HU182205B - Process for preparing diphenyl-ethers - Google Patents
Process for preparing diphenyl-ethers Download PDFInfo
- Publication number
- HU182205B HU182205B HU802316A HU231680A HU182205B HU 182205 B HU182205 B HU 182205B HU 802316 A HU802316 A HU 802316A HU 231680 A HU231680 A HU 231680A HU 182205 B HU182205 B HU 182205B
- Authority
- HU
- Hungary
- Prior art keywords
- alkyl
- phenoxy
- hydrogen
- formula
- halogen
- Prior art date
Links
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 23
- 239000001257 hydrogen Substances 0.000 claims abstract description 23
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 18
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 15
- 150000002367 halogens Chemical group 0.000 claims abstract description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 12
- 238000000034 method Methods 0.000 claims abstract description 12
- -1 nitro-phenoxy, cyano-phenoxy, amino Chemical group 0.000 claims abstract description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 10
- 150000001412 amines Chemical class 0.000 claims abstract description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 3
- 150000002431 hydrogen Chemical group 0.000 claims abstract 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 239000000460 chlorine Chemical group 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 239000011737 fluorine Chemical group 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000006528 (C2-C6) alkyl group Chemical group 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- 125000006373 (C2-C10) alkyl group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 125000006493 trifluoromethyl benzyl group Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 abstract description 4
- 125000006193 alkinyl group Chemical group 0.000 abstract 1
- 125000006277 halobenzyl group Chemical group 0.000 abstract 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 65
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 24
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 20
- 239000002904 solvent Substances 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 239000003921 oil Substances 0.000 description 15
- 235000019198 oils Nutrition 0.000 description 15
- 239000013078 crystal Substances 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 229910052938 sodium sulfate Inorganic materials 0.000 description 11
- 235000011152 sodium sulphate Nutrition 0.000 description 11
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- ZNTGJDYGWMGSEI-UHFFFAOYSA-N 3-chloro-1-nitro-2,4-diphenoxybenzene Chemical compound ClC1=C(OC=2C=CC=CC=2)C([N+](=O)[O-])=CC=C1OC1=CC=CC=C1 ZNTGJDYGWMGSEI-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 7
- 239000004009 herbicide Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- SXRPHNYWYDVQJV-UHFFFAOYSA-N 1-chloro-5-nitro-2,4-diphenoxybenzene Chemical compound C1=C(OC=2C=CC=CC=2)C([N+](=O)[O-])=CC(Cl)=C1OC1=CC=CC=C1 SXRPHNYWYDVQJV-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- UXJDZKJRGJNGTM-UHFFFAOYSA-N 1,2-dichloro-4-nitro-3-phenoxybenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1OC1=CC=CC=C1 UXJDZKJRGJNGTM-UHFFFAOYSA-N 0.000 description 3
- VIMIIJOCKXHOJA-UHFFFAOYSA-N 2-chloro-1-(2,5-dichloro-4-methylphenyl)sulfanyl-4-nitro-3-phenoxybenzene Chemical compound C1=C(Cl)C(C)=CC(Cl)=C1SC1=CC=C([N+]([O-])=O)C(OC=2C=CC=CC=2)=C1Cl VIMIIJOCKXHOJA-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- KWHDXJHBFYQOTK-UHFFFAOYSA-N heptane;toluene Chemical compound CCCCCCC.CC1=CC=CC=C1 KWHDXJHBFYQOTK-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000010502 orange oil Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- MTBYTWZDRVOMBR-UHFFFAOYSA-N 1,2,3,4-tetrachloro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl MTBYTWZDRVOMBR-UHFFFAOYSA-N 0.000 description 2
- BGKIECJVXXHLDP-UHFFFAOYSA-N 1,2,3-trichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1Cl BGKIECJVXXHLDP-UHFFFAOYSA-N 0.000 description 2
- LBKQVYCKFHARBV-UHFFFAOYSA-N 1,2-dichloro-4-nitro-5-phenoxybenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1OC1=CC=CC=C1 LBKQVYCKFHARBV-UHFFFAOYSA-N 0.000 description 2
- LNVDUFGZPHEFMD-UHFFFAOYSA-N 1-(4-bromo-2,5-dichlorophenoxy)-2-chloro-4-nitro-5-phenoxybenzene Chemical compound C1=C(OC=2C=CC=CC=2)C([N+](=O)[O-])=CC(Cl)=C1OC1=CC(Cl)=C(Br)C=C1Cl LNVDUFGZPHEFMD-UHFFFAOYSA-N 0.000 description 2
- LHJGJYXLEPZJPM-UHFFFAOYSA-N 2,4,5-trichlorophenol Chemical compound OC1=CC(Cl)=C(Cl)C=C1Cl LHJGJYXLEPZJPM-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001234610 Rapistrum rugosum Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- YKNZTUQUXUXTLE-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(C(F)(F)F)=C1 YKNZTUQUXUXTLE-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- VGHOWOWLIXPTOA-UHFFFAOYSA-N cyclohexane;toluene Chemical compound C1CCCCC1.CC1=CC=CC=C1 VGHOWOWLIXPTOA-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- DWUQJUFJAZECBM-UHFFFAOYSA-N n'-(2-chloro-6-nitro-3-phenoxyphenyl)ethane-1,2-diamine;hydrochloride Chemical compound Cl.C1=C([N+]([O-])=O)C(NCCN)=C(Cl)C(OC=2C=CC=CC=2)=C1 DWUQJUFJAZECBM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- 229940031826 phenolate Drugs 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- CKQYFZPCICOPMQ-VKHMYHEASA-N (2s)-2-amino-n-methylpropanamide Chemical compound CNC(=O)[C@H](C)N CKQYFZPCICOPMQ-VKHMYHEASA-N 0.000 description 1
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical compound C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 description 1
- OFMRACCIIIDSDN-UHFFFAOYSA-N 1,2,4-trichloro-3,5-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C([N+]([O-])=O)=C1Cl OFMRACCIIIDSDN-UHFFFAOYSA-N 0.000 description 1
- IBRBMZRLVYKVRF-UHFFFAOYSA-N 1,2,4-trichloro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1Cl IBRBMZRLVYKVRF-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- SZNMOFTWFKXCCM-UHFFFAOYSA-N 1,3-dichloro-5-nitro-2,4-diphenoxybenzene Chemical compound ClC1=C(OC=2C=CC=CC=2)C([N+](=O)[O-])=CC(Cl)=C1OC1=CC=CC=C1 SZNMOFTWFKXCCM-UHFFFAOYSA-N 0.000 description 1
- JTNRGGLCSLZOOQ-UHFFFAOYSA-N 1,3-diphenoxybenzene Chemical compound C=1C=CC(OC=2C=CC=CC=2)=CC=1OC1=CC=CC=C1 JTNRGGLCSLZOOQ-UHFFFAOYSA-N 0.000 description 1
- HFCHPZKZGGFNDF-UHFFFAOYSA-N 1-bromo-2,5-dichloro-4-phenoxybenzene Chemical compound ClC1=C(OC2=CC=CC=C2)C=C(C(=C1)Br)Cl HFCHPZKZGGFNDF-UHFFFAOYSA-N 0.000 description 1
- QRLSKLPDEADPSJ-UHFFFAOYSA-N 1-chloro-5-nitro-4-phenoxy-2-(2,4,5-trichlorophenoxy)benzene Chemical compound C1=C(OC=2C=CC=CC=2)C([N+](=O)[O-])=CC(Cl)=C1OC1=CC(Cl)=C(Cl)C=C1Cl QRLSKLPDEADPSJ-UHFFFAOYSA-N 0.000 description 1
- SUBNKKWDIQDTPT-UHFFFAOYSA-N 1-nitro-2,3-diphenoxybenzene Chemical compound C=1C=CC=CC=1OC=1C([N+](=O)[O-])=CC=CC=1OC1=CC=CC=C1 SUBNKKWDIQDTPT-UHFFFAOYSA-N 0.000 description 1
- QTBBWAVLSXPJGA-UHFFFAOYSA-N 2,5-dichloro-4-methylbenzenethiol Chemical compound CC1=CC(Cl)=C(S)C=C1Cl QTBBWAVLSXPJGA-UHFFFAOYSA-N 0.000 description 1
- XIZSLLQKSKGTQV-UHFFFAOYSA-N 2-chloro-6-nitro-3-phenoxy-n-[[3-(trifluoromethyl)phenyl]methyl]aniline Chemical compound ClC1=C(NCC=2C=C(C=CC=2)C(F)(F)F)C([N+](=O)[O-])=CC=C1OC1=CC=CC=C1 XIZSLLQKSKGTQV-UHFFFAOYSA-N 0.000 description 1
- XKGSXLDVZPHUBT-UHFFFAOYSA-N 2-chloro-n-[(4-fluorophenyl)methyl]-6-nitro-3-phenoxyaniline Chemical compound ClC1=C(NCC=2C=CC(F)=CC=2)C([N+](=O)[O-])=CC=C1OC1=CC=CC=C1 XKGSXLDVZPHUBT-UHFFFAOYSA-N 0.000 description 1
- SBZJJWYFJUPKJJ-UHFFFAOYSA-N 2-chloro-n-[2-(2,5-dichlorophenoxy)ethyl]-6-nitro-3-phenoxyaniline Chemical compound ClC1=C(NCCOC=2C(=CC=C(Cl)C=2)Cl)C([N+](=O)[O-])=CC=C1OC1=CC=CC=C1 SBZJJWYFJUPKJJ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- UQDDLFMWBKJUHG-UHFFFAOYSA-N 3-chloro-1-nitro-2-phenoxy-4-(2,4,5-trichlorophenoxy)benzene Chemical compound ClC1=C(OC=2C=CC=CC=2)C([N+](=O)[O-])=CC=C1OC1=CC(Cl)=C(Cl)C=C1Cl UQDDLFMWBKJUHG-UHFFFAOYSA-N 0.000 description 1
- JHEJJKKHRMNXIJ-UHFFFAOYSA-N 4-(2-chloro-4-nitro-3-phenoxyphenoxy)benzonitrile Chemical compound ClC1=C(OC=2C=CC=CC=2)C([N+](=O)[O-])=CC=C1OC1=CC=C(C#N)C=C1 JHEJJKKHRMNXIJ-UHFFFAOYSA-N 0.000 description 1
- HWWKEEKUMAZJLL-UHFFFAOYSA-N 4-bromo-2,5-dichlorophenol Chemical compound OC1=CC(Cl)=C(Br)C=C1Cl HWWKEEKUMAZJLL-UHFFFAOYSA-N 0.000 description 1
- SAGYWCUJHKYKKK-UHFFFAOYSA-N 4-chloro-2-nitro-5-phenoxy-n-[[3-(trifluoromethyl)phenyl]methyl]aniline Chemical compound C1=C(NCC=2C=C(C=CC=2)C(F)(F)F)C([N+](=O)[O-])=CC(Cl)=C1OC1=CC=CC=C1 SAGYWCUJHKYKKK-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- 241000512259 Ascophyllum nodosum Species 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 240000004585 Dactylis glomerata Species 0.000 description 1
- OFDYMSKSGFSLLM-UHFFFAOYSA-N Dinitramine Chemical compound CCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C(N)=C1[N+]([O-])=O OFDYMSKSGFSLLM-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- 239000005573 Linuron Substances 0.000 description 1
- LKJPSUCKSLORMF-UHFFFAOYSA-N Monolinuron Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C=C1 LKJPSUCKSLORMF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- 244000300264 Spinacia oleracea Species 0.000 description 1
- 235000009337 Spinacia oleracea Nutrition 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- DDBMQDADIHOWIC-UHFFFAOYSA-N aclonifen Chemical compound C1=C([N+]([O-])=O)C(N)=C(Cl)C(OC=2C=CC=CC=2)=C1 DDBMQDADIHOWIC-UHFFFAOYSA-N 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000035929 gnawing Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012447 hatching Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N monoethyl amine Natural products CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- BWJZHSHIMCEATL-UHFFFAOYSA-N n'-(2-chloro-6-nitro-3-phenoxyphenyl)hexane-1,6-diamine Chemical compound C1=C([N+]([O-])=O)C(NCCCCCCN)=C(Cl)C(OC=2C=CC=CC=2)=C1 BWJZHSHIMCEATL-UHFFFAOYSA-N 0.000 description 1
- KQVOFDQQAIJQIJ-UHFFFAOYSA-N n'-(4-chloro-2-nitro-5-phenoxyphenyl)ethane-1,2-diamine;hydrochloride Chemical compound Cl.C1=C([N+]([O-])=O)C(NCCN)=CC(OC=2C=CC=CC=2)=C1Cl KQVOFDQQAIJQIJ-UHFFFAOYSA-N 0.000 description 1
- TVIOANPYJLQDHL-UHFFFAOYSA-N n-benzyl-2-chloro-3-(2,5-dichloro-4-methylphenyl)sulfanyl-6-nitroaniline Chemical compound C1=C(Cl)C(C)=CC(Cl)=C1SC1=CC=C([N+]([O-])=O)C(NCC=2C=CC=CC=2)=C1Cl TVIOANPYJLQDHL-UHFFFAOYSA-N 0.000 description 1
- QJKHZRIMAUSSFE-UHFFFAOYSA-N n-benzyl-5-(4-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitroaniline Chemical compound C1=C(NCC=2C=CC=CC=2)C([N+](=O)[O-])=CC(Cl)=C1OC1=CC(Cl)=C(Br)C=C1Cl QJKHZRIMAUSSFE-UHFFFAOYSA-N 0.000 description 1
- ANORDWOIBSUYBN-UHFFFAOYSA-N n-chloro-1-phenylmethanamine Chemical compound ClNCC1=CC=CC=C1 ANORDWOIBSUYBN-UHFFFAOYSA-N 0.000 description 1
- LZGUHMNOBNWABZ-UHFFFAOYSA-N n-nitro-n-phenylnitramide Chemical compound [O-][N+](=O)N([N+]([O-])=O)C1=CC=CC=C1 LZGUHMNOBNWABZ-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical class [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 239000002547 new drug Substances 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 235000015277 pork Nutrition 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- AVWQQPYHYQKEIZ-UHFFFAOYSA-K trisodium;2-dodecylbenzenesulfonate;3-dodecylbenzenesulfonate;4-dodecylbenzenesulfonate Chemical compound [Na+].[Na+].[Na+].CCCCCCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCCC1=CC=CC(S([O-])(=O)=O)=C1.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O AVWQQPYHYQKEIZ-UHFFFAOYSA-K 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/04—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reaction of ammonia or amines with olefin oxides or halohydrins
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/08—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions not involving the formation of amino groups, hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/12—Preparation of carboxylic acid amides by reactions not involving the formation of carboxamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C241/00—Preparation of compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
- C07C241/02—Preparation of hydrazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/30—Preparation of carboxylic acid nitriles by reactions not involving the formation of cyano groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
- C07C319/20—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides by reactions not involving the formation of sulfide groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792938595 DE2938595A1 (de) | 1979-09-24 | 1979-09-24 | Verfahren zur herstellung von diphenylaethern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU182205B true HU182205B (en) | 1983-12-28 |
Family
ID=6081697
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU802316A HU182205B (en) | 1979-09-24 | 1980-09-22 | Process for preparing diphenyl-ethers |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4364875A (enExample) |
| EP (1) | EP0027555B1 (enExample) |
| JP (1) | JPS5655357A (enExample) |
| AT (1) | ATE5773T1 (enExample) |
| AU (1) | AU529324B2 (enExample) |
| BR (1) | BR8006061A (enExample) |
| CA (1) | CA1181088A (enExample) |
| DD (1) | DD154697A5 (enExample) |
| DE (2) | DE2938595A1 (enExample) |
| DK (1) | DK164045C (enExample) |
| ES (1) | ES8201519A1 (enExample) |
| HU (1) | HU182205B (enExample) |
| IE (1) | IE50314B1 (enExample) |
| IL (1) | IL61118A (enExample) |
| MA (1) | MA18956A1 (enExample) |
| NZ (1) | NZ195025A (enExample) |
| YU (1) | YU42355B (enExample) |
| ZA (1) | ZA805885B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3269621D1 (en) * | 1981-08-07 | 1986-04-10 | Ciba Geigy Ag | Phenoxyphenyl-aminocarboxylic-acid derivatives, their preparation, compositions containing them and their use |
| US4913729A (en) * | 1981-10-19 | 1990-04-03 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-3'-substituted amine-4'-nitro diphenyl ethers |
| EP0080746B1 (en) * | 1981-11-09 | 1985-08-21 | Duphar International Research B.V | New diphenyl ethers having herbicidal activity |
| DE3209878A1 (de) * | 1982-03-18 | 1983-09-29 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Verfahren zur herstellung von diphenylaethern |
| US4526608A (en) * | 1982-07-14 | 1985-07-02 | Zoecon Corporation | Certain 2-pyridyloxyphenyl-oximino-ether-carboxylates, herbicidal compositions containing same and their herbicidal method of use |
| DE3300585A1 (de) * | 1983-01-11 | 1984-07-12 | Basf Ag, 6700 Ludwigshafen | Diphenylether, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| US4694105A (en) * | 1983-12-20 | 1987-09-15 | Ciba-Geigy Corporation | Herbicidal alkoxyamino- and polyalkoxyaminodiphenyl ethers |
| US5024691A (en) * | 1985-02-25 | 1991-06-18 | Ici Americas Inc. | Substituted phenoxy benzamide herbicides and methods of use |
| GB8520774D0 (en) * | 1985-08-20 | 1985-09-25 | Shell Int Research | Diphenyl ether herbicides |
| JP2655359B2 (ja) * | 1990-01-25 | 1997-09-17 | 富士写真フイルム株式会社 | 芳香族求核置換反応による芳香族アミン類、芳香族アルコール類、芳香族チオール類の合成法 |
| US5424280A (en) * | 1993-10-07 | 1995-06-13 | American Cyanamid Company | Aryloxybenzene herbicidal agents |
| CN103242178A (zh) * | 2013-05-09 | 2013-08-14 | 北京颖泰嘉和生物科技有限公司 | 一种2-氯-3-苯氧基-6-硝基苯胺的合成方法 |
| CN110372550B (zh) * | 2013-09-09 | 2021-08-24 | 佩洛通治疗公司 | 芳基醚及其用途 |
| US10278942B2 (en) | 2015-03-11 | 2019-05-07 | Peloton Therapeutics, Inc. | Compositions for use in treating pulmonary arterial hypertension |
| WO2016144825A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Aromatic compounds and uses thereof |
| WO2016144826A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Substituted pyridines and uses thereof |
| WO2016145045A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Compositions for use in treating glioblastoma |
| US10335388B2 (en) | 2015-04-17 | 2019-07-02 | Peloton Therapeutics, Inc. | Combination therapy of a HIF-2-alpha inhibitor and an immunotherapeutic agent and uses thereof |
| US11104754B2 (en) * | 2016-11-15 | 2021-08-31 | Evonik Operations Gmbh | Asymmetrically substituted bis-alkenyl diphenyl ethers, their preparation and use |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH462847A (de) * | 1965-11-11 | 1968-09-30 | Agripat Sa | Verfahren zur Herstellung von halogenierten Nitranilinen |
| US3914310A (en) * | 1965-08-06 | 1975-10-21 | Ciba Geigy Corp | Phenoxy-substituted ortho-nitroanilines and ortho-phenylenediamines |
| US4039588A (en) * | 1969-05-28 | 1977-08-02 | Rohm And Haas Company | Herbicidal 4-nitro-diphenyl ethers |
| US3920445A (en) * | 1970-02-28 | 1975-11-18 | Bayer Ag | Substituted 6-nitroaniline compounds and herbicidal compositions |
| US4046798A (en) * | 1973-02-12 | 1977-09-06 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4'nitrodiphenyl ethers |
| US3798276A (en) * | 1972-03-14 | 1974-03-19 | H Bayer | Herbicidal 4-trifluoromethyl-4'-nitrodiphenyl ethers |
| SE416544B (sv) * | 1972-03-14 | 1981-01-19 | Rohm & Haas | Herbicidisk forening samt anvendning som herbicid av foreningen |
| JPS525486B2 (enExample) * | 1973-02-13 | 1977-02-14 | ||
| CH599752A5 (enExample) * | 1973-04-18 | 1978-05-31 | Ciba Geigy Ag | |
| FR2311004A1 (fr) * | 1975-05-13 | 1976-12-10 | Ciba Geigy Ag | Procede de preparation de composes diaryliques ou de composes heteroaryliques et produits obtenus par ce procede |
| LU76304A1 (enExample) * | 1976-12-01 | 1978-07-10 | ||
| DE2800105A1 (de) * | 1977-01-11 | 1978-07-13 | Ciba Geigy Ag | Verwendung von diphenylaethern als algizide |
| TR20258A (tr) * | 1978-07-15 | 1980-12-08 | Celamerck Gmbh & Co Kg | 2-klor-6-nitroanilin |
-
1979
- 1979-09-24 DE DE19792938595 patent/DE2938595A1/de not_active Withdrawn
-
1980
- 1980-09-19 JP JP13143780A patent/JPS5655357A/ja active Granted
- 1980-09-20 DE DE8080105658T patent/DE3066058D1/de not_active Expired
- 1980-09-20 AT AT80105658T patent/ATE5773T1/de active
- 1980-09-20 EP EP80105658A patent/EP0027555B1/de not_active Expired
- 1980-09-22 DD DD80224048A patent/DD154697A5/de not_active IP Right Cessation
- 1980-09-22 HU HU802316A patent/HU182205B/hu unknown
- 1980-09-22 MA MA19157A patent/MA18956A1/fr unknown
- 1980-09-23 IL IL61118A patent/IL61118A/xx not_active IP Right Cessation
- 1980-09-23 BR BR8006061A patent/BR8006061A/pt unknown
- 1980-09-23 IE IE1982/80A patent/IE50314B1/en not_active IP Right Cessation
- 1980-09-23 ZA ZA00805885A patent/ZA805885B/xx unknown
- 1980-09-23 DK DK402280A patent/DK164045C/da not_active IP Right Cessation
- 1980-09-23 AU AU62642/80A patent/AU529324B2/en not_active Expired
- 1980-09-23 ES ES495249A patent/ES8201519A1/es not_active Expired
- 1980-09-23 NZ NZ195025A patent/NZ195025A/xx unknown
- 1980-09-24 YU YU2432/80A patent/YU42355B/xx unknown
- 1980-09-24 CA CA000360960A patent/CA1181088A/en not_active Expired
-
1981
- 1981-07-07 US US06/281,123 patent/US4364875A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0259135B2 (enExample) | 1990-12-11 |
| NZ195025A (en) | 1983-05-31 |
| IE50314B1 (en) | 1986-04-02 |
| ES495249A0 (es) | 1981-11-16 |
| MA18956A1 (fr) | 1981-04-01 |
| IE801982L (en) | 1981-03-24 |
| AU6264280A (en) | 1982-04-01 |
| YU243280A (en) | 1983-02-28 |
| EP0027555A1 (de) | 1981-04-29 |
| BR8006061A (pt) | 1981-04-07 |
| DK164045C (da) | 1992-09-28 |
| EP0027555B1 (de) | 1984-01-04 |
| ATE5773T1 (de) | 1984-01-15 |
| ZA805885B (en) | 1982-05-26 |
| ES8201519A1 (es) | 1981-11-16 |
| DK402280A (da) | 1981-03-25 |
| JPS5655357A (en) | 1981-05-15 |
| AU529324B2 (en) | 1983-06-02 |
| DD154697A5 (de) | 1982-04-14 |
| CA1181088A (en) | 1985-01-15 |
| DK164045B (da) | 1992-05-04 |
| DE2938595A1 (de) | 1981-04-23 |
| IL61118A (en) | 1984-07-31 |
| DE3066058D1 (en) | 1984-02-09 |
| IL61118A0 (en) | 1980-11-30 |
| YU42355B (en) | 1988-08-31 |
| US4364875A (en) | 1982-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU182205B (en) | Process for preparing diphenyl-ethers | |
| JP2567235B2 (ja) | 置換ピリジンスルホンアミド系化合物、それらを含有する除草剤並びにそれらの製造方法 | |
| EP0014684B1 (de) | 2-Substituierte 5-Phenoxy-phenylphosphonsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| AU641905B2 (en) | 1-substituted-phenyl pyrrole derivatives as insecticides and methods for their production | |
| CS241078B2 (en) | Microbicide for plants' diseases suppression and method of active substances production | |
| JP2021522354A (ja) | ベンズアミド系化合物及びその使用 | |
| FR2590570A1 (fr) | Triazines, compositions herbicides contenant ces triazines et procede pour combattre les mauvaises herbes | |
| US4964905A (en) | N-substituted-phenylteraconimide compound, herbicidal composition, and method for the destruction of undesirable weeds | |
| US4465503A (en) | Diphenyl ether derivatives, process for preparing the same and herbicidal compositions containing the same | |
| HU176020B (en) | Herbicide composition containing n-/4-benzyl-oxy-phenyl/-n'-methyl-n'-methoxy-carbamide and process for preparing the active substance | |
| EP0196570B1 (en) | Benzoaxazine derivatives and herbicidal composition | |
| FR2572401A1 (fr) | Nouveaux derives du cyano-2 benzimidazole, leur preparation et leur utilisation comme fongicides et acaricides | |
| US4187096A (en) | Biocidally-active 1,3-benzodithiole-2-thione compounds | |
| US4806653A (en) | Process for preparation of iminooxazolidines | |
| US4240821A (en) | Biocidally-active 1,3-benzodithiole-2-thione compounds | |
| US4213775A (en) | Diphenyl ether derivatives and herbicidal compositions containing the same | |
| HU185201B (en) | Herbicide compositions containing quaternary amine salts as active substances and process for preparing the active cubstances | |
| JPH02209839A (ja) | 除草性化合物、その製造法、それを含有する除草剤組成物及び除草方法 | |
| CS210604B2 (en) | Herbicide and preparation method of active substance | |
| HU190646B (en) | Herbicidal compositions containing new diphenyl-ether-derivatives as active substance and process for the production of the active substances | |
| US4007033A (en) | Herbicidal substituted-haloethyl urea | |
| US3755437A (en) | 1,3-disubstituted-1-ureido-1',3'-disubstituted-1'-ureido sulfides | |
| US4064140A (en) | Process for the production of iminopyrrolinones | |
| KR0128544B1 (ko) | 2,3-디히드로-3-메틸렌-2-치환된 페닐-1h-이소인돌-1-온 유도체 | |
| JPS6261026B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |