FI71140C - Foerfarande foer framstaellning av nya farmakologiskt vaerdefulla vinylena karboxamider - Google Patents
Foerfarande foer framstaellning av nya farmakologiskt vaerdefulla vinylena karboxamider Download PDFInfo
- Publication number
- FI71140C FI71140C FI802366A FI802366A FI71140C FI 71140 C FI71140 C FI 71140C FI 802366 A FI802366 A FI 802366A FI 802366 A FI802366 A FI 802366A FI 71140 C FI71140 C FI 71140C
- Authority
- FI
- Finland
- Prior art keywords
- group
- general formula
- thiophen
- benzo
- formula
- Prior art date
Links
- 230000000144 pharmacologic effect Effects 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title claims 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N Acetylene Chemical compound C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 45
- -1 di-substituted phenyl Chemical group 0.000 claims abstract description 42
- 239000000460 chlorine Chemical group 0.000 claims abstract description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 29
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 29
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 6
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 5
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 4
- 239000001961 anticonvulsive agent Substances 0.000 claims abstract description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 4
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 3
- 125000001424 substituent group Chemical group 0.000 claims abstract 7
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims abstract 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract 2
- 229910052736 halogen Inorganic materials 0.000 claims abstract 2
- 150000002367 halogens Chemical class 0.000 claims abstract 2
- 239000000047 product Substances 0.000 claims description 36
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 34
- 239000000203 mixture Substances 0.000 claims description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- 238000002360 preparation method Methods 0.000 claims description 25
- 239000000243 solution Substances 0.000 claims description 21
- 150000001412 amines Chemical class 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 15
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 150000003863 ammonium salts Chemical class 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 7
- 150000007513 acids Chemical class 0.000 claims description 7
- 235000013877 carbamide Nutrition 0.000 claims description 7
- 230000000694 effects Effects 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 7
- 239000011707 mineral Substances 0.000 claims description 7
- HERSKCAGZCXYMC-UHFFFAOYSA-N thiophen-3-ol Chemical compound OC=1C=CSC=1 HERSKCAGZCXYMC-UHFFFAOYSA-N 0.000 claims description 7
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 6
- 239000000725 suspension Substances 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 5
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 claims description 5
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 claims description 4
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical class NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 4
- 229910021626 Tin(II) chloride Inorganic materials 0.000 claims description 4
- 230000001773 anti-convulsant effect Effects 0.000 claims description 4
- 239000007900 aqueous suspension Substances 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 239000004202 carbamide Substances 0.000 claims description 4
- 150000003857 carboxamides Chemical class 0.000 claims description 4
- 150000002084 enol ethers Chemical class 0.000 claims description 4
- 239000001119 stannous chloride Substances 0.000 claims description 4
- 235000011150 stannous chloride Nutrition 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 229960003965 antiepileptics Drugs 0.000 claims description 3
- 239000000010 aprotic solvent Substances 0.000 claims description 3
- 150000001555 benzenes Chemical class 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 239000012467 final product Substances 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 229910021506 iron(II) hydroxide Inorganic materials 0.000 claims description 3
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical compound [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 150000003672 ureas Chemical class 0.000 claims description 3
- 150000002170 ethers Chemical class 0.000 claims description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 238000009472 formulation Methods 0.000 claims 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 2
- 230000003197 catalytic effect Effects 0.000 claims 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 2
- 239000013543 active substance Substances 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims 1
- 150000008046 alkali metal hydrides Chemical class 0.000 claims 1
- 239000000956 alloy Substances 0.000 claims 1
- 229910045601 alloy Inorganic materials 0.000 claims 1
- 239000003125 aqueous solvent Substances 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 150000001805 chlorine compounds Chemical class 0.000 claims 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 claims 1
- 150000002085 enols Chemical class 0.000 claims 1
- PEOHLVWFSVQRLK-UHFFFAOYSA-N ethenylcarbamic acid Chemical class OC(=O)NC=C PEOHLVWFSVQRLK-UHFFFAOYSA-N 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 125000005647 linker group Chemical group 0.000 claims 1
- 210000005036 nerve Anatomy 0.000 claims 1
- 230000003389 potentiating effect Effects 0.000 claims 1
- 230000037452 priming Effects 0.000 claims 1
- 239000002002 slurry Substances 0.000 claims 1
- 235000020357 syrup Nutrition 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract description 4
- 229920006395 saturated elastomer Polymers 0.000 abstract description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 229940125681 anticonvulsant agent Drugs 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 abstract 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 abstract 1
- 239000011593 sulfur Substances 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 189
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 133
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 118
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 69
- 239000003208 petroleum Substances 0.000 description 60
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 43
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 29
- ALJWLHQGTSSBHL-UHFFFAOYSA-N (3-hydroxy-1-benzothiophen-2-yl)-phenylmethanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=CC=C1 ALJWLHQGTSSBHL-UHFFFAOYSA-N 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- 239000013078 crystal Substances 0.000 description 24
- OHUOHBAWAAPIDL-UHFFFAOYSA-N 2-(benzenecarboximidoyl)-1-benzothiophen-3-ol Chemical compound Oc1c(sc2ccccc12)C(=N)c1ccccc1 OHUOHBAWAAPIDL-UHFFFAOYSA-N 0.000 description 23
- 230000007935 neutral effect Effects 0.000 description 23
- ADHAJDDBRUOZHJ-UHFFFAOYSA-N 1-benzothiophen-3-one Chemical compound C1=CC=C2C(=O)CSC2=C1 ADHAJDDBRUOZHJ-UHFFFAOYSA-N 0.000 description 22
- 238000002844 melting Methods 0.000 description 21
- 230000008018 melting Effects 0.000 description 21
- 238000002329 infrared spectrum Methods 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 229910021529 ammonia Inorganic materials 0.000 description 17
- 238000005160 1H NMR spectroscopy Methods 0.000 description 16
- 238000000921 elemental analysis Methods 0.000 description 16
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 15
- 239000005695 Ammonium acetate Substances 0.000 description 15
- 229940043376 ammonium acetate Drugs 0.000 description 15
- 235000019257 ammonium acetate Nutrition 0.000 description 15
- 125000001639 phenylmethylene group Chemical group [H]C(=*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 13
- 229960000583 acetic acid Drugs 0.000 description 13
- 239000002244 precipitate Substances 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 238000004809 thin layer chromatography Methods 0.000 description 10
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000003513 alkali Substances 0.000 description 9
- 235000011114 ammonium hydroxide Nutrition 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 230000009467 reduction Effects 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 235000013601 eggs Nutrition 0.000 description 7
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- VPRSNYUHGGSGEP-JQIJEIRASA-N (2e)-2-[methylamino(phenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/NC)C1=CC=CC=C1 VPRSNYUHGGSGEP-JQIJEIRASA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 238000002211 ultraviolet spectrum Methods 0.000 description 5
- BKGKRTZLULFYCE-UHFFFAOYSA-N (2-ethylphenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound CCC1=CC=CC=C1C(=O)C1=C(O)C2=CC=CC=C2S1 BKGKRTZLULFYCE-UHFFFAOYSA-N 0.000 description 4
- 102000002322 Egg Proteins Human genes 0.000 description 4
- 108010000912 Egg Proteins Proteins 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 4
- 235000013345 egg yolk Nutrition 0.000 description 4
- 210000002969 egg yolk Anatomy 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 235000006408 oxalic acid Nutrition 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- IQABVXKBYDGVFJ-FOCLMDBBSA-N (2e)-2-[methoxy(phenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/OC)C1=CC=CC=C1 IQABVXKBYDGVFJ-FOCLMDBBSA-N 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 208000005392 Spasm Diseases 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 235000011007 phosphoric acid Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- VOBWLFNYOWWARN-UHFFFAOYSA-N thiophen-3-one Chemical compound O=C1CSC=C1 VOBWLFNYOWWARN-UHFFFAOYSA-N 0.000 description 3
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 3
- 230000001256 tonic effect Effects 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- KAIJJEDETYMCDH-UHFFFAOYSA-N (2-bromophenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=CC=C1Br KAIJJEDETYMCDH-UHFFFAOYSA-N 0.000 description 2
- HECIUUWZLCDOCS-UHFFFAOYSA-N (2-chlorophenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=CC=C1Cl HECIUUWZLCDOCS-UHFFFAOYSA-N 0.000 description 2
- LJDRWNZFCLNWTF-UHFFFAOYSA-N (2-fluorophenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=CC=C1F LJDRWNZFCLNWTF-UHFFFAOYSA-N 0.000 description 2
- PGITVZNVLPYSLH-FYWRMAATSA-N (2e)-2-[(hydroxyamino)-phenylmethylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/NO)C1=CC=CC=C1 PGITVZNVLPYSLH-FYWRMAATSA-N 0.000 description 2
- KPSJDTYTGBFJBT-UHFFFAOYSA-N (3,4-dichlorophenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=C(Cl)C(Cl)=C1 KPSJDTYTGBFJBT-UHFFFAOYSA-N 0.000 description 2
- ATOKOVGMLALELU-UHFFFAOYSA-N (3-chloro-1-benzothiophen-2-yl)-phenylmethanone Chemical compound S1C2=CC=CC=C2C(Cl)=C1C(=O)C1=CC=CC=C1 ATOKOVGMLALELU-UHFFFAOYSA-N 0.000 description 2
- NLKSGZRGVQNFAW-UHFFFAOYSA-N (3-hydroxy-1-benzothiophen-2-yl)-(2-methylphenyl)methanone Chemical compound CC1=CC=CC=C1C(=O)C1=C(O)C2=CC=CC=C2S1 NLKSGZRGVQNFAW-UHFFFAOYSA-N 0.000 description 2
- GIKYZNXXXXCCLI-UHFFFAOYSA-N (3-hydroxy-1-benzothiophen-2-yl)-(3-methylphenyl)methanone Chemical compound CC1=CC=CC(C(=O)C2=C(C3=CC=CC=C3S2)O)=C1 GIKYZNXXXXCCLI-UHFFFAOYSA-N 0.000 description 2
- RYCFCQUGIFRLTD-UHFFFAOYSA-N (3-hydroxy-1-benzothiophen-2-yl)-(4-methylphenyl)methanone Chemical compound C1=CC(C)=CC=C1C(=O)C1=C(O)C2=CC=CC=C2S1 RYCFCQUGIFRLTD-UHFFFAOYSA-N 0.000 description 2
- OLZPWVARGNOKBI-UHFFFAOYSA-N (3-hydroxy-1-benzothiophen-2-yl)-pyridin-2-ylmethanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=CC=N1 OLZPWVARGNOKBI-UHFFFAOYSA-N 0.000 description 2
- XTGKVKBLHQPFIP-UHFFFAOYSA-N (3-hydroxy-4-methyl-1-benzothiophen-2-yl)-phenylmethanone Chemical compound OC=1C=2C(C)=CC=CC=2SC=1C(=O)C1=CC=CC=C1 XTGKVKBLHQPFIP-UHFFFAOYSA-N 0.000 description 2
- RJFXKANIIJIFDQ-UHFFFAOYSA-N (3-hydroxy-6-methoxy-1-benzothiophen-2-yl)-phenylmethanone Chemical compound S1C2=CC(OC)=CC=C2C(O)=C1C(=O)C1=CC=CC=C1 RJFXKANIIJIFDQ-UHFFFAOYSA-N 0.000 description 2
- MTCGBVGDPGZQDV-UHFFFAOYSA-N (3-hydroxy-6-methyl-1-benzothiophen-2-yl)-phenylmethanone Chemical compound S1C2=CC(C)=CC=C2C(O)=C1C(=O)C1=CC=CC=C1 MTCGBVGDPGZQDV-UHFFFAOYSA-N 0.000 description 2
- XPBCZTSLIDXEQU-UHFFFAOYSA-N (4-chlorophenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=C(Cl)C=C1 XPBCZTSLIDXEQU-UHFFFAOYSA-N 0.000 description 2
- JOBVYQBAZDROPP-UHFFFAOYSA-N (4-fluorophenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=C(F)C=C1 JOBVYQBAZDROPP-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- 229940093475 2-ethoxyethanol Drugs 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- DDQAGDLHARKUFX-UHFFFAOYSA-N acetic acid;methanamine Chemical compound [NH3+]C.CC([O-])=O DDQAGDLHARKUFX-UHFFFAOYSA-N 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 229940013688 formic acid Drugs 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 2
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- HAYCFWVNEKSJJO-UHFFFAOYSA-N (2-aminophenyl)-(3-hydroxy-1-benzothiophen-2-yl)methanone Chemical compound NC1=CC=CC=C1C(=O)C1=C(O)C2=CC=CC=C2S1 HAYCFWVNEKSJJO-UHFFFAOYSA-N 0.000 description 1
- RXQVODAROJZMFL-JQIJEIRASA-N (2e)-2-[amino(phenyl)methylidene]-4-methyl-1-benzothiophen-3-one Chemical compound O=C1C=2C(C)=CC=CC=2S\C1=C(\N)C1=CC=CC=C1 RXQVODAROJZMFL-JQIJEIRASA-N 0.000 description 1
- QOMYBZVEYGVZQR-FYWRMAATSA-N (2e)-2-[amino(phenyl)methylidene]-5-chloro-1-benzothiophen-3-one Chemical compound S/1C2=CC=C(Cl)C=C2C(=O)C\1=C(/N)C1=CC=CC=C1 QOMYBZVEYGVZQR-FYWRMAATSA-N 0.000 description 1
- CUAJYVZLWWRSHR-JQIJEIRASA-N (2e)-2-[amino(phenyl)methylidene]-5-methyl-1-benzothiophen-3-one Chemical compound O=C1C2=CC(C)=CC=C2S\C1=C(\N)C1=CC=CC=C1 CUAJYVZLWWRSHR-JQIJEIRASA-N 0.000 description 1
- WNJDNOWBBMKKDY-JQIJEIRASA-N (2e)-2-[amino(phenyl)methylidene]-6-methoxy-1-benzothiophen-3-one Chemical compound S1C2=CC(OC)=CC=C2C(=O)\C1=C(/N)C1=CC=CC=C1 WNJDNOWBBMKKDY-JQIJEIRASA-N 0.000 description 1
- NSELJHHEQDLMPV-JQIJEIRASA-N (2e)-2-[amino(phenyl)methylidene]-6-methyl-1-benzothiophen-3-one Chemical compound S1C2=CC(C)=CC=C2C(=O)\C1=C(/N)C1=CC=CC=C1 NSELJHHEQDLMPV-JQIJEIRASA-N 0.000 description 1
- BHAQCGZKENMDHK-WYMLVPIESA-N (2e)-2-[amino(pyridin-2-yl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=CC=N1 BHAQCGZKENMDHK-WYMLVPIESA-N 0.000 description 1
- UJXHEJHZTBSTRQ-WYMLVPIESA-N (2e)-2-[amino(pyridin-4-yl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=NC=C1 UJXHEJHZTBSTRQ-WYMLVPIESA-N 0.000 description 1
- YJWPYMNJYJCWPV-FYWRMAATSA-N (2e)-2-[amino-(2-aminophenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=CC=C1N YJWPYMNJYJCWPV-FYWRMAATSA-N 0.000 description 1
- OVJJFFCTUDQSQW-FYWRMAATSA-N (2e)-2-[amino-(2-bromophenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=CC=C1Br OVJJFFCTUDQSQW-FYWRMAATSA-N 0.000 description 1
- GDZOBENHZFWXEC-FYWRMAATSA-N (2e)-2-[amino-(2-chlorophenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=CC=C1Cl GDZOBENHZFWXEC-FYWRMAATSA-N 0.000 description 1
- NAJZENYOHVGWJK-FYWRMAATSA-N (2e)-2-[amino-(2-chlorophenyl)methylidene]-5-chloro-1-benzothiophen-3-one Chemical compound S/1C2=CC=C(Cl)C=C2C(=O)C\1=C(/N)C1=CC=CC=C1Cl NAJZENYOHVGWJK-FYWRMAATSA-N 0.000 description 1
- PTBOZGQLONGLOO-BMRADRMJSA-N (2e)-2-[amino-(2-ethylphenyl)methylidene]-1-benzothiophen-3-one Chemical compound CCC1=CC=CC=C1\C(N)=C/1C(=O)C2=CC=CC=C2S\1 PTBOZGQLONGLOO-BMRADRMJSA-N 0.000 description 1
- YIUVRYFJXQSOMU-FYWRMAATSA-N (2e)-2-[amino-(2-fluorophenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=CC=C1F YIUVRYFJXQSOMU-FYWRMAATSA-N 0.000 description 1
- ORRIVOFQEYRZJF-JQIJEIRASA-N (2e)-2-[amino-(2-methylphenyl)methylidene]-1-benzothiophen-3-one Chemical compound CC1=CC=CC=C1\C(N)=C/1C(=O)C2=CC=CC=C2S\1 ORRIVOFQEYRZJF-JQIJEIRASA-N 0.000 description 1
- SQAGJEATLHOHRV-FYWRMAATSA-N (2e)-2-[amino-(2-nitrophenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=CC=C1[N+]([O-])=O SQAGJEATLHOHRV-FYWRMAATSA-N 0.000 description 1
- GMMIJOYUOHLNIK-JQIJEIRASA-N (2e)-2-[amino-(3-methylphenyl)methylidene]-1-benzothiophen-3-one Chemical compound CC1=CC=CC(C(\N)=C/2C(C3=CC=CC=C3S\2)=O)=C1 GMMIJOYUOHLNIK-JQIJEIRASA-N 0.000 description 1
- YCSIOQUKGXAHDU-FYWRMAATSA-N (2e)-2-[amino-(4-chlorophenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=C(Cl)C=C1 YCSIOQUKGXAHDU-FYWRMAATSA-N 0.000 description 1
- LOMBWJMQAWXIBJ-FYWRMAATSA-N (2e)-2-[amino-(4-fluorophenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(/N)C1=CC=C(F)C=C1 LOMBWJMQAWXIBJ-FYWRMAATSA-N 0.000 description 1
- SYIUEIVCDZJUHK-JQIJEIRASA-N (2e)-2-[amino-(4-methylphenyl)methylidene]-1-benzothiophen-3-one Chemical compound C1=CC(C)=CC=C1C(\N)=C/1C(=O)C2=CC=CC=C2S\1 SYIUEIVCDZJUHK-JQIJEIRASA-N 0.000 description 1
- AKGNUCMHPSRQHL-BMRADRMJSA-N (2e)-2-[dimethylamino(phenyl)methylidene]-1-benzothiophen-3-one Chemical compound S/1C2=CC=CC=C2C(=O)C\1=C(N(C)C)\C1=CC=CC=C1 AKGNUCMHPSRQHL-BMRADRMJSA-N 0.000 description 1
- YIOTVRYOYOKQCD-HTXNQAPBSA-N (2e)-2-[phenyl(pyrrolidin-1-yl)methylidene]-1-benzothiophen-3-one Chemical compound S1C2=CC=CC=C2C(=O)\C1=C(C=1C=CC=CC=1)/N1CCCC1 YIOTVRYOYOKQCD-HTXNQAPBSA-N 0.000 description 1
- YNHYWOUZAFQDLT-UHFFFAOYSA-N (3-hydroxy-1-benzothiophen-2-yl)-(2-nitrophenyl)methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=CC=C1[N+]([O-])=O YNHYWOUZAFQDLT-UHFFFAOYSA-N 0.000 description 1
- PLGUZYNHADWBIK-UHFFFAOYSA-N (3-hydroxy-1-benzothiophen-2-yl)-[2-(trifluoromethyl)phenyl]methanone Chemical compound S1C2=CC=CC=C2C(O)=C1C(=O)C1=CC=CC=C1C(F)(F)F PLGUZYNHADWBIK-UHFFFAOYSA-N 0.000 description 1
- ZNGAUGMITPSITL-UHFFFAOYSA-N (3-hydroxy-5-methyl-1-benzothiophen-2-yl)-phenylmethanone Chemical compound OC=1C2=CC(C)=CC=C2SC=1C(=O)C1=CC=CC=C1 ZNGAUGMITPSITL-UHFFFAOYSA-N 0.000 description 1
- GZIOMAIHGKUXRM-UHFFFAOYSA-N (5-chloro-3-hydroxy-1-benzothiophen-2-yl)-(2-chlorophenyl)methanone Chemical compound S1C2=CC=C(Cl)C=C2C(O)=C1C(=O)C1=CC=CC=C1Cl GZIOMAIHGKUXRM-UHFFFAOYSA-N 0.000 description 1
- XZONUUBQGNPZAE-UHFFFAOYSA-N (5-chloro-3-hydroxy-1-benzothiophen-2-yl)-phenylmethanone Chemical compound S1C2=CC=C(Cl)C=C2C(O)=C1C(=O)C1=CC=CC=C1 XZONUUBQGNPZAE-UHFFFAOYSA-N 0.000 description 1
- QLSIGQKRBSDVIM-UHFFFAOYSA-N (6-chloro-3-hydroxy-1-benzothiophen-2-yl)-phenylmethanone Chemical compound S1C2=CC(Cl)=CC=C2C(O)=C1C(=O)C1=CC=CC=C1 QLSIGQKRBSDVIM-UHFFFAOYSA-N 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-L 2-(carboxymethyl)-2-hydroxysuccinate Chemical compound [O-]C(=O)CC(O)(C(=O)O)CC([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-L 0.000 description 1
- LDGCSJYDINWTRT-UHFFFAOYSA-N 2-(naphthalen-1-ylmethylsulfanyl)-1,3-benzoxazole Chemical compound C1=CC=C2C(CSC=3OC4=CC=CC=C4N=3)=CC=CC2=C1 LDGCSJYDINWTRT-UHFFFAOYSA-N 0.000 description 1
- VNPNJVWHHHXILZ-UHFFFAOYSA-N 2-methoxyethoxyalumane Chemical compound COCCO[AlH2] VNPNJVWHHHXILZ-UHFFFAOYSA-N 0.000 description 1
- NXYZFJSEESJRDW-UHFFFAOYSA-N 2-methylpropylazanium;acetate Chemical compound CC([O-])=O.CC(C)C[NH3+] NXYZFJSEESJRDW-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- WNWVKZTYMQWFHE-UHFFFAOYSA-N 4-ethylmorpholine Chemical group [CH2]CN1CCOCC1 WNWVKZTYMQWFHE-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- BFVCZFDSSBXWTO-UHFFFAOYSA-N BrC1=C(C(=O)C2=C(C3=C(S2)C=CC=C3)O)C=CC=C1.C(C)CC(=O)O Chemical compound BrC1=C(C(=O)C2=C(C3=C(S2)C=CC=C3)O)C=CC=C1.C(C)CC(=O)O BFVCZFDSSBXWTO-UHFFFAOYSA-N 0.000 description 1
- OQIPITMXFAJEGQ-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)C1=C(C2=C(S1)C=C(C=C2)Cl)O.CO Chemical compound C(C1=CC=CC=C1)(=O)C1=C(C2=C(S1)C=C(C=C2)Cl)O.CO OQIPITMXFAJEGQ-UHFFFAOYSA-N 0.000 description 1
- VVUFDLFRGVHORG-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)C1=C(C2=C(S1)C=CC(=C2)C)O.CO Chemical compound C(C1=CC=CC=C1)(=O)C1=C(C2=C(S1)C=CC(=C2)C)O.CO VVUFDLFRGVHORG-UHFFFAOYSA-N 0.000 description 1
- AUMAUAXISQYCBT-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)C1=C(C2=C(S1)C=CC(=C2)Cl)O.CO Chemical compound C(C1=CC=CC=C1)(=O)C1=C(C2=C(S1)C=CC(=C2)Cl)O.CO AUMAUAXISQYCBT-UHFFFAOYSA-N 0.000 description 1
- YNFODQBMIGTLNB-UHFFFAOYSA-N C(CC)C1=C(C2=C(SC(C2=O)=CC2=CC=CC=C2)C=C1)N Chemical compound C(CC)C1=C(C2=C(SC(C2=O)=CC2=CC=CC=C2)C=C1)N YNFODQBMIGTLNB-UHFFFAOYSA-N 0.000 description 1
- NCBHIINAIAHYCS-UHFFFAOYSA-N C1(=CC=CC=C1)NNC(=C)CC1=CC=CC=C1 Chemical group C1(=CC=CC=C1)NNC(=C)CC1=CC=CC=C1 NCBHIINAIAHYCS-UHFFFAOYSA-N 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- ICCBGSSNOMBXRL-UHFFFAOYSA-N ClC1=C(C(=O)C2=C(C3=C(S2)C=CC(=C3)Cl)O)C=CC=C1.C(C)CC(=O)O Chemical compound ClC1=C(C(=O)C2=C(C3=C(S2)C=CC(=C3)Cl)O)C=CC=C1.C(C)CC(=O)O ICCBGSSNOMBXRL-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- MPGHAAPQFOFQRL-UHFFFAOYSA-N FC(C1=C(C(=O)C2=C(C3=C(S2)C=CC=C3)O)C=CC=C1)(F)F.CO Chemical compound FC(C1=C(C(=O)C2=C(C3=C(S2)C=CC=C3)O)C=CC=C1)(F)F.CO MPGHAAPQFOFQRL-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- BNRPIIZCIIJTDQ-UHFFFAOYSA-N OCCC1=C(C2=C(SC(C2=O)=CC2=CC=CC=C2)C=C1)N Chemical compound OCCC1=C(C2=C(SC(C2=O)=CC2=CC=CC=C2)C=C1)N BNRPIIZCIIJTDQ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241001481789 Rupicapra Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NXEAFNBZYAYRMO-UHFFFAOYSA-N [N+](=O)([O-])C1=C(C(=O)C2=C(C3=C(S2)C=CC=C3)O)C=CC=C1.CO Chemical compound [N+](=O)([O-])C1=C(C(=O)C2=C(C3=C(S2)C=CC=C3)O)C=CC=C1.CO NXEAFNBZYAYRMO-UHFFFAOYSA-N 0.000 description 1
- SVBXPEXMMWJPIE-UHFFFAOYSA-N acetic acid;propan-1-amine Chemical compound CCC[NH3+].CC([O-])=O SVBXPEXMMWJPIE-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- BVCZEBOGSOYJJT-UHFFFAOYSA-N ammonium carbamate Chemical compound [NH4+].NC([O-])=O BVCZEBOGSOYJJT-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- XJMWHXZUIGHOBA-UHFFFAOYSA-N azane;propanoic acid Chemical compound N.CCC(O)=O XJMWHXZUIGHOBA-UHFFFAOYSA-N 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 235000010338 boric acid Nutrition 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- VMODGNJVNZAOIZ-UHFFFAOYSA-N butanoic acid;methanol Chemical compound OC.CCCC(O)=O VMODGNJVNZAOIZ-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LXTKCTMGEWVPTB-UHFFFAOYSA-N butylazanium;acetate Chemical compound CC(O)=O.CCCCN LXTKCTMGEWVPTB-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 230000002566 clonic effect Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- QHNXEVRKFKHMRL-UHFFFAOYSA-N dimethylazanium;acetate Chemical compound CNC.CC(O)=O QHNXEVRKFKHMRL-UHFFFAOYSA-N 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002635 electroconvulsive therapy Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 206010015037 epilepsy Diseases 0.000 description 1
- QCHWBGRKGNYJSM-UHFFFAOYSA-N ethene Chemical group C=C.C=C.C=C QCHWBGRKGNYJSM-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- IKXNIQJDNKPPCH-UHFFFAOYSA-N hydron;prop-2-yn-1-amine;chloride Chemical compound [Cl-].[NH3+]CC#C IKXNIQJDNKPPCH-UHFFFAOYSA-N 0.000 description 1
- 229940090411 ifex Drugs 0.000 description 1
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- YLGXILFCIXHCMC-JHGZEJCSSA-N methyl cellulose Chemical compound COC1C(OC)C(OC)C(COC)O[C@H]1O[C@H]1C(OC)C(OC)C(OC)OC1COC YLGXILFCIXHCMC-JHGZEJCSSA-N 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- OQUOOEBLAKQCOP-UHFFFAOYSA-N nitric acid;hexahydrate Chemical compound O.O.O.O.O.O.O[N+]([O-])=O OQUOOEBLAKQCOP-UHFFFAOYSA-N 0.000 description 1
- 238000013421 nuclear magnetic resonance imaging Methods 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- UXWLBSIELRUMEM-UHFFFAOYSA-L sodium hydrosulfite dihydrate Chemical compound O.O.[Na+].[Na+].[O-]S(=O)S([O-])=O UXWLBSIELRUMEM-UHFFFAOYSA-L 0.000 description 1
- 230000001148 spastic effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/08—Antiepileptics; Anticonvulsants
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D333/64—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Pharmacology & Pharmacy (AREA)
- Pain & Pain Management (AREA)
- Animal Behavior & Ethology (AREA)
- Biomedical Technology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Hydrogenated Pyridines (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Pens And Brushes (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Materials For Medical Uses (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792931010 DE2931010A1 (de) | 1979-07-31 | 1979-07-31 | Neue vinyloge carboxamide, diese enthaltende arzneimittel und verfahren zur herstellung |
| DE2931010 | 1979-07-31 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI802366A7 FI802366A7 (fi) | 1981-02-01 |
| FI71140B FI71140B (fi) | 1986-08-14 |
| FI71140C true FI71140C (fi) | 1986-11-24 |
Family
ID=6077239
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI802366A FI71140C (fi) | 1979-07-31 | 1980-07-29 | Foerfarande foer framstaellning av nya farmakologiskt vaerdefulla vinylena karboxamider |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4288437A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0025489B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5622778A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE4210T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU538685B2 (cg-RX-API-DMAC7.html) |
| DE (2) | DE2931010A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK151962C (cg-RX-API-DMAC7.html) |
| ES (5) | ES8106901A1 (cg-RX-API-DMAC7.html) |
| FI (1) | FI71140C (cg-RX-API-DMAC7.html) |
| HK (1) | HK50685A (cg-RX-API-DMAC7.html) |
| IE (1) | IE50076B1 (cg-RX-API-DMAC7.html) |
| IL (1) | IL60708A (cg-RX-API-DMAC7.html) |
| NO (1) | NO151501C (cg-RX-API-DMAC7.html) |
| SG (1) | SG385G (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA804643B (cg-RX-API-DMAC7.html) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3212752A1 (de) * | 1982-04-06 | 1983-10-13 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue vinyloge carboxamide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| WO2000018231A1 (en) * | 1998-09-25 | 2000-04-06 | Viropharma Incorporated | Methods for treating or preventing viral infections and associated diseases |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2356824A (en) * | 1941-05-01 | 1944-08-29 | Du Pont | Organic dyestuffs of the thionaphthenone series, and process of making the same |
| DE2258036A1 (de) * | 1972-11-27 | 1974-05-30 | Goedecke Ag | Verfahren zur herstellung von benzo eckige klammer auf b eckige klammer zu thiophen-derivaten |
| LU76757A1 (cg-RX-API-DMAC7.html) * | 1977-02-11 | 1978-10-18 |
-
1979
- 1979-07-31 DE DE19792931010 patent/DE2931010A1/de not_active Withdrawn
-
1980
- 1980-07-16 DE DE8080104136T patent/DE3064255D1/de not_active Expired
- 1980-07-16 AT AT80104136T patent/ATE4210T1/de not_active IP Right Cessation
- 1980-07-16 EP EP80104136A patent/EP0025489B1/de not_active Expired
- 1980-07-28 US US06/173,173 patent/US4288437A/en not_active Expired - Lifetime
- 1980-07-29 DK DK326180A patent/DK151962C/da not_active IP Right Cessation
- 1980-07-29 FI FI802366A patent/FI71140C/fi not_active IP Right Cessation
- 1980-07-30 ES ES493852A patent/ES8106901A1/es not_active Expired
- 1980-07-30 NO NO802292A patent/NO151501C/no unknown
- 1980-07-30 AU AU60930/80A patent/AU538685B2/en not_active Ceased
- 1980-07-30 IE IE1596/80A patent/IE50076B1/en not_active IP Right Cessation
- 1980-07-30 IL IL60708A patent/IL60708A/xx unknown
- 1980-07-31 JP JP10583980A patent/JPS5622778A/ja active Granted
- 1980-07-31 ZA ZA00804643A patent/ZA804643B/xx unknown
-
1981
- 1981-05-08 ES ES502013A patent/ES8202812A1/es not_active Expired
- 1981-05-08 ES ES502014A patent/ES8202813A1/es not_active Expired
- 1981-05-08 ES ES502015A patent/ES502015A0/es active Granted
- 1981-05-08 ES ES502016A patent/ES502016A0/es active Granted
-
1985
- 1985-01-03 SG SG3/85A patent/SG385G/en unknown
- 1985-07-04 HK HK506/85A patent/HK50685A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK151962B (da) | 1988-01-18 |
| ES493852A0 (es) | 1981-09-01 |
| DE3064255D1 (en) | 1983-08-25 |
| ES502013A0 (es) | 1982-03-01 |
| NO802292L (no) | 1981-02-02 |
| AU538685B2 (en) | 1984-08-23 |
| JPH0120155B2 (cg-RX-API-DMAC7.html) | 1989-04-14 |
| ES8202815A1 (es) | 1982-03-01 |
| EP0025489A1 (de) | 1981-03-25 |
| AU6093080A (en) | 1981-02-05 |
| ES8202814A1 (es) | 1982-03-01 |
| ZA804643B (en) | 1982-04-28 |
| NO151501C (no) | 1985-04-24 |
| ES8202812A1 (es) | 1982-03-01 |
| ES502014A0 (es) | 1982-03-01 |
| ES8106901A1 (es) | 1981-09-01 |
| IL60708A (en) | 1984-05-31 |
| FI71140B (fi) | 1986-08-14 |
| HK50685A (en) | 1985-07-12 |
| ES8202813A1 (es) | 1982-03-01 |
| US4288437A (en) | 1981-09-08 |
| ATE4210T1 (de) | 1983-08-15 |
| IE50076B1 (en) | 1986-02-05 |
| NO151501B (no) | 1985-01-07 |
| IE801596L (en) | 1981-01-31 |
| SG385G (en) | 1985-11-15 |
| FI802366A7 (fi) | 1981-02-01 |
| DE2931010A1 (de) | 1981-02-26 |
| ES502015A0 (es) | 1982-03-01 |
| DK151962C (da) | 1988-06-20 |
| ES502016A0 (es) | 1982-03-01 |
| DK326180A (da) | 1981-02-01 |
| EP0025489B1 (de) | 1983-07-20 |
| JPS5622778A (en) | 1981-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4313672B2 (ja) | 強力なcb1−拮抗活性を有する4,5−ジヒドロ−1h−ピラゾール誘導体 | |
| MXPA04009318A (es) | Derivados de quinolina y su uso como ligados 5-ht6. | |
| JP4176805B2 (ja) | 肥満の処置のためのピロール−3−カルボキサミド誘導体 | |
| EP1877364B1 (en) | Phenylacetylene derivatives having mglur5 receptor affinity | |
| Bunce et al. | Dihydrobenzoxazines and tetrahydroquinoxalines by a tandem reduction‐reductive amination reaction | |
| US5334720A (en) | Diphenyl-1-(aminoalkyl)-2-piperidinone and -2-pyrrolidinone derivatives having anticonvulsant properties | |
| Weinhardt et al. | Synthesis and antidepressant profiles of phenyl-substituted 2-amino-and 2-[(alkoxycarbonyl) amino]-1, 4, 5, 6-tetrahydropyrimidines | |
| EP0012866B1 (en) | New 3h-naphtho(1,2-d)imidazoles, processes for preparing them, compounds for use as antiinflammatory and antimicrobial agents and compositions for that use containing them | |
| CA2465680A1 (en) | Piperazine derivatives having sst1 antagonistic activity | |
| FI71140C (fi) | Foerfarande foer framstaellning av nya farmakologiskt vaerdefulla vinylena karboxamider | |
| FI68395B (fi) | Foerfarande foer framstaellning av farmakologiskt verksamma trazolfoereningar | |
| HUP0004855A2 (hu) | Eljárás kinolinszármazékok előállítására és az eljárás intermedierjei | |
| US4975431A (en) | Certain anti-inflammatory cyclohepta[b]pyridines and analogs thereof | |
| US5051516A (en) | Benzodiazepine compounds and their use as pharmaceuticals | |
| MXPA05007387A (es) | Proceso de ciclizacion para derivados de benzotiazol sustituidos. | |
| JP2001503399A (ja) | 抗腫瘍剤としてのビス(アクリジンカルボキサミド)及びビス(フェナジンカルボキサミド) | |
| EP0278090B1 (en) | 2-Aminoacetamide pyridinyl derivatives | |
| Corral et al. | Synthesis of 10‐(4‐methyl‐1‐piperazinyl) thieno [3, 2‐b][1, 5] benzoxazepines | |
| US4927970A (en) | Substituted 3-cyclobutene-1,2-dione intermediates | |
| IE894027L (en) | New compounds derived from indane, their preparation process¹and intermediates, their use as medicaments and the¹pharmaceutical compositions containing them | |
| FI66872B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara tino(3,2-c)- och tieno(2,3-c)pyridinderivat | |
| US5432284A (en) | Process for the preparation of heterocyclic alkylamide derivatives | |
| JPH0649671B2 (ja) | アニリン類とその製造方法 | |
| TWI261590B (en) | C-6 ring-substituted pyrido [1,2-a]benzimidazole derivatives useful in treating central nervous system disorders | |
| FI74004C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara piperazinylpyrido/2,3-b/- och -/3,4-b/ pyrazinderivat. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: DR. KARL THOMAE GESELLSCHAFT MIT |