FI66004C - Foerfarande foer framstaellning av beta-laktamantibiotika anvaendbara saosom laekemedel - Google Patents
Foerfarande foer framstaellning av beta-laktamantibiotika anvaendbara saosom laekemedel Download PDFInfo
- Publication number
- FI66004C FI66004C FI753333A FI753333A FI66004C FI 66004 C FI66004 C FI 66004C FI 753333 A FI753333 A FI 753333A FI 753333 A FI753333 A FI 753333A FI 66004 C FI66004 C FI 66004C
- Authority
- FI
- Finland
- Prior art keywords
- parts
- weight
- oxo
- sodium
- volume
- Prior art date
Links
- 239000003782 beta lactam antibiotic agent Substances 0.000 title claims description 10
- 239000002132 β-lactam antibiotic Substances 0.000 title claims description 9
- 229940124586 β-lactam antibiotics Drugs 0.000 title claims description 9
- -1 p-hydroxylphenyl Chemical group 0.000 claims description 113
- 150000001875 compounds Chemical class 0.000 claims description 46
- 239000000203 mixture Substances 0.000 claims description 43
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 32
- 150000003839 salts Chemical class 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 7
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 231100000252 nontoxic Toxicity 0.000 claims description 6
- 230000003000 nontoxic effect Effects 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 150000001540 azides Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 3
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 3
- 229910052727 yttrium Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000002516 radical scavenger Substances 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 4
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- 239000008186 active pharmaceutical agent Substances 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 110
- 239000011734 sodium Substances 0.000 description 106
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 96
- 229910052708 sodium Inorganic materials 0.000 description 86
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 86
- 229910001868 water Inorganic materials 0.000 description 84
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 81
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 68
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 59
- 239000000460 chlorine Chemical group 0.000 description 57
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 51
- 239000005662 Paraffin oil Substances 0.000 description 47
- 229930182555 Penicillin Natural products 0.000 description 40
- 239000000243 solution Substances 0.000 description 39
- 238000002329 infrared spectrum Methods 0.000 description 37
- 229940049954 penicillin Drugs 0.000 description 37
- 150000003952 β-lactams Chemical class 0.000 description 37
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 36
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 34
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 33
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 31
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 30
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 30
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 29
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 29
- 239000000047 product Substances 0.000 description 29
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 229960003311 ampicillin trihydrate Drugs 0.000 description 27
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 27
- 239000002244 precipitate Substances 0.000 description 27
- 229950004030 cefaloglycin Drugs 0.000 description 26
- 150000002960 penicillins Chemical class 0.000 description 26
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 25
- 229930186147 Cephalosporin Natural products 0.000 description 24
- 229940124587 cephalosporin Drugs 0.000 description 24
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 22
- 150000001780 cephalosporins Chemical class 0.000 description 22
- 159000000000 sodium salts Chemical class 0.000 description 22
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 22
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 21
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 19
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 16
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 15
- 235000010288 sodium nitrite Nutrition 0.000 description 15
- 239000002585 base Substances 0.000 description 13
- 239000005051 trimethylchlorosilane Substances 0.000 description 13
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 10
- VRIKLWVRINZPSR-UHFFFAOYSA-N 1-aminoimidazolidin-2-one;hydrochloride Chemical compound Cl.NN1CCNC1=O VRIKLWVRINZPSR-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 229940056360 penicillin g Drugs 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 8
- RPBAFSBGYDKNRG-NJBDSQKTSA-N epicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CCC=CC1 RPBAFSBGYDKNRG-NJBDSQKTSA-N 0.000 description 8
- 229960002457 epicillin Drugs 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 229960004920 amoxicillin trihydrate Drugs 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- ZWXXVWSSKFZMOJ-UHFFFAOYSA-N 3-(furan-2-ylmethylideneamino)-2-oxoimidazolidine-1-carbonyl chloride Chemical compound O=C1N(C(=O)Cl)CCN1N=CC1=CC=CO1 ZWXXVWSSKFZMOJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 230000020477 pH reduction Effects 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 150000007529 inorganic bases Chemical class 0.000 description 5
- 150000007530 organic bases Chemical class 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 235000019371 penicillin G benzathine Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- DHIVBEZCBBHIPZ-UHFFFAOYSA-N 1-aminoimidazolidin-2-one Chemical compound NN1CCNC1=O DHIVBEZCBBHIPZ-UHFFFAOYSA-N 0.000 description 4
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- DCFKHNIGBAHNSS-UHFFFAOYSA-N chloro(triethyl)silane Chemical compound CC[Si](Cl)(CC)CC DCFKHNIGBAHNSS-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- RLGBRPHLXPWFHQ-UHFFFAOYSA-N 3-(cinnamylideneamino)-2-oxoimidazolidine-1-carbonyl chloride Chemical compound O=C1N(C(=O)Cl)CCN1N=CC=CC1=CC=CC=C1 RLGBRPHLXPWFHQ-UHFFFAOYSA-N 0.000 description 3
- DGOYPZJGZNPYIB-UHFFFAOYSA-N 3-[(3-methylphenyl)methylideneamino]-2-oxoimidazolidine-1-carbonyl chloride Chemical compound CC1=CC=CC(C=NN2C(N(C(Cl)=O)CC2)=O)=C1 DGOYPZJGZNPYIB-UHFFFAOYSA-N 0.000 description 3
- NASVHNJQONZOGA-UHFFFAOYSA-N 3-[(5-methylfuran-2-yl)methylideneamino]-2-oxoimidazolidine-1-carbonyl chloride Chemical compound ClC(=O)N1C(N(CC1)N=CC1=CC=C(O1)C)=O NASVHNJQONZOGA-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- CZEJDUIFJPHNBF-UHFFFAOYSA-N O=C(N(CCN1N=CC(O2)=CC=C2Br)C1=O)Cl Chemical compound O=C(N(CCN1N=CC(O2)=CC=C2Br)C1=O)Cl CZEJDUIFJPHNBF-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229960003022 amoxicillin Drugs 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 230000001580 bacterial effect Effects 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- HOWSSPXWUOKFGP-UHFFFAOYSA-N 1-(furan-2-ylmethylideneamino)imidazolidin-2-one Chemical compound O=C1NCCN1N=CC1=CC=CO1 HOWSSPXWUOKFGP-UHFFFAOYSA-N 0.000 description 2
- USRVDFPAQUTEKW-UHFFFAOYSA-N 1-[(2-fluorophenyl)methylideneamino]imidazolidin-2-one Chemical compound FC1=CC=CC=C1C=NN1C(=O)NCC1 USRVDFPAQUTEKW-UHFFFAOYSA-N 0.000 description 2
- USJFZGBIGDWFDX-UHFFFAOYSA-N 1-[(3-methylphenyl)methylideneamino]imidazolidin-2-one Chemical compound CC1=CC=CC(C=NN2C(NCC2)=O)=C1 USJFZGBIGDWFDX-UHFFFAOYSA-N 0.000 description 2
- FJRPDRDJLWHRCO-UHFFFAOYSA-N 1-[(5-bromofuran-2-yl)methylideneamino]imidazolidin-2-one Chemical compound O1C(Br)=CC=C1C=NN1C(=O)NCC1 FJRPDRDJLWHRCO-UHFFFAOYSA-N 0.000 description 2
- HOADBTGQZPNJKU-UHFFFAOYSA-N 1-[(5-chlorofuran-2-yl)methylideneamino]imidazolidin-2-one Chemical compound O1C(Cl)=CC=C1C=NN1C(=O)NCC1 HOADBTGQZPNJKU-UHFFFAOYSA-N 0.000 description 2
- QCRIBMQRLRTVAT-UHFFFAOYSA-N 1-[(5-methyl-1,2-oxazol-3-yl)methylideneamino]imidazolidin-2-one Chemical compound O1C(C)=CC(C=NN2C(NCC2)=O)=N1 QCRIBMQRLRTVAT-UHFFFAOYSA-N 0.000 description 2
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 2
- CYXGUUQIGXILKD-UHFFFAOYSA-N 3-[(2-fluorophenyl)methylideneamino]-2-oxoimidazolidine-1-carbonyl chloride Chemical compound FC1=CC=CC=C1C=NN1C(=O)N(C(Cl)=O)CC1 CYXGUUQIGXILKD-UHFFFAOYSA-N 0.000 description 2
- FUEAILYGIAMTLM-UHFFFAOYSA-N 3-[(4-fluorophenyl)methylideneamino]-2-oxoimidazolidine-1-carbonyl chloride Chemical compound C1=CC(F)=CC=C1C=NN1C(=O)N(C(Cl)=O)CC1 FUEAILYGIAMTLM-UHFFFAOYSA-N 0.000 description 2
- XAIGEDKGQYJIQS-UHFFFAOYSA-N 3-[(5-methyl-1,2-oxazol-3-yl)methylideneamino]-2-oxoimidazolidine-1-carbonyl chloride Chemical compound O1C(C)=CC(C=NN2C(N(C(Cl)=O)CC2)=O)=N1 XAIGEDKGQYJIQS-UHFFFAOYSA-N 0.000 description 2
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- OFOCZURUIAGMKO-UHFFFAOYSA-N O=C(N(CCN1N=CC(O2)=CC=C2Cl)C1=O)Cl Chemical compound O=C(N(CCN1N=CC(O2)=CC=C2Cl)C1=O)Cl OFOCZURUIAGMKO-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- YZUDSRQUMSTULR-UHFFFAOYSA-N [5-[(3-carbonochloridoyl-2-oxoimidazolidin-1-yl)iminomethyl]furan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)=CC=C1C=NN1C(=O)N(C(Cl)=O)CC1 YZUDSRQUMSTULR-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 229960000723 ampicillin Drugs 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000003125 aqueous solvent Substances 0.000 description 2
- 125000003460 beta-lactamyl group Chemical group 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Chemical group 0.000 description 2
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 150000004684 trihydrates Chemical class 0.000 description 2
- PQDJYEQOELDLCP-UHFFFAOYSA-N trimethylsilane Chemical compound C[SiH](C)C PQDJYEQOELDLCP-UHFFFAOYSA-N 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- 150000003953 γ-lactams Chemical class 0.000 description 2
- QAVITTVTXPZTSE-UHFFFAOYSA-N (5-formylfuran-2-yl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(C=O)O1 QAVITTVTXPZTSE-UHFFFAOYSA-N 0.000 description 1
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- VSONJTHCHIDILE-UHFFFAOYSA-N 1-(cinnamylideneamino)imidazolidin-2-one Chemical compound O=C1NCCN1N=CC=CC1=CC=CC=C1 VSONJTHCHIDILE-UHFFFAOYSA-N 0.000 description 1
- BMIXBQHTUUQYAL-UHFFFAOYSA-N 1-(pyridin-3-ylmethylideneamino)imidazolidin-2-one Chemical compound O=C1NCCN1N=CC1=CC=CN=C1 BMIXBQHTUUQYAL-UHFFFAOYSA-N 0.000 description 1
- PBAGBTWXETXOCZ-UHFFFAOYSA-N 1-[(4-fluorophenyl)methylideneamino]imidazolidin-2-one Chemical compound C1=CC(F)=CC=C1C=NN1C(=O)NCC1 PBAGBTWXETXOCZ-UHFFFAOYSA-N 0.000 description 1
- JBMZIRNDOLOMEB-UHFFFAOYSA-N 1-[(5-methylfuran-2-yl)methylideneamino]imidazolidin-2-one Chemical compound O1C(C)=CC=C1C=NN1C(=O)NCC1 JBMZIRNDOLOMEB-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical class CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- KXGOVBQTBXLWQJ-UHFFFAOYSA-N 2-oxo-3-(pyridin-3-ylmethylideneamino)imidazolidine-1-carbonyl chloride Chemical compound O=C1N(C(=O)Cl)CCN1N=CC1=CC=CN=C1 KXGOVBQTBXLWQJ-UHFFFAOYSA-N 0.000 description 1
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 1
- FLUOKGKFRDFKIB-UHFFFAOYSA-N 3-[(5-nitrofuran-2-yl)methylideneamino]-2-oxoimidazolidine-1-carbonyl chloride Chemical compound ClC(=O)N1C(N(CC1)N=CC1=CC=C(O1)[N+](=O)[O-])=O FLUOKGKFRDFKIB-UHFFFAOYSA-N 0.000 description 1
- NVMOXPMVKXGZKX-UHFFFAOYSA-N 3-[1-(1,2-oxazol-3-yl)ethylideneamino]-2-oxoimidazolidine-1-carbonyl chloride Chemical compound C1=CON=C1C(C)=NN1CCN(C(Cl)=O)C1=O NVMOXPMVKXGZKX-UHFFFAOYSA-N 0.000 description 1
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 1
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 1
- PDONIKHDXYHTLS-UHFFFAOYSA-N 4-bromothiophene-2-carbaldehyde Chemical compound BrC1=CSC(C=O)=C1 PDONIKHDXYHTLS-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 1
- PSVPUHBSBYJSMQ-UHFFFAOYSA-N 4-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=C(C=O)C=C1 PSVPUHBSBYJSMQ-UHFFFAOYSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- SXINBFXPADXIEY-UHFFFAOYSA-N 5-Nitrofurfural Chemical compound [O-][N+](=O)C1=CC=C(C=O)O1 SXINBFXPADXIEY-UHFFFAOYSA-N 0.000 description 1
- WJTFHWXMITZNHS-UHFFFAOYSA-N 5-bromofuran-2-carbaldehyde Chemical compound BrC1=CC=C(C=O)O1 WJTFHWXMITZNHS-UHFFFAOYSA-N 0.000 description 1
- VWYFITBWBRVBSW-UHFFFAOYSA-N 5-chlorothiophene-2-carbaldehyde Chemical compound ClC1=CC=C(C=O)S1 VWYFITBWBRVBSW-UHFFFAOYSA-N 0.000 description 1
- OCOCVXUEFWNRJU-UHFFFAOYSA-N 5-methyl-1,2-oxazole-3-carbaldehyde Chemical compound CC1=CC(C=O)=NO1 OCOCVXUEFWNRJU-UHFFFAOYSA-N 0.000 description 1
- OUDFNZMQXZILJD-UHFFFAOYSA-N 5-methyl-2-furaldehyde Chemical compound CC1=CC=C(C=O)O1 OUDFNZMQXZILJD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000588779 Bordetella bronchiseptica Species 0.000 description 1
- 241000508772 Brucella sp. Species 0.000 description 1
- JQJJUTUMAWAGMZ-UHFFFAOYSA-N COC(=O)C1=CC=C(O1)C=NN2CCN(C2=O)C(=O)Cl Chemical compound COC(=O)C1=CC=C(O1)C=NN2CCN(C2=O)C(=O)Cl JQJJUTUMAWAGMZ-UHFFFAOYSA-N 0.000 description 1
- 241000186216 Corynebacterium Species 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241001495410 Enterococcus sp. Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000644323 Escherichia coli C Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- CEAZRRDELHUEMR-URQXQFDESA-N Gentamicin Chemical compound O1[C@H](C(C)NC)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](NC)[C@@](C)(O)CO2)O)[C@H](N)C[C@@H]1N CEAZRRDELHUEMR-URQXQFDESA-N 0.000 description 1
- 229930182566 Gentamicin Natural products 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000606768 Haemophilus influenzae Species 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- 241000186610 Lactobacillus sp. Species 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 229910014299 N-Si Inorganic materials 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 241000588653 Neisseria Species 0.000 description 1
- 101100032401 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pyr-4 gene Proteins 0.000 description 1
- 206010033078 Otitis media Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 108010087702 Penicillinase Proteins 0.000 description 1
- 208000023668 Pharyngeal disease Diseases 0.000 description 1
- 201000007100 Pharyngitis Diseases 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000588768 Providencia Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241000607149 Salmonella sp. Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- 241000607758 Shigella sp. Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- 208000003217 Tetany Diseases 0.000 description 1
- 241000186064 Trueperella pyogenes Species 0.000 description 1
- AXMVYSVVTMKQSL-UHFFFAOYSA-N UNPD142122 Natural products OC1=CC=C(C=CC=O)C=C1O AXMVYSVVTMKQSL-UHFFFAOYSA-N 0.000 description 1
- 241000607477 Yersinia pseudotuberculosis Species 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- GETXRFAGXQQRQF-UHFFFAOYSA-N [5-[(2-oxoimidazolidin-1-yl)iminomethyl]furan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)=CC=C1C=NN1C(=O)NCC1 GETXRFAGXQQRQF-UHFFFAOYSA-N 0.000 description 1
- HSXKWKJCZNRMJO-UHFFFAOYSA-N [acetyloxy-(5-nitrofuran-2-yl)methyl] acetate Chemical compound CC(=O)OC(OC(C)=O)C1=CC=C([N+]([O-])=O)O1 HSXKWKJCZNRMJO-UHFFFAOYSA-N 0.000 description 1
- 239000008351 acetate buffer Substances 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 230000001668 ameliorated effect Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229960004821 amikacin Drugs 0.000 description 1
- LKCWBDHBTVXHDL-RMDFUYIESA-N amikacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O LKCWBDHBTVXHDL-RMDFUYIESA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- FCPVYOBCFFNJFS-LQDWTQKMSA-M benzylpenicillin sodium Chemical class [Na+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)CC1=CC=CC=C1 FCPVYOBCFFNJFS-LQDWTQKMSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229910000020 calcium bicarbonate Inorganic materials 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 229960002588 cefradine Drugs 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- RDLPVSKMFDYCOR-UEKVPHQBSA-N cephradine Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CCC=CC1 RDLPVSKMFDYCOR-UEKVPHQBSA-N 0.000 description 1
- 229940117916 cinnamic aldehyde Drugs 0.000 description 1
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 201000003146 cystitis Diseases 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- YFAGHNZHGGCZAX-JKIFEVAISA-N dicloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(Cl)C=CC=C1Cl YFAGHNZHGGCZAX-JKIFEVAISA-N 0.000 description 1
- 229960001585 dicloxacillin Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 229940092559 enterobacter aerogenes Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- UVQLFIREPQYSAC-UHFFFAOYSA-N ethyl 5-[(3-carbonochloridoyl-2-oxoimidazolidin-1-yl)iminomethyl]furan-2-carboxylate Chemical compound ClC(=O)N1C(N(CC1)N=CC1=CC=C(O1)C(=O)OCC)=O UVQLFIREPQYSAC-UHFFFAOYSA-N 0.000 description 1
- FPNANULSSQHZSS-UHFFFAOYSA-N ethyl 5-formylfuran-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C=O)O1 FPNANULSSQHZSS-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 1
- 229960002518 gentamicin Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- UHUSDOQQWJGJQS-UHFFFAOYSA-N glycerol 1,2-dioctadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCCCCCCCCCC UHUSDOQQWJGJQS-UHFFFAOYSA-N 0.000 description 1
- 229940047650 haemophilus influenzae Drugs 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229960000318 kanamycin Drugs 0.000 description 1
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 1
- 229930027917 kanamycin Natural products 0.000 description 1
- 229930182823 kanamycin A Natural products 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 235000012254 magnesium hydroxide Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- KDPOOUQFAUOHHX-UHFFFAOYSA-N methyl 5-formylfuran-2-carboxylate Chemical compound COC(=O)C1=CC=C(C=O)O1 KDPOOUQFAUOHHX-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 201000008383 nephritis Diseases 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- UWYHMGVUTGAWSP-JKIFEVAISA-N oxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=CC=CC=C1 UWYHMGVUTGAWSP-JKIFEVAISA-N 0.000 description 1
- 229960001019 oxacillin Drugs 0.000 description 1
- 238000001139 pH measurement Methods 0.000 description 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 1
- 229950009506 penicillinase Drugs 0.000 description 1
- 208000008494 pericarditis Diseases 0.000 description 1
- 206010034674 peritonitis Diseases 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- FNEDHAVUXWEPMP-UHFFFAOYSA-M sodium;2-methylhexanoate Chemical compound [Na+].CCCCC(C)C([O-])=O FNEDHAVUXWEPMP-UHFFFAOYSA-M 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 229960000707 tobramycin Drugs 0.000 description 1
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D505/00—Heterocyclic compounds containing 5-oxa-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxacephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/38—One oxygen atom with acyl radicals or hetero atoms directly attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D503/00—Heterocyclic compounds containing 4-oxa-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxapenicillins, clavulanic acid derivatives; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742456307 DE2456307A1 (de) | 1974-11-28 | 1974-11-28 | Beta-lactam-antibiotica, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2456307 | 1974-11-28 | ||
| DE2512998 | 1975-03-25 | ||
| DE19752512998 DE2512998A1 (de) | 1975-03-25 | 1975-03-25 | Beta-lactam-antibiotica, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE19752525541 DE2525541C2 (de) | 1975-06-07 | 1975-06-07 | β-Lactam-Antibiotica, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel |
| DE2525541 | 1975-06-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI753333A7 FI753333A7 (enFirst) | 1976-05-29 |
| FI66004B FI66004B (fi) | 1984-04-30 |
| FI66004C true FI66004C (fi) | 1984-08-10 |
Family
ID=27186174
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI753333A FI66004C (fi) | 1974-11-28 | 1975-11-26 | Foerfarande foer framstaellning av beta-laktamantibiotika anvaendbara saosom laekemedel |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4147693A (enFirst) |
| JP (2) | JPS5182286A (enFirst) |
| AR (1) | AR210103A1 (enFirst) |
| AT (1) | AT342196B (enFirst) |
| AU (1) | AU499337B2 (enFirst) |
| CA (1) | CA1064020A (enFirst) |
| CH (1) | CH623326A5 (enFirst) |
| DD (1) | DD124736A5 (enFirst) |
| DK (1) | DK535675A (enFirst) |
| ES (1) | ES443008A1 (enFirst) |
| FI (1) | FI66004C (enFirst) |
| FR (1) | FR2292471A1 (enFirst) |
| GB (1) | GB1486349A (enFirst) |
| HK (1) | HK19678A (enFirst) |
| IE (1) | IE43813B1 (enFirst) |
| IL (1) | IL48538A (enFirst) |
| LU (1) | LU73873A1 (enFirst) |
| NL (1) | NL7513746A (enFirst) |
| NO (1) | NO753818L (enFirst) |
| NZ (1) | NZ179347A (enFirst) |
| RO (1) | RO68146A (enFirst) |
| SE (1) | SE434513B (enFirst) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4061861A (en) * | 1976-06-21 | 1977-12-06 | Eli Lilly And Company | 7-[α-(2,3-DIHYDRO-2-OXO-1H-benzimidazol-1-ylcarbonyl-amino)arylacetamido]cephalosporins |
| JPS5326143A (en) * | 1976-08-24 | 1978-03-10 | Oki Electric Ind Co Ltd | Coupling method for op tical fiber |
| JPS5331690A (en) * | 1976-09-01 | 1978-03-25 | Shionogi & Co Ltd | Oxadithiacephalosporins |
| GB1584400A (en) * | 1976-12-24 | 1981-02-11 | Bayer Ag | (2-oxo-imidazoliden-1-yl(carbonylamino)-acetamido-cephalosporins and penicillins |
| DE2732283A1 (de) * | 1977-07-16 | 1979-01-25 | Bayer Ag | Beta-lactam-verbindungen |
| JPS5616489A (en) * | 1979-07-20 | 1981-02-17 | Ajinomoto Co Inc | Imidazolecarboxylic acid derivative |
| US4386199A (en) * | 1980-01-03 | 1983-05-31 | E. R. Squibb & Sons, Inc. | Cephalosporins having an imino substituted piperazindioncarbonylamino acyl sidechain |
| US4436904A (en) * | 1981-02-14 | 1984-03-13 | Kanto Ishi Pharmaceutical Co., Ltd. | Cephalosporins |
| DE3137038A1 (de) | 1981-09-17 | 1983-03-24 | Bayer Ag, 5090 Leverkusen | Ss-lactam antibiotika, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| GB8318846D0 (en) * | 1983-07-12 | 1983-08-10 | Fujisawa Pharmaceutical Co | Prophylactic/therapeutic agent against fish diseases |
| CN103360321B (zh) * | 2012-04-05 | 2016-09-21 | 北京勤邦生物技术有限公司 | 呋喃妥因代谢物半抗原及其制备方法和应用 |
| CN111995663B (zh) * | 2020-09-02 | 2023-07-28 | 重庆大学 | 一种含有N-氨基咪唑烷-2-酮结构的Ang-(1-7)多肽类似物 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH562249A5 (enFirst) * | 1970-05-25 | 1975-05-30 | Bayer Ag | |
| US3939149A (en) * | 1970-05-25 | 1976-02-17 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| US3980792A (en) * | 1970-05-25 | 1976-09-14 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| US3974140A (en) * | 1970-05-25 | 1976-08-10 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| CH571524A5 (enFirst) * | 1970-05-25 | 1976-01-15 | Bayer Ag | |
| US3732332A (en) * | 1970-10-16 | 1973-05-08 | Allied Chem | Production of low molecular weight polyanhydrides and epoxy compositions derived therefrom |
| BE790441A (fr) * | 1971-10-23 | 1973-04-24 | Bayer Ag | Nouvelles penicillines, leur procede de preparation et medicament les contenant |
| US3974142A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3972870A (en) * | 1971-10-23 | 1976-08-03 | Bayer Aktiengesellschaft | Penicillins |
| NL175419C (nl) * | 1971-10-23 | 1984-11-01 | Bayer Ag | Werkwijze ter bereiding of vervaardiging van antibiotisch werkzame farmaceutische preparaten, alsmede werkwijze ter bereiding van antibiotisch werkzame alfa-gesubstitueerde 6-(alfa-(3-acylureido)acetylamino) penicillanzuurderivaten. |
| US3974141A (en) * | 1971-10-23 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3983105A (en) * | 1971-10-23 | 1976-09-28 | Bayer Aktiengesellschaft | Penicillins |
| US3978056A (en) * | 1971-10-23 | 1976-08-31 | Bayer Aktiengesellschaft | Penicillins |
| DE2354219A1 (de) * | 1973-10-30 | 1975-05-07 | Bayer Ag | Beta-lactam-antibiotica, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
-
1975
- 1975-10-28 GB GB44296/75A patent/GB1486349A/en not_active Expired
- 1975-11-13 US US05/631,515 patent/US4147693A/en not_active Expired - Lifetime
- 1975-11-14 NO NO753818A patent/NO753818L/no unknown
- 1975-11-18 CA CA239,913A patent/CA1064020A/en not_active Expired
- 1975-11-24 CH CH1523375A patent/CH623326A5/de not_active IP Right Cessation
- 1975-11-25 IL IL48538A patent/IL48538A/xx unknown
- 1975-11-25 NL NL7513746A patent/NL7513746A/xx not_active Application Discontinuation
- 1975-11-25 NZ NZ179347A patent/NZ179347A/xx unknown
- 1975-11-26 RO RO7584030A patent/RO68146A/ro unknown
- 1975-11-26 JP JP50140877A patent/JPS5182286A/ja active Granted
- 1975-11-26 FI FI753333A patent/FI66004C/fi not_active IP Right Cessation
- 1975-11-26 JP JP50140878A patent/JPS6043332B2/ja not_active Expired
- 1975-11-26 LU LU73873A patent/LU73873A1/xx unknown
- 1975-11-26 DD DD189709A patent/DD124736A5/xx unknown
- 1975-11-26 ES ES443008A patent/ES443008A1/es not_active Expired
- 1975-11-27 SE SE7513378A patent/SE434513B/xx unknown
- 1975-11-27 DK DK535675A patent/DK535675A/da not_active Application Discontinuation
- 1975-11-27 IE IE2588/75A patent/IE43813B1/en unknown
- 1975-11-28 AU AU87085/75A patent/AU499337B2/en not_active Expired
- 1975-11-28 FR FR7536543A patent/FR2292471A1/fr active Granted
- 1975-11-28 AT AT907275A patent/AT342196B/de not_active IP Right Cessation
- 1975-11-28 AR AR261391A patent/AR210103A1/es active
-
1978
- 1978-04-13 HK HK196/78A patent/HK19678A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AR210103A1 (es) | 1977-06-30 |
| ES443008A1 (es) | 1977-05-01 |
| JPS6114151B2 (enFirst) | 1986-04-17 |
| FR2292471A1 (fr) | 1976-06-25 |
| FI753333A7 (enFirst) | 1976-05-29 |
| DD124736A5 (enFirst) | 1977-03-09 |
| IE43813B1 (en) | 1981-06-03 |
| CH623326A5 (enFirst) | 1981-05-29 |
| LU73873A1 (enFirst) | 1976-09-06 |
| FI66004B (fi) | 1984-04-30 |
| NL7513746A (nl) | 1976-06-01 |
| AT342196B (de) | 1978-03-28 |
| AU499337B2 (en) | 1979-04-12 |
| IL48538A0 (en) | 1976-01-30 |
| JPS5182286A (en) | 1976-07-19 |
| IL48538A (en) | 1979-07-25 |
| JPS5176438A (enFirst) | 1976-07-02 |
| HK19678A (en) | 1978-04-20 |
| SE434513B (sv) | 1984-07-30 |
| FR2292471B1 (enFirst) | 1981-12-31 |
| AU8708575A (en) | 1977-06-02 |
| DK535675A (da) | 1976-05-29 |
| IE43813L (en) | 1976-05-28 |
| US4147693A (en) | 1979-04-03 |
| NZ179347A (en) | 1978-04-28 |
| RO68146A (ro) | 1980-04-15 |
| JPS6043332B2 (ja) | 1985-09-27 |
| SE7513378L (sv) | 1976-05-31 |
| ATA907275A (de) | 1977-07-15 |
| CA1064020A (en) | 1979-10-09 |
| NO753818L (enFirst) | 1976-05-31 |
| GB1486349A (en) | 1977-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI75825B (fi) | Foerfarande foer framstaellning av -laktamantibiotika. | |
| EP0189287B1 (en) | Novel b-lactam antibiotics | |
| FI66004C (fi) | Foerfarande foer framstaellning av beta-laktamantibiotika anvaendbara saosom laekemedel | |
| DE2461478A1 (de) | Neue 7-(thiazolin-4-yl-acetamido)- cephalosporinderivate, verfahren zur herstellung derselben und diese enthaltende pharmazeutische mittel | |
| PL89056B1 (enFirst) | ||
| CA1103237A (en) | Unsaturated derivatives of 7-acylamido-3-cephem-4- carboxylic acid and process for their preparation | |
| HU193750B (en) | Process for preparing 7-/2-(5-amino-1,2,4-thiadiazol-3-yl)-2-imino-acetamido/-3-/3-(quaternary-ammonio)-1-propen-1-yl/-ceph-3-em-4-carboxylates and pharmaceutics comprising such active substances | |
| CA1135687A (en) | .beta.-LACTAM ANTIBIOTICS, THEIR PRODUCTION, AND THEIR MEDICINAL USE | |
| EP0000392B1 (de) | Cephalosporin und Penicillin-derivate, Verfahren zu deren Herstellung, und deren pharmazeutische Präparate | |
| US3813388A (en) | 7-(d-(alpha-amino-alpha-phenyl-,2-thienyl-and 3-thienyl-acetamido))-3-(s-(2-methyl-1,2,3-triazole-4-yl)thiomethyl)-3-cephem-4-carboxylic acids | |
| DE2222434A1 (de) | Antibakterielles Mittel und Verfahren zu dessen Herstellung | |
| US3757015A (en) | Oxylic acids 7-(d-(alpha-amino-alpha-phenyl-, 2 - thienyl- and 3-thienyl-acetamido) - 3 - (s-(2-methyltetrazole - 5-yl)thiomethyl) - 3 - -cephem-4-carb | |
| US3960849A (en) | Amino-1,2,4-oxadiazolyl-3-acetyl cephalosporins | |
| CH633802A5 (de) | Verfahren zur herstellung neuer beta-lactam-antibiotica. | |
| US4160829A (en) | Antibacterial 1,2,4-oxadiazolylacetamido cephalosporins | |
| US4224442A (en) | 7-Ureido acetamido substituted cephalosporin antibiotics | |
| DE2140498A1 (de) | Synthetische Cephalosporine und Ver fahren zu deren Herstellung | |
| CA1050010A (en) | Process for preparing-3-methyl-4-(5-tetrazolyl)-a3-cephem compounds | |
| US3823141A (en) | 7-(o-aminomethyl-p-hydroxy-phenylacetamido)-3-(3-hydroxy-pyridazin-6-ylthiomethyl)-3-cephem-4-carboxylic acid | |
| DE2525541C2 (de) | &beta;-Lactam-Antibiotica, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel | |
| DE2309135C2 (de) | Cephalosporine und Verfahren zu deren Herstellung | |
| JPS5852996B2 (ja) | β−ラクタム及び抗バクテリア剤 | |
| KR810000186B1 (ko) | β-락탐 항생물질의 제조방법 | |
| GB2065098A (en) | N-substituted Thiazolyl Derivatives of 7-amino- cephalosporanic Acid | |
| PL101400B1 (pl) | Sposob wytwarzania nowych ureidocefalosporyn |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: BAYER AKTIENGESELLSCHAFT |