HU177086B - Herbicide and fungicide preparation containing substituted 1,2,4-oxadiazolidin-3-one derivatives - Google Patents
Herbicide and fungicide preparation containing substituted 1,2,4-oxadiazolidin-3-one derivatives Download PDFInfo
- Publication number
- HU177086B HU177086B HU75EA148A HUEA000148A HU177086B HU 177086 B HU177086 B HU 177086B HU 75EA148 A HU75EA148 A HU 75EA148A HU EA000148 A HUEA000148 A HU EA000148A HU 177086 B HU177086 B HU 177086B
- Authority
- HU
- Hungary
- Prior art keywords
- oxadiazolidin
- derivatives
- rrt
- formula
- tendon
- Prior art date
Links
- JGDQLDVVLNXDPQ-UHFFFAOYSA-N 1,2,4-oxadiazolidin-3-one Chemical class O=C1NCON1 JGDQLDVVLNXDPQ-UHFFFAOYSA-N 0.000 title claims abstract description 15
- 238000002360 preparation method Methods 0.000 title claims abstract description 14
- 239000000417 fungicide Substances 0.000 title claims description 6
- 230000002363 herbicidal effect Effects 0.000 title claims description 6
- 239000004009 herbicide Substances 0.000 title claims description 4
- 230000000855 fungicidal effect Effects 0.000 title description 5
- 238000000034 method Methods 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 10
- -1 fatty alcohol sulfonate Chemical class 0.000 claims description 10
- 239000004480 active ingredient Substances 0.000 claims description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 150000002576 ketones Chemical class 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 claims description 3
- 229960001330 hydroxycarbamide Drugs 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 239000001110 calcium chloride Substances 0.000 claims description 2
- 229910001628 calcium chloride Inorganic materials 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- 239000011814 protection agent Substances 0.000 abstract 1
- 210000002435 tendon Anatomy 0.000 description 22
- 239000000203 mixture Substances 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- 238000011282 treatment Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- 239000002178 crystalline material Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 6
- 239000007900 aqueous suspension Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- IKYLYRBWLURWDH-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-hydroxyurea Chemical compound ONC(=O)NC1=CC=CC(Cl)=C1 IKYLYRBWLURWDH-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 4
- 239000004575 stone Substances 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- SYAKKVMBRZNPGL-UHFFFAOYSA-N 4-(3-chlorophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=CC(Cl)=C1 SYAKKVMBRZNPGL-UHFFFAOYSA-N 0.000 description 3
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 3
- IXZJCUVEVLXDPN-UHFFFAOYSA-N 5,5-dimethyl-4-phenyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=CC=C1 IXZJCUVEVLXDPN-UHFFFAOYSA-N 0.000 description 3
- 244000237956 Amaranthus retroflexus Species 0.000 description 3
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 240000006122 Chenopodium album Species 0.000 description 3
- 235000009344 Chenopodium album Nutrition 0.000 description 3
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 3
- 241000233866 Fungi Species 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- HXVNBWAKAOHACI-UHFFFAOYSA-N 2,4-dimethyl-3-pentanone Chemical compound CC(C)C(=O)C(C)C HXVNBWAKAOHACI-UHFFFAOYSA-N 0.000 description 2
- YMUIBJJOQYTBIY-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=C(Cl)C(Cl)=C1 YMUIBJJOQYTBIY-UHFFFAOYSA-N 0.000 description 2
- LBTCXKTVUQBVIW-UHFFFAOYSA-N 5,5-dimethyl-4-(2-methylphenyl)-1,2,4-oxadiazolidin-3-one Chemical compound CC1=CC=CC=C1N1C(C)(C)ONC1=O LBTCXKTVUQBVIW-UHFFFAOYSA-N 0.000 description 2
- 241000223602 Alternaria alternata Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000005789 Folpet Substances 0.000 description 2
- 241000209510 Liliopsida Species 0.000 description 2
- 239000005802 Mancozeb Substances 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- JYIMWRSJCRRYNK-UHFFFAOYSA-N dialuminum;disodium;oxygen(2-);silicon(4+);hydrate Chemical compound O.[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Na+].[Na+].[Al+3].[Al+3].[Si+4] JYIMWRSJCRRYNK-UHFFFAOYSA-N 0.000 description 2
- 241001233957 eudicotyledons Species 0.000 description 2
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000003090 pesticide formulation Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- VKYZMAVGJARVPE-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)-3-hydroxyurea Chemical compound ONC(=O)NC1=CC=C(Cl)C(Cl)=C1 VKYZMAVGJARVPE-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- YONRHSYABRDBNR-UHFFFAOYSA-N 4-(3-chlorophenyl)-5,5-diethyl-1,2,4-oxadiazolidin-3-one Chemical compound CCC1(CC)ONC(=O)N1C1=CC=CC(Cl)=C1 YONRHSYABRDBNR-UHFFFAOYSA-N 0.000 description 1
- LYQKCLZEDOCGBI-UHFFFAOYSA-N 4-(4-chlorophenyl)-5,5-dimethyl-1,2,4-oxadiazolidin-3-one Chemical compound CC1(C)ONC(=O)N1C1=CC=C(Cl)C=C1 LYQKCLZEDOCGBI-UHFFFAOYSA-N 0.000 description 1
- HCFAJYNVAYBARA-UHFFFAOYSA-N 4-heptanone Chemical compound CCCC(=O)CCC HCFAJYNVAYBARA-UHFFFAOYSA-N 0.000 description 1
- NAKBBPBCCGQMSL-UHFFFAOYSA-N 5,5-dimethyl-4-(4-methylphenyl)-1,2,4-oxadiazolidin-3-one Chemical compound C1=CC(C)=CC=C1N1C(C)(C)ONC1=O NAKBBPBCCGQMSL-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- NHAWKIGKHYUDSS-UHFFFAOYSA-N CC1(NC(NO1)=O)C Chemical compound CC1(NC(NO1)=O)C NHAWKIGKHYUDSS-UHFFFAOYSA-N 0.000 description 1
- 241000223194 Fusarium culmorum Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 229910021417 amorphous silicon Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/12—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU75EA148A HU177086B (en) | 1975-06-09 | 1975-06-09 | Herbicide and fungicide preparation containing substituted 1,2,4-oxadiazolidin-3-one derivatives |
| IE1192/76A IE43116B1 (en) | 1975-06-09 | 1976-06-03 | Derivatives of 1,2,4-oxadiazolidine-3-one and pesticidal compositions containing them |
| FR7616971A FR2314184A1 (fr) | 1975-06-09 | 1976-06-04 | Procede de preparation de derives de substitution de la 1,2,4-oxadiazoline-3-one, les composes ainsi obtenus et leur utilisation en tant que pesticides |
| CA254,114A CA1036609A (en) | 1975-06-09 | 1976-06-04 | Substituted-1,2,4-oxadiazolidine-3-one derivatives and pesticidal compositions containing the same and a process for the preparation thereof |
| DK252576A DK252576A (da) | 1975-06-09 | 1976-06-08 | Substituerede 1,2,4-oxadiazolidin-3-on-forbindelser, deres fremstilling og anvendelse |
| AT418276A AT347939B (de) | 1975-06-09 | 1976-06-08 | Verfahren zur herstellung von neuen, substi- tuierten 1,2,4-oxadiazolidin-3-on-verbindungen |
| DD7600199804A DD131126A5 (de) | 1975-06-09 | 1976-06-08 | Pflanzenschutzmittel |
| US05/693,892 US4193922A (en) | 1975-06-09 | 1976-06-08 | Substituted-1,2,4-oxadiazolidine-3-one derivatives |
| IT68388/76A IT1062322B (it) | 1975-06-09 | 1976-06-08 | 1..2..4 ossadiazolidin 3 oni sostituiti..procedimento per la loro preparazione e loro impiego come protettori delle piante |
| CS763770A CS198189B2 (en) | 1975-06-09 | 1976-06-08 | Fungicide and precess for preparing effective compound thereof |
| NL7606175A NL7606175A (nl) | 1975-06-09 | 1976-06-08 | Werkwijze voor het bereiden van gesubstitueerde 1,2,4-oxadiazolidine 3-on verbindingen. |
| DD193230A DD126227A5 (https=) | 1975-06-09 | 1976-06-08 | |
| RO7686395A RO70236A (ro) | 1975-06-09 | 1976-06-08 | Procedeu pentru prepararea unor 1,2,4-oxadiazolidin-3-one |
| PL1976203429A PL101489B1 (pl) | 1975-06-09 | 1976-06-09 | Srodek ochrony roslin |
| PL1976190257A PL99825B1 (pl) | 1975-06-09 | 1976-06-09 | Sposob wytwarzania nowych podstawionych 1,2,4-oksadiazolidynonow-3 |
| CH726876A CH620433A5 (https=) | 1975-06-09 | 1976-06-09 | |
| GB23914/76A GB1481158A (en) | 1975-06-09 | 1976-06-09 | Derivatives of 1,2,4-oxadiazolidine-3-one and pesticidal compositions containing them |
| SU762367751A SU867305A3 (ru) | 1975-06-09 | 1976-06-09 | Способ получени замещенных 1,2,4-оксадиазолидин-3-онов |
| BE167748A BE842740A (fr) | 1975-06-09 | 1976-06-09 | Procede de preparation de derives de substitution de la 1,2,4 oxadiazoline-3-one |
| DE2625848A DE2625848C2 (de) | 1975-06-09 | 1976-06-09 | Substituierte 1,2,4-Oxadiazolidin-3-on-Verbindungen, Verfahren zu ihrer Herstellung sowie Pflanzenschutzmittel, welche diese enthalten |
| LU75126A LU75126A1 (https=) | 1975-06-09 | 1976-06-09 | |
| SU772456904A SU727103A3 (ru) | 1975-06-09 | 1977-03-03 | Гербицидное и фунгицидное средство |
| AT169078A AT358868B (de) | 1975-06-09 | 1978-03-09 | Herbizides ung fungizides mittel |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU75EA148A HU177086B (en) | 1975-06-09 | 1975-06-09 | Herbicide and fungicide preparation containing substituted 1,2,4-oxadiazolidin-3-one derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU177086B true HU177086B (en) | 1981-07-28 |
Family
ID=10995099
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU75EA148A HU177086B (en) | 1975-06-09 | 1975-06-09 | Herbicide and fungicide preparation containing substituted 1,2,4-oxadiazolidin-3-one derivatives |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4193922A (https=) |
| AT (1) | AT347939B (https=) |
| BE (1) | BE842740A (https=) |
| CA (1) | CA1036609A (https=) |
| CH (1) | CH620433A5 (https=) |
| CS (1) | CS198189B2 (https=) |
| DD (2) | DD131126A5 (https=) |
| DE (1) | DE2625848C2 (https=) |
| DK (1) | DK252576A (https=) |
| FR (1) | FR2314184A1 (https=) |
| GB (1) | GB1481158A (https=) |
| HU (1) | HU177086B (https=) |
| IE (1) | IE43116B1 (https=) |
| IT (1) | IT1062322B (https=) |
| LU (1) | LU75126A1 (https=) |
| NL (1) | NL7606175A (https=) |
| PL (2) | PL101489B1 (https=) |
| RO (1) | RO70236A (https=) |
| SU (2) | SU867305A3 (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL73611A0 (en) * | 1983-12-06 | 1985-02-28 | Nippon Soda Co | 1,2,4-oxa-and thiadiazolin-3-one derivatives,their preparation and their use as insecticides and fungicides |
| US5066662A (en) * | 1990-05-21 | 1991-11-19 | Warner-Lambert Company | Substituted oxazolidin-2-ones and 1,2,4-oxadiazolin-5-ones and derivatives thereof acting at muscarinic receptors |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2852523A (en) * | 1957-09-13 | 1958-09-16 | American Cyanamid Co | 5, 5-diphenyl-1, 2, 4-oxadiazolidine-3-ones |
| IL31990A (en) * | 1968-04-26 | 1974-05-16 | Chinoin Gyogyszer Es Vegyeszet | Pyridyl 1,2,4-oxadiazole derivatives,process for the preparation thereof and pharmaceutical compositions containing same |
| DE2207576C2 (de) * | 1972-02-18 | 1985-07-25 | Basf Ag, 6700 Ludwigshafen | Oxazolidinderivate |
-
1975
- 1975-06-09 HU HU75EA148A patent/HU177086B/hu not_active IP Right Cessation
-
1976
- 1976-06-03 IE IE1192/76A patent/IE43116B1/en unknown
- 1976-06-04 CA CA254,114A patent/CA1036609A/en not_active Expired
- 1976-06-04 FR FR7616971A patent/FR2314184A1/fr active Granted
- 1976-06-08 NL NL7606175A patent/NL7606175A/xx not_active Application Discontinuation
- 1976-06-08 DK DK252576A patent/DK252576A/da unknown
- 1976-06-08 AT AT418276A patent/AT347939B/de not_active IP Right Cessation
- 1976-06-08 RO RO7686395A patent/RO70236A/ro unknown
- 1976-06-08 IT IT68388/76A patent/IT1062322B/it active
- 1976-06-08 DD DD7600199804A patent/DD131126A5/xx unknown
- 1976-06-08 DD DD193230A patent/DD126227A5/xx unknown
- 1976-06-08 CS CS763770A patent/CS198189B2/cs unknown
- 1976-06-08 US US05/693,892 patent/US4193922A/en not_active Expired - Lifetime
- 1976-06-09 PL PL1976203429A patent/PL101489B1/pl unknown
- 1976-06-09 SU SU762367751A patent/SU867305A3/ru active
- 1976-06-09 GB GB23914/76A patent/GB1481158A/en not_active Expired
- 1976-06-09 CH CH726876A patent/CH620433A5/de not_active IP Right Cessation
- 1976-06-09 BE BE167748A patent/BE842740A/xx not_active IP Right Cessation
- 1976-06-09 DE DE2625848A patent/DE2625848C2/de not_active Expired
- 1976-06-09 LU LU75126A patent/LU75126A1/xx unknown
- 1976-06-09 PL PL1976190257A patent/PL99825B1/pl unknown
-
1977
- 1977-03-03 SU SU772456904A patent/SU727103A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| CH620433A5 (https=) | 1980-11-28 |
| US4193922A (en) | 1980-03-18 |
| DK252576A (da) | 1976-12-10 |
| DD131126A5 (de) | 1978-06-07 |
| FR2314184B1 (https=) | 1980-04-25 |
| CA1036609A (en) | 1978-08-15 |
| AT347939B (de) | 1979-01-25 |
| IE43116L (en) | 1976-12-09 |
| PL99825B1 (pl) | 1978-08-31 |
| IE43116B1 (en) | 1980-12-17 |
| CS198189B2 (en) | 1980-05-30 |
| ATA418276A (de) | 1978-06-15 |
| RO70236A (ro) | 1980-05-15 |
| FR2314184A1 (fr) | 1977-01-07 |
| PL101489B1 (pl) | 1978-12-30 |
| GB1481158A (en) | 1977-07-27 |
| LU75126A1 (https=) | 1977-01-25 |
| DE2625848C2 (de) | 1986-02-27 |
| DE2625848A1 (de) | 1976-12-16 |
| DD126227A5 (https=) | 1977-07-06 |
| IT1062322B (it) | 1984-10-10 |
| SU727103A3 (ru) | 1980-04-05 |
| SU867305A3 (ru) | 1981-09-23 |
| NL7606175A (nl) | 1976-12-13 |
| BE842740A (fr) | 1976-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4347372A (en) | Benzoxazolyl-glyoxylonitrile-2-oxime ether derivatives | |
| US4871753A (en) | 3-Phenyl-5-trifluoromethyl-1,2,4-oxadiazole compounds which are useful pesticides | |
| EP1799657B1 (en) | Isoxazoline derivatives and their use as herbicides | |
| US4130413A (en) | Heterocyclic phenyl ethers and herbicides containing same | |
| HU219144B (hu) | Hatóanyagként szulfonamidot tartalmazó herbicid készítmény, eljárás a hatóanyagok előállítására, és a készítmény alkalmazása | |
| JPH06504538A (ja) | 殺菌剤 | |
| JPH08231310A (ja) | 農業用殺菌剤 | |
| DK156573B (da) | 2-(2-fluor-4-halogen-5-substitueret-phenyl)-hydantoinderivater, et herbicidt praeparat indeholdende disse, en fremgangsmaade til bekaempelse af ukrudt under anvendelse af disse samt anvendelse af disse som herbicid | |
| US4394157A (en) | Pyridyl-2-oxyphenyloxime derivatives and their use as herbicides | |
| US4337081A (en) | 5-Amido-3-trihalomethyl-1,2,4-thiadiazoles and their use as herbicides | |
| CA1164871A (en) | Isoxazolylbenzamides | |
| HU208677B (en) | Herbicidal compositions comprising benzimidazole and indazole derivatives as active ingredients, as well as process for using them and producing the active ingredients | |
| US6251829B1 (en) | Herbicidal benzoyloxy carboxylates and carboxamides | |
| JPH0415779B2 (https=) | ||
| IE51408B1 (en) | New aniline derivatives | |
| KR920004578B1 (ko) | 살균성 아닐린 유도체의 조성물 | |
| EP0001721B1 (en) | N-cyano- and n-alkynyl-2-(substituted phenoxy)butyramides and the use thereof as mildewicides | |
| HU208905B (en) | Fungicidal compositions containing imidazole derivatives as active substance and process for producing these imidazole derivatives | |
| JPH0140831B2 (https=) | ||
| CA1100972A (en) | Phenoxyalkyloxazolines, processes for their production, compositions containing them, and their use as herbicides | |
| HU177086B (en) | Herbicide and fungicide preparation containing substituted 1,2,4-oxadiazolidin-3-one derivatives | |
| EP0258182A1 (en) | Semicarbazones and thiosemicarbazones | |
| KR920005411B1 (ko) | 치환된 테트라졸의 제법 | |
| US4753671A (en) | 1,2,4-oxadiazole derivatives, and selective herbicidal compositions containing them | |
| FR2583265A1 (fr) | Nouveaux composes heterocycliques et compositions fongicides les contenant |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |