FI64579C - Som mellanprodukt anvaendbar 3-(4-bromfenyl)-3-(3-pyridyl)-3-hydroxi-prop-(1)-en foerfarande foer framstaellning daerav oc foerfarande foer framstaellning av terapeutiskt aktiva 3 -(-bromfenyl)-3-(3-pyridyl)-allylaminderivat - Google Patents
Som mellanprodukt anvaendbar 3-(4-bromfenyl)-3-(3-pyridyl)-3-hydroxi-prop-(1)-en foerfarande foer framstaellning daerav oc foerfarande foer framstaellning av terapeutiskt aktiva 3 -(-bromfenyl)-3-(3-pyridyl)-allylaminderivat Download PDFInfo
- Publication number
- FI64579C FI64579C FI782116A FI782116A FI64579C FI 64579 C FI64579 C FI 64579C FI 782116 A FI782116 A FI 782116A FI 782116 A FI782116 A FI 782116A FI 64579 C FI64579 C FI 64579C
- Authority
- FI
- Finland
- Prior art keywords
- pyridyl
- bromophenyl
- added
- solution
- temperature
- Prior art date
Links
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 title claims description 17
- -1 4-BROMOPHENYL Chemical class 0.000 title description 6
- 230000001225 therapeutic effect Effects 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 26
- 238000002360 preparation method Methods 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 14
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 13
- 150000002576 ketones Chemical class 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 2
- BVLDJXBFPHUCMZ-DMALGBCRSA-N (z)-3-(4-bromophenyl)-3-pyridin-3-ylprop-2-en-1-amine;dihydrochloride Chemical class Cl.Cl.C=1C=CN=CC=1C(=C/CN)\C1=CC=C(Br)C=C1 BVLDJXBFPHUCMZ-DMALGBCRSA-N 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 40
- 239000000243 solution Substances 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 32
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 28
- 239000000203 mixture Substances 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 24
- 239000000047 product Substances 0.000 description 19
- 239000000706 filtrate Substances 0.000 description 17
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 14
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 14
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 8
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 7
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- IJMWREDHKRHWQI-UHFFFAOYSA-M magnesium;ethene;chloride Chemical compound [Mg+2].[Cl-].[CH-]=C IJMWREDHKRHWQI-UHFFFAOYSA-M 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- OYPPVKRFBIWMSX-UHFFFAOYSA-N Cis-zimelidine Chemical compound C=1C=CN=CC=1C(=CCN(C)C)C1=CC=C(Br)C=C1 OYPPVKRFBIWMSX-UHFFFAOYSA-N 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 239000012467 final product Substances 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 238000002955 isolation Methods 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- IDGVUIHZWDVXOQ-UHFFFAOYSA-N (4-bromophenyl)-pyridin-3-ylmethanone Chemical compound C1=CC(Br)=CC=C1C(=O)C1=CC=CN=C1 IDGVUIHZWDVXOQ-UHFFFAOYSA-N 0.000 description 4
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- RMGJCSHZTFKPNO-UHFFFAOYSA-M magnesium;ethene;bromide Chemical compound [Mg+2].[Br-].[CH-]=C RMGJCSHZTFKPNO-UHFFFAOYSA-M 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- JPQUDQIQRLMROB-UHFFFAOYSA-N [K].CC(C)O Chemical compound [K].CC(C)O JPQUDQIQRLMROB-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 150000003509 tertiary alcohols Chemical class 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 230000001430 anti-depressive effect Effects 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000004656 dimethylamines Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- NJSUFZNXBBXAAC-UHFFFAOYSA-N ethanol;toluene Chemical compound CCO.CC1=CC=CC=C1 NJSUFZNXBBXAAC-UHFFFAOYSA-N 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical class II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 2
- 150000004794 vinyl magnesium halides Chemical class 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 240000006927 Foeniculum vulgare Species 0.000 description 1
- 235000004204 Foeniculum vulgare Nutrition 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000084978 Rena Species 0.000 description 1
- 239000005862 Whey Substances 0.000 description 1
- 102000007544 Whey Proteins Human genes 0.000 description 1
- 108010046377 Whey Proteins Proteins 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000729 antidote Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000001257 hydrogen Chemical group 0.000 description 1
- 229910052739 hydrogen Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- UCDWWJKPBQZZNT-UHFFFAOYSA-N magnesium;oxolane Chemical compound [Mg].C1CCOC1 UCDWWJKPBQZZNT-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/26—Radicals substituted by halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F3/00—Compounds containing elements of Groups 2 or 12 of the Periodic Table
- C07F3/02—Magnesium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7707708 | 1977-07-04 | ||
| SE7707708A SE409860B (sv) | 1977-07-04 | 1977-07-04 | En ny mellanprodukt for framstellning av terapeutiskt aktiva pyridinforeningar |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI782116A FI782116A (fi) | 1979-01-05 |
| FI64579B FI64579B (fi) | 1983-08-31 |
| FI64579C true FI64579C (fi) | 1983-12-12 |
Family
ID=20331765
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI782116A FI64579C (fi) | 1977-07-04 | 1978-06-30 | Som mellanprodukt anvaendbar 3-(4-bromfenyl)-3-(3-pyridyl)-3-hydroxi-prop-(1)-en foerfarande foer framstaellning daerav oc foerfarande foer framstaellning av terapeutiskt aktiva 3 -(-bromfenyl)-3-(3-pyridyl)-allylaminderivat |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4216328A (it) |
| EP (1) | EP0006864B1 (it) |
| JP (2) | JPS607981B2 (it) |
| AT (1) | AT364825B (it) |
| AU (1) | AU520374B2 (it) |
| BE (1) | BE868701A (it) |
| CA (1) | CA1099725A (it) |
| CH (1) | CH642354A5 (it) |
| DK (1) | DK295278A (it) |
| ES (1) | ES471365A1 (it) |
| FI (1) | FI64579C (it) |
| GB (1) | GB2036002B (it) |
| IE (1) | IE47017B1 (it) |
| IL (1) | IL54973A (it) |
| IT (1) | IT1105249B (it) |
| NL (1) | NL7807121A (it) |
| NO (1) | NO150604C (it) |
| SE (1) | SE409860B (it) |
| SU (1) | SU927113A3 (it) |
| WO (1) | WO1979000024A1 (it) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE7909514L (sv) * | 1979-11-16 | 1981-05-17 | Astra Laekemedel Ab | Nya halofenyl-pyridyl-allylaminderivat |
| JPH0354870Y2 (it) * | 1985-10-28 | 1991-12-04 | ||
| DE4036216C1 (it) * | 1990-11-14 | 1992-01-30 | Voest-Alpine Industrieanlagenbau Ges.M.B.H., Linz, At |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB850298A (en) * | 1956-10-30 | 1960-10-05 | Maggioni & C Societa Per Azion | ª‡,ª‡[(p-chlorophenyl)-(4-pyridyl)] carbinols and method of preparing same |
| DE1468359A1 (de) * | 1963-10-23 | 1968-11-28 | Merck & Co Inc | Verfahren zur Herstellung von Dibenzocycloheptehderivaten |
| US3396224A (en) * | 1965-09-09 | 1968-08-06 | Lilly Co Eli | Controlling phytopathogenic fungi on plants with 3-pyridyl methane derivatives |
| US3471505A (en) * | 1967-02-01 | 1969-10-07 | Ciba Geigy Corp | 1-(alkoxyphenyl)-1-(3-pyridyl)-carbinols |
| US3928369A (en) * | 1971-04-28 | 1975-12-23 | Haessle Ab | Compounds useful as antidepressive agents, and a process for their preparation |
| US4094908A (en) * | 1973-08-15 | 1978-06-13 | Richter Gedeon Vegyeszeti Gyar Rt. | Alpha-substituted benzhydrol derivatives |
| GB1480593A (en) * | 1973-11-30 | 1977-07-20 | Kefalas As | Xanthene and thioxanthene derivatives having pharmaceutical activity |
| SE388854B (sv) * | 1974-11-21 | 1979-03-26 | Astra Laekemedel Ab | Forfarande for framstellning av fenylpyridylaminderivat |
-
1977
- 1977-07-04 SE SE7707708A patent/SE409860B/sv unknown
-
1978
- 1978-06-22 IL IL54973A patent/IL54973A/xx unknown
- 1978-06-26 EP EP78900032A patent/EP0006864B1/en not_active Expired
- 1978-06-26 GB GB7920315A patent/GB2036002B/en not_active Expired
- 1978-06-26 CH CH330079A patent/CH642354A5/de not_active IP Right Cessation
- 1978-06-26 US US05/918,724 patent/US4216328A/en not_active Expired - Lifetime
- 1978-06-26 WO PCT/SE1978/000010 patent/WO1979000024A1/en unknown
- 1978-06-29 AU AU37613/78A patent/AU520374B2/en not_active Expired
- 1978-06-29 DK DK782952A patent/DK295278A/da not_active Application Discontinuation
- 1978-06-30 NL NL7807121A patent/NL7807121A/xx not_active Application Discontinuation
- 1978-06-30 FI FI782116A patent/FI64579C/fi not_active IP Right Cessation
- 1978-06-30 CA CA306,599A patent/CA1099725A/en not_active Expired
- 1978-07-03 IT IT50141/78A patent/IT1105249B/it active
- 1978-07-03 IE IE1334/78A patent/IE47017B1/en unknown
- 1978-07-03 NO NO782303A patent/NO150604C/no unknown
- 1978-07-03 ES ES471365A patent/ES471365A1/es not_active Expired
- 1978-07-04 BE BE189041A patent/BE868701A/xx not_active IP Right Cessation
- 1978-07-04 AT AT0483678A patent/AT364825B/de not_active IP Right Cessation
- 1978-07-04 JP JP53081819A patent/JPS607981B2/ja not_active Expired
-
1979
- 1979-08-03 SU SU792800303A patent/SU927113A3/ru active
-
1982
- 1982-04-22 JP JP57066429A patent/JPS609024B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES471365A1 (es) | 1979-10-01 |
| WO1979000024A1 (en) | 1979-01-25 |
| AU3761378A (en) | 1980-01-03 |
| AT364825B (de) | 1981-11-25 |
| SU927113A3 (ru) | 1982-05-07 |
| DK295278A (da) | 1979-01-05 |
| NO782303L (no) | 1979-01-05 |
| FI782116A (fi) | 1979-01-05 |
| NO150604B (no) | 1984-08-06 |
| US4216328A (en) | 1980-08-05 |
| IE47017B1 (en) | 1983-11-30 |
| IT7850141A0 (it) | 1978-07-03 |
| IT1105249B (it) | 1985-10-28 |
| BE868701A (fr) | 1979-01-04 |
| JPS609024B2 (ja) | 1985-03-07 |
| GB2036002A (en) | 1980-06-25 |
| ATA483678A (de) | 1981-04-15 |
| EP0006864B1 (en) | 1981-12-30 |
| JPS5414975A (en) | 1979-02-03 |
| SE409860B (sv) | 1979-09-10 |
| IE781334L (en) | 1979-01-04 |
| IL54973A (en) | 1981-12-31 |
| CA1099725A (en) | 1981-04-21 |
| JPS57183759A (en) | 1982-11-12 |
| CH642354A5 (de) | 1984-04-13 |
| NO150604C (no) | 1984-11-14 |
| AU520374B2 (en) | 1982-01-28 |
| SE7707708L (sv) | 1979-01-05 |
| GB2036002B (en) | 1982-04-21 |
| JPS607981B2 (ja) | 1985-02-28 |
| IL54973A0 (en) | 1978-08-31 |
| FI64579B (fi) | 1983-08-31 |
| NL7807121A (nl) | 1979-01-08 |
| EP0006864A1 (en) | 1980-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4282770B2 (ja) | 新規な中間体およびその製造方法 | |
| UA66359C2 (uk) | Спосіб одержання рацемічних або оптично активних сполук | |
| JP2021169482A (ja) | タピナロフを調製するためのプロセス | |
| DK169404B1 (da) | Substitueret phenylamidforbindelse, fremgangsmåde til fremstilling deraf, anvendelse deraf til brug som farmaceutisk middel og farmaceutisk præparat indeholdende forbindelsen | |
| HU225504B1 (en) | Novel halophenyl-(2-(2-thienyl)-ethylamino)-acetonitriles and process for producing them | |
| SK152998A3 (en) | Racemic separation of ketamine | |
| FI64579C (fi) | Som mellanprodukt anvaendbar 3-(4-bromfenyl)-3-(3-pyridyl)-3-hydroxi-prop-(1)-en foerfarande foer framstaellning daerav oc foerfarande foer framstaellning av terapeutiskt aktiva 3 -(-bromfenyl)-3-(3-pyridyl)-allylaminderivat | |
| DK150144B (da) | Fremgangsmaade til fremstilling af tetracykliske, kondenserede pyrazinderivater | |
| EP0343050A1 (fr) | Dérivés de phényl-6 pipérazinyl-alkyl-3 1H,3H-pyrimidinedione-2,4, leur préparation et leur application en thérapeutique | |
| EP0413667A1 (de) | Halogenalkylphenyl-Alkohole, -Ketone und deren Hydrate | |
| HU226421B1 (en) | Process for racemizing optically active 2-(2-chlorophenyl)-2-(2-(2-thienyl)-ethylamino)-acetamides | |
| RU2522437C2 (ru) | Способ получения гидразонов нитро-тетразол-5-карбальдегида | |
| FI61310C (fi) | Nytt foerfarande foer framstaellning av saosom ett laekemedel anvaendbar 5-metyl-1-fenyl-1,3,4,6-tetrahydro-5h-bens(f)-2,5-oxazocin | |
| Linzaga et al. | NMR and X-ray crystallographic studies of axial and equatorial 2-ethoxy-2-oxo-1, 4, 2-oxazaphosphinane | |
| HU193632B (en) | Process for producing alpha-halogeno-alkylamide | |
| EP0404748B1 (en) | Novel stereoisomers | |
| PL130528B1 (en) | Process for preparing n-/halomethyl/-acylamides | |
| EP1833814B1 (de) | Verfahren zur herstellung von substituierten 2-alkoxycarbonyl-3-aminothiophenen | |
| SE418742B (sv) | Nytt forfarande for framstellning av n-metyl-(eller n,n-dimetyl)-3-4(bromfenyl)-3-(3-pyridyl)-alkylamin | |
| DE60206069T2 (de) | Verfahren zur herstellung von n-alkyl-2-benzthiazolylsulfenimiden und verfahren zu deren aufreinigung | |
| DE69018619T2 (de) | Alpha, beta-ungesättigte ketone und ketoximderivat. | |
| JPS6092249A (ja) | α―アルキル化された非環式α―アミノカルボン酸を互変選択的に製造する方法 | |
| KR820000094B1 (ko) | N-메틸화된 3-(4-브로모페닐)-3-(3-피리딜)-알릴아민류의 제조방법 | |
| KR100441404B1 (ko) | 신규한 알케닐 아자 두 고리 화합물 및 그 제조방법 | |
| UA125362U (uk) | Спосіб одержання 5-арил-1-(1н-піразол-4-іл)-піролідин-2-онів |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: ASTRA LAEKEMEDEL AKTIEBOLAG |