HU180065B - Process for cleaning terephtalic acid with continuous cristallisation with multistep flas into steam - Google Patents
Process for cleaning terephtalic acid with continuous cristallisation with multistep flas into steam Download PDFInfo
- Publication number
- HU180065B HU180065B HU74SA2682A HUSA002682A HU180065B HU 180065 B HU180065 B HU 180065B HU 74SA2682 A HU74SA2682 A HU 74SA2682A HU SA002682 A HUSA002682 A HU SA002682A HU 180065 B HU180065 B HU 180065B
- Authority
- HU
- Hungary
- Prior art keywords
- terephthalic acid
- temperature
- crystallization
- acid
- ppm
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title claims abstract description 297
- 238000000034 method Methods 0.000 title claims abstract description 43
- 238000004140 cleaning Methods 0.000 title 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 claims abstract description 134
- 239000007864 aqueous solution Substances 0.000 claims abstract description 9
- 230000003247 decreasing effect Effects 0.000 claims abstract description 8
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 4
- 238000002425 crystallisation Methods 0.000 claims description 71
- 230000008025 crystallization Effects 0.000 claims description 71
- 239000000243 solution Substances 0.000 claims description 22
- 239000001963 growth medium Substances 0.000 claims description 4
- 239000002904 solvent Substances 0.000 abstract description 11
- 238000011084 recovery Methods 0.000 abstract 3
- 239000007788 liquid Substances 0.000 abstract 1
- 239000000047 product Substances 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 230000000052 comparative effect Effects 0.000 description 13
- 239000002609 medium Substances 0.000 description 13
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 239000013078 crystal Substances 0.000 description 9
- 238000000935 solvent evaporation Methods 0.000 description 8
- 238000011109 contamination Methods 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000007791 liquid phase Substances 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 230000001419 dependent effect Effects 0.000 description 6
- 238000009826 distribution Methods 0.000 description 6
- 239000012535 impurity Substances 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 238000005119 centrifugation Methods 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 150000003504 terephthalic acids Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 2
- 230000002902 bimodal effect Effects 0.000 description 2
- 230000001186 cumulative effect Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012527 feed solution Substances 0.000 description 2
- 239000013505 freshwater Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 208000018459 dissociative disease Diseases 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000011268 mixed slurry Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/42—Separation; Purification; Stabilisation; Use of additives
- C07C51/43—Separation; Purification; Stabilisation; Use of additives by change of the physical state, e.g. crystallisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/389,717 US3931305A (en) | 1973-08-20 | 1973-08-20 | Terephthalic acid recovery by continuous flash crystallization |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU180065B true HU180065B (en) | 1983-01-28 |
Family
ID=23539427
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU74SA2682A HU180065B (en) | 1973-08-20 | 1974-08-17 | Process for cleaning terephtalic acid with continuous cristallisation with multistep flas into steam |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3931305A (enExample) |
| JP (1) | JPS5324057B2 (enExample) |
| BE (1) | BE818228A (enExample) |
| BG (1) | BG31071A3 (enExample) |
| BR (1) | BR7406531D0 (enExample) |
| CA (1) | CA1019342A (enExample) |
| CS (1) | CS198150B2 (enExample) |
| DD (1) | DD115109A5 (enExample) |
| DE (1) | DE2437846A1 (enExample) |
| EG (1) | EG11555A (enExample) |
| ES (1) | ES429400A1 (enExample) |
| FR (1) | FR2241529B1 (enExample) |
| GB (1) | GB1476436A (enExample) |
| HU (1) | HU180065B (enExample) |
| IN (1) | IN142341B (enExample) |
| IT (1) | IT1018896B (enExample) |
| NL (1) | NL7409866A (enExample) |
| PL (1) | PL100195B1 (enExample) |
| RO (1) | RO66116A (enExample) |
| SU (1) | SU869554A3 (enExample) |
| TR (1) | TR18050A (enExample) |
| YU (1) | YU41043B (enExample) |
Families Citing this family (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51132395U (enExample) * | 1975-04-14 | 1976-10-25 | ||
| GB1582255A (en) * | 1976-08-11 | 1981-01-07 | Ici Ltd | Crystallisation of terephthalic acid |
| DE3037045C2 (de) * | 1980-10-01 | 1987-02-26 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Kristallisation in einem Lösungsmittel bis zur Sättigung gelöster Terephthalsäure und Kristallisationsvorrichtung |
| IT1163145B (it) * | 1983-03-11 | 1987-04-08 | Friuli Chim Spa | Preparazione di acido benzoico puro |
| US5567842A (en) * | 1994-11-16 | 1996-10-22 | Mitsubishi Chemical Corporation | Process for producing terephthalic acid |
| US5502247A (en) * | 1994-11-17 | 1996-03-26 | Amoco Corporation | Process for recovery of aromatic acid or ester and polyol from waste polyester resins |
| US5767311A (en) * | 1995-06-07 | 1998-06-16 | Glitsch International, Inc. | Method and apparatus for preparing purified terephtalic acid |
| US5840968A (en) * | 1995-06-07 | 1998-11-24 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| US6013835A (en) * | 1995-06-07 | 2000-01-11 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| US6054610A (en) * | 1995-06-07 | 2000-04-25 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid and isophthalic acid from mixed xylenes |
| US5929274A (en) * | 1995-06-07 | 1999-07-27 | Hfm International, Inc. | Method to reduce carboxybenzaldehyde isomers in terephthalic acid or isophthalic acid |
| US7485747B2 (en) * | 2001-06-04 | 2009-02-03 | Eastman Chemical Company | Two stage oxidation process for the production of aromatic dicarboxylic acids |
| US6689903B2 (en) | 2001-06-04 | 2004-02-10 | Eastman Chemical Company | Crystallization method for production of purified aromatic dicarboxylic acids |
| US7196215B2 (en) * | 2001-06-04 | 2007-03-27 | Eastman Chemical Company | Process for the production of purified terephthalic acid |
| US7276625B2 (en) | 2002-10-15 | 2007-10-02 | Eastman Chemical Company | Process for production of a carboxylic acid/diol mixture suitable for use in polyester production |
| WO2004063135A1 (ja) * | 2003-01-10 | 2004-07-29 | Mitsubishi Chemical Corporation | 芳香族カルボン酸の製造方法およびテレフタル酸の製造方法 |
| US7193109B2 (en) * | 2003-03-06 | 2007-03-20 | Eastman Chemical Company | Process for production of a carboxylic acid/diol mixture suitable for use in polyester production |
| US20040215036A1 (en) * | 2003-04-25 | 2004-10-28 | Robert Lin | Method for heating a crude carboxylic acid slurry in a post oxidation zone by the addition of steam |
| US7214760B2 (en) * | 2004-01-15 | 2007-05-08 | Eastman Chemical Company | Process for production of a carboxylic acid/diol mixture suitable for use in polyester production |
| US7546747B2 (en) * | 2004-01-15 | 2009-06-16 | Eastman Chemical Company | Process for production of a dried carboxylic acid cake suitable for use in polyester production |
| NZ586285A (en) | 2004-03-17 | 2011-12-22 | Novartis Ag | Use of aliskiren in monotherapy for treating diabetes and metabolic disorder (syndrome X) |
| US7390921B2 (en) * | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060047153A1 (en) * | 2004-09-02 | 2006-03-02 | Wonders Alan G | Optimized liquid-phase oxidation |
| US7572936B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) * | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) * | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) * | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) * | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) * | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) * | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) * | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) * | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) * | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) * | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| JP4747544B2 (ja) * | 2004-09-30 | 2011-08-17 | 株式会社日立プラントテクノロジー | テレフタル酸の精製方法 |
| US7919652B2 (en) * | 2005-05-19 | 2011-04-05 | Eastman Chemical Company | Process to produce an enriched composition through the use of a catalyst removal zone and an enrichment zone |
| US7741516B2 (en) | 2005-05-19 | 2010-06-22 | Eastman Chemical Company | Process to enrich a carboxylic acid composition |
| US7304178B2 (en) * | 2005-05-19 | 2007-12-04 | Eastman Chemical Company | Enriched isophthalic acid composition |
| US20060264664A1 (en) * | 2005-05-19 | 2006-11-23 | Parker Kenny R | Esterification of an exchange solvent enriched composition |
| US7432395B2 (en) * | 2005-05-19 | 2008-10-07 | Eastman Chemical Company | Enriched carboxylic acid composition |
| US7557243B2 (en) | 2005-05-19 | 2009-07-07 | Eastman Chemical Company | Enriched terephthalic acid composition |
| US7897809B2 (en) * | 2005-05-19 | 2011-03-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US20060264656A1 (en) * | 2005-05-19 | 2006-11-23 | Fujitsu Limited | Enrichment process using compounds useful in a polyester process |
| US7884231B2 (en) | 2005-05-19 | 2011-02-08 | Eastman Chemical Company | Process to produce an enriched composition |
| US7880031B2 (en) * | 2005-05-19 | 2011-02-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7834208B2 (en) * | 2005-05-19 | 2010-11-16 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US20060264662A1 (en) * | 2005-05-19 | 2006-11-23 | Gibson Philip E | Esterification of an enriched composition |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US20070155987A1 (en) * | 2006-01-04 | 2007-07-05 | O'meadhra Ruairi S | Oxidative digestion with optimized agitation |
| US7355068B2 (en) * | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| US20070179312A1 (en) * | 2006-02-02 | 2007-08-02 | O'meadhra Ruairi Seosamh | Process for the purification of a crude carboxylic axid slurry |
| US7420082B2 (en) | 2006-03-01 | 2008-09-02 | Eastman Chemical Company | Polycarboxylic acid production system employing hot liquor removal downstream of oxidative digestion |
| US7772424B2 (en) * | 2006-03-01 | 2010-08-10 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced evaporative concentration downstream of oxidative digestion |
| US7462736B2 (en) * | 2006-03-01 | 2008-12-09 | Eastman Chemical Company | Methods and apparatus for isolating carboxylic acid |
| US7863483B2 (en) * | 2006-03-01 | 2011-01-04 | Eastman Chemical Company | Carboxylic acid production process |
| US7847121B2 (en) * | 2006-03-01 | 2010-12-07 | Eastman Chemical Company | Carboxylic acid production process |
| US7326808B2 (en) * | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system employing cooled mother liquor from oxidative digestion as feed to impurity purge system |
| US7888529B2 (en) * | 2006-03-01 | 2011-02-15 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US7501537B2 (en) * | 2006-03-01 | 2009-03-10 | Eastman Chemical Company | Polycarboxylic acid production system employing oxidative digestion with reduced or eliminated upstream liquor exchange |
| US7326807B2 (en) | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced heating for oxidative digestion |
| US20070208194A1 (en) * | 2006-03-01 | 2007-09-06 | Woodruff Thomas E | Oxidation system with sidedraw secondary reactor |
| US7816556B2 (en) * | 2006-03-01 | 2010-10-19 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced multistage oxidative digestion |
| US7393973B2 (en) * | 2006-03-01 | 2008-07-01 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced residence time distribution for oxidative digestion |
| US9205388B2 (en) * | 2007-06-27 | 2015-12-08 | H R D Corporation | High shear system and method for the production of acids |
| US8614350B2 (en) | 2008-01-15 | 2013-12-24 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| US8455680B2 (en) | 2008-01-15 | 2013-06-04 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| US8969404B2 (en) * | 2012-06-22 | 2015-03-03 | Eastman Chemical Company | Purifying crude furan 2,5-dicarboxylic acid by hydrogenation |
| US9029580B2 (en) | 2012-07-20 | 2015-05-12 | Eastman Chemical Company | Oxidation process to produce a purified carboxylic acid product via solvent displacement and post oxidation |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3639465A (en) * | 1968-06-18 | 1972-02-01 | Standard Oil Co | Purification of aromatic polycarboxylic acids by catalytic reduction using prehumidified hydrogen |
| US3655729A (en) * | 1968-07-18 | 1972-04-11 | Gen Tire & Rubber Co | Process for preparing esters of terephthalic acid |
| US3708532A (en) * | 1968-11-04 | 1973-01-02 | Teijin Ltd | Process for the continuous purification of crude terephthalic acid |
| DE1925038C3 (de) * | 1969-05-16 | 1980-10-23 | Standard Oil Co., Chicago, Ill. (V.St.A.) | Verfahren zur Gewinnung von Terephthalsäure |
-
1973
- 1973-08-20 US US05/389,717 patent/US3931305A/en not_active Expired - Lifetime
-
1974
- 1974-07-22 NL NL7409866A patent/NL7409866A/xx active Search and Examination
- 1974-07-26 IN IN1669/CAL/1974A patent/IN142341B/en unknown
- 1974-07-29 BE BE147065A patent/BE818228A/xx not_active IP Right Cessation
- 1974-08-06 DE DE2437846A patent/DE2437846A1/de active Granted
- 1974-08-07 CA CA206,504A patent/CA1019342A/en not_active Expired
- 1974-08-08 BR BR6531/74A patent/BR7406531D0/pt unknown
- 1974-08-08 IT IT52518/74A patent/IT1018896B/it active
- 1974-08-13 FR FR7428072A patent/FR2241529B1/fr not_active Expired
- 1974-08-14 RO RO7479767A patent/RO66116A/ro unknown
- 1974-08-15 YU YU2241/74A patent/YU41043B/xx unknown
- 1974-08-15 TR TR18050A patent/TR18050A/xx unknown
- 1974-08-17 HU HU74SA2682A patent/HU180065B/hu unknown
- 1974-08-19 SU SU742055522A patent/SU869554A3/ru active
- 1974-08-19 DD DD180583A patent/DD115109A5/xx unknown
- 1974-08-19 GB GB3644974A patent/GB1476436A/en not_active Expired
- 1974-08-20 CS CS745779A patent/CS198150B2/cs unknown
- 1974-08-20 BG BG027525A patent/BG31071A3/xx unknown
- 1974-08-20 EG EG345/74A patent/EG11555A/xx active
- 1974-08-20 JP JP9545574A patent/JPS5324057B2/ja not_active Expired
- 1974-08-20 ES ES429400A patent/ES429400A1/es not_active Expired
- 1974-08-20 PL PL1974173574A patent/PL100195B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2241529A1 (enExample) | 1975-03-21 |
| DD115109A5 (enExample) | 1975-09-12 |
| SU869554A3 (ru) | 1981-09-30 |
| EG11555A (en) | 1977-08-15 |
| IT1018896B (it) | 1977-10-20 |
| GB1476436A (en) | 1977-06-16 |
| CA1019342A (en) | 1977-10-18 |
| CS198150B2 (en) | 1980-05-30 |
| TR18050A (tr) | 1976-09-23 |
| IN142341B (enExample) | 1977-06-25 |
| US3931305A (en) | 1976-01-06 |
| JPS5324057B2 (enExample) | 1978-07-18 |
| YU224174A (en) | 1982-05-31 |
| DE2437846A1 (de) | 1975-03-06 |
| BG31071A3 (en) | 1981-10-15 |
| RO66116A (ro) | 1980-03-15 |
| FR2241529B1 (enExample) | 1978-08-11 |
| DE2437846C2 (enExample) | 1989-12-28 |
| NL7409866A (nl) | 1975-02-24 |
| YU41043B (en) | 1986-10-31 |
| BE818228A (fr) | 1975-01-29 |
| ES429400A1 (es) | 1976-09-01 |
| BR7406531D0 (pt) | 1975-06-03 |
| JPS5049248A (enExample) | 1975-05-01 |
| PL100195B1 (pl) | 1978-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU180065B (en) | Process for cleaning terephtalic acid with continuous cristallisation with multistep flas into steam | |
| US3850983A (en) | Separation of terephthalic from paratoluic acid from solutions thereof in water and/or acetic acid | |
| DE69628319T2 (de) | Verfahren und gerät zur reinigung von terephtalsäure | |
| US3216481A (en) | Recovery of phthalic and maleic acid from solutions | |
| JP3854765B2 (ja) | 長鎖ジカルボン酸の精製方法 | |
| US4116712A (en) | Solvent refining of sugar | |
| JPS5966305A (ja) | 向流式溶融物冷却精製法 | |
| JP2018012720A (ja) | 二無水糖の回収及び精製 | |
| US3956457A (en) | Preparation of sodium carbonate monohydrate | |
| NL8603314A (nl) | Werkwijze en inrichting voor het winnen van een zuivere stof uit een vloeibaar mengsel door kristallisatie. | |
| KR930006694B1 (ko) | 인산결정을 제조하는 방법 | |
| GB2123403A (en) | Continuous procedure for obtaining pure terephthalic acid and glycol starting from polyethylene terephthalate waste | |
| US4900821A (en) | Method for producing high-purity caprolactam | |
| US3391187A (en) | Purification of malic acid | |
| US4524057A (en) | Production of concentrated phosphoric acid and hemihydrated calcium sulfate | |
| US2343456A (en) | Monocalcium phosphate crystallization | |
| US2790011A (en) | Process for the recovery of pentaerythritol | |
| US2214115A (en) | Process of making mono-sodium glutamate from gluten | |
| US4035419A (en) | Process for the preparation of malic acid crystals | |
| US4264332A (en) | Process for the preparation of pure aluminum chloride hexahydrate | |
| KR810001026B1 (ko) | 연속 순간 결정화에 의한 테레프탈산의 회수방법 | |
| US2102380A (en) | Process of crystallizing pure d-glucono-delta-lactone | |
| EP0264226B1 (en) | Separation process by crystallisation | |
| US2393095A (en) | Process of hydrolysis of starch | |
| US4877889A (en) | Method and installation for the crystallization of gluconodeltalactone |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |