FI90783C - Menetelmä polymeerin valmistamiseksi hiilimonoksidista ja olefiinisesti tyydyttämättömästä orgaanisesta yhdisteestä (yhdisteistä) - Google Patents
Menetelmä polymeerin valmistamiseksi hiilimonoksidista ja olefiinisesti tyydyttämättömästä orgaanisesta yhdisteestä (yhdisteistä) Download PDFInfo
- Publication number
- FI90783C FI90783C FI872297A FI872297A FI90783C FI 90783 C FI90783 C FI 90783C FI 872297 A FI872297 A FI 872297A FI 872297 A FI872297 A FI 872297A FI 90783 C FI90783 C FI 90783C
- Authority
- FI
- Finland
- Prior art keywords
- carbon monoxide
- polymerization
- catalyst composition
- catalyst
- acid
- Prior art date
Links
- 229910002091 carbon monoxide Inorganic materials 0.000 title claims abstract description 60
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 title claims abstract description 58
- 229920000642 polymer Polymers 0.000 title claims abstract description 58
- 238000000034 method Methods 0.000 title claims abstract description 18
- 238000002360 preparation method Methods 0.000 title claims abstract description 16
- 150000002894 organic compounds Chemical class 0.000 title abstract description 9
- 239000003054 catalyst Substances 0.000 claims abstract description 69
- 239000000203 mixture Substances 0.000 claims abstract description 41
- 239000003085 diluting agent Substances 0.000 claims abstract description 22
- 239000002253 acid Substances 0.000 claims abstract description 15
- 239000007788 liquid Substances 0.000 claims abstract description 13
- 239000003446 ligand Substances 0.000 claims abstract description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052787 antimony Chemical group 0.000 claims abstract description 5
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical group [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 5
- 239000011574 phosphorus Substances 0.000 claims abstract description 5
- 150000001450 anions Chemical class 0.000 claims abstract description 4
- 229910052785 arsenic Inorganic materials 0.000 claims abstract description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical group [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000001183 hydrocarbyl group Chemical group 0.000 claims abstract description 4
- 238000006116 polymerization reaction Methods 0.000 claims description 64
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 54
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 32
- 229910052763 palladium Inorganic materials 0.000 claims description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 239000000178 monomer Substances 0.000 claims description 9
- 239000000725 suspension Substances 0.000 claims description 6
- 238000000746 purification Methods 0.000 claims description 2
- 239000012876 carrier material Substances 0.000 claims 3
- 239000000463 material Substances 0.000 claims 3
- 210000004209 hair Anatomy 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
- 150000002941 palladium compounds Chemical class 0.000 abstract description 5
- 229920001577 copolymer Polymers 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 23
- 229920001038 ethylene copolymer Polymers 0.000 description 22
- 238000012685 gas phase polymerization Methods 0.000 description 17
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 16
- 239000005977 Ethylene Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- 229920001897 terpolymer Polymers 0.000 description 16
- 239000001257 hydrogen Substances 0.000 description 14
- 229910052739 hydrogen Inorganic materials 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 229910052751 metal Inorganic materials 0.000 description 12
- 239000002184 metal Substances 0.000 description 12
- 239000007791 liquid phase Substances 0.000 description 11
- 230000007423 decrease Effects 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 239000007789 gas Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 150000002431 hydrogen Chemical class 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- UJNZOIKQAUQOCN-UHFFFAOYSA-N methyl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C)C1=CC=CC=C1 UJNZOIKQAUQOCN-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- WHGYBXFWUBPSRW-FOUAGVGXSA-N beta-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO WHGYBXFWUBPSRW-FOUAGVGXSA-N 0.000 description 3
- 238000005119 centrifugation Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- -1 polyethylene Polymers 0.000 description 3
- 238000003825 pressing Methods 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- 239000001116 FEMA 4028 Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 235000011175 beta-cyclodextrine Nutrition 0.000 description 2
- 229960004853 betadex Drugs 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 2
- 150000004057 1,4-benzoquinones Chemical class 0.000 description 1
- WHFHDVDXYKOSKI-UHFFFAOYSA-N 1-ethenyl-4-ethylbenzene Chemical compound CCC1=CC=C(C=C)C=C1 WHFHDVDXYKOSKI-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- NVEOATUZNGIRFP-UHFFFAOYSA-N 2,2,2-trichloroacetic acid;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(Cl)(Cl)Cl NVEOATUZNGIRFP-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- WHGYBXFWUBPSRW-UHFFFAOYSA-N Cycloheptaamylose Natural products O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO WHGYBXFWUBPSRW-UHFFFAOYSA-N 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920005654 Sephadex Polymers 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- YFXWBJYXAOVVDR-UHFFFAOYSA-N bis(4-methylphenyl)phosphane;propane Chemical compound CCC.C1=CC(C)=CC=C1PC1=CC=C(C)C=C1 YFXWBJYXAOVVDR-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical compound [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- ONDPGJBEBGWAKI-UHFFFAOYSA-N diphenylphosphane;propane Chemical compound CCC.C=1C=CC=CC=1PC1=CC=CC=C1 ONDPGJBEBGWAKI-UHFFFAOYSA-N 0.000 description 1
- STCDDNDGEFVYKE-UHFFFAOYSA-N diphenylphosphane;propane Chemical compound CCC.C=1C=CC=CC=1PC1=CC=CC=C1.C=1C=CC=CC=1PC1=CC=CC=C1 STCDDNDGEFVYKE-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000002101 lytic effect Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G67/00—Macromolecular compounds obtained by reactions forming in the main chain of the macromolecule a linkage containing oxygen or oxygen and carbon, not provided for in groups C08G2/00 - C08G65/00
- C08G67/02—Copolymers of carbon monoxide and aliphatic unsaturated compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L77/00—Compositions of polyamides obtained by reactions forming a carboxylic amide link in the main chain; Compositions of derivatives of such polymers
- C08L77/10—Polyamides derived from aromatically bound amino and carboxyl groups of amino-carboxylic acids or of polyamines and polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Graft Or Block Polymers (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
- Multicomponent Fibers (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8601348 | 1986-05-27 | ||
| NL8601348 | 1986-05-27 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI872297A0 FI872297A0 (fi) | 1987-05-25 |
| FI872297L FI872297L (fi) | 1987-11-28 |
| FI90783B FI90783B (fi) | 1993-12-15 |
| FI90783C true FI90783C (fi) | 1994-03-25 |
Family
ID=19848074
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI872297A FI90783C (fi) | 1986-05-27 | 1987-05-25 | Menetelmä polymeerin valmistamiseksi hiilimonoksidista ja olefiinisesti tyydyttämättömästä orgaanisesta yhdisteestä (yhdisteistä) |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4778876A (en:Method) |
| EP (1) | EP0248483B1 (en:Method) |
| JP (1) | JPH0822915B2 (en:Method) |
| KR (1) | KR970000486B1 (en:Method) |
| CN (1) | CN1009652B (en:Method) |
| AT (1) | ATE60066T1 (en:Method) |
| AU (1) | AU592872B2 (en:Method) |
| BR (1) | BR8702703A (en:Method) |
| CA (1) | CA1318440C (en:Method) |
| DE (1) | DE3767371D1 (en:Method) |
| DK (1) | DK269787A (en:Method) |
| ES (1) | ES2019619B3 (en:Method) |
| FI (1) | FI90783C (en:Method) |
| IE (1) | IE60363B1 (en:Method) |
| IL (1) | IL82635A (en:Method) |
| IN (1) | IN170625B (en:Method) |
| MX (1) | MX170155B (en:Method) |
| NO (1) | NO168253C (en:Method) |
| NZ (1) | NZ220420A (en:Method) |
| ZA (1) | ZA873726B (en:Method) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4820802A (en) * | 1987-02-03 | 1989-04-11 | Shell Oil Company | Improved process of preparing carbon monoxide/olefin copolymer with ortho substituted phosphine catalyst composition. |
| US4855399A (en) * | 1987-02-26 | 1989-08-08 | Shell Oil Company | Carbon monoxide/olefin co-polymerization process with phosphino substituted sulfonic acid catalyst |
| AU612173B2 (en) * | 1987-08-28 | 1991-07-04 | Shell Internationale Research Maatschappij B.V. | Preparation of olefin/CO copolymers |
| NL8702317A (nl) * | 1987-09-29 | 1989-04-17 | Shell Int Research | Katalysatorcomposities. |
| ATE163299T1 (de) * | 1987-12-29 | 1998-03-15 | Shell Int Research | Polymere polyalkohole |
| CA1325306C (en) * | 1987-12-29 | 1993-12-14 | Pui Kwan Wong | Polymeric polyketone derivatives |
| CA1338577C (en) * | 1988-04-27 | 1996-09-03 | Jacobus Adrianus Bakkum | Process for the preparation of polymers of carbon monoxide with unsaturated compounds |
| CA1338578C (en) * | 1988-04-29 | 1996-09-03 | Gerrit Gerardus Rosenbrand | Process for the preparation of polymers of carbon monoxide with unsaturated compounds |
| US4948870A (en) * | 1988-05-27 | 1990-08-14 | Shell Oil Company | Polymerization process |
| US4965341A (en) * | 1988-06-08 | 1990-10-23 | Shell Oil Company | Polymerization of co/olefin with catalyst comprising sulfur bidentate ligand |
| US5077384A (en) * | 1989-08-17 | 1991-12-31 | Shell Oil Company | Carbon monoxide/olefin copolymer having wide molecular weight distribution |
| NL8902934A (nl) * | 1989-11-28 | 1991-06-17 | Shell Int Research | Bereiding van polymeren. |
| NL9000398A (nl) * | 1990-02-20 | 1991-09-16 | Shell Int Research | Bereiding van polymeren |
| US5245123A (en) * | 1991-02-26 | 1993-09-14 | Shell Oil Company | Vapor phase polymerization of co/olefin with palladium compound, lewis acid and bidentate ligand |
| US5216120A (en) * | 1991-02-26 | 1993-06-01 | Shell Oil Company | Polymerization of co/olefin with catalyst comprising palladium compound, lewis acid and bronsted acid |
| US5227464A (en) * | 1991-03-21 | 1993-07-13 | Shell Oil Company | Gas phase polymerization of co/olefin with particular catalyst support |
| US5237047A (en) * | 1991-05-01 | 1993-08-17 | Shell Oil Company | Polymerization of co/olefin wth catalyst chemically bound to particles of support |
| US5210178A (en) * | 1991-06-27 | 1993-05-11 | Shell Oil Company | Gas phase polyketone polymer preparation with preliminary addition of water |
| US5225523A (en) * | 1991-07-02 | 1993-07-06 | Shell Oil Company | Polyketone polymer preparation with tetra alkyl bis phosphine ligand and hydrogen |
| US5247064A (en) * | 1991-08-06 | 1993-09-21 | Shell Oil Company | Polymerization of co/olefin with p bidentate ligand |
| US5243026A (en) * | 1991-09-27 | 1993-09-07 | Shell Oil Company | Continuous gas phase polymerization of co/olefin with palladium and metal fluoride lewis acid catalyst |
| US5227437A (en) * | 1991-10-15 | 1993-07-13 | Shell Oil Company | Isomorphic polyketone polymer blend |
| US5644023A (en) * | 1992-04-21 | 1997-07-01 | Union Carbide Chemicals & Plastics Technology Corporation | Process for the manufacture of copolymers of ethylene and carbon monoxide |
| US5338825A (en) * | 1992-05-27 | 1994-08-16 | Shell Oil Company | Polymer preparation |
| EP0572087A1 (en) * | 1992-05-27 | 1993-12-01 | Shell Internationale Researchmaatschappij B.V. | Process for the preparation of polymers of carbon monoxyde and olefinically unsaturated compounds |
| US5567801A (en) * | 1992-06-15 | 1996-10-22 | Akzo Nobel Nv | Gas phase process for forming polyketones |
| JPH07508317A (ja) * | 1992-06-26 | 1995-09-14 | アクゾ ノーベル ナムローゼ フェンノートシャップ | ポリケトンヤーン及びそれを製造する方法 |
| TW305850B (en:Method) * | 1992-11-17 | 1997-05-21 | Shell Int Research | |
| TW305849B (en:Method) * | 1992-11-20 | 1997-05-21 | Shell Int Research | |
| US5820806A (en) * | 1993-01-13 | 1998-10-13 | Akzo Nobel Nv | Process for the preparation of polyketone fibers |
| EP0614928B1 (en) * | 1993-03-12 | 2000-02-02 | Shell Internationale Researchmaatschappij B.V. | Process for the preparation of copolymers of carbon monoxide and ethylenically unsaturated compounds |
| DE69422840T2 (de) * | 1993-03-12 | 2000-07-27 | Shell Internationale Research Maatschappij B.V., Den Haag/S'gravenhage | Verfahren zur Herstellung von Copolymeren aus Kohlenmonoxid und ethylenisch ungesättigten Verbindungen |
| ZA953387B (en) * | 1994-04-29 | 1995-11-29 | Shell Int Research | Catalyst system and process for the preparation of copolymers of carbon monoxide and olefinically unsaturated compounds |
| US5440010A (en) * | 1994-06-27 | 1995-08-08 | Akzo Nobel N.V. | Gas phase process for forming polyketones |
| EP0702045A3 (en) * | 1994-09-15 | 1996-07-17 | Shell Int Research | Gas phase process for the copolymerization of carbon monoxide and ethylenically unsaturated compounds |
| DE19746279A1 (de) * | 1997-10-20 | 1999-04-22 | Basf Ag | Verfahren zur heterogen-katalytischen Herstellung von Kohlenmonoxidcopolymeren |
| AU3140599A (en) | 1998-02-12 | 1999-08-30 | Akzo Nobel N.V. | Process for preparing polyketone fibres |
| US6548708B1 (en) | 1998-08-05 | 2003-04-15 | Sri International | Preparation of biphosphine ligands for incorporation into catalytic complexes |
| US6037442A (en) * | 1998-12-10 | 2000-03-14 | E. I. Du Pont De Nemours And Company | Preparation of olefin copolymers of sulfur dioxide or carbon monoxide |
| WO2018034549A1 (ko) * | 2016-08-19 | 2018-02-22 | 아주대학교산학협력단 | 폴리케톤 화합물 제조용 촉매 조성물, 팔라듐 혼합 촉매 시스템, 이를 이용한 폴리케톤 화합물 제조 방법 및 폴리케톤 중합체 |
| CN108906021B (zh) * | 2018-06-01 | 2021-05-18 | 浙江利欧环保科技有限公司 | 一种钍掺杂硅藻土负载对甲苯磺酸催化剂及其制备方法和应用 |
| CN112142956B (zh) * | 2020-09-27 | 2021-10-19 | 中国科学院物理研究所 | 一种一氧化碳的聚合方法 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1129551A (en) * | 1965-03-18 | 1968-10-09 | Ici Ltd | Process for the manufacture of urethanes |
| GB1081304A (en) * | 1965-03-23 | 1967-08-31 | Ici Ltd | Improvements in or relating to chemical compounds |
| US3689460A (en) * | 1971-03-04 | 1972-09-05 | Shell Oil Co | Interpolymers of carbon monoxide and process for preparing same |
| US3694412A (en) * | 1971-03-04 | 1972-09-26 | Shell Oil Co | Process for preparing interpolymers of carbon monoxide in the presence of aryl phosphine-palladium halide complex |
| CA1019637A (en) * | 1972-05-09 | 1977-10-25 | Dahlgren Manufacturing Company | Method and apparatus for inking printing plates |
| US3914391A (en) * | 1973-03-26 | 1975-10-21 | Shell Oil Co | Preparation of HPd(CN){HD 3{B |
| US3835123A (en) * | 1973-03-26 | 1974-09-10 | Shell Oil Co | Process for preparing interpolymers of carbon monoxide and ethylenically unsaturated compounds |
| US3984388A (en) * | 1975-06-02 | 1976-10-05 | Shell Oil Company | Process to prepare polyketones |
| US4076911A (en) * | 1975-11-05 | 1978-02-28 | Union Oil Company Of California | Ethylene-carbon monoxide copolymers |
| GB2058074B (en) * | 1979-08-23 | 1983-10-12 | Secr Defence | Palladium complexes |
| EP0086281B2 (en) * | 1981-12-02 | 1988-10-19 | Shell Internationale Researchmaatschappij B.V. | Preparation of carbamates using a palladium-containing catalyst |
| ATE49010T1 (de) * | 1983-04-06 | 1990-01-15 | Shell Int Research | Verfahren zur herstellung von polyketonen. |
| NL8403035A (nl) * | 1984-10-05 | 1986-05-01 | Shell Int Research | Werkwijze ter bereiding van polyketonen. |
| IN168306B (en:Method) * | 1986-03-05 | 1991-03-09 | Shell Int Research | |
| IN168056B (en:Method) * | 1986-03-05 | 1991-01-26 | Shell Int Research |
-
1987
- 1987-05-20 IE IE132887A patent/IE60363B1/en not_active IP Right Cessation
- 1987-05-22 IL IL82635A patent/IL82635A/xx unknown
- 1987-05-22 IN IN446/DEL/87A patent/IN170625B/en unknown
- 1987-05-25 NZ NZ220420A patent/NZ220420A/xx unknown
- 1987-05-25 FI FI872297A patent/FI90783C/fi not_active IP Right Cessation
- 1987-05-25 ZA ZA873726A patent/ZA873726B/xx unknown
- 1987-05-26 EP EP87201001A patent/EP0248483B1/en not_active Expired - Lifetime
- 1987-05-26 BR BR8702703A patent/BR8702703A/pt not_active Application Discontinuation
- 1987-05-26 AU AU73406/87A patent/AU592872B2/en not_active Ceased
- 1987-05-26 ES ES87201001T patent/ES2019619B3/es not_active Expired - Lifetime
- 1987-05-26 CA CA000537956A patent/CA1318440C/en not_active Expired - Fee Related
- 1987-05-26 NO NO872209A patent/NO168253C/no unknown
- 1987-05-26 DE DE8787201001T patent/DE3767371D1/de not_active Expired - Lifetime
- 1987-05-26 DK DK269787A patent/DK269787A/da not_active Application Discontinuation
- 1987-05-26 US US07/053,780 patent/US4778876A/en not_active Expired - Lifetime
- 1987-05-26 AT AT87201001T patent/ATE60066T1/de not_active IP Right Cessation
- 1987-05-26 CN CN87104681A patent/CN1009652B/zh not_active Expired
- 1987-05-27 JP JP62128554A patent/JPH0822915B2/ja not_active Expired - Lifetime
- 1987-05-27 MX MX006660A patent/MX170155B/es unknown
- 1987-05-27 KR KR1019870005349A patent/KR970000486B1/ko not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| CN1009652B (zh) | 1990-09-19 |
| DK269787A (da) | 1987-11-28 |
| CN87104681A (zh) | 1987-12-23 |
| NO872209D0 (no) | 1987-05-26 |
| DK269787D0 (da) | 1987-05-26 |
| ATE60066T1 (de) | 1991-02-15 |
| ES2019619B3 (es) | 1991-07-01 |
| FI872297L (fi) | 1987-11-28 |
| ZA873726B (en) | 1988-08-31 |
| IL82635A0 (en) | 1987-11-30 |
| MX170155B (es) | 1993-08-10 |
| IE871328L (en) | 1987-11-27 |
| IE60363B1 (en) | 1994-07-13 |
| AU592872B2 (en) | 1990-01-25 |
| IN170625B (en:Method) | 1992-04-25 |
| NO168253C (no) | 1992-01-29 |
| FI872297A0 (fi) | 1987-05-25 |
| KR870011169A (ko) | 1987-12-21 |
| BR8702703A (pt) | 1988-03-01 |
| DE3767371D1 (de) | 1991-02-21 |
| JPH0822915B2 (ja) | 1996-03-06 |
| NZ220420A (en) | 1989-06-28 |
| IL82635A (en) | 1991-03-10 |
| AU7340687A (en) | 1987-12-03 |
| EP0248483B1 (en) | 1991-01-16 |
| NO872209L (no) | 1987-11-30 |
| KR970000486B1 (ko) | 1997-01-13 |
| NO168253B (no) | 1991-10-21 |
| US4778876A (en) | 1988-10-18 |
| EP0248483A3 (en) | 1988-03-16 |
| EP0248483A2 (en) | 1987-12-09 |
| FI90783B (fi) | 1993-12-15 |
| JPS62285919A (ja) | 1987-12-11 |
| CA1318440C (en) | 1993-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI90783C (fi) | Menetelmä polymeerin valmistamiseksi hiilimonoksidista ja olefiinisesti tyydyttämättömästä orgaanisesta yhdisteestä (yhdisteistä) | |
| EP0305011B1 (en) | Preparation of olefin/CO copolymers | |
| EP0257663B1 (en) | Catalyst compositions, olefin/co copolymerization process and bisphosphine compounds | |
| KR960009687B1 (ko) | 신규 촉매 조성물 | |
| US4940776A (en) | Catalytic polymerization of carbon monoxide/olefin in the presence of insoluble particulate solid matter | |
| EP0259914B1 (en) | Novel catalyst compositions and process for olefin/co copolymerization | |
| JPS62232434A (ja) | 重合体の製造方法 | |
| JPS62212433A (ja) | 触媒組成物 | |
| EP0227135B1 (en) | Removal of catalyst remnants from ethene/co copolymers | |
| CA1338576C (en) | Polyketone polymer preparation | |
| US4791190A (en) | Removal of palladium compound catalyst residues from polymer ketones | |
| KR0160116B1 (ko) | 중합체 제조 방법 | |
| CA1338578C (en) | Process for the preparation of polymers of carbon monoxide with unsaturated compounds | |
| KR0178527B1 (ko) | 폴리케톤 중합체의 제조 | |
| JPH04216824A (ja) | 一酸化炭素と1種以上のオレフィン性不飽和化合物とのポリマーの製造方法 | |
| US4889914A (en) | Preparation of carbon monoxide/olefin copolymer with removal of s/Fe from carbon monoxide monomer | |
| US5434117A (en) | Catalyst system and copolymerization process | |
| JPH04272925A (ja) | ポリマーの製造方法 | |
| US5210178A (en) | Gas phase polyketone polymer preparation with preliminary addition of water | |
| WO1992018244A1 (en) | Catalyst for preparation of polyketones | |
| WO2000009583A1 (en) | Catalyst composition and process for the preparation of copolymers of carbon monoxide and an olefinically unsaturated compound |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB | Publication of examined application | ||
| MM | Patent lapsed |
Owner name: SHELL INTERNATIONALE RESEARCH MAATSCHAPPIJ B.V. |