GB1576237A - Dyestuffs containing the triazine ring their preparation and use - Google Patents
Dyestuffs containing the triazine ring their preparation and use Download PDFInfo
- Publication number
- GB1576237A GB1576237A GB13852/77A GB1385277A GB1576237A GB 1576237 A GB1576237 A GB 1576237A GB 13852/77 A GB13852/77 A GB 13852/77A GB 1385277 A GB1385277 A GB 1385277A GB 1576237 A GB1576237 A GB 1576237A
- Authority
- GB
- United Kingdom
- Prior art keywords
- dyestuff
- amino
- radical
- acid
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title claims description 16
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 title description 2
- 239000000975 dye Substances 0.000 claims abstract description 191
- 238000000034 method Methods 0.000 claims abstract description 41
- 150000001412 amines Chemical class 0.000 claims abstract description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 17
- 239000001257 hydrogen Substances 0.000 claims abstract description 17
- 125000001424 substituent group Chemical group 0.000 claims abstract description 17
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 16
- 238000004043 dyeing Methods 0.000 claims abstract description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 10
- 150000001450 anions Chemical class 0.000 claims abstract description 6
- 229910006069 SO3H Inorganic materials 0.000 claims abstract description 5
- -1 alkylene radical Chemical class 0.000 claims description 140
- 150000003254 radicals Chemical class 0.000 claims description 78
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 75
- 230000008878 coupling Effects 0.000 claims description 64
- 238000010168 coupling process Methods 0.000 claims description 64
- 238000005859 coupling reaction Methods 0.000 claims description 64
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 60
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 58
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 54
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 50
- 239000000203 mixture Substances 0.000 claims description 38
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 36
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 30
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 29
- 238000006243 chemical reaction Methods 0.000 claims description 27
- 239000011780 sodium chloride Substances 0.000 claims description 27
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 19
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 10
- 150000004056 anthraquinones Chemical class 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 claims description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 6
- 239000001913 cellulose Substances 0.000 claims description 6
- 229920002678 cellulose Polymers 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229920000742 Cotton Polymers 0.000 claims description 5
- 239000004952 Polyamide Substances 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 claims description 5
- 150000002790 naphthalenes Chemical class 0.000 claims description 5
- 229920002647 polyamide Polymers 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 claims description 4
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 239000004202 carbamide Substances 0.000 claims description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 4
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 claims description 4
- 159000000000 sodium salts Chemical class 0.000 claims description 4
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 claims description 4
- 238000005406 washing Methods 0.000 claims description 4
- XRIGHGYEGNDPEU-UHFFFAOYSA-N 1-anilinoanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1NC1=CC=CC=C1 XRIGHGYEGNDPEU-UHFFFAOYSA-N 0.000 claims description 3
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 claims description 3
- ONMOULMPIIOVTQ-UHFFFAOYSA-N 98-47-5 Chemical compound OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 ONMOULMPIIOVTQ-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical group [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 229940072056 alginate Drugs 0.000 claims description 3
- 235000010443 alginic acid Nutrition 0.000 claims description 3
- 229920000615 alginic acid Polymers 0.000 claims description 3
- WDEQGLDWZMIMJM-UHFFFAOYSA-N benzyl 4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical compound OCC1CC(O)CN1C(=O)OCC1=CC=CC=C1 WDEQGLDWZMIMJM-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 3
- 150000004696 coordination complex Chemical class 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims description 3
- 239000004744 fabric Substances 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- 125000004999 nitroaryl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 3
- 235000011152 sodium sulphate Nutrition 0.000 claims description 3
- 238000010025 steaming Methods 0.000 claims description 3
- 239000002562 thickening agent Substances 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 2
- NGUUMHKSNSFLOS-UHFFFAOYSA-N 2-methoxyethyl hydrogen carbonate Chemical compound COCCOC(O)=O NGUUMHKSNSFLOS-UHFFFAOYSA-N 0.000 claims description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 claims description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 claims description 2
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims description 2
- GGOZGYRTNQBSSA-UHFFFAOYSA-N pyridine-2,3-diol Chemical compound OC1=CC=CN=C1O GGOZGYRTNQBSSA-UHFFFAOYSA-N 0.000 claims description 2
- 239000000758 substrate Substances 0.000 claims 6
- 230000001419 dependent effect Effects 0.000 claims 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 239000002253 acid Substances 0.000 description 170
- 239000000243 solution Substances 0.000 description 88
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 49
- QUSNBJAOOMFDIB-UHFFFAOYSA-N monoethyl amine Natural products CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 44
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 35
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 34
- 150000004699 copper complex Chemical class 0.000 description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 239000000725 suspension Substances 0.000 description 25
- 230000007935 neutral effect Effects 0.000 description 23
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 20
- HMNPDEGBVWDHAR-UHFFFAOYSA-N 8-aminonaphthalen-1-ol Chemical compound C1=CC(O)=C2C(N)=CC=CC2=C1 HMNPDEGBVWDHAR-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 16
- 238000004519 manufacturing process Methods 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 12
- ZYSOYLBBCYWEMB-UHFFFAOYSA-N 7-aminonaphthalen-1-ol Chemical compound C1=CC=C(O)C2=CC(N)=CC=C21 ZYSOYLBBCYWEMB-UHFFFAOYSA-N 0.000 description 11
- QYFYIOWLBSPSDM-UHFFFAOYSA-N 6-aminonaphthalen-1-ol Chemical compound OC1=CC=CC2=CC(N)=CC=C21 QYFYIOWLBSPSDM-UHFFFAOYSA-N 0.000 description 10
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 10
- 125000002252 acyl group Chemical group 0.000 description 9
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 9
- 150000008049 diazo compounds Chemical class 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 8
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 8
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 8
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 8
- 229950011260 betanaphthol Drugs 0.000 description 8
- 229910052804 chromium Inorganic materials 0.000 description 8
- 239000011651 chromium Substances 0.000 description 8
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 7
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 7
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 7
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 7
- 125000003277 amino group Chemical group 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 6
- REJHVSOVQBJEBF-UHFFFAOYSA-N 5-azaniumyl-2-[2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 239000007859 condensation product Substances 0.000 description 6
- 150000004985 diamines Chemical class 0.000 description 6
- WGYKZJWCGVVSQN-UHFFFAOYSA-N mono-n-propyl amine Natural products CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 6
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000005185 salting out Methods 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 238000001694 spray drying Methods 0.000 description 6
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 5
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 5
- LDCCBULMAFILCT-UHFFFAOYSA-N 2-aminobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O LDCCBULMAFILCT-UHFFFAOYSA-N 0.000 description 5
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 5
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- ZNXSFVXZQBETRJ-UHFFFAOYSA-N (3-aminophenyl)urea Chemical compound NC(=O)NC1=CC=CC(N)=C1 ZNXSFVXZQBETRJ-UHFFFAOYSA-N 0.000 description 4
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 4
- VOWZNBNDMFLQGM-UHFFFAOYSA-N 2,5-dimethylaniline Chemical compound CC1=CC=C(C)C(N)=C1 VOWZNBNDMFLQGM-UHFFFAOYSA-N 0.000 description 4
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 4
- LTPSRQRIPCVMKQ-UHFFFAOYSA-N 2-amino-5-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C(S(O)(=O)=O)=C1 LTPSRQRIPCVMKQ-UHFFFAOYSA-N 0.000 description 4
- FLIOATBXVNLPLK-UHFFFAOYSA-N 3-amino-4-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(S(O)(=O)=O)C=C1N FLIOATBXVNLPLK-UHFFFAOYSA-N 0.000 description 4
- ZDIRCGKEOWZBIM-UHFFFAOYSA-N 4-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=CC=C1S(O)(=O)=O ZDIRCGKEOWZBIM-UHFFFAOYSA-N 0.000 description 4
- KKBQCLVIBFUKGQ-UHFFFAOYSA-N 4-amino-5-methylbenzene-1,3-disulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1N KKBQCLVIBFUKGQ-UHFFFAOYSA-N 0.000 description 4
- BRKFTWHPLMMNHF-UHFFFAOYSA-N 5-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C=C1S(O)(=O)=O BRKFTWHPLMMNHF-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 150000004982 aromatic amines Chemical class 0.000 description 4
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical group C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 4
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 4
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 4
- FKNGBLJXFDHNES-UHFFFAOYSA-N n-(5-hydroxynaphthalen-2-yl)acetamide Chemical compound OC1=CC=CC2=CC(NC(=O)C)=CC=C21 FKNGBLJXFDHNES-UHFFFAOYSA-N 0.000 description 4
- XHOWGWWNFSHBAM-UHFFFAOYSA-N n-(8-hydroxynaphthalen-1-yl)acetamide Chemical compound C1=CC(O)=C2C(NC(=O)C)=CC=CC2=C1 XHOWGWWNFSHBAM-UHFFFAOYSA-N 0.000 description 4
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 4
- 239000001103 potassium chloride Substances 0.000 description 4
- 235000011164 potassium chloride Nutrition 0.000 description 4
- VOPSFYWMOIKYEM-UHFFFAOYSA-N 2,5-diaminobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O VOPSFYWMOIKYEM-UHFFFAOYSA-N 0.000 description 3
- ZAKYBQTZZHWXOB-UHFFFAOYSA-N 2-amino-3,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C(N)=C1C ZAKYBQTZZHWXOB-UHFFFAOYSA-N 0.000 description 3
- VJHJWHAIOWSVCP-UHFFFAOYSA-N 2-amino-5-chloro-3-methylbenzenesulfonic acid Chemical compound CC1=CC(Cl)=CC(S(O)(=O)=O)=C1N VJHJWHAIOWSVCP-UHFFFAOYSA-N 0.000 description 3
- ZCGVPUAAMCMLTM-UHFFFAOYSA-N 2-amino-5-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C=C1S(O)(=O)=O ZCGVPUAAMCMLTM-UHFFFAOYSA-N 0.000 description 3
- KTFUNVBAGAPLLC-UHFFFAOYSA-N 2-amino-5-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC=C(N)C(S(O)(=O)=O)=C1 KTFUNVBAGAPLLC-UHFFFAOYSA-N 0.000 description 3
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 3
- ACHUDPKPXIEHAD-UHFFFAOYSA-N 2-amino-6-chlorobenzenesulfonic acid Chemical compound NC1=CC=CC(Cl)=C1S(O)(=O)=O ACHUDPKPXIEHAD-UHFFFAOYSA-N 0.000 description 3
- AACMNEWXGKOJJK-UHFFFAOYSA-N 2-amino-6-nitrophenol Chemical compound NC1=CC=CC([N+]([O-])=O)=C1O AACMNEWXGKOJJK-UHFFFAOYSA-N 0.000 description 3
- AFUHLZJMSIKUOK-UHFFFAOYSA-N 3,5-diamino-2-methylbenzenesulfonic acid Chemical compound CC1=C(N)C=C(N)C=C1S(O)(=O)=O AFUHLZJMSIKUOK-UHFFFAOYSA-N 0.000 description 3
- XIWOCDXCEHPARQ-UHFFFAOYSA-N 3-amino-2-methyl-5-nitrobenzenesulfonic acid Chemical compound CC1=C(N)C=C([N+]([O-])=O)C=C1S(O)(=O)=O XIWOCDXCEHPARQ-UHFFFAOYSA-N 0.000 description 3
- XJQRCFRVWZHIPN-UHFFFAOYSA-N 3-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1Cl XJQRCFRVWZHIPN-UHFFFAOYSA-N 0.000 description 3
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 3
- FOINSAWEWXUXPQ-UHFFFAOYSA-N 4-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(S(O)(=O)=O)C(N)=C1 FOINSAWEWXUXPQ-UHFFFAOYSA-N 0.000 description 3
- LIJDIOORYGRNMC-UHFFFAOYSA-N 4-amino-2-chloro-5-methoxybenzenesulfonic acid Chemical compound COC1=CC(S(O)(=O)=O)=C(Cl)C=C1N LIJDIOORYGRNMC-UHFFFAOYSA-N 0.000 description 3
- DTQVHBIQMCFTSZ-UHFFFAOYSA-N 4-amino-3-chloro-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC(Cl)=C1N DTQVHBIQMCFTSZ-UHFFFAOYSA-N 0.000 description 3
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 3
- IMUUNYPYNWXUBO-UHFFFAOYSA-N 4-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1S(O)(=O)=O IMUUNYPYNWXUBO-UHFFFAOYSA-N 0.000 description 3
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 3
- VPXCXBHLKDPWQV-UHFFFAOYSA-N 5-amino-2-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C(S(O)(=O)=O)=C1 VPXCXBHLKDPWQV-UHFFFAOYSA-N 0.000 description 3
- INESHSIZOSSOEI-UHFFFAOYSA-N 5-amino-2-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC=C(N)C=C1S(O)(=O)=O INESHSIZOSSOEI-UHFFFAOYSA-N 0.000 description 3
- LTYYONSWQIPDTA-UHFFFAOYSA-N 5-amino-2-methyl-3-nitrobenzenesulfonic acid Chemical compound CC1=C([N+]([O-])=O)C=C(N)C=C1S(O)(=O)=O LTYYONSWQIPDTA-UHFFFAOYSA-N 0.000 description 3
- JNAFLISQSIEQJI-UHFFFAOYSA-N 5-amino-3-chloro-2-methylbenzenesulfonic acid Chemical compound CC1=C(Cl)C=C(N)C=C1S(O)(=O)=O JNAFLISQSIEQJI-UHFFFAOYSA-N 0.000 description 3
- FTRIZCSZTKREQM-UHFFFAOYSA-N 6-(ethylamino)naphthalen-1-ol Chemical compound C(C)NC1=CC=2C=CC=C(C2C=C1)O FTRIZCSZTKREQM-UHFFFAOYSA-N 0.000 description 3
- QMYIZVZSDFZAAB-UHFFFAOYSA-N 6-(methylamino)naphthalen-1-ol Chemical compound OC1=CC=CC2=CC(NC)=CC=C21 QMYIZVZSDFZAAB-UHFFFAOYSA-N 0.000 description 3
- ISEPYHHXTVDVAG-UHFFFAOYSA-N 7-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,3,5-trisulfonic acid Chemical compound CC1=CC(N)=CC=C1N=NC1=CC(S(O)(=O)=O)=C(C=C(C=C2S(O)(=O)=O)S(O)(=O)=O)C2=C1 ISEPYHHXTVDVAG-UHFFFAOYSA-N 0.000 description 3
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 3
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical compound C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 3
- SJWQCBCAGCEWCV-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)acetamide Chemical compound COC1=CC=C(NC(C)=O)C=C1N SJWQCBCAGCEWCV-UHFFFAOYSA-N 0.000 description 3
- DPBLXKKOBLCELK-UHFFFAOYSA-N n-pentylamine Natural products CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 3
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 3
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 3
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000010792 warming Methods 0.000 description 3
- MBTLJJHFAWFTBJ-UHFFFAOYSA-N 1-amino-4-(3-amino-4-methyl-5-sulfoanilino)-9,10-dioxoanthracene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(C)=C(N)C=C1NC1=CC(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O MBTLJJHFAWFTBJ-UHFFFAOYSA-N 0.000 description 2
- ZOHPJXCEVYGLJT-UHFFFAOYSA-N 1-amino-4-(3-amino-4-sulfoanilino)-9,10-dioxoanthracene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC(NC=2C=3C(=O)C4=CC=CC=C4C(=O)C=3C(N)=C(C=2)S(O)(=O)=O)=C1 ZOHPJXCEVYGLJT-UHFFFAOYSA-N 0.000 description 2
- FHMMQQXRSYSWCM-UHFFFAOYSA-N 1-aminonaphthalen-2-ol Chemical compound C1=CC=C2C(N)=C(O)C=CC2=C1 FHMMQQXRSYSWCM-UHFFFAOYSA-N 0.000 description 2
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 2
- UONVFNLDGRWLKF-UHFFFAOYSA-N 2,5-diaminobenzoic acid Chemical compound NC1=CC=C(N)C(C(O)=O)=C1 UONVFNLDGRWLKF-UHFFFAOYSA-N 0.000 description 2
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 2
- CFCXQQUQLZIZPI-UHFFFAOYSA-N 2-amino-3,5-dimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(N)C(S(O)(=O)=O)=C1 CFCXQQUQLZIZPI-UHFFFAOYSA-N 0.000 description 2
- VRLPHBSFRWMMPW-UHFFFAOYSA-N 2-amino-4-chloro-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1Cl VRLPHBSFRWMMPW-UHFFFAOYSA-N 0.000 description 2
- SWFNPENEBHAHEB-UHFFFAOYSA-N 2-amino-4-chlorophenol Chemical compound NC1=CC(Cl)=CC=C1O SWFNPENEBHAHEB-UHFFFAOYSA-N 0.000 description 2
- VYZCFAPUHSSYCC-UHFFFAOYSA-N 2-amino-5-chloro-4-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=C(S(O)(=O)=O)C=C1Cl VYZCFAPUHSSYCC-UHFFFAOYSA-N 0.000 description 2
- KZKGEEGADAWJFS-UHFFFAOYSA-N 2-amino-5-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C(S(O)(=O)=O)=C1 KZKGEEGADAWJFS-UHFFFAOYSA-N 0.000 description 2
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 2
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 2
- IPQWXJDRMKGSFI-UHFFFAOYSA-N 3,5-diamino-4-methylbenzenesulfonic acid Chemical compound CC1=C(N)C=C(S(O)(=O)=O)C=C1N IPQWXJDRMKGSFI-UHFFFAOYSA-N 0.000 description 2
- KNOUFVBOBNEGMH-UHFFFAOYSA-N 3,7-diaminonaphthalene-1,5-disulfonic acid Chemical compound C1=C(N)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 KNOUFVBOBNEGMH-UHFFFAOYSA-N 0.000 description 2
- GADKYCGOSLZAKG-UHFFFAOYSA-N 3-amino-4-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC=C(S(O)(=O)=O)C=C1N GADKYCGOSLZAKG-UHFFFAOYSA-N 0.000 description 2
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 2
- MUQWDMCEFASSPA-UHFFFAOYSA-N 3-amino-4-methylbenzene-1,2-disulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C(S(O)(=O)=O)=C1N MUQWDMCEFASSPA-UHFFFAOYSA-N 0.000 description 2
- PEFKYEIJIGWGBJ-UHFFFAOYSA-N 3-amino-7-nitronaphthalene-1,5-disulfonic acid Chemical compound C1=C([N+]([O-])=O)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 PEFKYEIJIGWGBJ-UHFFFAOYSA-N 0.000 description 2
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 2
- QZMNTLVGYUZLQF-UHFFFAOYSA-N 4,5,6-tris(methylsulfonyl)triazine Chemical compound CS(=O)(=O)C1=NN=NC(S(C)(=O)=O)=C1S(C)(=O)=O QZMNTLVGYUZLQF-UHFFFAOYSA-N 0.000 description 2
- YYTRUFPLZKSNDK-UHFFFAOYSA-N 4,5-dichloro-6-fluorotriazine Chemical compound FC1=NN=NC(Cl)=C1Cl YYTRUFPLZKSNDK-UHFFFAOYSA-N 0.000 description 2
- SKLUWKYNZNXSLX-UHFFFAOYSA-N 4-Acetamidobenzaldehyde Chemical compound CC(=O)NC1=CC=C(C=O)C=C1 SKLUWKYNZNXSLX-UHFFFAOYSA-N 0.000 description 2
- LDQMZKBIBRAZEA-UHFFFAOYSA-N 4-amino-2-aminobenzoic acid Natural products NC1=CC=C(C(O)=O)C(N)=C1 LDQMZKBIBRAZEA-UHFFFAOYSA-N 0.000 description 2
- NEECEUZBAHTVIN-UHFFFAOYSA-N 4-amino-3-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1Cl NEECEUZBAHTVIN-UHFFFAOYSA-N 0.000 description 2
- RKWXBVZKKCFSQU-UHFFFAOYSA-N 4-amino-6-[[6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-hydroxy-4-sulfonaphthalen-1-yl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound ClC=1N=C(N=C(N1)Cl)NC=1C=C2C(=CC(=C(C2=CC1)N=NC1=CC=C2C(=CC(=C(C2=C1O)N)S(=O)(=O)O)S(=O)(=O)O)O)S(=O)(=O)O RKWXBVZKKCFSQU-UHFFFAOYSA-N 0.000 description 2
- PHRVJZNHPVJYOM-UHFFFAOYSA-N 5-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(N)C(S(O)(=O)=O)=C1 PHRVJZNHPVJYOM-UHFFFAOYSA-N 0.000 description 2
- NTPCHAXHWPDMEI-UHFFFAOYSA-N 5-amino-2,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C=C1N NTPCHAXHWPDMEI-UHFFFAOYSA-N 0.000 description 2
- JXZGTFLJFKLVAX-UHFFFAOYSA-N 5-amino-2-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C=C1S(O)(=O)=O JXZGTFLJFKLVAX-UHFFFAOYSA-N 0.000 description 2
- BHAYFFFYKOBUMW-UHFFFAOYSA-N 6-(butylamino)naphthalen-1-ol Chemical compound C(CCC)NC1=CC=2C=CC=C(C=2C=C1)O BHAYFFFYKOBUMW-UHFFFAOYSA-N 0.000 description 2
- PYILOHKMJBLDHQ-UHFFFAOYSA-N 7-(methylamino)naphthalen-1-ol Chemical compound C1=CC=C(O)C2=CC(NC)=CC=C21 PYILOHKMJBLDHQ-UHFFFAOYSA-N 0.000 description 2
- WJBNEMQYSHMDPS-UHFFFAOYSA-N 7-amino-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC=CC=C1S(O)(=O)=O WJBNEMQYSHMDPS-UHFFFAOYSA-N 0.000 description 2
- IRWJFLXBMUWAQM-UHFFFAOYSA-N 9h-xanthen-1-amine Chemical compound O1C2=CC=CC=C2CC2=C1C=CC=C2N IRWJFLXBMUWAQM-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- SMXUXPDUMQUWGI-UHFFFAOYSA-N ClC=1C(=NN=NC1S(=O)(=O)C)S(=O)(=O)C Chemical compound ClC=1C(=NN=NC1S(=O)(=O)C)S(=O)(=O)C SMXUXPDUMQUWGI-UHFFFAOYSA-N 0.000 description 2
- ZIEZSHKUKVICHE-UHFFFAOYSA-N ClC=1C(=NN=NC1S(=O)(=O)O)S(=O)(=O)O Chemical compound ClC=1C(=NN=NC1S(=O)(=O)O)S(=O)(=O)O ZIEZSHKUKVICHE-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N N-butylamine Natural products CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 150000004984 aromatic diamines Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 150000004700 cobalt complex Chemical class 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N isobutyl amine Natural products CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229940018564 m-phenylenediamine Drugs 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- RBQWGHBZCHFUQU-UHFFFAOYSA-N n-(3-amino-4-methylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(C)C(N)=C1 RBQWGHBZCHFUQU-UHFFFAOYSA-N 0.000 description 2
- IRFCTHNJIWUUJZ-UHFFFAOYSA-N n-(3-aminophenyl)benzamide Chemical compound NC1=CC=CC(NC(=O)C=2C=CC=CC=2)=C1 IRFCTHNJIWUUJZ-UHFFFAOYSA-N 0.000 description 2
- DRXFARCOYOPZDW-UHFFFAOYSA-N n-(3-aminophenyl)butanamide Chemical compound CCCC(=O)NC1=CC=CC(N)=C1 DRXFARCOYOPZDW-UHFFFAOYSA-N 0.000 description 2
- VGDKCRMZIWPMPW-UHFFFAOYSA-N n-(3-aminophenyl)propanamide Chemical compound CCC(=O)NC1=CC=CC(N)=C1 VGDKCRMZIWPMPW-UHFFFAOYSA-N 0.000 description 2
- KBKWZUVMKBNTFP-UHFFFAOYSA-N n-(3-formylphenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(C=O)=C1 KBKWZUVMKBNTFP-UHFFFAOYSA-N 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- 229940100684 pentylamine Drugs 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- ZRRGOUHITGRLBA-UHFFFAOYSA-N stattic Chemical compound [O-][N+](=O)C1=CC=C2C=CS(=O)(=O)C2=C1 ZRRGOUHITGRLBA-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- JSAHUYZTCXUBPT-UHFFFAOYSA-N (3e)-3-diazo-4-hydroxy-5-nitrocyclohexa-1,5-diene-1-sulfonic acid Chemical compound OC1C(=[N+]=[N-])C=C(S(O)(=O)=O)C=C1[N+]([O-])=O JSAHUYZTCXUBPT-UHFFFAOYSA-N 0.000 description 1
- IDYVIOQTBVOSGC-UHFFFAOYSA-N (5-hydroxynaphthalen-2-yl)urea Chemical compound OC1=CC=CC2=CC(NC(=O)N)=CC=C21 IDYVIOQTBVOSGC-UHFFFAOYSA-N 0.000 description 1
- KQBZAOQPCOSQDB-UHFFFAOYSA-N (5e)-3-chloro-5-diazo-6-hydroxycyclohexa-1,3-diene-1-sulfonic acid Chemical compound OC1C(=[N+]=[N-])C=C(Cl)C=C1S(O)(=O)=O KQBZAOQPCOSQDB-UHFFFAOYSA-N 0.000 description 1
- 150000000182 1,3,5-triazines Chemical class 0.000 description 1
- MAPWYRGGJSHAAU-UHFFFAOYSA-N 1,3-bis(4-aminophenyl)urea Chemical compound C1=CC(N)=CC=C1NC(=O)NC1=CC=C(N)C=C1 MAPWYRGGJSHAAU-UHFFFAOYSA-N 0.000 description 1
- SENOENRYIMUSNW-UHFFFAOYSA-N 1,4-diaminonaphthalene-2-sulfonic acid Chemical compound C1=CC=C2C(N)=CC(S(O)(=O)=O)=C(N)C2=C1 SENOENRYIMUSNW-UHFFFAOYSA-N 0.000 description 1
- YWIULIPFAXMSEF-UHFFFAOYSA-N 1,5-diaminocyclohexa-2,4-diene-1-sulfonic acid Chemical compound NC1=CC=CC(N)(S(O)(=O)=O)C1 YWIULIPFAXMSEF-UHFFFAOYSA-N 0.000 description 1
- YNTVTGAMOFVWKH-UHFFFAOYSA-N 1-(5-amino-2-sulfophenyl)-5-oxo-4-[(2-sulfophenyl)diazenyl]-4H-pyrazole-3-carboxylic acid Chemical compound NC=1C=C(C(=CC=1)S(=O)(=O)O)N1N=C(C(C1=O)N=NC1=C(C=CC=C1)S(=O)(=O)O)C(=O)O YNTVTGAMOFVWKH-UHFFFAOYSA-N 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- CSXMSPGCHNATPU-UHFFFAOYSA-N 1-amino-3-anilino-9,10-dioxoanthracene-2-sulfonic acid Chemical class OS(=O)(=O)C=1C(N)=C2C(=O)C3=CC=CC=C3C(=O)C2=CC=1NC1=CC=CC=C1 CSXMSPGCHNATPU-UHFFFAOYSA-N 0.000 description 1
- QESOMBMPKAMMLJ-UHFFFAOYSA-N 1-amino-4-(3-amino-2-methyl-5-sulfoanilino)-9,10-dioxoanthracene-2-sulfonic acid Chemical compound CC1=C(N)C=C(S(O)(=O)=O)C=C1NC1=CC(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O QESOMBMPKAMMLJ-UHFFFAOYSA-N 0.000 description 1
- OPBOOIFXQHPAPJ-UHFFFAOYSA-N 1-amino-4-anilino-9,10-dioxoanthracene-2-sulfonic acid Chemical class C1=C(S(O)(=O)=O)C(N)=C2C(=O)C3=CC=CC=C3C(=O)C2=C1NC1=CC=CC=C1 OPBOOIFXQHPAPJ-UHFFFAOYSA-N 0.000 description 1
- CPQDNTKUVUAFKZ-UHFFFAOYSA-N 1-amino-5-nitronaphthalen-2-ol Chemical compound C1=CC=C2C(N)=C(O)C=CC2=C1[N+]([O-])=O CPQDNTKUVUAFKZ-UHFFFAOYSA-N 0.000 description 1
- ZENKESXKWBIZCV-UHFFFAOYSA-N 2,2,4,4-tetrafluoro-1,3-benzodioxin-6-amine Chemical group O1C(F)(F)OC(F)(F)C2=CC(N)=CC=C21 ZENKESXKWBIZCV-UHFFFAOYSA-N 0.000 description 1
- LUZXGSRCYGQGQF-UHFFFAOYSA-N 2,5-dichloro-4-(5-methyl-3-oxo-1h-pyrazol-2-yl)benzenesulfonic acid Chemical compound N1C(C)=CC(=O)N1C1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl LUZXGSRCYGQGQF-UHFFFAOYSA-N 0.000 description 1
- WTXXGGVYTMCHLV-UHFFFAOYSA-N 2,5-dimethoxy-4-(3-oxobutanoylamino)benzenesulfonic acid Chemical compound COC1=CC(S(O)(=O)=O)=C(OC)C=C1NC(=O)CC(C)=O WTXXGGVYTMCHLV-UHFFFAOYSA-N 0.000 description 1
- ZGXJVLAIEZQGHY-UHFFFAOYSA-N 2-(3-methyl-5-oxo-4h-pyrazol-1-yl)benzene-1,4-disulfonic acid Chemical compound O=C1CC(C)=NN1C1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O ZGXJVLAIEZQGHY-UHFFFAOYSA-N 0.000 description 1
- KIHXFQWYCVEKMJ-UHFFFAOYSA-N 2-(4-amino-2-sulfophenyl)-3-oxo-1h-pyrazole-5-carboxylic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1N1C(=O)C=C(C(O)=O)N1 KIHXFQWYCVEKMJ-UHFFFAOYSA-N 0.000 description 1
- PBLJQSCHYVRLQT-UHFFFAOYSA-N 2-(4-methyl-2-sulfophenyl)-3-oxo-1H-pyrazole-5-carboxylic acid Chemical compound CC1=CC(=C(C=C1)N1NC(=CC1=O)C(=O)O)S(=O)(=O)O PBLJQSCHYVRLQT-UHFFFAOYSA-N 0.000 description 1
- BAJKNQQFKVFKKV-UHFFFAOYSA-N 2-(5-amino-2-sulfophenyl)-3-oxo-1h-pyrazole-5-carboxylic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N2C(C=C(N2)C(O)=O)=O)=C1 BAJKNQQFKVFKKV-UHFFFAOYSA-N 0.000 description 1
- SGSMPWTZYGTIEA-UHFFFAOYSA-N 2-(ethylamino)ethanesulfonic acid Chemical compound CCNCCS(O)(=O)=O SGSMPWTZYGTIEA-UHFFFAOYSA-N 0.000 description 1
- MOMFXATYAINJML-UHFFFAOYSA-N 2-Acetylthiazole Chemical group CC(=O)C1=NC=CS1 MOMFXATYAINJML-UHFFFAOYSA-N 0.000 description 1
- PLDDEHCUVORBIV-UHFFFAOYSA-N 2-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]benzene-1,4-disulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O PLDDEHCUVORBIV-UHFFFAOYSA-N 0.000 description 1
- RTTVSZDELFXAPX-UHFFFAOYSA-N 2-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]benzoic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC=CC=C1C(O)=O RTTVSZDELFXAPX-UHFFFAOYSA-N 0.000 description 1
- DVIMVGIZDUSQLL-UHFFFAOYSA-N 2-[[1-hydroxy-6-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]-4-sulfobenzoic acid Chemical compound CNC=1C=C2C=C(C(=C(C2=CC1)O)N=NC1=C(C=CC(=C1)S(=O)(=O)O)C(=O)O)S(=O)(=O)O DVIMVGIZDUSQLL-UHFFFAOYSA-N 0.000 description 1
- ASNBVPLMAXEWMH-UHFFFAOYSA-N 2-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-2-methylphenyl]diazenyl]benzene-1,4-disulfonic acid Chemical compound CC1=CC(N=NC=2C(=CC3=CC(N)=CC=C3C=2O)S(O)(=O)=O)=C(O)C=C1N=NC1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O ASNBVPLMAXEWMH-UHFFFAOYSA-N 0.000 description 1
- ODZMQFSEPJBWQI-UHFFFAOYSA-N 2-[[5-amino-4-(4-methyl-2-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]-5-methylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(C)=CC=C1NC(C=1C(=O)C2=CC=CC(N)=C2C(=O)C=11)=CC=C1NC1=CC=C(C)C=C1S(O)(=O)=O ODZMQFSEPJBWQI-UHFFFAOYSA-N 0.000 description 1
- NZBMCLLTCBTSMS-UHFFFAOYSA-N 2-acetamido-4-amino-5-methylbenzenesulfonic acid Chemical compound CC(=O)NC1=CC(N)=C(C)C=C1S(O)(=O)=O NZBMCLLTCBTSMS-UHFFFAOYSA-N 0.000 description 1
- YKWCMWIDDKSMLQ-UHFFFAOYSA-N 2-amino-3-nitrobenzenesulfonic acid Chemical compound NC1=C([N+]([O-])=O)C=CC=C1S(O)(=O)=O YKWCMWIDDKSMLQ-UHFFFAOYSA-N 0.000 description 1
- ZWJLWODBEQGSBP-UHFFFAOYSA-N 2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC(NC=2N=C(Cl)N=C(Cl)N=2)=C1 ZWJLWODBEQGSBP-UHFFFAOYSA-N 0.000 description 1
- BDCJBCKISOZMBR-UHFFFAOYSA-N 2-amino-4-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(S(O)(=O)=O)C(N)=C1 BDCJBCKISOZMBR-UHFFFAOYSA-N 0.000 description 1
- BDPUKBXMNHWUKI-UHFFFAOYSA-N 2-amino-4-nitronaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC([N+]([O-])=O)=C21 BDPUKBXMNHWUKI-UHFFFAOYSA-N 0.000 description 1
- KKQBASOGIVQPNZ-UHFFFAOYSA-N 2-amino-5-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid Chemical compound NC1=C(C=C(C=C1)N1N=C(CC1=O)C)S(=O)(=O)O KKQBASOGIVQPNZ-UHFFFAOYSA-N 0.000 description 1
- IIQLVLWFQUUZII-UHFFFAOYSA-N 2-amino-5-(4-amino-3-carboxyphenyl)benzoic acid Chemical compound C1=C(C(O)=O)C(N)=CC=C1C1=CC=C(N)C(C(O)=O)=C1 IIQLVLWFQUUZII-UHFFFAOYSA-N 0.000 description 1
- CDLVBOGQMAAWRQ-UHFFFAOYSA-N 2-amino-5-(5-oxo-4H-pyrazol-1-yl)benzene-1,4-disulfonic acid Chemical compound NC1=CC(=C(C=C1S(=O)(=O)O)N1N=CCC1=O)S(=O)(=O)O CDLVBOGQMAAWRQ-UHFFFAOYSA-N 0.000 description 1
- DMCYGHFRDIOTJO-UHFFFAOYSA-N 2-amino-5-(5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid Chemical compound NC1=C(C=C(C=C1)N1N=CCC1=O)S(=O)(=O)O DMCYGHFRDIOTJO-UHFFFAOYSA-N 0.000 description 1
- IECDNSODZKPEGZ-UHFFFAOYSA-N 2-amino-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IECDNSODZKPEGZ-UHFFFAOYSA-N 0.000 description 1
- BPXLXNLDJGWLDW-UHFFFAOYSA-N 2-amino-5-benzamidobenzenesulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC=C1NC(=O)C1=CC=CC=C1 BPXLXNLDJGWLDW-UHFFFAOYSA-N 0.000 description 1
- VMKHNXYWSCMKSS-UHFFFAOYSA-N 2-amino-5-hydroxy-6-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC2=C(S(O)(=O)=O)C(N)=CC=C2C(O)=C1N=NC1=CC(S(O)(=O)=O)=CC=C1O VMKHNXYWSCMKSS-UHFFFAOYSA-N 0.000 description 1
- QUIIUKFPLUUSGQ-UHFFFAOYSA-N 2-amino-6-chlorophenol Chemical compound NC1=CC=CC(Cl)=C1O QUIIUKFPLUUSGQ-UHFFFAOYSA-N 0.000 description 1
- ZMXYNJXDULEQCK-UHFFFAOYSA-N 2-amino-p-cresol Chemical compound CC1=CC=C(O)C(N)=C1 ZMXYNJXDULEQCK-UHFFFAOYSA-N 0.000 description 1
- YAIKCRUPEVOINQ-UHFFFAOYSA-N 2-aminonaphthalene-1,5-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 YAIKCRUPEVOINQ-UHFFFAOYSA-N 0.000 description 1
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- VVXAMEPHUUMNGZ-UHFFFAOYSA-N 2-hydrazinyl-3-hydroxy-5-nitrobenzenesulfonic acid Chemical compound NNC1=C(O)C=C([N+]([O-])=O)C=C1S(O)(=O)=O VVXAMEPHUUMNGZ-UHFFFAOYSA-N 0.000 description 1
- KODNOMSEPHQXPD-UHFFFAOYSA-N 2-hydrazinyl-3-hydroxy-5-sulfobenzoic acid Chemical compound NNC1=C(O)C=C(S(O)(=O)=O)C=C1C(O)=O KODNOMSEPHQXPD-UHFFFAOYSA-N 0.000 description 1
- MHYJCKNRFISDHU-UHFFFAOYSA-N 2-hydrazinyl-3-nitrophenol Chemical compound NNC1=C(O)C=CC=C1[N+]([O-])=O MHYJCKNRFISDHU-UHFFFAOYSA-N 0.000 description 1
- ZJPDZFZRKGDEGN-UHFFFAOYSA-N 2-hydrazinyl-4-nitrobenzoic acid Chemical compound NNC1=CC([N+]([O-])=O)=CC=C1C(O)=O ZJPDZFZRKGDEGN-UHFFFAOYSA-N 0.000 description 1
- OYDYLEBWNAYHMY-UHFFFAOYSA-N 2-hydrazinyl-4-sulfobenzoic acid Chemical compound NNC1=CC(S(O)(=O)=O)=CC=C1C(O)=O OYDYLEBWNAYHMY-UHFFFAOYSA-N 0.000 description 1
- FBHQARNJUDWWGV-UHFFFAOYSA-N 2-hydrazinyl-5-methoxybenzoic acid Chemical compound COC1=CC=C(NN)C(C(O)=O)=C1 FBHQARNJUDWWGV-UHFFFAOYSA-N 0.000 description 1
- KFGVDCBVGNMCJC-UHFFFAOYSA-N 2-hydrazinylbenzoic acid Chemical compound NNC1=CC=CC=C1C(O)=O KFGVDCBVGNMCJC-UHFFFAOYSA-N 0.000 description 1
- GCGNGYPZEHFOAN-UHFFFAOYSA-N 2-hydrazinylphenol Chemical compound NNC1=CC=CC=C1O GCGNGYPZEHFOAN-UHFFFAOYSA-N 0.000 description 1
- XWASWCWCBJRUMF-UHFFFAOYSA-N 2-hydroxy-4-methyl-6-oxo-1h-pyridine-3-sulfonic acid Chemical compound CC1=CC(O)=NC(O)=C1S(O)(=O)=O XWASWCWCBJRUMF-UHFFFAOYSA-N 0.000 description 1
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 1
- NMFFUUFPJJOWHK-UHFFFAOYSA-N 2-phenoxyaniline Chemical compound NC1=CC=CC=C1OC1=CC=CC=C1 NMFFUUFPJJOWHK-UHFFFAOYSA-N 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- PKKGGWLTUCMSSD-UHFFFAOYSA-N 3,5-diamino-2,4,6-trimethylbenzenesulfonic acid Chemical compound CC1=C(N)C(C)=C(S(O)(=O)=O)C(C)=C1N PKKGGWLTUCMSSD-UHFFFAOYSA-N 0.000 description 1
- NSWDWUHBMOIGOA-UHFFFAOYSA-N 3,5-diaminobenzenesulfonic acid Chemical compound NC1=CC(N)=CC(S(O)(=O)=O)=C1 NSWDWUHBMOIGOA-UHFFFAOYSA-N 0.000 description 1
- RKWKDLKDFWIJMD-UHFFFAOYSA-N 3,7-diaminonaphthalene-1-sulfonic acid Chemical compound C1=C(N)C=C(S(O)(=O)=O)C2=CC(N)=CC=C21 RKWKDLKDFWIJMD-UHFFFAOYSA-N 0.000 description 1
- IQCQWQDFHQPFIT-UHFFFAOYSA-N 3,8-diaminonaphthalene-1,5-disulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 IQCQWQDFHQPFIT-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- XXZDPVOWJBCNQC-UHFFFAOYSA-N 3-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,5-disulfonic acid Chemical compound CC1=CC(N)=CC=C1N=NC1=CC(S(O)(=O)=O)=C(C=CC=C2S(O)(=O)=O)C2=C1 XXZDPVOWJBCNQC-UHFFFAOYSA-N 0.000 description 1
- HWMNTCNULCBPCZ-UHFFFAOYSA-N 3-[(4-amino-2-sulfophenyl)diazenyl]-4-hydroxy-7-(3-sulfoanilino)naphthalene-2-sulfonic acid Chemical compound S(=O)(=O)(O)C=1C=C(C=CC1)NC1=CC2=CC(=C(C(=C2C=C1)O)N=NC1=C(C=C(C=C1)N)S(=O)(=O)O)S(=O)(=O)O HWMNTCNULCBPCZ-UHFFFAOYSA-N 0.000 description 1
- LLEMCGPJLNJOFA-UHFFFAOYSA-N 3-acetamido-5-amino-4-methylbenzenesulfonic acid Chemical compound CC(=O)NC1=CC(S(O)(=O)=O)=CC(N)=C1C LLEMCGPJLNJOFA-UHFFFAOYSA-N 0.000 description 1
- VCXAYTNLBWHTIO-UHFFFAOYSA-N 3-acetamido-7-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=C(N)C=C(S(O)(=O)=O)C2=CC(NC(=O)C)=CC(S(O)(=O)=O)=C21 VCXAYTNLBWHTIO-UHFFFAOYSA-N 0.000 description 1
- OSMZXKNDQCNATJ-UHFFFAOYSA-N 3-amino-4-methyl-5-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid Chemical compound CC1=C(C=C(C=C1N)S(=O)(=O)O)N1N=C(CC1=O)C OSMZXKNDQCNATJ-UHFFFAOYSA-N 0.000 description 1
- QGTXBWMKRGHPDD-UHFFFAOYSA-N 3-amino-5-chloro-4-hydroxybenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(Cl)=C1O QGTXBWMKRGHPDD-UHFFFAOYSA-N 0.000 description 1
- CRQFPCORJVAXPF-UHFFFAOYSA-N 3-amino-6-methyl-2-nitrobenzenesulfonic acid Chemical compound CC1=CC=C(N)C([N+]([O-])=O)=C1S(O)(=O)=O CRQFPCORJVAXPF-UHFFFAOYSA-N 0.000 description 1
- SIXYIEWSUKAOEN-UHFFFAOYSA-N 3-aminobenzaldehyde Chemical compound NC1=CC=CC(C=O)=C1 SIXYIEWSUKAOEN-UHFFFAOYSA-N 0.000 description 1
- UCTREIIEJSFTDI-UHFFFAOYSA-N 3-aminonaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1 UCTREIIEJSFTDI-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- AJPUJTAMBSRTEG-UHFFFAOYSA-N 3-methyl-4-(3-methyl-5-oxo-4h-pyrazol-1-yl)benzenesulfonic acid Chemical compound O=C1CC(C)=NN1C1=CC=C(S(O)(=O)=O)C=C1C AJPUJTAMBSRTEG-UHFFFAOYSA-N 0.000 description 1
- IUNVPXVTJRNCEK-UHFFFAOYSA-N 3-methyl-n-propylaniline Chemical compound CCCNC1=CC=CC(C)=C1 IUNVPXVTJRNCEK-UHFFFAOYSA-N 0.000 description 1
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 1
- UCJKAZZVJXOLRP-UHFFFAOYSA-N 3-oxo-2-(4-sulfophenyl)-1h-pyrazole-5-carboxylic acid Chemical compound N1C(C(=O)O)=CC(=O)N1C1=CC=C(S(O)(=O)=O)C=C1 UCJKAZZVJXOLRP-UHFFFAOYSA-N 0.000 description 1
- KABDZELCXGYYPA-UHFFFAOYSA-N 3-oxopyrazole-4-carboxylic acid Chemical compound OC(=O)C1=CN=NC1=O KABDZELCXGYYPA-UHFFFAOYSA-N 0.000 description 1
- WMPOWTWJFGZRIG-UHFFFAOYSA-N 4,5,6-tribromotriazine Chemical compound BrC1=NN=NC(Br)=C1Br WMPOWTWJFGZRIG-UHFFFAOYSA-N 0.000 description 1
- LZKGFGLOQNSMBS-UHFFFAOYSA-N 4,5,6-trichlorotriazine Chemical compound ClC1=NN=NC(Cl)=C1Cl LZKGFGLOQNSMBS-UHFFFAOYSA-N 0.000 description 1
- MRYIKYDDYVEWAW-UHFFFAOYSA-N 4,5,6-tris(benzenesulfonyl)triazine Chemical compound N=1N=NC(S(=O)(=O)C=2C=CC=CC=2)=C(S(=O)(=O)C=2C=CC=CC=2)C=1S(=O)(=O)C1=CC=CC=C1 MRYIKYDDYVEWAW-UHFFFAOYSA-N 0.000 description 1
- HPIITGUWGFPYGJ-UHFFFAOYSA-N 4,5,6-tris(ethylsulfonyl)triazine Chemical compound CCS(=O)(=O)C1=NN=NC(S(=O)(=O)CC)=C1S(=O)(=O)CC HPIITGUWGFPYGJ-UHFFFAOYSA-N 0.000 description 1
- GRLSWESXIFWOBF-UHFFFAOYSA-N 4-(3-oxobutanoylamino)benzenesulfonic acid Chemical compound CC(=O)CC(=O)NC1=CC=C(S(O)(=O)=O)C=C1 GRLSWESXIFWOBF-UHFFFAOYSA-N 0.000 description 1
- VFMNIJOKAXPZLE-UHFFFAOYSA-N 4-(5-methyl-3-oxo-1h-pyrazol-2-yl)benzenesulfonic acid Chemical compound N1C(C)=CC(=O)N1C1=CC=C(S(O)(=O)=O)C=C1 VFMNIJOKAXPZLE-UHFFFAOYSA-N 0.000 description 1
- NZDXSXLYLMHYJA-UHFFFAOYSA-M 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C NZDXSXLYLMHYJA-UHFFFAOYSA-M 0.000 description 1
- SJCTXIKOXTUQHC-UHFFFAOYSA-N 4-amino-2,5-dichlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl SJCTXIKOXTUQHC-UHFFFAOYSA-N 0.000 description 1
- ROAXWJLEECEOJF-UHFFFAOYSA-N 4-amino-2-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid Chemical compound NC=1C=C(C(=CC=1)S(=O)(=O)O)N1N=C(CC1=O)C ROAXWJLEECEOJF-UHFFFAOYSA-N 0.000 description 1
- YPECXEWEXWBMNK-UHFFFAOYSA-N 4-amino-2-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(Cl)=C1 YPECXEWEXWBMNK-UHFFFAOYSA-N 0.000 description 1
- HCEYSAVOFADVMD-UHFFFAOYSA-N 4-amino-3-hydroxybenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1O HCEYSAVOFADVMD-UHFFFAOYSA-N 0.000 description 1
- VSIKMIGINZLDFL-UHFFFAOYSA-N 4-amino-3-methyl-5-nitrobenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC([N+]([O-])=O)=C1N VSIKMIGINZLDFL-UHFFFAOYSA-N 0.000 description 1
- QWUGPNUVQIANLS-UHFFFAOYSA-N 4-amino-5-hydroxy-2-nitrobenzenesulfonic acid Chemical compound NC1=CC([N+]([O-])=O)=C(S(O)(=O)=O)C=C1O QWUGPNUVQIANLS-UHFFFAOYSA-N 0.000 description 1
- DLUKFQOGIDCRNV-UHFFFAOYSA-N 4-amino-5-hydroxybenzene-1,3-disulfonic acid Chemical compound NC1=C(O)C=C(S(O)(=O)=O)C=C1S(O)(=O)=O DLUKFQOGIDCRNV-UHFFFAOYSA-N 0.000 description 1
- ZFRBZRZEKIOGQI-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound C1=CC(O)=C2C(N)=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=C1 ZFRBZRZEKIOGQI-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- HSRYFCBIAQAZTP-UHFFFAOYSA-N 4-amino-N-(5-hydroxynaphthalen-2-yl)benzamide Chemical compound NC1=CC=C(C(=O)NC2=CC3=CC=CC(=C3C=C2)O)C=C1 HSRYFCBIAQAZTP-UHFFFAOYSA-N 0.000 description 1
- INLMNLWAAGNJHA-UHFFFAOYSA-N 4-amino-n-(5-hydroxynaphthalen-1-yl)benzamide Chemical compound C1=CC(N)=CC=C1C(=O)NC1=CC=CC2=C(O)C=CC=C12 INLMNLWAAGNJHA-UHFFFAOYSA-N 0.000 description 1
- PHZVGKMVVKFBCX-UHFFFAOYSA-N 4-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 PHZVGKMVVKFBCX-UHFFFAOYSA-N 0.000 description 1
- CKFUOIWVEOEYLZ-UHFFFAOYSA-N 4-chloro-2,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C(Cl)C=C1[N+]([O-])=O CKFUOIWVEOEYLZ-UHFFFAOYSA-N 0.000 description 1
- NPCVKJFEZGVKFY-UHFFFAOYSA-N 4-hydrazinyl-3-hydroxy-5-nitrobenzenesulfonic acid Chemical compound NNC1=C(O)C=C(S(O)(=O)=O)C=C1[N+]([O-])=O NPCVKJFEZGVKFY-UHFFFAOYSA-N 0.000 description 1
- DHPWAHJZWPAMEK-UHFFFAOYSA-N 4-hydrazinyl-3-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(NN)=C(O)C=C(S(O)(=O)=O)C2=C1 DHPWAHJZWPAMEK-UHFFFAOYSA-N 0.000 description 1
- HOYMMPOLDIVIHG-UHFFFAOYSA-N 4-hydrazinyl-5-hydroxybenzene-1,3-disulfonic acid Chemical compound NNC1=C(O)C=C(S(O)(=O)=O)C=C1S(O)(=O)=O HOYMMPOLDIVIHG-UHFFFAOYSA-N 0.000 description 1
- QGFCDQHZQAEFLA-UHFFFAOYSA-N 4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]-7-(methylamino)naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(NC)=CC=C2C(O)=C1N=NC1=CC=C(OC)C=C1S(O)(=O)=O QGFCDQHZQAEFLA-UHFFFAOYSA-N 0.000 description 1
- WGJDJIOVBVNPAU-UHFFFAOYSA-N 4-hydroxy-6-[(8-hydroxy-6-sulfonaphthalen-2-yl)amino]naphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(NC3=CC=C4C=C(C=C(C4=C3)O)S(O)(=O)=O)=CC=C21 WGJDJIOVBVNPAU-UHFFFAOYSA-N 0.000 description 1
- XUMPVMRAPYSHRQ-UHFFFAOYSA-N 4-hydroxy-6-[(8-hydroxy-6-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(NC(=O)NC3=CC=C4C=C(C=C(C4=C3)O)S(O)(=O)=O)=CC=C21 XUMPVMRAPYSHRQ-UHFFFAOYSA-N 0.000 description 1
- BQVLLTHCZQAJNH-UHFFFAOYSA-N 4-hydroxy-7-[(5-hydroxy-7-sulfonaphthalen-2-yl)amino]naphthalene-2-sulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(NC=3C=C4C=C(C=C(C4=CC=3)O)S(O)(=O)=O)=CC=C21 BQVLLTHCZQAJNH-UHFFFAOYSA-N 0.000 description 1
- PCGISRHGYLRXSR-UHFFFAOYSA-N 4-hydroxy-7-[(5-hydroxy-7-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(NC(=O)NC=3C=C4C=C(C=C(C4=CC=3)O)S(O)(=O)=O)=CC=C21 PCGISRHGYLRXSR-UHFFFAOYSA-N 0.000 description 1
- TZBROGJRQUABOK-UHFFFAOYSA-N 4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 TZBROGJRQUABOK-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- QZHXKQKKEBXYRG-UHFFFAOYSA-N 4-n-(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C=C1 QZHXKQKKEBXYRG-UHFFFAOYSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- XEQRJJADVVXFHB-UHFFFAOYSA-N 5,8-diaminonaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC=C(N)C2=C1 XEQRJJADVVXFHB-UHFFFAOYSA-N 0.000 description 1
- LPVHULFCIHNOSF-UHFFFAOYSA-N 5-(2-hydroxyethylamino)naphthalen-1-ol Chemical compound C1=CC=C2C(NCCO)=CC=CC2=C1O LPVHULFCIHNOSF-UHFFFAOYSA-N 0.000 description 1
- WAKHXUDLHBMYNM-UHFFFAOYSA-N 5-(methylamino)naphthalen-1-ol Chemical compound C1=CC=C2C(NC)=CC=CC2=C1O WAKHXUDLHBMYNM-UHFFFAOYSA-N 0.000 description 1
- BCKLFBZLLBBVHX-UHFFFAOYSA-N 5-[(3-aminobenzoyl)amino]-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound NC1=CC=CC(C(=O)NC=2C3=C(O)C(N=NC=4C(=CC=CC=4)S(O)(=O)=O)=C(C=C3C=C(C=2)S(O)(=O)=O)S(O)(=O)=O)=C1 BCKLFBZLLBBVHX-UHFFFAOYSA-N 0.000 description 1
- FVELBSCPKVNJHA-UHFFFAOYSA-N 5-acetamido-3-amino-2-hydroxybenzenesulfonic acid Chemical compound CC(=O)NC1=CC(N)=C(O)C(S(O)(=O)=O)=C1 FVELBSCPKVNJHA-UHFFFAOYSA-N 0.000 description 1
- PVQRMRDCXXFGHR-UHFFFAOYSA-N 5-acetamido-3-amino-2-methylbenzenesulfonic acid Chemical compound CC(=O)NC1=CC(N)=C(C)C(S(O)(=O)=O)=C1 PVQRMRDCXXFGHR-UHFFFAOYSA-N 0.000 description 1
- MBJAPGAZEWPEFB-UHFFFAOYSA-N 5-amino-2-(4-amino-2-sulfophenyl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C1=CC=C(N)C=C1S(O)(=O)=O MBJAPGAZEWPEFB-UHFFFAOYSA-N 0.000 description 1
- SQLUTPZZGLJZDD-UHFFFAOYSA-N 5-amino-2-(5-methyl-3-oxo-1h-pyrazol-2-yl)benzenesulfonic acid Chemical compound N1C(C)=CC(=O)N1C1=CC=C(N)C=C1S(O)(=O)=O SQLUTPZZGLJZDD-UHFFFAOYSA-N 0.000 description 1
- QBAXCCXQGMQZSR-UHFFFAOYSA-N 5-amino-2-methyl-3-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid Chemical compound NC=1C=C(C(=C(C=1)S(=O)(=O)O)C)N1N=C(CC1=O)C QBAXCCXQGMQZSR-UHFFFAOYSA-N 0.000 description 1
- YSUNNMYIEJJXBW-UHFFFAOYSA-N 5-amino-3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC(S(O)(=O)=O)=CC(Cl)=C1O YSUNNMYIEJJXBW-UHFFFAOYSA-N 0.000 description 1
- RBKVGYNWKNKJIC-UHFFFAOYSA-N 5-amino-3-[(5-amino-2-sulfophenyl)diazenyl]-6-[(2,5-disulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N=NC=2C(=CC3=CC(=C(N=NC=4C(=CC=C(C=4)S(O)(=O)=O)S(O)(=O)=O)C(N)=C3C=2O)S(O)(=O)=O)S(O)(=O)=O)=C1 RBKVGYNWKNKJIC-UHFFFAOYSA-N 0.000 description 1
- NQGIFVWQIYLXKQ-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=C([N+]([O-])=O)C=C1O NQGIFVWQIYLXKQ-UHFFFAOYSA-N 0.000 description 1
- HAIMEEBRQYGMSM-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[(2-hydroxy-5-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC(S(O)(=O)=O)=CC=C1O HAIMEEBRQYGMSM-UHFFFAOYSA-N 0.000 description 1
- ISTNBIUEOOWHHO-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=CC=C1S(O)(=O)=O ISTNBIUEOOWHHO-UHFFFAOYSA-N 0.000 description 1
- CZYHUSAZORFCKN-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[[2-hydroxy-5-methyl-4-[(2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid Chemical compound NC1=CC(=CC2=CC(=C(C(=C12)O)N=NC1=C(C=C(C(=C1)C)N=NC1=C(C=CC=C1)S(=O)(=O)O)O)S(=O)(=O)O)S(=O)(=O)O CZYHUSAZORFCKN-UHFFFAOYSA-N 0.000 description 1
- ZEUXMRDRYIHFCU-UHFFFAOYSA-N 5-amino-8-(4-amino-3-sulfoanilino)-9,10-dioxoanthracene-1,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC=C1NC1=CC(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=C(S(O)(=O)=O)C=CC=C1C2=O ZEUXMRDRYIHFCU-UHFFFAOYSA-N 0.000 description 1
- WSJKOVDREAJDAI-UHFFFAOYSA-N 5-amino-8-(4-aminoanilino)-9,10-dioxoanthracene-1,6-disulfonic acid Chemical compound C1=CC(N)=CC=C1NC1=CC(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=C(S(O)(=O)=O)C=CC=C1C2=O WSJKOVDREAJDAI-UHFFFAOYSA-N 0.000 description 1
- ZBIBQNVRTVLOHQ-UHFFFAOYSA-N 5-aminonaphthalen-1-ol Chemical compound C1=CC=C2C(N)=CC=CC2=C1O ZBIBQNVRTVLOHQ-UHFFFAOYSA-N 0.000 description 1
- FWGSYXZLPCUQDP-UHFFFAOYSA-N 5-chloro-2-hydrazinylbenzoic acid Chemical compound NNC1=CC=C(Cl)C=C1C(O)=O FWGSYXZLPCUQDP-UHFFFAOYSA-N 0.000 description 1
- GDBANHJMXDZUNE-UHFFFAOYSA-N 5-hydroxynaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC=CC2=C1 GDBANHJMXDZUNE-UHFFFAOYSA-N 0.000 description 1
- URZPSKKSHSLKIR-UHFFFAOYSA-N 5-methyl-2-(5-methyl-3-oxo-1h-pyrazol-2-yl)benzenesulfonic acid Chemical compound N1C(C)=CC(=O)N1C1=CC=C(C)C=C1S(O)(=O)=O URZPSKKSHSLKIR-UHFFFAOYSA-N 0.000 description 1
- APZQNXAMDJGBJZ-UHFFFAOYSA-N 6-[(2-acetamido-4-aminophenyl)diazenyl]naphthalene-1,3-disulfonic acid Chemical compound CC(=O)NC1=CC(N)=CC=C1N=NC1=CC=C(C(=CC(=C2)S(O)(=O)=O)S(O)(=O)=O)C2=C1 APZQNXAMDJGBJZ-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- SEMRCUIXRUXGJX-UHFFFAOYSA-N 6-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(N)=CC=C21 SEMRCUIXRUXGJX-UHFFFAOYSA-N 0.000 description 1
- OZJHMAHNYDSSPX-UHFFFAOYSA-N 7-(ethylamino)naphthalen-1-ol Chemical compound C(C)NC1=CC2=C(C=CC=C2C=C1)O OZJHMAHNYDSSPX-UHFFFAOYSA-N 0.000 description 1
- PJQUFZPSUQYROE-UHFFFAOYSA-N 7-[(2-acetamido-4-aminophenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid Chemical compound CC(=O)NC1=CC(N)=CC=C1N=NC1=CC2=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C=C2C=C1S(O)(=O)=O PJQUFZPSUQYROE-UHFFFAOYSA-N 0.000 description 1
- DWGBLODXAMYUOP-UHFFFAOYSA-N 7-amino-3-nitronaphthalene-1-sulfonic acid Chemical compound C1=C([N+]([O-])=O)C=C(S(O)(=O)=O)C2=CC(N)=CC=C21 DWGBLODXAMYUOP-UHFFFAOYSA-N 0.000 description 1
- HXCAOTTUHMNTPB-UHFFFAOYSA-N 7-amino-4-hydroxy-3-[(2-hydroxy-5-nitro-3-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(N)=CC=C2C(O)=C1N=NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1O HXCAOTTUHMNTPB-UHFFFAOYSA-N 0.000 description 1
- HKTWHHAJDJCUPC-UHFFFAOYSA-N 7-aminonaphthalene-1,3,5-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 HKTWHHAJDJCUPC-UHFFFAOYSA-N 0.000 description 1
- FYVOTMMSGKWFPK-UHFFFAOYSA-N 7-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC=C21 FYVOTMMSGKWFPK-UHFFFAOYSA-N 0.000 description 1
- CSEIGFQMUDCSEV-UHFFFAOYSA-N 8-amino-2-(naphthalen-2-yldiazenyl)naphthalen-1-ol Chemical compound NC=1C=CC=C2C=CC(=C(C12)O)N=NC1=CC2=CC=CC=C2C=C1 CSEIGFQMUDCSEV-UHFFFAOYSA-N 0.000 description 1
- RYMZBUDIVMITCZ-UHFFFAOYSA-N 8-amino-7-methylnaphthalen-1-ol Chemical compound NC=1C(=CC=C2C=CC=C(C12)O)C RYMZBUDIVMITCZ-UHFFFAOYSA-N 0.000 description 1
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 1
- DQIVFTJHYKDOMZ-UHFFFAOYSA-N 96-67-3 Chemical compound NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1O DQIVFTJHYKDOMZ-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- GAFOAZBJASXLCW-UHFFFAOYSA-N ClC1=C(C=C(C=C1)S(=O)(=O)O)N1N=CCC1=O Chemical compound ClC1=C(C=C(C=C1)S(=O)(=O)O)N1N=CCC1=O GAFOAZBJASXLCW-UHFFFAOYSA-N 0.000 description 1
- DASZDSALJSEWLB-UHFFFAOYSA-N ClC=1N=C(N=C(N1)Cl)NC1=CC=CC2=CC=CC(=C12)O Chemical compound ClC=1N=C(N=C(N1)Cl)NC1=CC=CC2=CC=CC(=C12)O DASZDSALJSEWLB-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NCJYUQJETQLWQD-UHFFFAOYSA-N NC1=C(C(=CC(=C1)S(=O)(=O)O)N)C.NC1=C(C(=CC(=C1)N)S(=O)(=O)O)C Chemical compound NC1=C(C(=CC(=C1)S(=O)(=O)O)N)C.NC1=C(C(=CC(=C1)N)S(=O)(=O)O)C NCJYUQJETQLWQD-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- LRPPWXBTUMEWJM-UHFFFAOYSA-N OC1=CC(=CC2=CC(NC(=S)NC3=CC=C4C(O)=CC(=CC4=C3)S(O)(=O)=O)=CC=C12)S(O)(=O)=O Chemical compound OC1=CC(=CC2=CC(NC(=S)NC3=CC=C4C(O)=CC(=CC4=C3)S(O)(=O)=O)=CC=C12)S(O)(=O)=O LRPPWXBTUMEWJM-UHFFFAOYSA-N 0.000 description 1
- OVVCEJNUYJRFAM-UHFFFAOYSA-N S(=O)(=O)(O)C1=C(C=CC(=C1)NC=1N(NN=CC1Cl)Cl)N1NC(=C(C1=O)N=NC1=C(C=CC=C1)S(=O)(=O)O)C(=O)O Chemical compound S(=O)(=O)(O)C1=C(C=CC(=C1)NC=1N(NN=CC1Cl)Cl)N1NC(=C(C1=O)N=NC1=C(C=CC=C1)S(=O)(=O)O)C(=O)O OVVCEJNUYJRFAM-UHFFFAOYSA-N 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N S-phenyl benzenesulfonothioate Natural products C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- NVIVJPRCKQTWLY-UHFFFAOYSA-N cobalt nickel Chemical compound [Co][Ni][Co] NVIVJPRCKQTWLY-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003546 flue gas Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229960002449 glycine Drugs 0.000 description 1
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- ZZLSKMRCEGCSIH-UHFFFAOYSA-N n-(3-amino-4-hydroxyphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(O)C(N)=C1 ZZLSKMRCEGCSIH-UHFFFAOYSA-N 0.000 description 1
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 1
- BVGSTJDGMQHVGZ-UHFFFAOYSA-N n-(5-hydroxynaphthalen-1-yl)acetamide Chemical compound C1=CC=C2C(NC(=O)C)=CC=CC2=C1O BVGSTJDGMQHVGZ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HHZGSWYRSQTJHC-UHFFFAOYSA-N n-ethylethenesulfonamide Chemical compound CCNS(=O)(=O)C=C HHZGSWYRSQTJHC-UHFFFAOYSA-N 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000004045 reactive dyeing Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P1/00—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed
- D06P1/38—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using reactive dyes
- D06P1/382—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using reactive dyes reactive group directly attached to heterocyclic group
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/4401—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring with two or more reactive groups at least one of them being directly attached to a heterocyclic system and at least one of them being directly attached to a non-heterocyclic system
- C09B62/4403—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring with two or more reactive groups at least one of them being directly attached to a heterocyclic system and at least one of them being directly attached to a non-heterocyclic system the heterocyclic system being a triazine ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2614550A DE2614550C3 (de) | 1976-04-03 | 1976-04-03 | Neue Reaktivfarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von Cellulose sowie natürlichen und synthetischen Polyamidsubstraten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1576237A true GB1576237A (en) | 1980-10-01 |
Family
ID=5974425
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB13852/77A Expired GB1576237A (en) | 1976-04-03 | 1977-04-01 | Dyestuffs containing the triazine ring their preparation and use |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS603109B2 (enExample) |
| BE (1) | BE853181A (enExample) |
| BR (1) | BR7702070A (enExample) |
| CA (1) | CA1087172A (enExample) |
| CH (1) | CH622818A5 (enExample) |
| DE (1) | DE2614550C3 (enExample) |
| ES (1) | ES457444A1 (enExample) |
| FR (1) | FR2346418A1 (enExample) |
| GB (1) | GB1576237A (enExample) |
| IN (1) | IN145278B (enExample) |
| IT (1) | IT1075683B (enExample) |
| NL (1) | NL7703274A (enExample) |
Cited By (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4709018A (en) * | 1983-08-30 | 1987-11-24 | Ciba-Geigy Corporation | Fibre-reactive dyes containing halopyrimidine radicals to which a vinylsulfonyl or the like group is attached by means of a bridge member |
| US4754023A (en) * | 1983-11-09 | 1988-06-28 | Ciba-Geigy Corporation | Reactive dyestuffs comprising a triazine moiety and a vinylsulfonyl moiety both being linked by a substituted alkylene bridge member |
| US4766206A (en) * | 1985-10-03 | 1988-08-23 | Ciba-Geigy Corporation | Reactive dyestuffs comprising a vinylsulfonylalkylaminocarbonyl moiety |
| US4782140A (en) * | 1984-04-05 | 1988-11-01 | Ciba-Giegy Corporation | Triazinyl reactive dyes containing additional fiber reactive groups bound through the sulfonylalkylaminoalkylamino bridge |
| US4786721A (en) * | 1985-08-14 | 1988-11-22 | Ciba-Geigy Corporation | Fiber-reactive dyes containing a vinylsulfonylalkylamino- or sulfonyl-arylaminotriazine moiety |
| US4801694A (en) * | 1984-10-15 | 1989-01-31 | Ciba-Geigy Corporation | Triazinyl reactive dyestuffs in which triazinyl group is further substituted with a beta-chloroethylsulfonyl- or vinylsulfonylbutyrylamino moiety |
| US4908436A (en) * | 1983-10-26 | 1990-03-13 | Ciba-Geigy Corporation | Fibre-reactive azo dyes containing vinylsulfonyl groups and further aliphatic fibre-reactive radicals |
| US4925927A (en) * | 1987-07-03 | 1990-05-15 | Ciba-Geigy Corporation | Reactive dyes containing a vinylsulfonylaminocarbonyl group bound to bis-(triazenylamino)-benzene as bridging member of two chromophoric systems |
| US4925928A (en) * | 1988-06-23 | 1990-05-15 | Ciba-Geigy Corporation | Reactive dyes containing vinylsulfonylalkylamino bound to a bis-(triazinylamino)-benzene group |
| US5003052A (en) * | 1985-07-12 | 1991-03-26 | Ciba-Geigy Corporation | Reactive dyes containing a substituted aminocarbonyl reactive moiety |
| US5023325A (en) * | 1985-07-12 | 1991-06-11 | Ciba-Geigy Corporation | Fibre-reactive dyes containing a substituted aminocarbonyl-phenylamino or naphthylamino reactive moiety |
| US5081296A (en) * | 1987-09-24 | 1992-01-14 | Ciba-Geigy Corporation | Bis(β-hydroxyethylthio)-C1 -C4 -alkylamines |
| US5243034A (en) * | 1988-12-21 | 1993-09-07 | Hoechst Aktiengesellschaft | Disazo dyestuffs having a triazine moiety and a fiberreactive group of vinylsulfone series |
| EP0624630A1 (de) * | 1993-05-13 | 1994-11-17 | Hoechst Aktiengesellschaft | Wasserlösliche faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| EP0629667A1 (de) * | 1993-05-18 | 1994-12-21 | Hoechst Aktiengesellschaft | Wasserlöslichse faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| US5405947A (en) * | 1992-05-04 | 1995-04-11 | Bayer Aktiengesellschaft | Triazine ring-containing reactive dyestuffs, their preparation and use |
| US5541300A (en) * | 1993-06-04 | 1996-07-30 | Bayer Aktiengesellschaft | Azo dyestuffs carrying sulphonylated amino-halo-triazinyl reactive site plus second different site |
| US5585489A (en) * | 1994-05-04 | 1996-12-17 | Hoechst Ag | Water-soluble triphendioxazine compounds and their use as dyestuffs |
| US5597902A (en) * | 1992-05-04 | 1997-01-28 | Bayer Aktiengesellschaft | Bi -and polyfunctional reactive dyestuffs, their prepartion and their use |
| US5760195A (en) * | 1995-11-23 | 1998-06-02 | Ciba Specialty Chemicals Corporation | Monoazo triazinyl group-containing fiber reactive dyes, processes for their preparation and their use |
| US5760194A (en) * | 1995-11-23 | 1998-06-02 | Ciba Specialty Chemicals Corporation | Monoazotriaziayl group-containing fiber reactive dyes, processes for their preparation and their use |
| US5779740A (en) * | 1995-11-23 | 1998-07-14 | Ciba Specialty Chemicals Corporation | Process for dichromatic or trichromatic dyeing or printing |
| GB2325470A (en) * | 1997-05-22 | 1998-11-25 | Sumitomo Chemical Co | Fibre-reactive bisazo compounds based on (6/7,6'/7')-(imino or carbonyldiimino) bis[2-azo-1-hydroxy-naphthalene-3-sulphonic acid] |
| US5847090A (en) * | 1996-06-05 | 1998-12-08 | Sumitomo Chemical Company, Limited | Monoazo compounds and process for dyeing or printing fiber materials using the same |
| US6025478A (en) * | 1993-11-08 | 2000-02-15 | Bayer Ag | Reactive dyestuffs containing monohalogenotriazine and vinylsulfone groups, their preparation and use |
| US6518409B2 (en) | 2000-03-22 | 2003-02-11 | Ciba Specialty Chemicals Corporation | Reactive dyes, processes for the preparation thereof and the use thereof |
| WO2013182349A1 (en) * | 2012-06-05 | 2013-12-12 | Huntsman Advanced Materials (Switzerland) Gmbh | Reactive dyes, their preparation and their use |
| WO2021219556A1 (en) | 2020-04-27 | 2021-11-04 | Huntsman Advanced Materials (Switzerland) Gmbh | Mixtures of reactive dyes and their use for the dyeing or printing of textile fibre materials |
| CN114981005A (zh) * | 2020-01-29 | 2022-08-30 | 亨斯迈先进材料(瑞士)有限公司 | 官能化颗粒 |
| WO2023144005A1 (en) | 2022-01-25 | 2023-08-03 | Huntsman Advanced Materials (Switzerland) Gmbh | Isomeric mixture of reactive dyes and their use for the dyeing or printing of textile fibre materials |
| CN116814090A (zh) * | 2023-06-11 | 2023-09-29 | 水木聚力接枝纺织新技术(深圳)有限公司 | 一种水溶性双丙烯酰基氨基c酸染料及其合成方法和用途 |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5792054A (en) * | 1980-11-28 | 1982-06-08 | Nippon Kayaku Co Ltd | Copper-containing reactive dye |
| DE3272886D1 (en) * | 1981-07-21 | 1986-10-02 | Ciba Geigy Ag | Reactive dyestuffs, their preparation and their use |
| EP0074928A3 (de) * | 1981-09-16 | 1983-04-20 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0076782B1 (de) * | 1981-10-02 | 1986-03-05 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| DE3145571A1 (de) * | 1981-11-17 | 1983-05-26 | Hoechst Ag, 6230 Frankfurt | "wasserloesliche 1:2-metallkomplex-azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe" |
| DE3477802D1 (en) * | 1983-06-10 | 1989-05-24 | Ciba Geigy Ag | Reactive dyes, their preparation and their use |
| JPS59161463A (ja) * | 1984-02-13 | 1984-09-12 | Sumitomo Chem Co Ltd | モノアゾ化合物およびその製造方法 |
| JPH07116375B2 (ja) * | 1984-02-20 | 1995-12-13 | 住友化学工業株式会社 | トリアジン化合物およびそれを用いる繊維材料の染色または捺染法 |
| DE3731202A1 (de) * | 1987-09-17 | 1989-07-13 | Basf Ag | Doppelankerreaktivfarbstoffe und benzylsulfonylverbindungen als deren zwischenprodukte |
| DE3843014A1 (de) * | 1988-12-21 | 1990-06-28 | Hoechst Ag | Wasserloesliche farbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
| DE3917369A1 (de) * | 1989-05-29 | 1990-12-06 | Hoechst Ag | Wasserloesliche faserreaktive farbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
| DE4320447A1 (de) * | 1993-06-21 | 1994-12-22 | Hoechst Ag | Wasserlösliche faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| JP6118833B2 (ja) * | 2014-03-27 | 2017-04-19 | 富士フイルム株式会社 | 化合物、着色組成物、インクジェット記録用インク、インクジェット記録方法、インクジェットプリンタカートリッジ、及びインクジェット記録物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH407373A (de) * | 1960-10-28 | 1966-02-15 | Ciba Geigy | Verfahren zur Herstellung neuer Farbstoffe |
| GB987074A (en) * | 1961-03-24 | 1965-03-24 | Ciba Ltd | New reactive metallised monoazo-dyestuffs and their manufacture and use |
| DE1265698C2 (de) * | 1961-05-06 | 1968-11-07 | Hoechst Ag | Verfahren zur Erzeugung von nassechten Faerbungen und Drucken |
| DE1793172C3 (de) * | 1968-08-10 | 1974-05-16 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Anthrachinonfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| CH514659A (de) * | 1968-08-12 | 1971-10-31 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung wasserlöslicher metallhaltiger Farbstoffe der Phthalocyaninreihe |
-
1976
- 1976-04-03 DE DE2614550A patent/DE2614550C3/de not_active Expired
-
1977
- 1977-03-25 NL NL7703274A patent/NL7703274A/xx not_active Application Discontinuation
- 1977-03-26 IN IN457/CAL/1977A patent/IN145278B/en unknown
- 1977-03-29 IT IT21830/77A patent/IT1075683B/it active
- 1977-03-31 JP JP52035513A patent/JPS603109B2/ja not_active Expired
- 1977-04-01 BE BE176372A patent/BE853181A/xx not_active IP Right Cessation
- 1977-04-01 GB GB13852/77A patent/GB1576237A/en not_active Expired
- 1977-04-01 BR BR7702070A patent/BR7702070A/pt unknown
- 1977-04-01 ES ES457444A patent/ES457444A1/es not_active Expired
- 1977-04-01 CH CH414677A patent/CH622818A5/de not_active IP Right Cessation
- 1977-04-04 FR FR7710075A patent/FR2346418A1/fr active Granted
- 1977-04-04 CA CA275,472A patent/CA1087172A/en not_active Expired
Cited By (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4709018A (en) * | 1983-08-30 | 1987-11-24 | Ciba-Geigy Corporation | Fibre-reactive dyes containing halopyrimidine radicals to which a vinylsulfonyl or the like group is attached by means of a bridge member |
| US4908436A (en) * | 1983-10-26 | 1990-03-13 | Ciba-Geigy Corporation | Fibre-reactive azo dyes containing vinylsulfonyl groups and further aliphatic fibre-reactive radicals |
| US4754023A (en) * | 1983-11-09 | 1988-06-28 | Ciba-Geigy Corporation | Reactive dyestuffs comprising a triazine moiety and a vinylsulfonyl moiety both being linked by a substituted alkylene bridge member |
| US4782140A (en) * | 1984-04-05 | 1988-11-01 | Ciba-Giegy Corporation | Triazinyl reactive dyes containing additional fiber reactive groups bound through the sulfonylalkylaminoalkylamino bridge |
| US4801694A (en) * | 1984-10-15 | 1989-01-31 | Ciba-Geigy Corporation | Triazinyl reactive dyestuffs in which triazinyl group is further substituted with a beta-chloroethylsulfonyl- or vinylsulfonylbutyrylamino moiety |
| US5003052A (en) * | 1985-07-12 | 1991-03-26 | Ciba-Geigy Corporation | Reactive dyes containing a substituted aminocarbonyl reactive moiety |
| US5023325A (en) * | 1985-07-12 | 1991-06-11 | Ciba-Geigy Corporation | Fibre-reactive dyes containing a substituted aminocarbonyl-phenylamino or naphthylamino reactive moiety |
| US4786721A (en) * | 1985-08-14 | 1988-11-22 | Ciba-Geigy Corporation | Fiber-reactive dyes containing a vinylsulfonylalkylamino- or sulfonyl-arylaminotriazine moiety |
| US4766206A (en) * | 1985-10-03 | 1988-08-23 | Ciba-Geigy Corporation | Reactive dyestuffs comprising a vinylsulfonylalkylaminocarbonyl moiety |
| US4925927A (en) * | 1987-07-03 | 1990-05-15 | Ciba-Geigy Corporation | Reactive dyes containing a vinylsulfonylaminocarbonyl group bound to bis-(triazenylamino)-benzene as bridging member of two chromophoric systems |
| US5081296A (en) * | 1987-09-24 | 1992-01-14 | Ciba-Geigy Corporation | Bis(β-hydroxyethylthio)-C1 -C4 -alkylamines |
| US4925928A (en) * | 1988-06-23 | 1990-05-15 | Ciba-Geigy Corporation | Reactive dyes containing vinylsulfonylalkylamino bound to a bis-(triazinylamino)-benzene group |
| US5243034A (en) * | 1988-12-21 | 1993-09-07 | Hoechst Aktiengesellschaft | Disazo dyestuffs having a triazine moiety and a fiberreactive group of vinylsulfone series |
| US5405947A (en) * | 1992-05-04 | 1995-04-11 | Bayer Aktiengesellschaft | Triazine ring-containing reactive dyestuffs, their preparation and use |
| US5686642A (en) * | 1992-05-04 | 1997-11-11 | Bayer Aktiengesellschaft | Compounds useful for the preparation of bi-and polyfunctional reactive dyestuffs |
| US5597902A (en) * | 1992-05-04 | 1997-01-28 | Bayer Aktiengesellschaft | Bi -and polyfunctional reactive dyestuffs, their prepartion and their use |
| EP0624630A1 (de) * | 1993-05-13 | 1994-11-17 | Hoechst Aktiengesellschaft | Wasserlösliche faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| EP0629667A1 (de) * | 1993-05-18 | 1994-12-21 | Hoechst Aktiengesellschaft | Wasserlöslichse faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| US5541300A (en) * | 1993-06-04 | 1996-07-30 | Bayer Aktiengesellschaft | Azo dyestuffs carrying sulphonylated amino-halo-triazinyl reactive site plus second different site |
| US6376656B1 (en) | 1993-11-08 | 2002-04-23 | Dystar Textilfarben Gmbh & Co. Deutschland Kg | Reactive dyestuffs containing monohagenotriazine and vinylsulfone groups, their preparation and use |
| US6025478A (en) * | 1993-11-08 | 2000-02-15 | Bayer Ag | Reactive dyestuffs containing monohalogenotriazine and vinylsulfone groups, their preparation and use |
| US5585489A (en) * | 1994-05-04 | 1996-12-17 | Hoechst Ag | Water-soluble triphendioxazine compounds and their use as dyestuffs |
| US5760194A (en) * | 1995-11-23 | 1998-06-02 | Ciba Specialty Chemicals Corporation | Monoazotriaziayl group-containing fiber reactive dyes, processes for their preparation and their use |
| US5779740A (en) * | 1995-11-23 | 1998-07-14 | Ciba Specialty Chemicals Corporation | Process for dichromatic or trichromatic dyeing or printing |
| US5760195A (en) * | 1995-11-23 | 1998-06-02 | Ciba Specialty Chemicals Corporation | Monoazo triazinyl group-containing fiber reactive dyes, processes for their preparation and their use |
| US5944855A (en) * | 1995-11-23 | 1999-08-31 | Ciba Specialty Chemicals Corporation | Process for dichromatic or trichromatic dyeing or printing |
| US5973147A (en) * | 1995-11-23 | 1999-10-26 | Ciba Specialty Chemicals Corporation | Process for dichromatic or trichromatic dyeing or printing |
| US5847090A (en) * | 1996-06-05 | 1998-12-08 | Sumitomo Chemical Company, Limited | Monoazo compounds and process for dyeing or printing fiber materials using the same |
| GB2325470B (en) * | 1997-05-22 | 1999-04-28 | Sumitomo Chemical Co | A fiber-reactive bisazo compound |
| US5998591A (en) * | 1997-05-22 | 1999-12-07 | Sumitomo Chemical Company, Limited | Fiber-reactive bisazo compound |
| GB2325470A (en) * | 1997-05-22 | 1998-11-25 | Sumitomo Chemical Co | Fibre-reactive bisazo compounds based on (6/7,6'/7')-(imino or carbonyldiimino) bis[2-azo-1-hydroxy-naphthalene-3-sulphonic acid] |
| US6518409B2 (en) | 2000-03-22 | 2003-02-11 | Ciba Specialty Chemicals Corporation | Reactive dyes, processes for the preparation thereof and the use thereof |
| WO2013182349A1 (en) * | 2012-06-05 | 2013-12-12 | Huntsman Advanced Materials (Switzerland) Gmbh | Reactive dyes, their preparation and their use |
| US9346958B2 (en) | 2012-06-05 | 2016-05-24 | Huntsman International Llc | Reactive dyes, their preparation and their use |
| CN114981005A (zh) * | 2020-01-29 | 2022-08-30 | 亨斯迈先进材料(瑞士)有限公司 | 官能化颗粒 |
| US12528934B2 (en) | 2020-01-29 | 2026-01-20 | Archroma (Switzerland) Gmbh | Functionalized particles |
| WO2021219556A1 (en) | 2020-04-27 | 2021-11-04 | Huntsman Advanced Materials (Switzerland) Gmbh | Mixtures of reactive dyes and their use for the dyeing or printing of textile fibre materials |
| KR20230003123A (ko) * | 2020-04-27 | 2023-01-05 | 훈츠만 어드밴스트 머티리얼스(스위처랜드) 게엠베하 | 반응성 염료들의 혼합물 및 텍스타일 섬유 재료를 염색 또는 프린팅하기 위한 이의 용도 |
| KR102787946B1 (ko) | 2020-04-27 | 2025-03-31 | 아크로마 (스위처랜드) 게엠베하 | 반응성 염료들의 혼합물 및 텍스타일 섬유 재료를 염색 또는 프린팅하기 위한 이의 용도 |
| US12448519B2 (en) | 2020-04-27 | 2025-10-21 | Archroma (Switzerland) Gmbh | Mixture of reactive dyes and their use for the dyeing or printing of textile fibre materials |
| WO2023144005A1 (en) | 2022-01-25 | 2023-08-03 | Huntsman Advanced Materials (Switzerland) Gmbh | Isomeric mixture of reactive dyes and their use for the dyeing or printing of textile fibre materials |
| US12473432B2 (en) | 2022-01-25 | 2025-11-18 | Archroma (Switzerland) Gmbh | Isomeric mixture of reactive dyes and their use for the dyeing or printing of textile fibre materials |
| CN116814090A (zh) * | 2023-06-11 | 2023-09-29 | 水木聚力接枝纺织新技术(深圳)有限公司 | 一种水溶性双丙烯酰基氨基c酸染料及其合成方法和用途 |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2346418A1 (fr) | 1977-10-28 |
| ES457444A1 (es) | 1978-03-01 |
| IT1075683B (it) | 1985-04-22 |
| DE2614550B2 (de) | 1980-07-10 |
| BE853181A (fr) | 1977-10-03 |
| CA1087172A (en) | 1980-10-07 |
| BR7702070A (pt) | 1977-11-08 |
| JPS603109B2 (ja) | 1985-01-25 |
| CH622818A5 (en) | 1981-04-30 |
| DE2614550A1 (de) | 1977-10-27 |
| IN145278B (enExample) | 1978-09-23 |
| FR2346418B1 (enExample) | 1980-05-09 |
| NL7703274A (nl) | 1977-10-05 |
| JPS52121039A (en) | 1977-10-12 |
| DE2614550C3 (de) | 1981-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1087172A (en) | Dyestuffs, their preparation and use | |
| US4261889A (en) | Reactive dyestuffs, their manufacture and use | |
| US4754023A (en) | Reactive dyestuffs comprising a triazine moiety and a vinylsulfonyl moiety both being linked by a substituted alkylene bridge member | |
| EP0167219B1 (en) | Fiber-reactive compound having both pyridiniotriazinyl and vinylsulfone type groups | |
| US4906737A (en) | Azo dye of the pyridone series containing a fluoro-s-triazinyl fibre-reactive group | |
| GB2026527A (en) | Reactive dyes, processes for their manufacture and use thereof | |
| GB2034343A (en) | Reactive dyestuffs | |
| JPS602337B2 (ja) | 繊維反応性染料およびその製法 | |
| CA1038377A (en) | Water-soluble azo dyestuffs, their preparation and utilization | |
| US4507236A (en) | Fibre-reactive dyes, containing both chloro and fluoro triazine radicals | |
| US3518245A (en) | Azo dyestuffs and their metal complex compounds | |
| JPS6147177B2 (enExample) | ||
| US5319074A (en) | Bifunctional reactive dyestuffs containing vinylsulphone or alkylsulphone groups and a 2,4 difluoro pyrimidine group | |
| JPH0611869B2 (ja) | 反応染料とその製造方法及び使用 | |
| GB1577498A (en) | Fluorotriazinyl-azo reactive dyestuffs | |
| US3426008A (en) | Water-soluble monoazo dyestuffs and their metal complex compounds | |
| US3377336A (en) | Metallized azo dyestuffs containing 2,3 - dichloroquinoxaline carboxamide or sulfonamide groups | |
| US3261826A (en) | Monoazo triazine containing dyestuffs | |
| US3114746A (en) | Reactive dyestuffs | |
| JPH06220348A (ja) | 繊維反応性染料 | |
| US4082739A (en) | Fibre-reactive dyestuff containing a bis-triazinylamino | |
| GB2029850A (en) | Reactive dyes their preparation and use | |
| US3197456A (en) | Azo-dyestuffs | |
| US3527760A (en) | Anthraquinone dyestuffs containing 2,3 - dihaloquinoxaline carboxamide or sulfonamide groups | |
| US4129736A (en) | Triazinyl-antraquinone dyestuffs |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PE20 | Patent expired after termination of 20 years |
Effective date: 19970331 |