-hydroxy-prostaglandinderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| EP0652211A1 (en) * | 1992-07-24 | 1995-05-10 | Taisho Pharmaceutical Co. Ltd | Prostaglandin derivative |
| DE4229050A1 (de) * | 1992-08-31 | 1994-03-03 | Schering Ag | Neue 9-Chlor-Prostaglandin-Ester und -amide |
| JPH08500597A (ja) * | 1992-08-31 | 1996-01-23 | シエーリング アクチエンゲゼルシヤフト | 9−クロル−プロスタグランジン−エステルおよび9−クロル−プロスタグランジンアミド並びに医薬品の製造のための該9−クロル−プロスタグランジン−エステルおよび9−クロル−プロスタグランジンアミドの使用 |
| DE4229048A1 (de) * | 1992-08-31 | 1994-03-03 | Schering Ag | Ester von 9-Chlor-Prostaglandinen, Verfahren zu ihrer Herstellung und ihre pharmazeutische Verwendung |
| US5972991A (en) * | 1992-09-21 | 1999-10-26 | Allergan | Cyclopentane heptan(ene) oic acid, 2-heteroarylalkenyl derivatives as therapeutic agents |
| IT1257479B (it) * | 1992-12-01 | 1996-01-25 | Derivati prostaglandinici aventi effetti radioprotettivi | |
| DE4330177A1 (de) * | 1993-08-31 | 1995-03-02 | Schering Ag | Neue 9-Chlor-prostaglandin-derivate |
| US5721273A (en) | 1993-12-15 | 1998-02-24 | Alcon Laboratories, Inc. | Use of certain 9-halo-13,14-dihydroprostaglandins to treat glaucoma and ocular hypertension |
| US5807892A (en) * | 1994-09-30 | 1998-09-15 | Alcon Laboratories, Inc. | Use of certain prostaglandin analogues to treat glaucoma and ocular hypertension |
| US6235780B1 (en) | 1998-07-21 | 2001-05-22 | Ono Pharmaceutical Co., Ltd. | ω-cycloalkyl-prostaglandin E1 derivatives |
| PT1816121E (pt) * | 2005-11-21 | 2008-05-28 | Bayer Schering Pharma Ag | Derivados de 9-cloro-15-desoxiprostaglandina, processo para a sua preparação e sua utilização como medicamentos |
| US7563924B2 (en) * | 2005-11-21 | 2009-07-21 | Schering Aktiengesellschaft | 9-chloro-15-deoxyprostaglandin derivatives, process for their preparation and their use as medicaments |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2517773A1 (de) * | 1975-04-18 | 1976-10-28 | Schering Ag | Neue 11-oxo-prostaglandin-derivate und verfahren zu ihrer herstellung |
| US4163016A (en) * | 1977-07-05 | 1979-07-31 | Hoffmann-La Roche Inc. | 16-Substituted prostaglandins |
| US4192799A (en) * | 1977-09-21 | 1980-03-11 | The Upjohn Company | Conjugates formed by reacting a prostaglandin mimic compound with a carrier molecule |
| DE2950027A1 (de) * | 1979-12-10 | 1981-06-11 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | 9-chlor-prostaglandinderivate, verfahren zur herstellung und verwendung als arzneimittel |
-
1979
- 1979-12-10 DE DE19792950027 patent/DE2950027A1/de not_active Withdrawn
-
1980
- 1980-12-05 AT AT80107657T patent/ATE6364T1/de not_active IP Right Cessation
- 1980-12-05 EP EP80107657A patent/EP0030377B1/de not_active Expired
- 1980-12-05 DE DE8080107657T patent/DE3066726D1/de not_active Expired
- 1980-12-09 IE IE2572/80A patent/IE51212B1/en not_active IP Right Cessation
- 1980-12-09 CS CS808647A patent/CS226419B2/cs unknown
- 1980-12-09 HU HU802949A patent/HU183263B/hu not_active IP Right Cessation
- 1980-12-09 IL IL61669A patent/IL61669A/xx not_active IP Right Cessation
- 1980-12-09 SU SU803221450A patent/SU1026652A3/ru active
- 1980-12-09 CA CA000366408A patent/CA1196327A/en not_active Expired
- 1980-12-09 AU AU65190/80A patent/AU543797B2/en not_active Ceased
- 1980-12-10 DK DK526080A patent/DK153944C/da not_active IP Right Cessation
- 1980-12-10 ES ES497589A patent/ES497589A0/es active Granted
- 1980-12-10 JP JP17447980A patent/JPS5692860A/ja active Granted
-
1982
- 1982-06-10 US US06/387,140 patent/US4444788A/en not_active Expired - Fee Related
-
1987
- 1987-09-08 US US07/096,232 patent/US5079259A/en not_active Expired - Fee Related
- 1987-11-02 DK DK573687A patent/DK573687A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| ATE6364T1 (de) | 1984-03-15 |
| DE2950027A1 (de) | 1981-06-11 |
| AU543797B2 (en) | 1985-05-02 |
| EP0030377B1 (de) | 1984-02-22 |
| JPS5692860A (en) | 1981-07-27 |
| JPS6224422B2 (show.php) | 1987-05-28 |
| EP0030377A1 (de) | 1981-06-17 |
| AU6519080A (en) | 1981-06-18 |
| DK573687D0 (da) | 1987-11-02 |
| SU1026652A3 (ru) | 1983-06-30 |
| CS226419B2 (en) | 1984-03-19 |
| DK153944B (da) | 1988-09-26 |
| IL61669A (en) | 1986-08-31 |
| DK526080A (da) | 1981-06-11 |
| ES8200336A1 (es) | 1981-11-16 |
| DK573687A (da) | 1987-11-02 |
| IL61669A0 (en) | 1981-01-30 |
| DE3066726D1 (en) | 1984-03-29 |
| US4444788A (en) | 1984-04-24 |
| IE802572L (en) | 1981-06-10 |
| IE51212B1 (en) | 1986-11-12 |
| CA1196327A (en) | 1985-11-05 |
| DK153944C (da) | 1989-02-20 |
| ES497589A0 (es) | 1981-11-16 |
| US5079259A (en) | 1992-01-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU183263B (en) | Process for preparing 9-chloro-prostaglandin derivatives | |
| US3852337A (en) | Pgf tetraols and alkanoyl esters | |
| US4789685A (en) | 9-fluoroprostaglandin derivatives, their preparation and use as medicinal agents | |
| HU206084B (en) | Process for producing 9-halogen-/z/-prostaglandin derivatives and pharmaceutical compositions comprising such active ingredient | |
| JPH068280B2 (ja) | 9―ハロゲン―δ2―プロスタン誘導体及びその製法 | |
| US5004752A (en) | Novel 9-haloprostaglandins, processes for their preparation, and their use as medicinal agents | |
| JPS60501813A (ja) | 11―ハロゲン―プロスタン誘導体及びその製法 | |
| CA1092102A (en) | 11-oxo-prostaglandin derivatives and processes for their manufacture | |
| US5204371A (en) | Pharmaceutically active 9-chloroprostaglandins | |
| US4560786A (en) | Δ8,9 -Prostaglandin derivatives, their preparation and use as medicinal agents | |
| HU183114B (en) | Process for producing new prostacyclin derivatives | |
| JPS6049632B2 (ja) | 16−フェノキシ プロスタ グランジン類似体 | |
| HU190823B (en) | Process for preparing 9-bromo-prostaglandin derivatives and pharmaceutical compositions thereof | |
| HU196746B (en) | Process for producing in 6-position halogenated prostaglandins and pharmaceutical compositions comprising such active ingredient | |
| HU191111B (en) | Process for producing 5-fluoro-carbacyclines | |
| EP0276124B1 (en) | Prostaglandin derivatives, their preparation and their therapeutic use | |
| CH630897A5 (en) | Process for preparing novel prostaglandin analogues having a triple bond between C-13 and C-14. | |
| CS226442B2 (cs) | Způsob výroby derivátů 9-chlorprostaglandinu | |
| CA1185969A (en) | 5Z-9-DEOXY-6,9-EPOXY-.DELTA. 5-PGF IN1.alpha. XX, SODIUM SALT | |
| JPS5929074B2 (ja) | 2a,2b−ジホモ−16,16−ジメチルPGF化合物及び製法 | |
| CS236890B2 (en) | Processing of 5-fluorine -3-oxo-6-carbaprostaglandine i2 derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |