FI71124C - Nya derivat av 2,4,6-trijodisoftalsyra foerfarande foer framstaellning av dessa samt roentgenkontrastmedel innehaollande desamma - Google Patents
Nya derivat av 2,4,6-trijodisoftalsyra foerfarande foer framstaellning av dessa samt roentgenkontrastmedel innehaollande desamma Download PDFInfo
- Publication number
- FI71124C FI71124C FI802373A FI802373A FI71124C FI 71124 C FI71124 C FI 71124C FI 802373 A FI802373 A FI 802373A FI 802373 A FI802373 A FI 802373A FI 71124 C FI71124 C FI 71124C
- Authority
- FI
- Finland
- Prior art keywords
- alkyl
- triiodoisophthalic acid
- acid bis
- methyl
- hydroxyacylamino
- Prior art date
Links
- 101100148710 Clarkia breweri SAMT gene Proteins 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 36
- 239000002872 contrast media Substances 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 11
- -1 2, 3-dihydroxypropyl Chemical group 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 9
- NJKDOADNQSYQEV-UHFFFAOYSA-N iomeprol Chemical group OCC(=O)N(C)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I NJKDOADNQSYQEV-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- VIBQOTCUBQEVDQ-UHFFFAOYSA-N CN(C=1C(=C(C(=C(C(=O)O)C1I)I)C(=O)O)I)C(C(C)O)=O Chemical group CN(C=1C(=C(C(=C(C(=O)O)C1I)I)C(=O)O)I)C(C(C)O)=O VIBQOTCUBQEVDQ-UHFFFAOYSA-N 0.000 claims description 3
- 239000002168 alkylating agent Substances 0.000 claims description 3
- 229940100198 alkylating agent Drugs 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229940039231 contrast media Drugs 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- 239000000243 solution Substances 0.000 description 40
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000003480 eluent Substances 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 229920001429 chelating resin Polymers 0.000 description 9
- 229910052740 iodine Inorganic materials 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- 229940126062 Compound A Drugs 0.000 description 7
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 6
- ZPJJDGLVOWPGAN-UHFFFAOYSA-N 1-n,3-n-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxamide Chemical compound OCC(O)CNC(=O)C1=C(I)C(NC(=O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I ZPJJDGLVOWPGAN-UHFFFAOYSA-N 0.000 description 6
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 6
- GOCIYSIBXXQUAW-REOHCLBHSA-N 5-[[(2s)-2-hydroxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound C[C@H](O)C(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I GOCIYSIBXXQUAW-REOHCLBHSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 6
- 238000002347 injection Methods 0.000 description 6
- 239000007924 injection Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000005325 percolation Methods 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 5
- 239000003957 anion exchange resin Substances 0.000 description 5
- 239000003729 cation exchange resin Substances 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 235000002639 sodium chloride Nutrition 0.000 description 5
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 5
- DTZMSDADRKLCQE-RFMXWLSYSA-N 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodo-n-[(2r,3r,4s,5r)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]benzamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)=C1I DTZMSDADRKLCQE-RFMXWLSYSA-N 0.000 description 4
- VIBQOTCUBQEVDQ-VKHMYHEASA-N 5-[[(2S)-2-hydroxypropanoyl]-methylamino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CN(C=1C(=C(C(=C(C(=O)O)C=1I)I)C(=O)O)I)C([C@H](C)O)=O VIBQOTCUBQEVDQ-VKHMYHEASA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- XBGORFMDWCSNJY-BYPYZUCNSA-N [(2S)-1-(3,5-dicarbonochloridoyl-2,4,6-triiodo-N-methylanilino)-1-oxopropan-2-yl] acetate Chemical compound CN(C=1C(=C(C(=C(C(=O)Cl)C=1I)I)C(=O)Cl)I)C([C@H](C)OC(C)=O)=O XBGORFMDWCSNJY-BYPYZUCNSA-N 0.000 description 4
- LBJFPMPSYBLNHA-UHFFFAOYSA-N [2-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-2-oxoethyl] propanoate Chemical compound CCC(=O)OCC(=O)NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I LBJFPMPSYBLNHA-UHFFFAOYSA-N 0.000 description 4
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000012154 double-distilled water Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 230000003301 hydrolyzing effect Effects 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- XQZXYNRDCRIARQ-LURJTMIESA-N iopamidol Chemical compound C[C@H](O)C(=O)NC1=C(I)C(C(=O)NC(CO)CO)=C(I)C(C(=O)NC(CO)CO)=C1I XQZXYNRDCRIARQ-LURJTMIESA-N 0.000 description 4
- 229960004647 iopamidol Drugs 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- NBULJIWTSVFPLA-UHFFFAOYSA-N 5-[(2-hydroxyacetyl)-methylamino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CN(C=1C(=C(C(=C(C(=O)O)C=1I)I)C(=O)O)I)C(CO)=O NBULJIWTSVFPLA-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000002583 angiography Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000003384 imaging method Methods 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- HZDNNJABYXNPPV-UHFFFAOYSA-N (2-chloro-2-oxoethyl) acetate Chemical compound CC(=O)OCC(Cl)=O HZDNNJABYXNPPV-UHFFFAOYSA-N 0.000 description 2
- HGBUAVOFAPHRCF-UEJVZZJDSA-N 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[[(2S)-2-hydroxypropanoyl]-methylamino]-2,4,6-triiodobenzene-1,3-dicarboxamide Chemical compound OC(CNC(C1=C(C(C(=O)NCC(CO)O)=C(C(=C1I)N(C)C([C@H](C)O)=O)I)I)=O)CO HGBUAVOFAPHRCF-UEJVZZJDSA-N 0.000 description 2
- TZEBLZRSPJJCOS-UHFFFAOYSA-N 2,4,6-triiodo-5-(methylamino)benzene-1,3-dicarbonyl chloride Chemical compound CNC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I TZEBLZRSPJJCOS-UHFFFAOYSA-N 0.000 description 2
- WBJREMGRYVPNKY-UHFFFAOYSA-N 2,4,6-triiodo-5-(methylamino)benzene-1,3-dicarboxylic acid Chemical compound CNC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I WBJREMGRYVPNKY-UHFFFAOYSA-N 0.000 description 2
- GHRHOOSJOUMRNE-UHFFFAOYSA-N 5-[(2-acetyloxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CC(=O)OCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I GHRHOOSJOUMRNE-UHFFFAOYSA-N 0.000 description 2
- NBHYSCZJHBGHBW-UHFFFAOYSA-N 5-[(2-hydroxyacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I NBHYSCZJHBGHBW-UHFFFAOYSA-N 0.000 description 2
- GIVSYLRJVDIHAA-YFKPBYRVSA-N 5-[[(2S)-2-hydroxypropanoyl]-propylamino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound C(CC)N(C=1C(=C(C(=C(C(=O)O)C=1I)I)C(=O)O)I)C([C@H](C)O)=O GIVSYLRJVDIHAA-YFKPBYRVSA-N 0.000 description 2
- KCJKAFLKXGASBH-LURJTMIESA-N 5-[butyl-[(2S)-2-hydroxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound C(CCC)N(C=1C(=C(C(=C(C(=O)O)C=1I)I)C(=O)O)I)C([C@H](C)O)=O KCJKAFLKXGASBH-LURJTMIESA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- PQZLQOGLMSANKA-UHFFFAOYSA-N [2-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-2-oxoethyl] acetate Chemical compound CC(=O)OCC(=O)NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I PQZLQOGLMSANKA-UHFFFAOYSA-N 0.000 description 2
- 230000003187 abdominal effect Effects 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000002591 computed tomography Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 229940102396 methyl bromide Drugs 0.000 description 2
- 229960000554 metrizamide Drugs 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000009608 myelography Methods 0.000 description 2
- DNWSSZXZTVMPKC-UHFFFAOYSA-N n,n-dihydroxypropan-1-amine Chemical compound CCCN(O)O DNWSSZXZTVMPKC-UHFFFAOYSA-N 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 229960000281 trometamol Drugs 0.000 description 2
- 238000007487 urography Methods 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- CJTNLEQLKKYLFO-UHFFFAOYSA-N 1-butoxyethanol Chemical compound CCCCOC(C)O CJTNLEQLKKYLFO-UHFFFAOYSA-N 0.000 description 1
- IPHVGAPABXWWLO-UHFFFAOYSA-N 2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical class OC(=O)C1=C(I)C=C(I)C(C(O)=O)=C1I IPHVGAPABXWWLO-UHFFFAOYSA-N 0.000 description 1
- AHXADOAHIKYQRT-UHFFFAOYSA-N 2,5-dimethylheptan-4-one Chemical compound CCC(C)C(=O)CC(C)C AHXADOAHIKYQRT-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- FATSNIKFBPFWFS-UHFFFAOYSA-N 3-acetamidooxycarbonyl-5-hydroxy-2,4,6-triiodobenzoic acid Chemical compound OC=1C(=C(C(=C(C(=O)ONC(C)=O)C=1I)I)C(=O)O)I FATSNIKFBPFWFS-UHFFFAOYSA-N 0.000 description 1
- DLTCLUPPEMEAGB-UHFFFAOYSA-N 3-carbamoyl-2,4,6-triiodobenzoic acid Chemical class NC(=O)C1=C(I)C=C(I)C(C(O)=O)=C1I DLTCLUPPEMEAGB-UHFFFAOYSA-N 0.000 description 1
- IHSZCCUYQVZZHJ-UHFFFAOYSA-N 3-carbamoyl-2,5,6-triiodobenzoic acid Chemical class NC(=O)C1=CC(I)=C(I)C(C(O)=O)=C1I IHSZCCUYQVZZHJ-UHFFFAOYSA-N 0.000 description 1
- GOCIYSIBXXQUAW-UHFFFAOYSA-N 5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CC(O)C(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I GOCIYSIBXXQUAW-UHFFFAOYSA-N 0.000 description 1
- KNAYQMYLLAWLBR-BYPYZUCNSA-N 5-[ethyl-[(2S)-2-hydroxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound C(C)N(C=1C(=C(C(=C(C(=O)O)C=1I)I)C(=O)O)I)C([C@H](C)O)=O KNAYQMYLLAWLBR-BYPYZUCNSA-N 0.000 description 1
- BHCBLTRDEYPMFZ-UHFFFAOYSA-N 5-acetamido-1-n,3-n-bis(2,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide Chemical compound CC(=O)NC1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I BHCBLTRDEYPMFZ-UHFFFAOYSA-N 0.000 description 1
- FBJVWRITWDYUAC-UHFFFAOYSA-N 5-amino-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I FBJVWRITWDYUAC-UHFFFAOYSA-N 0.000 description 1
- JEZJSNULLBSYHV-UHFFFAOYSA-N 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I JEZJSNULLBSYHV-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- ZDQIBZMWWMDIAQ-UHFFFAOYSA-N C(C)N(C=1C(=C(C(=C(C(=O)O)C1I)I)C(=O)O)I)C(CO)=O Chemical compound C(C)N(C=1C(=C(C(=C(C(=O)O)C1I)I)C(=O)O)I)C(CO)=O ZDQIBZMWWMDIAQ-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- XTMPEFJBZXPROI-UHFFFAOYSA-N OCC(=O)C=1C(=C(C(=C(C(=O)O)C1I)I)C(=O)O)I Chemical compound OCC(=O)C=1C(=C(C(=C(C(=O)O)C1I)I)C(=O)O)I XTMPEFJBZXPROI-UHFFFAOYSA-N 0.000 description 1
- QAPAIXREGONXHN-UHFFFAOYSA-N [2-[3,5-bis(2,3-dihydroxypropylcarbamoyl)-2,4,6-triiodoanilino]-2-oxoethyl] acetate Chemical compound CC(=O)OCC(=O)NC1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I QAPAIXREGONXHN-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 238000002584 aortography Methods 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 150000001720 carbohydrates Chemical group 0.000 description 1
- 238000013155 cardiography Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000002585 cerebral angiography Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 125000000350 glycoloyl group Chemical group O=C([*])C([H])([H])O[H] 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- SIGPWCVHTYIKME-UHFFFAOYSA-N hexamethanol Chemical compound OC.OC.OC.OC.OC.OC SIGPWCVHTYIKME-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- AZVCGYPLLBEUNV-UHFFFAOYSA-N lithium;ethanolate Chemical compound [Li+].CC[O-] AZVCGYPLLBEUNV-UHFFFAOYSA-N 0.000 description 1
- 238000002587 lymphangiography Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- IZXGZAJMDLJLMF-UHFFFAOYSA-N methylaminomethanol Chemical compound CNCO IZXGZAJMDLJLMF-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 230000002276 neurotropic effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 1
- 210000000115 thoracic cavity Anatomy 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/28—Radicals substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Polyamides (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2502679 | 1979-08-09 | ||
| IT25026/79A IT1193211B (it) | 1979-08-09 | 1979-08-09 | Derivati dell'acido 2,4,6-triiodo-isoftalico,metodo per la loro preparazione e mezzi di contrasto che li contengono |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI802373A7 FI802373A7 (fi) | 1981-02-10 |
| FI71124B FI71124B (fi) | 1986-08-14 |
| FI71124C true FI71124C (fi) | 1986-11-24 |
Family
ID=11215461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI802373A FI71124C (fi) | 1979-08-09 | 1980-07-29 | Nya derivat av 2,4,6-trijodisoftalsyra foerfarande foer framstaellning av dessa samt roentgenkontrastmedel innehaollande desamma |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4352788A (da) |
| EP (1) | EP0026281B1 (da) |
| JP (1) | JPS5827264B2 (da) |
| AR (2) | AR225773A1 (da) |
| AT (1) | ATE1995T1 (da) |
| AU (1) | AU541428B2 (da) |
| CA (1) | CA1128065A (da) |
| DE (1) | DE3061347D1 (da) |
| DK (1) | DK158659C (da) |
| ES (1) | ES8106696A1 (da) |
| FI (1) | FI71124C (da) |
| IE (1) | IE50149B1 (da) |
| IT (1) | IT1193211B (da) |
| MX (1) | MX9202639A (da) |
| NL (1) | NL940024I2 (da) |
| NO (1) | NO150154C (da) |
| PL (2) | PL123167B1 (da) |
| PT (1) | PT71682B (da) |
| YU (1) | YU42352B (da) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56127373A (en) * | 1980-01-31 | 1981-10-06 | Univ California | Novel amino-dioxepane intermediate for synthesizing novel nonionic contrast agent |
| DE3038853A1 (de) * | 1980-10-10 | 1982-05-27 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue n-hydroxy-alkylierte dicarbonsaeure-bis-(3,5-dicarbamoyl-2,4,6-trijodanilide), deren herstellung und diese enthaltende roentgenkonstrastmittel (ii) |
| DE3150917A1 (de) * | 1981-12-18 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | "2-amino-1-(1,3-dioxolan-4-yl)-ethanol-verbindungen, deren herstellung und verwendung zur weiterverarbeitung" |
| DE3150916A1 (de) * | 1981-12-18 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | N-hydroxyaethylierte 2,4,6-trijodaminoisiophthalsaeure-bis- trihydroxybutylamide, deren herstellung und diese enthaltende roentgenkontrastmittel" |
| US4396598A (en) * | 1982-01-11 | 1983-08-02 | Mallinckrodt, Inc. | Triiodoisophthalamide X-ray contrast agent |
| US5204086A (en) * | 1982-10-01 | 1993-04-20 | Nycomed Imaging As | X-ray contrast agent |
| US4584401A (en) * | 1983-10-20 | 1986-04-22 | Biophysica Foundation | Methods and compositions involving polyhydroxylated polyiodo non-ionic contrast media |
| JPH0813794B2 (ja) * | 1985-08-09 | 1996-02-14 | クツク イマジング，インコ−ポレイテイド | イオン性コントラスト媒体からの非イオン性ポリオ−ルコントラスト媒体 |
| AU618535B2 (en) * | 1987-05-22 | 1992-01-02 | Bracco International B.V. | Preparation of 5-acylamino-2,4,6-triiodo-or tribromo-benzoic acid derivatives |
| US5614638A (en) * | 1989-11-29 | 1997-03-25 | Bracco International B.V. | Nonionic radiographic contrast agents |
| US5869024A (en) * | 1989-11-29 | 1999-02-09 | Bracco International B.V. | Methods and compositions for using non-ionic contrast agents to reduce the risk of clot formation in diagnostic procedures |
| CA2029830A1 (en) * | 1989-11-29 | 1991-05-30 | Ramachandran S. Ranganathan | Nonionic radiographic contrast agents |
| US5075502A (en) * | 1989-12-13 | 1991-12-24 | Mallinckrodt, Inc. | Nonionic x-ray contrast agents, compositions and methods |
| US5019371A (en) * | 1990-11-21 | 1991-05-28 | Mallinckrodt Medical, Inc. | Novel x-ray contrast agents, compositions and methods |
| US5527926A (en) * | 1990-11-26 | 1996-06-18 | Bracco International B.V. | Methods and compositions for using non-ionic contrast agents to reduce the risk of clot formation in diagnostic procedures |
| IT1248741B (it) * | 1991-02-26 | 1995-01-26 | Bracco Spa | Processo di concentrazione e di purificazione di composti organici |
| US5356613A (en) * | 1991-03-18 | 1994-10-18 | Mallinckrodt Medical, Inc. | X-ray contrast agents, compositions and methods |
| US5278311A (en) * | 1992-06-05 | 1994-01-11 | E. R. Squibb & Sons, Inc. | Nonionic radiographic contrast agents |
| IL110391A (en) * | 1993-07-30 | 1998-12-06 | Zambon Spa | Process for the crystallization of iopamidol |
| IT1274027B (it) * | 1994-03-03 | 1997-07-14 | Zambon Spa | Processo per la preparazione e purificazione di mezzi di contrasto iodurati |
| US6310243B1 (en) * | 1994-09-23 | 2001-10-30 | Nycomed Imaging As | Iodinated x-ray contrast media |
| IT1271107B (it) * | 1994-11-29 | 1997-05-26 | Zambon Spa | Processo per la preparazione di un intermedio utile nella sintesi di composti organici |
| DE19510864A1 (de) * | 1995-03-16 | 1996-09-19 | Schering Ag | Röntgenkontrastmittel für die Computertomographie und Urographie |
| IT1275429B (it) * | 1995-05-18 | 1997-08-07 | Zambon Spa | Processo per la preparazione di un intermedio utile nella sintesi di composti organici |
| CA2195636C (en) * | 1995-05-23 | 2007-10-30 | Marina Mauro | Process for the preparation of a dicarboxylic acid dichloride |
| IT1288114B1 (it) * | 1996-06-13 | 1998-09-10 | Fructamine Spa | Processo per la purificazione di un intermedio |
| IT1292127B1 (it) * | 1997-06-11 | 1999-01-25 | Bracco Spa | Processo per la dissalazione di sostanze instabili a ph acidi |
| US6723746B2 (en) * | 1998-09-08 | 2004-04-20 | Veritas Pharmaceuticals, Inc. | Functional radiographic imaging methods and agents |
| US6751290B2 (en) | 1998-09-08 | 2004-06-15 | Veritas Pharmaceuticals, Inc. | Radiographic assessment of tissue after exposure to a compound |
| US20040170561A1 (en) * | 1998-09-08 | 2004-09-02 | Jesse Salb | Functional radiographic imaging methods and agents |
| US20010038682A1 (en) * | 1998-09-08 | 2001-11-08 | Jesse Salb | Radiographic assessment of tissue response to compounds |
| US6226352B1 (en) * | 1998-09-08 | 2001-05-01 | Veritas Pharmaceuticals, Inc. | System and method for radiographic imaging of tissue |
| US6803485B2 (en) * | 1999-02-26 | 2004-10-12 | Bracco Imaging S.P.A. | Process for the preparation of iopamidol |
| US6660248B2 (en) | 2000-11-10 | 2003-12-09 | William Marsh Rice University | Fullerene (C60)-based X-ray contrast agent for diagnostic imaging |
| IT1319671B1 (it) * | 2000-12-01 | 2003-10-23 | Bracco Spa | Processo per la preparazione di (s)-n,n'-bis(2-idrossi-1-(idrossimetil)etil)-5-((2-idrossi-1-ossopropil)ammino) |
| WO2006074809A2 (en) | 2005-01-13 | 2006-07-20 | Cinvention Ag | Composite materials containing carbon nanoparticles |
| EP2104473A1 (en) * | 2007-01-19 | 2009-09-30 | Cinvention Ag | Porous, non-degradable implant made by powder molding |
| US7955234B1 (en) | 2007-02-28 | 2011-06-07 | Pursley Michael G | Exercise device and method |
| US20080206862A1 (en) * | 2007-02-28 | 2008-08-28 | Cinvention Ag | High surface cultivation system bag |
| BRPI0807993A2 (pt) * | 2007-02-28 | 2014-06-17 | Cinv Ag | Sistema de cultivo de alta superfície. |
| DE102007058220A1 (de) | 2007-12-03 | 2009-06-04 | Bayer Schering Pharma Aktiengesellschaft | Dimere macrocyclisch substituierte Benzolderivate |
| JP2012514622A (ja) | 2009-01-09 | 2012-06-28 | ジーイー・ヘルスケア・アクスイェ・セルスカプ | 造影製剤組成物 |
| EP2243767A1 (en) | 2009-04-21 | 2010-10-27 | Bracco Imaging S.p.A | Process for the iodination of aromatic compounds |
| WO2012136813A2 (en) | 2011-04-07 | 2012-10-11 | Universitetet I Oslo | Agents for medical radar diagnosis |
| CN102363600B (zh) * | 2011-10-24 | 2013-07-17 | 江苏省原子医学研究所 | 一种碘美普尔的制备方法 |
| DE102012109481A1 (de) | 2012-10-05 | 2014-04-10 | Faro Technologies, Inc. | Vorrichtung zum optischen Abtasten und Vermessen einer Umgebung |
| US10067231B2 (en) | 2012-10-05 | 2018-09-04 | Faro Technologies, Inc. | Registration calculation of three-dimensional scanner data performed between scans based on measurements by two-dimensional scanner |
| PT108524B (pt) | 2015-06-02 | 2017-12-15 | Hovione Farmaciência S A | Processo para a preparação de intermediários úteis na preparação de agentes de contraste não-iónicos |
| CN106316878B (zh) * | 2015-06-15 | 2018-01-19 | 重庆常捷医药有限公司 | 一种碘美普尔杂质的制备方法 |
| US10836710B2 (en) | 2016-12-05 | 2020-11-17 | Bracco Imaging Spa | Mechanochemical synthesis of radiographic agents intermediates |
| CN107253918A (zh) * | 2017-07-27 | 2017-10-17 | 成都丽璟科技有限公司 | 一种制备碘美普尔的新方法 |
| KR102128423B1 (ko) * | 2018-09-17 | 2020-07-01 | (주)유케이케미팜 | 조영제 이오메프롤의 제조방법 |
| CN116354842B (zh) * | 2021-12-20 | 2024-12-03 | 重庆圣华曦药业股份有限公司 | 一种改进的碘美普尔制备方法及其在制剂中的应用 |
| US20250051267A1 (en) | 2021-12-20 | 2025-02-13 | Bracco Imaging S.P.A. | Process for the preparation of 2,4,6-triiodoisophthalic bisamides |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE344166B (da) * | 1966-12-13 | 1972-04-04 | Pharmacia Ab | |
| SE315975B (da) * | 1967-12-28 | 1969-10-13 | Pharmacia Ab | |
| ES381202A1 (es) * | 1969-06-27 | 1973-04-16 | Nyegaard & Co As | Un procedimiento para la preparacion de agentes de contras-te de rayos x. |
| US3886859A (en) * | 1974-04-26 | 1975-06-03 | Gen Electric | Compactor brake |
| CH616403A5 (en) * | 1975-10-29 | 1980-03-31 | Bracco Ind Chimica Spa | Process for the preparation of 2,4,6-triodoisophthalamides which are readily soluble in water. |
| GB1548594A (en) * | 1976-06-11 | 1979-07-18 | Nyegaard & Co As | Triiodoisophthalic acid amides |
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
| DE2909439A1 (de) * | 1979-03-08 | 1980-09-18 | Schering Ag | Neue nichtionische roentgenkontrastmittel |
-
1979
- 1979-08-09 IT IT25026/79A patent/IT1193211B/it active Protection Beyond IP Right Term
-
1980
- 1980-07-18 AT AT80104243T patent/ATE1995T1/de active
- 1980-07-18 DE DE8080104243T patent/DE3061347D1/de not_active Expired
- 1980-07-18 EP EP80104243A patent/EP0026281B1/de not_active Expired
- 1980-07-18 AU AU60616/80A patent/AU541428B2/en not_active Expired
- 1980-07-24 CA CA356,889A patent/CA1128065A/en not_active Expired
- 1980-07-29 FI FI802373A patent/FI71124C/fi not_active IP Right Cessation
- 1980-07-30 US US06/173,698 patent/US4352788A/en not_active Expired - Lifetime
- 1980-08-08 PL PL1980226143A patent/PL123167B1/pl unknown
- 1980-08-08 JP JP55108377A patent/JPS5827264B2/ja not_active Expired
- 1980-08-08 NO NO802373A patent/NO150154C/no unknown
- 1980-08-08 YU YU2011/80A patent/YU42352B/xx unknown
- 1980-08-08 DK DK343980A patent/DK158659C/da not_active IP Right Cessation
- 1980-08-08 IE IE1684/80A patent/IE50149B1/en not_active IP Right Cessation
- 1980-08-08 ES ES494076A patent/ES8106696A1/es not_active Expired
- 1980-08-08 AR AR282095A patent/AR225773A1/es active
- 1980-08-08 PL PL1980231658A patent/PL126118B1/pl unknown
- 1980-08-08 PT PT71682A patent/PT71682B/pt unknown
-
1981
- 1981-09-23 AR AR286853A patent/AR225836A1/es active
-
1992
- 1992-06-03 MX MX9202639A patent/MX9202639A/es unknown
-
1994
- 1994-12-06 NL NL940024C patent/NL940024I2/nl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL123167B1 (en) | 1982-09-30 |
| EP0026281A1 (de) | 1981-04-08 |
| EP0026281B1 (de) | 1982-12-15 |
| JPS5629553A (en) | 1981-03-24 |
| US4352788A (en) | 1982-10-05 |
| IE50149B1 (en) | 1986-02-19 |
| ATE1995T1 (de) | 1982-12-15 |
| PL226143A1 (da) | 1981-05-08 |
| DK158659B (da) | 1990-07-02 |
| IT7925026A0 (it) | 1979-08-09 |
| DE3061347D1 (en) | 1983-01-20 |
| NO150154B (no) | 1984-05-21 |
| IE801684L (en) | 1981-02-09 |
| CA1128065A (en) | 1982-07-20 |
| DK343980A (da) | 1981-02-10 |
| NL940024I1 (nl) | 1995-01-16 |
| PT71682B (en) | 1981-06-15 |
| MX9202639A (es) | 1992-06-30 |
| AU541428B2 (en) | 1985-01-10 |
| ES494076A0 (es) | 1981-09-01 |
| PL126118B1 (en) | 1983-07-30 |
| JPS5827264B2 (ja) | 1983-06-08 |
| YU201180A (en) | 1983-02-28 |
| NO802373L (no) | 1981-02-10 |
| FI802373A7 (fi) | 1981-02-10 |
| IT1193211B (it) | 1988-06-15 |
| NL940024I2 (nl) | 1999-06-01 |
| AU6061680A (en) | 1981-02-12 |
| ES8106696A1 (es) | 1981-09-01 |
| PT71682A (en) | 1980-09-01 |
| DK158659C (da) | 1991-01-21 |
| FI71124B (fi) | 1986-08-14 |
| AR225836A1 (es) | 1982-04-30 |
| NO150154C (no) | 1984-08-29 |
| YU42352B (en) | 1988-08-31 |
| AR225773A1 (es) | 1982-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI71124C (fi) | Nya derivat av 2,4,6-trijodisoftalsyra foerfarande foer framstaellning av dessa samt roentgenkontrastmedel innehaollande desamma | |
| FI73200B (fi) | Nya derivat av 2,4,6-trijodisoftalsyra, foerfarande foer framstaellning av dessa samt roentgenkontrastmedel innehaollande desamma. | |
| US4139605A (en) | Water-soluble, non-ionizing, radiopaque compounds and contrast compositions containing the same | |
| US3702866A (en) | Novel 3,5 - bis-acylamido - 2,4,6-triiodobenzoic acids and 5-acylamido-2,4,6-triiodoisophthalamic acids | |
| US4001323A (en) | Water-soluble, non-ionizing hydroxy-containing amide derivatives of 2,4,6-triiodo-isophthalic acid | |
| US4426371A (en) | Novel N-hydroxyalkylated dicarboxylic acid bis(3,5-dicarbamoyl-2,4,6-triiodoanilides), as X-ray contrast media | |
| AU646119B2 (en) | 1,3-bis-(3-(mono- or poly-hydroxy)acylamino-5-(mono- or poly-hydroxyalkyl)aminocarbonyl-2,4,6-triiodo-benzoyl-amino) -hydroxy- or hydroxyalkyl-propanes, their methods of preparation and X-ray contrast media containing them | |
| CA2200753A1 (en) | Iodinated x-ray contrast media | |
| CN116813493A (zh) | 一种脂质化合物及基于其的脂质载体、核酸脂质纳米粒组合物和药物制剂 | |
| EP0096870B1 (en) | Ester of metronidazole with n,n-dimethylglycine and acid addition salt thereof | |
| AU654952B2 (en) | Novel X-ray contrast agents, compositions and methods | |
| US3574718A (en) | Method for producing x-ray contrast agents | |
| FI93209B (fi) | Substituoituja dikarboksyylihappo-bis(3,5-dikarbamoyyli-2,4,6-trijodianilideja) menetelmä niiden valmistamiseksi sekä niiden käyttö röntgenvarjoaineiden valmistamiseksi | |
| US5851511A (en) | Polyiodo compounds, their preparation and their use in X-ray radiology | |
| AU612510B2 (en) | Nonionic x-ray contrast agents, compositions and methods | |
| CS277109B6 (en) | Nonionic contrast means and process for preparing thereof | |
| RU1829940C (ru) | Способ получени инъектируемой контрастной среды | |
| JPH0433786B2 (da) | ||
| EP0647618B1 (en) | New non ionic iodine-containing dimers useful as x-ray contrast agents, method for the preparation thereof, and galenical compositions containing them | |
| SI8610621A8 (en) | New bis-(hydroxyalkyl-amides) 5-(n-alkyl-alpha-hydroxyacylamino) -2,4,6-threeiodine-isophthalic acid and process for their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC | Transfer of assignment of patent |
Owner name: BRACCO INTERNATIONAL B.V. |
|
| ND | Supplementary protection certificate (spc) granted | ||
| SPCG | Supplementary protection certificate granted |
Spc suppl protection certif: L91 Extension date: 20050729 |
|
| MA | Patent expired |
Owner name: BRACCO INTERNATIONAL B.V. |