FI66395C - 3-acetoxi-9alfa 11beta-epoxipregna-1,3,5-triener och motsvarande 3,5-diener anvaendbara som mellanprodukt vid framstaellning av 6alfa-halogen substituerade pregna-1,4-dien-3-oner ochpregn-4-en-3-oner och ett foerfarande foer framstaellning a dessa mellanprodukter - Google Patents
3-acetoxi-9alfa 11beta-epoxipregna-1,3,5-triener och motsvarande 3,5-diener anvaendbara som mellanprodukt vid framstaellning av 6alfa-halogen substituerade pregna-1,4-dien-3-oner ochpregn-4-en-3-oner och ett foerfarande foer framstaellning a dessa mellanprodukter Download PDFInfo
- Publication number
- FI66395C FI66395C FI791124A FI791124A FI66395C FI 66395 C FI66395 C FI 66395C FI 791124 A FI791124 A FI 791124A FI 791124 A FI791124 A FI 791124A FI 66395 C FI66395 C FI 66395C
- Authority
- FI
- Finland
- Prior art keywords
- epoxy
- pregna
- och
- faring
- oner
- Prior art date
Links
- 229910052736 halogen Inorganic materials 0.000 title description 10
- 150000001875 compounds Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- SNHKWZAAMYPZLN-NWSAAYAGSA-N (8s,9s,10r,13r,14s,17s)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one Chemical class C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](CC)[C@@]1(C)CC2 SNHKWZAAMYPZLN-NWSAAYAGSA-N 0.000 claims description 4
- 239000000543 intermediate Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 8
- 150000003431 steroids Chemical class 0.000 description 8
- -1 enol acetate Chemical class 0.000 description 7
- XHFXMNZYIKFCPN-UHFFFAOYSA-N perchloryl fluoride Chemical compound FCl(=O)(=O)=O XHFXMNZYIKFCPN-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 4
- 150000003122 pregn-4-en-3-ones Chemical class 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000004593 Epoxy Substances 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000021736 acetylation Effects 0.000 description 3
- 238000006640 acetylation reaction Methods 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000003246 corticosteroid Substances 0.000 description 3
- 229960001334 corticosteroids Drugs 0.000 description 3
- 125000003700 epoxy group Chemical group 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- MYYIMZRZXIQBGI-HVIRSNARSA-N 6alpha-Fluoroprednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3C[C@H](F)C2=C1 MYYIMZRZXIQBGI-HVIRSNARSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- LRJOMUJRLNCICJ-JZYPGELDSA-N Prednisolone acetate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)COC(=O)C)(O)[C@@]1(C)C[C@@H]2O LRJOMUJRLNCICJ-JZYPGELDSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- WEGNFRKBIKYVLC-XTLNBZDDSA-N flunisolide acetate Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2C[C@H]3OC(C)(C)O[C@@]3(C(=O)COC(=O)C)[C@@]2(C)C[C@@H]1O WEGNFRKBIKYVLC-XTLNBZDDSA-N 0.000 description 2
- 229960000618 fluprednisolone Drugs 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229960002800 prednisolone acetate Drugs 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- YJPJZKLBGREORN-XFNMXBBLSA-N 9β,11β-epoxy-3,17,21-triacetoxy-pregna-1,3,5-trien-20-one Chemical compound C1C=C2C=C(OC(C)=O)C=C[C@]2(C)[C@]23[C@@H]1[C@@H]1CC[C@](OC(C)=O)(C(=O)COC(=O)C)[C@@]1(C)C[C@@H]3O2 YJPJZKLBGREORN-XFNMXBBLSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- YNFXRELIVDKQGV-AYHYENMDSA-N CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC3[C@H]4[C@H]2CC=C5[C@@]4(C=CC(=C5)O3)C)C Chemical compound CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC3[C@H]4[C@H]2CC=C5[C@@]4(C=CC(=C5)O3)C)C YNFXRELIVDKQGV-AYHYENMDSA-N 0.000 description 1
- QWOJMRHUQHTCJG-UHFFFAOYSA-N CC([CH2-])=O Chemical compound CC([CH2-])=O QWOJMRHUQHTCJG-UHFFFAOYSA-N 0.000 description 1
- 238000007181 Dienone-phenol rearrangement reaction Methods 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- POPFMWWJOGLOIF-XWCQMRHXSA-N Flurandrenolide Chemical compound C1([C@@H](F)C2)=CC(=O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]2(C)C[C@@H]1O POPFMWWJOGLOIF-XWCQMRHXSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- HPAKILCZTKWIFK-JZTHCNPZSA-N [2-[(8r,9s,10r,13s,14s,17r)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1h-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)COC(=O)C)(O)[C@@]1(C)CC2 HPAKILCZTKWIFK-JZTHCNPZSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- AOCFUSWYTDSCEV-UHFFFAOYSA-N acetic acid;propan-2-one Chemical compound CC(C)=O.CC(O)=O.CC(O)=O AOCFUSWYTDSCEV-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229950006229 chloroprednisone Drugs 0.000 description 1
- SXYZQZLHAIHKKY-GSTUPEFVSA-N clocortolone pivalate Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(Cl)[C@@H]2[C@@H]2C[C@@H](C)[C@H](C(=O)COC(=O)C(C)(C)C)[C@@]2(C)C[C@@H]1O SXYZQZLHAIHKKY-GSTUPEFVSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- VRLDVERQJMEPIF-UHFFFAOYSA-N dbdmh Chemical compound CC1(C)N(Br)C(=O)N(Br)C1=O VRLDVERQJMEPIF-UHFFFAOYSA-N 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229960004511 fludroxycortide Drugs 0.000 description 1
- 229940042902 flumethasone pivalate Drugs 0.000 description 1
- JWRMHDSINXPDHB-OJAGFMMFSA-N flumethasone pivalate Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(F)[C@@H]2[C@@H]2C[C@@H](C)[C@@](C(=O)COC(=O)C(C)(C)C)(O)[C@@]2(C)C[C@@H]1O JWRMHDSINXPDHB-OJAGFMMFSA-N 0.000 description 1
- GAKMQHDJQHZUTJ-ULHLPKEOSA-N fluocortolone Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2C[C@@H](C)[C@H](C(=O)CO)[C@@]2(C)C[C@@H]1O GAKMQHDJQHZUTJ-ULHLPKEOSA-N 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 238000005647 hydrohalogenation reaction Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VRWLBMGRSLQKSU-UHFFFAOYSA-N methanol;pyridine Chemical compound OC.C1=CC=NC=C1 VRWLBMGRSLQKSU-UHFFFAOYSA-N 0.000 description 1
- 238000013048 microbiological method Methods 0.000 description 1
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 description 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 description 1
- PFGVNLZDWRZPJW-OPAMFIHVSA-N otamixaban Chemical compound C([C@@H](C(=O)OC)[C@@H](C)NC(=O)C=1C=CC(=CC=1)C=1C=C[N+]([O-])=CC=1)C1=CC=CC(C(N)=N)=C1 PFGVNLZDWRZPJW-OPAMFIHVSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- AYGFEWYXKDFVIQ-NWSAAYAGSA-N pregn-4-en-3-one Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](CC)[C@@]1(C)CC2 AYGFEWYXKDFVIQ-NWSAAYAGSA-N 0.000 description 1
- 150000003124 pregnadienes Chemical class 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000005671 trienes Chemical class 0.000 description 1
- SMBZJSVIKJMSFP-UHFFFAOYSA-N trifluoromethyl hypofluorite Chemical compound FOC(F)(F)F SMBZJSVIKJMSFP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J71/00—Steroids in which the cyclopenta(a)hydrophenanthrene skeleton is condensed with a heterocyclic ring
- C07J71/0005—Oxygen-containing hetero ring
- C07J71/0026—Oxygen-containing hetero ring cyclic ketals
- C07J71/0031—Oxygen-containing hetero ring cyclic ketals at positions 16, 17
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J71/00—Steroids in which the cyclopenta(a)hydrophenanthrene skeleton is condensed with a heterocyclic ring
- C07J71/0005—Oxygen-containing hetero ring
- C07J71/001—Oxiranes
- C07J71/0015—Oxiranes at position 9(11)
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Steroid Compounds (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7803655 | 1978-04-05 | ||
| NL7803656 | 1978-04-05 | ||
| NL7803656 | 1978-04-05 | ||
| NL7803655 | 1978-04-05 | ||
| NLAANVRAGE7902333,A NL187577C (nl) | 1978-04-05 | 1979-03-23 | 3-acetoxy-9beta,11beta-epoxy-pregna-1,3,5-trienen, werkwijze voor de bereiding daarvan en werkwijze voor de bereiding van 6alfa-halogeen-pregna-1,4-dieen-3-onen. |
| NL7902333 | 1979-03-23 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI791124A7 FI791124A7 (fi) | 1979-10-06 |
| FI66395B FI66395B (fi) | 1984-06-29 |
| FI66395C true FI66395C (fi) | 1984-10-10 |
Family
ID=27352047
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI791124A FI66395C (fi) | 1978-04-05 | 1979-04-05 | 3-acetoxi-9alfa 11beta-epoxipregna-1,3,5-triener och motsvarande 3,5-diener anvaendbara som mellanprodukt vid framstaellning av 6alfa-halogen substituerade pregna-1,4-dien-3-oner ochpregn-4-en-3-oner och ett foerfarande foer framstaellning a dessa mellanprodukter |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4255331A (en:Method) |
| JP (1) | JPS6425793A (en:Method) |
| CH (1) | CH639655A5 (en:Method) |
| DE (1) | DE2913147A1 (en:Method) |
| FI (1) | FI66395C (en:Method) |
| FR (1) | FR2421914A1 (en:Method) |
| GB (1) | GB2018258B (en:Method) |
| NL (1) | NL187577C (en:Method) |
| PH (1) | PH16138A (en:Method) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188322A (en) * | 1978-04-28 | 1980-02-12 | Blasinachim S.P.A. | Process for the preparation of 6-halo-pregnanes |
| EP0029151B1 (en) | 1979-11-16 | 1985-09-25 | STEROSYNT Ltd. | 6-alpha-fluoro-9-alpha-chloro-prednisolone-17,21 diesters, pharmaceutical compositions containing them and intermediates |
| HU182775B (en) * | 1981-10-15 | 1984-03-28 | Richter Gedeon Vegyeszet | Process for preparing new 3-chloro-pregnane derivatives |
| FR2701262B1 (fr) * | 1993-02-05 | 1995-03-24 | Roussel Uclaf | Nouveau procédé de préparation de stéroïdes 6 alpa, 9 alpha-difluorés et nouveaus intermédiaires. |
| GB0017988D0 (en) * | 2000-07-21 | 2000-09-13 | Glaxo Group Ltd | Novel process |
| IT1319663B1 (it) * | 2000-11-17 | 2003-10-23 | Farmabios Srl | Processo per la preparazione di fluoro-steroidi. |
| PT102628B (pt) * | 2001-06-12 | 2010-09-09 | Hovione Farmaciencia S A | Novo processo de preparação de flumetasona e do seu análogo 17-carboxilo androsteno |
| EP1275656A1 (en) * | 2001-07-11 | 2003-01-15 | Genchem Pharma Limited | Preparation of 9alpha-fluoro-11beta-hydroxypregnane 16,17-acetal derivatives |
| AU2002359523A1 (en) | 2001-11-29 | 2003-06-17 | Taro Pharmaceuticals U.S.A., Inc. | Method for the preparation of 6-alpha-fluoro corticosteroids |
| AU2003298339A1 (en) * | 2002-12-09 | 2004-06-30 | Sicor Inc. | Process for the preparation of pregnanes |
| ES2565194T3 (es) | 2010-07-20 | 2016-04-01 | Taro Pharmaceutical Industries Ltd | Procedimiento para la preparación de 17-desoxi-corticosteroides |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU75903A1 (en:Method) * | 1976-09-29 | 1978-05-16 | ||
| US3047596A (en) * | 1959-11-17 | 1962-07-31 | Merck & Co Inc | 6alpha-halogen-9alpha-halogen-delta-pregnadiene-3-one compounds |
| SE339685B (en:Method) * | 1967-06-16 | 1971-10-18 | Warner Lambert Pharmaceutical | |
| DE2365992C3 (de) * | 1972-03-09 | 1982-05-19 | The Upjohn Co., 49001 Kalamazoo, Mich. | 6α-Fluor-17,21-dihydroxy-16β-methylpregna-4,9(11)-dien-3,20-dion-17,21-diacetat und Verfahren zu dessen Herstellung |
| US4188322A (en) * | 1978-04-28 | 1980-02-12 | Blasinachim S.P.A. | Process for the preparation of 6-halo-pregnanes |
-
1979
- 1979-03-23 NL NLAANVRAGE7902333,A patent/NL187577C/xx not_active IP Right Cessation
- 1979-04-02 DE DE19792913147 patent/DE2913147A1/de active Granted
- 1979-04-03 US US06/026,677 patent/US4255331A/en not_active Expired - Lifetime
- 1979-04-04 GB GB7911796A patent/GB2018258B/en not_active Expired
- 1979-04-04 CH CH314779A patent/CH639655A5/de not_active IP Right Cessation
- 1979-04-05 FI FI791124A patent/FI66395C/fi not_active IP Right Cessation
- 1979-04-05 PH PH22354A patent/PH16138A/en unknown
- 1979-04-05 FR FR7910137A patent/FR2421914A1/fr active Granted
-
1988
- 1988-06-08 JP JP63141437A patent/JPS6425793A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2421914A1 (fr) | 1979-11-02 |
| JPS6425793A (en) | 1989-01-27 |
| DE2913147A1 (de) | 1979-10-18 |
| CH639655A5 (de) | 1983-11-30 |
| NL187577C (nl) | 1991-11-18 |
| US4255331A (en) | 1981-03-10 |
| NL7902333A (nl) | 1979-10-09 |
| GB2018258A (en) | 1979-10-17 |
| JPH0217560B2 (en:Method) | 1990-04-20 |
| DE2913147C2 (en:Method) | 1988-06-30 |
| FR2421914B1 (en:Method) | 1983-07-22 |
| PH16138A (en) | 1983-07-08 |
| GB2018258B (en) | 1983-02-02 |
| NL187577B (nl) | 1991-06-17 |
| FI66395B (fi) | 1984-06-29 |
| FI791124A7 (fi) | 1979-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI80888C (fi) | Foerfarande foer framstaellning av terapeutiskt verkande steroida karboxylsyraestrar. | |
| CA1056371A (en) | Polyhalogeno-steroids and processes for their manufacture | |
| FI66395C (fi) | 3-acetoxi-9alfa 11beta-epoxipregna-1,3,5-triener och motsvarande 3,5-diener anvaendbara som mellanprodukt vid framstaellning av 6alfa-halogen substituerade pregna-1,4-dien-3-oner ochpregn-4-en-3-oner och ett foerfarande foer framstaellning a dessa mellanprodukter | |
| CH533094A (de) | Verfahren zur Herstellung neuer Steroide | |
| JP2721002B2 (ja) | アンドロスタ‐1,4‐ジエン‐3,17‐ジオンの6‐メチレン誘導体の合成における改良 | |
| DE69302220T2 (de) | Neues Verfahren zur Herstelling von 16-alpha-methyl-steroide | |
| HU216638B (hu) | Új eljárás 11-oxo-szteroid-származékok előállítására | |
| US5310896A (en) | Process for preparing Δ1,4 -pregnadiene-3,20-diones | |
| HU214717B (hu) | Új eljárás 6alfa,9alfa-difluorozott szteroidok előállítására | |
| CA1159049A (en) | Process for the preparation of 6-halo-pregnanes | |
| US4525303A (en) | Process for preparation of steroids | |
| AU2002310616B2 (en) | Preparation of flumethasone and its 17-carboxyl androsten analogue | |
| KR100284824B1 (ko) | 16알파-메틸화 스테로이드의 제조 방법 | |
| DK146017B (da) | Analogifremgangsmaade til fremstilling af 17alfa-acyloxy-9alfa,21-dihalogen-11beta-hydroxy-6alfa-fluor-16beta-methyl-pregna-1,4-dien-3,20-dion-forbindelser | |
| US4950428A (en) | Novel steroids | |
| EP0003519A1 (de) | Neue in 17-Position substituierte Steroide der Pregnanreihe, ihre Herstellung und Verwendung | |
| EP1422235B1 (en) | Stereoselective method of producing 6alpha-fluoropregnanes and intermediaries | |
| US2666067A (en) | Simultaneous oxidation and halogenation of steroids | |
| EP0005523B1 (de) | D-Homosteroide, Verfahren zu deren Herstellung | |
| US4113722A (en) | Steroidal[16α,17-b]benzodioxins | |
| EP0001737A1 (de) | 17-Alpha-(3-Jodbenzoyloxy)-9-Alpha-chlor-4-pregnen-3.20-dione, deren D-Homo-analoga und Verfahren zu ihrer Herstellung | |
| DE3324403A1 (de) | Androsten-17-dithioketale und diese verbindungen enthaltende arzeimittel | |
| KR820001643B1 (ko) | 6-할로-프레그난류의 개량된 제조방법 | |
| DE1793270A1 (de) | 16alpha,17alpha-Methylensteroidverbindungen und Verfahren zu ihrer Herstellung | |
| JPS6363555B2 (en:Method) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: SIBLA S.R.L. |