FI61839C - Tryckkaensligt kalkeringsmaterial - Google Patents
Tryckkaensligt kalkeringsmaterial Download PDFInfo
- Publication number
- FI61839C FI61839C FI1677/74A FI167774A FI61839C FI 61839 C FI61839 C FI 61839C FI 1677/74 A FI1677/74 A FI 1677/74A FI 167774 A FI167774 A FI 167774A FI 61839 C FI61839 C FI 61839C
- Authority
- FI
- Finland
- Prior art keywords
- chloride
- dye
- zinc
- receiving
- binder
- Prior art date
Links
- JIAARYAFYJHUJI-UHFFFAOYSA-L Zinc chloride Inorganic materials [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 57
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 32
- 235000005074 zinc chloride Nutrition 0.000 claims description 29
- 239000011592 zinc chloride Substances 0.000 claims description 29
- -1 polyethylene Polymers 0.000 claims description 18
- 239000011230 binding agent Substances 0.000 claims description 14
- 239000004202 carbamide Substances 0.000 claims description 13
- 229910052751 metal Inorganic materials 0.000 claims description 13
- 239000002184 metal Substances 0.000 claims description 13
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 10
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical class [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 claims description 9
- 239000005995 Aluminium silicate Substances 0.000 claims description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 7
- 235000012211 aluminium silicate Nutrition 0.000 claims description 7
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 239000010941 cobalt Substances 0.000 claims description 6
- 229910017052 cobalt Inorganic materials 0.000 claims description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 4
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- 229920005989 resin Polymers 0.000 claims description 4
- 239000011347 resin Substances 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 3
- 239000011118 polyvinyl acetate Substances 0.000 claims description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 3
- 235000012239 silicon dioxide Nutrition 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- 229910021556 Chromium(III) chloride Inorganic materials 0.000 claims description 2
- 229910021380 Manganese Chloride Inorganic materials 0.000 claims description 2
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 claims description 2
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 claims description 2
- 239000011636 chromium(III) chloride Substances 0.000 claims description 2
- 235000007831 chromium(III) chloride Nutrition 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 239000011565 manganese chloride Substances 0.000 claims description 2
- 235000002867 manganese chloride Nutrition 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 239000000025 natural resin Substances 0.000 claims description 2
- 239000004014 plasticizer Substances 0.000 claims description 2
- 239000004800 polyvinyl chloride Substances 0.000 claims description 2
- 239000002243 precursor Substances 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 239000000463 material Substances 0.000 claims 5
- 241001521291 Morus bassanus Species 0.000 claims 2
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 claims 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims 1
- 235000013877 carbamide Nutrition 0.000 claims 1
- 239000012876 carrier material Substances 0.000 claims 1
- 239000004927 clay Substances 0.000 claims 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 claims 1
- 239000000370 acceptor Substances 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 10
- 229960000892 attapulgite Drugs 0.000 description 10
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical class [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- 229910052625 palygorskite Inorganic materials 0.000 description 10
- 239000001993 wax Substances 0.000 description 10
- 239000000975 dye Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 8
- 210000002700 urine Anatomy 0.000 description 8
- 238000000576 coating method Methods 0.000 description 7
- 235000013539 calcium stearate Nutrition 0.000 description 6
- 239000008116 calcium stearate Substances 0.000 description 6
- 239000011248 coating agent Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000004372 Polyvinyl alcohol Substances 0.000 description 5
- 229910000019 calcium carbonate Inorganic materials 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 229910001510 metal chloride Inorganic materials 0.000 description 5
- 229920002451 polyvinyl alcohol Polymers 0.000 description 5
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 4
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- 239000004408 titanium dioxide Substances 0.000 description 4
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 3
- KBAYQFWFCOOCIC-GNVSMLMZSA-N [(1s,4ar,4bs,7s,8ar,10ar)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methanol Chemical compound OC[C@@]1(C)CCC[C@]2(C)[C@H]3CC[C@H](C(C)C)C[C@H]3CC[C@H]21 KBAYQFWFCOOCIC-GNVSMLMZSA-N 0.000 description 3
- ZKURGBYDCVNWKH-UHFFFAOYSA-N [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone Chemical compound C12=CC=C(N(C)C)C=C2SC2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=CC=C1 ZKURGBYDCVNWKH-UHFFFAOYSA-N 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerol Natural products OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- FRVCGRDGKAINSV-UHFFFAOYSA-L iron(2+);octadecanoate Chemical class [Fe+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O FRVCGRDGKAINSV-UHFFFAOYSA-L 0.000 description 2
- 229940107698 malachite green Drugs 0.000 description 2
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- DSEKYWAQQVUQTP-XEWMWGOFSA-N (2r,4r,4as,6as,6as,6br,8ar,12ar,14as,14bs)-2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1h-picen-3-one Chemical compound C([C@H]1[C@]2(C)CC[C@@]34C)C(C)(C)CC[C@]1(C)CC[C@]2(C)[C@H]4CC[C@@]1(C)[C@H]3C[C@@H](O)C(=O)[C@@H]1C DSEKYWAQQVUQTP-XEWMWGOFSA-N 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- QHMNIYLDJAUBMU-BTJKTKAUSA-N 2,2-bis(hydroxymethyl)propane-1,3-diol;(z)-but-2-enedioic acid Chemical class OC(=O)\C=C/C(O)=O.OCC(CO)(CO)CO QHMNIYLDJAUBMU-BTJKTKAUSA-N 0.000 description 1
- ZQVHTTABFLHMPA-UHFFFAOYSA-N 2-(4-chlorophenoxy)-5-nitropyridine Chemical compound N1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1 ZQVHTTABFLHMPA-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical compound NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229910021551 Vanadium(III) chloride Inorganic materials 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 239000012164 animal wax Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000002894 chemical waste Substances 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- UQLDLKMNUJERMK-UHFFFAOYSA-L di(octadecanoyloxy)lead Chemical compound [Pb+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O UQLDLKMNUJERMK-UHFFFAOYSA-L 0.000 description 1
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Natural products CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 239000012184 mineral wax Substances 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000003097 polyterpenes Chemical class 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- OXUXQTLJGMPEAY-UHFFFAOYSA-N urea trihydrochloride Chemical compound Cl.Cl.Cl.NC(N)=O OXUXQTLJGMPEAY-UHFFFAOYSA-N 0.000 description 1
- FIQKRKMICFAHCT-UHFFFAOYSA-N urea;zinc Chemical compound [Zn].NC(N)=O FIQKRKMICFAHCT-UHFFFAOYSA-N 0.000 description 1
- 239000012178 vegetable wax Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/155—Colour-developing components, e.g. acidic compounds; Additives or binders therefor; Layers containing such colour-developing components, additives or binders
- B41M5/1555—Inorganic mineral developers, e.g. clays
Landscapes
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Paper (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT665673 | 1973-07-27 | ||
| AT665773 | 1973-07-27 | ||
| AT665773A AT329596B (de) | 1973-07-27 | 1973-07-27 | Druckempfindliches, losungsmittelfreies aufzeichnungsmaterial |
| AT665673A AT329595B (de) | 1973-07-27 | 1973-07-27 | Druckempfindliches kopierpapier |
| AT780673A AT329597B (de) | 1973-09-10 | 1973-09-10 | Druckempfindliches durchschreibematerial |
| AT780673 | 1973-09-10 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI167774A7 FI167774A7 (cs) | 1975-01-28 |
| FI61839B FI61839B (fi) | 1982-06-30 |
| FI61839C true FI61839C (fi) | 1982-10-11 |
Family
ID=27150667
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI1677/74A FI61839C (fi) | 1973-07-27 | 1974-05-31 | Tryckkaensligt kalkeringsmaterial |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4321092A (cs) |
| JP (1) | JPS5042912A (cs) |
| AU (1) | AU496998B2 (cs) |
| BR (1) | BR7405966D0 (cs) |
| CA (1) | CA1026095A (cs) |
| CH (1) | CH605161A5 (cs) |
| DD (1) | DD113189A1 (cs) |
| DE (1) | DE2426678C3 (cs) |
| DK (1) | DK137788B (cs) |
| ES (1) | ES428709A1 (cs) |
| FI (1) | FI61839C (cs) |
| FR (1) | FR2238596B1 (cs) |
| GB (1) | GB1472580A (cs) |
| IL (1) | IL45351A (cs) |
| IT (1) | IT1017434B (cs) |
| NL (1) | NL7409090A (cs) |
| SE (1) | SE413587B (cs) |
| TR (1) | TR18390A (cs) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT335477B (de) * | 1975-02-25 | 1977-03-10 | Koreska Ges Mbh W | Druckempfindliches aufzeichnungsmaterial |
| DE2731418C3 (de) * | 1977-07-12 | 1987-10-22 | Feldmühle AG, 4000 Düsseldorf | Farbreaktives Aufzeichnungsmaterial und Verfahren zu seiner Herstellung |
| AT372909B (de) * | 1979-03-20 | 1983-11-25 | Manuel Ing Cespon | Farbentwicklermassen zur herstellung eines druck- empfindlichen aufzeichungsmaterials mit besonders starker farbbildung und lichtbestaendigkeit |
| FR2462271A1 (fr) * | 1979-07-30 | 1981-02-13 | Kores Holding Zug Ag | Materiau d'autocopie et son procede de preparation |
| JPS5637189A (en) * | 1979-09-05 | 1981-04-10 | Oji Paper Co Ltd | Tinting paper for pressure sensitive recording |
| GB2088889B (en) * | 1980-10-24 | 1984-09-05 | Fuji Photo Film Co Ltd | Recording materials having a clay-containing developer layer |
| EP0093208A1 (en) * | 1982-04-29 | 1983-11-09 | Frye Copysystems, Inc. | Improved chemical carbonless copy paper and transfer medium therefor |
| ZA834588B (en) * | 1982-06-24 | 1984-03-28 | Ciba Geigy Ag | Pressure-sensitive or heat-sensitive recording material |
| US4525214A (en) * | 1983-03-11 | 1985-06-25 | The Mazer Corporation | Crayon adapted for development of latent images |
| GB8511202D0 (en) * | 1985-05-02 | 1985-06-12 | Wiggins Teape Group Ltd | Record material |
| WO1988000890A1 (fr) * | 1986-07-31 | 1988-02-11 | Goyo Paper Working Co., Ltd | Feuille a revelateur de couleur |
| DE69502156T2 (de) * | 1994-09-30 | 1998-12-03 | Eastman Kodak Co., Rochester, N.Y. | Tintenstrahlaufzeichnungsmaterial, das ein Vanadiumsalz enthält |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3516845A (en) * | 1967-01-24 | 1970-06-23 | Ncr Co | Record sheet sensitized with salt modified kaolin-phenolic material |
| DE1807894A1 (de) * | 1968-11-08 | 1970-08-13 | Naigai Ink Mfg Co Ltd | Adsorptionsmittelmasse fuer druckempfindliches Durchschriftpapier |
| DE2228581C3 (de) * | 1971-06-14 | 1974-05-30 | Matsushita Electric Industrial Co. Ltd., Kadoma, Osaka (Japan) | Hitzeempfindliches Zweifarben-Aufzeichnungsmaterial |
| US3856554A (en) * | 1973-04-16 | 1974-12-24 | Ibm | Pressure-sensitive carbonless transfer sheet and method for providing a chemically formed image on an untreated substrate |
| US3906123A (en) * | 1973-04-23 | 1975-09-16 | Champion Int Corp | Self-contained pressure-sensitive system |
-
1974
- 1974-05-31 FI FI1677/74A patent/FI61839C/fi active
- 1974-06-01 DE DE2426678A patent/DE2426678C3/de not_active Expired
- 1974-07-04 NL NL7409090A patent/NL7409090A/xx not_active Application Discontinuation
- 1974-07-09 CH CH942574A patent/CH605161A5/xx not_active IP Right Cessation
- 1974-07-19 BR BR5966/74A patent/BR7405966D0/pt unknown
- 1974-07-23 TR TR18390A patent/TR18390A/xx unknown
- 1974-07-24 FR FR7425643A patent/FR2238596B1/fr not_active Expired
- 1974-07-24 SE SE7409628A patent/SE413587B/xx not_active IP Right Cessation
- 1974-07-25 DD DD180126A patent/DD113189A1/xx unknown
- 1974-07-25 IT IT25555/74A patent/IT1017434B/it active
- 1974-07-25 GB GB3292374A patent/GB1472580A/en not_active Expired
- 1974-07-25 AU AU71619/74A patent/AU496998B2/en not_active Expired
- 1974-07-26 JP JP49085923A patent/JPS5042912A/ja active Pending
- 1974-07-26 DK DK403974AA patent/DK137788B/da not_active Application Discontinuation
- 1974-07-26 IL IL45351A patent/IL45351A/en unknown
- 1974-07-26 CA CA205,782A patent/CA1026095A/en not_active Expired
- 1974-07-27 ES ES428709A patent/ES428709A1/es not_active Expired
-
1980
- 1980-03-10 US US06/128,806 patent/US4321092A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2238596A1 (cs) | 1975-02-21 |
| NL7409090A (nl) | 1975-01-29 |
| SE413587B (sv) | 1980-06-09 |
| DE2426678C3 (de) | 1981-08-27 |
| BR7405966D0 (pt) | 1975-05-13 |
| DE2426678A1 (de) | 1975-02-06 |
| ES428709A1 (es) | 1977-01-01 |
| GB1472580A (en) | 1977-05-04 |
| DK137788C (cs) | 1978-10-16 |
| JPS5042912A (cs) | 1975-04-18 |
| TR18390A (tr) | 1977-01-12 |
| FI61839B (fi) | 1982-06-30 |
| US4321092A (en) | 1982-03-23 |
| IL45351A0 (en) | 1974-10-22 |
| AU7161974A (en) | 1976-01-29 |
| SE7409628L (cs) | 1975-01-28 |
| IL45351A (en) | 1976-12-31 |
| AU496998B2 (en) | 1978-11-16 |
| IT1017434B (it) | 1977-07-20 |
| FI167774A7 (cs) | 1975-01-28 |
| CA1026095A (en) | 1978-02-14 |
| DK137788B (da) | 1978-05-08 |
| DE2426678B2 (de) | 1978-09-14 |
| CH605161A5 (cs) | 1978-09-29 |
| DD113189A1 (cs) | 1975-05-20 |
| DK403974A (cs) | 1975-03-10 |
| FR2238596B1 (cs) | 1982-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI61839C (fi) | Tryckkaensligt kalkeringsmaterial | |
| US4165102A (en) | Method of preparing zinc-modified phenol-aldehyde novolak resins and use as a color-developer | |
| JPS5826365B2 (ja) | 亜鉛変性フェノ−ル−アルデビドノボラック樹脂の製法 | |
| JPS60193691A (ja) | 可逆的画像形成材料 | |
| US4769305A (en) | Pressure-sensitive recording material | |
| JPH04224996A (ja) | 感熱記録材料 | |
| US3968320A (en) | Dye solvents for pressure-sensitive record material | |
| JPS646447B2 (cs) | ||
| JPS60208286A (ja) | 感熱記録材料 | |
| FI59220C (fi) | Kopieringsmaterial | |
| GB2028888A (en) | Colour-developing sheet for pressure-sensitive copying paper | |
| US4920091A (en) | Recording material | |
| US4093278A (en) | Dye solvents for pressure-sensitive copying systems | |
| US3979324A (en) | Dye solvents for pressure-sensitive copying systems | |
| JPS6049663B2 (ja) | 染料溶媒組成物 | |
| US3856552A (en) | Color projection transparencies | |
| US3773542A (en) | Sensitizing sheet for pressure- or heat-sensitive copying paper | |
| JPS5967081A (ja) | 感熱記録シ−ト | |
| JPH05221131A (ja) | 感熱性記録材料 | |
| AT329597B (de) | Druckempfindliches durchschreibematerial | |
| JPS59165678A (ja) | 感熱記録材料 | |
| JPH01295885A (ja) | 感熱記録材料 | |
| JPH0430916B2 (cs) | ||
| JPS6043316B2 (ja) | 感圧複写紙用顕色紙 | |
| JPH02277688A (ja) | 感圧記録用顕色シート |